From 408079c041cd6ea60765332bd3da5660bb997966 Mon Sep 17 00:00:00 2001 From: wp_xxyyzz Date: Wed, 7 Aug 2019 15:55:11 +0000 Subject: [PATCH] jvcllaz: Add JvTimeFramework components, incl adapted demo which uses sqlite3 instead of BDE. git-svn-id: https://svn.code.sf.net/p/lazarus-ccr/svn@7097 8e941d3f-bd1b-0410-a28a-d453659cc2b4 --- .../design/JvTimeFramework/images/images.txt | 10 + .../JvTimeFramework/images/make_res.bat | 1 + .../JvTimeFramework/images/tjvtfalarm.bmp | Bin 0 -> 1654 bytes .../JvTimeFramework/images/tjvtfdays.bmp | Bin 0 -> 1654 bytes .../images/tjvtfdaysprinter.bmp | Bin 0 -> 1654 bytes .../JvTimeFramework/images/tjvtfglance.bmp | Bin 0 -> 1654 bytes .../images/tjvtfglancetextviewer.bmp | Bin 0 -> 1654 bytes .../JvTimeFramework/images/tjvtfmonths.bmp | Bin 0 -> 1654 bytes .../JvTimeFramework/images/tjvtfnavigator.bmp | Bin 0 -> 1654 bytes .../images/tjvtfschedulemanager.bmp | Bin 0 -> 1654 bytes .../images/tjvtfuniversalprinter.bmp | Bin 0 -> 1654 bytes .../JvTimeFramework/images/tjvtfweeks.bmp | Bin 0 -> 1654 bytes .../JvTimeFramework/jvtimeframeworkreg.pas | 48 + .../examples/JvTimeFramework/Data.sqlite | Bin 0 -> 24576 bytes .../JvTimeFramework/JvTimeFrameDemo.lpi | 127 + .../JvTimeFramework/JvTimeFrameDemo.lpr | 35 + .../examples/JvTimeFramework/readme.txt | 18 + .../examples/JvTimeFramework/tfapptedit.lfm | 389 + .../examples/JvTimeFramework/tfapptedit.pas | 236 + .../examples/JvTimeFramework/tfmain.lfm | 1500 ++ .../examples/JvTimeFramework/tfmain.pas | 712 + .../JvTimeFramework/tfprintprogress.lfm | 78 + .../JvTimeFramework/tfprintprogress.pas | 69 + .../examples/JvTimeFramework/tfshare.lfm | 44 + .../examples/JvTimeFramework/tfshare.pas | 114 + .../JvTimeFramework/tfvisibleresources.lfm | 53 + .../JvTimeFramework/tfvisibleresources.pas | 94 + components/jvcllaz/packages/jvcl_all.lpk | 39 +- components/jvcllaz/packages/jvcllaz_all.lpg | 4 +- .../jvcllaz/packages/jvtimeframeworklazd.lpk | 46 + .../jvcllaz/packages/jvtimeframeworklazr.lpk | 73 + .../jvcllaz/resource/jvtimeframeworkreg.res | Bin 0 -> 17028 bytes .../jvcllaz/run/JvTimeFramework/jvtfalarm.pas | 342 + .../jvcllaz/run/JvTimeFramework/jvtfdays.pas | 14562 ++++++++++++++++ .../jvcllaz/run/JvTimeFramework/jvtfgantt.pas | 548 + .../run/JvTimeFramework/jvtfglance.pas | 4076 +++++ .../JvTimeFramework/jvtfglancetextviewer.pas | 1585 ++ .../run/JvTimeFramework/jvtfmanager.pas | 5369 ++++++ .../run/JvTimeFramework/jvtfmonths.pas | 611 + .../run/JvTimeFramework/jvtfsparsematrix.pas | 269 + .../jvcllaz/run/JvTimeFramework/jvtfutils.pas | 827 + .../jvcllaz/run/JvTimeFramework/jvtfweeks.pas | 494 + 42 files changed, 32355 insertions(+), 18 deletions(-) create mode 100644 components/jvcllaz/design/JvTimeFramework/images/images.txt create mode 100644 components/jvcllaz/design/JvTimeFramework/images/make_res.bat create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfalarm.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfdays.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfdaysprinter.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfglance.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfglancetextviewer.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfmonths.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfnavigator.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfschedulemanager.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfuniversalprinter.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/images/tjvtfweeks.bmp create mode 100644 components/jvcllaz/design/JvTimeFramework/jvtimeframeworkreg.pas create mode 100644 components/jvcllaz/examples/JvTimeFramework/Data.sqlite create mode 100644 components/jvcllaz/examples/JvTimeFramework/JvTimeFrameDemo.lpi create mode 100644 components/jvcllaz/examples/JvTimeFramework/JvTimeFrameDemo.lpr create mode 100644 components/jvcllaz/examples/JvTimeFramework/readme.txt create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfapptedit.lfm create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfapptedit.pas create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfmain.lfm create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfmain.pas create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfprintprogress.lfm create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfprintprogress.pas create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfshare.lfm create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfshare.pas create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.lfm create mode 100644 components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.pas create mode 100644 components/jvcllaz/packages/jvtimeframeworklazd.lpk create mode 100644 components/jvcllaz/packages/jvtimeframeworklazr.lpk create mode 100644 components/jvcllaz/resource/jvtimeframeworkreg.res create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfalarm.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfdays.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfgantt.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfglance.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfglancetextviewer.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfmanager.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfmonths.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfsparsematrix.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfutils.pas create mode 100644 components/jvcllaz/run/JvTimeFramework/jvtfweeks.pas diff --git a/components/jvcllaz/design/JvTimeFramework/images/images.txt b/components/jvcllaz/design/JvTimeFramework/images/images.txt new file mode 100644 index 000000000..a31d63073 --- /dev/null +++ b/components/jvcllaz/design/JvTimeFramework/images/images.txt @@ -0,0 +1,10 @@ +tjvtfalarm.bmp +tjvtfdays.bmp +tjvtfdaysprinter.bmp +tjvtfglance.bmp +tjvtfglancetextviewer.bmp +tjvtfmonths.bmp +tjvtfnavigator.bmp +tjvtfschedulemanager.bmp +tjvtfuniversalprinter.bmp +tjvtfweeks.bmp diff --git a/components/jvcllaz/design/JvTimeFramework/images/make_res.bat b/components/jvcllaz/design/JvTimeFramework/images/make_res.bat new file mode 100644 index 000000000..397361645 --- /dev/null +++ b/components/jvcllaz/design/JvTimeFramework/images/make_res.bat @@ -0,0 +1 @@ +lazres ../../../resource/jvtimeframeworkreg.res @images.txt diff --git a/components/jvcllaz/design/JvTimeFramework/images/tjvtfalarm.bmp b/components/jvcllaz/design/JvTimeFramework/images/tjvtfalarm.bmp new file mode 100644 index 0000000000000000000000000000000000000000..8ff343d3e21098b2de7143a06054e874fcc3163e GIT binary patch literal 1654 zcmb8tF>Vz>41i$=p#+HwP`ae1pi9=G=MFvvwU6Q=;vDXfI0J=`kT!~x$3N@$Lf(T0 z?|$ojo_V`7v-9Qaw`j~P3Q`=sDdZOuO#Y_E; z{!}?1A0J=W?@slL{?v(o_MiHH_5XW3chAR|@oc9Fkni_L&-1re4fi+nUBUP_8dxCW zvj4U(-eIp#_vybDafO^e|5#psI(z=q*OmH99JcuwtNf4t`=2iQ@9*3%XU|{5Tp#yx bJlkpf+jicch80ZwY&`rv#by6L^)>$A}8S82I6VM4_MmSBVBkAW>)$s*(zWBakRGlN2ZnjzFT& zBD~THgCmeAw3skWQLK+6kSO$6nkv!Y2qX$UmTgKjI0A`6k1cT}8XSQ{p~rTG5)F<( zqR?Y2Q;7ygAW`VC&80+xBakTcb_CW+G&ll@LQAmz5XHK3$ND4+EujL1!4XIldK{Z6 z(clOq3O$b0m1uAT5``Ye&7VXV9Dzik$5lur8XSQ{p~p2TB^n%oM4`7U6s<&qBakSx z6zeZh7#xAb`t-P3szie$kSO%HcBVvwBakTcxRS0!gCmeA^ti5}M1v!cDD=3>sYHV# zkSO%H=A}e~Barg&xX2Is1>=b<+bhem*1)r-`20FwmDB0;bQ$F;OLfaXKGJlXKhvKq z@4RdHm)|vP^L)4|PtRp$ox5^i8K+q$nV02qVezBLVO`%W z2O)X6OxOAIYyWB87uqjt|MU5^|31HszbtR|r|%g5YMhDxUGwW_KmJ?!m+^1r$$X~W ia$n{-O^0bM%l4h7kw5Nxi)<%&JaRI-vNjz5)9@Fv)IKNx literal 0 HcmV?d00001 diff --git a/components/jvcllaz/design/JvTimeFramework/images/tjvtfdaysprinter.bmp b/components/jvcllaz/design/JvTimeFramework/images/tjvtfdaysprinter.bmp new file mode 100644 index 0000000000000000000000000000000000000000..330f8df7ce1e9083d5929e6f43a4aa3bcf85b96e GIT binary patch literal 1654 zcmaLVJ&x5t48Ua@ywgA%%{&^Ze%MTUyHow>D}%mZ??R>68Z3Uk`t+6D zXmA7)g`S_(m1uAT5`~_hn?WKBjzFT&^C+Ye4URyf(DRs-5)F<(qR`tBidLe*5l9qT ziuIQ$430ozTs@DLD$(EwBnmx`ohi}a2qX$UkEAQn;0PoNJ&$WB(clOq3O$c{u^I7G5J+7_) zhgnv6OrOVUr^{s>Jsf4*2C9~kf6|_RjKU%Ju~+Mh?`QJ(d`ce3Tz zmA~xeXgu0)`O%Qc{F6W0ucM2t9PQ@}*T;&PpX-$I^1S`ngDrhj+|p#5kL>Ba;+Bdr Po4@HzR>79#v4Vgh%%QdLqvOMdN;EhEi9(Cel~foUfkdI1q(EVC1QLZ7 z;U}#yI0A`6iwV;d#dbLYi9*lPREY*hAW`U9wkgrz2qX$UTjEMII0A`6&vu0p4URyf z(6g1PM1v!cDD-S|Dbe5vBnrJgfwdA1jzFT&60AQ&v8~*(U5P?Vs6b(G1QLaw&t^(A zI0A`6&nI;y8XSQ{q33h+k_dw%kSO#Vg;b)!5l9qzj!7xe;0PoNy^c_{5)F<(qR>*T zzeHhh1QOfTbF@^621g)K=s9+#M1v!cDD)gjSE9iYNECXGYbep+2qX$UM>&;fa0C*C zo?~80G&lk&zaB4g=DDDr$YuTHa@l&|+EU!UA8*>>aCp9-c9W&M@{f-U9ghzW4|ms5 zo+r!iv?Xr_{-3AF{`_sB_1?*!uGQ(>=GQy+!9Vjnoo?qN^1Qdxw0U|h{30yla5}%V zZ3DKp4X`cOwrAJCJab-;t^C@xy=Dk*E4!b*Q+eyw*icLY%p*5 E4U1k&z5oCK literal 0 HcmV?d00001 diff --git a/components/jvcllaz/design/JvTimeFramework/images/tjvtfglancetextviewer.bmp b/components/jvcllaz/design/JvTimeFramework/images/tjvtfglancetextviewer.bmp new file mode 100644 index 0000000000000000000000000000000000000000..6f3ccde3df0a1124a1efaab1345bff8f41d6f965 GIT binary patch literal 1654 zcmbW#F>Vz>41i$=p*$omKbZD=(&SWLG7csK%B!J5@(?B5z^-=%Re(O$-W>O zX7^jqv-i!;?9P|3->zl0&u>LO())0BCGTe5-iUm9zsMD-VYU$Al!z6$(v_-``dxDW z>xYOM927KBXb}@A=$IprD71(R6b62HAW`V^bCqat1QLZ7p)08{I0A`6Gf9EM;0PoN zEy5|SFgOBF06va3kfkdI#(o~5CM<7w?wQN(O!4XIldc6`?qQMbJ6ned`P@=&R zNECX#%2cAk5l9qzz2;J)!4XIldVT_HB^n%oM4=^Ee~4nN+%b+sp(RwHFgOBPj>?0*OMe&&@+3430pe&}%EC5)F<(qR?xbloAb&K%&rd3q>o@;0PoN zEyemv6b45iF^*naOO3|a0C*CUR%MfGM<7w?xouOT!4XIldX~hMXmA7)g`VXKB^n%o zM4@LXQ;7ygAW`U9=2D`;5l9qzd;)7F8XSQ{p(WUVh+^HjW4#iEmQaDh;0PoNJwKZ% z(clOq3OzrmE79NxBnmx0HxG$0I0A`6&!dn^G&ll@LeFDTN;EhEi9(Mf6s<&qBakSx z6#Fkx7#xAbdi6Y7szie$kSO##cBVvwBakTcJd&bO{LSJ#>zdy#!uU1+f7jW`d)lZ3_c0#tzq>0AKS$YjyWK4H I_RfC)054Bo5C8xG literal 0 HcmV?d00001 diff --git a/components/jvcllaz/design/JvTimeFramework/images/tjvtfnavigator.bmp b/components/jvcllaz/design/JvTimeFramework/images/tjvtfnavigator.bmp new file mode 100644 index 0000000000000000000000000000000000000000..ec09f388cbfb3e5cf814d529551769b7ecc1fa58 GIT binary patch literal 1654 zcmZ9~F|O1=41i%TLQhCsfYK#31+RKpi=I396x2S73&c6xA#nx@AK|sDC$ao9vzt7a z>=$P}6DKp7FJHes$ZVhAihShi!_7(F&Ah!4`SgB~6RBag5aA~gD{$sgs!Hm2$@8xt zB5H8Zp@~9^m_WgWIRc47i?~2x;Ex9qg}yyki3Ud?QD_k^B^3roAW>*uQlKz60*OM4 z@RL>;9Dzik#e~-s#W);+M4{KzREY*hAW`TwZBwGb5l9qzEr~19;0PoNy_PGKXmA7) zgF2gLk*BApKM$+z*-f^M4)QNAbRBup z+eV%&zw^;SdfWE=-ZAQoJZ+3WA06X{SNXkT)!D}%cihL*MV(irsB>#8KTBOs^NqNP z`3W5ZFEiSB#O?AdBY*xUzcGFsv*W14efK)_%>1lIx&QKW$;X<{6616^F@7xlXtM43 z^W}26rN>Q2e$-!s#|^LYOk{LSM}Az*@$0mYC%+!M@{jk9Il)Vz>41i$=p$LhRhSDV`AXQ#0dhXy;Q2Qt@o;Zg)B+fwLBhW|68$*gb0^JOyHNMRF%}PlHWhS zi>SdtK@)`*F@b`HIRc47i?~2x;Ex9qg+89EM1v!cD6|MoNrk}?NEDiv6etXiK%&qh zT+#}IBakSxnDCmSSf?Y9DD+HCm1uAT5`~^=n-UF%Y z2qX$UpVXCTa0C*Cp3lugA`Ff|qR_JyQi%pfAW`VqCZ$A!BakTc-a^qzG&ll@LQ66K z5{1DLNUXDGYpD_qjzFT&v+YcY21g)K=-HC4M1v!cDD-UCP@=&RNECXuaw^f_2qX$U z+q{%$a0F6*KVIZazhFF(%f94tSuJp`6hA*sFOK{B`={GEUSw(R{Np2~*ZC9u$#OkB z7tXu&oWB;%=Uv$2ul^5HAiWDO^2Z(5ad_zTzus|-Kkvyn$52QAr#U8neK@zQ$1uMm z|6JfMt|QOdi0t8KFbb>xUbo9CT+^r1q*+1MaNlwK?A|;3x^T_!MSpPv`JGzh$bPGN z#?gP(F0yAn>-SH7FWYHi41i&}D3SubKu3<9J2X>lqI>VaQ*`E0I21hxw*oyw2Oc5oYk;`FB-^p0 z_dZjm^z`&3ef$37PGzI@h4URyf(DMjIE79NxBnmCX z_m?OPjzD5uy^fYD(clOq3cZev>ZG`RRR1R`VlcQmq zFX#IXYnVCI=s(}SANfoF@dWwVLjHcc|95%Ewp$PEZ~9-x*^_@$PU~`@j0K-XPD#Sb z&*`u$Z}aE==e2t6KlV}NvWTZ~=s$LL40`ik7KzbE`rPn9ZO&&5vdVnofrdHsCB2?_ K7!7X=Py7dFfd=US literal 0 HcmV?d00001 diff --git a/components/jvcllaz/design/JvTimeFramework/images/tjvtfweeks.bmp b/components/jvcllaz/design/JvTimeFramework/images/tjvtfweeks.bmp new file mode 100644 index 0000000000000000000000000000000000000000..d66379d9ea9a20c5d922c4dc8d500a8797223b3e GIT binary patch literal 1654 zcmcK2F|HFq41i%jgaC;PP`ae1AXO5Jo;&yy)IN%fh;z6@;tUi%!t3+&!ap;4XcGxh zF}vS-;u+0myz}Mjw>L7|=hq@1>3z6*kash0uS7n*U*v(*Fk6UlOT-F1=}J{e{VI9< z`CUW}4hA$)Xb}@A=$IprD71(R6b62HAW`V+dzEN#1QLZ7p)08{I0A`6^CtxggCmeA zvj>1QLZ_WiBNe9Dzik=O?gMqQMbJ6k3A)hbYF*9pg$AT0#X1gCmeA^!jY3 zM1v!cDD?WIu0(?)kSO%}+`J^h;0PoNy^caE(clOq3cZd=Dbe5vBnmx`P_z;ajzFT& zQtZD(VQ>Tz`aLUM<7w?btGMh21g)K=yhB}i3Ud?QRsD)Q;7yg zAW`Ub%u9&|M0mYo{@A9Mu@@v;w6e zf7s+tPfv5jnLqqxKKYk}6$D)sis F{NLm%ZMXmc literal 0 HcmV?d00001 diff --git a/components/jvcllaz/design/JvTimeFramework/jvtimeframeworkreg.pas b/components/jvcllaz/design/JvTimeFramework/jvtimeframeworkreg.pas new file mode 100644 index 000000000..6b1211fec --- /dev/null +++ b/components/jvcllaz/design/JvTimeFramework/jvtimeframeworkreg.pas @@ -0,0 +1,48 @@ +unit JvTimeFrameworkReg; + +{$mode objfpc}{$H+} + +interface + +uses + Classes, SysUtils; + +procedure Register; + +implementation + +{$R ../../resource/jvtimeframeworkreg.res} + +uses + //Controls, + JvDsgnConsts, + JvTFGlance, JvTFGlanceTextViewer, JvTFMonths, JvTFWeeks, JvTFDays, + JvTFAlarm, JvTFManager; + +procedure Register; +begin + RegisterComponents(RsPaletteJvclVisual, [ + TJvTFScheduleManager, + TJvTFMonths, TJvTFWeeks, TJvTFDays, TJvTFAlarm, TJvTFGlanceTextViewer, + TJvTFUniversalPrinter, TJvTFDaysPrinter + ]); + +// RegisterPropertyEditor(TypeInfo(TJvTFGlanceCells, TJvTFMonths, 'Cells', nil); + + (* +// RegisterPropertyEditor(TypeInfo(string), TJvTFControl, 'Version', TutfVersionEditor); +// RegisterPropertyEditor(TypeInfo(string), TJvTFScheduleManager, 'Version', TutfVersionEditor); + RegisterComponents(RsPaletteTimeFramework, [TJvTFGlanceTextViewer, TJvTFMonths, + TJvTFWeeks, TJvTFAlarm]); +// RegisterPropertyEditor(TypeInfo(TJvTFGlanceCells), '', 'Cells', +// TJvTFGlanceCellsProperty); + + // register a nil property editor for now, so cells cannot be added, + // deleted, or moved at design time... BAD THINGS HAPPEN + RegisterPropertyEditor(TypeInfo(TJvTFGlanceCells), TJvTFMonths, 'Cells', nil); + RegisterComponents(RsPaletteTimeFramework, [TJvTFDays, TJvTFDaysPrinter]); +*) +end; + +end. + diff --git a/components/jvcllaz/examples/JvTimeFramework/Data.sqlite b/components/jvcllaz/examples/JvTimeFramework/Data.sqlite new file mode 100644 index 0000000000000000000000000000000000000000..d3a7ec3020449023e8d5345a25028d4dfb531685 GIT binary patch literal 24576 zcmeHv3#=U1dEU;hXg(xrWa~khyNpJ(Etw*DwY&4$v15|^-n;L+kGs1PU(0)kyesbA zz1#=M>sWTA){gDk@}pK9*=^DWO^Y}{&?HKVq-e{uMI0b5g4R%yrgc)pY1{xtjkHCA zB0<&fpEHj$!>hD_VFRX0JzPj~=)RC3gw9D) zC=_}Ke;&sl=W`f;xzB0f{{r{-xBBZtq0@hGh#riDkA%YiA@bw+-@VUYeG0sk-oO9I zv17u^-No?A*le1!d3tAO;r#y{*;YQ?$xEGdrka*=p{%)LzU+lWV7r zw->|NA~#%^$E6$|v47}{w(&z}wT2(^lTE%KO};m0&NpVGoyBN6!2|hz=hX4^csSe6 zPiSJB$E8f8QMG?dZ{8eEHUNy-RZqN>+qeJ76Hf>)_pCJ(XVc{l&CdPHe*Y@m-~VbY z(v_1>rT}Md7lL6`m3fhQ1y8 z_0Z3TUJcz2J%1NdN1u#5tY@ZIWKD@1D|#HCL`qE<>$P6BAC>q{%`kLBHc|<7y;1Ju zqE7@mHA9PQN@_jV%2lJ^7wAkXs;tMAYNM7NM34D9wWOLzsJhbc<;&S<%-^XRx@sg< zqtIyOGtp?EQ!^5prs?_he4`aT8t7EmY%{IZVln#8K&Pyy3|URC*VcQr=;MLTgqBRG z$y6&{Ewzpwi9D>j6w(YuHR70Ydv(3hj6UXnP?4><%4>zyO8@Aifd>@<6S9_i4!+}m!*0hw7>Q&ck#ppW%ok~2ZDw^D^bvw=I+kKrWT}^6n zC82jR?Rr1@P@prZs>ygtuGhNR-civv*_0laWh0Ty)LZMT(FgqxYPv2PYD!MmR@0g2 z;XtR#PzPY3wdezZ&ZG(sNvQRHbI_08ALxuLng$A1`srpaddS~N3z6e-qtWcA>(PUO z&bY;SiA<(6$VCtMI~7$2;p1Ap-$*y3`vaY_q7!GPTeV^%`nEtPo>TE(FV{-9qx<}w za!O0kCta^+GDq+8QxA-lQd6m7zdI;JBY_8#hPBLEsn=>o!+}n)h^{IS(|sHGdRrD> zktfMEKMCQD{7K}uBmXS&_alGvp8P{wX@+`F{^fh}pHlx{lYgyO95gcfg~-DKEYF)H z{||&;3q^h}@~8x|fu@2AJE1bX#UQch~J(W$KF+Oc7nRO~N6?nw9l@GdGA1e4K$fB`spX zW6zgk{oteURpFGXy?VZqkM#n*iMT>`JC*JY`t{g)pf?U55ZsaIuB}$;v2L(eNzf53 zx!P^?+R;v6QgMul(@C@4?et=8|D!2Ghk&Yvoa+=C#c0d_C^o=yg&Uc*b}6Y&>xG-LJPqj88lXk1BG2i;gL(Cc&i zW7S|UZ}$&WB996rxo^hG_;=;$)?{z3wCeOa67G}#5+-jw>-6&SUkp5&;H5NH@bw0T zDev#a4ss`&ST5MhFOB5?c&HwVd^7SZk)MowDl(0BYJ*3 zA30V>Q52|eFz5POzSuwZzPq}U1`ffRKFC#TgJVXp8;otK_#OfbYsXT7Zof%8rn}t^ zS(1vLg0QdEyWK)eiyTqe)SPaPeU7QYhkbNArue%9lshH|y8W~}mb|N*r{2Lt}~}z(F=;Sx!=zIA? zIf75zRz#onKj<^$(Wm^KK1&^aPoR@m0nvB+JL52@6oksR*PDgty8@kB$|7yMHYlt` zj|V#Olwzn#uG|}RDE@aa@^!M_2krRZwPc>a{al-K#EZ-4U@gKz)9r+@Qn z8PJdx=@Cy!8Dek$L6vsqEQhM8GJ-^vwN8G(gWL*i%q})2Gn`G#U8%K1IDPI=FQMxI zejA(a2RL9QnM}YBsHEGuG>^Ot?8+@HzG6-&>^${0JCRgUhYyMC`xr2{-HBup3L&nq zb=DE2<9KNvpz6)k%eOG)D}I^Csk15x%(Jy*4r&8s)U?M8H3eUZ;i*j@zvOj zZ!d0K-Iv`mXCo=QHQktwk+E>FF>77yMeZU7)C?36qKe&m--o?p$$=*iH@@+quV&1} z0&@nLL1&xy6G>SSOJN55gga?VJ1fbATrOwZE{_spzVMZ=_!xCcyl>90OO!DYlfuD+ z-~$Z)&_#TSZG1hrim$_G@%4a;ulrBp>yU)6w?Brj0}oi|e~5YHYmt{DC&K?GybQ;L zeHqS3@^V0tlT*{# z8qFpAH?(%9vdPe%cF+P5Fdl6dK>Hxt%=6f0p2tg%Z5*<^x0ejZmg~qgav?LoefbVH zn5@j_7{j>jFMVb83*{+%gwAwxa|{=5IN2mGWG+o7r{`2Y0(-`sIYreZe8{j#?ddi+ zY=#*~x!LHZdCK}_F}*dBnrZwKO;yB8SJ*0R+_d;u9Y3vC*ecy=eIC;)nZpH)wp1Nm z+ge<;8@6>tDp3|M4euJj7w+Q+_>{GNj}D)Kb!{SfJ|0R>Nv-J>bB2|`&^mqr1un#k zm)QUnZv}8`y@(+{z{djv{4ETS-CAy32Yz$7SnNu@;kD_+!Pj*~5ieX~_^TW~A9LjK zZP(bP&?n%>wzo#JG4}2$3Fk7YyqsKj;57~OAt65$IvI+5BJ!T_FNZG)ZwfyuoC*CV zPW0p|@Sl>zX7YqH6D=jPoFdC9U?yKWhX*)E#clf?mCH{sq=t)xI2$GS6KZ2MU&{f> zJxhEs;Ih63m$g0I#(HWfEZG`L?d4=lyYDOu34K{KzmJVD;6||dYS3$Sdi)5l2K3_> zX;-GR*$5m9dYKrix(lBT^t&>0he;SIS-g0R4dZS;;!QZS#1Rdv)LX?GKg{O?Li#E; zhdkt`q~drw8(|>}_?)f>j_k1^UWze%S3H1^oV%iH#-PyZAxG{J>a!NZ3 z#EVgT0j~3@BVcU>EwbrSvB3}UO6r@h@a@lj^Yn3tdvl}VWHJParY?IaYDyO`A7%L5 zPE)WQeR8JN7!-KCPr)VU+nO)#urYSMb!ZrZ$~wB)TE};cyB*kSIvbXk zV`5lLfA^GB1w);JO0kGX@i?hGTajABD_4dKm%|cCRk!5-{!lU$`3I3|_`ijJBz#8r zkHVLQ8e;pe;O9L)&z)ow&AJoC5tb{=05M##w|UZS6HnT+YA>;$V|>}#8rC2wUV4UM zd;FdPmwI&_Jhsg)E;eavpF9<((`y{JC~`6(oU$Zw7cKAy(s*>6Ph9j*f;9eU!P%#Q<_liY*jcF^O&qbr}p1< z7qYM5hDWx84=yqVAF}W`b`d0iUo+ftsF8#Wi|fZ(AjUf{A%o{t>+rxkEV|>m^oW#j|r4J80W#-ZazCl#Bqhsx@>2v{S$&FKR@q`Wru5~G_{H4DaD4lNkdfACV{16u zB!vxCC-t^0|I=HNAzo0}Hh4zamw(~`_u?GHCwIx_R826a)SgUlxjc`!pCS%qwt%#! zLVOu49)C~%p&-+EcS6R}Q^v?$tKw>sK|jes^XV@hdM^%Yn+tHxd~3Q8>j_4L)2?Ap z@wqY{DabNAh=k?Lo91}BBQ-}Gi{;Fmi>)}Dn#|$x=`|kEj#9ZiIE5k4jzLbz;y?=i z&Zg6C@zS#llhgLTszM&qb^~2ZI+N6=<`{xF8_gHn!?~lMSXdd^S3|tK!Uo`YP3J2U z`2k)HC=v1k>*k0!f%MZDvff$FuEUeId5yx~;>FX9%={9#@Y z_ZgX#gjo6jgZF~8hOat~hj-ZDS&#qhGx&anUN+bOp0FCeS_XcAz5L1=3pbP94nu zKNK2M{O=6ne=mj43BM=2EF2Hr!H<8zpVlfPm1jdx#Ke`*&|(~+*-MB5Hl#&1&dypRYaU@g1&o@GY*KnC1r&n;XsNI8FKRtpL^eJj3U- zg34cC;PIV9iGxpv5=8#SNLxXecKztc(Idl}1G?{!V)zQ59CZ7T;sASxlnYrlJx+co zdgk7dZ~*9#@}g~{9TbwE)@WfH2BeiuIEC(!44kEi=QB)xIC%b+1&{8?kAwbU7-%M) zl)KxN%I0Fu2j{SN!!(=xn(MF`zIz%x{Ou5PW*vBPX5FMXyjheNNtNlCchF(##S7=y z0yy?lxZ5852+II@ZX-aGpN%%4Upfe&>`Em>uspko9I+GsdodLGsYpBgzfkW}5WWuo zKO6e}(2JPx_x5A98Ts5OUEq=s7Wd_Im;&v+?G?Cf@(S{BQb&s|tj~&ZWDwsNn^)jl zxVbvul(b-*h#Y zZMbneDJAx54Bk6fqpXOl`Q+j4x(OGaVq?v%U0RGiisRI%s@SeFV3i{kUoOf6JMoJ< zHbYYUBE7vUtu0NMSO$u+8%12NFi@|$0qnq4new1Pk)_Z@$HakaC{?&38LE&J+hu#Q zp8JA$hF71;8Nh1jzlJ`Kp97yO7ugit zU@JCpuLzPE9=w>oqY~d{mT@^2N7`z)_06bs5$HUvY#D(7l9qeFx2PdQLq12%(({2U}(NO37 ze=~&I-+K6u5&t)E%l9=w3;jmuCYa-U^tt#LTUNzYWxAG3DLBX{vy}?&VRCsbds%Km z(2DLNUq*DZk{-y(PP|hMZh;`J^{9>S>UEeSg|1AbdaH%HFJZH1ftk5+o#HaIJI$@} z@Y>KlNhWY1RvbQZP^OZ*E{6|GrK_tsWVQI&+hIC)_Ecs@6?bq|37-5)@an|8h4_qf zShY5$^DtY2?vV%=J|JUpy_u`5m-#^^fy~?v96uD^4Jj>3HF#E7&^j)a-oa2kUqx3F zN|J8QtPjd9A7N~z;7)y;6rfvdcH!*|$z^sI8`5Buh=tObX&M z*Sdg;P?s-}_=Ki@h`|@Vp~5Gy>{a%WGL5U+)^R6SB#0`a!sWA-+hs9 zk(@v5)&GWO^uzb&^K#?>t3~-64-=J=in5YQ#PzsN_eVPGg*HklUq5vYgOfU*Sa~V0 zP1>MaZ{>@t?M}Xx&q=v_yJEdaLXw;UnmH_&gh0oxG^XVurs9NaP+4<(v10$rTZs5c zS4?R+2PfhMC|21GIbA!;+0Jxs&QD2;sWdlD>DCtBjj{zCb23K*B1J_fCM(t%PZ!ek zs)cN!KrwM6VzBm9qNw8L6v=%=k8Vw8*UyR<_cKnhG@wO;I5yL|G(T9&7uq}xzF^V9 zqXCJN?IuXKo|T5z;7Lj6P&+cdp5BHb*%+>fQ@eI|n=}-|$JHOJa;cg{-8_%aINZZ0 zd2;dTd{rKzL?p=-zVV<`Vh4}R3nSm#(-B>#GGBzd&C=1MK!&gh$jclLIb4= z-T>^R?X^FQ0omDQ%dX(Pyq1hbPZwVFH%V{;GX(>z(&w2^S9Ji9e%+aF}} zor~w}dS1~QNlvZE2odTU)e2`j%`{5RUq9_Ip*@n@{t;}5ELQEp-KVV;GXxzW7ei4R zh4mgZ^y{bYSX+mRa?Fiye*$fPws$EohOqMgNrtB47CQ84wzo!Qz}`wf77z+T^9hB2 z_mKa`G#=IQ_1H7`I`Ra*9)AR1j~pQXKOC8bB0q~S{3HCK!eDw!&*S*>4*dBG{@j!Q zd-5OP-~X@V|BRjIIE=zhs_3bV5^ODkU_GBCfZdyi$P_k z&hrT)PWL@B=}N20KVPz*^YE%@J64jFnUee;fVoHg-}}S=GyIwGD)Rrg@7e!*_TRd) zB;C4a|Hp6q^|$|?8+4UbaXD@f$^YTd8Os0n@z#%D4gVk_fZq}Rk#I?PB=qaJ0dxlc z;4MD|JNX$U7f4O$D|#Y@7b3~Bs`sijI>&puXDy)1S}+0~IFazU#iGWXpJRlB7eK8* zAEsDMVYxKO`Y-JI&E{RCVR5Df2(EgOE0$_@%Q>GD8U)GMtCGyk5#o6TnVs6$!nDK+ zy=VfEvfgS{)`&hQ?pV_pzhQgfZu`d&c%tdhAF*Ip23ds0X&pE^bUsB)D(ls39zf5q zsf^!XRpwrsiY_5I8p?6vwq!CaYm%Qno-=J3L7I~m; zMj;o7l0^(iES$18-a1~S)D^rcjJ@4$wT~OEKyi<_>@JAcChy*z&PBW0);lL^arg_6 zHoSSQRi+JEan{8$6keMcp*BQXk?w2E5CodxXo`Bvoh<~Mqzy!z=2rdB{h@3q@^>Sd zh=4c#Y=s{eeo5FAj)r~_KmXr+7Ix9@Euxrp)Wq)Lr5Shu$?9r`ir`<5J5#jJL2jFv zzRIdKMzhTc)B&9?am1YBtS#XbKC%)`WQ9;YGF{H3jp_Cd79n0b!3b=Xi`b*8c&mx7 zW^2tg@`Bt!mTa5cHci4hZaTqsX65pe#R!M`tUW-b`H-V)_*vrR|MXYYUzSN-&O0nK1`nqU4*4(`|jh5dv`8pY~X4mtca1Zvl0>JoqP+TpL*X!ch zOyaglUfF)#dbWmp-sVg!*+snE=HT*(LA3|nOrcNu@Y!=VNo{d=+eA`tbIu;e<~Vs4 zn~Zo}4Bl6wlq#8wH8Dc6k_>)O7P1)F)wx!3fdSys0Ok9V{r(_BkrsDoTZ6gnmp~~i zD~anL)+X#Au054dwT?=Ixj2*GB$?PByMn z%-@2)vYaDUKA%fFW7HdwS`=k4=xz*D*8G-fqGrrmiPS^%PORJ4d^j$} z%Ra4ecClHj6C14D0SHMJQG{>*AWE>U==0MgQ>f4xj>U|9pT~<#s;X@0bmP6+8w|+u zyFs9jSwVNNP1?4&yDg?;Y}0rQ+_i(r&zDzgBsi|Zwjta$aVkMvwr}Ndx{Wp+CBk~G zkjqkV(0zslzr8larmCY4q9Q0Wz5SNk-nH-L7@l|&+2~CtJ-j>;;dKwumLGRSQc>06 zayFEj?3TQ>A=ZApU|+`B@L*+CMTR)8RjX?hSAYHV9Xw9^@haO7w{3|fqSR7*XNt57 zfo6uN-d|jy)X2tkxB(M@;H+&E#0!rzI$MP?jIr=uQPdVS6NFF-@2@2D=fF|(=Z6)*Qb0)7}q9Y#w_c5mhxbJ z<%2hoTGeZ%LaXEQFH=4)zH7k5vy|xa10X4Y%LpmCJZLn?eX{n=1~_Na-UA@{e<1X1 zDDo4LM)+IdFNWj7?+Tw0@}WNs{Y+>F9sbYRN9^&u4Njs4fzmRo^=y{>M~ljAJeT0! zcxNfC6__wevK1sX+l^A49CS;koh$KVzgt@)#qBP@MsnM92=Q!4$xc>rNSKu6#J19nJZ>9$YQjNs zRz@blL#o?}sgo|(DT-ar*sQMR$*8+AWm|yUw#9Y0=EY?n#D<-aI_>TkCFv}3<=S|e zGLL6ViHk@0wlgH{IQIa|!)*UN38$B-7&5M@4F;VG`7#y&+dmhJl%r$9cW?;>t`<@V z8>rZW`+?*Nj5-`IxFbl~G?!PzI(yqp#460Ob{Qv>q(Scp$@S8G>tJ~Yn8X`IL4H^m zHY9)MR&5DtnRm#{UA12@^Sn!kgqBdqMNL#orB&ivcdla#*K6MdJ_Xd7m-y$qO&xmS zjL+4hT0J`PDVcUD<2yS3us!c{_ByQnL*{Q}!XmY&8yoQWibJHb#KA$P>a6#gFlxXg i(bd3yXOP8pS?}<$#HR7>-SK0;?4AKy> + + + + + + + + + + + <Scaled Value="True"/> + <ResourceType Value="res"/> + <UseXPManifest Value="True"/> + <XPManifest> + <DpiAware Value="True"/> + </XPManifest> + <Icon Value="0"/> + </General> + <BuildModes Count="1"> + <Item1 Name="Default" Default="True"/> + </BuildModes> + <PublishOptions> + <Version Value="2"/> + <UseFileFilters Value="True"/> + </PublishOptions> + <RunParams> + <FormatVersion Value="2"/> + <Modes Count="0"/> + </RunParams> + <RequiredPackages Count="6"> + <Item1> + <PackageName Value="Printer4Lazarus"/> + </Item1> + <Item2> + <PackageName Value="FCL"/> + </Item2> + <Item3> + <PackageName Value="DateTimeCtrls"/> + </Item3> + <Item4> + <PackageName Value="SQLDBLaz"/> + </Item4> + <Item5> + <PackageName Value="JvTimeFrameworkLazR"/> + </Item5> + <Item6> + <PackageName Value="LCL"/> + </Item6> + </RequiredPackages> + <Units Count="6"> + <Unit0> + <Filename Value="JvTimeFrameDemo.lpr"/> + <IsPartOfProject Value="True"/> + </Unit0> + <Unit1> + <Filename Value="tfmain.pas"/> + <IsPartOfProject Value="True"/> + <ComponentName Value="PhotoOpMain"/> + <HasResources Value="True"/> + <ResourceBaseClass Value="Form"/> + <UnitName Value="tfMain"/> + </Unit1> + <Unit2> + <Filename Value="tfvisibleresources.pas"/> + <IsPartOfProject Value="True"/> + <ComponentName Value="VisibleResources"/> + <HasResources Value="True"/> + <ResourceBaseClass Value="Form"/> + <UnitName Value="tfVisibleResources"/> + </Unit2> + <Unit3> + <Filename Value="tfshare.pas"/> + <IsPartOfProject Value="True"/> + <HasResources Value="True"/> + <UnitName Value="tfShare"/> + </Unit3> + <Unit4> + <Filename Value="tfapptedit.pas"/> + <IsPartOfProject Value="True"/> + <ComponentName Value="ApptEdit"/> + <HasResources Value="True"/> + <ResourceBaseClass Value="Form"/> + <UnitName Value="tfApptEdit"/> + </Unit4> + <Unit5> + <Filename Value="tfprintprogress.pas"/> + <IsPartOfProject Value="True"/> + <ComponentName Value="PrintProgress"/> + <HasResources Value="True"/> + <ResourceBaseClass Value="Form"/> + <UnitName Value="tfPrintProgress"/> + </Unit5> + </Units> + </ProjectOptions> + <CompilerOptions> + <Version Value="11"/> + <PathDelim Value="\"/> + <Target> + <Filename Value="../../bin/$(TargetCPU)-$(TargetOS)/JvTimeFrameDemo"/> + </Target> + <SearchPaths> + <IncludeFiles Value="$(ProjOutDir)"/> + <UnitOutputDirectory Value="lib\$(TargetCPU)-$(TargetOS)"/> + </SearchPaths> + <Linking> + <Options> + <Win32> + <GraphicApplication Value="True"/> + </Win32> + </Options> + </Linking> + </CompilerOptions> + <Debugging> + <Exceptions Count="3"> + <Item1> + <Name Value="EAbort"/> + </Item1> + <Item2> + <Name Value="ECodetoolError"/> + </Item2> + <Item3> + <Name Value="EFOpenError"/> + </Item3> + </Exceptions> + </Debugging> +</CONFIG> diff --git a/components/jvcllaz/examples/JvTimeFramework/JvTimeFrameDemo.lpr b/components/jvcllaz/examples/JvTimeFramework/JvTimeFrameDemo.lpr new file mode 100644 index 000000000..8efefbd66 --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/JvTimeFrameDemo.lpr @@ -0,0 +1,35 @@ +program JvTimeFrameDemo; + +{%File 'dbUTF'} + +uses + InterfaceBase, SysUtils, Dialogs, + Forms, datetimectrls, printer4lazarus, Interfaces, + tfMain in 'PhotoOpUnit.pas' {PhotoOpMain}, + tfVisibleResources in 'VisibleResourcesUnit.pas' {VisibleResources}, + tfShare in 'ShareUnit.pas' {Share}, + tfApptEdit in 'ApptEditUnit.pas' {ApptEdit}, + tfPrintProgress in 'PrintProgressUnit.pas' {PrintProgress}; + +{$R *.res} + +var + fn: String; +begin + Application.Scaled:=True; + Application.Initialize; + + fn := Application.Location + 'data.sqlite'; + if not FileExists(fn) then begin + MessageDlg('Database file "' + fn + '" not found. Copy it from the source directory to here.', + mtError, [mbOK], 0); + Halt; + end; + + Application.CreateForm(TPhotoOpMain, PhotoOpMain); + Application.CreateForm(TVisibleResources, VisibleResources); + Application.CreateForm(TShare, Share); + Application.CreateForm(TApptEdit, ApptEdit); + Application.CreateForm(TPrintProgress, PrintProgress); + Application.Run; +end. diff --git a/components/jvcllaz/examples/JvTimeFramework/readme.txt b/components/jvcllaz/examples/JvTimeFramework/readme.txt new file mode 100644 index 000000000..2c272eff6 --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/readme.txt @@ -0,0 +1,18 @@ +The JvTimeFrameDemo of the JVCL Lazarus port uses an SQLite3 database to store +the data. In order to run this demo you must have SQLite3 installed, or you must +copy the sqlite3.dll to the folder with JvTimeFrameDemo.exe. + +It is also required to copy the data base file, data.sqlite, from the source +directory (the directory which contains this readme.txt) to the folder with +JvTimeFrameDemo.exe. + +-------------------------------------------------------------------------------- + +Original text: + +The PhotoOp demo uses a Paradox database to store the data. In order to run this +demo, you need to have the BDE installed and correctly configured. In addition, +the path to the data is restricted in Paradox. If you get an error about the +path being too long when you start the application, copy the executable and +the \Data subfolder from the source folder to a folder with a shorter path and +run the demo from that location instead. \ No newline at end of file diff --git a/components/jvcllaz/examples/JvTimeFramework/tfapptedit.lfm b/components/jvcllaz/examples/JvTimeFramework/tfapptedit.lfm new file mode 100644 index 000000000..bb9cb9bb8 --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfapptedit.lfm @@ -0,0 +1,389 @@ +object ApptEdit: TApptEdit + Left = 218 + Height = 210 + Top = 152 + Width = 350 + AutoSize = True + Caption = 'ApptEdit' + ClientHeight = 210 + ClientWidth = 350 + Color = clBtnFace + Font.Color = clWindowText + OnClose = FormClose + OnShow = FormShow + Position = poScreenCenter + LCLVersion = '2.1.0.0' + Scaled = False + object Bevel1: TBevel + AnchorSideLeft.Control = Owner + AnchorSideTop.Control = Edit1 + AnchorSideTop.Side = asrBottom + AnchorSideRight.Control = Owner + AnchorSideRight.Side = asrBottom + Left = 6 + Height = 10 + Top = 29 + Width = 338 + Anchors = [akTop, akLeft, akRight] + BorderSpacing.Left = 6 + BorderSpacing.Right = 6 + Shape = bsBottomLine + end + object Bevel2: TBevel + AnchorSideLeft.Control = Owner + AnchorSideTop.Control = EndDatePicker + AnchorSideTop.Side = asrBottom + AnchorSideRight.Control = Owner + AnchorSideRight.Side = asrBottom + Left = 6 + Height = 10 + Top = 97 + Width = 338 + Anchors = [akTop, akLeft, akRight] + BorderSpacing.Left = 6 + BorderSpacing.Right = 6 + Shape = bsBottomLine + end + object Label1: TLabel + AnchorSideLeft.Control = Image1 + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = StartDatePicker + AnchorSideTop.Side = asrCenter + Left = 50 + Height = 15 + Top = 51 + Width = 56 + BorderSpacing.Left = 12 + Caption = 'Start &Time:' + FocusControl = StartDatePicker + ParentColor = False + end + object Label3: TLabel + AnchorSideLeft.Control = Label1 + AnchorSideTop.Control = EndDatePicker + AnchorSideTop.Side = asrCenter + Left = 50 + Height = 15 + Top = 78 + Width = 52 + Caption = '&End Time:' + FocusControl = EndDatePicker + ParentColor = False + end + object Label5: TLabel + AnchorSideLeft.Control = UpDown1 + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = AlarmAdvanceEdit + AnchorSideTop.Side = asrCenter + Left = 192 + Height = 15 + Top = 119 + Width = 80 + BorderSpacing.Left = 8 + BorderSpacing.Right = 6 + Caption = 'minutes before' + ParentColor = False + end + object Label6: TLabel + AnchorSideLeft.Control = Owner + AnchorSideTop.Control = Edit1 + AnchorSideTop.Side = asrCenter + Left = 6 + Height = 15 + Top = 10 + Width = 42 + BorderSpacing.Left = 6 + Caption = '&Subject:' + FocusControl = Edit1 + ParentColor = False + end + object Image1: TImage + AnchorSideLeft.Control = Owner + AnchorSideTop.Control = Bevel1 + AnchorSideTop.Side = asrBottom + Left = 6 + Height = 32 + Top = 47 + Width = 32 + AutoSize = True + BorderSpacing.Left = 6 + BorderSpacing.Top = 8 + Picture.Data = { + 1754506F727461626C654E6574776F726B477261706869633006000089504E47 + 0D0A1A0A0000000D4948445200000020000000200806000000737A7AF4000005 + F7494441545885D596DD53135718C6BDE81FD10B2FFB2778D90BEFFA310326BB + 212ACE74A622524BA58C1843BAC9D92C84AAD4CAA0A2824644B47C683AC340B2 + 399BC4E84C35241A3F08042480094128109290F02DF0F44241680802ED45FBDC + ED39EFEEEFD9739EF3EEEEDAF57FD2D72AF3A7193F998FC8096D6678C925D759 + 07E53AEB20C34B2E39A1CD193F998F30A72CBBFF757066B1F94B86977C324E5C + C8A9684F16D5BE82BABE1FDAC610B48D21A8EBFB71E2460F722ADCD3324E5C60 + 78C997A1B1C8FE399833EF51E86D5D0ABD6D4A5DDF8FB3E62848731805359DC8 + AFF222AFD285BC4A17BEBFF414C7AB7DD0350DA2DC1243F1ED016409F604AB97 + 7A3339F39E1DC1F7973AF3E45A71A6D0D8BD7CA66D023F5EEB44B6C18E43061B + 2A4D1DB8F7B00F0E6F180E6F184DCE002E983A70C86047B6C18EC21A1FCEB44D + A0D0E85F9671E2C27E83A3705B7086500D43E8BCAE69105C4310D906074E55BB + F0A26F1C6B35164F62249A5837F6A26F1CEA6A17F697D8A0B93300FEEE101842 + E7153CADD8F29B3384CE08A61114DF7A05A59EE2FEF321FC5DCBCBCB68F707F1 + B8EB3516979652E63D3DA33850224155DB85B29631B0449A3950E6546F0ACFE4 + CC7BE43AEBACAE691045B53D3864B021F46722E5E12B8A4FCD20969C4919AFFF + DD0E00088F25917BEE010A6A7C104CC390EBC4F90CAEF5F3B4061482D45978DD + BFC83504A1D4D34DE1E9D4DCF610576EB7AE5E0F47A6A1D45368EE0CE0E4CD5E + B0BC14DA10CE0A8E0C855E9A3AD336816C8303CE0D96FD63F2F5BC4681BE0A13 + B1C975E3DEDE31280509A75B2350963A120AC19E971A3C5EF2A9EBFBA1AAED42 + D115D7B6E18B8B4BD0FD7A137F3CF16D38CF193D28BADE01AE2108865883EBE0 + 5FABCC9FCA3871E1AC398A6C833D25ED5BD16F2DF771ADC19C763E3014074BAC + 28B7C4C0123A9559DCF2D9AA817D5A31EFDB73AE08690EE390C1B66DF8F3AE3E + 9C28BD8A78626AD3BAC3E54E700D41E454786272420DAB06E4843617D5BE4241 + 4D272A4D1DDB82CFCD2F40536E84EB99FFA3B5464B37F22F3F87AA2E009648D6 + 0F01D44BEDEAFA7EFC70D98B7B0FFBB6045E5A5A42FBF36EFC52DD8CEB8DE296 + EE11DD21E45FF240DB18024B68CF8700123AA86D0CE1BB4A171CDE30466349B4 + FB83884FA59EF1153D7477E0A8A602473515303BDD69EB923373707707313231 + 094FCF288E9E7F04C13402B9CE1A496B60249AC0E3AED78826A6D33EF841FBCB + 5503C6A6F42B30393D8BC75DAF31341E4F6F40C14B6E757D3FF2AB9EAE6EC146 + ED75AD16DEBEC5FDC72F70F31EC5514D05BCBEDEB4B54BCBCB0036DB029EDE2D + AA7D85E3D53E5CD8660801C0EBEBFDA809E07D08AB9E4155170043A8F421843A + E9BB6F7F754DE89A0677740CB76A62E5181EA9F4C419BDF4F387153865D92DE3 + C485724B6CC78D68AD894432353B2B8DE8AC399ADA88DE07D15F7C7B00AA1B9D + 38B98356FC3191DA2728BAF6125C43107242DFA47C0BE444CACA12EC89336D13 + D85F6283B777EC5F83FB835164E9294EB74670D0E08CB182949F62E07D43EA2D + 34762F6AEE0C40A9A7088F25FF313C129F45B6C186E2FAC0BB0EC8D3F05EBDF3 + 930D0D6472E63D324E5CE0EF0EA1A0C687DC730F301C49DF0B923373989C9EDD + 149E7BEE010AAA3B20988621D38A730A42BFDA10BEA28306472143E86C59CB18 + 4EDEE884524FD36E87BBFBDD2FD9CA395F2B7F308A6C830D45D77D286B194396 + 609B3A50E22CDD14BE22054F2B585E9A174CC328BE3D00A52081AF7D8281E1F5 + 3F1A231393181A8FAF1B0B0CC5517AEB29B2F414AABA0004D330B24AEC732CB1 + D66C09BEA203654EB54C2BCE9DBCD98BD3AD111CBFFA122CB122A7DC09A3A51B + A23B044FCF283C3DA310DD21182DDDC829778225561CBFF202A75B2350D50520 + D38A735B7EF39495D08B7B595E0A294B1D09AE2188B3E628B88620F2AB9EE1D8 + 450F72CF3F42EEF9473876D183FCAA67585B73D0E08CB13C0DB3C4F6C58EE06B + B54F67FD8621D62043E8746EE59359555D00DAC61004D30804D308B48D21A8EA + 02C8AD7C3ACF103A2D27F44DA6CE72386DDA77AACCE296CFF67116C212C9CA10 + EA97EBACE3729D759C21D4CF102AEDE32C24A5C3FDD7F517CAA592C8B12E2C19 + 0000000049454E44AE426082 + } + Transparent = True + end + object Image2: TImage + AnchorSideLeft.Control = Image1 + AnchorSideLeft.Side = asrCenter + AnchorSideTop.Control = Bevel2 + AnchorSideTop.Side = asrBottom + AnchorSideRight.Control = Image1 + AnchorSideRight.Side = asrBottom + Left = 14 + Height = 24 + Top = 115 + Width = 24 + Anchors = [akTop, akRight] + AutoSize = True + BorderSpacing.Top = 8 + BorderSpacing.Bottom = 8 + Picture.Data = { + 1754506F727461626C654E6574776F726B477261706869633102000089504E47 + 0D0A1A0A0000000D4948445200000018000000180806000000E0773DF8000001 + F8494441544889ED96CF6B134114C773C821070F3978E8C13FC5C3DCF266AB5E + 0A2D7A152A147AE8C1533D2C041A8A1091122179B3597F507A50E8C5B6C9BCD6 + A52548A93FA07521C628B4074B1A5B83B4104ADD3C0FBA524835B39A631F7C8F + F3F9CCBC99612616332CCF154952F21539726BC1B5064CC799C16D112FE7C1D6 + 08AC11983075CFB345BC3FE002DC21257743F86F89239B8490F172E2C23FC117 + 5C6B80947C494A763697463BFBD5690EBE3CE4CEC1636ED5B3ECEB31266505A4 + AC778B282F459BB92B12E4581F968B5782FDEA34F3D72767A655CFF28B47D7BE + 6B94BB9156420AD21A810FDEDFFD233CCCB74FF77FB64C41DA6CF6F9AB17B592 + C75BA55B3DE1617C3DC65AC963CF15C99E82924A8146E03D7FCA58B0E74FB146 + E0924A41EFF614E4B846E0A39D9CB1E06827C71A81CB0539DE53109E77537818 + 8DC0E53CD8E78273412C56C6D483B5D9A17654C1DAEC509B14E4FE0AF75C9124 + 4736DF3EBF1979059B8BA34C8E6C9E799B3D5724280F9735CAD72BC5C193563D + 1B5970B83DC32BC5C1134278B384203C5724BAFA5E991B6E1F6ECF44869FBED1 + 95B9E176D77E8482DAEA047FACDCFEAFD45627BA37FCF473D8AF189DA8B09695 + AC6DCCDFE0863FC90D7F9237E6AF77345A556340AF22848C4619AC3F1D09D69F + 8DFC7AF821D33781678B3829489382CFA464831032A6BF8A1FDBA511CB562822 + EB0000000049454E44AE426082 + } + Transparent = True + end + object StartDatePicker: TDateTimePicker + AnchorSideLeft.Control = Label1 + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = Image1 + Left = 114 + Height = 23 + Top = 47 + Width = 79 + CenturyFrom = 1941 + MaxDate = 2958465 + MinDate = -53780 + TabOrder = 1 + BorderSpacing.Left = 8 + TrailingSeparator = False + LeadingZeros = True + Kind = dtkDate + TimeFormat = tf24 + TimeDisplay = tdHMS + DateMode = dmComboBox + Date = 36235 + Time = 0.775961111103243 + UseDefaultSeparators = True + HideDateTimeParts = [] + MonthNames = 'Long' + CalAlignment = dtaLeft + end + object StartTimePicker: TDateTimePicker + AnchorSideLeft.Control = StartDatePicker + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = StartDatePicker + Left = 217 + Height = 23 + Top = 47 + Width = 65 + CenturyFrom = 1941 + MaxDate = 2958465 + MinDate = -53780 + TabOrder = 2 + BorderSpacing.Left = 24 + BorderSpacing.Right = 6 + TrailingSeparator = False + LeadingZeros = True + Kind = dtkTime + TimeFormat = tf24 + TimeDisplay = tdHMS + DateMode = dmComboBox + Date = 36235 + Time = 0.776266203698469 + UseDefaultSeparators = True + HideDateTimeParts = [] + MonthNames = 'Long' + CalAlignment = dtaLeft + end + object EndDatePicker: TDateTimePicker + AnchorSideLeft.Control = StartDatePicker + AnchorSideTop.Control = StartDatePicker + AnchorSideTop.Side = asrBottom + Left = 114 + Height = 23 + Top = 74 + Width = 79 + CenturyFrom = 1941 + MaxDate = 2958465 + MinDate = -53780 + TabOrder = 3 + BorderSpacing.Top = 4 + TrailingSeparator = False + LeadingZeros = True + Kind = dtkDate + TimeFormat = tf24 + TimeDisplay = tdHMS + DateMode = dmComboBox + Date = 36235 + Time = 0.776392129599117 + UseDefaultSeparators = True + HideDateTimeParts = [] + MonthNames = 'Long' + CalAlignment = dtaLeft + end + object EndTimePicker: TDateTimePicker + AnchorSideLeft.Control = StartTimePicker + AnchorSideTop.Control = EndDatePicker + Left = 217 + Height = 23 + Top = 74 + Width = 65 + CenturyFrom = 1941 + MaxDate = 2958465 + MinDate = -53780 + TabOrder = 4 + BorderSpacing.Right = 6 + TrailingSeparator = False + LeadingZeros = True + Kind = dtkTime + TimeFormat = tf24 + TimeDisplay = tdHMS + DateMode = dmComboBox + Date = 36235 + Time = 0.77642199069669 + UseDefaultSeparators = True + HideDateTimeParts = [] + MonthNames = 'Long' + CalAlignment = dtaLeft + end + object AlarmEnabledCheck: TCheckBox + AnchorSideLeft.Control = Label1 + AnchorSideTop.Control = AlarmAdvanceEdit + AnchorSideTop.Side = asrCenter + Left = 50 + Height = 19 + Top = 117 + Width = 74 + Caption = '&Reminder:' + TabOrder = 5 + end + object AlarmAdvanceEdit: TEdit + AnchorSideLeft.Control = AlarmEnabledCheck + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = Image2 + Left = 132 + Height = 23 + Top = 115 + Width = 37 + BorderSpacing.Left = 8 + BorderSpacing.Bottom = 8 + ReadOnly = True + TabOrder = 6 + Text = '0' + end + object UpDown1: TUpDown + AnchorSideLeft.Control = AlarmAdvanceEdit + AnchorSideLeft.Side = asrBottom + Left = 169 + Height = 23 + Top = 115 + Width = 15 + Associate = AlarmAdvanceEdit + Max = 60 + Min = 0 + OnClick = UpDown1Click + Position = 0 + TabOrder = 7 + end + object Edit1: TEdit + AnchorSideLeft.Control = Label6 + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = Owner + AnchorSideRight.Control = Owner + AnchorSideRight.Side = asrBottom + Left = 54 + Height = 23 + Top = 6 + Width = 290 + Anchors = [akTop, akLeft, akRight] + BorderSpacing.Left = 6 + BorderSpacing.Top = 6 + BorderSpacing.Right = 6 + Constraints.MinWidth = 280 + TabOrder = 0 + end + object ButtonPanel1: TButtonPanel + AnchorSideLeft.Control = Owner + AnchorSideTop.Control = Image2 + AnchorSideTop.Side = asrBottom + AnchorSideRight.Control = Owner + AnchorSideRight.Side = asrBottom + Left = 6 + Height = 26 + Top = 155 + Width = 338 + Align = alNone + Anchors = [akTop, akLeft, akRight] + BorderSpacing.Top = 10 + OKButton.Name = 'OKButton' + OKButton.DefaultCaption = True + HelpButton.Name = 'HelpButton' + HelpButton.DefaultCaption = True + CloseButton.Name = 'CloseButton' + CloseButton.DefaultCaption = True + CancelButton.Name = 'CancelButton' + CancelButton.DefaultCaption = True + TabOrder = 8 + ShowButtons = [pbOK, pbCancel] + ShowBevel = False + end +end diff --git a/components/jvcllaz/examples/JvTimeFramework/tfapptedit.pas b/components/jvcllaz/examples/JvTimeFramework/tfapptedit.pas new file mode 100644 index 000000000..4033bf87f --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfapptedit.pas @@ -0,0 +1,236 @@ +{****************************************************************** + + JEDI-VCL Demo + + Copyright (C) 2002 Project JEDI + + Original author: + + Contributor(s): + + You may retrieve the latest version of this file at the JEDI-JVCL + home page, located at http://jvcl.delphi-jedi.org + + The contents of this file are used with permission, subject to + the Mozilla Public License Version 1.1 (the "License"); you may + not use this file except in compliance with the License. You may + obtain a copy of the License at + http://www.mozilla.org/MPL/MPL-1_1Final.html + + Software distributed under the License is distributed on an + "AS IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or + implied. See the License for the specific language governing + rights and limitations under the License. + +******************************************************************} + +unit tfApptEdit; + +interface + +uses + Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, + StdCtrls, Buttons, ComCtrls, JvTFManager, ExtCtrls, ButtonPanel, + DateTimePicker; + +type + + { TApptEdit } + + TApptEdit = class(TForm) + ButtonPanel1: TButtonPanel; + Label1: TLabel; + Label3: TLabel; + Label5: TLabel; + StartDatePicker: TDateTimePicker; + StartTimePicker: TDateTimePicker; + EndDatePicker: TDateTimePicker; + EndTimePicker: TDateTimePicker; + AlarmEnabledCheck: TCheckBox; + AlarmAdvanceEdit: TEdit; + UpDown1: TUpDown; + Edit1: TEdit; + Label6: TLabel; + Bevel1: TBevel; + Image1: TImage; + Bevel2: TBevel; + Image2: TImage; + procedure UpDown1Click(Sender: TObject; Button: TUDBtnType); + procedure FormShow(Sender: TObject); + procedure FormClose(Sender: TObject; var TheAction: TCloseAction); + private + { Private declarations } + // This form will use this var to indicate whether the appt is being + // editing or whether is it being created. (This is important in the + // OnClose event.) + AddingAppt : Boolean; + public + { Public declarations } + // the main form will set this var to the selected appt if the user + // wants to edit the appt OR the main form will set this var to nil + // if the user wants to add a new appointment. + Appt : TJvTFAppt; + end; + +var + ApptEdit: TApptEdit; + +implementation + +Uses + tfMain, JvTFDays; + +{$R *.lfm} + +procedure TApptEdit.UpDown1Click(Sender: TObject; Button: TUDBtnType); +begin + // Handles the Alarm Advance "spin" + AlarmAdvanceEdit.Text := IntToStr(UpDown1.Position); +end; + +procedure TApptEdit.FormShow(Sender: TObject); +var + ApptStartDate, + ApptEndDate : TDate; + ApptStartTime, + ApptEndTime : TTime; + DaysGrid : TJvTFDays; +begin + // Just a short cut to save typing :) + DaysGrid := PhotoOpMain.JvTFDays1; + + If Assigned(Appt) Then + Begin + // Assume we want to edit the selected appt + // Populate the window fields from the selected appt + StartDatePicker.Date := Appt.StartDate; + StartTimePicker.Time := Appt.StartTime; + EndDatePicker.Date := Appt.EndDate; + EndTimePicker.Time := Appt.EndTime; + AlarmEnabledCheck.Checked := Appt.AlarmEnabled; + AlarmAdvanceEdit.Text := IntToStr(Appt.AlarmAdvance); + UpDown1.Position := Appt.AlarmAdvance; + Edit1.Text := Appt.Description; + // Change the caption of the form to indicate that the appointment + // is being edited. + Caption := 'Edit Appointment'; + // Set the AddingAppt var to false so that the form will recognize + // that the appt is being edited and not created. + AddingAppt := False; + End + Else + Begin + // Assume we are adding a new appt + // Request an appt from the server + Appt := PhotoOpMain.JvTFDays1.ScheduleManager.dbNewAppt(''); + // Right now this appt object is in a state of flux. It is not + // assigned to any schedules and shouldn't be because we're unsure + // of its data. The caching system is programmed to automatically + // destroy any appt objects that are not assigned to any schedules. + // In this particular situation, this is bad. + // So... + // Make the Appt object persistent so the cache does not attempt to + // flush it while this window is open. + Appt.Persistent := True; + + // Now populate the appt object with some default data which is + // retrieved from the JvTFDays grid. + With Appt do + Begin + If DaysGrid.ValidSelection Then + Begin + // Set the start/end dates according to the selection + ApptStartDate := DaysGrid.Cols[DaysGrid.SelStart.X].SchedDate; + ApptEndDate := DaysGrid.Cols[DaysGrid.SelEnd.X].SchedDate; + // Set the start/end times according to the selection + ApptStartTime := DaysGrid.RowToTime(DaysGrid.SelStart.Y); + ApptEndTime := DaysGrid.RowEndTime(DaysGrid.SelEnd.Y); + End + Else + Begin + // Set the start/end dates to today + ApptStartDate := Date; + ApptEndDate := Date; + // Set the start/end times to now and now + granularity + ApptStartTime := Time; + // Subtract one min from granularity, then add the minute back in. + // (Avoids minute overflow when granularity is 60) + ApptEndTime := ApptStartTime + + EncodeTime(0, DaysGrid.Granularity - 1, 0, 0) + + EncodeTime(0, 1, 0, 0); + End; + + Appt.BeginUpdate; + // Call BeginUpdate so that the appt will NOT be posted when we + // set the following properties. Don't worry about calling + // EndUpdate here. It will be called if the user chooses 'OK' to + // save the new appt. See FormClose below. + + SetStartEnd(ApptStartDate, ApptStartTime, ApptEndDate, ApptEndTime); + AlarmEnabled := True; + AlarmAdvance := 15; + End; + + // Now call this proc again to populate the window fields + FormShow(nil); // Appt won't be nil now so this call will fill the + // window fields + // Set the caption of the form to indicate that the appt is being added + Caption := 'Add Appointment'; + // Set the AddingAppt var to true so that the form will recognize that + // the appt is being added instead of edited. + AddingAppt := True; + End; +end; + +procedure TApptEdit.FormClose(Sender: TObject; var TheAction: TCloseAction); +var + DaysGrid : TJvTFDays; + I : Integer; +begin + If (ModalResult = mrOK) and Assigned(Appt) Then + With Appt do + Begin + Appt.BeginUpdate; + // Call BeginUpdate so that the appt is not posted while we are + // setting its properties. + + Try + // Copy the data from the window fields to the appt object + SetStartEnd(StartDatePicker.Date, StartTimePicker.Time, + EndDatePicker.Date, EndTimePicker.Time); + AlarmEnabled := AlarmEnabledCheck.Checked; + AlarmAdvance := StrToInt(AlarmAdvanceEdit.Text); + Description := Edit1.Text; + + If AddingAppt Then + Begin + // Just a shortcut to save some typing :-) + DaysGrid := PhotoOpMain.JvTFDays1; + + // Add the appt to selected schedule(s) + For I := 0 to DaysGrid.Cols.Count - 1 do + Appt.AddSchedule(DaysGrid.Cols[I].SchedName); + + // Now that we're done working with the appointment and it is + // actually assigned to a schedule, we should set the Persistent + // property to false. This will ensure the the caching system + // will properly dispose of the appointment object when it is + // no longer needed. + Appt.Persistent := False; + End; + Finally + Appt.EndUpdate; // this causes the appt to be posted + End; + End + Else If AddingAppt Then + // The user canceled the window, but we have already created the appt + // object. We need to clean up the appt object we requested from the + // server. This can be done either by manually destroying the appt + // object (Appt.Free), or by setting Appt.Persistent to false. + Appt.Free; + + // Set Appt to nil to prepare window for next opening + Appt := nil; +end; + +end. diff --git a/components/jvcllaz/examples/JvTimeFramework/tfmain.lfm b/components/jvcllaz/examples/JvTimeFramework/tfmain.lfm new file mode 100644 index 000000000..5fe084bce --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfmain.lfm @@ -0,0 +1,1500 @@ +object PhotoOpMain: TPhotoOpMain + Left = 212 + Height = 546 + Top = 138 + Width = 445 + Caption = 'UTF Demo 1: PhotoOp' + ClientHeight = 546 + ClientWidth = 445 + Color = clBtnFace + Constraints.MinHeight = 400 + Constraints.MinWidth = 445 + DefaultMonitor = dmDesktop + Font.Color = clWindowText + OnCreate = FormCreate + OnShow = FormShow + Position = poScreenCenter + LCLVersion = '2.1.0.0' + Scaled = False + object PageControl1: TPageControl + Left = 0 + Height = 448 + Top = 73 + Width = 445 + ActivePage = TabSheet1 + Align = alClient + TabIndex = 0 + TabOrder = 0 + object TabSheet1: TTabSheet + Caption = 'Day View' + ClientHeight = 420 + ClientWidth = 437 + object JvTFDays1: TJvTFDays + Left = 0 + Height = 420 + Top = 0 + Width = 437 + ScheduleManager = utfScheduleManager1 + ColHdrHeight = 30 + Cols = < + item + SchedDate = 0 + Title = ' - ' + Width = 370 + end> + Template.CompDate = 36406 + Template.LinearDayCount = 1 + Template.LinearEndDate = 36406 + Template.LinearStartDate = 36406 + Grouping = grNone + GridStartTime = 0 + GridEndTime = 0 + TimeBlocks = <> + TimeBlockProps.BlockHdrAttr.Font.Color = clWindowText + TimeBlockProps.BlockHdrAttr.ParentFont = False + TimeBlockProps.BlockHdrAttr.FrameColor = clBlack + TimeBlockProps.DayStart = 0 + TimeBlockProps.SelBlockHdrAttr.Font.Color = clBlack + TimeBlockProps.SelBlockHdrAttr.ParentFont = False + TimeBlockProps.SelBlockHdrAttr.FrameColor = clBlack + ApptAttr.Color = clWhite + ApptAttr.Font.Color = clWindowText + ApptAttr.ParentFont = False + SelApptAttr.Color = clWhite + SelApptAttr.Font.Color = clWindowText + SelApptAttr.ParentFont = False + HdrAttr.Font.Color = clWindowText + HdrAttr.ParentFont = False + HdrAttr.FrameColor = clBlack + SelHdrAttr.Font.Color = clBlack + SelHdrAttr.ParentFont = False + SelHdrAttr.FrameColor = clBlack + FancyRowHdrAttr.Hr2400 = False + FancyRowHdrAttr.MinorFont.Color = clWindowText + FancyRowHdrAttr.MajorFont.Color = clWindowText + FancyRowHdrAttr.MajorFont.Height = -21 + SelFancyRowHdrAttr.Hr2400 = True + SelFancyRowHdrAttr.MinorFont.Color = clBlack + SelFancyRowHdrAttr.MajorFont.Color = clBlack + SelFancyRowHdrAttr.MajorFont.Height = -21 + SelFancyRowHdrAttr.TickColor = clBlack + PrimeTime.StartTime = 0.333333333333333 + PrimeTime.EndTime = 0.708333333333333 + PrimeTime.Color = clYellow + GroupHdrAttr.Font.Color = clWindowText + GroupHdrAttr.ParentFont = False + GroupHdrAttr.FrameColor = clBlack + SelGroupHdrAttr.Font.Color = clBlack + SelGroupHdrAttr.ParentFont = False + SelGroupHdrAttr.FrameColor = clBlack + LeftCol = 0 + OnDateChanging = JvTFDays1DateChanging + OnDateChanged = JvTFDays1DateChanged + OnGranularityChanged = JvTFDays1GranularityChanged + DateFormat = 'ddddd' + TimeFormat = 't' + Align = alClient + Color = clWindow + TabOrder = 0 + OnDblClick = JvTFDays1DblClick + end + end + object TabSheet2: TTabSheet + Caption = 'Week View' + ClientHeight = 445 + ClientWidth = 437 + ImageIndex = 1 + object JvTFWeeks1: TJvTFWeeks + Left = 0 + Height = 445 + Top = 0 + Width = 437 + ScheduleManager = utfScheduleManager1 + Cells = < + item + Color = clBlack + CellDate = 37270 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37271 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37272 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37273 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37274 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37275 + CellPics = <> + CanSelect = True + end> + GapSize = 4 + TitleAttr.TxtAttr.Font.Color = clWindowText + TitleAttr.TxtAttr.Font.Height = -19 + TitleAttr.TxtAttr.Font.Style = [fsBold] + TitleAttr.Title = 'Week of Jan 14, 2002' + CellAttr.Font.Color = clWindowText + CellAttr.TitleAttr.Color = clWhite + CellAttr.TitleAttr.FrameAttr.Color = clGray + CellAttr.TitleAttr.DayTxtAttr.Font.Color = clWindowText + CellAttr.DrawBottomLine = False + SelCellAttr.Font.Color = clWindowText + SelCellAttr.TitleAttr.Color = clNavy + SelCellAttr.TitleAttr.DayTxtAttr.Font.Color = clWhite + SelCellAttr.DrawBottomLine = False + CellPics = StateImageList + Viewer = GlanceTextViewer1 + DateFormat = 'ddddd' + TimeFormat = 't' + Align = alClient + ParentColor = True + TabOrder = 0 + DisplayDate = 37270 + DisplayOrder = doLeftRight + DWNames.DWN_Sunday = 'S' + DWNames.DWN_Monday = 'M' + DWNames.DWN_Tuesday = 'T' + DWNames.DWN_Wednesday = 'W' + DWNames.DWN_Thursday = 'T' + DWNames.DWN_Friday = 'F' + DWNames.DWN_Saturday = 'S' + DWTitleAttr.Height = 20 + DWTitleAttr.Visible = False + DWTitleAttr.TxtAttr.Font.Color = clWindowText + DWTitleAttr.TxtAttr.Font.Height = -11 + DWTitleAttr.TxtAttr.Font.Style = [fsBold] + end + end + object TabSheet3: TTabSheet + Caption = 'Month View' + ClientHeight = 445 + ClientWidth = 437 + ImageIndex = 2 + object JvTFMonths1: TJvTFMonths + Left = 0 + Height = 445 + Top = 0 + Width = 437 + ScheduleManager = utfScheduleManager1 + Cells = < + item + Color = clBlack + CellDate = 37255 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37256 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37257 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37258 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37259 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37260 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37261 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37262 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37263 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37264 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37265 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37266 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37267 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37268 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37269 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37270 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37271 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37272 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37273 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37274 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37275 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37276 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37277 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37278 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37279 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37280 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37281 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37282 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37283 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37284 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37285 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37286 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37287 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37288 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37289 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37290 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37291 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37292 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37293 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37294 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37295 + CellPics = <> + CanSelect = True + end + item + Color = clBlack + CellDate = 37296 + CellPics = <> + CanSelect = True + end> + GapSize = 0 + TitleAttr.TxtAttr.Font.Color = clWindowText + TitleAttr.TxtAttr.Font.Height = -19 + TitleAttr.TxtAttr.Font.Style = [fsBold] + TitleAttr.Title = 'Januar 2002' + CellAttr.Font.Color = clWindowText + CellAttr.TitleAttr.Color = clWhite + CellAttr.TitleAttr.DayTxtAttr.Font.Color = clWindowText + CellAttr.DrawBottomLine = False + SelCellAttr.Font.Color = clWindowText + SelCellAttr.TitleAttr.Color = clNavy + SelCellAttr.TitleAttr.DayTxtAttr.Font.Color = clWhite + SelCellAttr.DrawBottomLine = False + Viewer = GlanceTextViewer2 + DateFormat = 'ddddd' + TimeFormat = 't' + Align = alClient + ParentColor = True + TabOrder = 0 + Month = 1 + Year = 2002 + DisplayDate = 37270 + DWNames.DWN_Sunday = 'S' + DWNames.DWN_Monday = 'M' + DWNames.DWN_Tuesday = 'T' + DWNames.DWN_Wednesday = 'W' + DWNames.DWN_Thursday = 'T' + DWNames.DWN_Friday = 'F' + DWNames.DWN_Saturday = 'S' + DWTitleAttr.FrameAttr.Style = fs3DRaised + DWTitleAttr.Height = 20 + DWTitleAttr.TxtAttr.Font.Color = clWindowText + DWTitleAttr.TxtAttr.Font.Height = -11 + ExtraDayCellAttr.Font.Color = clWindowText + ExtraDayCellAttr.TitleAttr.Color = clWhite + ExtraDayCellAttr.TitleAttr.DayTxtAttr.Font.Color = clWindowText + ExtraDayCellAttr.DrawBottomLine = False + OffDayCellAttr.Font.Color = clWindowText + OffDayCellAttr.TitleAttr.Color = clWhite + OffDayCellAttr.TitleAttr.DayTxtAttr.Font.Color = clWindowText + OffDayCellAttr.DrawBottomLine = False + FirstDayOfMonthFormat = 'mmm d' + DayFormat = 'd' + end + end + end + object Panel1: TPanel + Left = 0 + Height = 73 + Top = 0 + Width = 445 + Align = alTop + ClientHeight = 73 + ClientWidth = 445 + TabOrder = 1 + object ResourceCombo: TComboBox + Left = 198 + Height = 23 + Hint = 'Display Resource' + Top = 40 + Width = 131 + ItemHeight = 15 + OnChange = ResourceComboChange + ParentShowHint = False + ShowHint = True + Style = csDropDownList + TabOrder = 11 + end + object PrevDateButton: TBitBtn + AnchorSideLeft.Control = Panel1 + AnchorSideTop.Control = Panel1 + Left = 9 + Height = 24 + Hint = 'Previous Day' + Top = 9 + Width = 24 + BorderSpacing.Left = 8 + BorderSpacing.Top = 8 + NumGlyphs = 2 + Images = ImageList + ImageIndex = 0 + OnClick = PrevDateButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 0 + TabStop = False + end + object NextDateButton: TBitBtn + AnchorSideTop.Control = PrevDateButton + AnchorSideRight.Control = ModeCombo + AnchorSideRight.Side = asrBottom + Left = 148 + Height = 24 + Hint = 'Next Day' + Top = 9 + Width = 24 + Anchors = [akTop, akRight] + NumGlyphs = 2 + Images = ImageList + ImageIndex = 1 + OnClick = NextDateButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 1 + TabStop = False + end + object NewApptButton: TBitBtn + Left = 198 + Height = 24 + Hint = 'New Appointment' + Top = 8 + Width = 24 + NumGlyphs = 2 + Images = ImageList + ImageIndex = 4 + OnClick = NewApptButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 2 + TabStop = False + end + object EditApptButton: TBitBtn + Left = 225 + Height = 24 + Hint = 'Edit Appointment' + Top = 8 + Width = 24 + NumGlyphs = 2 + Images = ImageList + ImageIndex = 5 + OnClick = EditApptButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 3 + TabStop = False + end + object DeleteApptButton: TBitBtn + Left = 252 + Height = 24 + Hint = 'Delete Appointment' + Top = 8 + Width = 24 + NumGlyphs = 2 + Images = ImageList + ImageIndex = 6 + OnClick = DeleteApptButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 4 + TabStop = False + end + object ViewSchedsButton: TBitBtn + Left = 198 + Height = 24 + Hint = 'View Schedules (<Shift> + <Insert>)' + Top = 40 + Width = 24 + Glyph.Data = { + 76010000424D7601000000000000760000002800000020000000100000000100 + 0400000000000001000000000000000000001000000010000000000000000000 + 80000080000000808000800000008000800080800000C0C0C000808080000000 + FF0000FF000000FFFF00FF000000FF00FF00FFFF0000FFFFFF00333333333333 + 3333333333333333333333333333333333333333333333333333333333333333 + 3333333333333333333333333030330333333333383833833333330308888883 + 0333338388888883833330388F6666F88303383887FFFF788383388FF666666F + F88338877F8888F778838FFFF660066FFFF887777F8778F777788FFFF660066F + FFF887777F8778F77778388FF666666FF88338877F8888F7788330388F6666F8 + 8303383887FFFF78838333030888888303333383888888838333333330303303 + 3333333338383383333333333333333333333333333333333333333333333333 + 3333333333333333333333333333333333333333333333333333 + } + NumGlyphs = 2 + OnClick = ViewSchedsButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 5 + TabStop = False + end + object HideSchedButton: TBitBtn + Left = 225 + Height = 24 + Hint = 'Hide Selected Schedule (<Shift> + <Delete>)' + Top = 40 + Width = 24 + Glyph.Data = { + 76010000424D7601000000000000760000002800000020000000100000000100 + 0400000000000001000000000000000000001000000010000000000000000000 + 80000080000000808000800000008000800080800000C0C0C000808080000000 + FF0000FF000000FFFF00FF000000FF00FF00FFFF0000FFFFFF00333333333333 + 3333333333333333333333333333333333333333333333333333333333333333 + 3333333333333333333333333033030333333333383383833333330308808083 + 033333838FF8F8F383333038088888808303383FFFFFFFF8F383308887777778 + 808338FFFF77777FF8F38887777777777888FFF7777777777FFF877777777777 + 7778877777777777777838877777777778833887777777777883333887777778 + 8333333887777778833333333888888333333333388888833333333333333333 + 3333333333333333333333333333333333333333333333333333333333333333 + 3333333333333333333333333333333333333333333333333333 + } + NumGlyphs = 2 + OnClick = HideSchedButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 6 + TabStop = False + end + object ShareButton: TBitBtn + Left = 252 + Height = 24 + Hint = 'Share Appointment (<Ctrl> + Drag)' + Top = 40 + Width = 24 + NumGlyphs = 2 + Images = ImageList + ImageIndex = 3 + OnClick = ShareButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 7 + TabStop = False + end + object TimeIncCombo: TComboBox + Left = 328 + Height = 23 + Hint = 'Time Increments' + Top = 8 + Width = 105 + DropDownCount = 12 + ItemHeight = 15 + Items.Strings = ( + '60 mins' + '30 mins' + '20 mins' + '15 mins' + '12 mins' + '10 mins' + '6 mins' + '5 mins' + '4 mins' + '3 mins' + '2 mins' + '1 min' + ) + OnClick = TimeIncComboChange + ParentShowHint = False + ShowHint = True + Style = csDropDownList + TabOrder = 8 + end + object GotoDatePicker: TDateTimePicker + AnchorSideLeft.Control = PrevDateButton + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = PrevDateButton + AnchorSideTop.Side = asrCenter + AnchorSideRight.Control = NextDateButton + Left = 37 + Height = 23 + Hint = 'Current Day' + Top = 10 + Width = 107 + CenturyFrom = 1941 + MaxDate = 2958465 + MinDate = -53780 + TabOrder = 10 + BorderSpacing.Left = 4 + BorderSpacing.Right = 4 + TrailingSeparator = False + LeadingZeros = True + ShowHint = True + ParentShowHint = False + Anchors = [akTop, akLeft, akRight] + Kind = dtkDate + TimeFormat = tf24 + TimeDisplay = tdHMS + DateMode = dmComboBox + Date = 36892 + Time = 0.414710879602353 + UseDefaultSeparators = True + HideDateTimeParts = [] + MonthNames = 'Long' + CalAlignment = dtaLeft + OnChange = GotoDatePickerChange + end + object ModeCombo: TComboBox + AnchorSideLeft.Control = PrevDateButton + AnchorSideTop.Control = PrevDateButton + AnchorSideTop.Side = asrBottom + Left = 9 + Height = 23 + Hint = 'Display Mode' + Top = 41 + Width = 163 + BorderSpacing.Top = 8 + ItemHeight = 15 + Items.Strings = ( + 'Single' + 'Group' + ) + OnChange = ModeComboChange + ParentShowHint = False + ShowHint = True + Style = csDropDownList + TabOrder = 9 + end + object DaysCombo: TComboBox + Left = 344 + Height = 23 + Hint = 'Visible Days' + Top = 40 + Width = 89 + ItemHeight = 15 + Items.Strings = ( + '31 days' + '14 days' + '7 days' + '5 days' + '3 days' + '2 days' + '1 day' + ) + OnChange = DaysComboChange + ParentShowHint = False + ShowHint = True + Style = csDropDownList + TabOrder = 12 + end + object PrintButton: TBitBtn + Left = 279 + Height = 24 + Hint = 'Print' + Top = 8 + Width = 24 + Glyph.Data = { + 76010000424D7601000000000000760000002800000020000000100000000100 + 0400000000000001000000000000000000001000000010000000000000000000 + 800000800000008080008000000080008000808000007F7F7F00BFBFBF000000 + FF0000FF000000FFFF00FF000000FF00FF00FFFF0000FFFFFF00300000000000 + 0003377777777777777308888888888888807F33333333333337088888888888 + 88807FFFFFFFFFFFFFF7000000000000000077777777777777770F8F8F8F8F8F + 8F807F333333333333F708F8F8F8F8F8F9F07F333333333337370F8F8F8F8F8F + 8F807FFFFFFFFFFFFFF7000000000000000077777777777777773330FFFFFFFF + 03333337F3FFFF3F7F333330F0000F0F03333337F77773737F333330FFFFFFFF + 03333337F3FF3FFF7F333330F00F000003333337F773777773333330FFFF0FF0 + 33333337F3F37F3733333330F08F0F0333333337F7337F7333333330FFFF0033 + 33333337FFFF7733333333300000033333333337777773333333 + } + NumGlyphs = 2 + Images = ImageList + ImageIndex = 2 + OnClick = PrintButtonClick + ParentShowHint = False + ShowHint = True + Spacing = 0 + TabOrder = 13 + end + end + object Panel2: TPanel + Left = 0 + Height = 25 + Top = 521 + Width = 445 + Align = alBottom + AutoSize = True + BevelInner = bvLowered + BevelOuter = bvNone + BorderWidth = 2 + ClientHeight = 25 + ClientWidth = 445 + TabOrder = 2 + object Label1: TLabel + AnchorSideLeft.Control = Panel2 + AnchorSideTop.Control = Panel2 + Left = 5 + Height = 15 + Top = 5 + Width = 94 + BorderSpacing.Around = 2 + Caption = 'Icons provided by' + ParentColor = False + end + object Label2: TLabel + AnchorSideLeft.Control = Label1 + AnchorSideLeft.Side = asrBottom + AnchorSideTop.Control = Label1 + AnchorSideTop.Side = asrCenter + Left = 103 + Height = 15 + Top = 5 + Width = 61 + BorderSpacing.Left = 4 + Caption = 'icons8.com' + Font.Color = clBlue + ParentColor = False + ParentFont = False + OnClick = Label2Click + OnMouseEnter = Label2MouseEnter + OnMouseLeave = Label2MouseLeave + end + end + object utfScheduleManager1: TJvTFScheduleManager + OnRefreshAppt = utfScheduleManager1RefreshAppt + OnPostAppt = utfScheduleManager1PostAppt + OnDeleteAppt = utfScheduleManager1DeleteAppt + StateImages = StateImageList + StateImageMap.AlarmEnabled = 0 + StateImageMap.AlarmDisabled = 1 + StateImageMap.Shared = 3 + StateImageMap.Recurring = -1 + StateImageMap.Modified = 2 + OnLoadBatch = utfScheduleManager1LoadBatch + SchedLoadMode = slmBatch + left = 112 + top = 136 + end + object StateImageList: TImageList + left = 112 + top = 280 + Bitmap = { + 4C69040000001000000010000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 000000000000000000FF000000FF000000FF0000000000000000000000000000 + 000000000000000000000000000000000000000000007B7B7BFF000000FF0000 + 00FF0000000000000000000000FF0000000000000000000000FF000000FF7B7B + 7BFF00000000000000000000000000000000000000FF7B7B7BFFBDBDBDFFBDBD + BDFF000000FF7B7B7BFF000000FF7B7B7BFF000000FFBDBDBDFFBDBDBDFF7B7B + 7BFF000000FF0000000000000000000000FFBDBDBDFFBDBDBDFFBDBDBDFFBDBD + BDFF7B7B7BFF7B7B7BFF000000FF7B7B7BFFBDBDBDFFBDBDBDFFBDBDBDFFBDBD + BDFF7B7B7BFF000000FF00000000000000FFBDBDBDFFBDBDBDFF7B7B7BFF0000 + 00FF000000FF000000FF000000FF000000FF000000FF000000FFBDBDBDFF7B7B + 7BFF7B7B7BFF000000FF00000000000000FF000000FF000000FF000000FF0000 + 00FF0000FFFF0000FFFF0000FFFF0000FFFF0000FFFF000000FF000000FF0000 + 00FF000000FF000000FF000000000000000000000000000000FF000000FF0000 + FFFFBDBDBDFFFFFFFFFF000000FFFFFFFFFFBDBDBDFF0000FFFF000000FF0000 + 00FF000000000000000000000000000000007B7B7BFF000000FF0000FFFFBDBD + BDFF000000FFFFFFFFFF000000FFFFFFFFFF000000FFBDBDBDFF0000FFFF0000 + 00FF7B7B7BFF000000000000000000000000000000FF0000FFFF0000FFFFFFFF + FFFFFFFFFFFFFFFFFFFF000000FFFFFFFFFFFFFFFFFFFFFFFFFF0000FFFF0000 + FFFF000000FF000000000000000000000000000000FF0000FFFF000000FFFFFF + FFFFFFFFFFFFFFFFFFFF000000FFFFFFFFFFFFFFFFFF000000FF000000FF0000 + FFFF000000FF000000000000000000000000000000FF0000FFFF0000FFFFFFFF + FFFFFFFFFFFF000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0000FFFF0000 + FFFF000000FF0000000000000000000000007B7B7BFF000000FF0000FFFFBDBD + BDFF000000FFFFFFFFFFFFFFFFFFFFFFFFFF000000FFBDBDBDFF0000FFFF0000 + 00FF7B7B7BFF00000000000000000000000000000000000000FF000000FF0000 + FFFFBDBDBDFFFFFFFFFF000000FFFFFFFFFFBDBDBDFF0000FFFF000000FF0000 + 00FF000000000000000000000000000000000000000000007BFF000000FF0000 + 00FF000000FF0000FFFF000000FF0000FFFF000000FF000000FF000000FF0000 + 7BFF00000000000000000000000000000000000000FF000000FF00007BFF0000 + 0000000000FF000000FF000000FF000000FF000000FF0000000000007BFF0000 + 00FF000000FF0000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000007B7B7BFF7B7B7BFF7B7B7BFF0000000000000000000000000000 + 000000000000000000000000000000000000000000007B7B7BFF7B7B7BFF7B7B + 7BFF00000000000000007B7B7BFFFFFFFFFFFFFFFFFF7B7B7BFF7B7B7BFF7B7B + 7BFF000000000000000000000000000000007B7B7BFF00000000FFFFFFFFFFFF + FFFF7B7B7BFF000000007B7B7BFFFFFFFFFF7B7B7BFF00000000FFFFFFFFFFFF + FFFF7B7B7BFF00000000000000007B7B7BFF00000000FFFFFFFF000000000000 + 0000000000007B7B7BFF7B7B7BFF7B7B7BFF00000000FFFFFFFF000000000000 + 0000000000007B7B7BFF000000007B7B7BFFFFFFFFFF00000000000000007B7B + 7BFF7B7B7BFF7B7B7BFF7B7B7BFF7B7B7BFF7B7B7BFF7B7B7BFF000000000000 + 0000000000007B7B7BFFFFFFFFFF7B7B7BFF7B7B7BFF7B7B7BFF7B7B7BFF7B7B + 7BFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7B7B7BFF7B7B7BFF7B7B + 7BFF7B7B7BFF7B7B7BFFFFFFFFFF00000000FFFFFFFF7B7B7BFF7B7B7BFFFFFF + FFFFFFFFFFFF000000007B7B7BFF0000000000000000000000007B7B7BFF7B7B + 7BFFFFFFFFFFFFFFFFFFFFFFFFFF00000000000000007B7B7BFFFFFFFFFFFFFF + FFFF7B7B7BFF000000007B7B7BFFFFFFFFFF7B7B7BFF00000000000000007B7B + 7BFFFFFFFFFF0000000000000000000000007B7B7BFF00000000FFFFFFFF0000 + 000000000000FFFFFFFF7B7B7BFFFFFFFFFF00000000FFFFFFFF000000000000 + 00007B7B7BFF0000000000000000000000007B7B7BFFFFFFFFFF7B7B7BFF0000 + 000000000000000000007B7B7BFFFFFFFFFF000000007B7B7BFF7B7B7BFF0000 + 00007B7B7BFFFFFFFFFF00000000000000007B7B7BFFFFFFFFFF00000000FFFF + FFFF000000007B7B7BFF00000000FFFFFFFF0000000000000000FFFFFFFFFFFF + FFFF7B7B7BFFFFFFFFFF0000000000000000000000007B7B7BFF000000000000 + 00007B7B7BFF00000000FFFFFFFF000000007B7B7BFF00000000000000007B7B + 7BFF00000000FFFFFFFF0000000000000000000000007B7B7BFF7B7B7BFF0000 + 000000000000FFFFFFFF7B7B7BFF0000000000000000FFFFFFFF7B7B7BFF7B7B + 7BFFFFFFFFFF00000000000000000000000000000000000000007B7B7BFF7B7B + 7BFF7B7B7BFF000000007B7B7BFFFFFFFFFF7B7B7BFF7B7B7BFF7B7B7BFFFFFF + FFFFFFFFFFFF0000000000000000000000007B7B7BFF7B7B7BFF00000000FFFF + FFFF7B7B7BFF7B7B7BFF7B7B7BFF7B7B7BFF7B7B7BFFFFFFFFFFFFFFFFFF7B7B + 7BFF7B7B7BFF0000000000000000000000000000000000000000000000FF0000 + 000000000000000000FF000000FF000000FF000000FF000000FF000000FF0000 + 00FF0000000000000000000000000000000000000000000000FF0000FFFF0000 + 00FF00000000000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0000 + 00FF000000FF0000000000000000000000000000000000000000000000FF00FF + FFFF000000FF000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0000 + 00FFFFFFFFFF000000FF00000000000000000000000000000000000000000000 + 00FF00FFFFFF000000FFFFFFFFFFFFFFFFFF000000FF000000FFFFFFFFFF0000 + 00FFFFFFFFFFFFFFFFFF000000FF000000000000000000000000000000000000 + 0000000000FF00FFFFFF000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF0000 + 00FF000000FF000000FF000000FF000000000000000000000000000000FF0000 + 00FF000000FF000000FF00FFFFFF000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFF000000FF000000FF000000FF000000FF00FFFFFFFFFF + FFFF00FFFFFF000000FF000000FF00FFFFFF000000FFFFFFFFFFFFFFFFFF0000 + 00FF000000FFFFFFFFFF000000FFFFFF00FF000000FF00FFFFFFFFFFFFFF0000 + 00FF000000FF000000FF000000FF000000FF000000FF000000FFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFF000000FFFFFF00FF000000FFFFFFFFFF00FFFFFFFFFF + FFFF00FFFFFFFFFFFFFF00FFFFFFFFFFFFFF00FFFFFFFFFFFFFF000000FFFFFF + FFFFFFFFFFFFFFFFFFFF000000FFFFFF00FF000000FF00FFFFFFFFFFFFFF00FF + FFFFFFFFFFFF000000FF000000FF000000FF000000FF000000FF00FFFFFF0000 + 00FFFFFFFFFFFFFFFFFF000000FFFFFF00FF000000FFFFFFFFFF00FFFFFFFFFF + FFFF00FFFFFFFFFFFFFF00FFFFFFFFFFFFFF000000FFFFFFFFFF000000FF0000 + 00FFFFFFFFFFFFFFFFFF000000FFFFFF00FF000000FF00FFFFFFFFFFFFFF00FF + FFFFFFFFFFFF000000FF000000FF000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFF000000FFFFFFFFFF000000FFFFFF00FF000000FF000000FF00FFFFFFFFFF + FFFF00FFFFFFFFFFFFFF00FFFFFF000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFF000000FF000000FF000000FF00000000000000FF0000 + 00FF000000FF000000FF000000FFFFFFFFFFFFFFFFFF000000FFFFFFFFFF0000 + 00FF000000FFFFFFFFFF000000FF000000000000000000000000000000000000 + 000000000000000000FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFF000000FF000000000000000000000000000000000000 + 000000000000000000FF000000FF000000FF000000FF000000FF000000FF0000 + 00FF000000FF000000FF000000FF000000000000000000000000000000000000 + 0000000000FF000000FF000000FF000000FF000000FF00000000000000000000 + 0000000000000000000000000000000000000000000000000000000000FF0000 + 00FF0000000000000000000000000000000000000000000000FF000000FF0000 + 00000000000000000000000000000000000000000000000000FF000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00FF00000000000000000000000000000000000000FF000000FF000000FF0000 + 00FF000000FF000000FF00000000000000000000000000000000000000000000 + 0000000000FF000000000000000000000000000000FF000000FF0000FFFF0000 + FFFF0000FFFF000000FF0000000000000000000000FF000000FF000000FF0000 + 0000000000FF0000000000000000000000FF00000000000000FF0000FFFF0000 + FFFF0000FFFF000000FF00000000000000FF7B7B7BFF00FFFFFF7B7B7BFF0000 + 00FF00000000000000FF00000000000000FF00000000000000FF0000FFFF0000 + FFFF0000FFFF000000FF00000000000000FF00FFFFFF00FFFFFF00FFFFFF0000 + 00FF00000000000000FF00000000000000FF00000000000000FF000000FF0000 + 00FF000000FF000000FF00000000000000FF7B7B7BFF00FFFFFF7B7B7BFF0000 + 00FF00000000000000FF00000000000000FF0000000000000000000000000000 + 00000000000000000000000000FF00000000000000FF000000FF000000FF0000 + 000000000000000000FF00000000000000FF0000000000000000000000000000 + 000000000000000000FFFF0000FF000000FF0000000000000000000000000000 + 000000000000000000FF0000000000000000000000FF00000000000000000000 + 0000000000FFFF0000FFFF0000FFFF0000FF000000FF00000000000000000000 + 0000000000FF000000000000000000000000000000FF00000000000000000000 + 00FF000000FF000000FF000000FF000000FF000000FF000000FF000000000000 + 0000000000FF00000000000000000000000000000000000000FF000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00FF000000000000000000000000000000000000000000000000000000FF0000 + 00FF0000000000000000000000000000000000000000000000FF000000FF0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000FF000000FF000000FF000000FF000000FF00000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000 + } + end + object NeedApptsQuery: TSQLQuery + FieldDefs = <> + Database = dbUTF + Transaction = SQLTransaction + SQL.Strings = ( + 'Select * From GroupLink, GroupAppt' + ' Where (SchedName = :SchedName)' + ' And (GroupLink.ApptID = GroupAppt.ApptID)' + ' And ((StartDate >= :D1) and (EndDate <= :D2))' + ) + Params = < + item + DataType = ftUnknown + Name = 'SchedName' + ParamType = ptInput + end + item + DataType = ftUnknown + Name = 'D1' + ParamType = ptInput + end + item + DataType = ftUnknown + Name = 'D2' + ParamType = ptInput + end> + left = 208 + top = 328 + end + object ApptSchedulesQuery: TSQLQuery + FieldDefs = <> + Database = dbUTF + Transaction = SQLTransaction + SQL.Strings = ( + 'Select * From GroupLink' + ' Where ApptID = :ApptID' + ) + Params = < + item + DataType = ftUnknown + Name = 'ApptID' + ParamType = ptInput + end> + left = 208 + top = 384 + end + object GetApptQuery: TSQLQuery + FieldDefs = <> + Database = dbUTF + Transaction = SQLTransaction + SQL.Strings = ( + 'Select * From GroupAppt' + ' Where ApptID = :ApptID' + ) + Params = < + item + DataType = ftUnknown + Name = 'ApptID' + ParamType = ptInput + end> + left = 200 + top = 440 + end + object DeleteApptLinkQuery: TSQLQuery + FieldDefs = <> + Database = dbUTF + Transaction = SQLTransaction + SQL.Strings = ( + 'Delete From GroupLink' + ' Where ApptID = :ApptID' + ) + Params = < + item + DataType = ftUnknown + Name = 'ApptID' + ParamType = ptInput + end> + left = 328 + top = 440 + end + object DeleteApptQuery: TSQLQuery + FieldDefs = <> + Database = dbUTF + Transaction = SQLTransaction + SQL.Strings = ( + 'Delete From GroupAppt' + ' Where ApptID = :ApptID' + ) + Params = < + item + DataType = ftUnknown + Name = 'ApptID' + ParamType = ptInput + end> + left = 328 + top = 328 + end + object SchedulesQuery: TSQLQuery + FieldDefs = <> + Database = dbUTF + Transaction = SQLTransaction + SQL.Strings = ( + 'Select Distinct(SchedName) From GroupLink' + ) + Params = <> + left = 328 + top = 384 + end + object GlanceTextViewer1: TJvTFGlanceTextViewer + ShowStartEndTimeInHint = False + LineSpacing = 2 + left = 304 + top = 144 + end + object GlanceTextViewer2: TJvTFGlanceTextViewer + ShowStartEndTimeInHint = False + LineSpacing = 2 + ShowStartEnd = False + left = 304 + top = 224 + end + object dbUTF: TSQLite3Connection + Connected = False + LoginPrompt = False + KeepConnection = False + Transaction = SQLTransaction + left = 104 + top = 384 + end + object SQLTransaction: TSQLTransaction + Active = False + Action = caCommit + Database = dbUTF + left = 100 + top = 440 + end + object ImageList: TImageList + left = 112 + top = 211 + Bitmap = { + 4C69070000001000000010000000000000000000000000000000000000000000 + 00000000000000000000000000000000000000000000000000005A3B261C0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00000000000000000000000000000000000000000000885B3B4EB57C50B70000 + 0000000000000000000000000000000000000000000000000000000000000000 + 000000000000000000000000000000000000895D3A5CD69C70F9BF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00000000000000000000000000008C5F3E6FDAA074FDF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 000000000000000000008D603F83DDA377FDF0B78BFFF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00002F2010018D614095E0A67AFCF0B78BFFF0B78BFFF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000002A20 + 1503B98256A4E3A97DFBF0B78BFFF0B78BFFF0B78BFFF0B78BFFBF8558BD0000 + 00000000000000000000000000000000000000000000000000002D1D1206BD81 + 55B2E5AC80FBF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFBF8558BD0000 + 00000000000000000000000000000000000000000000000000002D1D1206BD81 + 55B3E5AC80FBF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000002A20 + 1503B98357A5E3A97DFCF0B78BFFF0B78BFFF0B78BFFF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00002F201001BD825097E0A77AFCF0B78BFFF0B78BFFF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 000000000000000000008D613F86DEA478FDF0B78BFFF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00000000000000000000000000008C603F74DBA175FEF0B78BFFBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 000000000000000000000000000000000000895D3C61D89D71FCBF8558BD0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00000000000000000000000000000000000000000000885C3B52B57B50BA0000 + 0000000000000000000000000000000000000000000000000000000000000000 + 00000000000000000000000000000000000000000000000000005A3B261C0000 + 0000000000000000000000000000000000000000000000000000000000002D1E + 13122C1E130A0000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630B77C51C42C1E130F00000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630D89E71F6C2875CD12F201518000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6EDB488FFC58A5EDB2F2015220000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFEEB589FFC88D61E25E40252E00000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFF0B78BFFEFB68AFFCA9064E889603A39000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFF0B78BFFF0B78BFFF0B78BFFCE9468ED885D3A440000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFD3986CF3875C + 3A50000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFD3986CF4885C + 3A50000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFF0B78BFFF0B78BFFF0B78BFFCF9568EE895A39450000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFF0B78BFFF0B68AFFCB9165E884603F3B000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6F0B78BFFEFB68AFFC88E62E25E40253000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630DCA376F6EEB589FFC68A5FDC2F2015260000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630D89E72F6C3885CD42F20151C000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000005A3D + 2630B77D50CA2D1E131100000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000002D1E + 13122C1E130A0000000000000000000000000000000000000000000000000000 + 000000000000000000000000000000000000000000000000000050483F5F5048 + 3F7550483F7550483F7550483F7550483F7550483F7550483F7550483F755048 + 3F5F000000000000000000000000000000000000000000000000B5A99ACFF9F8 + F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFB8AD + 9FD5000000000000000000000000000000000000000000000000B8AB9DCBFFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFBCB0 + A3D50000000000000000000000000000000000000000493E3544B6A99BF7FFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFBBAE + A1F84A3E35460000000000000000231D1917957F6DA09B8673D0B68C6AFFC598 + 74FFC59874FFC59874FFC59874FFC59874FFC59874FFC59874FFC59874FFB68C + 6AFF9B8674D095806DA2241E191A493E3570CDB9A8FFD4C1B0FFCB9972FFF0B7 + 8BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFCC98 + 70FFD3C3B3FFCEBBAAFF493E3475493E3475CEBBA9FFD4C1B0FFCB9972FFF0B7 + 8BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFCC98 + 70FFBCD8D8FFC3C9C1FF483D347B493E3475CEBBA9FFD4C1B0FFC99873FFEFB6 + 8AFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B78BFFF0B68AFFC997 + 71FFD4C1B0FFD0BDACFF483D347B493E3475CEBBA9FFD4C1B0FFCFB49EFFC49A + 7AFFC39979FFC39979FFC39979FFC39979FFC39979FFC39979FFC39A7AFFCFB4 + 9DFFD4C1B0FFD0BDACFF483D347B493E3475CEBBA9FFD4C1B0FFD4C1B0FFD4C1 + B0FFD4C1B0FFD4C1B0FFD4C1B0FFD4C1B0FFD4C1B0FFD4C1B0FFD4C1B0FFD4C1 + B0FFD4C1B0FFD0BDACFF483D347B493E3475CEBBA9FFAF9A88FFA08D7BFFAE9D + 8CFFAE9D8CFFAE9D8CFFAE9D8CFFAE9D8CFFAE9D8CFFAE9D8CFFAE9D8CFFA08D + 7BFFAD9886FFD0BDACFF483D347B493E3573CDBAA9FFB5A18FFFC4B5A7FFEDE3 + D6FFE3D8CAFFD8CCBDFFD8CCBDFFD8CCBDFFD8CCBDFFE3D8CAFFEDE3D6FFC6B8 + AAFFB49F8DFFCFBCABFF493E3477453E3A1F9B8673BBA38E7BD5BAAD9EF7FBF8 + F5FFEFEBE6FFE3DDD6FFE3DDD6FFE3DDD6FFE3DDD6FFEFEBE6FFFBF8F5FFBEB1 + A4F8A38E7BD59C8773BD443E3A24000000000000000000000000B8AB9DCBFFFF + FFFFE3DED9FFCAC1B7FFCAC1B7FFCAC1B7FFCAC1B7FFE3DED9FFFFFFFFFFBCB0 + A3D5000000000000000000000000000000000000000000000000B5A99ACFF9F8 + F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFF9F8F7FFB8AD + 9FD500000000000000000000000000000000000000000000000050483F5F5048 + 3F7550483F7550483F7550483F7550483F7550483F7550483F7550483F755048 + 3F5F0000000000000000000000004C7047004C7047004C7047004C7047004C70 + 47004C70470080808002769B5B1C779F602D7A9B591780804004799A5E2671AA + 55094C7047004C7047004C7047004C7047004C7047004C7047004C70470076A7 + 621A8DB27B9F9BBF8DD3A7CB9EEEADD1A6FA9EC292EF96BA87F5AACFA2FA9BBF + 8EDB8AAF75534C7047004C7047004C7047004C7047004C70470086AD73549CC2 + 91DCBCDEB8FFBDE0BAFFB6D9B1FFB1D4AAFF9CC291FFBDE0BAFFBDE0BAFFBDE0 + BAFF95BA86D34C7047004C7047004C7047004C70470081AE6F45A4C899E6BDE0 + BAFFA8CC9FEA8FB37EA882AA70607B9D663C94B984D6BDE0BAFFBDE0BAFFBDE0 + BAFF9ABE8EF880A7621A4C7047004C7047008080400495BA86CCBDE0BAFFA0C4 + 95DE83AB71464C7047004C7047004C70470086AC746EAFD1A6F4BDE0BAFFB5D8 + AFFF9FC292FF8EB37DAE4C7047004C70470084AA7072A1C596FEA4C79AFA85AA + 71664C7047004C7047004C7047004C7047004C70470085AC74568FB37D9B89AE + 76C6BADDB6FFA7C99CED75A05F237BAD6B1F96BA87F1B8DCB4FFAFD4A8FD8CB1 + 7BA04C7047004C7047004C7047004C7047004C7047004C7047004C704700799E + 6115A2C798E7BBDEB7FF87AD74828CB17A94BDDFBAFFBDE0BAFFBDE0BAFFA5C9 + 9BEC7A995C194C7047004C7047004C7047004C7047004C7047004C7047004C70 + 470099BE8BCBBDE0BAFF8FB37D9B8CB07A94BDDFBAFFBDE0BAFFBDE0BAFFA4C9 + 9BEC759F60184C7047004C7047004C7047004C7047004C7047004C7047004C70 + 47009BBE8BCBBDE0BAFF8DB27D9B7BA76A1D96BA87F1B8DBB4FFAFD3A8FD8CB0 + 7A9F4C7047004C7047004C7047004C7047004C7047004C7047004C7047007497 + 5D16A2C798E7BBDEB7FF87AD74824C70470083A8716FA1C596FEA4C999FA82AC + 71684C7047004C7047004C7047004C7047004C70470080AA6F1E8CB17A948BB0 + 7AD6B3D7ADFFA5CA9CEC78A562224C7047008080400496BB87CABDE0BAFFA2C6 + 95DE83AA71484C7047004C7047004C704700809C631296BB88D6BDDFBAFFBDDF + BAFF9DC190FF8CB27BB24C7047004C7047004C70470085AB6E43A4C89AE5BDE0 + BAFFA8CB9EEB8EB47DA985A9706277A0633E84AA71ACB8DBB4FFBDE0BAFFBDE0 + BAFFB8DBB4FF84A86F784C7047004C7047004C7047004C70470087A972539DC1 + 8FDBBBDFB8FFBDE0BAFFB6DAB1FFB1D4AAFFA8CDA0FFB0D4A9FFBDE0BAFFBDE0 + BAFFAFD3A9F981A96C474C7047004C7047004C7047004C7047004C7047007A9B + 64178CB27B9E9ABD8DD2A6CA9DEDADD1A5FAA5C99AEA90B37FEBA5C899F6A5C9 + 9AED8CB27B9E4C7047004C7047004C7047004C7047004C7047004C7047004C70 + 47004C7047008080800271A15E1B779F602D799E61154C7047007A995C19759F + 60184C7047004C7047004C704700000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000005856CAFC6564D8FE6564D8FE6564 + D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564 + D8FE6564D8FE5856CAFC00000000000000006766D7FD8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF6767DAFE00000000000000005E5ED3FE7C7CEBFF7C7CEBFF7C7C + EBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7C + EBFF7C7CEBFF5F5ED5FE0000000000000000A59DB5F2D0D0F1FFD0D0F1FFD0D0 + F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0 + F1FFD0D0F1FFA7A0B7F80000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFDFCFAFFFEFDFDFFFDFCFBFFFDFCFBFFFEFDFDFFFDFCFAFFFEFEFEFFFCFB + F9FFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFEBE4DBFFF3F0EAFFEEE9E2FFEEE9E1FFF4F0EBFFEAE4DAFFF8F5F2FFE6DE + D3FFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFE5DED2FFF6F3 + EFFFEAE3D9FFF2EEE8FFEEE8E0FFEDE7DFFFF3EFE9FFE3DED1FFD3DCC8FFBAC4 + A5FFE7EEE3FFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFEFDFCFFFFFF + FEFFFEFEFDFFFFFEFEFFFEFEFDFFFEFEFDFFE2EADDFF9CBD8EFFACD0A4FFB2D5 + ABFFA2C697FF95A87DFA1C27180400000000C5BBAFEFFFFFFFFFE8E2D7FFF8F5 + F2FFECE6DDFFF4F1EBFFF0EBE4FFE9E6DCFF9DBC8EFFBDE0BAFFCBE7C8FFE9F5 + E9FFBDE0BAFFB0D3A9FF5B784A7C00000000C5BBAFEFFFFFFFFFFAF9F6FFFEFD + FDFFFBFAF8FFFDFCFBFFFCFBF9FFD4DFCBFFADD0A5FFCBE7C8FFDCEFDAFFF6FB + F5FFCFE9CDFFC3E3C0FF8FB47EDF00000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFC9D9C0FFB2D6ACFFE9F5E9FFF6FBF5FFFDFE + FDFFF2F9F2FFD1EACFFF94B986F600000000C8BDB0EFF6F1EBFFF6F1EBFFF6F1 + EBFFF6F1EBFFF6F1EBFFF6F1EBFFDFE1D0FFA3C798FFBDE0BAFFCFE9CDFFF2F9 + F2FFBDE0BAFFBDE0B9FF84A96FBE00000000B2A494E8C8BDB0F5C8BDB0F5C8BD + B0F5C8BDB0F5C8BDB0F5C8BDB0F5C8BDB0F595A87DFAB1D4AAFFC3E3C0FFD1EA + CFFFBDE0B9FF98BB8AFE3C4F3038000000000000000000000000000000000000 + 0000000000000000000000000000000000001C2718045A76497A8FB47EDD94B9 + 85F583A86EBC3B4E2F3600000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000005856CAFC6564D8FE6564D8FE6564 + D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564 + D8FE6564D8FE5856CAFC00000000000000006766D7FD8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF6767DAFE00000000000000005E5ED3FE7C7CEBFF7C7CEBFF7C7C + EBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7C + EBFF7C7CEBFF5F5ED5FE0000000000000000A59DB5F2D0D0F1FFD0D0F1FFD0D0 + F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0 + F1FFD0D0F1FFA7A0B7F80000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFDFCFAFFFEFDFDFFFDFCFBFFFDFCFBFFFEFDFDFFFDFCFAFFFEFEFEFFFCFB + F9FFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFEBE4DBFFF3F0EAFFEEE9E2FFEEE9E1FFF4F0EBFFEAE4DAFFF8F5F2FFE6DE + D3FFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFE5DED2FFF6F3 + EFFFEAE3D9FFF2EEE8FFEEE8E0FFEDE7DFFFF3EFE9FFE9E2D7FFF7F4F1FFE4DC + D0FFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFEFDFCFFFFFF + FEFFFEFEFDFFFFFEFEFFFEFEFDFFFEFEFDFFFFFEFEFFFEFEFDFFFFFFFEFFFEFD + FCFFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFE8E2D7FFF8F5 + F2FFECE6DDFFF4F1EBFFF0EBE4FFEFEAE3FFF4F1ECFFECE6DCFFFFFFFFFFFFFF + FFFFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFAF9F6FFFEFD + FDFFFBFAF8FFFDFCFBFFFCFBF9FFFCFBF9FFFDFCFBFFFBFAF8FFFFFFFFFFFFFF + FFFFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFC7BDB3F50000000000000000C8BDB0EFF6F1EBFFF6F1EBFFF6F1 + EBFFF6F1EBFFF6F1EBFFF6F1EBFFF6F1EBFFF6F1EBFFF6F1EBFFF6F1EBFFF6F1 + EBFFF6F1EBFFC9BEB1F50000000000000000B2A494E8C8BDB0F5C8BDB0F5C8BD + B0F5C8BDB0F5C8BDB0F5C8BDB0F5C8BDB0F5C8BDB0F5C8BDB0F5C8BDB0F5C8BD + B0F5C8BDB0F5B2A494E900000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000000000000000000000000000000000 + 0000000000000000000000000000000000005856CAFC6564D8FE6564D8FE6564 + D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564D8FE6564 + D8FE6564D8FE5856CAFC00000000000000006766D7FD8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF6767DAFE00000000000000005E5ED3FE7C7CEBFF7C7CEBFF7C7C + EBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7CEBFF7C7C + EBFF7C7CEBFF5F5ED5FE0000000000000000A59DB5F2D0D0F1FFD0D0F1FFD0D0 + F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0F1FFD0D0 + F1FFD0D0F1FFA7A0B7F80000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFDFCFAFFFEFDFDFFFDFCFBFFFDFCFBFFFEFDFDFFFDFCFAFFFEFEFEFFFCFB + F9FFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFEBE4DBFFF3F0EAFFEEE9E2FFEEE9E1FFF4F0EBFFEAE4DAFFF8F5F2FFE6DE + D3FFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFE5DED2FFF6F3 + EFFFEAE3D9FFF2EEE8FFEEE8E0FFEDE7DFFFF3EFE9FFE1DAD6FFC4C2E6FFA5A0 + CEFFDEDEF6FFC7BDB3F50000000000000000C5BBAFEFFFFFFFFFFEFDFCFFFFFF + FEFFFEFEFDFFFFFEFEFFFEFEFDFFFEFEFDFFD7D7F3FF7272DCFF7D7DECFF8383 + F0FF7272E4FF7570BCFA10102F0400000000C5BBAFEFFFFFFFFFE8E2D7FFF8F5 + F2FFECE6DDFFF4F1EBFFF0EBE4FFE7E2E1FF7171DCFF8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF8282EDFF3535977C00000000C5BBAFEFFFFFFFFFFAF9F6FFFEFD + FDFFFBFAF8FFFDFCFBFFFCFBF9FFC5C4EAFF7E7EECFFA6A6F9FFADADF9FFADAD + F9FFADADF9FF9999F8FF5D5DD8DF00000000C5BBAFEFFFFFFFFFFFFFFFFFFFFF + FFFFFFFFFFFFFFFFFFFFFFFFFFFFB4B4EAFF8484F0FFDADAFDFFE9E9FEFFE9E9 + FEFFE9E9FEFFB1B1FAFF6363DCF600000000C8BDB0EFF6F1EBFFF6F1EBFFF6F1 + EBFFF6F1EBFFF6F1EBFFF6F1EBFFD5D1E4FF7473E5FF8F8FF7FF8F8FF7FF8F8F + F7FF8F8FF7FF8F8FF7FF5151D0BE00000000B2A494E8C8BDB0F5C8BDB0F5C8BD + B0F5C8BDB0F5C8BDB0F5C8BDB0F5C8BDB0F57470BBFA8282EEFF8F8FF7FF8F8F + F7FF8F8FF7FF6968DBFE22226538000000000000000000000000000000000000 + 00000000000000000000000000000000000010102F043434967A5E5ED8DD6363 + DCF55050D0BC2121643600000000 + } + BitmapAdv = { + 4C69010000004C7A070000002000000020000000510F00000000000078DAED9A + 795093DB15C05FDBD76DFA66DA4EF769A77DD369A76FA6FDA3D37FDBCE38639F + CFE78A0BF6C963532480DB136509D9080828A0AC8A2C0990051114903D405040 + 5156173645106471098B10B6B0E6F49E4F931730C1846CD5973B7326B9F9BEEF + FCEE77CFB9E79EF37DF9E083F7B315FB6EFA751163DB17D66097D2ED3E2E61DB + F51532B6712DCD2E0CD8FA4909CB6EAC8CB36BD1D2FC42E6D67F95B2764C74A4 + 7C35D310E3366749BE84BDFDDFA5ACED8A4702DF85F1D248B0245FCAD9FDA584 + B543F158E40FC8B624BF32788F6729CB6EB63F8BAD665B8A5F19B4872BE1EC98 + 1EC8E62C635B825F19649F50C6DE39F33C27E80DB6B9F9D2A03D6269D0EE0959 + DE49AD6C73F1AF73D77D58C1B5BF56196C3F31941FAA936D0E7E36D7FE2329D7 + BEBA2AD4616CB4E8F4AA6C53F3915D1EB8ABFD46B8D34B7DD8A6E4E33E52C6D9 + D95D7BC6656CAC24422FB6A9F8C896B0773EBB13471B35846D6A7E739CC74B6B + F035E6BFF79615E67FA5FFD5463A8F5ADAFF34C740D6FEEDAAB0BDE3965E7FCB + E3CFEEEBD743F68E593AFE2C1B43F0EE2C69D0EA31D0DCFB4F4590BDB09CBB6B + CA1AFB8FC6DE7F52D71E68A9FC431ABC8761ADFC43633F76C131F45D6259858F + AD9C63BFA3542307B434FFEBFC7BBBA233EDC4BC35F854BC66D8FD9DD862C21A + F5C78A1A68D45A7C6BD79FEF5D2D4FDFB6116D6A353E63AB2BD6D4E8DBD6E293 + 7A63A1846937836BDC1AFCBAA8FDA318DB30C649D8BBF658838F71F549261330 + D6931AC8D51A7C14DCEB24EC1D8A8AA03D81D6E0A3E09E8F7B3FC90122ADC157 + 8D81E4417269F06E9135F8289803925C70928CA30873434BF351860BC2A02A74 + EF1819439539C6F0363E0AD60455610EE324276DC35AC1D27C14ACCF6E45BABC + 2463E828E46EFDB9A5F9AA31D447BB8D9571763CC53DD8D27C9534C579C849DD + 2A33C5BEB5163E4A5BF2D18952B69DDCD83118C3975889DF1CEF2127317AC4D2 + F38FFED714EBFE92D8DEE2FE876C7C4E551EB8ABD3546C43E20F3E9FC3E72496 + 8E3FC8BE1EBA771C9F4F9A9AADCFFE5319FC5F393E97B5F4FEF37AEF9B20FC0C + ABE41F9C9D3352EE9E144BE71FCF5EE73EA4EE0FB674FE85B91FE69FD260FBE3 + 96CE3F7B2F3228760577B7B3E5EB0FFB056417D1B7FFC72AF517739BC21AB5CF + FF43FDF94D6CE951EC58416CE0B029047519CA4F8B6167DCBE560893F2974609 + EA109D0BBE6C285F18CB4968AEAD00635B5BD34D1BDF407E2CD38BC68B0CE836 + 153F3D9A3D803AF5E59F0B3C745914C30193DD7F1C1712B847F2576346D33D3F + 8E0AA0D1CFD269DC58A6677B4E940F14C7FA40755A8851823A72A37D218EE5F5 + 107523E34C006D592C3DEBEFE118CF3E389D11C399C88CE34E12992E8DA0919C + CE01EA62DC8D12D481BA50E76BDD93C88A617A1C54CF37E7D0839A5C1EB4555F + 55CB8D243AB4261E06436B9E95D2C13B0635E7BC97E9AECD4F07C2EC51F1E3D8 + 5EC3B78B8466E7DFB95D0E2D3505D028C90462E3194BF29BEAAF81E8254051EF + A055F8F76F1643DEC03054B5DED38B8FD798828F3A56DA5F1F7E435614D444B8 + C248E1A935B3B12EBA79661FD48BC30CE6B75ECF81AA984350C2DC0EC58C6D6B + 96EB515ED07AEDB2C17C95B4545C827B12F19A04AFD5A6D310BE39E4FF997FA7 + 3C0B72934F4372E8714808FECA2482BA7292C2A0A9ECD25BF97929E1101D4003 + 7EB81F14659C875A499651823AF8E1FE94CECB09216FE517A54751E766C406C2 + E3B63A181DE8304AFA3BEF40467C10A5339F1FA9951FCF39D4877B02B5EEAAF2 + A0322B11F278916FF06B8AC47AC94AFE95E470A8C83C4FE946465DB108C81EF8 + 54CD677AD29342BCA70BC8F85472E9FC49686FAE8119F9B05A6E95E7E8259AD7 + 3C6AA9874B64DE3575A784F94CC731BDCEAAF85C2EF743323F76F19CC31731F7 + 413175FEA5D28B121D706037320DCD3F7B1EB6E825E6C87F6715335092CDD34B + F0DC773DFFB776FD65EDFAD3526DCBB1CFDE39E1A6B9FEC03FD9E5AF7E298E9F + FAF25D9C7D79CEBB7C792EFF3CC173F8031EF7B9E0F44BEA3772CC8FEFF48F0F + E0836F19CDCCB6FF5E40EA3E9740B16775A0F8A0ECCC55A6EC7C45D8586A4DDC + 7CCAB5A8E9B8D2E091D3574EC8D842DA14F7E2C1D9A4CA08051E8BCC670EB345 + 1EED749EE39FD6C4E572BFCDE0EF7766093D06932A23A70BDAAF40E59372AD12 + 2F09860B15A741DA2359F6FBD5B62C206378CE48D9FB2B43D8F404879FB284EE + F5E72421E392AE429D5C94BCD62C08CFF503E99332ADC7C575494B4CA187585F + B66F9AEB9F09FBC9A546FE82367DC50FF320FB8E0084B713E1623D8FBAF78C06 + 9EEE31F6965373A00F9BD8F9172C216D00E74D53470599577E4DCC0C37E3908C + 2DF26C20FACED3F9FB4F3085EE411CB1E7939CFB19ABCE1127C36B461F3F6309 + 6877B39A058B9AD75EB9275EE288BD640CC101B68FD0E9476FD82A7D1F53702B + 6151171BC71E28F65AA28BDC0EACC667A6BBB3D0CF34AF15DC4A54B044B496D5 + FCC73FC9F9F741170F0D57F44AB4F2536FC442F2B533640E0E0EE1FAD4A6E358 + 9AEB4F38224F59454FA9FABAACE6F4250E998F237147BEFFB6B96388DCFD4F5D + F191973E2A505F8FFE28BA7D01C8EF807A33EA531675F921B1E369328773AA6B + 255D45C0167B3EF5E539FC4C5FBF6508DD1CC85AEDC75870269F2923369B08C9 + F29E2B7F5CA21E4FF0A523438C24C7DFACBC96F8FB8BA80236845D3E0E67F219 + 10911BA060A4EE3FB096B881B11063A477B6FD0F892FB715767C1D37485C9A0B + 48DF775433C630053469649EBFF26A5B36A00D8B1EE4622C51927B6945BB1813 + 3BFD792E9BCF4942C755FC22B276C9FA6952CFBB80164A62CCAC8EB8B1C0167B + 488DE1A3EF10DF9769EA650B3D87705FE072D77D48D6F1329F5B2921D9C787E9 + A9FBFF68CC18D8428F07E5DDC56A9DC1994764DE02E7DFFAF11DFF12914797AD + 1637F8D5310A7F9ED317C6F039199E959A3E1079952EF3E139FDCDB2FC1CB54E + 64225F35FF521D710325F4B2F790B9E61F8F0592F87DA1E294421B3BB3216581 + 25F2283397FFA9D79FD0BD3C22D75F994FD69FF4F5FA4B283FA5C4B8EB9F44FB + B151EB2FD5752BEEE1BAD69F3AFE080E3C8F2AC4F873E255FCB94A57D045FB69 + 6B61DA67DB7F2720C9F59313697B3FC1FC47D3F6FCEAB85966AADB61ADF1B756 + 23FE7617517BB621F117E792957E20047D0A7D3C3C8F3EC1CDF052F2ABA2A91C + 808ABF99DAE32FC639322FB2F29E9265FB0FB1C15DCC39F5F4B382736521539A + F104ED99288D8098622EB5FF048A3C043AF78F74F700ADFB2F89E1DAC6BCD2CE + E49EE5BAD6D1D97C26994FDA38E637BA74D09268DFA5F28FA6F437F20FCC7BC9 + 5ECCE59EB7FF48EBBD93388DFB872EFEEB3CB4FDADB91FB137EEA12BF32F9C47 + 7E75AC827B91CABF9A48AE9088F917F1DB6076865726D1BDB05A1CC11C885CD7 + A56FFE49FCB127B3913FA735FFECBCAACE3F31EFC4DC2FF26A00B5B674F1714D + 73445EB5FAFA32FA234BE0713BBEF4E4B8664EA34B84B72E503996AEE3643F9F + 34349FC018C548DDE748FC6680F8F0547EBB6EFB62DD817996B82EF98D63171B + 780B18CB30DEAFB5FEF24F75762471F43AC6526DF557588EEF0BE2BB4FB1560A + C9F61EE35545CFA2E0FE8131DCD838AA19CFB1AEF44B71DA493EDDFC539C1D7D + 79AE1BE969AE1FABF371B25FF9A6B8EC453176EF32A7D8DAAB66BF533ABD6D6B + ED922504592BF9DBB6DC5C3A7AB41F58AC61B30A32700C2BF93BED6A16F07874 + B4C2AC1214F4D2C6D7C2DFBAE5C6A28B4B277879F59A5590A18DEF774438723E + BE05048201B34A62C203F03B9A3EB5922F8A0FEA79D6FF18CCDD4664CF009FC9 + BE6BFCC58579504C8DC39C628AEA2B954B541F05BF63C363D8C773B12DCCCF52 + FDF9D919A3F9D313A3D0D3560B83DDF7A8FED2E202D547410EB667BDAD547F72 + 4C46F5C764FD547F68B0CB68FE947C04FA3B9B4036D0F9FADEE6A83E0A7EC786 + C7B08FE762938F3CA3FAA3CF7BDF79FB5B9A3FF2BC87B21D7E5AC3FEC6F0BB7B + EF42754B09A4149F82B08B5F4162C149A8BC9B0F7DB26EBDF98B8BF3945EE450 + BCA545AAAF5A5B4AA592EAA3E0776CF3E47B696336901C94D4EE61406A59B87C + 57447D9E2F0B038ED00332A5099016C71E31B5FD717C71F98110914B273548AE + D6FCBCB4AB10A20B39C0E6BB2F616DB11A7F7C78909A4F952D6726C7A8BECA1E + 380FD847C1EF78DF9139F465BCBB2F9A6154310AAD43F797D7A1790C25A9830A + 4C65FFFE175DD49CAFBCEF27F257EBFEE9E4E0B2DFCBBA8B8029709FF1E5396E + D4C5574CCBA97B57C5DBF93905D5C77950CD37F651AEDD2F84C4F2F037E65B17 + 1F85D4690BA45E1599C2FEA9E551948FA9E61CB928F2D971EAF8E4DC84FA3795 + 2D2E35A5E11C749B821F71D90F9F0F507AD1DEABB58939F9EB6750B9E0CFDF37 + 6B0A3EAF2C12447549945EBC3F9C6F14BC6FCA77E6A7D4BF3D1CE9A0CECBBE23 + C4FBEFD5E4CB9EF6C03CB1B7A12269C882C40AC3ECCFAF8E51929AFA8A267F4C + F6042686FB0C96F687351028F2A4D6B73E7C7C36456AE8697CA6AB7EDF1DC391 + 3D7DDC063886B54886340E620B039771D016686FD59CABE45C7188922DF4B8B5 + EC7D7B0CBBC99877EC185331AEC5147195B8BEB53FFF29A5E2302375FFA25FCA + 97BF33750D893135206D7F26C616625FCAC7D0CFF113FB38E7E478A539D89ACD + 37D9790BE12433D3DD1EE11A630A0EF430D2DD449AF6B6355BFD6FABBF6DF5BF + ADFEB7D5FFB6FADFE67FEF53FD6F0AFE5AEA7F3C465D43CE558D91BA6671FE9D + B3BFA1F5BFCA66D857D5C8D6F63F63F886D4FF2A7BE331ECE3B9EFDBFEF34DE0 + AFB5FE37445E0E3DD5C95F6BFD6F88C887FBB5F28DADFFF5156468E71B57FF1B + F47F7CC2B255BCB666ABFF6DF5B7ADFEB7D5FFB6FADF56FFDBFCEFFDA9FF5BEE + 0E4076F633F0F7BD0F7BBFA887E3C7EE82583C081D1D9366ADFFE766E72095DF + 0B9B3737008DD605DEDE83D49E8B9FEEEE5DB0654B239C0E6B035ED44993BFFF + 5F5C5482A7672B3838B44268A85CEBDE131E3E49E27F07D86DAF5E5AB7EEBA49 + DFFF27270F80A3E37DBDF64017E77BCA4D9B9A4DF6FEBFF3E11835E7BAEE7BA5 + 44444CC1E79F37CCAC5F7FCB24EFFF333307C9DEDA6D501E70F0E093854D9B1A + 4DF2FE3F20A093F231D49B9333078D8D0B3AA5B8789E3A8F4E97E11C98E4FDBF + 93D33D60B34728BD7D7D4BAB9E2B932D51E7A1AD3EFDB4DE24EFFFFDFC1E828F + CF334A2FDE5F4BCBA24E914A5FDD3F9339041B373698E4FD7F2ABFC760FB1F3E + DC47D640A349DEFFD7DFEC22395D23B5BEF5619F3D3B4D6251F3F4FAF5B5267B + FF1F12DC0A6E6EED7AF169EEEDCACD9B1B4DFAFE1F63EAF66D354B24BE29717D + EBBA6F77F747B0E9F39B8BEBD6D599FC1D3CC6D40D1BEA3231B61C39D247F918 + FA397E621FE77CC386FA4A73B0351B896B5B3EFBAC2E998CE311AE31E2E73D1B + 36348834EDAD6AFF03880DBFF8 + } + end +end diff --git a/components/jvcllaz/examples/JvTimeFramework/tfmain.pas b/components/jvcllaz/examples/JvTimeFramework/tfmain.pas new file mode 100644 index 000000000..18ff27e9f --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfmain.pas @@ -0,0 +1,712 @@ +{****************************************************************** + + JEDI-VCL Demo + + Copyright (C) 2002 Project JEDI + + Original author: + + Contributor(s): + + You may retrieve the latest version of this file at the JEDI-JVCL + home page, located at http://jvcl.delphi-jedi.org + + The contents of this file are used with permission, subject to + the Mozilla Public License Version 1.1 (the "License"); you may + not use this file except in compliance with the License. You may + obtain a copy of the License at + http://www.mozilla.org/MPL/MPL-1_1Final.html + + Software distributed under the License is distributed on an + "AS IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or + implied. See the License for the specific language governing + rights and limitations under the License. + +******************************************************************} + +unit tfMain; + +interface + +uses + LCLIntf, + //Windows, Messages, + SysUtils, Classes, Graphics, Controls, Forms, Dialogs, + Db, sqldb, sqlite3conn, //DBTables, + ComCtrls, StdCtrls, Buttons, ExtCtrls, ImgList, DateTimePicker, JvTFManager, + JvTFDays, JvTFGlance, JvTFGlanceTextViewer, JvTFMonths, JvTFWeeks, + JvComponent, JvExControls; + +type + + { TPhotoOpMain } + + TPhotoOpMain = class(TForm) + ImageList: TImageList; + Label1: TLabel; + Label2: TLabel; + Panel2: TPanel; + utfScheduleManager1: TJvTFScheduleManager; + StateImageList: TImageList; + NeedApptsQuery: TSQLQuery; + ApptSchedulesQuery: TSQLQuery; + GetApptQuery: TSQLQuery; + DeleteApptLinkQuery: TSQLQuery; + DeleteApptQuery: TSQLQuery; + SchedulesQuery: TSQLQuery; + PageControl1: TPageControl; + TabSheet1: TTabSheet; + TabSheet2: TTabSheet; + TabSheet3: TTabSheet; + JvTFDays1: TJvTFDays; + JvTFWeeks1: TJvTFWeeks; + JvTFMonths1: TJvTFMonths; + GlanceTextViewer1: TJvTFGlanceTextViewer; + GlanceTextViewer2: TJvTFGlanceTextViewer; + Panel1: TPanel; + ResourceCombo: TComboBox; + PrevDateButton: TBitBtn; + NextDateButton: TBitBtn; + NewApptButton: TBitBtn; + EditApptButton: TBitBtn; + DeleteApptButton: TBitBtn; + ViewSchedsButton: TBitBtn; + HideSchedButton: TBitBtn; + ShareButton: TBitBtn; + TimeIncCombo: TComboBox; + GotoDatePicker: TDateTimePicker; + ModeCombo: TComboBox; + DaysCombo: TComboBox; + PrintButton: TBitBtn; + dbUTF: TSQLite3Connection; + SQLTransaction: TSQLTransaction; + procedure Label2Click(Sender: TObject); + procedure Label2MouseEnter(Sender: TObject); + procedure Label2MouseLeave(Sender: TObject); + procedure utfScheduleManager1PostAppt(Sender: TObject; Appt: TJvTFAppt); + procedure utfScheduleManager1DeleteAppt(Sender: TObject; Appt: TJvTFAppt); + procedure utfScheduleManager1RefreshAppt(Sender: TObject; Appt: TJvTFAppt); + procedure ModeComboChange(Sender: TObject); + procedure ViewSchedsButtonClick(Sender: TObject); + procedure HideSchedButtonClick(Sender: TObject); + procedure ResourceComboChange(Sender: TObject); + procedure DaysComboChange(Sender: TObject); + procedure ShareButtonClick(Sender: TObject); + procedure PrevDateButtonClick(Sender: TObject); + procedure NextDateButtonClick(Sender: TObject); + procedure GotoDatePickerChange(Sender: TObject); + procedure GotoDatePickerUserInput(Sender: TObject; + const UserString: String; var DateAndTime: TDateTime; + var AllowChange: Boolean); + procedure TimeIncComboChange(Sender: TObject); + procedure NewApptButtonClick(Sender: TObject); + procedure EditApptButtonClick(Sender: TObject); + procedure DeleteApptButtonClick(Sender: TObject); + procedure JvTFDays1DateChanging(Sender: TObject; var NewDate: TDate); + procedure JvTFDays1DateChanged(Sender: TObject); + procedure JvTFDays1GranularityChanged(Sender: TObject); + procedure JvTFDays1DblClick(Sender: TObject); + procedure JvTFDaysPrinter1ApptProgress(Sender: TObject; Current, + Total: Integer); + procedure JvTFDaysPrinter1AssembleProgress(Sender: TObject; Current, + Total: Integer); + procedure JvTFDaysPrinter1PrintProgress(Sender: TObject; Current, + Total: Integer); + + procedure utfScheduleManager1LoadBatch(Sender: TObject; BatchName: String; + BatchStartDate, BatchEndDate: TDate); + + procedure FormCreate(Sender: TObject); + procedure FormShow(Sender: TObject); + + procedure PrintButtonClick(Sender: TObject); + private + { Private declarations } + public + { Public declarations } + end; + +var + PhotoOpMain: TPhotoOpMain; + +implementation + +uses + tfVisibleResources, tfShare, tfApptEdit, tfPrintProgress; + +{$R *.lfm} + +procedure TPhotoOpMain.utfScheduleManager1PostAppt(Sender: TObject; + Appt: TJvTFAppt); +var + I : Integer; +begin + With GetApptQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + Open; + + If RecordCount > 0 Then // SQL RecordCount not reliable except on local tables + Edit + Else + Begin + Insert; + FieldByName('ApptID').AsString := Appt.ID; + End; + + FieldByName('StartDate').AsDateTime := Appt.StartDate; + FieldByName('StartTime').AsDateTime := Appt.StartTime; + FieldByName('EndDate').AsDateTime := Appt.EndDate; + FieldByName('EndTime').AsDateTime := Appt.EndTime; + FieldByName('Description').AsString := Appt.Description; + FieldByName('AlarmEnabled').AsBoolean := Appt.AlarmEnabled; + FieldByName('AlarmAdvance').AsInteger := Appt.AlarmAdvance; + Post; + Close; + End; + + // Now update the Appt --> Schedule relationship + // First delete all entries in the Link table + With DeleteApptLinkQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + ExecSQL; + End; + + // Now "refresh" the link table by adding a record for each of the names + // in Appt.Schedules. We will use the ApptSchedulesQuery to update the table. + With ApptSchedulesQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + Open; + For I := 0 to Appt.ScheduleCount - 1 do + Begin + Insert; + FieldByName('ApptID').AsString := Appt.ID; + FieldByName('SchedName').AsString := Appt.Schedules[I]; + Post; + End; + Close; + End; +end; + +procedure TPhotoOpMain.utfScheduleManager1DeleteAppt(Sender: TObject; + Appt: TJvTFAppt); +begin + // First delete the appointment from the appointment table + With DeleteApptQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + ExecSQL; + End; + + // Next, delete the related records from the link table + With DeleteApptLinkQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + ExecSQL; + End; +end; + +procedure TPhotoOpMain.utfScheduleManager1RefreshAppt(Sender: TObject; + Appt: TJvTFAppt); +begin + With GetApptQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + Open; + If RecordCount = 1 Then + Begin + Appt.SetStartEnd(FieldByName('StartDate').AsDateTime, + FieldByName('StartTime').AsDateTime, + FieldByName('EndDate').AsDateTime, + FieldByName('EndTime').AsDateTime); + Appt.Description := FieldByName('Description').AsString; + Appt.AlarmEnabled := FieldByName('AlarmEnabled').AsBoolean; + Appt.AlarmAdvance := FieldByName('AlarmAdvance').AsInteger; + End; + Close; + End; + + // Now update the Appt --> Schedule(s) relationship + Appt.ClearSchedules; + With ApptSchedulesQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + Open; + First; + While not EOF do + Begin + Appt.AddSchedule(FieldByName('SchedName').AsString); + Next; + End; + Close; // ApptSchedulesQuery + End; +end; + +procedure TPhotoOpMain.ModeComboChange(Sender: TObject); +begin + If ModeCombo.ItemIndex = 0 Then + // Single mode + Begin + // display the appropriate tool bar controls + ViewSchedsButton.Visible := False; + HideSchedButton.Visible := False; + ShareButton.Visible := False; + ResourceCombo.Visible := True; + DaysCombo.Visible := True; + // synchronize the date + JvTFDays1.Template.LinearStartDate := GotoDatePicker.Date; + // "activate" the Linear template + JvTFDays1.Template.ActiveTemplate := agtLinear; + // set the column grouping + JvTFDays1.Grouping := grResource; + End + Else + // Group mode + Begin + // display the appropriate tool bar controls + ViewSchedsButton.Visible := True; + HideSchedButton.Visible := True; + ShareButton.Visible := True; + ResourceCombo.Visible := False; + DaysCombo.Visible := False; + // synchronize the date + JvTFDays1.Template.CompDate := GotoDatePicker.Date; + // "activate" the Comparative template + JvTFDays1.Template.ActiveTemplate := agtComparative; + // set the column grouping + JvTFDays1.Grouping := grDate; + End; +end; + +procedure TPhotoOpMain.ViewSchedsButtonClick(Sender: TObject); +begin + VisibleResources.ShowModal; +end; + +procedure TPhotoOpMain.HideSchedButtonClick(Sender: TObject); +var + I, + NameIndex : Integer; + NameList : TStringList; +begin + NameList := TStringList.Create; + + Try + With JvTFDays1 do + Begin + If ValidSelection Then + Begin + For I := SelStart.X to SelEnd.X do + NameList.Add(Cols[I].SchedName); + + For I := 0 to NameList.Count - 1 do + Begin + NameIndex := Template.CompNames.IndexOf(NameList[I]); + If NameIndex > -1 Then + Template.CompNames.Delete(NameIndex); + End; + End + Else + MessageDlg('Please select a schedule to hide.', mtInformation, [mbOK], 0); + End; + Finally + NameList.Free; + End; +end; + +procedure TPhotoOpMain.ResourceComboChange(Sender: TObject); +begin + JvTFDays1.Template.LinearName := ResourceCombo.Text; + JvTFWeeks1.SchedNames.Clear; + JvTFWeeks1.SchedNames.Add(ResourceCombo.Text); + JvTFWeeks1.Refresh; + JvTFMonths1.SchedNames.Clear; + JvTFMonths1.SchedNames.Add(ResourceCombo.Text); + JvTFMonths1.Refresh; +end; + +procedure TPhotoOpMain.DaysComboChange(Sender: TObject); +begin + Case DaysCombo.ItemIndex of + 0 : JvTFDays1.Template.LinearDayCount := 31; + 1 : JvTFDays1.Template.LinearDayCount := 14; + 2 : JvTFDays1.Template.LinearDayCount := 7; + 3 : JvTFDays1.Template.LinearDayCount := 5; + 4 : JvTFDays1.Template.LinearDayCount := 3; + 5 : JvTFDays1.Template.LinearDayCount := 2; + 6 : JvTFDays1.Template.LinearDayCount := 1; + End; +end; + +procedure TPhotoOpMain.ShareButtonClick(Sender: TObject); +begin + If JvTFDays1.SelAppt <> nil Then + Share.ShowModal + Else + MessageDlg('Please select an appointment.', mtInformation, [mbOK], 0); +end; + +procedure TPhotoOpMain.PrevDateButtonClick(Sender: TObject); +begin + JvTFDays1.PrevDate; +end; + +procedure TPhotoOpMain.NextDateButtonClick(Sender: TObject); +begin + JvTFDays1.NextDate; +end; + +procedure TPhotoOpMain.GotoDatePickerChange(Sender: TObject); +begin + // GotoDatePicker.OnCloseUp should also point to this handler + JvTFDays1.GotoDate(GotoDatePicker.Date); + JvTFWeeks1.DisplayDate := GotoDatePicker.Date; + JvTFWeeks1.DisplayDate := GotoDatePicker.Date; +end; + +procedure TPhotoOpMain.GotoDatePickerUserInput(Sender: TObject; + const UserString: String; var DateAndTime: TDateTime; + var AllowChange: Boolean); +begin + AllowChange := True; + GotoDatePicker.OnChange(nil); +end; + +procedure TPhotoOpMain.TimeIncComboChange(Sender: TObject); +begin + Case TimeIncCombo.ItemIndex of + 0 : JvTFDays1.Granularity := 60; + 1 : JvTFDays1.Granularity := 30; + 2 : JvTFDays1.Granularity := 20; + 3 : JvTFDays1.Granularity := 15; + 4 : JvTFDays1.Granularity := 12; + 5 : JvTFDays1.Granularity := 10; + 6 : JvTFDays1.Granularity := 6; + 7 : JvTFDays1.Granularity := 5; + 8 : JvTFDays1.Granularity := 4; + 9 : JvTFDays1.Granularity := 3; + 10 : JvTFDays1.Granularity := 2; + 11 : JvTFDays1.Granularity := 1; + End; +end; + +procedure TPhotoOpMain.NewApptButtonClick(Sender: TObject); +begin + // Simply open the EditAppt window. The Appt var of the + // EditAppt form will already be nil (which indicates + // that the appoinment is being created). + ApptEdit.ShowModal; +end; + +procedure TPhotoOpMain.EditApptButtonClick(Sender: TObject); +begin + If Assigned(JvTFDays1.SelAppt) Then + Begin + // Set EditAppt's Appt var to the selected appointment to + // indicate that the appointment should be edited. + ApptEdit.Appt := JvTFDays1.SelAppt; + ApptEdit.ShowModal; + End + Else + MessageDlg('Please select an appointment to edit.', mtInformation, + [mbOK], 0); +end; + +procedure TPhotoOpMain.DeleteApptButtonClick(Sender: TObject); +var + Appt : TJvTFAppt; + dbDel : Boolean; + SelSchedName : String; +begin + // This routine employs a simple business that asks the user what to + // do in the case where the user is attempting to delete a shared appt. + // NOTE: This is NOT required. You are completely free to implement + // any business rules you see fit. + + // Another shortcut to save typing + Appt := JvTFDays1.SelAppt; + + If Assigned(Appt) Then + Begin + dbDel := True; + If Appt.Shared Then + If MessageDlg('This appointment is shared with other schedules.' + #13#10 + + 'Do you want to delete the appointment from ' + + 'all schedules?' + #13#10#13#10 + + 'Choose ''No'' to delete the appointment from the ' + + 'selected schedule only.' + #13#10 + + 'Choose ''All'' to delete the appointment from all schedules.', + mtConfirmation, [mbNo, mbAll], 0) = mrNo Then + Begin + // Don't delete the appointment, but remove it from the schedule + // of the selected resource. + dbDel := False; + + With JvTFDays1 do + Begin + SelSchedName := ''; + If ValidSelection and Cols[SelStart.X].Connected Then + SelSchedName := Cols[SelStart.X].Schedule.SchedName; + End; + + If SelSchedName <> '' Then + Appt.RemoveSchedule(SelSchedName) + Else + MessageDlg('No schedule is selected.' + #13#10 + + 'Could not remove appointment from schedule.', + mtInformation, [mbOK], 0); + End; + + If dbDel Then + If MessageDlg('Are you sure you want to delete the selected appointment?', + mtConfirmation, [mbYes, mbNo], 0) = mrYes Then + // Delete the appointment (removes it from the db) + // Note: Could substitute Appt.Delete; for the line below + JvTFDays1.ScheduleManager.dbDeleteAppt(JvTFDays1.SelAppt); + End + Else + MessageDlg('Please select an appointment to delete.', + mtInformation, [mbOK], 0); +end; + +procedure TPhotoOpMain.JvTFDays1DateChanging(Sender: TObject; + var NewDate: TDate); +begin + // Make sure all appts are posted before moving on. + JvTFDays1.ScheduleManager.PostAppts; +end; + +procedure TPhotoOpMain.JvTFDays1DateChanged(Sender: TObject); +begin + // Synchronize the tool bar + With JvTFDays1.Template do + If ActiveTemplate = agtLinear Then + GotoDatePicker.Date := LinearStartDate + Else + GotoDatePicker.Date := CompDate; +end; + +procedure TPhotoOpMain.JvTFDays1GranularityChanged(Sender: TObject); +begin + // Update the TimeIncCombo when the granularity is changed. + // (This can be done by <Ctrl> + <Insert> and <Ctrl> + <Delete>) + Case JvTFDays1.Granularity of + 60 : TimeIncCombo.ItemIndex := 0; + 30 : TimeIncCombo.ItemIndex := 1; + 20 : TimeIncCombo.ItemIndex := 2; + 15 : TimeIncCombo.ItemIndex := 3; + 12 : TimeIncCombo.ItemIndex := 4; + 10 : TimeIncCombo.ItemIndex := 5; + 6 : TimeIncCombo.ItemIndex := 6; + 5 : TimeIncCombo.ItemIndex := 7; + 4 : TimeIncCombo.ItemIndex := 8; + 3 : TimeIncCombo.ItemIndex := 9; + 2 : TimeIncCombo.ItemIndex := 10; + Else + TimeIncCombo.ItemIndex := 11; + End; +end; + +procedure TPhotoOpMain.JvTFDays1DblClick(Sender: TObject); +begin + With JvTFDays1 do + If ValidSelection Then + If Assigned(SelAppt) Then + EditApptButtonClick(nil) + Else + NewApptButtonClick(nil); +end; + +procedure TPhotoOpMain.FormShow(Sender: TObject); +var + ResName : String; +begin + // Initialize the date + //GotoDatePicker.Date := Date; + GotoDatePicker.Date := EncodeDate(2002, 1, 1); + + // Initialize the granularity + TimeIncCombo.ItemIndex := 1; // 30 mins + + // Initialize the mode + ModeCombo.ItemIndex := 0; // Single mode + DaysCombo.ItemIndex := 6; // One day + + // Populate the resource related controls + With SchedulesQuery do + try + Open; + First; + While not EOF do + Begin + ResName := SchedulesQuery.FieldByName('SchedName').AsString; + ResourceCombo.Items.Add(ResName); + VisibleResources.ResourcesCheckList.Items.Add(ResName); + Share.ResourcesCheckList.Items.Add(ResName); + Next; + End; + Close; + except + //on E:EDBEngineError do + on E: EDatabaseError do + begin + ShowMessageFmt('%s:'#13#10'Try moving the database to a shorter path.',[E.Message]); + Application.Terminate; + Exit; + end; + end; + + // Initialize the resource related controls + ResourceCombo.ItemIndex := 0; + VisibleResources.ResourcesCheckList.Checked[0] := True; + + // Initialize the comparative template + JvTFDays1.Template.CompNames.Add(VisibleResources.ResourcesCheckList.Items[0]); + + // Now run the events to synchronize JvTFDays, etc. + ResourceComboChange(nil); + DaysComboChange(nil); + ModeComboChange(nil); + GotoDatePicker.Date := EncodeDate(2002, 1, 1); + GotoDatePickerChange(nil); + TimeIncComboChange(nil); +end; + +procedure TPhotoOpMain.PrintButtonClick(Sender: TObject); +begin + (******************** wp: deactivated due to stack overflow ************ + With JvTFDaysPrinter1 do + Begin + // "Copy" the display properties from the JvTFDays control + SetProperties(JvTFDays1); + // Set gridline color to black for sharp display on printed page + GridLineColor := clBlack; + // print 48 rows on each page + PageLayout.RowsPerPage := 48; + // fit all the columns onto one page wide + PageLayout.ColsPerPage := 0; + // "Copy" the schedules from the JvTFDays control + Cols.Assign(JvTFDays1.Cols); + PrintProgress.Show; + Application.ProcessMessages; + // print the document + PrintDirect; + PrintProgress.Close; + End; + ************************) +end; + +procedure TPhotoOpMain.JvTFDaysPrinter1ApptProgress(Sender: TObject; + Current, Total: Integer); +begin + If Current > Total Then + Total := Current; + PrintProgress.Label2.Caption := 'Processing appointment ' + IntToStr(Current) + + ' of ' + IntToStr(Total) + ' (estimated)'; + PrintProgress.ProgressBar1.Max := Total; + PrintProgress.ProgressBar1.Position := Current; +end; + +procedure TPhotoOpMain.JvTFDaysPrinter1AssembleProgress(Sender: TObject; + Current, Total: Integer); +begin + PrintProgress.Label2.Caption := 'Assembling page ' + IntToStr(Current) + + ' of ' + IntToStr(Total); + PrintProgress.ProgressBar1.Max := Total; + PrintProgress.ProgressBar1.Position := Current; +end; + +procedure TPhotoOpMain.JvTFDaysPrinter1PrintProgress(Sender: TObject; + Current, Total: Integer); +begin + PrintProgress.Label2.Caption := 'Printing page ' + IntToStr(Current) + + ' of ' + IntToStr(Total); + PrintProgress.ProgressBar1.Max := Total; + PrintProgress.ProgressBar1.Position := Current; +end; + +procedure TPhotoOpMain.Label2Click(Sender: TObject); +begin + OpenURL('https://icons8.com'); +end; + +procedure TPhotoOpMain.Label2MouseEnter(Sender: TObject); +begin + Label2.Font.Style := Label2.Font.Style + [fsUnderline]; + Screen.Cursor := crHandPoint; +end; + +procedure TPhotoOpMain.Label2MouseLeave(Sender: TObject); +begin + Label2.Font.Style := Label2.Font.Style - [fsUnderline]; + Screen.Cursor := crDefault; +end; + +procedure TPhotoOpMain.utfScheduleManager1LoadBatch(Sender: TObject; + BatchName: String; BatchStartDate, BatchEndDate: TDate); +var + Appt : TJvTFAppt; + NewAppt : Boolean; +begin + With NeedApptsQuery do + Begin + // Set the query parameters so the query will return + // all appointments for the given resource that fall + // on the given date. + ParamByName('D1').AsDate := BatchStartDate; + ParamByName('D2').AsDate := BatchEndDate; + ParamByName('SchedName').AsString := BatchName; + + // Next, loop through the returned records to add the data + Open; + First; + While not EOF do + Begin + // Request an appointment object from the server + utfScheduleManager1.RequestAppt(FieldByName('ApptID').AsString, + Appt, NewAppt); + + // If it is a newly loaded appt we want to set its properties + If NewAppt Then + Begin + Appt.SetStartEnd(FieldByName('StartDate').AsDateTime, + FieldByName('StartTime').AsDateTime, + FieldByName('EndDate').AsDateTime, + FieldByName('EndTime').AsDateTime); + Appt.Description := FieldByName('Description').AsString; + Appt.AlarmEnabled := FieldByName('AlarmEnabled').AsBoolean; + Appt.AlarmAdvance := FieldByName('AlarmAdvance').AsInteger; + + // Now manage the Appt --> Schedule(s) relationship + With ApptSchedulesQuery do + Begin + ParamByName('ApptID').AsString := Appt.ID; + Open; + First; + While not EOF do + Begin + Appt.AddSchedule(FieldByName('SchedName').AsString); + Next; + End; + Close; // ApptSchedulesQuery + End; + End; + Next; // NeedApptsQuery record + End; + Close; // NeedApptsQuery + End; +end; + +procedure TPhotoOpMain.FormCreate(Sender: TObject); +var + fn: String; +begin + fn := Application.Location + 'data.sqlite'; + dbUTF.DatabaseName := fn; + dbUTF.Connected := FileExists(fn); +end; + +end. + diff --git a/components/jvcllaz/examples/JvTimeFramework/tfprintprogress.lfm b/components/jvcllaz/examples/JvTimeFramework/tfprintprogress.lfm new file mode 100644 index 000000000..b98621532 --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfprintprogress.lfm @@ -0,0 +1,78 @@ +object PrintProgress: TPrintProgress + Left = 613 + Height = 161 + Top = 250 + Width = 367 + BorderIcons = [] + BorderStyle = bsSingle + Caption = 'Print Progress' + ClientHeight = 161 + ClientWidth = 367 + Color = clBtnFace + Font.Color = clWindowText + FormStyle = fsStayOnTop + OnShow = FormShow + Position = poScreenCenter + LCLVersion = '2.1.0.0' + Scaled = False + object Label1: TLabel + AnchorSideLeft.Control = Owner + AnchorSideTop.Control = Owner + AnchorSideRight.Control = Owner + AnchorSideRight.Side = asrBottom + Left = 16 + Height = 33 + Top = 16 + Width = 335 + Anchors = [akTop, akLeft, akRight] + AutoSize = False + BorderSpacing.Left = 16 + BorderSpacing.Top = 16 + BorderSpacing.Right = 16 + Caption = 'Generating Report. This may take a while. Please be patient.' + ParentColor = False + WordWrap = True + end + object Label2: TLabel + AnchorSideLeft.Control = Label1 + AnchorSideTop.Control = Label1 + AnchorSideTop.Side = asrBottom + AnchorSideRight.Control = Label1 + AnchorSideRight.Side = asrBottom + Left = 16 + Height = 16 + Top = 49 + Width = 335 + Alignment = taCenter + Anchors = [akTop, akLeft, akRight] + AutoSize = False + Caption = 'Processing...' + ParentColor = False + end + object ProgressBar1: TProgressBar + AnchorSideLeft.Control = Label1 + AnchorSideTop.Side = asrBottom + AnchorSideRight.Control = Label1 + AnchorSideRight.Side = asrBottom + Left = 16 + Height = 20 + Top = 80 + Width = 335 + Anchors = [akTop, akLeft, akRight] + Max = 200 + TabOrder = 0 + end + object CancelButton: TBitBtn + AnchorSideLeft.Control = Owner + AnchorSideLeft.Side = asrCenter + Left = 142 + Height = 26 + Top = 120 + Width = 82 + AutoSize = True + Caption = 'Cancel' + Kind = bkCancel + OnClick = CancelButtonClick + TabOrder = 1 + end +end diff --git a/components/jvcllaz/examples/JvTimeFramework/tfprintprogress.pas b/components/jvcllaz/examples/JvTimeFramework/tfprintprogress.pas new file mode 100644 index 000000000..6803d16f4 --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfprintprogress.pas @@ -0,0 +1,69 @@ +{****************************************************************** + + JEDI-VCL Demo + + Copyright (C) 2002 Project JEDI + + Original author: + + Contributor(s): + + You may retrieve the latest version of this file at the JEDI-JVCL + home page, located at http://jvcl.delphi-jedi.org + + The contents of this file are used with permission, subject to + the Mozilla Public License Version 1.1 (the "License"); you may + not use this file except in compliance with the License. You may + obtain a copy of the License at + http://www.mozilla.org/MPL/MPL-1_1Final.html + + Software distributed under the License is distributed on an + "AS IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or + implied. See the License for the specific language governing + rights and limitations under the License. + +******************************************************************} + +unit tfPrintProgress; + +interface + +uses + Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, + StdCtrls, Buttons, ComCtrls; + +type + TPrintProgress = class(TForm) + Label1: TLabel; + Label2: TLabel; + ProgressBar1: TProgressBar; + CancelButton: TBitBtn; + procedure CancelButtonClick(Sender: TObject); + procedure FormShow(Sender: TObject); + private + { Private declarations } + public + { Public declarations } + end; + +var + PrintProgress: TPrintProgress; + +implementation + +uses tfMain; + +{$R *.lfm} + +procedure TPrintProgress.CancelButtonClick(Sender: TObject); +begin +// PhotoOpMain.JvTFDaysPrinter1.AbortPrint; +end; + +procedure TPrintProgress.FormShow(Sender: TObject); +begin + ProgressBar1.Position := 0; + Label2.Caption := 'Processing...'; +end; + +end. diff --git a/components/jvcllaz/examples/JvTimeFramework/tfshare.lfm b/components/jvcllaz/examples/JvTimeFramework/tfshare.lfm new file mode 100644 index 000000000..9f6f8be31 --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfshare.lfm @@ -0,0 +1,44 @@ +object Share: TShare + Left = 738 + Top = 285 + Width = 271 + Height = 216 + Caption = 'Share' + Color = clBtnFace + Font.Charset = DEFAULT_CHARSET + Font.Color = clWindowText + Font.Height = -13 + Font.Name = 'MS Sans Serif' + Font.Style = [] + OldCreateOrder = True + Position = poScreenCenter + Scaled = False + OnClose = FormClose + OnShow = FormShow + PixelsPerInch = 96 + TextHeight = 16 + object ResourcesCheckList: TCheckListBox + Left = 16 + Top = 8 + Width = 225 + Height = 129 + ItemHeight = 16 + TabOrder = 0 + end + object OKButton: TBitBtn + Left = 40 + Top = 152 + Width = 75 + Height = 25 + TabOrder = 1 + Kind = bkOK + end + object CancelButton: TBitBtn + Left = 152 + Top = 152 + Width = 75 + Height = 25 + TabOrder = 2 + Kind = bkCancel + end +end diff --git a/components/jvcllaz/examples/JvTimeFramework/tfshare.pas b/components/jvcllaz/examples/JvTimeFramework/tfshare.pas new file mode 100644 index 000000000..948187212 --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfshare.pas @@ -0,0 +1,114 @@ +{****************************************************************** + + JEDI-VCL Demo + + Copyright (C) 2002 Project JEDI + + Original author: + + Contributor(s): + + You may retrieve the latest version of this file at the JEDI-JVCL + home page, located at http://jvcl.delphi-jedi.org + + The contents of this file are used with permission, subject to + the Mozilla Public License Version 1.1 (the "License"); you may + not use this file except in compliance with the License. You may + obtain a copy of the License at + http://www.mozilla.org/MPL/MPL-1_1Final.html + + Software distributed under the License is distributed on an + "AS IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or + implied. See the License for the specific language governing + rights and limitations under the License. + +******************************************************************} + +unit tfShare; + +interface + +uses + Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, + StdCtrls, Buttons, checklst; + +type + TShare = class(TForm) + ResourcesCheckList: TCheckListBox; + OKButton: TBitBtn; + CancelButton: TBitBtn; + procedure FormShow(Sender: TObject); + procedure FormClose(Sender: TObject; var TheAction: TCloseAction); + private + { Private declarations } + public + { Public declarations } + end; + +var + Share: TShare; + +implementation + +uses + tfMain, JvTFManager; + +{$R *.lfm} + +procedure TShare.FormShow(Sender: TObject); +var + Appt : TJvTFAppt; + I : Integer; +begin + // First, get the selected appointment + Appt := PhotoOpMain.JvTFDays1.SelAppt; + + // now roll through the resource list and check all resources + // that are found in the appointment's list of schedules. + With ResourcesCheckList do + For I := 0 to Items.Count - 1 do + Checked[I] := Appt.IndexOfSchedule(Items[I]) > -1; +end; + +procedure TShare.FormClose(Sender: TObject; var TheAction: TCloseAction); +var + TempList : TStringList; + I : Integer; +begin + If ModalResult = mrOK Then + Begin + // create and populate a temporary list of the selected resources + // from the checklistbox. + TempList := TStringList.Create; + Try + With ResourcesCheckList do + For I := 0 to Items.Count - 1 do + If Checked[I] Then + TempList.Add(Items[I]); + + // Enforce a business rule where removing all resources from an + // appointment causes the appointment to be deleted. + // NOTE: This is NOT a requirement. Feel free to implement any + // business rules as you see fit. + If TempList.Count > 0 Then + // If at least one resource then change the appointment's + // schedule list to match the temp list. + PhotoOpMain.JvTFDays1.SelAppt.AssignSchedules(TempList) + Else + If MessageDlg('You have removed this appointment from all schedules.' + + ' This will cause the appointment to be deleted.' + #13#10 + + 'Are you sure this is what you want to do?', + mtConfirmation, [mbYes, mbNo], 0) = mrYes Then + With PhotoOpMain.JvTFDays1 do + // Delete the appointment if that is what the user wants to do. + ScheduleManager.dbDeleteAppt(SelAppt) + Else + TheAction := caNone; + + Finally + TempList.Free; + End; + End; +end; + +end. diff --git a/components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.lfm b/components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.lfm new file mode 100644 index 000000000..d628ce7ae --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.lfm @@ -0,0 +1,53 @@ +object VisibleResources: TVisibleResources + Left = 707 + Height = 205 + Top = 215 + Width = 271 + Caption = 'Visible Resources' + ClientHeight = 205 + ClientWidth = 271 + Font.Color = clWindowText + OnClose = FormClose + OnShow = FormShow + Position = poScreenCenter + LCLVersion = '2.1.0.0' + Scaled = False + object ResourcesCheckList: TCheckListBox + AnchorSideLeft.Control = Owner + AnchorSideTop.Control = Owner + AnchorSideRight.Control = Owner + AnchorSideRight.Side = asrBottom + Left = 16 + Height = 129 + Top = 16 + Width = 239 + Anchors = [akTop, akLeft, akRight] + BorderSpacing.Left = 16 + BorderSpacing.Top = 16 + BorderSpacing.Right = 16 + ItemHeight = 0 + TabOrder = 0 + end + object OKButton: TBitBtn + AnchorSideLeft.Control = ResourcesCheckList + Left = 40 + Height = 25 + Top = 160 + Width = 75 + BorderSpacing.Left = 24 + Kind = bkOK + TabOrder = 1 + end + object CancelButton: TBitBtn + AnchorSideRight.Control = ResourcesCheckList + AnchorSideRight.Side = asrBottom + Left = 156 + Height = 25 + Top = 160 + Width = 75 + Anchors = [akTop, akRight] + BorderSpacing.Right = 24 + Kind = bkCancel + TabOrder = 2 + end +end diff --git a/components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.pas b/components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.pas new file mode 100644 index 000000000..3f86966ca --- /dev/null +++ b/components/jvcllaz/examples/JvTimeFramework/tfvisibleresources.pas @@ -0,0 +1,94 @@ +{****************************************************************** + + JEDI-VCL Demo + + Copyright (C) 2002 Project JEDI + + Original author: + + Contributor(s): + + You may retrieve the latest version of this file at the JEDI-JVCL + home page, located at http://jvcl.delphi-jedi.org + + The contents of this file are used with permission, subject to + the Mozilla Public License Version 1.1 (the "License"); you may + not use this file except in compliance with the License. You may + obtain a copy of the License at + http://www.mozilla.org/MPL/MPL-1_1Final.html + + Software distributed under the License is distributed on an + "AS IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or + implied. See the License for the specific language governing + rights and limitations under the License. + +******************************************************************} + +unit tfVisibleResources; + +{$mode objfpc}{$H+} + +interface + +uses + Windows, Messages, SysUtils, Classes, Graphics, Controls, Forms, Dialogs, + StdCtrls, Buttons, checklst; + +type + TVisibleResources = class(TForm) + ResourcesCheckList: TCheckListBox; + OKButton: TBitBtn; + CancelButton: TBitBtn; + procedure FormShow(Sender: TObject); + procedure FormClose(Sender: TObject; var TheAction: TCloseAction); + private + { Private declarations } + public + { Public declarations } + end; + +var + VisibleResources: TVisibleResources; + +implementation + +Uses tfMain; + +{$R *.lfm} + +procedure TVisibleResources.FormShow(Sender: TObject); +var + I : Integer; +begin + // Check the template and check any resources currently + // visible in the grid + With PhotoOpMain.JvTFDays1.Template do + For I := 0 to ResourcesCheckList.Items.Count - 1 do + ResourcesCheckList.Checked[I] := + CompNames.IndexOf(ResourcesCheckList.Items[I]) > -1; +end; + +procedure TVisibleResources.FormClose(Sender: TObject; + var TheAction: TCloseAction); +var + I : Integer; +begin + If ModalResult = mrOK Then + begin + // First, clear the old resources from the template + PhotoOpMain.JvTFDays1.Template.CompNames.Clear; + PhotoOpMain.JvTFWeeks1.SchedNames.Clear; + PhotoOpMain.JvTFMonths1.SchedNames.Clear; + + // Next, add the new resources to the template + For I := 0 to ResourcesCheckList.Items.Count - 1 do + If ResourcesCheckList.Checked[I] Then + begin + PhotoOpMain.JvTFDays1.Template.CompNames.Add(ResourcesCheckList.Items[I]); + PhotoOpMain.JvTFWeeks1.SchedNames.Add(ResourcesCheckList.Items[I]); + PhotoOpMain.JvTFMonths1.SchedNames.Add(ResourcesCheckList.Items[I]); + end; + end; +end; + +end. diff --git a/components/jvcllaz/packages/jvcl_all.lpk b/components/jvcllaz/packages/jvcl_all.lpk index e22ab069a..25eb382e8 100644 --- a/components/jvcllaz/packages/jvcl_all.lpk +++ b/components/jvcllaz/packages/jvcl_all.lpk @@ -11,55 +11,60 @@ <UnitOutputDirectory Value="lib\$(TargetCPU)-$(TargetOS)"/> </SearchPaths> </CompilerOptions> - <RequiredPkgs Count="16"> + <Description Value="A meta package for simple installation of all JVCL designtime packages."/> + <Version Major="1" Release="6"/> + <RequiredPkgs Count="17"> <Item1> - <PackageName Value="JvXPCtrlsLazD"/> + <PackageName Value="JvTimeFrameworkLazD"/> </Item1> <Item2> - <PackageName Value="JvWizardLazD"/> + <PackageName Value="JvXPCtrlsLazD"/> </Item2> <Item3> - <PackageName Value="JvValidatorsLazD"/> + <PackageName Value="JvWizardLazD"/> </Item3> <Item4> - <PackageName Value="JvRuntimeDesignLazD"/> + <PackageName Value="JvValidatorsLazD"/> </Item4> <Item5> - <PackageName Value="JvPageCompsD"/> + <PackageName Value="JvRuntimeDesignLazD"/> </Item5> <Item6> - <PackageName Value="JvNetLazD"/> + <PackageName Value="JvPageCompsD"/> </Item6> <Item7> - <PackageName Value="JvMMLazD"/> + <PackageName Value="JvNetLazD"/> </Item7> <Item8> - <PackageName Value="JvJansLazD"/> + <PackageName Value="JvMMLazD"/> </Item8> <Item9> - <PackageName Value="JvStdCtrlsLazD"/> + <PackageName Value="JvJansLazD"/> </Item9> <Item10> - <PackageName Value="JvHMILazD"/> + <PackageName Value="JvStdCtrlsLazD"/> </Item10> <Item11> - <PackageName Value="JvDBLazD"/> + <PackageName Value="JvHMILazD"/> </Item11> <Item12> - <PackageName Value="JvCustomLazD"/> + <PackageName Value="JvDBLazD"/> </Item12> <Item13> - <PackageName Value="JvCtrlsLazD"/> + <PackageName Value="JvCustomLazD"/> </Item13> <Item14> - <PackageName Value="JvAppFrmLazD"/> + <PackageName Value="JvCtrlsLazD"/> </Item14> <Item15> - <PackageName Value="JvCmpD"/> + <PackageName Value="JvAppFrmLazD"/> </Item15> <Item16> - <PackageName Value="JvCoreLazD"/> + <PackageName Value="JvCmpD"/> </Item16> + <Item17> + <PackageName Value="JvCoreLazD"/> + </Item17> </RequiredPkgs> <UsageOptions> <UnitPath Value="$(PkgOutDir)"/> diff --git a/components/jvcllaz/packages/jvcllaz_all.lpg b/components/jvcllaz/packages/jvcllaz_all.lpg index af59c9061..38089f022 100644 --- a/components/jvcllaz/packages/jvcllaz_all.lpg +++ b/components/jvcllaz/packages/jvcllaz_all.lpg @@ -1,7 +1,7 @@ <?xml version="1.0" encoding="UTF-8"?> <CONFIG> <ProjectGroup FileVersion="1"> - <Targets Count="32"> + <Targets Count="34"> <Target0 FileName="jvcorelazr.lpk"/> <Target1 FileName="jvcorelazd.lpk"/> <Target2 FileName="jvctrlslazr.lpk"/> @@ -34,6 +34,8 @@ <Target29 FileName="jvwizardlazd.lpk"/> <Target30 FileName="jvxpctrlslazr.lpk"/> <Target31 FileName="jvxpctrlslazd.lpk"/> + <Target32 FileName="jvtimeframeworklazr.lpk"/> + <Target33 FileName="jvtimeframeworklazd.lpk"/> </Targets> </ProjectGroup> </CONFIG> diff --git a/components/jvcllaz/packages/jvtimeframeworklazd.lpk b/components/jvcllaz/packages/jvtimeframeworklazd.lpk new file mode 100644 index 000000000..efcafcbf4 --- /dev/null +++ b/components/jvcllaz/packages/jvtimeframeworklazd.lpk @@ -0,0 +1,46 @@ +<?xml version="1.0" encoding="UTF-8"?> +<CONFIG> + <Package Version="4"> + <PathDelim Value="\"/> + <Name Value="JvTimeFrameworkLazD"/> + <Type Value="RunAndDesignTime"/> + <Author Value="Original author: Mike Kolter, Lazarus port by W.Pamler"/> + <CompilerOptions> + <Version Value="11"/> + <PathDelim Value="\"/> + <SearchPaths> + <OtherUnitFiles Value="..\design\JvTimeFramework"/> + <UnitOutputDirectory Value="..\lib\$(TargetCPU)-$(TargetOS)\design\JvTimeFramework"/> + </SearchPaths> + </CompilerOptions> + <Description Value="Designtime package of the JVCL "time framework" components: Planners, calendars, Gantt"/> + <License Value="The JVCL is released in accordance with the MPL 1.1 license. To get your own copy or read it, go to http://www.mozilla.org/MPL/MPL-1.1.html. "/> + <Version Major="1" Release="6"/> + <Files Count="1"> + <Item1> + <Filename Value="..\design\JvTimeFramework\jvtimeframeworkreg.pas"/> + <HasRegisterProc Value="True"/> + <AddToUsesPkgSection Value="False"/> + <UnitName Value="JvTimeFrameworkReg"/> + </Item1> + </Files> + <RequiredPkgs Count="3"> + <Item1> + <PackageName Value="JvCoreLazD"/> + </Item1> + <Item2> + <PackageName Value="IDEIntf"/> + </Item2> + <Item3> + <PackageName Value="JvTimeFrameworkLazR"/> + </Item3> + </RequiredPkgs> + <UsageOptions> + <UnitPath Value="$(PkgOutDir)"/> + </UsageOptions> + <PublishOptions> + <Version Value="2"/> + <UseFileFilters Value="True"/> + </PublishOptions> + </Package> +</CONFIG> diff --git a/components/jvcllaz/packages/jvtimeframeworklazr.lpk b/components/jvcllaz/packages/jvtimeframeworklazr.lpk new file mode 100644 index 000000000..ea823fd41 --- /dev/null +++ b/components/jvcllaz/packages/jvtimeframeworklazr.lpk @@ -0,0 +1,73 @@ +<?xml version="1.0" encoding="UTF-8"?> +<CONFIG> + <Package Version="4"> + <PathDelim Value="\"/> + <Name Value="JvTimeFrameworkLazR"/> + <Author Value="Original author: Mike Kolter, Lazarus port by W.Pamler"/> + <CompilerOptions> + <Version Value="11"/> + <PathDelim Value="\"/> + <SearchPaths> + <OtherUnitFiles Value="..\run\JvTimeFramework"/> + <UnitOutputDirectory Value="..\lib\$(TargetCPU)-$(TargetOS)\run\JvTimeFramework"/> + </SearchPaths> + </CompilerOptions> + <Description Value="Runtime package of the JVCL "time framework" components: Planners, calendars, Gantt"/> + <License Value="The JVCL is released in accordance with the MPL 1.1 license. To get your own copy or read it, go to http://www.mozilla.org/MPL/MPL-1.1.html. "/> + <Version Major="1" Release="6"/> + <Files Count="10"> + <Item1> + <Filename Value="..\run\JvTimeFramework\jvtfsparsematrix.pas"/> + <UnitName Value="JvTFSparseMatrix"/> + </Item1> + <Item2> + <Filename Value="..\run\JvTimeFramework\jvtfutils.pas"/> + <UnitName Value="JvTFUtils"/> + </Item2> + <Item3> + <Filename Value="..\run\JvTimeFramework\jvtfglance.pas"/> + <UnitName Value="JvTFGlance"/> + </Item3> + <Item4> + <Filename Value="..\run\JvTimeFramework\jvtfmanager.pas"/> + <UnitName Value="JvTFManager"/> + </Item4> + <Item5> + <Filename Value="..\run\JvTimeFramework\jvtfmonths.pas"/> + <UnitName Value="JvTFMonths"/> + </Item5> + <Item6> + <Filename Value="..\run\JvTimeFramework\jvtfweeks.pas"/> + <UnitName Value="JvTFWeeks"/> + </Item6> + <Item7> + <Filename Value="..\run\JvTimeFramework\jvtfdays.pas"/> + <UnitName Value="JvTFDays"/> + </Item7> + <Item8> + <Filename Value="..\run\JvTimeFramework\jvtfalarm.pas"/> + <UnitName Value="JvTFAlarm"/> + </Item8> + <Item9> + <Filename Value="..\run\JvTimeFramework\jvtfgantt.pas"/> + <UnitName Value="JvTFGantt"/> + </Item9> + <Item10> + <Filename Value="..\run\JvTimeFramework\jvtfglancetextviewer.pas"/> + <UnitName Value="JvTFGlanceTextViewer"/> + </Item10> + </Files> + <RequiredPkgs Count="1"> + <Item1> + <PackageName Value="JvCoreLazR"/> + </Item1> + </RequiredPkgs> + <UsageOptions> + <UnitPath Value="$(PkgOutDir)"/> + </UsageOptions> + <PublishOptions> + <Version Value="2"/> + <UseFileFilters Value="True"/> + </PublishOptions> + </Package> +</CONFIG> diff --git a/components/jvcllaz/resource/jvtimeframeworkreg.res b/components/jvcllaz/resource/jvtimeframeworkreg.res new file mode 100644 index 0000000000000000000000000000000000000000..85a96ecfd3ce3bb3e6a85d39c4507c579bb5b64b GIT binary patch literal 17028 zcmeI(y^bVF5y0_Sj2$E#Bpl2zF%d#qhn<cUEXU`8I6l2Fd5n0JFh)E_ct|`0Mm_@W zup^p(X4Y5t&Vp|5KnQhp|2q4kva&uVyJEAdPDDg;K2LnTnEv=u<hw-9=dZ}G<tOr6 zK7S~0<Y)Mm{CunX^{;PV<y(CH=Hi8Xb<D7@h<xX3le{3*jVVNUOT;Yr<f~Mb)L%>f z_Lo1gfd&UNG*M_GCQ$Ij9DzikiMT*v;6FT&D70n0N@;Ke5``whS4oAz5l9po8!1p2 z9DzikiSU-DFgOB<LK71<QxyH>2qX$^?wTs4!4XIl+T3kZN`oViD71M<TqzBXK%&s* z;R>ZRI0A`6n};%$(%=Xr3T+<dQc8m(kSMhAC$OfJ21g)KXcFvyh@$VgqrVb`CZPg_ z!4XIl+WfPbQW_kAM4`<;sVk+y5l9r;{ByIC2!kV#D74uXQYj6NK%&rQHz}nwI0A`6 z8(k=xQW_kAM4?Hs|0N28BarB?HoKN8rNI$M6x!@|rj!OpAW>+uOS)1T9Dzik&F&gX zX>bG*g*Ll#Dy6{@NEF)a=B1PdM<C^I@6Pf-y`VkL9OK<jFnj~AajrSbpYIRT>({UU z@p4Y*F|G4P{M|cd-Sz3b#_y?5l=tJ~<1v1}#;@uVXL`2&jDN2B?{CljKbC23&uQDx z`}>E{^lblhnDKB&-9EAXCuVSfn6B%e#=$#}_^dwb6CRUXw!eh?LKp4Nc>g56P3KcT zx%WQ`f0g&^kA<%4_m!^k>+KosTyD>4-Tu?*qJ4IF>@MZS_VC~9bX|Xs_wDbw>Dx4M znVWtfZ{!d1*=SnimX}=kF(XlE<Q{>-;0PoNO-uxe{&EBog+}fXC=8B3qR_}a0)@d5 zNE8~mN1!k`0*OK+_XrdQM<7vX<Q{>-;0PoNjoc$p7#x8_p^<w83WFn%C^TX9Q1m@_ z^jD(L$UOpu!4XIl8o5WHFgOB<LL>JG6b45iQD~eu1qy>BkSH{Ak3eB?1QLZt?hz;q zjzFT&$UOpu!4XIlny@$&21g*#Uya-&P#7G6M4^#;1PX&AkSH{Ak3eB?1QLZdyK5+= z!4XIl+U&}ylm<s2QE0Q9mr@!WfiIAkp5}Boq4Slz^z`)Z9kVXu<fSK~ybmY(QDuu? z&7hrG|CkzB;t;=B;ut^97;&09oqD3%r!_Cl(=C78eR|1mygtdDoX+Q`r+#7|lf3Nv zcaoPv@agI97{A}^-}Mb={!_1if4|qij*s@w=V$9vcea0M=Z^LEc>lO=|GD_u{>65( zJ$L(_&Tq?h-rX(#m{`)_-2PYBwR<XNdi83}J9|0f&(G+2$!P2Oy!1=PO+S`T8ArY4 z+dAFylnXy@BnnN0_bpE;ImzG%BnnM}!*k11DjW?s0*U@=<RXE>;0PoNja(#97#x8_ zp^=LO3WFn%D74vKLn#f8K%&rQS5BogI0A`6o87#W(%=YufjqUG^6&3oFpX0eAFqXR z&lo@5-}is5uQTMlj+0LJJ-E!^thL2Yd%XX<ejPuZ{zd%7i^s9ze)c=mXT4)^GsX=g z&bD%XKCiFQ{*tH|FRbCau|S_GJs%yWKBK=!o;uWLi9Yomr~Svfzwb?*mqT*VKC|ap zzUQy2X|2y`zi+~r*2>K5*<cK6$EbFxyv5i0dxl=?&n?`O{ftw;?@#}ai}iAlXupTo z89nQa?U5zC%;<S)?!l-$K6+EHK9Inkzqa?uxVHDHe4qR@r(14v;RlUGq1|#5hu}7b zQpQULM<7vXLN9^B;0Pr8tC4>M3WFn%C^YhqKw)qM5`{+o5hx6fK%&rQcMYX9I0A`6 zn_W4T(%=Xr3T<}tQc8m(@MYwt<>WSs{o3BhO>1i6+`Z+XJq3*=J{%{ZaBZ)rrai|o zhUz(S#@Ey8(#{?q>1^4oEjOJGsgl&SjiKhLb=L0Z>zRUHpC0yUoSXaUoZLh=*ru5g z<`T2cLl4cb{gd2sjE_(c_xKo{J@n5}WquI9TJ09^EuTmGV}a2YTYYGUc1L3)qaE6z z#j(j_A4hvjJ9BFvW_;hC^W3T>zHiU`CQE#bwC16hUmwQbV>>w87Y;CM=(*`f#4g8B z$K2G%Prqjr^;<?$Z{>GbM^m?a<-(5~i9);OD-OXeUn#lC;0PoNP3R?17#x8_e>HNF zKw)qM5`{)i5-1FgK%&sdNdkqz5l9r;?5?4d21g)KXtOJ)QW_kAM4`=YUP@_j1pbrx zYMchwk3C<lk)_=7)kXF><fZi=^;`WVFU`~7*4mcGdj8p>OFJym!^auV=BstNe$8*0 z*3c}M_`E81oHgo?%W+(lJI<h)yMBd^>3p2g!%QPf9A|t?oSfI&VFml1@2l-A-uJw3 z&)gg~wD04xvHk0E8FPf!8RH7x+}~cMPh*J>44FRXSnB8Ui*cpzN4NV?{5Clepq~f= zi9);OCJw<ZHz|3@;0PoNP3R?17#x8_e>L)tKw)qM5`{LqohhZk5l9r;?2@jO21g)K zXtTS9QW_kAM4`>DoJwhM1QLZdyLl<4!4dcZxoJ7U9nZu4ehv43{zvaeZKu_-$$M_P z9xOaOup5`x`S{y2F^K5#F`{7@vcAXQ;zMz+=RGktIlOuBp>M$Ha<J3KJ4<|Td9GrO z9~<HOf2o~U(i79ze?G_ev7OJ{ry5D?UtQ<>9?e{ir9PE6W9;+^<*&(8>*(qB%mhDr z;fIYxq1|#6hv1f@lze1x1QLZN^b#lxjzFTn8hJ>dFgOB<LL(0e6b45iQE0PEx>6b( zfkdIr?ixyIa0C*CHoI~vrNI$M6x!_OrIZFo;G=SsaI0o}mT%8d{UX-!df&yI=f+Rt zy43sQr{2!9<EL@c=QvK<*KkpP{ipw!y<hM9P>$;Hae94xF}8@s*uQ?~rDJ3IG*>mg zatmfGag1{lj@t8X4L91>c35t0hebwwEXDk*IOp#E-f#F&oBG7YB;#IGUoFi%J}%+D z#Ei`uFJ`=d9^?I{Q4e){d~85(d@OVkpR1km?FopngIhcMGZVc@=8bmPuPsN7_Luur z9KGkS_kAYc=PKY^`GNd~yHam?-uw;YsW<Wo-#=fz`UcOQcfvs%#(@qI-okHX6nyfP zeqXm|&z1ANDh!T5qR_-lpfETBi9!=XP#7G6M4<`Qp)fcCi9!>ag2LbkBnnMf4HO1P zAW>-KDuKe_2qX$kSUnU5M}H*>jpz6T3WFn%C^QKZC=8B3qR=E<pfETBi9#FwELcg< zP*6D{kSH|aD-;GtAW>*SH7E>@K%&sdNdkqz5l9r8us9S3M<CH(jhrM<7#x8_p^=jW z3WFn%C^T}CKw)qM5`{)i5-1FgK%&sdNdkqz5l9pozfpn0;0SzFz8dHAH4n@a`TF^M zzGCh(`D*;re0%nMOEQcudTWQgG#VcxpUe2X@N~bnvtI|CGY;{K>wQaneRg7=@W(pV z6^${~k_grrEX8}d-Y0#UwU_zhdf#@^Ubd;vqnUBy?}=flJBlsb7dp&X<9(s4_z3l| zj2)c&vD6>yAVtv9JbqX4IdEj|vOS}%v5Q;%u>|oob<Oriz8d?x9FXM?^)c7`-oHQf z8?w`n8CCV{^qKVkOX|6&{ciWCT=<bAQE0dE6^G!Kuaw+ma0C*CCiD_0430pezZyA7 zpfETBi9#bM2^0oLAW>-KB!R-<2qX$^cGpl!gCmeAwAqzYDGiQ5qR?hHFQqg%0$+N* zdL+**&-xus!aNbNjiWBY_j`QFKFsb<Vf1$9a}!%48xLn3<8z7rs38yi?e+OXF`XHP z^l8L<zS^Gkd+ZP7J#N<k_h<e3jPVfS<K;C#o*O@p_{dj#eWJbo*siN*{dfXod6tB1 zwLbv3wbQQwUQNq!=~-bU9}?3sVa@p1GoHrV58`G0{UEOO$!<*BL0q00>}@ZZ>0-VA z?PvY^Qxk9Hr`z4B+qFM_?7|Nki9);OCJw<ZHz|3@;0PoNP3R?17#x8_e>L)tKw)qM z5`{+o5hx6fK%&rQmvp5xI0A`6o82{((%=Xr3T<}fR7!&*kSMg-%}Xf_j=&elP5;05 zr^Z<Ez1(rQKh@L5^0-_-$@f9WxIZ=HJSjIuF6(`z5xuV8?@ulD*7D!g|4=(0im&ai M<;S)EW!<0pCrF~`P5=M^ literal 0 HcmV?d00001 diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfalarm.pas b/components/jvcllaz/run/JvTimeFramework/jvtfalarm.pas new file mode 100644 index 000000000..7fb65c006 --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfalarm.pas @@ -0,0 +1,342 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFAlarm.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFAlarm; + +{$mode objfpc}{$H+} + +interface + +uses + SysUtils, Classes, Controls, ExtCtrls, + JvTFManager; + +type + TJvTFAlarm = class; + + TJvTFAlarmInfo = class(TObject) + private + FAppt: TJvTFAppt; + FSnoozeMins: Integer; + FDismiss: Boolean; + FNextAlarmTime: TTime; + protected + property NextAlarmTime: TTime read FNextAlarmTime write FNextAlarmTime; + public + constructor Create(AAppt: TJvTFAppt); virtual; + property Appt: TJvTFAppt read FAppt; + property SnoozeMins: Integer read FSnoozeMins write FSnoozeMins; + property Dismiss: Boolean read FDismiss write FDismiss; + end; + + TJvTFAlarmList = class(TStringList) + private + FOwner: TJvTFAlarm; + public + procedure Clear; override; + function GetAlarmForAppt(AAppt: TJvTFAppt): TJvTFAlarmInfo; + function GetAlarmForApptID(const ID: string): TJvTFAlarmInfo; + function IndexOfAppt(AAppt: TJvTFAppt): Integer; + procedure AddAppt(AAppt: TJvTFAppt); + procedure DeleteAppt(AAppt: TJvTFAppt); + property Owner: TJvTFAlarm read FOwner write FOwner; + end; + + TJvTFAlarmEvent = procedure(Sender: TObject; AAppt: TJvTFAppt; + var SnoozeMins: Integer; var Dismiss: Boolean) of object; + + {$IFDEF RTL230_UP} + [ComponentPlatformsAttribute(pidWin32 or pidWin64)] + {$ENDIF RTL230_UP} + TJvTFAlarm = class(TJvTFComponent) + private + FResources: TStringList; + FTimer: TTimer; + FCurrentDate: TDate; + FAlarmList: TJvTFAlarmList; + FOnAlarm: TJvTFAlarmEvent; + FDefaultSnoozeMins: Integer; + function GetResources: TStrings; + procedure SetResources(Value: TStrings); + function GetTimerInterval: Integer; + procedure SetTimerInterval(Value: Integer); + function GetEnabled: Boolean; + procedure SetEnabled(Value: Boolean); + procedure InternalTimer(Sender: TObject); + protected + procedure DestroyApptNotification(AAppt: TJvTFAppt); override; + procedure ConnectSchedules; virtual; + procedure DisconnectSchedules; virtual; + procedure TimerCheck; virtual; + procedure AlarmCheck; virtual; + procedure Loaded; override; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + published + property Resources: TStrings read GetResources write SetResources; + property TimerInterval: Integer read GetTimerInterval write SetTimerInterval default 30000; + property Enabled: Boolean read GetEnabled write SetEnabled default True; + property DefaultSnoozeMins: Integer read FDefaultSnoozeMins write FDefaultSnoozeMins default 5; + property OnAlarm: TJvTFAlarmEvent read FOnAlarm write FOnAlarm; + end; + + +implementation + +uses + JvTFUtils; + +//=== { TJvTFAlarm } ========================================================= + +constructor TJvTFAlarm.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + FDefaultSnoozeMins := 5; + FCurrentDate := Date; + FResources := TStringList.Create; + FTimer := TTimer.Create(Self); + FTimer.Interval := 30000; + FTimer.Enabled := True; + FTimer.OnTimer := @InternalTimer; + FAlarmList := TJvTFAlarmList.Create; + FAlarmList.Owner := Self; +end; + +destructor TJvTFAlarm.Destroy; +begin + DisconnectSchedules; + FTimer.Free; + FResources.Free; + FAlarmList.Create; + FAlarmList.Free; + inherited Destroy; +end; + +procedure TJvTFAlarm.Loaded; +begin + inherited Loaded; + ConnectSchedules; +end; + +procedure TJvTFAlarm.AlarmCheck; +var + I, J, SnoozeMins: Integer; + Dismiss: Boolean; + Sched: TJvTFSched; + Appt: TJvTFAppt; + AlarmInfo: TJvTFAlarmInfo; + AlarmTime: TTime; +begin + // 1. Roll through all schedules and add an alarm for each appt with a start + // time that is less than the current time. (Duplicate appts will be ignored.) + // 2. Roll through the alarm list and fire an OnAlarm event when appropriate. + + // 1. + for I := 0 to ScheduleCount - 1 do + begin + Sched := Schedules[I]; + for J := 0 to Sched.ApptCount - 1 do + begin + Appt := Sched.Appts[J]; + AlarmTime := Appt.StartTime - Appt.AlarmAdvance * ONE_MINUTE; + if (AlarmTime < Frac(Time)) and Appt.AlarmEnabled then + FAlarmList.AddAppt(Appt); + end; + end; + + // 2. + for I := 0 to FAlarmList.Count - 1 do + begin + AlarmInfo := TJvTFAlarmInfo(FAlarmList.Objects[I]); + if not AlarmInfo.Dismiss and (AlarmInfo.NextAlarmTime < Frac(Time)) then + begin + SnoozeMins := AlarmInfo.SnoozeMins; + Dismiss := False; + if Assigned(FOnAlarm) then + begin + FOnAlarm(Self, AlarmInfo.Appt, SnoozeMins, Dismiss); + AlarmInfo.SnoozeMins := SnoozeMins; + AlarmInfo.Dismiss := Dismiss; + end; + AlarmInfo.NextAlarmTime := Time + SnoozeMins * ONE_MINUTE; + end; + end; +end; + +procedure TJvTFAlarm.ConnectSchedules; +var + I: Integer; + CurrentSchedules: TStringList; + Schedule: TJvTFSched; +begin + CurrentSchedules := TStringList.Create; + try + FTimer.Enabled := False; + // request all appropriate schedules. Store in temporary list so that + // we can release all schedules no longer needed. + for I := 0 to Resources.Count - 1 do + begin + Schedule := RetrieveSchedule(Resources[I], Date); + CurrentSchedules.AddObject('', Schedule); + end; + + // Now release all schedules no longer needed. (Cross check CurrentSchedules + // against Schedules list.) + for I := 0 to ScheduleCount - 1 do + begin + Schedule := Schedules[I]; + if CurrentSchedules.IndexOfObject(Schedule) = -1 then + ReleaseSchedule(Schedule.SchedName, Schedule.SchedDate); + end; + finally + CurrentSchedules.Free; + FTimer.Enabled := True; + end; +end; + +procedure TJvTFAlarm.DestroyApptNotification(AAppt: TJvTFAppt); +begin + FAlarmList.DeleteAppt(AAppt); + inherited DestroyApptNotification(AAppt); +end; + +procedure TJvTFAlarm.DisconnectSchedules; +begin + ReleaseSchedules; +end; + +function TJvTFAlarm.GetEnabled: Boolean; +begin + Result := FTimer.Enabled; +end; + +function TJvTFAlarm.GetTimerInterval: Integer; +begin + Result := FTimer.Interval; +end; + +function TJvTFAlarm.GetResources: TStrings; +begin + Result := FResources; +end; + +procedure TJvTFAlarm.InternalTimer(Sender: TObject); +begin + if Trunc(Date) <> Trunc(FCurrentDate) then + begin + FCurrentDate := Date; + ConnectSchedules; + end; + TimerCheck; +end; + +procedure TJvTFAlarm.SetEnabled(Value: Boolean); +begin + FTimer.Enabled := Value; +end; + +procedure TJvTFAlarm.SetResources(Value: TStrings); +begin + FResources.Assign(Value); + ConnectSchedules; +end; + +procedure TJvTFAlarm.SetTimerInterval(Value: Integer); +begin + FTimer.Interval := Value; +end; + +procedure TJvTFAlarm.TimerCheck; +begin + AlarmCheck; +end; + +//=== { TJvTFAlarmInfo } ===================================================== + +constructor TJvTFAlarmInfo.Create(AAppt: TJvTFAppt); +begin + inherited Create; + FAppt := AAppt; +end; + +//=== { TJvTFAlarmList } ===================================================== + +procedure TJvTFAlarmList.AddAppt(AAppt: TJvTFAppt); +var + AlarmInfo: TJvTFAlarmInfo; +begin + if Assigned(AAppt) and (IndexOfAppt(AAppt) = -1) then + begin + AlarmInfo := TJvTFAlarmInfo.Create(AAppt); + AlarmInfo.SnoozeMins := Owner.DefaultSnoozeMins; + AlarmInfo.NextAlarmTime := AAppt.StartTime - AAppt.AlarmAdvance * ONE_MINUTE; + AddObject(AAppt.ID, AlarmInfo); + end; +end; + +procedure TJvTFAlarmList.Clear; +var + I: Integer; +begin + for I := 0 to Count - 1 do + Objects[I].Free; + inherited Clear; +end; + +procedure TJvTFAlarmList.DeleteAppt(AAppt: TJvTFAppt); +var + I: Integer; +begin + I := IndexOfAppt(AAppt); + if I > -1 then + begin + Objects[I].Free; + Delete(I); + end; +end; + +function TJvTFAlarmList.GetAlarmForAppt(AAppt: TJvTFAppt): TJvTFAlarmInfo; +begin + Result := GetAlarmForApptID(AAppt.ID); +end; + +function TJvTFAlarmList.GetAlarmForApptID(const ID: string): TJvTFAlarmInfo; +var + I: Integer; +begin + Result := nil; + I := IndexOf(ID); + if I > -1 then + Result := TJvTFAlarmInfo(Objects[I]); +end; + +function TJvTFAlarmList.IndexOfAppt(AAppt: TJvTFAppt): Integer; +begin + Result := IndexOf(AAppt.ID); +end; + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfdays.pas b/components/jvcllaz/run/JvTimeFramework/jvtfdays.pas new file mode 100644 index 000000000..ef1a5e881 --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfdays.pas @@ -0,0 +1,14562 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFDays.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: + This version of the source contains modifications which enable the use + of time blocks. These modifications can be found by doing a search for + "DEF Jv_TIMEBLOCKS". Previously, two versions were released; one which did + NOT support timeblocks and one which did support timeblocks. (Hence the + use of the compiler defines.) + + These two versions are in the process of being integrated. The compiler + defines remain as an indicator of exactly what has been changed. All + lines that are NOT compiled ($IFNDEF Jv_TIMEBLOCKS and $ELSE) remain + as a reference during the transition, but have been commented out to + reduce confusion. Many of these lines are marked by a "// remove" comment. + + The conditional defines and disabled code will be removed and this file + will be cleaned up after the time block code has been fully integrated + and tested. +Changes to JvTFDays by deanh: +============================ + +These changes peform the following functions. + +1) The addition of a new time entry is aborted if the user presses escape. +2) New property for FancyHeader to only show the '00' minutes. This emulates outlook's behaviour. +3) Few changes to clean up the dithering of the background. +4) Hide the blank area that sometimes appears at the bottom of the Calendar when scrolling right down to the bottom. +5) Remove the focus rectangle when ShowFocus is false (the focus rect is not shown in Outlook). + +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFDays; + +{$mode objfpc}{$H+} +{$define Jv_TIMEBLOCKS} + +interface + +uses + LCLIntf, LCLType, LMessages, Types, + SysUtils, Classes, Graphics, Controls, Forms, Dialogs, StdCtrls, ImgList, + JvTFManager, JvTFSparseMatrix, JvTFUtils; + +const + AbsMinColWidth = 5; + SizingThreshold = 5; + gcUndef = -3; + gcGroupHdr = -2; + gcHdr = -1; + +type + EJvTFDaysError = class(Exception); + + {$IFDEF Jv_TIMEBLOCKS} + // remove TTFDayOfWeek and TTFDaysOfWeek, they are found in JvTFUtils + //TTFDayOfWeek = (dowSunday, dowMonday, dowTuesday, dowWednesday, + // dowThursday, dowFriday, dowSaturday); + //TTFDaysOfWeek = set of TTFDayOfWeek; + + EJvTFBlockGranError = class(EJvTFDaysError); + {$ENDIF Jv_TIMEBLOCKS} + + // Forward declarations + TJvTFDays = class; + TJvTFDaysCols = class; + TJvTFDaysCol = class; + TJvTFDaysPrinter = class; + TJvTFDaysTemplate = class; + TJvTFDaysHdrAttr = class; + + {$IFDEF Jv_TIMEBLOCKS} + // okay to leave + TJvTFDaysTimeBlocks = class; + TJvTFDaysTimeBlock = class; + {$ENDIF Jv_TIMEBLOCKS} + + TJvTFDaysCoord = record + Col: Integer; + Row: Integer; + CellX: Integer; + CellY: Integer; + AbsX: Integer; + AbsY: Integer; + Schedule: TJvTFSched; + Appt: TJvTFAppt; + DragAccept: Boolean; + end; + + TJvTFDrawPicInfo = class(TObject) + public + ImageList: TCustomImageList; + ImageIndex: Integer; + Glyph: TGraphic; + PicLeft: Integer; + PicTop: Integer; + end; + + TJvTFDaysTemplates = (agtNone, agtLinear, agtComparative); + + TJvTFListMoveEvent = procedure(Sender: TObject; CurIndex, NewIndex: Integer) of object; + + TJvTFCompNamesList = class(TStringList) + private + FOnMove: TJvTFListMoveEvent; + public + procedure Move(CurIndex, NewIndex: Integer); override; + property OnMove: TJvTFListMoveEvent read FOnMove write FOnMove; + end; + + TJvTFDaysTemplate = class(TPersistent) + private + FActiveTemplate: TJvTFDaysTemplates; + FCompDate: TDate; + FCompNames: TJvTFCompNamesList; + FLinearDayCount: Integer; + FLinearEndDate: TDate; + FLinearName: string; + FLinearStartDate: TDate; + FShortTitles: Boolean; + FUpdatingGrid: Boolean; + // Property Access Methods + function GetCompNames: TStrings; + procedure SetActiveTemplate(Value: TJvTFDaysTemplates); + procedure SetCompDate(Value: TDate); + procedure SetCompNames(Value: TStrings); + procedure SetLinearDayCount(Value: Integer); + procedure SetLinearEndDate(Value: TDate); + procedure SetLinearName(const Value: string); + procedure SetLinearStartDate(Value: TDate); + procedure SetShortTitles(Value: Boolean); + protected + FCompNamesChanged: Boolean; + FGrid: TJvTFDays; + FUpdatingCompNames: Boolean; + FIgnoreNav: Boolean; + procedure DoDateChangedEvent; + procedure DoDateChangingEvent(var NewDate: TDate); + procedure CompNamesChanged(Sender: TObject); virtual; + procedure CompNamesMoved(Sender: TObject; CurIndex, NewIndex: Integer); virtual; + procedure LinearDaysChanged; virtual; + procedure BeginGridUpdate; + procedure EndGridUpdate; + public + constructor Create(AApptGrid: TJvTFDays); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + procedure BeginCompNamesUpdate; + procedure EndCompNamesUpdate; + procedure UpdateGrid; + property UpdatingGrid: Boolean read FUpdatingGrid; + property ApptGrid: TJvTFDays read FGrid; + published + property ActiveTemplate: TJvTFDaysTemplates read FActiveTemplate write SetActiveTemplate default agtNone; + + property CompDate: TDate read FCompDate write SetCompDate; + property CompNames: TStrings read GetCompNames write SetCompNames; + + property IgnoreNav: Boolean read FIgnoreNav write FIgnoreNav default False; + property LinearDayCount: Integer read FLinearDayCount write SetLinearDayCount; + property LinearEndDate: TDate read FLinearEndDate write SetLinearEndDate; + property LinearName: string read FLinearName write SetLinearName; + property LinearStartDate: TDate read FLinearStartDate write SetLinearStartDate; + + property ShortTitles: Boolean read FShortTitles write SetShortTitles default True; + end; + + TJvTFDaysPrimeTime = class(TPersistent) + private + FStartTime: TTime; + FEndTime: TTime; + FColor: TColor; + procedure SetStartTime(Value: TTime); + procedure SetEndTime(Value: TTime); + procedure SetColor(Value: TColor); + protected + FApptGrid: TJvTFDays; + FFillPic: TBitmap; + procedure Change; + procedure UpdateFillPic; + public + constructor Create(AApptGrid: TJvTFDays); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + published + property StartTime: TTime read FStartTime write SetStartTime; + property EndTime: TTime read FEndTime write SetEndTime; + property Color: TColor read FColor write SetColor; + end; + + TJvTFCreateQuickEntryEvent = procedure(Sender: TObject; var ApptID: string; + var StartDate: TDate; var StartTime: TTime; var EndDate: TDate; + var EndTime: TTime; var Confirm: Boolean) of object; + + TJvTFDropApptEvent = procedure(Appt: TJvTFAppt; SchedName: string; + NewStartDate: TDate; NewStartTime: TTime; NewEndDate: TDate; + NewEndTime: TTime; Share: Boolean; var Confirm: Boolean) of object; + + TJvTFDragRowColEvent = procedure(Sender: TObject; Index: Integer; + var NewInfo: Integer; var Confirm: Boolean) of object; + + TJvTFSizeApptEvent = procedure(Sender: TObject; Appt: TJvTFAppt; + var NewEndDT: TDateTime; var Confirm: Boolean) of object; + + TJvTFSelecTJvTFApptEvent = procedure(Sender: TObject; OldSel, NewSel: TJvTFAppt) of object; + + TJvTFDrawApptEvent = procedure(Sender: TObject; ACanvas: TCanvas; ARect: TRect; + Appt: TJvTFAppt; Selected: Boolean) of object; + + TJvTFDrawGrabHandleEvent = procedure(Sender: TObject; ACanvas: TCanvas; + ARect: TRect; Appt: TJvTFAppt; TopHandle: Boolean) of object; + + TJvTFDrawDataCellEvent = procedure(Sender: TObject; ACanvas: TCanvas; ARect: TRect; + Col, Row: Integer) of object; + + TJvTFDaysCorner = (agcTopLeft, agcTopRight, agcBottomLeft, agcBottomRight); + TJvTFDrawCornerEvent = procedure(Sender: TObject; ACanvas: TCanvas; ARect: TRect; + Corner: TJvTFDaysCorner) of object; + + TJvTFDrawHdrEvent = procedure(Sender: TObject; ACanvas: TCanvas; ARect: TRect; + Index: Integer; Selected: Boolean) of object; + + TJvTFDrawApptBarEvent = procedure(Sender: TObject; ACanvas: TCanvas; + Appt: TJvTFAppt; Col: Integer; BarRect, TimeStampRect: TRect) of object; + + TJvTFFailEditorEvent = procedure(Sender: TObject; Col: Integer; Appt: TJvTFAppt; + var EditorBounds: TRect; var Fail: Boolean) of object; + + TJvTFDateChangingEvent = procedure(Sender: TObject; var NewDate: TDate) of object; + + TJvTFGranChangingEvent = procedure(Sender: TObject; var NewGran: Integer) of object; + + TJvTFShadeCellEvent = procedure(Sender: TObject; ColIndex, RowIndex: Integer; + var CellColor: TColor) of object; + + TJvTFBeginEditEvent = procedure(Sender: TObject; Appt: TJvTFAppt; + var AllowEdit: Boolean) of object; + + TJvTFInPlaceApptEditor = class(TMemo) + private + FLinkedAppt: TJvTFAppt; + FQuickCreate: Boolean; + protected + FCancelEdit: Boolean; + procedure DoExit; override; + procedure KeyDown(var Key: Word; Shift: TShiftState); override; + public + constructor Create(AOwner: TComponent); override; + property LinkedAppt: TJvTFAppt read FLinkedAppt write FLinkedAppt; + property QuickCreate: Boolean read FQuickCreate write FQuickCreate; + end; + + TJvTFApptMap = class(TObject) + private + FData: TJvTFSparseMatrix; + function GetLocation(Row, Col: Integer): TJvTFAppt; + protected + FGridCol: TJvTFDaysCol; + procedure Add(Appt: TJvTFAppt); + procedure ProcessMapGroup(GroupStart, GroupEnd: Integer); + procedure UpdateMapGroups; + public + constructor Create(AGridCol: TJvTFDaysCol); virtual; + destructor Destroy; override; + procedure Clear; + function ColCount(Row: Integer): Integer; + procedure GetAppts(StartRow, EndRow: Integer; ApptList: TStringList); + function LocateMapCol(Appt: TJvTFAppt; MapSearchRow: Integer): Integer; + property Location[Row, Col: Integer]: TJvTFAppt read GetLocation; + procedure Refresh; + function HasAppt(Appt: TJvTFAppt): Boolean; + procedure Dump(AName: TFileName); // used for debugging only + end; + + TJvTFDaysOption = (agoSizeCols, agoSizeRows, agoSizeColHdr, agoSizeRowHdr, + agoMoveCols, agoSizeAppt, agoMoveAppt, agoSnapMove, + agoSnapSize, agoEditing, agoShowPics, agoShowText, + agoShowApptHints, agoShowColHdrHints, agoShowSelHint, + agoEnforceMaxColWidth, agoQuickEntry, agoFormattedDesc); + TJvTFDaysOptions = set of TJvTFDaysOption; + + TJvTFDaysState = (agsNormal, agsSizeCol, agsSizeRow, agsSizeColHdr, + agsSizeRowHdr, agsMoveCol, agsSizeAppt, agsMoveAppt); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + TJvTFColTitleStyle = (ctsSingleClip, ctsSingleEllipsis, ctsMultiClip, + ctsMultiEllipsis, ctsHide, ctsRotated); + {$ELSE} + // remove + //TJvTFColTitleStyle = (ctsSingleClip, ctsSingleEllipsis, ctsMultiClip, + // ctsMultiEllipsis, ctsHide); + {$ENDIF Jv_TIMEBLOCKS} + + TJvTFDaysThresholds = class(TPersistent) + private + FDetailHeight: Integer; + FDetailWidth: Integer; + FEditHeight: Integer; + FEditWidth: Integer; + FTextHeight: Integer; + FTextWidth: Integer; + FDropTextFirst: Boolean; + FPicsAllOrNone: Boolean; + FWholePicsOnly: Boolean; + procedure SetDetailHeight(Value: Integer); + procedure SetDetailWidth(Value: Integer); + procedure SetEditHeight(Value: Integer); + procedure SetEditWidth(Value: Integer); + procedure SetTextHeight(Value: Integer); + procedure SetTextWidth(Value: Integer); + procedure SetDropTextFirst(Value: Boolean); + procedure SetPicsAllOrNone(Value: Boolean); + procedure SetWholePicsOnly(Value: Boolean); + protected + FApptGrid: TJvTFDays; + procedure Change; dynamic; + public + constructor Create(AOwner: TJvTFDays); + procedure Assign(Source: TPersistent); override; + published + property DetailHeight: Integer read FDetailHeight write SetDetailHeight default 10; + property DetailWidth: Integer read FDetailWidth write SetDetailWidth default 10; + property EditHeight: Integer read FEditHeight write SetEditHeight default 1; + property EditWidth: Integer read FEditWidth write SetEditWidth default 10; + property TextHeight: Integer read FTextHeight write SetTextHeight default 1; + property TextWidth: Integer read FTextWidth write SetTextWidth default 10; + property DropTextFirst: Boolean read FDropTextFirst write SetDropTextFirst default True; + property PicsAllOrNone: Boolean read FPicsAllOrNone write SetPicsAllOrNone default False; + property WholePicsOnly: Boolean read FWholePicsOnly write SetWholePicsOnly default True; + end; + + TJvTFDaysScrollBar = class(TScrollBar) + protected + procedure CMDesignHitTest(var Msg: TCMDesignHitTest); message CM_DESIGNHITTEST; + procedure CreateWnd; override; + function GetLargeChange: Integer; virtual; + procedure SetLargeChange(Value: Integer); virtual; + procedure UpdateRange; virtual; + public + constructor Create(AOwner: TComponent); override; + published + property LargeChange: Integer read GetLargeChange write SetLargeChange default 1; + end; + + //TJvTFUpdateTitleEvent = Procedure(Sender: TObject; Col: TJvTFDaysCol; + //var NewTitle: string) of object; + TJvTFUpdateTitlesEvent = procedure(Sender: TObject; Col: TJvTFDaysCol; + var NewGroupTitle, NewTitle: string) of object; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + TJvTFDaysTimeBlock = class(TCollectionItem) + private + FLength: Integer; + FTitle: string; + FName: string; + FAllowAppts: Boolean; + procedure SetLength(Value: Integer); + procedure SetTitle(const Value: string); + procedure SetName(const Value: string); + procedure SetAllowAppts(Value: Boolean); + function GetGridLength: Integer; + function GetBlockCollection: TJvTFDaysTimeBlocks; + protected + function GetDisplayName: string; override; + procedure Change; + public + constructor Create(ACollection: TCollection); override; + procedure Assign(Source: TPersistent); override; + property BlockCollection: TJvTFDaysTimeBlocks read GetBlockCollection; + published + property AllowAppts: Boolean read FAllowAppts write SetAllowAppts default True; + property GridLength: Integer read GetGridLength; + property Length: Integer read FLength write SetLength default 1; + property Name: string read FName write SetName; + property Title: string read FTitle write SetTitle; + end; + + // ok + TJvTFDaysTimeBlocks = class(TCollection) + private + FDaysControl: TJvTFDays; + function GetItem(Index: Integer): TJvTFDaysTimeBlock; + procedure SetItem(Index: Integer; Value: TJvTFDaysTimeBlock); + protected + function GetOwner: TPersistent; override; + public + constructor Create(ADaysControl: TJvTFDays); + function Add: TJvTFDaysTimeBlock; + property DaysControl: TJvTFDays read FDaysControl; + procedure Assign(Source: TPersistent); override; + property Items[Index: Integer]: TJvTFDaysTimeBlock read GetItem + write SetItem; default; + function BlockByName(const BlockName: string): TJvTFDaysTimeBlock; + function FindBlock(const BlockName: string): TJvTFDaysTimeBlock; + end; + + // ok + TJvTFDaysBlockProps = class(TPersistent) + private + FBlockGran: Integer; + FDayStart: TTime; + FDaysControl: TJvTFDays; + FBlockHdrAttr: TJvTFDaysHdrAttr; + FSelBlockHdrAttr: TJvTFDaysHdrAttr; + FBlockHdrWidth: Integer; + FOffTimeColor: TColor; + FDataDivColor: TColor; + FSnapMove: Boolean; + FDrawOffTime: Boolean; + procedure SetBlockGran(Value: Integer); + procedure SetDayStart(Value: TTime); + procedure SetBlockHdrAttr(Value: TJvTFDaysHdrAttr); + procedure SetSelBlockHdrAttr(Value: TJvTFDaysHdrAttr); + procedure SetBlockHdrWidth(Value: Integer); + procedure SetOffTimeColor(Value: TColor); + procedure SetDataDivColor(Value: TColor); + procedure SetDrawOffTime(Value: Boolean); + public + constructor Create(ADaysControl: TJvTFDays); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + property DaysControl: TJvTFDays read FDaysControl; + procedure Change; + published + property BlockGran: Integer read FBlockGran write SetBlockGran default 60; + property BlockHdrAttr: TJvTFDaysHdrAttr read FBlockHdrAttr write SetBlockHdrAttr; + property BlockHdrWidth: Integer read FBlockHdrWidth write SetBlockHdrWidth default 50; + property DataDivColor: TColor read FDataDivColor write SetDataDivColor default clBlack; + property DayStart: TTime read FDayStart write SetDayStart; + property DrawOffTime: Boolean read FDrawOffTime write SetDrawOffTime default True; + property OffTimeColor: TColor read FOffTimeColor write SetOffTimeColor default clGray; + property SelBlockHdrAttr: TJvTFDaysHdrAttr read FSelBlockHdrAttr write SetSelBlockHdrAttr; + property SnapMove: Boolean read FSnapMove write FSnapMove default True; + end; + + {$ENDIF Jv_TIMEBLOCKS} + + TJvTFDaysCol = class(TCollectionItem) + private + FMap: TJvTFApptMap; + FNullSchedDate: Boolean; + FSchedDate: TDate; + FSchedName: string; + FSchedule: TJvTFSched; + FGroupTitle: string; + FTitle: string; + FWidth: Integer; + procedure SetSchedDate(Value: TDate); + procedure SetSchedName(const Value: string); + procedure SetGroupTitle(const Value: string); + procedure SetTitle(const Value: string); + procedure SetWidth(Value: Integer); + protected + FDisconnecting: Boolean; + function GetDisplayName: string; override; + procedure CheckTemplate; + procedure SetIndex(Value: Integer); override; + public + constructor Create(ACollection: TCollection); override; + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + function ColCollection: TJvTFDaysCols; + property Schedule: TJvTFSched read FSchedule; + function Connected: Boolean; + + procedure Connect; + procedure Disconnect; + procedure SetSchedule(const NewSchedName: string; NewSchedDate: TDate); + + function LocateMapCol(Appt: TJvTFAppt; MapSearchRow: Integer): Integer; + function MapColCount(Row: Integer): Integer; + function MapLocation(Col, Row: Integer): TJvTFAppt; + + procedure RefreshMap; + procedure CalcStartEndRows(Appt: TJvTFAppt; var StartRow, EndRow: Integer); + //procedure UpdateTitle; + procedure UpdateTitles; + + function GetFirstAppt: TJvTFAppt; + function GetPrevAppt(RefAppt: TJvTFAppt): TJvTFAppt; + function GetNextAppt(RefAppt: TJvTFAppt): TJvTFAppt; + function GetLastAppt: TJvTFAppt; + procedure DumpMap; + function ApptInCol(Appt: TJvTFAppt): Boolean; + published + property SchedDate: TDate read FSchedDate write SetSchedDate; + property SchedName: string read FSchedName write SetSchedName; + property GroupTitle: string read FGroupTitle write SetGroupTitle; + property Title: string read FTitle write SetTitle; + property Width: Integer read FWidth write SetWidth; + end; + + TJvTFDaysCols = class(TCollection) + private + FApptGrid: TJvTFDays; + FPrinter: TJvTFDaysPrinter; + FOldCount: Integer; + function GetItem(Index: Integer): TJvTFDaysCol; + procedure SetItem(Index: Integer; Value: TJvTFDaysCol); + protected + FAddingCol: Boolean; + FSizingCols: Boolean; + FUpdating: Boolean; + procedure EnsureCol(Index: Integer); + function GetOwner: TPersistent; override; + procedure SizeCols; virtual; + procedure Update(Item: TCollectionItem); override; + public + constructor Create(AApptGrid: TJvTFDays); + constructor CreateForPrinter(APrinter: TJvTFDaysPrinter); + property ApptGrid: TJvTFDays read FApptGrid; + property Printer: TJvTFDaysPrinter read FPrinter; + + function Add: TJvTFDaysCol; + property AddingCol: Boolean read FAddingCol; + property Updating: Boolean read FUpdating; + + procedure EnsureMinColWidth; + procedure EnsureMaxColWidth; + procedure ResizeCols; + property SizingCols: Boolean read FSizingCols; + procedure MoveCol(SourceIndex, TargetIndex: Integer); + + procedure Assign(Source: TPersistent); override; + property Items[Index: Integer]: TJvTFDaysCol read GetItem write SetItem; default; + procedure UpdateTitles; + end; + + TJvTFRowHdrType = (rhGrid, rhFancy); + + TJvTFDaysFancyRowHdrAttr = class(TPersistent) + private + FColor: TColor; + FHr2400: Boolean; + FMinorFont: TFont; + FMajorFont: TFont; + FTickColor: TColor; + FOnlyShow00Minutes: Boolean; + procedure SetColor(Value: TColor); + procedure SetHr2400(Value: Boolean); + procedure SetMinorFont(Value: TFont); + procedure SetMajorFont(Value: TFont); + procedure SetTickColor(Value: TColor); + procedure SetOnlyShow00Minutes(Value: Boolean); + protected + FGrid: TJvTFDays; + procedure Change; virtual; + procedure FontChange(Sender: TObject); virtual; + public + constructor Create(AOwner: TJvTFDays); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + published + property Color: TColor read FColor write SetColor default clBtnFace; + property Hr2400: Boolean read FHr2400 write SetHr2400; + property MinorFont: TFont read FMinorFont write SetMinorFont; + property MajorFont: TFont read FMajorFont write SetMajorFont; + property TickColor: TColor read FTickColor write SetTickColor default clGray; + property OnlyShow00Minutes: Boolean read FOnlyShow00Minutes write SetOnlyShow00Minutes + default True; + end; + + TJvTFDaysHdrAttr = class(TPersistent) + private + FApptGrid: TJvTFDays; + FColor: TColor; + FFont: TFont; + FParentFont: Boolean; + FFrame3D: Boolean; + {$IFDEF Jv_TIMEBLOCKS} + // ok + FFrameColor: TColor; + FTitleRotation: Integer; + {$ENDIF Jv_TIMEBLOCKS} + procedure SetColor(Value: TColor); + procedure SetFont(Value: TFont); + procedure SetParentFont(Value: Boolean); + procedure SetFrame3D(Value: Boolean); + {$IFDEF Jv_TIMEBLOCKS} + // ok + procedure SetFrameColor(Value: TColor); + procedure SetTitleRotation(Value: Integer); + {$ENDIF Jv_TIMEBLOCKS} + protected + procedure Change; + procedure FontChange(Sender: TObject); + public + constructor Create(AOwner: TJvTFDays); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + procedure ParentFontChanged; + published + property Color: TColor read FColor write SetColor default clBtnFace; + property Font: TFont read FFont write SetFont; + property ParentFont: Boolean read FParentFont write SetParentFont default True; + property Frame3D: Boolean read FFrame3D write SetFrame3D default True; + {$IFDEF Jv_TIMEBLOCKS} + // ok + property FrameColor: TColor read FFrameColor write SetFrameColor nodefault; + property TitleRotation: Integer read FTitleRotation write SetTitleRotation default 0; + {$ENDIF Jv_TIMEBLOCKS} + end; + + TJvTFTimeStampStyle = (tssNone, tssFullI, tssHalfI, tssBlock); + + TJvTFDaysApptBar = class(TPersistent) + private + FColor: TColor; + FVisible: Boolean; + FWidth: Integer; + FTimeStampStyle: TJvTFTimeStampStyle; + FTimeStampColor: TColor; + procedure SetColor(Value: TColor); + procedure SetVisible(Value: Boolean); + procedure SetWidth(Value: Integer); + procedure SetTFTimeStampStyle(Value: TJvTFTimeStampStyle); + procedure SetTimeStampColor(Value: TColor); + protected + FApptGrid: TJvTFDays; + procedure Change; virtual; + public + constructor Create(AApptGrid: TJvTFDays); + procedure Assign(Source: TPersistent); override; + published + property Color: TColor read FColor write SetColor default clBlue; + property Width: Integer read FWidth write SetWidth default 5; + property Visible: Boolean read FVisible write SetVisible default True; + property TimeStampStyle: TJvTFTimeStampStyle read FTimeStampStyle + write SetTFTimeStampStyle default tssBlock; + property TimeStampColor: TColor read FTimeStampColor + write SetTimeStampColor default clBlue; + end; + + TJvTFDaysApptAttr = class(TPersistent) + private + FColor: TColor; + FFont: TFont; + FParentFont: Boolean; + FFrameColor: TColor; + FFrameWidth: Integer; + procedure SetColor(Value: TColor); + procedure SetFont(Value: TFont); + procedure SetParentFont(Value: Boolean); + procedure SetFrameColor(Value: TColor); + procedure SetFrameWidth(Value: Integer); + protected + FApptGrid: TJvTFDays; + procedure Change; virtual; + procedure FontChange(Sender: TObject); virtual; + public + constructor Create(AApptGrid: TJvTFDays); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + procedure ParentFontChanged; virtual; + published + property Color: TColor read FColor write SetColor; + property Font: TFont read FFont write SetFont; + property ParentFont: Boolean read FParentFont write SetParentFont default True; + property FrameColor: TColor read FFrameColor write SetFrameColor default clBlack; + property FrameWidth: Integer read FFrameWidth write SetFrameWidth default 1; + end; + + TJvTFSelCellStyle = (scsSolid, scsFrame, scsCombo); + + TJvTFSelCellAttr = class(TPersistent) + private + FColor: TColor; + FFrameWidth: Integer; + FStyle: TJvTFSelCellStyle; + procedure SetColor(Value: TColor); + procedure SetFrameWidth(Value: Integer); + procedure SetStyle(Value: TJvTFSelCellStyle); + protected + FApptGrid: TJvTFDays; + procedure Change; virtual; + public + constructor Create(AApptGrid: TJvTFDays); + procedure Assign(Source: TPersistent); override; + published + property Color: TColor read FColor write SetColor default clNavy; + property FrameWidth: Integer read FFrameWidth write SetFrameWidth default 2; + property Style: TJvTFSelCellStyle read FStyle write SetStyle default scsSolid; + end; + + TJvTFGrabStyle = (gs3D, gsFlat); + + TJvTFDaysGrabHandles = class(TPersistent) + private + FColor: TColor; + FHeight: Integer; + FStyle: TJvTFGrabStyle; + procedure SetColor(Value: TColor); + procedure SetHeight(Value: Integer); + procedure SetStyle(Value: TJvTFGrabStyle); + protected + FApptGrid: TJvTFDays; + procedure Change; virtual; + property Style: TJvTFGrabStyle read FStyle write SetStyle default gsFlat; + public + constructor Create(AApptGrid: TJvTFDays); + procedure Assign(Source: TPersistent); override; + published + property Height: Integer read FHeight write SetHeight default 6; + property Color: TColor read FColor write SetColor default clBlue; + end; + + {$M+} + TJvTFDaysApptDrawInfo = class(TObject) + private + FColor: TColor; + FFrameColor: TColor; + FFrameWidth: Integer; + FFont: TFont; + FVisible: Boolean; + procedure SetColor(Value: TColor); + procedure SetFrameColor(Value: TColor); + procedure SetFont(Value: TFont); + procedure SetFrameWidth(const Value: Integer); + procedure SetVisible(Value: Boolean); + public + constructor Create; + destructor Destroy; override; + published + property Color: TColor read FColor write SetColor; + property FrameColor: TColor read FFrameColor write SetFrameColor; + property FrameWidth: Integer read FFrameWidth write SetFrameWidth; + property Font: TFont read FFont write SetFont; + property Visible: Boolean read FVisible write SetVisible; + end; + {$M-} + + TJvTFGetDaysApptDrawInfoEvent = procedure(Sender: TObject; Appt: TJvTFAppt; + DrawInfo: TJvTFDaysApptDrawInfo) of object; + + TDynPointArray = array of TPoint; + TDynIntArray = array of Integer; + + TJvTFDaysGrouping = (grNone, grDate, grResource, grCustom); + + TJvTFAutoScrollDir = (asdUp, asdDown, asdLeft, asdRight, asdNowhere); + + TJvTFDays = class(TJvTFControl) + private + // internal stuff +// FBorderStyle: TBorderStyle; + FHitTest: TPoint; + FVisibleScrollBars: TJvTFVisibleScrollBars; + FDitheredBackground: Boolean; + + // row, col layout + FGranularity: Integer; + FColHdrHeight: Integer; + FRowHdrWidth: Integer; + FRowHeight: Integer; + FMinRowHeight: Integer; + FDefColWidth: Integer; + FMinColWidth: Integer; + FAutoSizeCols: Boolean; + FColTitleStyle: TJvTFColTitleStyle; + FGroupHdrHeight: Integer; + + FCols: TJvTFDaysCols; + FTemplate: TJvTFDaysTemplate; + + FTopRow: Integer; + FFocusedRow: Integer; + FLeftCol: Integer; + FFocusedCol: Integer; + FGrouping: TJvTFDaysGrouping; + + FGridStartTime: TTime; + FGridEndTime: TTime; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + FTimeBlockProps: TJvTFDaysBlockProps; + FTimeBlocks: TJvTFDaysTimeBlocks; + {$ENDIF Jv_TIMEBLOCKS} + + // visual appearance attr's + FHdrAttr: TJvTFDaysHdrAttr; + FSelHdrAttr: TJvTFDaysHdrAttr; + FApptAttr: TJvTFDaysApptAttr; + FSelApptAttr: TJvTFDaysApptAttr; + FFancyRowHdrAttr: TJvTFDaysFancyRowHdrAttr; + FSelFancyRowHdrAttr: TJvTFDaysFancyRowHdrAttr; + FRowHdrType: TJvTFRowHdrType; + FSelCellAttr: TJvTFSelCellAttr; + FApptBar: TJvTFDaysApptBar; + FApptBuffer: Integer; + FGridLineColor: TColor; + FGrabHandles: TJvTFDaysGrabHandles; + FThresholds: TJvTFDaysThresholds; + FPrimeTime: TJvTFDaysPrimeTime; + FGroupHdrAttr: TJvTFDaysHdrAttr; + FSelGroupHdrAttr: TJvTFDaysHdrAttr; + + FOptions: TJvTFDaysOptions; + FEditor: TJvTFInPlaceApptEditor; + FHintProps: TJvTFHintProps; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + FWeekend: TTFDaysOfWeek; + FWeekendColor: TColor; + {$ENDIF Jv_TIMEBLOCKS} + + // Row/Col Sizing/Moving Events + FOnSizeCol: TJvTFDragRowColEvent; + FOnSizeRow: TJvTFDragRowColEvent; + FOnSizeColHdr: TJvTFDragRowColEvent; + FOnSizeRowHdr: TJvTFDragRowColEvent; + FOnMoveCol: TJvTFDragRowColEvent; + + // Appt mouse events + FOnSelectingAppt: TJvTFVarApptEvent; + FOnSelectAppt: TJvTFSelecTJvTFApptEvent; + FOnSelectedAppt: TNotifyEvent; + FOnSizeAppt: TJvTFSizeApptEvent; + FOnDropAppt: TJvTFDropApptEvent; + + // Drawing events + FOnDrawAppt: TJvTFDrawApptEvent; + FOnDrawApptBar: TJvTFDrawApptBarEvent; + FOnDrawCorner: TJvTFDrawCornerEvent; + FOnDrawColHdr: TJvTFDrawHdrEvent; + FOnDrawDataCell: TJvTFDrawDataCellEvent; + FOnDrawGrabHandle: TJvTFDrawGrabHandleEvent; + FOnDrawMajorRowHdr: TJvTFDrawHdrEvent; + FOnDrawMinorRowHdr: TJvTFDrawHdrEvent; + FOnDrawRowHdr: TJvTFDrawHdrEvent; + //FOnUpdateColTitle: TJvTFUpdateTitleEvent; + FOnUpdateColTitles: TJvTFUpdateTitlesEvent; + FOnDrawGroupHdr: TJvTFDrawHdrEvent; + FOnShadeCell: TJvTFShadeCellEvent; + FOnGetApptDrawInfo: TJvTFGetDaysApptDrawInfoEvent; + + // editor events + FOnFailEditor: TJvTFFailEditorEvent; + FOnCreateQuickEntry: TJvTFCreateQuickEntryEvent; + FOnQuickEntry: TNotifyEvent; + FOnBeginEdit: TJvTFBeginEditEvent; + + // navigation events + FOnInsertAppt: TNotifyEvent; + FOnInsertSchedule: TNotifyEvent; + FOnDeleteAppt: TNotifyEvent; + FOnDeleteSchedule: TNotifyEvent; + FOnDateChanging: TJvTFDateChangingEvent; + FOnDateChanged: TNotifyEvent; + FOnGranularityChanging: TJvTFGranChangingEvent; + FOnGranularityChanged: TNotifyEvent; + FOnFocusedRowChanged: TNotifyEvent; + FOnFocusedColChanged: TNotifyEvent; + FShowFocus: Boolean; + + // internal stuff +// procedure CMCtl3DChanged(var Msg: TLMessage); message CM_CTL3DCHANGED; + procedure WMGetDlgCode(var Msg: TLMGetDlgCode); message LM_GETDLGCODE; +// procedure SetBorderStyle(Value: TBorderStyle); + procedure SetTFVisibleScrollBars(Value: TJvTFVisibleScrollBars); + procedure AlignScrollBars; + function CheckSBVis: Boolean; + procedure SetOnShowHint(Value: TJvTFShowHintEvent); + function GetOnShowHint: TJvTFShowHintEvent; + {$IFDEF Jv_TIMEBLOCKS} + // ok + procedure UpdateWeekendFillPic; + {$ENDIF Jv_TIMEBLOCKS} + + // row, col layout + procedure SetGranularity(Value: Integer); + procedure SetColHdrHeight(Value: Integer); + procedure SetRowHdrWidth(Value: Integer); + procedure SetRowHeight(Value: Integer); + procedure SetMinRowHeight(Value: Integer); + procedure SetMinColWidth(Value: Integer); + procedure SetAutoSizeCols(Value: Boolean); + procedure SetTFColTitleStyle(Value: TJvTFColTitleStyle); + + procedure SetCols(Value: TJvTFDaysCols); + + procedure SetTopRow(Value: Integer); + procedure SetFocusedRow(Value: Integer); + function GetFocusedRow: Integer; + procedure SetLeftCol(Value: Integer); + procedure SetFocusedCol(Value: Integer); + function GetFocusedCol: Integer; + procedure SetGrouping(Value: TJvTFDaysGrouping); + procedure SetGroupHdrHeight(Value: Integer); + + procedure SetGridStartTime(Value: TTime); + procedure SetGridEndTime(Value: TTime); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + procedure SetTimeBlockProps(Value: TJvTFDaysBlockProps); + // ok + procedure SetTimeBlocks(Value: TJvTFDaysTimeBlocks); + {$ENDIF Jv_TIMEBLOCKS} + + // visual appearance attr's + procedure SetHdrAttr(Value: TJvTFDaysHdrAttr); + procedure SetSelHdrAttr(Value: TJvTFDaysHdrAttr); + procedure SetApptAttr(Value: TJvTFDaysApptAttr); + procedure SetSelApptAttr(Value: TJvTFDaysApptAttr); + procedure SetFancyRowHdrAttr(Value: TJvTFDaysFancyRowHdrAttr); + procedure SetSelFancyRowHdrAttr(Value: TJvTFDaysFancyRowHdrAttr); + procedure SetTFRowHdrType(Value: TJvTFRowHdrType); + procedure SetTFSelCellAttr(Value: TJvTFSelCellAttr); + procedure SetApptBar(Value: TJvTFDaysApptBar); + procedure SetApptBuffer(Value: Integer); + procedure SetGridLineColor(Value: TColor); + procedure SetGrabHandles(Value: TJvTFDaysGrabHandles); + procedure SetGroupHdrAttr(Value: TJvTFDaysHdrAttr); + procedure SetSelGroupHdrAttr(Value: TJvTFDaysHdrAttr); + + procedure SetOptions(Value: TJvTFDaysOptions); + procedure SetTFHintProps(Value: TJvTFHintProps); + procedure DrawDither(ACanvas: TCanvas; ARect: TRect; Color1, Color2: TColor); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + procedure SetWeekend(Value: TTFDaysOfWeek); + // ok + procedure SetWeekendColor(Value: TColor); + procedure SetDitheredBackground(const Value: Boolean); + procedure SetShowFocus(const Value: Boolean); + {$ENDIF Jv_TIMEBLOCKS} + protected + FState: TJvTFDaysState; + FHint: TJvTFHint; + FNeedCheckSBParams: Boolean; + PaintBuffer: TBitmap; + {$IFDEF Jv_TIMEBLOCKS} + // ok + FWeekendFillPic: TBitmap; + {$ENDIF Jv_TIMEBLOCKS} + + FBeginDraggingCoord: TJvTFDaysCoord; + FDraggingCoord: TJvTFDaysCoord; + + FSelAppt: TJvTFAppt; + FSelStart: TPoint; + FSelEnd: TPoint; + FFromToSel: Boolean; + FSaveFocCol: Integer; + + FHScrollBar: TJvTFDaysScrollBar; + FVScrollBar: TJvTFDaysScrollBar; + + FAutoScrollDir: TJvTFAutoScrollDir; + FLiveTimer: Boolean; + + FMouseMovePt: TPoint; + FMouseMoveState: TShiftState; + + procedure SetDateFormat(const Value: string); override; + procedure ReqSchedNotification(Schedule: TJvTFSched); override; + procedure RelSchedNotification(Schedule: TJvTFSched); override; + procedure CreateParams(var Params: TCreateParams); override; + + function GetFocusedSchedule: TJvTFSched; + procedure SetSelAppt(Value: TJvTFAppt); + //procedure SetGroupTitles; dynamic; + //procedure ReorderCols; + + // All painting routines + procedure Paint; override; + procedure DrawDataCell(ACanvas: TCanvas; ColIndex, RowIndex: Integer); + procedure DrawEmptyColHdr(ACanvas: TCanvas); + procedure DrawAppt(ACanvas: TCanvas; Col: Integer; Appt: TJvTFAppt; + StartRow, EndRow: Integer); + procedure DrawApptDetail(ACanvas: TCanvas; ARect: TRect; Appt: TJvTFAppt; + Selected: Boolean; Col, StartRow, EndRow: Integer); + procedure DrawApptBar(ACanvas: TCanvas; Appt: TJvTFAppt; BarRect: TRect; + Col, StartRow, EndRow: Integer); + function CalcTimeStampRect(Appt: TJvTFAppt; BarRect: TRect; + Col, StartRow, EndRow: Integer): TRect; + procedure DrawTimeStamp(ACanvas: TCanvas; TimeStampRect: TRect); + procedure DrawPics(ACanvas: TCanvas; var ARect: TRect; Appt: TJvTFAppt); + procedure CreatePicDrawList(ARect: TRect; Appt: TJvTFAppt; DrawList: TList); + procedure FilterPicDrawList(ARect: TRect; DrawList: TList; + var PicsHeight: Integer; var PicsWidth: Integer); + procedure ClearPicDrawList(DrawList: TList); + procedure DrawListPics(ACanvas: TCanvas; var ARect: TRect; DrawList: TList); + procedure DrawGrabLines(ACanvas: TCanvas; LineTop, LineLeft, + LineRight: Integer); + procedure DrawGrabHandle(ACanvas: TCanvas; ARect: TRect; + AAppt: TJvTFAppt; TopHandle: Boolean); + procedure DrawCorner(ACanvas: TCanvas; Corner: TJvTFDaysCorner); + procedure DrawRowHdr(ACanvas: TCanvas; Index: Integer); + //procedure DrawColHdr(ACanvas: TCanvas; Index: Integer); + function GetTallestColTitle(ACanvas: TCanvas): Integer; + + procedure GetApptDrawInfo(DrawInfo: TJvTFDaysApptDrawInfo; + AAppt: TJvTFAppt; Attr: TJvTFDaysApptAttr); + + {$IFDEF Jv_TIMEBLOCKS} + // ok to REPLACE old DrawFrame + procedure DrawFrame(ACanvas: TCanvas; ARect: TRect; Draw3D: Boolean; + FrameColour: TColor); + {$ELSE} + // obsolete + //procedure DrawFrame(ACanvas: TCanvas; ARect: TRect; Draw3D: Boolean); + {$ENDIF Jv_TIMEBLOCKS} + + procedure DrawAppts(ACanvas: TCanvas; DrawAll: Boolean); + procedure AdjustForMargins(var ARect: TRect); + procedure CanDrawWhat(ACanvas: TCanvas; ApptRect: TRect; PicsHeight: Integer; + var CanDrawText, CanDrawPics: Boolean); + procedure ManualFocusRect(ACanvas: TCanvas; ARect: TRect); + // Fancy painting routines + procedure DrawFancyRowHdrs(ACanvas: TCanvas); + procedure DrawMinor(ACanvas: TCanvas; ARect: TRect; RowNum: Integer; + const LabelStr: string; TickLength: Integer; Selected: Boolean); + function GetMinorLabel(RowNum: Integer): string; + function GetMinorTickLength: Integer; virtual; + function GetMajorTickLength: Integer; virtual; + procedure DrawGroupHdrs(ACanvas: TCanvas); + //procedure DrawGroupHdr(ACanvas: TCanvas; ACol: Integer); + procedure DrawColGroupHdr(ACanvas: TCanvas; Index: Integer; + IsGroupHdr: Boolean); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + procedure DrawBlockHdr(ACanvas: TCanvas; BlockIndex: Integer); + // ok + procedure FillBlockHdrDeadSpace(ACanvas: TCanvas); + // REMOVE, replaced by CalcTextPos in JvTFUtils + //procedure CalcTextPos(var ARect: TRect; aAngle: Integer; aTxt: string); + // REMOVE, replaced by DrawAngleText in JvTFUtils + //procedure DrawAngleText(ACanvas: TCanvas; ARect: TRect; aAngle: Integer; + //aTxt: string); + {$ENDIF Jv_TIMEBLOCKS} + + // message handlers + procedure Resize; override; + + procedure WMEraseBkgnd(var Msg: TLMessage); message LM_ERASEBKGND; + procedure WMSetCursor(var Msg: TLMSetCursor); message LM_SETCURSOR; + procedure WMNCHitTest(var Msg: TLMNCHitTest); message LM_NCHITTEST; + procedure CMDesignHitTest(var Msg: TCMDesignHitTest); message CM_DESIGNHITTEST; + procedure CNRequestRefresh(var Msg: TCNRequestRefresh); message CN_REQUESTREFRESH; + procedure WMTimer(var Msg: TLMTimer); message LM_TIMER; + + procedure CMFontChanged(var Msg: TLMessage); message CM_FONTCHANGED; + procedure CMEnabledChanged(var Msg: TLMessage); message CM_ENABLEDCHANGED; + procedure CMMouseLeave(var Msg: TLMessage); message CM_MOUSELEAVE; + + // internal routines + procedure Loaded; override; + procedure RefreshControl; override; + procedure UpdateDesigner; + + // scroll bar stuff + procedure CheckSBParams; + procedure ScrollBarScroll(Sender: TObject; ScrollCode: TScrollCode; + var ScrollPos: Integer); + property VisibleScrollBars: TJvTFVisibleScrollBars read FVisibleScrollBars + write SetTFVisibleScrollBars; + + // mouse routines + procedure MouseDown(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); override; + procedure MouseMove(Shift: TShiftState; X, Y: Integer); override; + procedure MouseUp(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); override; + procedure DblClick; override; + procedure DoApptHint(GridCoord: TJvTFDaysCoord); + procedure DoCellHint(GridCoord: TJvTFDaysCoord); + + // Drag/Drop routines + procedure DoStartDrag(var DragObject: TDragObject); override; + procedure DragOver(Source: TObject; X, Y: Integer; State: TDragState; + var Accept: Boolean); override; + procedure DoEndDrag(Target: TObject; X, Y: Integer); override; + procedure DropAppt(ADragInfo: TJvTFDragInfo; X, Y: Integer); + + procedure BeginDragging(Coord: TJvTFDaysCoord; DragWhat: TJvTFDaysState; + Appt: TJvTFAppt); + procedure DrawDrag(Coord: TJvTFDaysCoord; AAppt: TJvTFAppt; AClear: Boolean); + procedure ContinueDragging(Coord: TJvTFDaysCoord; Appt: TJvTFAppt); + procedure EndDragging(Coord: TJvTFDaysCoord; Appt: TJvTFAppt); + function CanDragWhat(Coord: TJvTFDaysCoord): TJvTFDaysState; + procedure CalcSizeEndTime(Appt: TJvTFAppt; var NewEndDT: TDateTime); + procedure CalcMoveStartEnd(Appt: TJvTFAppt; Coord: TJvTFDaysCoord; + KeepDates, KeepTimes: Boolean; var StartDT, EndDT: TDateTime); + + procedure KillAutoScrollTimer; + + procedure EnsureCol(ACol: Integer); + procedure EnsureRow(ARow: Integer); + + // navigation + procedure KeyDown(var Key: Word; Shift: TShiftState); override; + procedure KeyPress(var Key: Char); override; + procedure DoInsertSchedule; dynamic; + procedure DoInsertAppt; dynamic; + procedure DoDeleteAppt; dynamic; + procedure DoDeleteSchedule; dynamic; +// procedure DoNavigate; virtual; + + function DoMouseWheelDown(Shift: TShiftState; MousePos: TPoint): Boolean; override; + function DoMouseWheelUp(Shift: TShiftState; MousePos: TPoint): Boolean; override; + procedure DestroyApptNotification(AAppt: TJvTFAppt); override; + procedure Navigate(AControl: TJvTFControl; SchedNames: TStringList; + Dates: TJvTFDateList); override; + + procedure DoEnter; override; + procedure DoExit; override; + + // Selection methods + function GetSelStart: TPoint; + function GetSelEnd: TPoint; + procedure SetSelStart(Value: TPoint); + procedure SetSelEnd(Value: TPoint); + procedure QuickEntry(Key: Char); virtual; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + procedure EnsureBlockRules(GridGran, BlockGran: Integer; DayStart: TTime); + // ok + function ValidateBlockRules(GridGran, BlockGran: Integer; + DayStart: TTime): Boolean; + {$ENDIF Jv_TIMEBLOCKS} + + { Lazarus } + class function GetControlClassDefaultSize: TSize; override; + + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + function GetTFHintClass: TJvTFHintClass; dynamic; + + // move grab handles + function GetTopGrabHandleRect(Col: Integer; Appt: TJvTFAppt): TRect; + // move grab handles + function GetBottomGrabHandleRect(Col: Integer; Appt: TJvTFAppt): TRect; + function PtInTopHandle(APoint: TPoint; Col: Integer; Appt: TJvTFAppt): Boolean; + function PtInBottomHandle(APoint: TPoint; Col: Integer; Appt: TJvTFAppt): Boolean; + + // grid region functions + function GetAdjClientRect: TRect; + function GetDataAreaRect: TRect; + function GetDataWidth: Integer; + function GetDataHeight: Integer; + function PtToCell(X, Y: Integer): TJvTFDaysCoord; + function CellRect(Col, Row: Integer): TRect; + function VirtualCellRect(Col, Row: Integer): TRect; + function GetApptRect(Col: Integer; Appt: TJvTFAppt): TRect; + function LocateDivCol(X, TotalWidth, SegCount: Integer): Integer; + function CalcGroupHdrHeight: Integer; + function CalcGroupColHdrsHeight: Integer; + function VirtualGroupHdrRect(Col: Integer): TRect; + procedure GetGroupStartEndCols(Col: Integer; var StartCol, EndCol: Integer); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + function RowToTimeBlock(ARow: Integer): Integer; + // ok + procedure GetTimeBlockStartEnd(ATimeBlock: Integer; var BlockStart, + BlockEnd: Integer); + // ok + function CalcBlockHdrWidth: Integer; + // ok + function CalcBlockRowHdrsWidth: Integer; + // ok + procedure GetBlockStartEndRows(Row: Integer; var StartRow, EndRow: Integer); + // ok + function VirtualBlockHdrRect(Row: Integer): TRect; + {$ENDIF Jv_TIMEBLOCKS} + + // editor management routines + procedure EditAppt(Col: Integer; Appt: TJvTFAppt); + procedure FinishEditAppt; + function Editing: Boolean; + function CanEdit: Boolean; dynamic; + + // grid layout routines + function RowsPerHour: Integer; + function RowCount: Integer; + function PossVisibleRows: Integer; + function VisibleRows: Integer; + function FullVisibleRows: Integer; + function VisibleCols: Integer; + function FullVisibleCols: Integer; + function RowToTime(RowNum: Integer): TTime; + function TimeToRow(ATime: TTime): Integer; + procedure TimeToTop(ATime: TTime); + function AdjustEndTime(ATime: TTime): TTime; dynamic; + function RowStartsHour(RowNum: Integer): Boolean; + function RowEndsHour(RowNum: Integer): Boolean; + function RowEndTime(RowNum: Integer): TTime; + + function RowToHour(RowNum: Integer): Word; + function HourStartRow(Hour: Word): Integer; + function HourEndRow(Hour: Word): Integer; + + property State: TJvTFDaysState read FState; + function BottomRow: Integer; + function RightCol: Integer; + property SelAppt: TJvTFAppt read FSelAppt write SetSelAppt; + property FocusedSchedule: TJvTFSched read GetFocusedSchedule; + + procedure DragDrop(Source: TObject; X, Y: Integer); override; + procedure CalcStartEndRows(AAppt: TJvTFAppt; SchedDate: TDate; + var StartRow, EndRow: Integer); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + function IsWeekend(ColIndex: Integer): Boolean; + {$ENDIF Jv_TIMEBLOCKS} + + // date navigation methods + procedure PrevDate; + procedure NextDate; + procedure GotoDate(aDate: TDate); + procedure ScrollDays(NumDays: Integer); + procedure ScrollMonths(NumMonths: Integer); + procedure ScrollYears(NumYears: Integer); + + procedure ReleaseSchedule(const SchedName: string; SchedDate: TDate); override; + procedure RowInView(ARow: Integer); + procedure ColInView(ACol: Integer); + + // selection properties and methods + property FocusedCol: Integer read GetFocusedCol write SetFocusedCol; + property FocusedRow: Integer read GetFocusedRow write SetFocusedRow; + property SelStart: TPoint read GetSelStart write SetSelStart; + property SelEnd: TPoint read GetSelEnd write SetSelEnd; + function CellIsSelected(ACell: TPoint): Boolean; + function ColIsSelected(ACol: Integer): Boolean; + function RowIsSelected(ARow: Integer): Boolean; + procedure ClearSelection; + function ValidSelection: Boolean; + procedure SelFirstAppt; + procedure SelPrevAppt; + procedure SelNextAppt; + procedure SelLastAppt; + procedure SelFirstApptNextCol; + procedure SelFirstApptPrevCol; + procedure ApptInView(AAppt: TJvTFAppt; ACol: Integer); + procedure SelApptCell(AAppt: TJvTFAppt; ACol: Integer); + function GroupHdrIsSelected(ACol: Integer): Boolean; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + function BlockHdrIsSelected(ARow: Integer): Boolean; + {$ENDIF Jv_TIMEBLOCKS} + + function EnumSelCells: TDynPointArray; + function EnumSelCols: TDynIntArray; + function EnumSelRows: TDynIntArray; + + function GetApptDispColor(Appt: TJvTFAppt; Selected: Boolean): TColor; + published + property DitheredBackground: Boolean read FDitheredBackground write SetDitheredBackground default True; +// property BorderStyle: TBorderStyle read FBorderStyle write SetBorderStyle default bsSingle; + // grid layout properties + property AutoSizeCols: Boolean read FAutoSizeCols write SetAutoSizeCols default True; + property Granularity: Integer read FGranularity write SetGranularity default 30; + property ColHdrHeight: Integer read FColHdrHeight write SetColHdrHeight default 25; + property Cols: TJvTFDaysCols read FCols write SetCols; + property DefColWidth: Integer read FDefColWidth write FDefColWidth default 100; + property MinColWidth: Integer read FMinColWidth write SetMinColWidth default AbsMinColWidth; + property MinRowHeight: Integer read FMinRowHeight write SetMinRowHeight default 12; + property Options: TJvTFDaysOptions read FOptions write SetOptions + default [agoSizeCols, agoSizeRows, agoSizeColHdr, agoSizeRowHdr, + agoSizeAppt, agoMoveAppt, agoEditing, agoShowPics, + agoShowText, agoShowApptHints, agoQuickEntry, agoShowSelHint]; + property RowHdrWidth: Integer read FRowHdrWidth write SetRowHdrWidth default 50; + property RowHeight: Integer read FRowHeight write SetRowHeight default 19; + property ShowFocus:Boolean read FShowFocus write SetShowFocus default True; + property Template: TJvTFDaysTemplate read FTemplate write FTemplate; + property Grouping: TJvTFDaysGrouping read FGrouping write SetGrouping; + property GroupHdrHeight: Integer read FGroupHdrHeight write SetGroupHdrHeight default 25; + + property GridStartTime: TTime read FGridStartTime write SetGridStartTime; + property GridEndTime: TTime read FGridEndTime write SetGridEndTime; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + property TimeBlocks: TJvTFDaysTimeBlocks read FTimeBlocks write SetTimeBlocks; + property TimeBlockProps: TJvTFDaysBlockProps read FTimeBlockProps write SetTimeBlockProps; + {$ENDIF Jv_TIMEBLOCKS} + + // visual appearance properties + property ApptAttr: TJvTFDaysApptAttr read FApptAttr write SetApptAttr; + property SelApptAttr: TJvTFDaysApptAttr read FSelApptAttr write SetSelApptAttr; + property HdrAttr: TJvTFDaysHdrAttr read FHdrAttr write SetHdrAttr; + property SelHdrAttr: TJvTFDaysHdrAttr read FSelHdrAttr write SetSelHdrAttr; + property FancyRowHdrAttr: TJvTFDaysFancyRowHdrAttr read FFancyRowHdrAttr + write SetFancyRowHdrAttr; + property SelFancyRowHdrAttr: TJvTFDaysFancyRowHdrAttr + read FSelFancyRowHdrAttr write SetSelFancyRowHdrAttr; + property SelCellAttr: TJvTFSelCellAttr read FSelCellAttr write SetTFSelCellAttr; + + property ApptBar: TJvTFDaysApptBar read FApptBar write SetApptBar; + property ApptBuffer: Integer read FApptBuffer write SetApptBuffer default 5; + property ColTitleStyle: TJvTFColTitleStyle read FColTitleStyle + write SetTFColTitleStyle default ctsSingleEllipsis; + property GrabHandles: TJvTFDaysGrabHandles read FGrabHandles + write SetGrabHandles; + property GridLineColor: TColor read FGridLineColor write SetGridLineColor + default clGray; + property PrimeTime: TJvTFDaysPrimeTime read FPrimeTime write FPrimeTime; + property RowHdrType: TJvTFRowHdrType read FRowHdrType write SetTFRowHdrType + default rhFancy; + property Thresholds: TJvTFDaysThresholds read FThresholds write FThresholds; + property HintProps: TJvTFHintProps read FHintProps + write SetTFHintProps; + property GroupHdrAttr: TJvTFDaysHdrAttr read FGroupHdrAttr + write SetGroupHdrAttr; + property SelGroupHdrAttr: TJvTFDaysHdrAttr read FSelGroupHdrAttr + write SetSelGroupHdrAttr; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + property Weekend: TTFDaysOfWeek read FWeekend write SetWeekend + default [dowSunday, dowSaturday]; + property WeekendColor: TColor read FWeekendColor write SetWeekendColor default clSilver; + {$ENDIF Jv_TIMEBLOCKS} + + // navigation/selection properties + property LeftCol: Integer read FLeftCol write SetLeftCol; + property TopRow: Integer read FTopRow write SetTopRow default 0; + + // Drag/Drop events + property OnDropAppt: TJvTFDropApptEvent read FOnDropAppt write FOnDropAppt; + property OnSizeAppt: TJvTFSizeApptEvent read FOnSizeAppt write FOnSizeAppt; + + // Grid Layout events + property OnSizeCol: TJvTFDragRowColEvent read FOnSizeCol write FOnSizeCol; + property OnSizeRow: TJvTFDragRowColEvent read FOnSizeRow write FOnSizeRow; + property OnSizeColHdr: TJvTFDragRowColEvent read FOnSizeColHdr write FOnSizeColHdr; + property OnSizeRowHdr: TJvTFDragRowColEvent read FOnSizeRowHdr write FOnSizeRowHdr; + property OnMoveCol: TJvTFDragRowColEvent read FOnMoveCol write FOnMoveCol; + + property OnDateChanging: TJvTFDateChangingEvent read FOnDateChanging + write FOnDateChanging; + property OnDateChanged: TNotifyEvent read FOnDateChanged write FOnDateChanged; + property OnGranularityChanging: TJvTFGranChangingEvent read FOnGranularityChanging + write FOnGranularityChanging; + property OnGranularityChanged: TNotifyEvent read FOnGranularityChanged + write FOnGranularityChanged; + + // Custom draw events + property OnDrawAppt: TJvTFDrawApptEvent read FOnDrawAppt write FOnDrawAppt; + property OnDrawApptBar: TJvTFDrawApptBarEvent read FOnDrawApptBar + write FOnDrawApptBar; + property OnDrawColHdr: TJvTFDrawHdrEvent read FOnDrawColHdr write FOnDrawColHdr; + property OnDrawCorner: TJvTFDrawCornerEvent read FOnDrawCorner + write FOnDrawCorner; + property OnDrawDataCell: TJvTFDrawDataCellEvent read FOnDrawDataCell + write FOnDrawDataCell; + property OnDrawGrabHandle: TJvTFDrawGrabHandleEvent read FOnDrawGrabHandle + write FOnDrawGrabHandle; + property OnDrawMajorRowHdr: TJvTFDrawHdrEvent read FOnDrawMajorRowHdr + write FOnDrawMajorRowHdr; + property OnDrawMinorRowHdr: TJvTFDrawHdrEvent read FOnDrawMinorRowHdr + write FOnDrawMinorRowHdr; + property OnDrawRowHdr: TJvTFDrawHdrEvent read FOnDrawRowHdr write FOnDrawRowHdr; + property OnDrawGroupHdr: TJvTFDrawHdrEvent read FOnDrawGroupHdr + write FOnDrawGroupHdr; + property OnShadeCell: TJvTFShadeCellEvent read FOnShadeCell write FOnShadeCell; + property OnGetApptDrawInfo: TJvTFGetDaysApptDrawInfoEvent read FOnGetApptDrawInfo + write FOnGetApptDrawInfo; + + // Input events + property OnFailEditor: TJvTFFailEditorEvent read FOnFailEditor write FOnFailEditor; + property OnInsertAppt: TNotifyEvent read FOnInsertAppt write FOnInsertAppt; + property OnInsertSchedule: TNotifyEvent read FOnInsertSchedule + write FOnInsertSchedule; + property OnDeleteAppt: TNotifyEvent read FOnDeleteAppt write FOnDeleteAppt; + property OnDeleteSchedule: TNotifyEvent read FOnDeleteSchedule + write FOnDeleteSchedule; + property OnCreateQuickEntry: TJvTFCreateQuickEntryEvent read FOnCreateQuickEntry + write FOnCreateQuickEntry; + property OnQuickEntry: TNotifyEvent read FOnQuickEntry write FOnQuickEntry; + property OnBeginEdit: TJvTFBeginEditEvent read FOnBeginEdit write FOnBeginEdit; + + // Help and Hint events + property OnShowHint: TJvTFShowHintEvent read GetOnShowHint + write SetOnShowHint; + + // Misc events + property OnSelectingAppt: TJvTFVarApptEvent read FOnSelectingAppt + write FOnSelectingAppt; + property OnSelectAppt: TJvTFSelecTJvTFApptEvent read FOnSelectAppt + write FOnSelectAppt; + property OnSelectedAppt: TNotifyEvent read FOnSelectedAppt + write FOnSelectedAppt; + //property OnUpdateColTitle: TJvTFUpdateTitleEvent read FOnUpdateColTitle + //write FOnUpdateColTitle; + property OnUpdateColTitles: TJvTFUpdateTitlesEvent read FOnUpdateColTitles + write FOnUpdateColTitles; + property OnFocusedRowChanged: TNotifyEvent read FOnFocusedRowChanged + write FOnFocusedRowChanged; + property OnFocusedColChanged: TNotifyEvent read FOnFocusedColChanged + write FOnFocusedColChanged; + + //Inherited properties + property DateFormat; // from TJvTFControl + property TimeFormat; // from TJvTFControl +// property Navigator; // from TJvTFControl +// property OnNavigate; // from TJvTFControl + + property Align; + property BorderSpacing; + property BorderStyle; + property Color default clSilver; + property ParentColor default False; + property Font; + property ParentFont; + property TabStop; + property TabOrder; + property Anchors; + property Constraints; + property DragKind; + property DragCursor; + property DragMode; + property Enabled; + property ParentShowHint; + property PopupMenu; + property ShowHint; + property Visible; + + property OnClick; + property OnDblClick; + property OnDragDrop; + property OnDragOver; + property OnEndDrag; + property OnEnter; + property OnExit; + property OnKeyDown; + property OnKeyPress; + property OnKeyUp; + property OnMouseDown; + property OnMouseMove; + property OnMouseUp; + property OnMouseWheelDown; + property OnMouseWheelUp; + property OnEndDock; + property OnStartDock; + property OnStartDrag; + end; + + TJvTFDaysPrinterPageLayout = class(TJvTFPrinterPageLayout) + private + FColsPerPage: Integer; + FRowsPerPage: Integer; + FAlwaysShowColHdr: Boolean; + FAlwaysShowRowHdr: Boolean; + procedure SetColsPerPage(Value: Integer); + procedure SetRowsPerPage(Value: Integer); + procedure SetAlwaysShowColHdr(Value: Boolean); + procedure SetAlwaysShowRowHdr(Value: Boolean); + public + procedure Assign(Source: TPersistent); override; + published + property ColsPerPage: Integer read FColsPerPage write SetColsPerPage; + property RowsPerPage: Integer read FRowsPerPage write SetRowsPerPage; + property AlwaysShowColHdr: Boolean read FAlwaysShowColHdr + write SetAlwaysShowColHdr; + property AlwaysShowRowHdr: Boolean read FAlwaysShowRowHdr + write SetAlwaysShowRowHdr; + end; + + TJvTFDaysPageInfo = class(TObject) + private + FPageNum: Integer; + FStartRow: Integer; + FEndRow: Integer; + FStartCol: Integer; + FEndCol: Integer; + FRowHeight: Integer; + FColWidth: Integer; + FShowRowHdr: Boolean; + FShowColHdr: Boolean; + public + property PageNum: Integer read FPageNum write FPageNum; + property StartRow: Integer read FStartRow write FStartRow; + property EndRow: Integer read FEndRow write FEndRow; + property StartCol: Integer read FStartCol write FStartCol; + property EndCol: Integer read FEndCol write FEndCol; + property RowHeight: Integer read FRowHeight write FRowHeight; + property ColWidth: Integer read FColWidth write FColWidth; + property ShowRowHdr: Boolean read FShowRowHdr write FShowRowHdr; + property ShowColHdr: Boolean read FShowColHdr write FShowColHdr; + end; + + TJvTFDaysPrinter = class(TJvTFPrinter) + private + FApptCount: Integer; + FApptAttr: TJvTFDaysApptAttr; + FApptBar: TJvTFDaysApptBar; + FApptBuffer: Integer; + FColHdrHeight: Integer; + FColor: TColor; + FCols: TJvTFDaysCols; + FColTitleStyle: TJvTFColTitleStyle; + FFancyRowHdrAttr: TJvTFDaysFancyRowHdrAttr; + FGranularity: Integer; + FGridLineColor: TColor; + FGroupHdrAttr: TJvTFDaysHdrAttr; + FGroupHdrHeight: Integer; + FGrouping: TJvTFDaysGrouping; + FHdrAttr: TJvTFDaysHdrAttr; + FMinColWidth: Integer; + FMinRowHeight: Integer; + FPrimeTime: TJvTFDaysPrimeTime; + FRowHdrType: TJvTFRowHdrType; + FRowHdrWidth: Integer; + FRowHeight: Integer; + FShowPics: Boolean; + FShowText: Boolean; + FFormattedDesc: Boolean; + FThresholds: TJvTFDaysThresholds; + FOnDrawCorner: TJvTFDrawCornerEvent; + //FOnUpdateColTitle: TJvTFUpdateTitleEvent; + FOnUpdateColTitles: TJvTFUpdateTitlesEvent; + FOnDrawColHdr: TJvTFDrawHdrEvent; + FOnDrawGroupHdr: TJvTFDrawHdrEvent; + FOnDrawRowHdr: TJvTFDrawHdrEvent; + FOnDrawMinorRowHdr: TJvTFDrawHdrEvent; + FOnDrawMajorRowHdr: TJvTFDrawHdrEvent; + FOnDrawDataCell: TJvTFDrawDataCellEvent; + FOnDrawAppt: TJvTFDrawApptEvent; + FOnDrawApptBar: TJvTFDrawApptBarEvent; + FOnGetApptDrawInfo: TJvTFGetDaysApptDrawInfoEvent; + FOnShadeCell: TJvTFShadeCellEvent; + FOnApptProgress: TJvTFProgressEvent; + FGridStartTime: TTime; + FGridEndTime: TTime; + procedure SetApptAttr(Value: TJvTFDaysApptAttr); + procedure SetApptBar(Value: TJvTFDaysApptBar); + procedure SetApptBuffer(Value: Integer); + procedure SetColHdrHeight(Value: Integer); + procedure SetColor(Value: TColor); + procedure SetCols(Value: TJvTFDaysCols); + procedure SetTFColTitleStyle(Value: TJvTFColTitleStyle); + procedure SetFancyRowHdrAttr(Value: TJvTFDaysFancyRowHdrAttr); + procedure SetGranularity(Value: Integer); + procedure SetGridLineColor(Value: TColor); + procedure SetGroupHdrAttr(Value: TJvTFDaysHdrAttr); + procedure SetGroupHdrHeight(Value: Integer); + procedure SetGrouping(Value: TJvTFDaysGrouping); + procedure SetHdrAttr(Value: TJvTFDaysHdrAttr); + procedure SetMinColWidth(Value: Integer); + procedure SetMinRowHeight(Value: Integer); + procedure SetPrimeTime(Value: TJvTFDaysPrimeTime); + procedure SetTFRowHdrType(Value: TJvTFRowHdrType); + procedure SetRowHdrWidth(Value: Integer); + procedure SetRowHeight(Value: Integer); + procedure SetShowPics(Value: Boolean); + procedure SetShowText(Value: Boolean); + procedure SetThresholds(Value: TJvTFDaysThresholds); + procedure SetFormattedDesc(Value: Boolean); + function GetApptCount: Integer; + procedure SetGridStartTime(Value: TTime); + procedure SetGridEndTime(Value: TTime); + protected + FPageInfoList: TStringList; + FApptsDrawn: Integer; + FValidPageInfo: Boolean; + procedure SetMeasure(Value: TJvTFPrinterMeasure); override; + procedure DrawBody(ACanvas: TCanvas; ARect: TRect; PageNum: Integer); override; + + procedure Loaded; override; + + // Drawing routines + procedure DrawCorner(ACanvas: TCanvas); + procedure DrawFrame(ACanvas: TCanvas; ARect: TRect; Draw3D: Boolean); + procedure DrawEmptyColHdr(ACanvas: TCanvas; PageInfo: TJvTFDaysPageInfo); + //procedure DrawColHdr(ACanvas: TCanvas; Index: Integer; + //PageInfo: TJvTFDaysPageInfo); + procedure DrawColGroupHdr(ACanvas: TCanvas; Index: Integer; + PageInfo: TJvTFDaysPageInfo; IsGroupHdr: Boolean); + procedure DrawRowHdr(ACanvas: TCanvas; Index: Integer; + PageInfo: TJvTFDaysPageInfo); + procedure DrawGroupHdrs(ACanvas: TCanvas; PageInfo: TJvTFDaysPageInfo); + + procedure DrawFancyRowHdrs(ACanvas: TCanvas; PageInfo: TJvTFDaysPageInfo); + procedure DrawMinor(ACanvas: TCanvas; ARect: TRect; RowNum: Integer; + const LabelStr: string; TickLength: Integer); + function GetMinorLabel(RowNum: Integer; PageInfo: TJvTFDaysPageInfo): string; + function GetMinorTickLength(ACanvas: TCanvas): Integer; virtual; + function GetMajorTickLength: Integer; virtual; + + procedure DrawDataCell(ACanvas: TCanvas; ColIndex, RowIndex: Integer; + PageInfo: TJvTFDaysPageInfo); + procedure DrawAppts(ACanvas: TCanvas; DrawAll: Boolean; + PageInfo: TJvTFDaysPageInfo); + procedure PrintBitmap(ACanvas: TCanvas; SourceRect, DestRect: TRect; + aBitmap: TBitmap); + procedure DrawAppt(ACanvas: TCanvas; Col: Integer; Appt: TJvTFAppt; + StartRow, EndRow: Integer; PageInfo: TJvTFDaysPageInfo); + procedure DrawApptDetail(ACanvas: TCanvas; ARect: TRect; Appt: TJvTFAppt; + Col, StartRow, EndRow: Integer); + procedure DrawApptBar(ACanvas: TCanvas; Appt: TJvTFAppt; BarRect: TRect; + Col, StartRow, EndRow: Integer); + function CalcTimeStampRect(Appt: TJvTFAppt; BarRect: TRect; + Col, StartRow, EndRow: Integer): TRect; + procedure DrawTimeStamp(ACanvas: TCanvas; TimeStampRect: TRect); + procedure GetApptDrawInfo(DrawInfo: TJvTFDaysApptDrawInfo; Appt: TJvTFAppt); + + procedure CreatePicDrawList(ARect: TRect; Appt: TJvTFAppt; DrawList: TList); + procedure FilterPicDrawList(ARect: TRect; DrawList: TList; + var PicsHeight: Integer; var PicsWidth: Integer); + procedure CanDrawWhat(ACanvas: TCanvas; ApptRect: TRect; + PicsHeight, PicsWidth: Integer; var CanDrawText, CanDrawPics: Boolean); + procedure DrawListPics(ACanvas: TCanvas; var ARect: TRect; DrawList: TList); + procedure ClearPicDrawList(DrawList: TList); + + function GetDataWidth(ShowRowHdr: Boolean): Integer; + function GetDataHeight(ShowColHdr: Boolean): Integer; + procedure EnsureRow(RowNum: Integer); + procedure CreateLayout; override; + procedure ClearPageInfo; + procedure CalcPageInfo; dynamic; + procedure CalcPageRowInfo(ShowColHdrs: Boolean; var CalcRowsPerPage, + CalcRowHeight: Integer); + procedure CalcPageColInfo(ShowRowHdrs: Boolean; var CalcColsPerPage, + CalcColWidth: Integer); + function GetPageLayout: TJvTFDaysPrinterPageLayout; + procedure SetPageLayout(Value: TJvTFDaysPrinterPageLayout); + procedure CreateDoc; override; + function GetPageInfo(PageNum: Integer): TJvTFDaysPageInfo; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + procedure SetProperties(aJvTFDays: TJvTFDays); dynamic; + function RowCount: Integer; + function TimeToRow(ATime: TTime): Integer; + function RowToTime(RowNum: Integer): TTime; + function RowToHour(RowNum: Integer): Word; + function RowStartsHour(RowNum: Integer): Boolean; + function RowEndsHour(RowNum: Integer): Boolean; + function HourStartRow(Hour: Word): Integer; + function HourEndRow(Hour: Word): Integer; + function RowEndTime(RowNum: Integer): TTime; + function AdjustEndTime(ATime: TTime): TTime; + function DaysPageLayout: TJvTFDaysPrinterPageLayout; + function CellRect(Col, Row: Integer; PageInfo: TJvTFDaysPageInfo): TRect; + function GetApptRect(Col: Integer; Appt: TJvTFAppt; + PageInfo: TJvTFDaysPageInfo): TRect; + function GetApptDispColor(Appt: TJvTFAppt): TColor; + procedure CalcStartEndRows(AAppt: TJvTFAppt; SchedDate: TDate; + var StartRow, EndRow: Integer); + procedure Prepare; dynamic; + property ApptCount: Integer read GetApptCount; + property PageInfo[PageNum: Integer]: TJvTFDaysPageInfo read GetPageInfo; + procedure FreeDoc; override; + procedure PrintDirect; virtual; + function CalcGroupHdrHeight: Integer; + function CalcGroupColHdrsHeight: Integer; + function VirtualGroupHdrRect(Col: Integer; APageInfo: TJvTFDaysPageInfo): TRect; + procedure GetGroupStartEndCols(Col: Integer; var StartCol, EndCol: Integer); + published + property PageLayout: TJvTFDaysPrinterPageLayout read GetPageLayout + write SetPageLayout; + property ApptAttr: TJvTFDaysApptAttr read FApptAttr write SetApptAttr; + property ApptBar: TJvTFDaysApptBar read FApptBar write SetApptBar; + property ApptBuffer: Integer read FApptBuffer write SetApptBuffer; + property ColHdrHeight: Integer read FColHdrHeight write SetColHdrHeight; + property Color: TColor read FColor write SetColor; + property Cols: TJvTFDaysCols read FCols write SetCols; + property ColTitleStyle: TJvTFColTitleStyle read FColTitleStyle + write SetTFColTitleStyle; + property DateFormat; // inherited + property FancyRowHdrAttr: TJvTFDaysFancyRowHdrAttr read FFancyRowHdrAttr + write SetFancyRowHdrAttr; + property FormattedDesc: Boolean read FFormattedDesc write SetFormattedDesc; + property Granularity: Integer read FGranularity write SetGranularity; + property GridLineColor: TColor read FGridLineColor write SetGridLineColor; + property GroupHdrAttr: TJvTFDaysHdrAttr read FGroupHdrAttr + write SetGroupHdrAttr; + property GroupHdrHeight: Integer read FGroupHdrHeight + write SetGroupHdrHeight default 25; + property Grouping: TJvTFDaysGrouping read FGrouping write SetGrouping; + property HdrAttr: TJvTFDaysHdrAttr read FHdrAttr write SetHdrAttr; + property MinColWidth: Integer read FMinColWidth write SetMinColWidth; + property MinRowHeight: Integer read FMinRowHeight write SetMinRowHeight; + property PrimeTime: TJvTFDaysPrimeTime read FPrimeTime write SetPrimeTime; + property RowHdrType: TJvTFRowHdrType read FRowHdrType write SetTFRowHdrType; + property RowHdrWidth: Integer read FRowHdrWidth write SetRowHdrWidth; + property RowHeight: Integer read FRowHeight write SetRowHeight; + property ShowPics: Boolean read FShowPics write SetShowPics; + property ShowText: Boolean read FShowText write SetShowText; + property Thresholds: TJvTFDaysThresholds read FThresholds + write SetThresholds; + property TimeFormat; // inherited; + property OnDrawCorner: TJvTFDrawCornerEvent read FOnDrawCorner + write FOnDrawCorner; + property OnDrawGroupHdr: TJvTFDrawHdrEvent read FOnDrawGroupHdr + write FOnDrawGroupHdr; + property OnDrawMinorRowHdr: TJvTFDrawHdrEvent read FOnDrawMinorRowHdr + write FOnDrawMinorRowHdr; + property OnDrawMajorRowHdr: TJvTFDrawHdrEvent read FOnDrawMajorRowHdr + write FOnDrawMajorRowHdr; + //property OnUpdateColTitle: TJvTFUpdateTitleEvent read FOnUpdateColTitle + //write FOnUpdateColTitle; + property OnUpdateColTitles: TJvTFUpdateTitlesEvent read FOnUpdateColTitles + write FOnUpdateColTitles; + property OnDrawColHdr: TJvTFDrawHdrEvent read FOnDrawColHdr write FOnDrawColHdr; + property OnDrawRowHdr: TJvTFDrawHdrEvent read FOnDrawRowHdr write FOnDrawRowHdr; + property OnDrawDataCell: TJvTFDrawDataCellEvent read FOnDrawDataCell + write FOnDrawDataCell; + property OnDrawAppt: TJvTFDrawApptEvent read FOnDrawAppt write FOnDrawAppt; + property OnDrawApptBar: TJvTFDrawApptBarEvent read FOnDrawApptBar + write FOnDrawApptBar; + property OnGetApptDrawInfo: TJvTFGetDaysApptDrawInfoEvent read FOnGetApptDrawInfo + write FOnGetApptDrawInfo; + property OnShadeCell: TJvTFShadeCellEvent read FOnShadeCell write FOnShadeCell; + property OnApptProgress: TJvTFProgressEvent read FOnApptProgress + write FOnApptProgress; + property GridStartTime: TTime read FGridStartTime write SetGridStartTime; + property GridEndTime: TTime read FGridEndTime write SetGridEndTime; + end; + + +implementation + +uses + JvResources; + +//Type + // DEF TIMEBLOCK (not conditionally compiled, just marked for reference) + // removed as part of TimeBlock integration + //TVertAlignment = (vaTop, vaCenter, vaBottom); + +// Utility routines +// Most, if not all, of these will be moved out of this unit and into +// a utilities unit. + +function StripCRLF(const S: string): string; +var + I: Integer; +begin + Result := ''; + for I := 1 to Length(S) do + if (S[I] <> #13) and (S[I] <> #10) then + Result := Result + S[I]; +end; + +function EmptyRect: TRect; +begin + Result := Classes.Rect(0, 0, 0, 0); +end; + +function RectWidth(ARect: TRect): Integer; +begin + Result := ARect.Right - ARect.Left; +end; + +function RectHeight(ARect: TRect): Integer; +begin + Result := ARect.Bottom - ARect.Top; +end; + +// DEF TIMEBLOCK (not conditionally compiled, just marked for reference) +// the type of VAlign was orginally TVertAlignment + +procedure DrawTxt(ACanvas: TCanvas; ARect: TRect; + const Txt: string; HAlign: TAlignment; VAlign: TJvTFVAlignment); +var + TxtWidth, TxtHeight, TxtLeft, TxtTop: Integer; +begin + TxtLeft := 0; + TxtTop := 0; + TxtWidth := ACanvas.TextWidth(Txt); + TxtHeight := ACanvas.TextHeight('Wq'); + + case HAlign of + taLeftJustify: + TxtLeft := ARect.Left; + taCenter: + TxtLeft := ARect.Left + RectWidth(ARect) div 2 - TxtWidth div 2; + taRightJustify: + TxtLeft := ARect.Right - TxtWidth; + end; + + case VAlign of + vaTop: + TxtTop := ARect.Top; + vaCenter: + TxtTop := ARect.Top + RectHeight(ARect) div 2 - TxtHeight div 2; + vaBottom: + TxtTop := ARect.Bottom - TxtHeight; + end; + + ACanvas.TextRect(ARect, TxtLeft, TxtTop, Txt); +end; + +function Greater(I1, I2: Integer): Integer; +begin + if I1 > I2 then + Result := I1 + else + Result := I2; +end; + +function Lesser(I1, I2: Integer): Integer; +begin + if I1 < I2 then + Result := I1 + else + Result := I2; +end; + +//=== { TJvTFDaysTemplate } ================================================== + +constructor TJvTFDaysTemplate.Create(AApptGrid: TJvTFDays); +begin + inherited Create; + FGrid := AApptGrid; + + FCompNames := TJvTFCompNamesList.Create; + FCompNames.OnChange := @CompNamesChanged; + FCompNames.OnMove := @CompNamesMoved; + + FLinearStartDate := Date; + FLinearEndDate := Date; + FLinearDayCount := 1; + FCompDate := Date; + FActiveTemplate := agtNone; + FShortTitles := True; +end; + +destructor TJvTFDaysTemplate.Destroy; +begin + FCompNames.OnChange := nil; + FCompNames.OnMove := nil; + FCompNames.Free; + inherited Destroy; +end; + +procedure TJvTFDaysTemplate.SetActiveTemplate(Value: TJvTFDaysTemplates); +begin + if Value <> FActiveTemplate then + begin + FActiveTemplate := Value; + UpdateGrid; + end; +end; + +procedure TJvTFDaysTemplate.SetCompDate(Value: TDate); +var + I: Integer; +begin + if Trunc(Value) <> Trunc(FCompDate) then + begin + DoDateChangingEvent(Value); + + FCompDate := Value; + if (ActiveTemplate = agtComparative) and Assigned(FGrid) then + try + BeginGridUpdate; + for I := 0 to FGrid.Cols.Count - 1 do + FGrid.Cols[I].SchedDate := CompDate; + finally + EndGridUpdate; + end; + + DoDateChangedEvent; + end; +end; + +function TJvTFDaysTemplate.GetCompNames: TStrings; +begin + Result := FCompNames; +end; + +procedure TJvTFDaysTemplate.SetCompNames(Value: TStrings); +begin + FCompNames.Assign(Value); + CompNamesChanged(Self); +end; + +procedure TJvTFDaysTemplate.SetLinearDayCount(Value: Integer); +begin + if Value < 1 then + Value := 1; + + if (Value <> FLinearDayCount) then + begin + FLinearDayCount := Value; + if not (csLoading in FGrid.ComponentState) then + begin + FLinearEndDate := FLinearStartDate + Value - 1; + LinearDaysChanged; + end; + end; +end; + +procedure TJvTFDaysTemplate.SetLinearEndDate(Value: TDate); +begin + if Trunc(Value) < Trunc(FLinearStartDate) then + Value := FLinearStartDate; + + if (Trunc(Value) <> Trunc(FLinearEndDate)) then + begin + FLinearEndDate := Value; + if not (csLoading in FGrid.ComponentState) then + begin + FLinearDayCount := Trunc(FLinearEndDate - FLinearStartDate + 1); + LinearDaysChanged; + end; + end; +end; + +procedure TJvTFDaysTemplate.SetLinearName(const Value: string); +var + I: Integer; +begin + if Value <> FLinearName then + begin + FLinearName := Value; + if (ActiveTemplate = agtLinear) and Assigned(FGrid) then + begin + try + BeginGridUpdate; + + for I := 0 to FGrid.Cols.Count - 1 do + FGrid.Cols[I].SchedName := Value; + finally + EndGridUpdate; + end; + end; + end; +end; + +procedure TJvTFDaysTemplate.SetLinearStartDate(Value: TDate); +var + I: Integer; +begin + if Trunc(Value) <> Trunc(FLinearStartDate) then + begin + DoDateChangingEvent(Value); + + FLinearStartDate := Value; + FLinearEndDate := Value + FLinearDayCount - 1; + if (ActiveTemplate = agtLinear) and Assigned(FGrid) then + begin + BeginGridUpdate; + try + for I := 0 to FGrid.Cols.Count - 1 do + FGrid.Cols[I].SchedDate := Value + I; + finally + EndGridUpdate; + end; + end; + + DoDateChangedEvent; + end; +end; + +procedure TJvTFDaysTemplate.SetShortTitles(Value: Boolean); +begin + if Value <> FShortTitles then + begin + FShortTitles := Value; + if Assigned(FGrid) and (ActiveTemplate <> agtNone) then + FGrid.Cols.UpdateTitles; + end; +end; + +procedure TJvTFDaysTemplate.DoDateChangedEvent; +begin + if Assigned(FGrid) and Assigned(FGrid.FOnDateChanged) then + FGrid.FOnDateChanged(FGrid); +end; + +procedure TJvTFDaysTemplate.DoDateChangingEvent(var NewDate: TDate); +begin + if Assigned(FGrid) and Assigned(FGrid.FOnDateChanging) then + FGrid.FOnDateChanging(FGrid, NewDate); +end; + +procedure TJvTFDaysTemplate.CompNamesChanged(Sender: TObject); +var + TempNames: TStringList; + I: Integer; + Col: TJvTFDaysCol; +begin + if FUpdatingCompNames then + begin + FCompNamesChanged := True; + Exit; + end; + + FCompNamesChanged := False; + if (ActiveTemplate = agtComparative) and Assigned(FGrid) then + begin + TempNames := TStringList.Create; + try + BeginGridUpdate; + + // remove any unneeded cols + I := 0; + while I < FGrid.Cols.Count do + if CompNames.IndexOf(FGrid.Cols[I].SchedName) = -1 then + FGrid.Cols[I].Free + else + begin + TempNames.Add(FGrid.Cols[I].SchedName); + Inc(I); + end; + + // add all new cols + for I := 0 to CompNames.Count - 1 do + if TempNames.IndexOf(CompNames[I]) = -1 then + begin + Col := FGrid.Cols.Add; + Col.SchedName := CompNames[I]; + Col.SchedDate := CompDate; + end; + finally + TempNames.Free; + EndGridUpdate; + end; + end; +end; + +procedure TJvTFDaysTemplate.LinearDaysChanged; +var + I, DeltaDays: Integer; + Col: TJvTFDaysCol; +begin + if (ActiveTemplate = agtLinear) and Assigned(FGrid) then + begin + try + BeginGridUpdate; + + DeltaDays := LinearDayCount - FGrid.Cols.Count; + + // ONLY ONE OF THE FOLLOWING LOOPS WILL BE EXECUTED !! + // Add some days + for I := 1 to DeltaDays do + begin + Col := FGrid.Cols.Add; + Col.SchedName := LinearName; + Col.SchedDate := LinearStartDate + FGrid.Cols.Count - 1; + end; + + // Remove some days + for I := -1 downto DeltaDays do + if FGrid.Cols.Count > 0 then + FGrid.Cols[FGrid.Cols.Count - 1].Free; + finally + EndGridUpdate; + end; + end; +end; + +procedure TJvTFDaysTemplate.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysTemplate then + begin + FLinearName := TJvTFDaysTemplate(Source).LinearName; + FLinearStartDate := TJvTFDaysTemplate(Source).LinearStartDate; + FLinearEndDate := TJvTFDaysTemplate(Source).LinearEndDate; + FLinearDayCount := TJvTFDaysTemplate(Source).LinearDayCount; + FCompNames.OnChange := nil; + FCompNames.Assign(TJvTFDaysTemplate(Source).CompNames); + FCompNames.OnChange := @CompNamesChanged; + FCompDate := TJvTFDaysTemplate(Source).CompDate; + FActiveTemplate := TJvTFDaysTemplate(Source).ActiveTemplate; + FShortTitles := TJvTFDaysTemplate(Source).ShortTitles; + FIgnoreNav := TJvTFDaysTemplate(Source).IgnoreNav; + UpdateGrid; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDaysTemplate.BeginCompNamesUpdate; +begin + FUpdatingCompNames := True; +end; + +procedure TJvTFDaysTemplate.EndCompNamesUpdate; +begin + FUpdatingCompNames := False; + if FCompNamesChanged then + CompNamesChanged(Self); +end; + +procedure TJvTFDaysTemplate.UpdateGrid; +var + I: Integer; + Col: TJvTFDaysCol; +begin + if not Assigned(FGrid) then + Exit; + + if ActiveTemplate = agtLinear then + begin + try + BeginGridUpdate; + + FGrid.Cols.Clear; + for I := 0 to LinearDayCount - 1 do + begin + Col := FGrid.Cols.Add; + Col.SchedName := LinearName; + Col.SchedDate := LinearStartDate + I; + end; + finally + EndGridUpdate; + end + end + else + if ActiveTemplate = agtComparative then + begin + try + BeginGridUpdate; + FGrid.Cols.Clear; + for I := 0 to CompNames.Count - 1 do + begin + Col := FGrid.Cols.Add; + Col.SchedName := CompNames[I]; + Col.SchedDate := CompDate; + end; + finally + EndGridUpdate; + end; + end; + + FGrid.Cols.UpdateTitles; +end; + +procedure TJvTFDaysTemplate.CompNamesMoved(Sender: TObject; + CurIndex, NewIndex: Integer); +begin + if Assigned(ApptGrid) and (ActiveTemplate = agtComparative) and + not ApptGrid.Cols.Updating then + ApptGrid.Cols.MoveCol(CurIndex, NewIndex); +end; + +procedure TJvTFDaysTemplate.BeginGridUpdate; +begin + FUpdatingGrid := True; +end; + +procedure TJvTFDaysTemplate.EndGridUpdate; +begin + FUpdatingGrid := False; + ApptGrid.ProcessBatches; +end; + +//=== { TJvTFDaysPrimeTime } ================================================= + +constructor TJvTFDaysPrimeTime.Create(AApptGrid: TJvTFDays); +begin + inherited Create; + FApptGrid := AApptGrid; + FStartTime := EncodeTime(8, 0, 0, 0); + FEndTime := EncodeTime(17, 0, 0, 0); + FColor := clYellow; + FFillPic := TBitmap.Create; + FFillPic.Width := 16; + FFillPic.Height := 16; + UpdateFillPic; +end; + +destructor TJvTFDaysPrimeTime.Destroy; +begin + FFillPic.Free; + inherited Destroy; +end; + +procedure TJvTFDaysPrimeTime.SetStartTime(Value: TTime); +begin + if Assigned(FApptGrid) and not (csLoading in FApptGrid.ComponentState) and + (Value >= EndTime) then + raise EJvTFDaysError.CreateRes(@RsEInvalidPrimeTimeStartTime); + + FStartTime := Value; + Change; +end; + +procedure TJvTFDaysPrimeTime.SetEndTime(Value: TTime); +begin + if Assigned(FApptGrid) and (Value <= StartTime) and + not (csLoading in FApptGrid.ComponentState) then + raise EJvTFDaysError.CreateRes(@RsEInvalidPrimeTimeEndTime); + + FEndTime := Value; + Change; +end; + +procedure TJvTFDaysPrimeTime.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + UpdateFillPic; + Change; + end; +end; + +procedure TJvTFDaysPrimeTime.Change; +begin + if Assigned(FApptGrid) and not (csLoading in FApptGrid.ComponentState) then + FApptGrid.Invalidate; +end; + +procedure TJvTFDaysPrimeTime.UpdateFillPic; +begin + with FFillPic.Canvas do + begin + Brush.Color := FColor; + FillRect(Classes.Rect(0, 0, FFillPic.Width, FFillPic.Height)); + end; +end; + +procedure TJvTFDaysPrimeTime.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysPrimeTime then + begin + FStartTime := TJvTFDaysPrimeTime(Source).StartTime; + FEndTime := TJvTFDaysPrimeTime(Source).EndTime; + FColor := TJvTFDaysPrimeTime(Source).Color; + UpdateFillPic; + Change; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFInPlaceApptEditor } ============================================= + +constructor TJvTFInPlaceApptEditor.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + + ControlStyle := ControlStyle + [csNoDesignVisible]; + + BorderStyle := bsNone; + FQuickCreate := False; + //ParentCtl3D := False; + //Ctl3D := False; +end; + +procedure TJvTFInPlaceApptEditor.DoExit; +begin + inherited DoExit; + try + if not FCancelEdit then + TJvTFDays(Parent).FinishEditAppt + else + if FQuickCreate then + // Free the appointment + FLinkedAppt.Free; + finally + FCancelEdit := False; + Parent.SetFocus; + end; +end; + +procedure TJvTFInPlaceApptEditor.KeyDown(var Key: Word; Shift: TShiftState); +begin + inherited KeyDown(Key, Shift); + + if Key = VK_ESCAPE then + begin + FCancelEdit := True; + Key := 0; + Visible := False; + end; +end; + +//=== { TJvTFApptMap } ======================================================= + +constructor TJvTFApptMap.Create(AGridCol: TJvTFDaysCol); +begin + inherited Create; + FGridCol := AGridCol; + FData := TJvTFSparseMatrix.Create; +end; + +destructor TJvTFApptMap.Destroy; +begin + FData.Free; + inherited Destroy; +end; + +function TJvTFApptMap.GetLocation(Row, Col: Integer): TJvTFAppt; +begin + Result := nil; + if (Row >= 0) and (Col > 0) then + Result := TJvTFAppt(FData[Row, Col]); +end; + +procedure TJvTFApptMap.Add(Appt: TJvTFAppt); +var + StartRow, EndRow, MapRow, MapCol: Integer; + Empty: Boolean; + ApptGrid: TJvTFDays; +begin + // We need to find the left-most col that does not have any appts already + // scheduled in any of the rows needed by the new appt. (In other words, + // we need a contiguous set cols for the new appt.) + + FGridCol.CalcStartEndRows(Appt, StartRow, EndRow); + + StartRow := Greater(StartRow, 0); + + ApptGrid := FGridCol.ColCollection.ApptGrid; + if Assigned(ApptGrid) then + EndRow := Lesser(EndRow, ApptGrid.RowCount - 1) + else + EndRow := Lesser(EndRow, FGridCol.ColCollection.Printer.RowCount - 1); + + MapRow := StartRow; + MapCol := 1; + repeat + Empty := FData[MapRow, MapCol] = 0; + if Empty then + Inc(MapRow) + else + begin + Inc(MapCol); + MapRow := StartRow; + end; + until (MapRow > EndRow) and Empty; + + // Now write the new appt to the map in all rows hit by appt, using the + // col found above. + for MapRow := StartRow to EndRow do + begin + FData[MapRow, MapCol] := NativeInt(Appt); + FData[MapRow, -1] := FData[MapRow, -1] + 1; + end; +end; + +procedure TJvTFApptMap.ProcessMapGroup(GroupStart, GroupEnd: Integer); +var + MapRow, Examined, ApptCount, MaxCol, MapCol: Integer; +begin + // Find the highest used column in group + MaxCol := 0; + for MapRow := GroupStart to GroupEnd do + begin + Examined := 0; + ApptCount := FData[MapRow, -1]; + // ApptCount > 0 check added by Mike 1/14/01 + if ApptCount > 0 then + begin + MapCol := 1; + + repeat + if FData[MapRow, MapCol] <> 0 then + Inc(Examined); + Inc(MapCol); + until Examined = ApptCount; + + Dec(MapCol); + + MaxCol := Greater(MaxCol, MapCol); + end; + end; + + // Now write MaxCol in col 0 for each row in the groups + for MapRow := GroupStart to GroupEnd do + FData[MapRow, 0] := MaxCol; +end; + +procedure TJvTFApptMap.UpdateMapGroups; +var + GridRowCount: Integer; +begin + if Assigned(FGridCol.ColCollection.ApptGrid) then + GridRowCount := FGridCol.ColCollection.ApptGrid.RowCount + else + if Assigned(FGridCol.ColCollection.Printer) then + GridRowCount := FGridCol.ColCollection.Printer.RowCount + else + GridRowCount := 0; + + // we could try to find a smaller group, by looking for the first and last + // row where there is at least one appt, but CPU wise, it's actually simpler + // to let the ProcessMapGroup function deal with it. + ProcessMapGroup(0, GridRowCount); +end; + +procedure TJvTFApptMap.Clear; +begin + FData.Clear; +end; + +function TJvTFApptMap.ColCount(Row: Integer): Integer; +begin + Result := FData[Row, 0]; +end; + +procedure TJvTFApptMap.GetAppts(StartRow, EndRow: Integer; ApptList: TStringList); +var + Row, Col, Existing, Found, MapCols: Integer; + Appt: TJvTFAppt; +begin + ApptList.Clear; + + for Row := StartRow to EndRow do + begin + Existing := FData[Row, -1]; + MapCols := FData[Row, 0]; + Found := 0; + Col := 1; + while (Found < Existing) and (Col <= MapCols) do + begin + if FData[Row, Col] <> 0 then + begin + Inc(Found); + Appt := TJvTFAppt(FData[Row, Col]); + if ApptList.IndexOf(Appt.ID) = -1 then + ApptList.AddObject(Appt.ID, Appt); + end; + Inc(Col); + end; + end; +end; + +function TJvTFApptMap.LocateMapCol(Appt: TJvTFAppt; MapSearchRow: Integer): Integer; +var + Col, MapCols, ApptVal: Integer; +begin + MapCols := FData[MapSearchRow, 0]; + Col := 1; + ApptVal := Integer(Appt); + + while (Col <= MapCols) and (FData[MapSearchRow, Col] <> ApptVal) do + Inc(Col); + + if FData[MapSearchRow, Col] = ApptVal then + Result := Col + else + Result := -2; +end; + +procedure TJvTFApptMap.Refresh; +var + Sched: TJvTFSched; + I: Integer; +begin + Clear; + + Sched := FGridCol.Schedule; + if Assigned(Sched) then + begin + for I := 0 to Sched.ApptCount - 1 do + Add(Sched.Appts[I]); + + UpdateMapGroups; + end; +end; + +procedure TJvTFApptMap.Dump(AName: TFileName); +var + DumpData: TStringList; +begin + // used for debugging only + DumpData := TStringList.Create; + try + FData.Dump(DumpData); + DumpData.SaveToFile(AName); + finally + DumpData.Free; + end; +end; + +function TJvTFApptMap.HasAppt(Appt: TJvTFAppt): Boolean; +var + MapRow, MapCol, StartRow, EndRow, ApptsExamined: Integer; + Test: NativeInt; + ApptGrid: TJvTFDays; +begin + FGridCol.CalcStartEndRows(Appt, StartRow, EndRow); + + StartRow := Greater(StartRow, 0); + + ApptGrid := FGridCol.ColCollection.ApptGrid; + if Assigned(ApptGrid) then + EndRow := Lesser(EndRow, ApptGrid.RowCount - 1) + else + EndRow := Lesser(EndRow, FGridCol.ColCollection.Printer.RowCount - 1); + + MapRow := 0; + Result := False; + while (MapRow <= EndRow) and not Result do + begin + MapCol := 1; + ApptsExamined := 0; + while (ApptsExamined < FData[MapRow, -1]) and not Result do + begin + Test := FData[MapRow, MapCol]; + if Test > 0 then + begin + Inc(ApptsExamined); + if Test = NativeInt(Appt) then + Result := True; + end; + + Inc(MapCol); + end; + + Inc(MapRow); + end; +end; + +//=== { TJvTFDaysThresholds } ================================================ + +constructor TJvTFDaysThresholds.Create(AOwner: TJvTFDays); +begin + inherited Create; + FApptGrid := AOwner; + + FTextHeight := 1; + FTextWidth := 10; + FEditHeight := 1; + FEditWidth := 10; + FDetailWidth := 10; + FDetailHeight := 10; + FDropTextFirst := True; + FPicsAllOrNone := False; + FWholePicsOnly := True; +end; + +procedure TJvTFDaysThresholds.SetDetailHeight(Value: Integer); +begin + if Value < 1 then + Value := 1; + if Value <> FDetailHeight then + begin + FDetailHeight := Value; + Change; + end; +end; + +procedure TJvTFDaysThresholds.SetDetailWidth(Value: Integer); +begin + if Value < 1 then + Value := 1; + if Value <> FDetailWidth then + begin + FDetailWidth := Value; + Change; + end; +end; + +procedure TJvTFDaysThresholds.SetEditHeight(Value: Integer); +begin + if Value < 0 then + Value := 0; + if Value <> FEditHeight then + FEditHeight := Value; +end; + +procedure TJvTFDaysThresholds.SetEditWidth(Value: Integer); +begin + if Value < 0 then + Value := 0; + if Value <> FEditWidth then + FEditWidth := Value; +end; + +procedure TJvTFDaysThresholds.SetTextHeight(Value: Integer); +begin + if Value < 0 then + Value := 0; + if Value <> FTextHeight then + begin + FTextHeight := Value; + Change; + end; +end; + +procedure TJvTFDaysThresholds.SetTextWidth(Value: Integer); +begin + if Value < 0 then + Value := 0; + if Value <> FTextWidth then + begin + FTextWidth := Value; + Change; + end; +end; + +procedure TJvTFDaysThresholds.SetDropTextFirst(Value: Boolean); +begin + if Value <> FDropTextFirst then + begin + FDropTextFirst := Value; + Change; + end; +end; + +procedure TJvTFDaysThresholds.SetPicsAllOrNone(Value: Boolean); +begin + if Value <> FPicsAllOrNone then + begin + FPicsAllOrNone := Value; + Change; + end; +end; + +procedure TJvTFDaysThresholds.SetWholePicsOnly(Value: Boolean); +begin + if Value <> FWholePicsOnly then + begin + FWholePicsOnly := Value; + Change; + end; +end; + +procedure TJvTFDaysThresholds.Change; +begin + if Assigned(FApptGrid) then + FApptGrid.Invalidate; +end; + +procedure TJvTFDaysThresholds.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysThresholds then + begin + FTextWidth := TJvTFDaysThresholds(Source).TextWidth; + FTextHeight := TJvTFDaysThresholds(Source).TextHeight; + FEditHeight := TJvTFDaysThresholds(Source).EditHeight; + FEditWidth := TJvTFDaysThresholds(Source).EditWidth; + FDropTextFirst := TJvTFDaysThresholds(Source).DropTextFirst; + FPicsAllOrNone := TJvTFDaysThresholds(Source).PicsAllOrNone; + FWholePicsOnly := TJvTFDaysThresholds(Source).WholePicsOnly; + Change; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFDaysScrollBar } ================================================= + +constructor TJvTFDaysScrollBar.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + // if we set the csNoDesignVisible flag then visibility at design time + // is controled by the Visible property, which is exactly what we want. + ControlStyle := ControlStyle + [csNoDesignVisible]; + //ParentCtl3D := False; + //Ctl3D := False; +end; + +procedure TJvTFDaysScrollBar.CMDesignHitTest(var Msg: TCMDesignHitTest); +begin + Msg.Result := 1; +end; + +procedure TJvTFDaysScrollBar.CreateWnd; +begin + inherited CreateWnd; + UpdateRange; +end; + +function TJvTFDaysScrollBar.GetLargeChange: Integer; +begin + Result := inherited LargeChange; +end; + +procedure TJvTFDaysScrollBar.SetLargeChange(Value: Integer); +begin + inherited LargeChange := Value; + UpdateRange; +end; + +procedure TJvTFDaysScrollBar.UpdateRange; +var + Info: TScrollInfo; +begin + if not HandleAllocated then + exit; + + FillChar(Info, SizeOf(Info), 0); + with Info do + begin + cbsize := SizeOf(Info); + fmask := SIF_PAGE; + nPage := LargeChange; + end; + SetScrollInfo(Handle, SB_CTL, Info, True); +end; + +//=== { TJvTFDaysCol } ======================================================= + +constructor TJvTFDaysCol.Create(ACollection: TCollection); +begin + inherited Create(ACollection); + FNullSchedDate := True; + FMap := TJvTFApptMap.Create(Self); +end; + +destructor TJvTFDaysCol.Destroy; +begin + Disconnect; + FMap.Free; + inherited Destroy; +end; + +procedure TJvTFDaysCol.SetSchedDate(Value: TDate); +begin + if Value <> FSchedDate then + begin + Disconnect; + FSchedDate := Value; + FNullSchedDate := False; + Connect; + //UpdateTitle; + UpdateTitles; + CheckTemplate; + end; +end; + +procedure TJvTFDaysCol.SetSchedName(const Value: string); +begin + if Value <> FSchedName then + begin + Disconnect; + FSchedName := Value; + Connect; + //UpdateTitle; + UpdateTitles; + CheckTemplate; + end; +end; + +procedure TJvTFDaysCol.SetTitle(const Value: string); +begin + if FTitle <> Value then + begin + FTitle := Value; + if Assigned(ColCollection.ApptGrid) then + ColCollection.ApptGrid.Invalidate; + end; +end; + +procedure TJvTFDaysCol.SetWidth(Value: Integer); +var + ApptGrid: TJvTFDays; +begin + if Value < AbsMinColWidth then + Value := AbsMinColWidth; + + if Assigned(ColCollection.ApptGrid) then + if Value > ColCollection.ApptGrid.GetDataWidth then + Value := ColCollection.ApptGrid.GetDataWidth; + + if Value < 1 then + Value := 1; + + // For the printer, just set the private member then EXIT + if Assigned(ColCollection.Printer) then + begin + FWidth := Value; + Exit; + end; + + if Value <> FWidth then + begin + FWidth := Value; + ApptGrid := ColCollection.ApptGrid; + + if not (csLoading in ApptGrid.ComponentState) then + begin + if ApptGrid.AutoSizeCols then + begin + if not ColCollection.AddingCol and + not (vsbHorz in ApptGrid.VisibleScrollBars) then + ColCollection.ResizeCols; + end + else + ApptGrid.CheckSBVis; + + ApptGrid.CheckSBParams; + ApptGrid.Invalidate; + end; + end; +end; + +function TJvTFDaysCol.GetDisplayName: string; +begin + Result := SchedName + ' ['; + if not FNullSchedDate then + Result := Result + FormatDateTime('ddddd', SchedDate); + Result := Result + ']'; +{ + if Title <> '' then + Result := Title + else + Result := Inherited GetDisplayName; +} +end; + +procedure TJvTFDaysCol.CheckTemplate; +begin + if Assigned(ColCollection.ApptGrid) then + with ColCollection.ApptGrid.Template do + if not UpdatingGrid then + ActiveTemplate := agtNone; +end; + +procedure TJvTFDaysCol.SetIndex(Value: Integer); +begin + if not Assigned(ColCollection.ApptGrid) or + (ColCollection.ApptGrid.Template.ActiveTemplate <> agtLinear) then + inherited SetIndex(Value); +end; + +procedure TJvTFDaysCol.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysCol then + begin + Title := TJvTFDaysCol(Source).Title; + Width := TJvTFDaysCol(Source).Width; + SchedName := TJvTFDaysCol(Source).SchedName; + SchedDate := TJvTFDaysCol(Source).SchedDate; + end + else + inherited Assign(Source); +end; + +function TJvTFDaysCol.ColCollection: TJvTFDaysCols; +begin + Result := TJvTFDaysCols(Collection); +end; + +function TJvTFDaysCol.Connected: Boolean; +begin + Result := Assigned(FSchedule); +end; + +procedure TJvTFDaysCol.Connect; +var + ApptGrid: TJvTFDays; + FPrinter: TJvTFDaysPrinter; +begin + ApptGrid := ColCollection.ApptGrid; + FPrinter := ColCollection.Printer; + + if Assigned(ApptGrid) then + begin + if not Connected and not (csDesigning in ApptGrid.ComponentState) and + not FNullSchedDate and (SchedName <> '') and Assigned(ApptGrid.ScheduleManager) and + not (csLoading in ApptGrid.ComponentState) then + begin + FSchedule := ApptGrid.RetrieveSchedule(SchedName, SchedDate); + FMap.Refresh; + ApptGrid.Invalidate; + //UpdateTitle; + UpdateTitles; + end; + end + else + if Assigned(FPrinter) then + begin + if not Connected and not (csDesigning in FPrinter.ComponentState) and + not FNullSchedDate and (SchedName <> '') and + Assigned(FPrinter.ScheduleManager) and + not (csLoading in FPrinter.ComponentState) then + begin + FSchedule := FPrinter.RetrieveSchedule(SchedName, SchedDate); + FMap.Refresh; + //UpdateTitle; + UpdateTitles; + end; + end; +end; + +procedure TJvTFDaysCol.Disconnect; +var + ApptGrid: TJvTFDays; + FPrinter: TJvTFDaysPrinter; + lSchedName: string; + lSchedDate: TDate; +begin + if not FDisconnecting then + try + FDisconnecting := True; + + ApptGrid := ColCollection.ApptGrid; + FPrinter := ColCollection.Printer; + + if Assigned(ApptGrid) then + begin + if Connected and Assigned(ApptGrid.ScheduleManager) then + begin + lSchedName := Schedule.SchedName; + lSchedDate := Schedule.SchedDate; + FSchedule := nil; + FMap.Clear; + ApptGrid.ReleaseSchedule(lSchedName, lSchedDate); + ApptGrid.Invalidate; + end; + end + else + if Assigned(FPrinter) then + begin + if Connected and Assigned(FPrinter.ScheduleManager) then + begin + lSchedName := Schedule.SchedName; + lSchedDate := Schedule.SchedDate; + FSchedule := nil; + FMap.Clear; + FPrinter.ReleaseSchedule(lSchedName, lSchedDate); + end; + end; + finally + FDisconnecting := False; + end; +end; + +procedure TJvTFDaysCol.SetSchedule(const NewSchedName: string; NewSchedDate: TDate); +begin + Disconnect; + FSchedName := SchedName; + FSchedDate := SchedDate; + FNullSchedDate := False; + Connect; + //UpdateTitle; + UpdateTitles; + CheckTemplate; +end; + +procedure TJvTFDaysCol.RefreshMap; +begin + FMap.Refresh; +end; + +procedure TJvTFDaysCol.CalcStartEndRows(Appt: TJvTFAppt; + var StartRow, EndRow: Integer); +var + ApptGrid: TJvTFDays; + FPrinter: TJvTFDaysPrinter; +begin + ApptGrid := ColCollection.ApptGrid; + FPrinter := ColCollection.Printer; + + if Assigned(ApptGrid) then + begin + if Trunc(Appt.StartDate) = Trunc(SchedDate) then + StartRow := ApptGrid.TimeToRow(Appt.StartTime) + else + StartRow := 0; + + if Trunc(Appt.EndDate) = Trunc(SchedDate) then + EndRow := ApptGrid.TimeToRow(ApptGrid.AdjustEndTime(Appt.EndTime)) + else + EndRow := ApptGrid.RowCount - 1; + end + else + if Assigned(FPrinter) then + begin + if Trunc(Appt.StartDate) = Trunc(SchedDate) then + StartRow := FPrinter.TimeToRow(Appt.StartTime) + else + StartRow := 0; + + if Trunc(Appt.EndDate) = Trunc(SchedDate) then + EndRow := FPrinter.TimeToRow(FPrinter.AdjustEndTime(Appt.EndTime)) + else + EndRow := FPrinter.RowCount - 1; + end; +end; +{ +procedure TJvTFDaysCol.UpdateTitle; +Var + NewTitle: string; + ApptGrid: TJvTFDays; + FPrinter: TJvTFDaysPrinter; +begin + ApptGrid := ColCollection.ApptGrid; + FPrinter := ColCollection.Printer; + + if Assigned(ApptGrid) then + begin + if (ApptGrid.Template.ActiveTemplate = agtLinear) and + (ApptGrid.Template.ShortTitles) then + NewTitle := FormatDateTime(ApptGrid.DateFormat, SchedDate) + else + if (ApptGrid.Template.ActiveTemplate = agtComparative) and + (ApptGrid.Template.ShortTitles) then + NewTitle := SchedName + else + NewTitle := SchedName + ' - ' + FormatDateTime(ApptGrid.DateFormat, SchedDate); + + if Assigned(ApptGrid.OnUpdateColTitle) then + ApptGrid.OnUpdateColTitle(ApptGrid, Self, NewTitle); + Title := NewTitle; + end + else + if Assigned(FPrinter) then + begin + NewTitle := SchedName + ' - ' + + FormatDateTime(FPrinter.DateFormat, SchedDate); + if Assigned(FPrinter.OnUpdateColTitle) then + FPrinter.OnUpdateColTitle(FPrinter, Self, NewTitle); + Title := NewTitle; + end; +end; +} + +function TJvTFDaysCol.GetFirstAppt: TJvTFAppt; +var + ApptList: TStringList; +begin + Result := nil; + ApptList := TStringList.Create; + try + FMap.GetAppts(0, ColCollection.ApptGrid.RowCount - 1, ApptList); + if ApptList.Count > 0 then + Result := TJvTFAppt(ApptList.Objects[0]); + finally + ApptList.Free; + end; +end; + +function TJvTFDaysCol.GetLastAppt: TJvTFAppt; +var + ApptList: TStringList; +begin + Result := nil; + ApptList := TStringList.Create; + try + FMap.GetAppts(0, ColCollection.ApptGrid.RowCount - 1, ApptList); + if ApptList.Count > 0 then + Result := TJvTFAppt(ApptList.Objects[ApptList.Count - 1]); + finally + ApptList.Free; + end; +end; + +function TJvTFDaysCol.GetNextAppt(RefAppt: TJvTFAppt): TJvTFAppt; +var + ApptList: TStringList; + NextIndex: Integer; +begin + if not Assigned(RefAppt) then + begin + Result := GetFirstAppt; + Exit; + end; + + Result := nil; + ApptList := TStringList.Create; + try + FMap.GetAppts(0, ColCollection.ApptGrid.RowCount - 1, ApptList); + if ApptList.Count > 0 then + begin + NextIndex := ApptList.IndexOfObject(RefAppt) + 1; + // if NextIndex = 0 then RefAppt is in a different column, + // so return the first appt. + if (NextIndex >= 0) and (NextIndex < ApptList.Count) then + Result := TJvTFAppt(ApptList.Objects[NextIndex]); + end; + finally + ApptList.Free; + end; +end; + +function TJvTFDaysCol.GetPrevAppt(RefAppt: TJvTFAppt): TJvTFAppt; +var + ApptList: TStringList; + PrevIndex: Integer; +begin + if RefAppt = nil then + begin + Result := GetLastAppt; + Exit; + end; + + Result := nil; + ApptList := TStringList.Create; + try + FMap.GetAppts(0, ColCollection.ApptGrid.RowCount - 1, ApptList); + if ApptList.Count > 0 then + begin + PrevIndex := ApptList.IndexOfObject(RefAppt) - 1; + if PrevIndex > -1 then + Result := TJvTFAppt(ApptList.Objects[PrevIndex]) + else + if PrevIndex = -2 then + // RefAppt is in a different column so return last appt + Result := GetLastAppt; + end; + finally + ApptList.Free; + end; +end; + +procedure TJvTFDaysCol.SetGroupTitle(const Value: string); +begin + if Value <> FGroupTitle then + begin + FGroupTitle := Value; + if Assigned(ColCollection.ApptGrid) then + ColCollection.ApptGrid.Invalidate; + end; +end; + +procedure TJvTFDaysCol.UpdateTitles; +var + NewTitle, NewGroupTitle, NameStr, DateStr: string; + ApptGrid: TJvTFDays; + FPrinter: TJvTFDaysPrinter; + FromGrid: Boolean; + Grouping: TJvTFDaysGrouping; +begin + ApptGrid := ColCollection.ApptGrid; + FPrinter := ColCollection.Printer; + + if not Assigned(ApptGrid) and not Assigned(FPrinter) then + Exit; + + FromGrid := Assigned(ApptGrid); + if FromGrid then + Grouping := ApptGrid.Grouping + else + Grouping := FPrinter.Grouping; + + if FNullSchedDate then + DateStr := '' + else + if FromGrid then + DateStr := FormatDateTime(ApptGrid.DateFormat, SchedDate) + else + DateStr := FormatDateTime(FPrinter.DateFormat, SchedDate); + + if Assigned(Schedule) and (Schedule.SchedDisplayName <> '') then + NameStr := Schedule.SchedDisplayName + else + NameStr := SchedName; + + case Grouping of + grNone: + begin + NewGroupTitle := ''; + NewTitle := NameStr + ' - ' + DateStr; + end; + grDate: + begin + NewGroupTitle := DateStr; + NewTitle := NameStr; + end; + grResource: + begin + NewGroupTitle := NameStr; + NewTitle := DateStr; + end; + grCustom: + begin + NewGroupTitle := GroupTitle; + NewTitle := NameStr + ' - ' + DateStr; + end; + end; + + if FromGrid then + begin + if Assigned(ApptGrid.OnUpdateColTitles) then + ApptGrid.OnUpdateColTitles(ApptGrid, Self, NewGroupTitle, NewTitle) + end + else + if Assigned(FPrinter.OnUpdateColTitles) then + FPrinter.OnUpdateColTitles(FPrinter, Self, NewGroupTitle, NewTitle); + + GroupTitle := NewGroupTitle; + Title := NewTitle; +end; + +procedure TJvTFDaysCol.DumpMap; +begin + FMap.Dump('Map Dump (' + IntToStr(Index) + ').txt'); +end; + +function TJvTFDaysCol.ApptInCol(Appt: TJvTFAppt): Boolean; +begin + Result := FMap.HasAppt(Appt); +end; + +function TJvTFDaysCol.LocateMapCol(Appt: TJvTFAppt; MapSearchRow: Integer): Integer; +begin + Result := FMap.LocateMapCol(Appt, MapSearchRow); +end; + +function TJvTFDaysCol.MapColCount(Row: Integer): Integer; +begin + Result := FMap.ColCount(Row); +end; + +function TJvTFDaysCol.MapLocation(Col, Row: Integer): TJvTFAppt; +begin + Result := FMap.Location[Row, Col]; +end; + +//=== { TJvTFDaysCols } ====================================================== + +constructor TJvTFDaysCols.Create(AApptGrid: TJvTFDays); +begin + inherited Create(TJvTFDaysCol); + FApptGrid := AApptGrid; + FOldCount := 0; +end; + +constructor TJvTFDaysCols.CreateForPrinter(APrinter: TJvTFDaysPrinter); +begin + inherited Create(TJvTFDaysCol); + FPrinter := APrinter; +end; + +function TJvTFDaysCols.GetItem(Index: Integer): TJvTFDaysCol; +begin + Result := TJvTFDaysCol(inherited GetItem(Index)); +end; + +procedure TJvTFDaysCols.SetItem(Index: Integer; Value: TJvTFDaysCol); +begin + inherited SetItem(Index, Value); +end; + +procedure TJvTFDaysCols.EnsureCol(Index: Integer); +begin + if (Index < 0) or (Index > Count - 1) then + raise EJvTFDaysError.CreateRes(@RsEColumnIndexOutOfBounds); +end; + +function TJvTFDaysCols.GetOwner: TPersistent; +begin + if Assigned(FApptGrid) then + Result := FApptGrid + else + if Assigned(FPrinter) then + Result := FPrinter + else + Result := nil; +end; + +procedure TJvTFDaysCols.SizeCols; +var + DataWidth, Base, MakeUp, I: Integer; +begin + // DO NOT RUN IF WE'RE ALREADY IN THE SIZING PROCESS!! + if SizingCols or (Count <= 0) then + Exit; + + if Assigned(FApptGrid) then + try + FSizingCols := True; + DataWidth := ApptGrid.GetDataWidth; + + Base := DataWidth div Count; + + if Base >= ApptGrid.MinColWidth then + begin + MakeUp := DataWidth - (Base * Count); + for I := 0 to MakeUp - 1 do + Items[I].Width := Base + 1; + for I := MakeUp to Count - 1 do + Items[I].Width := Base; + end + finally + FSizingCols := False; + end + else + begin + // sizing for printer + end; +end; + +procedure TJvTFDaysCols.Update(Item: TCollectionItem); +begin +{*******************************************************************} +{** DO NOT PUT ANY CALLS TO SHOWMESSAGE IN THIS ROUTINE!!!! *******} +{** IT WILL BLOW UP WHEN REMOVING COLS AT DESIGN TIME!!!! *******} +{*******************************************************************} + + // Exit if owner is printer + if not Assigned(ApptGrid) or (csLoading in ApptGrid.ComponentState) then + Exit; + + try + FUpdating := True; + + ApptGrid.ClearSelection; + + if Count > FOldCount then // we're adding a col + try + FAddingCol := True; + + // if we're adding the first col then set left col to 0. + if FOldCount = 0 then + ApptGrid.LeftCol := 0; + + if ApptGrid.AutoSizeCols then + begin + // default col width to grid's min col width + Items[Count - 1].Width := ApptGrid.MinColWidth; + + if not (vsbHorz in ApptGrid.VisibleScrollBars) then + // run the CheckSBVis routine + if not ApptGrid.CheckSBVis then + // if CheckSBVis didn't resize the cols then recheck + // the visibility of the horz scroll bar. if still not + // visible, then size the cols. + if not (vsbHorz in ApptGrid.VisibleScrollBars) then + SizeCols; + end + else + Items[Count - 1].Width := ApptGrid.DefColWidth; + finally + FAddingCol := False; + end + else + if Count < FOldCount then // we're removing a col + begin + if ApptGrid.FocusedCol >= Count then + ApptGrid.FocusedCol := Count - 1; + + if ApptGrid.SelStart.X >= Count then + ApptGrid.SelStart := Point(Count - 1, ApptGrid.SelStart.Y); + + if ApptGrid.LeftCol >= Count then + ApptGrid.LeftCol := Count - 1; + + if ApptGrid.AutoSizeCols then + begin + if vsbHorz in ApptGrid.VisibleScrollBars then + begin + // run the CheckSBVis routine + if not ApptGrid.CheckSBVis then + // if CheckSBVis didn't resize the cols then recheck + // the visibility of the horz scroll bar. if still not + // visible, then size the cols. + if not (vsbHorz in ApptGrid.VisibleScrollBars) then + SizeCols; + end + else + SizeCols; + end + else + ApptGrid.CheckSBVis; + end; + + finally + FUpdating := False; + FOldCount := Count; + FApptGrid.Invalidate; + end; +end; + +function TJvTFDaysCols.Add: TJvTFDaysCol; +begin + Result := TJvTFDaysCol(inherited Add); +end; + +procedure TJvTFDaysCols.EnsureMinColWidth; +var + I, MCW: Integer; +begin + if Assigned(ApptGrid) then + MCW := ApptGrid.MinColWidth + else + if Assigned(FPrinter) then + MCW := FPrinter.MinColWidth + else + Exit; + + for I := 0 to Count - 1 do + if Items[I].Width < MCW then + Items[I].Width := MCW; +end; + +procedure TJvTFDaysCols.EnsureMaxColWidth; +var + I: Integer; + DataW: Integer; +begin + if not Assigned(ApptGrid) or not (agoEnforceMaxColWidth in ApptGrid.Options) then + Exit; + + DataW := ApptGrid.GetDataWidth; + for I := 0 to Count - 1 do + if Items[I].Width > DataW then + Items[I].Width := DataW; +end; + +procedure TJvTFDaysCols.ResizeCols; +begin + SizeCols; +end; + +procedure TJvTFDaysCols.MoveCol(SourceIndex, TargetIndex: Integer); +var + SelID: Integer; +begin + if SourceIndex <> TargetIndex then + begin + SelID := -1; + EnsureCol(SourceIndex); + EnsureCol(TargetIndex); + + if Assigned(ApptGrid) and (ApptGrid.FocusedCol > -1) then + SelID := Items[ApptGrid.FocusedCol].ID; + + Items[SourceIndex].Index := TargetIndex; + + if Assigned(ApptGrid) and (ApptGrid.FocusedCol > -1) then + ApptGrid.FocusedCol := FindItemID(SelID).Index; + + // sychronize the CompName list + if Assigned(ApptGrid) and + (ApptGrid.Template.ActiveTemplate = agtComparative) then + begin + FUpdating := True; + try + ApptGrid.Template.CompNames.Move(SourceIndex, TargetIndex); + finally + FUpdating := False; + end; + end; + end; +end; + +procedure TJvTFDaysCols.Assign(Source: TPersistent); +var + I: Integer; +begin + if Source is TJvTFDaysCols then + begin + BeginUpdate; + try + Clear; + for I := 0 to TJvTFDaysCols(Source).Count - 1 do + Add.Assign(TJvTFDaysCols(Source).Items[I]); + finally + EndUpdate; + end; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDaysCols.UpdateTitles; +var + I: Integer; +begin + for I := 0 to Count - 1 do + //Items[I].UpdateTitle; + Items[I].UpdateTitles; +end; + +//=== { TJvTFDaysFancyRowHdrAttr } =========================================== + +constructor TJvTFDaysFancyRowHdrAttr.Create(AOwner: TJvTFDays); +begin + inherited Create; + FGrid := AOwner; + + FTickColor := clGray; + FColor := clBtnFace; + + FMinorFont := TFont.Create; + if Assigned(FGrid) then + FMinorFont.Assign(FGrid.Font); + + FMajorFont := TFont.Create; + if Assigned(FGrid) then + FMajorFont.Assign(FGrid.Font); + FMajorFont.Size := FMajorFont.Size * 2; + + FMinorFont.OnChange := @FontChange; + FMajorFont.OnChange := @FontChange; + FOnlyShow00Minutes := True; +end; + +destructor TJvTFDaysFancyRowHdrAttr.Destroy; +begin + FMinorFont.OnChange := nil; + FMajorFont.OnChange := nil; + FMinorFont.Free; + FMajorFont.Free; + + inherited Destroy; +end; + +procedure TJvTFDaysFancyRowHdrAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFDaysFancyRowHdrAttr.SetHr2400(Value: Boolean); +begin + if Value <> FHr2400 then + begin + FHr2400 := Value; + Change; + end; +end; + +procedure TJvTFDaysFancyRowHdrAttr.SetMinorFont(Value: TFont); +begin + FMinorFont.Assign(Value); +end; + +procedure TJvTFDaysFancyRowHdrAttr.SetMajorFont(Value: TFont); +begin + FMajorFont.Assign(Value); +end; + +procedure TJvTFDaysFancyRowHdrAttr.SetTickColor(Value: TColor); +begin + if Value <> FTickColor then + begin + FTickColor := Value; + Change; + end; +end; + +procedure TJvTFDaysFancyRowHdrAttr.SetOnlyShow00Minutes(Value: Boolean); +begin + if Value <> FOnlyShow00Minutes then + begin + FOnlyShow00Minutes := Value; + Change; + end; +end; + +procedure TJvTFDaysFancyRowHdrAttr.Change; +begin + if Assigned(FGrid) then + FGrid.Invalidate; +end; + +procedure TJvTFDaysFancyRowHdrAttr.FontChange(Sender: TObject); +begin + Change; +end; + +procedure TJvTFDaysFancyRowHdrAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysFancyRowHdrAttr then + begin + FTickColor := TJvTFDaysFancyRowHdrAttr(Source).TickColor; + FMinorFont.OnChange := nil; + FMajorFont.OnChange := nil; + FMinorFont.Assign(TJvTFDaysFancyRowHdrAttr(Source).MinorFont); + FMajorFont.Assign(TJvTFDaysFancyRowHdrAttr(Source).MajorFont); + FMinorFont.OnChange := @FontChange; + FMajorFont.OnChange := @FontChange; + FHr2400 := TJvTFDaysFancyRowHdrAttr(Source).Hr2400; + FColor := TJvTFDaysFancyRowHdrAttr(Source).Color; + Change; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFDaysHdrAttr } =================================================== + +constructor TJvTFDaysHdrAttr.Create(AOwner: TJvTFDays); +begin + inherited Create; + FApptGrid := AOwner; + FFont := TFont.Create; + if Assigned(FApptGrid) then + begin + FFont.Assign(FApptGrid.Font); + FParentFont := True; + end; + FFont.OnChange := @FontChange; + + FColor := clBtnFace; + FFrame3D := True; + {$IFDEF Jv_TIMEBLOCKS} + // ok + FFrameColor := clBlack; + {$ENDIF Jv_TIMEBLOCKS} +end; + +destructor TJvTFDaysHdrAttr.Destroy; +begin + FFont.Free; + inherited Destroy; +end; + +procedure TJvTFDaysHdrAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFDaysHdrAttr.SetFont(Value: TFont); +begin + if Value <> FFont then + begin + FFont.Assign(Value); + FFont.OnChange := @FontChange; + if Assigned(FApptGrid) then + ParentFont := Value = FApptGrid.Font; + Change; + end; +end; + +procedure TJvTFDaysHdrAttr.SetParentFont(Value: Boolean); +begin + if Value and Assigned(FApptGrid) then + Font.Assign(FApptGrid.Font); + FParentFont := Value; +end; + +procedure TJvTFDaysHdrAttr.SetFrame3D(Value: Boolean); +begin + if Value <> FFrame3D then + begin + FFrame3D := Value; + Change; + end; +end; + +{$IFDEF Jv_TIMEBLOCKS} +// ok + +procedure TJvTFDaysHdrAttr.SetFrameColor(Value: TColor); +begin + if Value <> FFrameColor then + begin + FFrameColor := Value; + Change; + end; +end; + +// ok + +procedure TJvTFDaysHdrAttr.SetTitleRotation(Value: Integer); +begin + if Value <> FTitleRotation then + begin + FTitleRotation := Value; + Change; + end; +end; + +{$ENDIF Jv_TIMEBLOCKS} + +procedure TJvTFDaysHdrAttr.Change; +begin + if Assigned(FApptGrid) then + FApptGrid.Invalidate; +end; + +procedure TJvTFDaysHdrAttr.FontChange(Sender: TObject); +begin + ParentFont := False; + Change; +end; + +procedure TJvTFDaysHdrAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysHdrAttr then + try + FParentFont := False; + Frame3D := TJvTFDaysHdrAttr(Source).Frame3D; + FColor := TJvTFDaysHdrAttr(Source).Color; + Font.Assign(TJvTFDaysHdrAttr(Source).Font); + Font.OnChange := @FontChange; + ParentFont := TJvTFDaysHdrAttr(Source).ParentFont; + {$IFDEF Jv_TIMEBLOCKS} + // ok + FFrameColor := TJvTFDaysHdrAttr(Source).FrameColor; + // ok + FTitleRotation := TJvTFDaysHdrAttr(Source).TitleRotation; + {$ENDIF Jv_TIMEBLOCKS} + finally + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDaysHdrAttr.ParentFontChanged; +begin + if ParentFont and Assigned(FApptGrid) then + begin + // Disconnect Font.OnChange + FFont.OnChange := nil; + // Assign the parent font to FFont + FFont.Assign(FApptGrid.Font); + // Reconnect Font.OnChange + FFont.OnChange := @FontChange; + end; +end; + +//=== { TJvTFDaysApptBar } =================================================== + +constructor TJvTFDaysApptBar.Create(AApptGrid: TJvTFDays); +begin + inherited Create; + FApptGrid := AApptGrid; + FColor := clBlue; + FWidth := 5; + FVisible := True; + FTimeStampStyle := tssBlock; + FTimeStampColor := clBlue; +end; + +procedure TJvTFDaysApptBar.SetColor(Value: TColor); +begin + if FColor <> Value then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFDaysApptBar.SetVisible(Value: Boolean); +begin + if FVisible <> Value then + begin + FVisible := Value; + Change; + end; +end; + +procedure TJvTFDaysApptBar.SetWidth(Value: Integer); +begin + if Value < 0 then + Value := 0; + + if FWidth <> Value then + begin + FWidth := Value; + Change; + end; +end; + +procedure TJvTFDaysApptBar.Change; +begin + if Assigned(FApptGrid) then + FApptGrid.Invalidate; +end; + +procedure TJvTFDaysApptBar.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysApptBar then + begin + FColor := TJvTFDaysApptBar(Source).Color; + FVisible := TJvTFDaysApptBar(Source).Visible; + FWidth := TJvTFDaysApptBar(Source).Width; + FTimeStampStyle := TJvTFDaysApptBar(Source).TimeStampStyle; + FTimeStampColor := TJvTFDaysApptBar(Source).TimeStampColor; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDaysApptBar.SetTimeStampColor(Value: TColor); +begin + if FTimeStampColor <> Value then + begin + FTimeStampColor := Value; + Change; + end; +end; + +procedure TJvTFDaysApptBar.SetTFTimeStampStyle(Value: TJvTFTimeStampStyle); +begin + if FTimeStampStyle <> Value then + begin + FTimeStampStyle := Value; + Change; + end; +end; + +//=== { TJvTFDaysApptAttr } ================================================== + +constructor TJvTFDaysApptAttr.Create(AApptGrid: TJvTFDays); +begin + inherited Create; + FApptGrid := AApptGrid; + + FFont := TFont.Create; + if Assigned(FApptGrid) then + begin + FFont.Assign(FApptGrid.Font); + FParentFont := True; + end + else + FParentFont := False; + + FFont.OnChange := @FontChange; + + FFrameWidth := 1; + FFrameColor := clBlack; + FColor := clWhite; +end; + +destructor TJvTFDaysApptAttr.Destroy; +begin + FFont.OnChange := nil; + FFont.Free; + inherited Destroy; +end; + +procedure TJvTFDaysApptAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFDaysApptAttr.SetFont(Value: TFont); +begin + if Value <> FFont then + begin + FFont.Assign(Value); + FFont.OnChange := @FontChange; + if Assigned(FApptGrid) then + ParentFont := Value = FApptGrid.Font; + Change; + end; +end; + +procedure TJvTFDaysApptAttr.SetParentFont(Value: Boolean); +begin + if Assigned(FApptGrid) and Value then + Font.Assign(FApptGrid.Font); + FParentFont := Value; +end; + +procedure TJvTFDaysApptAttr.SetFrameColor(Value: TColor); +begin + if Value <> FFrameColor then + begin + FFrameColor := Value; + Change; + end; +end; + +procedure TJvTFDaysApptAttr.SetFrameWidth(Value: Integer); +begin + if Value <> FFrameWidth then + begin + FFrameWidth := Value; + Change; + end; +end; + +procedure TJvTFDaysApptAttr.Change; +begin + if Assigned(FApptGrid) then + FApptGrid.Invalidate; +end; + +procedure TJvTFDaysApptAttr.FontChange(Sender: TObject); +begin + ParentFont := False; + Change; +end; + +procedure TJvTFDaysApptAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysApptAttr then + try + FParentFont := False; + FFrameWidth := TJvTFDaysApptAttr(Source).FrameWidth; + FFrameColor := TJvTFDaysApptAttr(Source).FrameColor; + FColor := TJvTFDaysApptAttr(Source).Color; + Font.Assign(TJvTFDaysApptAttr(Source).Font); + ParentFont := TJvTFDaysApptAttr(Source).ParentFont; + finally + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDaysApptAttr.ParentFontChanged; +begin + if ParentFont and Assigned(FApptGrid) then + begin + FFont.OnChange := nil; + FFont.Assign(FApptGrid.Font); + FFont.OnChange := @FontChange; + end; +end; + +//=== { TJvTFSelCellAttr } =================================================== + +constructor TJvTFSelCellAttr.Create(AApptGrid: TJvTFDays); +begin + inherited Create; + + FApptGrid := AApptGrid; + FColor := clNavy; + FStyle := scsSolid; + FFrameWidth := 2; +end; + +procedure TJvTFSelCellAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFSelCellAttr.SetFrameWidth(Value: Integer); +begin + if Value <> FFrameWidth then + begin + FFrameWidth := Value; + Change; + end; +end; + +procedure TJvTFSelCellAttr.SetStyle(Value: TJvTFSelCellStyle); +begin + if Value <> FStyle then + begin + FStyle := Value; + Change; + end; +end; + +procedure TJvTFSelCellAttr.Change; +begin + if Assigned(FApptGrid) then + FApptGrid.Invalidate; +end; + +procedure TJvTFSelCellAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFSelCellAttr then + begin + FColor := TJvTFSelCellAttr(Source).Color; + FStyle := TJvTFSelCellAttr(Source).Style; + FFrameWidth := TJvTFSelCellAttr(Source).FrameWidth; + Change; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFDaysGrabHandles } =============================================== + +constructor TJvTFDaysGrabHandles.Create(AApptGrid: TJvTFDays); +begin + inherited Create; + FApptGrid := AApptGrid; + FStyle := gsFlat; + FColor := clBlue; + FHeight := 6; +end; + +procedure TJvTFDaysGrabHandles.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFDaysGrabHandles.SetHeight(Value: Integer); +begin + if Value < 1 then + Value := 1; + if Value <> FHeight then + begin + FHeight := Value; + Change; + end; +end; + +procedure TJvTFDaysGrabHandles.SetStyle(Value: TJvTFGrabStyle); +begin + if Value <> FStyle then + begin + FStyle := Value; + if Style = gs3D then + FHeight := 6; + Change; + end; +end; + +procedure TJvTFDaysGrabHandles.Change; +begin + if Assigned(FApptGrid) then + FApptGrid.Invalidate; +end; + +procedure TJvTFDaysGrabHandles.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysGrabHandles then + begin + FHeight := TJvTFDaysGrabHandles(Source).Height; + FColor := TJvTFDaysGrabHandles(Source).Color; + FStyle := TJvTFDaysGrabHandles(Source).Style; + Change; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFDays } ========================================================== + +constructor TJvTFDays.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + ControlStyle := ControlStyle + + [csOpaque, csCaptureMouse, csClickEvents, csDoubleClicks]; + + (* + with GetControlClassDefaultSize do + SetInitialBounds(0, 0, CX, CY); + *) + { + Height := 300; + Width := 400; + } + + FSaveFocCol := -1; + + //set property defaults +// FBorderStyle := bsSingle; + FColHdrHeight := 30; + FGroupHdrHeight := 25; + FRowHdrWidth := 50; + FRowHeight := 19; + FGranularity := 30; + FTopRow := 0; + FFocusedRow := -1; + FMinColWidth := AbsMinColWidth; + FLeftCol := -1; + FFocusedCol := -1; + FDefColWidth := 100; + FVisibleScrollBars := []; + FAutoSizeCols := True; + FMinRowHeight := 12; + ParentColor := False; + Color := clSilver; + FOptions := [agoSizeCols, agoSizeRows, agoSizeColHdr, agoSizeRowHdr, + agoSizeAppt, agoMoveAppt, agoEditing, agoShowPics, + agoShowText, agoShowApptHints, agoQuickEntry, agoShowSelHint]; + FColTitleStyle := ctsSingleEllipsis; + FRowHdrType := rhFancy; + FSelStart := Point(-1, -1); + FSelEnd := FSelStart; + FApptBuffer := 5; + FFocusedCol := -1; + FFocusedRow := -1; + FGridLineColor := clGray; + FDitheredBackground := True; + + {$IFDEF Jv_TIMEBLOCKS} + // all ok + FWeekend := [dowSunday, dowSaturday]; + FWeekendColor := clSilver; + FWeekendFillPic := TBitmap.Create; + FWeekendFillPic.Height := 16; + FWeekendFillPic.Width := 16; + UpdateWeekendFillPic; + {$ENDIF Jv_TIMEBLOCKS} + + // Create internal objects + FVScrollBar := TJvTFDaysScrollBar.Create(Self); + with FVScrollBar do + begin + Kind := sbVertical; + TabStop := False; + Anchors := []; + Parent := Self; + Visible := False; + OnScroll := @ScrollBarScroll; + end; + + FHScrollBar := TJvTFDaysScrollBar.Create(Self); + with FHScrollBar do + begin + Kind := sbHorizontal; + TabStop := False; + Anchors := []; + Parent := Self; + Visible := False; + OnScroll := @ScrollBarScroll; + end; + + FHdrAttr := TJvTFDaysHdrAttr.Create(Self); + FHdrAttr.Color := clBtnFace; + + FSelHdrAttr := TJvTFDaysHdrAttr.Create(Self); + with FSelHdrAttr do + begin + Color := clBtnFace; + Font.Color := clBlack; + end; + + FGroupHdrAttr := TJvTFDaysHdrAttr.Create(Self); + FGroupHdrAttr.Color := clBtnFace; + + FSelGroupHdrAttr := TJvTFDaysHdrAttr.Create(Self); + with FSelGroupHdrAttr do + begin + Color := clBtnFace; + Font.Color := clBlack; + end; + + FFancyRowHdrAttr := TJvTFDaysFancyRowHdrAttr.Create(Self); + FSelFancyRowHdrAttr := TJvTFDaysFancyRowHdrAttr.Create(Self); + with FSelFancyRowHdrAttr do + begin + TickColor := clBlack; + MinorFont.Color := clBlack; + MajorFont.Color := clBlack; + end; + + FSelCellAttr := TJvTFSelCellAttr.Create(Self); + + FApptBar := TJvTFDaysApptBar.Create(Self); + + FCols := TJvTFDaysCols.Create(Self); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + FTimeBlocks := TJvTFDaysTimeBlocks.Create(Self); + FTimeBlockProps := TJvTFDaysBlockProps.Create(Self); + {$ENDIF Jv_TIMEBLOCKS} + + FEditor := TJvTFInPlaceApptEditor.Create(Self); + with FEditor do + begin + Visible := False; + Parent := Self; + end; + + FThresholds := TJvTFDaysThresholds.Create(Self); + FPrimeTime := TJvTFDaysPrimeTime.Create(Self); + + FApptAttr := TJvTFDaysApptAttr.Create(Self); + FSelApptAttr := TJvTFDaysApptAttr.Create(Self); + + FTemplate := TJvTFDaysTemplate.Create(Self); + + FGrabHandles := TJvTFDaysGrabHandles.Create(Self); + + FHintProps := TJvTFHintProps.Create(Self); + //FHint := TJvTFHint.Create(Self); + FHint := GetTFHintClass.Create(Self); + FHint.RefProps := FHintProps; + PaintBuffer := TBitmap.Create; + FShowFocus := True; + + with GetControlClassDefaultSize do + SetInitialBounds(0, 0, CX, CY); +end; + +destructor TJvTFDays.Destroy; +begin + FVScrollBar.Free; + FHScrollBar.Free; + FHdrAttr.Free; + FSelHdrAttr.Free; + FGroupHdrAttr.Free; + FSelGroupHdrAttr.Free; + + FFancyRowHdrAttr.Free; + FSelFancyRowHdrAttr.Free; + FSelCellAttr.Free; + FApptBar.Free; + FPrimeTime.Free; + + {$IFDEF Jv_TIMEBLOCKS} + // all ok + FTimeBlocks.Free; + FTimeBlockProps.Free; + FWeekendFillPic.Free; + {$ENDIF Jv_TIMEBLOCKS} + + FEditor.Free; + FThresholds.Free; + FApptAttr.Free; + FSelApptAttr.Free; + FHint.Free; + FHintProps.Free; + FTemplate.Free; + FGrabHandles.Free; + PaintBuffer.Free; + inherited Destroy; + + // This MUST be done after the inherited Destroy as it will set the Manager + // property to nil, thus triggering RelSchedNotification if ScheduleCount + // is still not 0. And in that very method, there is a test on Cols.Count. + // Hence, if FCols was to be freed before inherited, RelSchedNotification + // would try to access a freed object, leading to potential AVs. + FCols.Free; +end; + + + { +procedure TJvTFDays.CMCtl3DChanged(var Msg: TLMessage); +begin + if FBorderStyle = bsSingle then + RecreateWnd; + inherited; +end; } + +procedure TJvTFDays.WMGetDlgCode(var Msg: TLMGetDlgCode); +begin + Msg.Result := DLGC_WANTALLKEYS or DLGC_WANTARROWS; +end; + + + { +procedure TJvTFDays.SetBorderStyle(Value: TBorderStyle); +begin + if FBorderStyle <> Value then + begin + FBorderStyle := Value; + RecreateWnd; + end; +end; +} + +procedure TJvTFDays.SetTFVisibleScrollBars(Value: TJvTFVisibleScrollBars); +begin + if Value <> FVisibleScrollBars then + begin + FVisibleScrollBars := Value; + AlignScrollBars; + FVScrollBar.Visible := vsbVert in FVisibleScrollBars; + FHScrollBar.Visible := vsbHorz in FVisibleScrollBars; + end; +end; + +procedure TJvTFDays.AlignScrollBars; +begin + // DO NOT INVALIDATE GRID IN THIS METHOD + if (FVScrollBar = nil) or (FHScrollbar = nil) then + exit; + + FVScrollBar.Left := ClientWidth - FVScrollBar.Width; + FHScrollBar.Top := ClientHeight - FHScrollBar.Height; + + with FVScrollBar do + begin + //group Top := ColHdrHeight; + Top := CalcGroupColHdrsHeight; + if vsbHorz in VisibleScrollBars then + Height := FHScrollBar.Top - Top + else + Height := Self.ClientHeight - Top; + end; + + with FHScrollBar do + begin + {$IFDEF Jv_TIMEBLOCKS} + // ok + Left := CalcBlockRowHdrsWidth; + {$ELSE} + // remove + //Left := RowHdrWidth; + {$ENDIF Jv_TIMEBLOCKS} + + if vsbVert in VisibleScrollBars then + Width := FVScrollBar.Left - Left + else + Width := Self.ClientWidth - Left; + end; +end; + +function TJvTFDays.CheckSBVis: Boolean; +var + NewSBVis: TJvTFVisibleScrollBars; + I, TempWidth, NewDataHeight, NewDataWidth: Integer; + DoColResize: Boolean; + + function CalcDataRect(ForScrollBars: TJvTFVisibleScrollBars): TRect; + begin + Result := GetClientRect; + {$IFDEF Jv_TIMEBLOCKS} + // ok + Inc(Result.Left, CalcBlockRowHdrsWidth); + {$ELSE} + // remove + //Inc(Result.Left, RowHdrWidth); + {$ENDIF Jv_TIMEBLOCKS} + + //group Inc(Result.Top, ColHdrHeight); + Inc(Result.Top, CalcGroupColHdrsHeight); + if vsbHorz in ForScrollBars then + Dec(Result.Bottom, FHScrollBar.Height); + if vsbVert in ForScrollBars then + Dec(Result.Right, FVScrollBar.Width); + end; + + function CalcDataWidth(ForScrollBars: TJvTFVisibleScrollBars): Integer; + begin + Result := RectWidth(CalcDataRect(ForScrollBars)); + end; + + function CalcDataHeight(ForScrollBars: TJvTFVisibleScrollBars): Integer; + begin + Result := RectHeight(CalcDataRect(ForScrollBars)); + end; + +begin + NewSBVis := []; + + // First check vert scroll bar, assuming horz is not needed + NewDataHeight := CalcDataHeight(NewSBVis); + if (RowCount * RowHeight > NewDataHeight) or (TopRow > 0) then + Include(NewSBVis, vsbVert); + + if Cols.Count > 0 then + begin + // Now check the horz scroll under the new conditions + NewDataWidth := CalcDataWidth(NewSBVis); + if AutoSizeCols then + begin + if (Cols.Count * MinColWidth > NewDataWidth) or (LeftCol > 0) then + Include(NewSBVis, vsbHorz); + end + else + begin + TempWidth := 0; + I := 0; + while (TempWidth <= NewDataWidth) and (I < Cols.Count) do + begin + Inc(TempWidth, Cols[I].Width); + Inc(I); + end; + + if (TempWidth > NewDataWidth) or (LeftCol > 0) then + Include(NewSBVis, vsbHorz); + end; + end; + + // if the horz scrollbar should show, we must recheck the vert scrollbar, + // since the vert scrollbar was initially checked with the assumption + // that the horz scrollbar was not needed. + if vsbHorz in NewSBVis then + begin + NewDataHeight := CalcDataHeight(NewSBVis); + if (RowCount * RowHeight > NewDataHeight) or (TopRow > 0) then + Include(NewSBVis, vsbVert); + end; + + // if we're autosizing the cols and the vert scrollbar has been + // toggled and the horz scroll isn't visible then we need to resize + // the cols. We can't call Cols.Resize until VisibleScrollBars has + // been updated so just set a flag here. + DoColResize := AutoSizeCols and not (vsbHorz in NewSBVis) and + ((vsbVert in NewSBVis) xor (vsbVert in VisibleScrollBars)); + + // At this point NewSBVis will correctly reflect which scrollbars need to + // visible on the control. + VisibleScrollBars := NewSBVis; + + // In order to optimize the resizing of cols when AutoSizeCols is on, this + // function needs a return value specifying whether or not the cols have + // been resized from within this routine. if we're not autosizing cols + // it'll return false, but the result is meaningless. + Result := DoColResize; + + // Finally, resize the cols if necessary + if DoColResize then + Cols.ResizeCols; + + CheckSBParams; +end; + +procedure TJvTFDays.SetOnShowHint(Value: TJvTFShowHintEvent); +begin + FHint.OnShowHint := Value; +end; + +function TJvTFDays.GetOnShowHint: TJvTFShowHintEvent; +begin + Result := FHint.OnShowHint; +end; + +procedure TJvTFDays.SetGranularity(Value: Integer); +var + ATime: TTime; + MaxRowHeight, I: Integer; +begin + if Assigned(FOnGranularityChanging) then + FOnGranularityChanging(Self, Value); + + // Enforce minimum granularity of 1 min and max of 60 mins + if Value < 1 then + Value := 1 + else + if Value > 60 then + Value := 60; + + // Ensure that granularity is evenly divisable by an hour + while 60 mod Value <> 0 do + Dec(Value); + + // Sum of row heights cannot exceed 32767 + MaxRowHeight := 32767 div (60 div Value * 24); + if RowHeight > MaxRowHeight then + RowHeight := MaxRowHeight; + + if Value <> FGranularity then + begin + {$IFDEF Jv_TIMEBLOCKS} + // ok + EnsureBlockRules(Value, TimeBlockProps.BlockGran, TimeBlockProps.DayStart); + {$ENDIF Jv_TIMEBLOCKS} + + ATime := RowToTime(TopRow); + FGranularity := Value; + ClearSelection; + if not (csLoading in ComponentState) then + begin + for I := 0 to Cols.Count - 1 do + Cols[I].RefreshMap; + TopRow := TimeToRow(ATime); + CheckSBVis; + CheckSBParams; + Invalidate; + if Assigned(FOnGranularityChanged) then + FOnGranularityChanged(Self); + end; + end; +end; + +procedure TJvTFDays.SetColHdrHeight(Value: Integer); +begin + if Value > RectHeight(GetAdjClientRect) then + Value := RectHeight(GetAdjClientRect); + if Value < 1 then + Value := 1; + + if Value <> ColHdrHeight then + begin + FColHdrHeight := Value; + AlignScrollBars; + if not (csLoading in ComponentState) then + begin + CheckSBVis; + CheckSBParams; + Invalidate; + end; + end; +end; + +procedure TJvTFDays.SetRowHdrWidth(Value: Integer); +begin + if Value > RectWidth(GetAdjClientRect) then + Value := RectWidth(GetAdjClientRect); + if Value < 1 then + Value := 1; + + if Value <> FRowHdrWidth then + begin + FRowHdrWidth := Value; + AlignScrollBars; + if AutoSizeCols then + begin + if not CheckSBVis then + if not (vsbHorz in VisibleScrollBars) then + Cols.ResizeCols; + end + else + CheckSBVis; + CheckSBParams; + Invalidate; + end; +end; + +procedure TJvTFDays.SetRowHeight(Value: Integer); +var + MaxRowHeight: Integer; +begin + if Value > GetDataHeight then + Value := GetDataHeight; + if Value < MinRowHeight then + Value := MinRowHeight; + if Value < 1 then + Value := 1; + + // Sum of row heights cannot exceed 32767. + MaxRowHeight := 32767 div (60 div Granularity * 24); + if Value > MaxRowHeight then + Value := MaxRowHeight; + + if Value <> FRowHeight then + begin + FRowHeight := Value; + if not (csLoading in ComponentState) then + begin + CheckSBVis; + CheckSBParams; + Invalidate; + end; + end; +end; + +procedure TJvTFDays.SetMinRowHeight(Value: Integer); +begin + if Value < AbsMinColWidth then + Value := AbsMinColWidth; + + if Value <> FMinRowHeight then + begin + FMinRowHeight := Value; + if Value > RowHeight then + RowHeight := Value; + end; +end; + +procedure TJvTFDays.SetMinColWidth(Value: Integer); +begin + if Value < AbsMinColWidth then + Value := AbsMinColWidth; + + if Value <> FMinColWidth then + begin + FMinColWidth := Value; + if not (csLoading in ComponentState) then + Cols.EnsureMinColWidth; + end; +end; + +procedure TJvTFDays.SetAutoSizeCols(Value: Boolean); +begin + if Value <> FAutoSizeCols then + begin + FAutoSizeCols := Value; + if FAutoSizeCols then + if not CheckSBVis then + Cols.ResizeCols; + end; +end; + +procedure TJvTFDays.SetTFColTitleStyle(Value: TJvTFColTitleStyle); +begin + if Value <> FColTitleStyle then + begin + FColTitleStyle := Value; + Invalidate; + end; +end; + +procedure TJvTFDays.SetCols(Value: TJvTFDaysCols); +begin + FCols.Assign(Value); +end; + +procedure TJvTFDays.SetTopRow(Value: Integer); +var + MaxTopRow: Integer; +begin + MaxTopRow := RowCount - 1; + if MaxTopRow < 0 then + MaxTopRow := 0; + if Value > MaxTopRow then + Value := MaxTopRow; + + if Value <> FTopRow then + if (Value > -1) and (Value < RowCount) then + begin + if Editing then + FinishEditAppt; + + FTopRow := Value; + FVScrollBar.Position := Value; + CheckSBVis; + Invalidate; + end + else + raise EJvTFDaysError.CreateRes(@RsERowIndexOutOfBounds); +end; + +procedure TJvTFDays.SetFocusedRow(Value: Integer); +begin + // ALLOW -1 TO INDICATE NO SELECTED ROW + + {$IFDEF Jv_TIMEBLOCKS} + // ok + if (Value <> -1) and (RowToTimeBlock(Value) = -1) and (TimeBlocks.Count > 0) then + Exit; + {$ENDIF Jv_TIMEBLOCKS} + + if Value <> FFocusedRow then + if (Value >= -1) and (Value < RowCount) then + begin + FFocusedRow := Value; + if not (csDesigning in ComponentState) then + SetFocus; + if not Assigned(SelAppt) and (Value > -1) then + RowInView(Value); + if Assigned(FOnFocusedRowChanged) then + FOnFocusedRowChanged(Self); + Invalidate; + end + else + raise EJvTFDaysError.CreateRes(@RsERowIndexOutOfBounds); +end; + +function TJvTFDays.GetFocusedRow: Integer; +begin + if Focused then + Result := FFocusedRow + else + Result := -1; +end; + +procedure TJvTFDays.SetLeftCol(Value: Integer); +begin + // LeftCol will be -1 when no cols are present. + // After the first col is added, LeftCol is set to 0, which is done in + // TJvTFDaysCols.Update. Likewise, when all cols are removed, LeftCol + // must be set to -1. This is also done in TJvTFDaysCols.Update. + + if Value <> FLeftCol then + if Cols.Count > 0 then + if (Value > -1) and (Value < Cols.Count) then + begin + FLeftCol := Value; + FHScrollBar.Position := Value; + if not Cols.Updating then + begin + CheckSBVis; + CheckSBParams; + Invalidate; + end; + end + else + raise EJvTFDaysError.CreateRes(@RsEColumnIndexOutOfBounds) + else + if Value = -1 then + begin + FLeftCol := -1; + Invalidate; + end + else + raise EJvTFDaysError.CreateRes(@RsEColumnIndexOutOfBounds); +end; + +procedure TJvTFDays.SetFocusedCol(Value: Integer); +begin + // ALLOW -1 TO INDICATE NO SELECTED COL + + if Value <> FFocusedCol then + if (Value >= -1) and (Value < Cols.Count) then + begin + FFocusedCol := Value; + if not (csDesigning in ComponentState) then + SetFocus; + if not Cols.Updating then + begin + if Value > -1 then + ColInView(Value); + if Assigned(FOnFocusedColChanged) then + FOnFocusedColChanged(Self); + Invalidate; + end; + end + else + raise EJvTFDaysError.CreateRes(@RsEColumnIndexOutOfBounds); +end; + +function TJvTFDays.GetFocusedCol: Integer; +begin + if Focused then + Result := FFocusedCol + else + Result := -1; +end; + +procedure TJvTFDays.SetHdrAttr(Value: TJvTFDaysHdrAttr); +begin + FHdrAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetSelHdrAttr(Value: TJvTFDaysHdrAttr); +begin + FSelHdrAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetApptAttr(Value: TJvTFDaysApptAttr); +begin + FApptAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetSelApptAttr(Value: TJvTFDaysApptAttr); +begin + FSelApptAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetFancyRowHdrAttr(Value: TJvTFDaysFancyRowHdrAttr); +begin + FFancyRowHdrAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetSelFancyRowHdrAttr(Value: TJvTFDaysFancyRowHdrAttr); +begin + FSelFancyRowHdrAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetTFRowHdrType(Value: TJvTFRowHdrType); +begin + if Value <> FRowHdrType then + begin + FRowHdrType := Value; + Invalidate; + end; +end; + +procedure TJvTFDays.SetTFSelCellAttr(Value: TJvTFSelCellAttr); +begin + FSelCellAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetApptBar(Value: TJvTFDaysApptBar); +begin + FApptBar.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetApptBuffer(Value: Integer); +begin + if Value < 0 then + Value := 0; + if Value <> FApptBuffer then + begin + FApptBuffer := Value; + Invalidate; + end; +end; + +procedure TJvTFDays.SetGridLineColor(Value: TColor); +begin + if Value <> FGridLineColor then + begin + FGridLineColor := Value; + Invalidate; + end; +end; + +procedure TJvTFDays.SetGrabHandles(Value: TJvTFDaysGrabHandles); +begin + FGrabHandles.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetOptions(Value: TJvTFDaysOptions); +begin + FOptions := Value; + Invalidate; +end; + +procedure TJvTFDays.SetDateFormat(const Value: string); +begin + if Value <> FDateFormat then + begin + FDateFormat := Value; + Cols.UpdateTitles; + Invalidate; + end; +end; + +procedure TJvTFDays.RelSchedNotification(Schedule: TJvTFSched); +var + I: Integer; +begin + for I := 0 to Cols.Count - 1 do + if Cols[I].Schedule = Schedule then + Cols[I].Disconnect; + inherited RelSchedNotification(Schedule); +end; + +procedure TJvTFDays.CreateParams(var Params: TCreateParams); +const + BorderStyles: array [TBorderStyle] of DWORD = (0, WS_BORDER); +begin + inherited CreateParams(Params); + { + with Params do + begin + Style := Style or BorderStyles[FBorderStyle] or WS_CLIPCHILDREN; + if Ctl3D and (FBorderStyle = bsSingle) then + begin + Style := Style and not WS_BORDER; + ExStyle := ExStyle or WS_EX_CLIENTEDGE; + end; + end; + } +end; + +function TJvTFDays.GetFocusedSchedule: TJvTFSched; +begin + Result := nil; + if FocusedCol > gcHdr then + Result := Cols[FocusedCol].Schedule; +end; + +procedure TJvTFDays.SetSelAppt(Value: TJvTFAppt); +begin + // need event here with var Appt param - allows handler to set Appt + // to nil. + if Assigned(FOnSelectingAppt) then + FOnSelectingAppt(Self, Value); + + if Value <> FSelAppt then + begin + if Editing then + FinishEditAppt; + if Assigned(FOnSelectAppt) then + FOnSelectAppt(Self, FSelAppt, Value); + FSelAppt := Value; + if Assigned(FOnSelectedAppt) then + FOnSelectedAppt(Self); + Invalidate; + end; +end; + +procedure TJvTFDays.Paint; +var + I, J, lRightCol, lBottomRow: Integer; +begin +{ optimization incorrectly kicks in if control is only partially + visible on the screen + if not PaintBuffer.Empty and + ((Canvas.ClipRect.Left <> ClientRect.Left) or + (Canvas.ClipRect.Top <> ClientRect.Top) or + (Canvas.ClipRect.Right <> ClientRect.Right) or + (Canvas.ClipRect.Bottom <> ClientRect.Bottom)) then + begin + With Canvas do + Windows.BitBlt(Canvas.Handle, ClipRect.Left, ClipRect.Top, + RectWidth(ClipRect), RectHeight(ClipRect), + PaintBuffer.Canvas.Handle, + ClipRect.Left, ClipRect.Top, SRCCOPY); + Exit; + end; + } + + with PaintBuffer do + begin + Width := ClientWidth; + Height := ClientHeight; + + with Canvas do + begin + if FDitheredBackground then + // added by TIM, 10/27/2001 10:36:03 PM: + DrawDither(Canvas, Classes.Rect(0, 0, Width, Height), Self.Color, clGray) + else + begin + Brush.Color := Self.Color; + FillRect(Classes.Rect(0, 0, Width, Height)); + end; + end; + + DrawCorner(Canvas, agcTopLeft); + + if Cols.Count = 0 then + DrawEmptyColHdr(Canvas); + + DrawGroupHdrs(Canvas); + + lRightCol := LeftCol + VisibleCols - 1; + for I := LeftCol to lRightCol do + //DrawColHdr(Canvas, I); + DrawColGroupHdr(Canvas, I, False); + + if vsbVert in VisibleScrollBars then + DrawCorner(Canvas, agcTopRight); + + {$IFDEF Jv_TIMEBLOCKS} + // all ok + FillBlockHdrDeadSpace(Canvas); + for I := 0 to TimeBlocks.Count - 1 do + DrawBlockHdr(Canvas, I); + {$ENDIF Jv_TIMEBLOCKS} + + lBottomRow := TopRow + VisibleRows - 1; + if RowHdrType = rhFancy then + DrawFancyRowHdrs(Canvas) + else + for I := TopRow to lBottomRow do + DrawRowHdr(Canvas, I); + + for I := TopRow to lBottomRow do + for J := LeftCol to lRightCol do + DrawDataCell(Canvas, J, I); + + if not (csDesigning in ComponentState) then + DrawAppts(Canvas, False); + + if vsbHorz in VisibleScrollBars then + begin + DrawCorner(Canvas, agcBottomLeft); + if vsbVert in VisibleScrollBars then + DrawCorner(Canvas, agcBottomRight); + end; + end; + + if Enabled then + BitBlt(Canvas.Handle, 0, 0, ClientWidth, ClientHeight, + PaintBuffer.Canvas.Handle, 0, 0, SRCCOPY) + else + BitBlt(Canvas.Handle, 0, 0, ClientWidth, ClientHeight, + PaintBuffer.Canvas.Handle, 0, 0, SRCCOPY) + { wp --- to do: Above line is a work-around because LCL does not + support DrawState + Windows.DrawState(Canvas.Handle, 0, nil, PaintBuffer.Handle, 0, + 0, 0, 0, 0, DST_BITMAP or DSS_UNION or DSS_DISABLED); + } +end; + +{$IFNDEF Jv_TIMEBLOCKS} +// OBSOLETE +{ +procedure TJvTFDays.DrawDataCell(ACanvas: TCanvas; ColIndex, RowIndex: Integer); +Var + SelFrameRect, + FocusRect, + ARect: TRect; + I, + PrimeStartRow, + PrimeEndRow, + FrameOffset: Integer; + CellColor: TColor; + IsPrimeTimeCell: Boolean; +begin + // Calc the cell rect + ARect.Left := RowHdrWidth; + For I := LeftCol to ColIndex - 1 do + Inc(ARect.Left, Cols[I].Width); + ARect.Right := ARect.Left + Cols[ColIndex].Width; + + //group Top := ColHdrHeight + (RowIndex - TopRow) * RowHeight; + ARect.Top := CalcGroupColHdrsHeight + (RowIndex - TopRow) * RowHeight; + ARect.Bottom := ARect.Top + RowHeight; + + PrimeStartRow := TimeToRow(PrimeTime.StartTime); + PrimeEndRow := TimeToRow(AdjustEndTime(PrimeTime.EndTime)); + + IsPrimeTimeCell := (RowIndex >= PrimeStartRow) and (RowIndex <= PrimeEndRow); + + if IsPrimeTimeCell then + CellColor := PrimeTime.Color + else + CellColor := Color; + + if Assigned(FOnShadeCell) then + FOnShadeCell(Self, ColIndex, RowIndex, CellColor); + + if IsPrimeTimeCell and (CellColor = PrimeTime.Color) then + Windows.StretchBlt(ACanvas.Handle, ARect.Left, ARect.Top, RectWidth(ARect), + RectHeight(ARect), PrimeTime.FFillPic.Canvas.Handle, + 0, 0, PrimeTime.FFillPic.Width, + PrimeTime.FFillPic.Height, SRCCOPY) + else + if CellColor <> Color then + begin + ACanvas.Brush.Color := CellColor; + ACanvas.FillRect(ARect); + end; + + if CellIsSelected(Point(ColIndex, RowIndex)) then + if SelCellAttr.Style = scsFrame then + begin + SelFrameRect := ARect; + FrameOffset := -(SelCellAttr.FrameWidth div 2); + Windows.InflateRect(SelFrameRect, FrameOffset, FrameOffset); + + if SelCellAttr.FrameWidth mod 2 <> 0 then + begin + Dec(SelFrameRect.Right); + Dec(SelFrameRect.Bottom); + end; + + With ACanvas do + begin + Pen.Color := SelCellAttr.Color; + Pen.Width := SelCellAttr.FrameWidth; + + if FFromToSel then + begin + // Draw Left border + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + + // Draw Top border only if this cell is the same as SelStart cell + if (ColIndex = SelStart.X) and (RowIndex = SelStart.Y) then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Top); + end; + + // Draw Right border + MoveTo(SelFrameRect.Right - 1, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + + // Draw bottom border only in this cell is the same as SelEnd cell + if (ColIndex = SelEnd.X) and (RowIndex = SelEnd.Y) then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + end; + end + else + begin + // Draw Left border only if col is left-most in selection + if ColIndex = SelStart.X then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + end; + + // Draw Top border only if row is top-most in selection + if RowIndex = SelStart.Y then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Top); + end; + + // Draw Right border only if col is right-most in selection + if ColIndex = SelEnd.X then + begin + MoveTo(SelFrameRect.Right - 1, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + end; + + // Draw Bottom border only if row is bottom-most in selection + if RowIndex = SelEnd.Y then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + end; + end; + end; + end + // Refer to the private FSel* fields because we want anchor + else + if (SelCellAttr.Style = scsCombo) and + (FSelStart.X = ColIndex) and (FSelStart.Y = RowIndex) then + begin + SelFrameRect := ARect; + FrameOffset := -(SelCellAttr.FrameWidth div 2); + Windows.InflateRect(SelFrameRect, FrameOffset, FrameOffset); + + if SelCellAttr.FrameWidth mod 2 <> 0 then + begin + Dec(SelFrameRect.Right); + Dec(SelFrameRect.Bottom); + end; + + With ACanvas do + begin + Pen.Color := SelCellAttr.Color; + Pen.Width := SelCellAttr.FrameWidth; + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Left, SelFrameRect.Top); + end; + end + else + begin + ACanvas.Brush.Color := SelCellAttr.Color; + ACanvas.FillRect(ARect); + end; + + if (ColIndex = FocusedCol) and (RowIndex = FocusedRow) and Focused then + begin + FocusRect := ARect; + Windows.InflateRect(FocusRect, -1, -1); + Dec(FocusRect.Bottom); + Dec(FocusRect.Right); + ManualFocusRect(ACanvas, FocusRect); + end; + + // Draw a line across the bottom and down the right side + With ACanvas do + begin + Pen.Color := GridLineColor; + Pen.Width := 1; + + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + end; + + if Assigned(FOnDrawDataCell) then + FOnDrawDataCell(Self, ACanvas, ARect, ColIndex, RowIndex); +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +{$IFDEF Jv_TIMEBLOCKS} +// ok +procedure TJvTFDays.DrawDataCell(ACanvas: TCanvas; ColIndex, RowIndex: Integer); +var + SelFrameRect, FocusRect, Rect: TRect; + I, PrimeStartRow, PrimeEndRow: Integer; + FrameOffset, BlockStart, BlockEnd, TimeBlockIndex: Integer; + IsPrimeTimeCell: Boolean; + CellColor: TColor; + // col buffer start + BufferRect: TRect; + // col buffer end +begin + // Calc the cell rect + //block Left := RowHdrWidth; + Rect.Left := CalcBlockRowHdrsWidth; + for I := LeftCol to ColIndex - 1 do + Inc(Rect.Left, Cols[I].Width); + Rect.Right := Rect.Left + Cols[ColIndex].Width; + + //group Top := ColHdrHeight + (RowIndex - TopRow) * RowHeight; + Rect.Top := CalcGroupColHdrsHeight + (RowIndex - TopRow) * RowHeight; + Rect.Bottom := Rect.Top + RowHeight; + + PrimeStartRow := TimeToRow(PrimeTime.StartTime); + PrimeEndRow := TimeToRow(AdjustEndTime(PrimeTime.EndTime)); + + IsPrimeTimeCell := (RowIndex >= PrimeStartRow) and (RowIndex <= PrimeEndRow); + + if IsWeekend(ColIndex) then + CellColor := WeekendColor + else + if IsPrimeTimeCell then + CellColor := PrimeTime.Color + else + CellColor := Color; + + if Assigned(FOnShadeCell) then + FOnShadeCell(Self, ColIndex, RowIndex, CellColor); + + if IsWeekend(ColIndex) and (CellColor = WeekendColor) then + begin + if FDitheredBackground then + DrawDither(ACanvas, Rect, CellColor, clWhite) + else + StretchBlt(ACanvas.Handle, Rect.Left, Rect.Top, RectWidth(Rect), + RectHeight(Rect), FWeekendFillPic.Canvas.Handle, + 0, 0, FWeekendFillPic.Width, + FWeekendFillPic.Height, SRCCOPY); + end + else + if IsPrimeTimeCell and (CellColor = PrimeTime.Color) then + begin + if FDitheredBackground then + DrawDither(ACanvas, Rect, CellColor, clWhite) + else + StretchBlt(ACanvas.Handle, Rect.Left, Rect.Top, RectWidth(Rect), + RectHeight(Rect), PrimeTime.FFillPic.Canvas.Handle, + 0, 0, PrimeTime.FFillPic.Width, + PrimeTime.FFillPic.Height, SRCCOPY); + end + else + if CellColor <> Color then + begin + ACanvas.Brush.Color := CellColor; + ACanvas.FillRect(Rect); + end + else + begin + if FDitheredBackground then + DrawDither(ACanvas, Rect, CellColor, clWhite); + end; + + { + if IsWeekend(ColIndex) then + Windows.StretchBlt(ACanvas.Handle, ARect.Left, ARect.Top, RectWidth(ARect), + RectHeight(ARect), FWeekendFillPic.Canvas.Handle, + 0, 0, FWeekendFillPic.Width, + FWeekendFillPic.Height, SRCCOPY) + else + if (RowIndex >= PrimeStartRow) and (RowIndex <= PrimeEndRow) then + Windows.StretchBlt(ACanvas.Handle, ARect.Left, ARect.Top, RectWidth(ARect), + RectHeight(ARect), PrimeTime.FFillPic.Canvas.Handle, + 0, 0, PrimeTime.FFillPic.Width, + PrimeTime.FFillPic.Height, SRCCOPY); + } + + if CellIsSelected(Point(ColIndex, RowIndex)) then + if SelCellAttr.Style = scsFrame then + begin + SelFrameRect := Rect; + FrameOffset := -(SelCellAttr.FrameWidth div 2); + InflateRect(SelFrameRect, FrameOffset, FrameOffset); + + if SelCellAttr.FrameWidth mod 2 <> 0 then + begin + Dec(SelFrameRect.Right); + Dec(SelFrameRect.Bottom); + end; + + with ACanvas do + begin + Pen.Color := SelCellAttr.Color; + Pen.Width := SelCellAttr.FrameWidth; + + if FFromToSel then + begin + // Draw Left border + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + + // Draw Top border only if this cell is the same as SelStart cell + if (ColIndex = SelStart.X) and (RowIndex = SelStart.Y) then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Top); + end; + + // Draw Right border + MoveTo(SelFrameRect.Right - 1, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + + // Draw bottom border only in this cell is the same as SelEnd cell + if (ColIndex = SelEnd.X) and (RowIndex = SelEnd.Y) then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + end; + end + else + begin + // Draw Left border only if col is left-most in selection + if ColIndex = SelStart.X then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + end; + + // Draw Top border only if row is top-most in selection + if RowIndex = SelStart.Y then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Top); + end; + + // Draw Right border only if col is right-most in selection + if ColIndex = SelEnd.X then + begin + MoveTo(SelFrameRect.Right - 1, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + end; + + // Draw Bottom border only if row is bottom-most in selection + if RowIndex = SelEnd.Y then + begin + MoveTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + end; + end; + end; + end + // Refer to the private FSel* fields because we want anchor + else + if (SelCellAttr.Style = scsCombo) and + (FSelStart.X = ColIndex) and (FSelStart.Y = RowIndex) then + begin + SelFrameRect := Rect; + FrameOffset := -(SelCellAttr.FrameWidth div 2); + InflateRect(SelFrameRect, FrameOffset, FrameOffset); + + if SelCellAttr.FrameWidth mod 2 <> 0 then + begin + Dec(SelFrameRect.Right); + Dec(SelFrameRect.Bottom); + end; + + with ACanvas do + begin + Pen.Color := SelCellAttr.Color; + Pen.Width := SelCellAttr.FrameWidth; + MoveTo(SelFrameRect.Left, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Top); + LineTo(SelFrameRect.Right - 1, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Left, SelFrameRect.Bottom - 1); + LineTo(SelFrameRect.Left, SelFrameRect.Top); + end; + end + else + begin + ACanvas.Brush.Color := SelCellAttr.Color; + ACanvas.FillRect(Rect); + end; + + if (ColIndex = FocusedCol) and (RowIndex = FocusedRow) and Focused and ShowFocus then + begin + FocusRect := Rect; + InflateRect(FocusRect, -1, -1); + Dec(FocusRect.Bottom); + Dec(FocusRect.Right); + ManualFocusRect(ACanvas, FocusRect); + end; + + // Draw a line across the bottom and down the right side + with ACanvas do + begin + Pen.Color := GridLineColor; + Pen.Width := 1; + + MoveTo(Rect.Left, Rect.Bottom - 1); + LineTo(Rect.Right, Rect.Bottom - 1); + MoveTo(Rect.Right - 1, Rect.Top); + LineTo(Rect.Right - 1, Rect.Bottom); + + if TimeBlocks.Count > 0 then + begin + GetTimeBlockStartEnd(0, BlockStart, BlockEnd); + if RowIndex = BlockStart - 1 then + begin + Pen.Color := TimeBlockProps.DataDivColor; + MoveTo(Rect.Left, Rect.Bottom - 1); + LineTo(Rect.Right, Rect.Bottom - 1); + end; + + TimeBlockIndex := RowToTimeBlock(RowIndex); + if TimeBlockIndex > -1 then + begin + GetTimeBlockStartEnd(TimeBlockIndex, BlockStart, BlockEnd); + if BlockEnd = RowIndex then + begin + Pen.Color := TimeBlockProps.DataDivColor; + MoveTo(Rect.Left, Rect.Bottom - 1); + LineTo(Rect.Right, Rect.Bottom - 1); + end; + end; + end; + end; + + // Col Buffer start + // Draw the column buffer + with ACanvas do + begin + BufferRect := Rect; + BufferRect.Right := BufferRect.Left + ApptBar.Width; // + 10 to simulate buffer + + Brush.Color := clWhite; + FillRect(BufferRect); + + Pen.Color := clBlack; + Pen.Width := 1; + + MoveTo(BufferRect.Right, BufferRect.Top); + LineTo(BufferRect.Right, BufferRect.Bottom); + end; + // Col buffer end + + if Assigned(FOnDrawDataCell) then + FOnDrawDataCell(Self, ACanvas, Rect, ColIndex, RowIndex); +end; +{$ENDIF Jv_TIMEBLOCKS} + +procedure TJvTFDays.DrawEmptyColHdr(ACanvas: TCanvas); +var + Rect: TRect; +begin + {$IFDEF Jv_TIMEBLOCKS} + // ok + Rect.Left := CalcBlockRowHdrsWidth; + {$ELSE} + // remove + //Left := RowHdrWidth; + {$ENDIF Jv_TIMEBLOCKS} + Rect.Top := 0; + Rect.Right := Rect.Left + GetDataWidth; + //group Bottom := ColHdrHeight; + Rect.Bottom := CalcGroupColHdrsHeight; + + ACanvas.Brush.Color := HdrAttr.Color; + ACanvas.FillRect(Rect); + ACanvas.Pen.Color := clGray; + ACanvas.MoveTo(Rect.Left, Rect.Bottom - 1); + ACanvas.LineTo(Rect.Right, Rect.Bottom - 1); +end; + +procedure TJvTFDays.DrawAppt(ACanvas: TCanvas; Col: Integer; + Appt: TJvTFAppt; StartRow, EndRow: Integer); +var + ApptRect: TRect; + ClipRgn: HRgn; +begin + ApptRect := GetApptRect(Col, Appt); + + if IsRectEmpty(ApptRect) then + Exit; + + // Printer bug, fixed + ClipRgn := CreateRectRgn(RowHdrWidth, CalcGroupColHdrsHeight, + ClientWidth, ClientHeight); + SelectClipRgn(ACanvas.Handle, ClipRgn); + DrawApptDetail(ACanvas, ApptRect, Appt, Appt = SelAppt, Col, StartRow, EndRow); + SelectClipRgn(ACanvas.Handle, 0); + DeleteObject(ClipRgn); +end; + +function TJvTFDays.CalcTimeStampRect(Appt: TJvTFAppt; BarRect: TRect; + Col, StartRow, EndRow: Integer): TRect; +var + Offset, ApptLength: TTime; + ColDate: TDate; + StartPercent, EndPercent: Double; +begin + Result := BarRect; + + if StartRow < 0 then + StartRow := 0; + + if EndRow > RowCount - 1 then + EndRow := RowCount - 1; + + Offset := RowToTime(StartRow); + ApptLength := RowEndTime(EndRow) - Offset; + ColDate := Cols[Col].SchedDate; + + if Trunc(ColDate) <> Trunc(Appt.StartDate) then + StartPercent := 0 + else + StartPercent := (Appt.StartTime - Offset) / ApptLength; + + if Trunc(ColDate) <> Trunc(Appt.EndDate) then + EndPercent := 1.0 + else + EndPercent := (Appt.EndTime - Offset) / ApptLength; + + Result.Top := Round((BarRect.Bottom - BarRect.Top) * StartPercent) + BarRect.Top; + Result.Bottom := Round((BarRect.Bottom - BarRect.Top) * EndPercent) + BarRect.Top; +end; + +procedure TJvTFDays.DrawTimeStamp(ACanvas: TCanvas; TimeStampRect: TRect); +var + OldColor: TColor; + StampLeft: Integer; +begin + with ACanvas do + case ApptBar.TimeStampStyle of + tssFullI: + begin + OldColor := Pen.Color; + Pen.Color := ApptBar.TimeStampColor; + MoveTo(TimeStampRect.Left + 1, TimeStampRect.Top); + LineTo(TimeStampRect.Right - 1, TimeStampRect.Top); + MoveTo(TimeStampRect.Left + 1, TimeStampRect.Bottom - 1); + LineTo(TimeStampRect.Right - 1, TimeStampRect.Bottom - 1); + + if ApptBar.Width > 5 then + Pen.Width := 2 + else + Pen.Width := 1; + + // Printer bug, fixed + StampLeft := TimeStampRect.Left + RectWidth(TimeStampRect) div 2; + MoveTo(StampLeft, TimeStampRect.Top + 1); + LineTo(StampLeft, TimeStampRect.Bottom - 1); + + Pen.Width := 1; + + Pen.Color := OldColor; + end; + tssHalfI: + begin + // we only want the left half of the time stamp rect + TimeStampRect.Right := (TimeStampRect.Left + TimeStampRect.Right) div 2; + + OldColor := Pen.Color; + Pen.Color := ApptBar.TimeStampColor; + MoveTo(TimeStampRect.Left, TimeStampRect.Top); + LineTo(TimeStampRect.Right - 0, TimeStampRect.Top); + MoveTo(TimeStampRect.Left, TimeStampRect.Bottom - 0); + LineTo(TimeStampRect.Right - 0, TimeStampRect.Bottom - 0); + + if ApptBar.Width > 5 then + Pen.Width := 2 + else + Pen.Width := 1; + MoveTo(TimeStampRect.Right - 0, TimeStampRect.Top + 1); + LineTo(TimeStampRect.Right - 0, TimeStampRect.Bottom); + Pen.Color := OldColor; + Pen.Width := 1; + end; + tssBlock: + begin + // we only want the left half of the time stamp rect + TimeStampRect.Right := (TimeStampRect.Left + TimeStampRect.Right) div 2; + + OldColor := Brush.Color; + Brush.Color := ApptBar.TimeStampColor; + FillRect(TimeStampRect); + Brush.Color := OldColor; + end; + end; +end; + +procedure TJvTFDays.DrawApptBar(ACanvas: TCanvas; Appt: TJvTFAppt; + BarRect: TRect; Col, StartRow, EndRow: Integer); +var + OldColor: TColor; + TimeStampRect: TRect; + Attr: TJvTFDaysApptAttr; +begin + with ACanvas do + begin + if Appt <> SelAppt then + Attr := ApptAttr + else + Attr := SelApptAttr; + + // Fill Bar Color + OldColor := Brush.Color; + if Appt.BarColor = clDefault then + Brush.Color := ApptBar.Color + else + Brush.Color := Appt.BarColor; + + FillRect(BarRect); + + // Draw Bar Border + Pen.Width := 1; + Pen.Color := Attr.FrameColor; + + MoveTo(BarRect.Right - 1, BarRect.Top); + LineTo(BarRect.Right - 1, BarRect.Bottom); +// Rectangle(BarRect); + + Brush.Color := OldColor; + + // Draw Time Stamp + TimeStampRect := CalcTimeStampRect(Appt, BarRect, Col, StartRow, EndRow); + if ApptBar.TimeStampStyle <> tssNone then + DrawTimeStamp(ACanvas, TimeStampRect); + + if Assigned(FOnDrawApptBar) then + FOnDrawApptBar(Self, ACanvas, Appt, Col, BarRect, TimeStampRect); + end; +end; + +procedure TJvTFDays.DrawApptDetail(ACanvas: TCanvas; ARect: TRect; + Appt: TJvTFAppt; Selected: Boolean; Col, StartRow, EndRow: Integer); +var + TheFrameRect, TxtRect, DetailRect, BarRect, HandleRect: TRect; + Txt: string; + Flags: UINT; + CanDrawText, CanDrawPics, CanDrawAppt: Boolean; + PicsHeight, PicsWidth: Integer; + DrawList: TList; + Attr: TJvTFDaysApptAttr; + DrawInfo: TJvTFDaysApptDrawInfo; +begin + with ACanvas do + begin + if Appt <> SelAppt then + Attr := ApptAttr + else + Attr := SelApptAttr; + + DrawInfo := TJvTFDaysApptDrawInfo.Create; + try + GetApptDrawInfo(DrawInfo, Appt, Attr); + Font.Assign(DrawInfo.Font); + Brush.Color := DrawInfo.Color; + Pen.Color := DrawInfo.FrameColor; + Pen.Width := DrawInfo.FrameWidth; + CanDrawAppt := DrawInfo.Visible; + finally + DrawInfo.Free; + end; + + // !!!!!!!!!!!!!!!!!!!!!!!!!! + // EXIT IF NOTHING TO DRAW !! + // !!!!!!!!!!!!!!!!!!!!!!!!!! + if not CanDrawAppt then + Exit; + + FillRect(ARect); + + TheFrameRect := ARect; + InflateRect(TheFrameRect, -(Attr.FrameWidth div 2), -(Attr.FrameWidth div 2)); + + // Need to fine tune the frame rect + if Attr.FrameWidth mod 2 = 0 then + begin + Inc(TheFrameRect.Right); + Inc(TheFrameRect.Bottom); + end; + + MoveTo(TheFrameRect.Left, TheFrameRect.Top); + LineTo(TheFrameRect.Right - 1, TheFrameRect.Top); + LineTo(TheFrameRect.Right - 1, TheFrameRect.Bottom - 1); + LineTo(TheFrameRect.Left, TheFrameRect.Bottom - 1); + LineTo(TheFrameRect.Left, TheFrameRect.Top); + + // Only go through the following work if all details must be drawn +// if (RectHeight(ARect) > Thresholds.DetailHeight) and +// (RectWidth(ARect) > Thresholds.DetailWidth) then + begin + InflateRect(TheFrameRect, -(Attr.FrameWidth div 2), -(Attr.FrameWidth div 2)); + + DetailRect := TheFrameRect; + + if ApptBar.Visible then + begin + Inc(DetailRect.Left, ApptBar.Width); + SubtractRect(BarRect, TheFrameRect, DetailRect); + Dec(BarRect.Bottom); + + DrawApptBar(ACanvas, Appt, BarRect, Col, StartRow, EndRow); + end; + + TxtRect := DetailRect; + + AdjustForMargins(TxtRect); + + DrawList := TList.Create; + try + CreatePicDrawList(TxtRect, Appt, DrawList); + FilterPicDrawList(TxtRect, DrawList, PicsHeight, PicsWidth); + // Calc'ing text height and width in CanDrawWhat + CanDrawWhat(ACanvas, TxtRect, PicsHeight, CanDrawText, CanDrawPics); + + if CanDrawPics then + begin + DrawListPics(ACanvas, TxtRect, DrawList); + Inc(TxtRect.Left, PicsWidth); // Tim + end; + finally + ClearPicDrawList(DrawList); + DrawList.Free; + end; + + if CanDrawText then + begin + Flags := DT_WORDBREAK or DT_NOPREFIX or DT_EDITCONTROL; + + Txt := ScheduleManager.GetApptDisplayText(Self, Appt); + + if not (agoFormattedDesc in Options) then + begin + Txt := StripCRLF(Txt); + Flags := Flags or DT_END_ELLIPSIS; + end; + + //PTxt := StrNew(PChar(Txt)); + DrawText(ACanvas.Handle, PChar(Txt), -1, TxtRect, Flags); + end; + end; + + if Assigned(FOnDrawAppt) then + FOnDrawAppt(Self, ACanvas, ARect, Appt, Selected); + + if Selected then + begin + { OLD 3D HANDLES CODE + if agoMoveAppt in Options then + DrawGrabLines(ACanvas, ARect.Top + 0, ARect.Left + 2, + ARect.Right - 3); + if agoSizeAppt in Options then + DrawGrabLines(ACanvas, ARect.Bottom - GrabHandles.Height, + ARect.Left + 2, ARect.Right - 3); + } + // move grab handles + if agoMoveAppt in Options then + begin +// HandleRect := Classes.Rect(ARect.Left + 2, ARect.Top, ARect.Right - 3, +// ARect.Top + GrabHandles.Height); +// DrawGrabHandle(ACanvas, HandleRect, Appt, True); + HandleRect := GetTopGrabHandleRect(Col, Appt); + DrawGrabHandle(ACanvas, HandleRect, Appt, True); + end; + if agoSizeAppt in Options then + begin +// HandleRect := Classes.Rect(ARect.Left + 2, +// ARect.Bottom - GrabHandles.Height, +// ARect.Right - 3, ARect.Bottom); +// DrawGrabHandle(ACanvas, HandleRect, Appt, False); + HandleRect := GetBottomGrabHandleRect(Col, Appt); + DrawGrabHandle(ACanvas, HandleRect, Appt, False); + end; + end; + end; +end; + +procedure TJvTFDays.DrawPics(ACanvas: TCanvas; var ARect: TRect; Appt: TJvTFAppt); +var + I, PicAdjust, NextPicLeft, CustomPicLeft, ImageIndex: Integer; + ImageList: TCustomImageList; + ImageMap: TJvTFStateImageMap; + CustomImageMap: TJvTFCustomImageMap; +begin + PicAdjust := 0; + NextPicLeft := ARect.Left; + + if (agoShowPics in Options) and Assigned(ScheduleManager.CustomImages) then + begin + ImageList := ScheduleManager.CustomImages; + CustomImageMap := Appt.ImageMap; + + for I := 0 to CustomImageMap.Count - 1 do + begin + ImageIndex := CustomImageMap[I]; + ImageList.Draw(ACanvas, NextPicLeft, ARect.Top, ImageIndex); + Inc(NextPicLeft, ImageList.Width + 2); + end; + + if CustomImageMap.Count > 0 then + PicAdjust := ImageList.Height + 2; + end; + CustomPicLeft := NextPicLeft; + + if (agoShowPics in Options) and Assigned(ScheduleManager.StateImages) then + begin + ImageList := ScheduleManager.StateImages; + ImageMap := ScheduleManager.StateImageMap; + + if Appt.AlarmEnabled then + begin + ImageIndex := ImageMap.AlarmEnabled; + if ImageIndex > -1 then + begin + ImageList.Draw(ACanvas, NextPicLeft, ARect.Top, ImageIndex); + Inc(NextPicLeft, ImageList.Width + 2); + end; + end + else + begin + ImageIndex := ImageMap.AlarmDisabled; + if ImageIndex > -1 then + begin + ImageList.Draw(ACanvas, NextPicLeft, ARect.Top, ImageIndex); + Inc(NextPicLeft, ImageList.Width + 2); + end; + end; + + ImageIndex := ImageMap.Shared; + if Appt.Shared and (ImageIndex > -1) then + begin + ImageList.Draw(ACanvas, NextPicLeft, ARect.Top, ImageIndex); + Inc(NextPicLeft, ImageList.Width + 2); + end; + + if Appt.Modified and (ImageMap.Modified > -1) then + begin + ImageList.Draw(ACanvas, NextPicLeft, ARect.Top, ImageMap.Modified); + Inc(NextPicLeft, ImageList.Width + 2); + end; + + if (NextPicLeft <> CustomPicLeft) and (ImageList.Height + 2 > PicAdjust) then + PicAdjust := ImageList.Height + 2; + end; + + Inc(ARect.Top, PicAdjust); +end; + +procedure TJvTFDays.CreatePicDrawList(ARect: TRect; Appt: TJvTFAppt; + DrawList: TList); +var + I, NextPicLeft, ImageIndex: Integer; + ImageList: TCustomImageList; + ImageMap: TJvTFStateImageMap; + CustomImageMap: TJvTFCustomImageMap; + + procedure AddToList(AImageList: TCustomImageList; AImageIndex: Integer; + AGlyph: TGraphic; APicLeft, APicTop: Integer); + var + DrawInfo: TJvTFDrawPicInfo; + begin + DrawInfo := TJvTFDrawPicInfo.Create; + DrawInfo.ImageList := AImageList; + DrawInfo.ImageIndex := AImageIndex; + DrawInfo.Glyph := AGlyph; + DrawInfo.PicLeft := APicLeft; + DrawInfo.PicTop := APicTop; + DrawList.Add(DrawInfo); + end; + +begin + NextPicLeft := ARect.Left; + + if (agoShowPics in Options) and Assigned(Appt.Glyph.Graphic) and not Appt.Glyph.Graphic.Empty then + begin + AddToList(nil, -1, Appt.Glyph.Graphic, NextPicLeft, ARect.Top); + Inc(NextPicLeft, Appt.Glyph.Graphic.Width + 2); + end; + + if (agoShowPics in Options) and Assigned(ScheduleManager.CustomImages) then + begin + ImageList := ScheduleManager.CustomImages; + CustomImageMap := Appt.ImageMap; + + for I := 0 to CustomImageMap.Count - 1 do + begin + ImageIndex := CustomImageMap[I]; + AddToList(ImageList, ImageIndex, nil, NextPicLeft, ARect.Top); + Inc(NextPicLeft, ImageList.Width + 2); + end; + end; + + if (agoShowPics in Options) and Assigned(ScheduleManager.StateImages) then + begin + ImageList := ScheduleManager.StateImages; + ImageMap := ScheduleManager.StateImageMap; + + if Appt.AlarmEnabled then + begin + ImageIndex := ImageMap.AlarmEnabled; + if ImageIndex > -1 then + begin + AddToList(ImageList, ImageIndex, nil, NextPicLeft, ARect.Top); + Inc(NextPicLeft, ImageList.Width + 2); + end + end + else + begin + ImageIndex := ImageMap.AlarmDisabled; + if ImageIndex > -1 then + begin + AddToList(ImageList, ImageIndex, nil, NextPicLeft, ARect.Top); + Inc(NextPicLeft, ImageList.Width + 2); + end; + end; + + ImageIndex := ImageMap.Shared; + if Appt.Shared and (ImageIndex > -1) then + begin + AddToList(ImageList, ImageIndex, nil, NextPicLeft, ARect.Top); + Inc(NextPicLeft, ImageList.Width + 2); + end; + + if Appt.Modified and (ImageMap.Modified > -1) then + begin + AddToList(ImageList, ImageMap.Modified, nil, NextPicLeft, ARect.Top); + // The following line generates a compiler hint so comment out, + // but leave here as reminder in case method is expanded. + //Inc(NextPicLeft, ImageList.Width + 2); + end; + end; +end; + +procedure TJvTFDays.FilterPicDrawList(ARect: TRect; DrawList: TList; + var PicsHeight: Integer; var PicsWidth: Integer); +var + I, NextPicLeft: Integer; + DrawIt: Boolean; + DrawInfo: TJvTFDrawPicInfo; +begin + PicsHeight := 0; + PicsWidth := 0; + if DrawList.Count = 0 then + Exit; + + if Thresholds.PicsAllOrNone then + begin + DrawInfo := TJvTFDrawPicInfo(DrawList[DrawList.Count - 1]); + if DrawInfo.PicLeft + DrawInfo.ImageList.Width >= ARect.Right then + begin + while DrawList.Count > 0 do + begin + TJvTFDrawPicInfo(DrawList[0]).Free; + DrawList.Delete(0); + end; + end; + end; + + NextPicLeft := ARect.Left; + I := 0; + while I < DrawList.Count do + begin + DrawInfo := TJvTFDrawPicInfo(DrawList[I]); + with DrawInfo do + begin + DrawIt := True; +// if Thresholds.WholePicsOnly and +// ((PicLeft + ImageList.Width >= ARect.Right) or +// (PicTop + ImageList.Height >= ARect.Bottom)) then +// DrawIt := False; + + if DrawIt then + begin + if Assigned(ImageList) then + PicsHeight := Greater(PicsHeight, ImageList.Height + 2) + else + PicsHeight := Greater(PicsHeight, Glyph.Height + 2); + PicLeft := NextPicLeft; + if Assigned(ImageList) then + Inc(NextPicLeft, ImageList.Width + 2) + else + Inc(NextPicLeft, Glyph.Width + 2); + // Increment I to move onto next pic in list + Inc(I); + end + else // Remove pic from list + begin + // Remove pic from list + DrawInfo.Free; + DrawList.Delete(I); + // DO NOT increment I - Since pic was removed from list + // I will now point to next pic + end; + end; + end; + PicsWidth := NextPicLeft - ARect.Left; +end; + +procedure TJvTFDays.ClearPicDrawList(DrawList: TList); +begin + while DrawList.Count > 0 do + begin + TJvTFDrawPicInfo(DrawList[0]).Free; + DrawList.Delete(0); + end; +end; + +procedure TJvTFDays.DrawListPics(ACanvas: TCanvas; var ARect: TRect; + DrawList: TList); +var + I: Integer; + DrawInfo: TJvTFDrawPicInfo; +begin + for I := 0 to DrawList.Count - 1 do + begin + DrawInfo := TJvTFDrawPicInfo(DrawList[I]); + with DrawInfo do + begin + if Assigned(ImageList) then + ImageList.Draw(ACanvas, PicLeft, PicTop, ImageIndex) + else + ACanvas.Draw(PicLeft, PicTop, Glyph); + end; + end; +end; + +procedure TJvTFDays.DrawGrabLines(ACanvas: TCanvas; LineTop, LineLeft, + LineRight: Integer); +begin + // This draws the 3D grab handles, which have been replaced by flat style + // handles. This remains as reference for possible future comeback as option. + with ACanvas do + begin + Pen.Width := 1; + Pen.Color := clWhite; + MoveTo(LineLeft, LineTop); + LineTo(LineRight, LineTop); + MoveTo(LineLeft, LineTop + 1); + LineTo(LineLeft + 1, LineTop + 1); + Pen.Color := clSilver; + LineTo(LineRight - 1, LineTop + 1); + Pen.Color := clGray; + LineTo(LineRight, LineTop + 1); + MoveTo(LineLeft, LineTop + 2); + LineTo(LineRight, LineTop + 2); + + Pen.Color := clWhite; + MoveTo(LineLeft, LineTop + 3); + LineTo(LineRight, LineTop + 3); + MoveTo(LineLeft, LineTop + 4); + LineTo(LineLeft + 1, LineTop + 4); + Pen.Color := clSilver; + LineTo(LineRight - 1, LineTop + 4); + Pen.Color := clGray; + LineTo(LineRight, LineTop + 4); + MoveTo(LineLeft, LineTop + 5); + LineTo(LineRight, LineTop + 5); + end +end; + +procedure TJvTFDays.DrawGrabHandle(ACanvas: TCanvas; ARect: TRect; + AAppt: TJvTFAppt; TopHandle: Boolean); +begin + with ACanvas do + begin + Pen.Color := clBlack; + Pen.Width := 1; + Brush.Color := GrabHandles.Color; + Rectangle(ARect.Left, ARect.Top, ARect.Right, ARect.Bottom); + end; + if Assigned(FOnDrawGrabHandle) then + FOnDrawGrabHandle(Self, ACanvas, ARect, AAppt, TopHandle); +end; + +procedure TJvTFDays.DrawCorner(ACanvas: TCanvas; Corner: TJvTFDaysCorner); +var + ARect: TRect; + CornerLeft: Integer; +begin + case Corner of + //group agcTopLeft : ARect := Classes.Rect(0, 0, RowHdrWidth, ColHdrHeight); + agcTopLeft: + {$IFDEF Jv_TIMEBLOCKS} + // ok + ARect := Classes.Rect(0, 0, CalcBlockRowHdrsWidth, CalcGroupColHdrsHeight); + {$ELSE} + // remove + // ARect := Classes.Rect(0, 0, RowHdrWidth, CalcGroupColHdrsHeight); + {$ENDIF Jv_TIMEBLOCKS} + agcTopRight: + begin + CornerLeft := Lesser(CellRect(RightCol, -1).Right, ClientWidth - FVScrollBar.Width); + //group ARect := Classes.Rect(CornerLeft, 0, ClientWidth, ColHdrHeight); + ARect := Classes.Rect(CornerLeft, 0, ClientWidth, CalcGroupColHdrsHeight); + end; + agcBottomLeft: + {$IFDEF Jv_TIMEBLOCKS} + // ok + ARect := Classes.Rect(0, ClientHeight - FHScrollBar.Height, + CalcBlockRowHdrsWidth, ClientHeight); + {$ELSE} + // remove + // ARect := Classes.Rect(0, ClientHeight - FHScrollBar.Height, + // RowHdrWidth, ClientHeight); + {$ENDIF Jv_TIMEBLOCKS} + + agcBottomRight: + ARect := Classes.Rect(ClientWidth - FVScrollBar.Width - 1, + ClientHeight - FHScrollBar.Height - 1, ClientWidth, ClientHeight); + end; + + with ACanvas do + begin + Brush.Color := HdrAttr.Color; + FillRect(ARect); + + if HdrAttr.Frame3D then + {$IFDEF Jv_TIMEBLOCKS} + // ok + DrawFrame(ACanvas, ARect, + not ((Corner = agcTopLeft) and not HdrAttr.Frame3D), GridLineColor) + {$ELSE} + // remove + //DrawFrame(ACanvas, ARect, + // not ((Corner = agcTopLeft) and not HdrAttr.Frame3D)) + {$ENDIF Jv_TIMEBLOCKS} + else + begin + case Corner of + agcTopLeft: + if RowHdrType = rhFancy then + begin + Pen.Color := FancyRowHdrAttr.TickColor; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom - 1); + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + end + else + {$IFDEF Jv_TIMEBLOCKS} + // ok + DrawFrame(ACanvas, ARect, False, GridLineColor); + {$ELSE} + // remove + //DrawFrame(ACanvas, ARect, False); + {$ENDIF Jv_TIMEBLOCKS} + agcTopRight: + begin + Pen.Color := clGray; + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + if VirtualCellRect(RightCol, -1).Right > ClientWidth - FVScrollBar.Width then + begin + MoveTo(ClientWidth - FVScrollBar.Width, ARect.Top); + LineTo(ClientWidth - FVScrollBar.Width, ARect.Bottom - 1); + end; + end; + agcBottomLeft: + begin + Pen.Color := clGray; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Right - 1, ARect.Top); + end; + end; + end; + + if Assigned(FOnDrawCorner) then + FOnDrawCorner(Self, ACanvas, ARect, Corner); + end; +end; + +procedure TJvTFDays.DrawRowHdr(ACanvas: TCanvas; Index: Integer); +var + Rect: TRect; + UseAttr: TJvTFDaysHdrAttr; + Txt: string; +begin + {$IFDEF Jv_TIMEBLOCKS} + // ok + Rect.Left := CalcBlockHdrWidth; + {$ELSE} + // remove + //Rect.Left := 0; + {$ENDIF Jv_TIMEBLOCKS} + + //group Rect.Top := ColHdrHeight + (Index - TopRow) * RowHeight; + Rect.Top := CalcGroupColHdrsHeight + (Index - TopRow) * RowHeight; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + Rect.Right := Rect.Left + RowHdrWidth; + {$ELSE} + // remove + //Rect.Right := RowHdrWidth; + {$ENDIF Jv_TIMEBLOCKS} + + Rect.Bottom := Rect.Top + RowHeight; + + Txt := FormatDateTime(TimeFormat, RowToTime(Index)); + + if RowIsSelected(Index) then + UseAttr := SelHdrAttr + else + UseAttr := HdrAttr; + + ACanvas.Brush.Color := UseAttr.Color; + ACanvas.Font.Assign(UseAttr.Font); + + DrawTxt(ACanvas, Rect, Txt, taCenter, vaCenter); + + if (Index = FocusedRow) and Focused and ShowFocus then + begin + InflateRect(Rect, -2, -2); + ManualFocusRect(ACanvas, Rect); + InflateRect(Rect, 2, 2); + end; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + DrawFrame(ACanvas, Rect, UseAttr.Frame3D, UseAttr.FrameColor); + {$ELSE} + // remove + //DrawFrame(ACanvas, ARect, UseAttr.Frame3D); + {$ENDIF Jv_TIMEBLOCKS} + + if Assigned(FOnDrawRowHdr) then + FOnDrawRowHdr(Self, ACanvas, Rect, Index, RowIsSelected(Index)); +end; + +(* +procedure TJvTFDays.DrawColHdr(ACanvas: TCanvas; Index: Integer); +var + ARect, + TxtRect, + CalcRect: TRect; + Txt: string; + PTxt: PChar; + UseAttr: TJvTFDaysHdrAttr; + Flags: UINT; + TxtHt, + TxtRectHt: Integer; +begin + ARect := CellRect(Index, -1); + + //Txt := Copy(Cols[Index].Title, 1, Length(Cols[Index].Title)); + Txt := Cols[Index].Title; + + if ColIsSelected(Index) then + UseAttr := SelHdrAttr + else + UseAttr := HdrAttr; + + ACanvas.Brush.Color := UseAttr.Color; + ACanvas.Font.Assign(UseAttr.Font); + + Flags := DT_NOPREFIX or DT_CENTER; + Case ColTitleStyle of + ctsSingleClip : Flags := Flags or DT_SINGLELINE or DT_VCENTER; + ctsSingleEllipsis: Flags := Flags or DT_END_ELLIPSIS or DT_SINGLELINE or + DT_VCENTER; + ctsMultiClip : Flags := Flags or DT_WORDBREAK; + ctsMultiEllipsis : Flags := Flags or DT_END_ELLIPSIS or + DT_WORDBREAK or DT_EDITCONTROL; + ctsHide : Flags := Flags or DT_SINGLELINE or DT_VCENTER; + end; + + ACanvas.FillRect(ARect); + TxtRect := ARect; + Windows.InflateRect(TxtRect, -2, -2); + CalcRect := TxtRect; + + PTxt := StrNew(PChar(Txt)); + if (ColTitleStyle = ctsMultiClip) or + (ColTitleStyle = ctsMultiEllipsis) then + begin + TxtHt := Windows.DrawText(ACanvas.Handle, PTxt, -1, CalcRect, + Flags or DT_CALCRECT); + + if TxtHt < RectHeight(TxtRect) then + begin + // we need to vertically center the text + TxtRectHt := RectHeight(TxtRect); + TxtRect.Top := TxtRect.Top + RectHeight(TxtRect) div 2 - TxtHt div 2; + TxtRect.Bottom := Lesser(TxtRect.Top + TxtRectHt, TxtRect.Bottom); + end; + end + else + if ColTitleStyle = ctsHide then + begin + Windows.DrawText(ACanvas.Handle, PTxt, -1, CalcRect, Flags or DT_CALCRECT); + if RectWidth(CalcRect) > RectWidth(TxtRect) then + PTxt := ''; + end; + + Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + + if (Index = FocusedCol) and Focused then + begin + CalcRect := ARect; + Windows.InflateRect(CalcRect, -2, -2); + ManualFocusRect(ACanvas, CalcRect); + { + if Windows.IsRectEmpty(TxtRect) then + Windows.InflateRect(TxtRect, 5, 5); + ManualFocusRect(ACanvas, TxtRect); + } +{ end; + + DrawFrame(ACanvas, ARect, UseAttr.Frame3D); + + if Assigned(FOnDrawColHdr) then + FOnDrawColHdr(Self, ACanvas, ARect, Index, ColIsSelected(Index)); +end; +*) + +// returns height in pixels of tallest col title +// assumes word wrap and bounds all of title + +function TJvTFDays.GetTallestColTitle(ACanvas: TCanvas): Integer; +var + I, Tallest, ColLeft, TxtHt: Integer; + LRect: TRect; + TheCol: TJvTFDaysCol; + Txt: string; + Flags: UINT; +begin + {$IFDEF Jv_TIMEBLOCKS} + // ok + ColLeft := CalcBlockRowHdrsWidth; + {$ELSE} + // remove + //ColLeft := RowHdrWidth; + {$ENDIF Jv_TIMEBLOCKS} + + Tallest := 0; + for I := 0 to Cols.Count - 1 do + begin + TheCol := Cols[I]; + + // (rom) silly assignments + // Just set top (0), left, and bottom (ColHdrHeight) for now. + //group ARect := Classes.Rect(ColLeft, 0, 0, ColHdrHeight); + LRect := Classes.Rect(ColLeft, CalcGroupHdrHeight, 0, CalcGroupColHdrsHeight); + // Set right by adding this col's width to the left value + LRect.Right := LRect.Left + TheCol.Width; + LRect := CellRect(I, -1); + InflateRect(LRect, -2, -2); + + Txt := Copy(TheCol.Title, 1, Length(TheCol.Title)); + + if ColIsSelected(I) then + begin + ACanvas.Brush.Color := SelHdrAttr.Color; + ACanvas.Font.Assign(SelHdrAttr.Font); + end + else + begin + ACanvas.Brush.Color := HdrAttr.Color; + ACanvas.Font.Assign(HdrAttr.Font); + end; + + // All parameters now specified. Now calc text height. + Flags := DT_NOPREFIX or DT_WORDBREAK or DT_CENTER or DT_CALCRECT; + TxtHt := DrawText(ACanvas.Handle, PChar(Txt), -1, LRect, Flags); + + if TxtHt > Tallest then + Tallest := TxtHt; + + Inc(ColLeft, TheCol.Width); + end; + Result := Tallest; +end; + +{$IFNDEF Jv_TIMEBLOCKS} +// remove +{ +procedure TJvTFDays.DrawFrame(ACanvas: TCanvas; ARect: TRect; Draw3D: Boolean); +var + OldPenColor: TColor; +begin + OldPenColor := ACanvas.Pen.Color; + + if Draw3D then + ACanvas.Pen.Color := clBtnShadow + else + ACanvas.Pen.Color := GridLineColor; + + ACanvas.MoveTo(ARect.Right - 1, ARect.Top); + ACanvas.LineTo(ARect.Right - 1, ARect.Bottom); + ACanvas.MoveTo(ARect.Left, ARect.Bottom - 1); + ACanvas.LineTo(ARect.Right, ARect.Bottom - 1); + + if Draw3D then + begin + ACanvas.Pen.Color := clBtnHighlight; + ACanvas.MoveTo(ARect.Left, ARect.Top); + ACanvas.LineTo(ARect.Right, ARect.Top); + ACanvas.MoveTo(ARect.Left, ARect.Top); + ACanvas.LineTo(ARect.Left, ARect.Bottom); + end; + + ACanvas.Pen.Color := OldPenColor; +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +procedure TJvTFDays.DrawAppts(ACanvas: TCanvas; DrawAll: Boolean); +var + FromCol, ToCol, FromRow, ToRow, Col, I: Integer; + ApptStartRow, ApptEndRow, SchedDate: Integer; + Appt: TJvTFAppt; + TempSelAppt: TJvTFAppt; +begin + if DrawAll then + begin + FromCol := 0; + ToCol := Cols.Count - 1; + FromRow := 0; + ToRow := RowCount - 1; + end + else + begin + FromCol := LeftCol; + ToCol := RightCol; + FromRow := TopRow; + ToRow := BottomRow; + end; + + for Col := FromCol to ToCol do + if Cols[Col].Connected then + begin + TempSelAppt := nil; + SchedDate := Trunc(Cols[Col].SchedDate); + for I := 0 to Cols[Col].Schedule.ApptCount - 1 do + begin + Appt := Cols[Col].Schedule.Appts[I]; + // Added by Mike 10/31/01 7:04pm - Happy Haloween!! + // We want to draw the selected appt last. Check to see if the + // current appt is selected, if so, save a reference in TempSelAppt + // and then use TempSelAppt to draw the appt after the loop finishes. + // This solves the problem of having the bottom grab handle + // overwritten by an appt that lies immediately below the sel appt. + if Appt = SelAppt then + TempSelAppt := Appt + else + begin + CalcStartEndRows(Appt, SchedDate, ApptStartRow, ApptEndRow); + + if (ApptStartRow <= ToRow) and (ApptEndRow >= FromRow) then + DrawAppt(ACanvas, Col, Appt, ApptStartRow, ApptEndRow); + end; + end; + + // Added by Mike 10/31/01 7:04 pm - see above + if Assigned(TempSelAppt) then + begin + CalcStartEndRows(TempSelAppt, SchedDate, ApptStartRow, ApptEndRow); + + if (ApptStartRow <= ToRow) and (ApptEndRow >= FromRow) then + DrawAppt(ACanvas, Col, TempSelAppt, ApptStartRow, ApptEndRow); + end; + end; +end; + +procedure TJvTFDays.AdjustForMargins(var ARect: TRect); +begin + // Make room for side margins and grab handles + // Changed by TIM: + // Windows.InflateRect(ARect, -2, -2); + InflateRect(ARect, -1, -1); + + // Commented out by Tim: + // if agoMoveAppt in Options then + // Inc(ARect.Top, GrabHandles.Height - 1); + // if agoSizeAppt in Options then + // Dec(ARect.Bottom, GrabHandles.Height - 1); +end; + +procedure TJvTFDays.CanDrawWhat(ACanvas: TCanvas; ApptRect: TRect; + PicsHeight: Integer; var CanDrawText, CanDrawPics: Boolean); +//var +// TextHeightThreshold, +// TextWidthThreshold: Integer; +begin +// TextHeightThreshold := CanvasMaxTextHeight(ACanvas) * Thresholds.TextHeight; +// TextWidthThreshold := ACanvas.TextWidth('Bi') div 2 * Thresholds.TextWidth; + +// if TextHeightThreshold + PicsHeight < RectHeight(ApptRect) then +// begin +// CanDrawText := RectWidth(ApptRect) >= TextWidthThreshold; +// CanDrawPics := True; +// end +// else +// if Thresholds.DropTextFirst then +// begin +// CanDrawText := False; +// CanDrawPics := True; +// if Thresholds.WholePicsOnly then +// if PicsHeight > RectHeight(ApptRect) then +// CanDrawPics := False; +// end +// else +// begin +// CanDrawText := (RectHeight(ApptRect) >= TextHeightThreshold) and +// (RectWidth(ApptRect) >= TextWidthThreshold); +// CanDrawPics := False; +// end; + + CanDrawText := True; + CanDrawPics := True; + + if not (agoShowPics in Options) then + CanDrawPics := False; + if not (agoShowText in Options) then + CanDrawText := False; +end; + +procedure TJvTFDays.ManualFocusRect(ACanvas: TCanvas; ARect: TRect); +var + Mark: Boolean; + I: Integer; + OldPenMode: TPenMode; +begin + OldPenMode := ACanvas.Pen.Mode; + ACanvas.Pen.Mode := pmNot; + + Mark := True; + + // Top side + for I := ARect.Left to ARect.Right - 1 do + begin + if Mark then + ACanvas.Pixels[I, ARect.Top] := clBlack; + Mark := not Mark; + end; + + // Right side + for I := ARect.Top + 1 to ARect.Bottom - 1 do + begin + if Mark then + ACanvas.Pixels[ARect.Right - 1, I] := clBlack; + Mark := not Mark; + end; + + // Bottom side + for I := ARect.Right - 2 downto ARect.Left do + begin + if Mark then + ACanvas.Pixels[I, ARect.Bottom - 1] := clBlack; + Mark := not Mark; + end; + + // Left side + for I := ARect.Bottom - 2 downto ARect.Top + 1 do + begin + if Mark then + ACanvas.Pixels[ARect.Left, I] := clBlack; + Mark := not Mark; + end; + + ACanvas.Pen.Mode := OldPenMode; +end; + +procedure TJvTFDays.DrawFancyRowHdrs(ACanvas: TCanvas); +var + I, J, MajorTickLength, MinorTickLength, TickLength: Integer; + LRect: TRect; + Lbl: string; + PrevHour, CurrentHour: Word; + // FirstMajor, + Selected, PrevHrSel, CurrHrSel, Switch: Boolean; +begin + MajorTickLength := GetMajorTickLength; + MinorTickLength := GetMinorTickLength; + +// FirstMajor := True; + PrevHour := RowToHour(TopRow); + PrevHrSel := False; + CurrHrSel := False; + for I := TopRow to BottomRow do + begin + CurrentHour := RowToHour(I); + + Switch := (CurrentHour <> PrevHour) or (I = BottomRow); + if Switch then + begin + PrevHrSel := CurrHrSel; + CurrHrSel := False; + end; + + // Determine if this row is selected + Selected := False; + J := 0; + while (J < Cols.Count) and not Selected do + if CellIsSelected(Point(J, I)) then + Selected := True + else + Inc(J); + + CurrHrSel := CurrHrSel or Selected; + + LRect := CellRect(-1, I); + Lbl := GetMinorLabel(I); + if not RowEndsHour(I) then + TickLength := MinorTickLength + else + TickLength := MajorTickLength; + + DrawMinor(ACanvas, LRect, I, Lbl, TickLength, Selected); + + // Draw Major if needed + if Switch and (Granularity <> 60) then + begin + if I <> TopRow + 1 then + begin + {$IFDEF Jv_TIMEBLOCKS} + // ok + LRect.Left := CalcBlockHdrWidth; + LRect.Right := LRect.Left + RowHdrWidth - MinorTickLength; + {$ELSE} + // remove + //LRect.Left := 0; + //LRect.Right := RowHdrWidth - MinorTickLength; + {$ENDIF Jv_TIMEBLOCKS} + + LRect.Top := VirtualCellRect(-1, HourStartRow(PrevHour)).Top; + //group if LRect.Top < ColHdrHeight then + //group LRect.Top := ColHdrHeight; + if LRect.Top < CalcGroupColHdrsHeight then + LRect.Top := CalcGroupColHdrsHeight; + LRect.Bottom := VirtualCellRect(-1, HourEndRow(PrevHour)).Bottom - 1; + if LRect.Bottom > ClientHeight then + LRect.Bottom := ClientHeight; + + if FancyRowHdrAttr.Hr2400 then + Lbl := IntToStr(PrevHour) + else + begin + if PrevHour = 0 then + Lbl := '12' + else + if PrevHour > 12 then + Lbl := IntToStr(PrevHour - 12) + else + Lbl := IntToStr(PrevHour); + +{ if FirstMajor or (PrevHour = 0) or (PrevHour = 12) then + if PrevHour < 12 then + Lbl := Lbl + 'a' + else + Lbl := Lbl + 'p'; +} + end; + + if PrevHrSel then + ACanvas.Font.Assign(SelFancyRowHdrAttr.MajorFont) + else + ACanvas.Font.Assign(FancyRowHdrAttr.MajorFont); + + ACanvas.Brush.Style := bsClear; + + DrawText(ACanvas.Handle, PChar(Lbl), -1, LRect, + DT_NOPREFIX or DT_SINGLELINE or DT_CENTER or DT_VCENTER); + + if Assigned(FOnDrawMajorRowHdr) then + FOnDrawMajorRowHdr(Self, ACanvas, LRect, I - 1, PrevHrSel); + +// FirstMajor := False; + end; + if Switch then + PrevHour := CurrentHour; + end; + end; +end; + +procedure TJvTFDays.DrawMinor(ACanvas: TCanvas; ARect: TRect; RowNum: Integer; + const LabelStr: string; TickLength: Integer; Selected: Boolean); +var + Attr: TJvTFDaysFancyRowHdrAttr; + MinorRect, TxtRect: TRect; +begin + // do the background shading + ACanvas.Brush.Color := FancyRowHdrAttr.Color; + ACanvas.FillRect(ARect); + + MinorRect := ARect; + MinorRect.Left := (MinorRect.Right - GetMinorTickLength) div 2; + + if Selected then + begin + Attr := SelFancyRowHdrAttr; + // Shade the minor rect if selected + ACanvas.Brush.Color := Attr.Color; + ACanvas.FillRect(MinorRect); + end + else + Attr := FancyRowHdrAttr; + + with ACanvas do + begin + // draw the right border line + Pen.Color := Attr.TickColor; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + + // now draw the tick + MoveTo(ARect.Right - 5, ARect.Bottom - 1); + LineTo(ARect.Right - 5 - TickLength, ARect.Bottom - 1); + end; + + // set up a 2 pel margin on the right and bottom sides + TxtRect := ARect; + TxtRect.Right := TxtRect.Right - 6; + TxtRect.Bottom := TxtRect.Bottom - 2; + + // now draw the LabelStr right aligned + ACanvas.Font.Assign(Attr.MinorFont); + ACanvas.Brush.Style := bsClear; + + // draw the focus rect if needed + if (RowNum = FocusedRow) and Focused and ShowFocus then + begin + InflateRect(MinorRect, -2, -2); + MinorRect.Left := MinorRect.Right - ACanvas.TextWidth(LabelStr) - 2; + ManualFocusRect(ACanvas, MinorRect); + end; + + DrawText(ACanvas.Handle, PChar(LabelStr), -1, TxtRect, + DT_SINGLELINE or DT_RIGHT or DT_NOPREFIX or DT_VCENTER); + + if Assigned(FOnDrawMinorRowHdr) then + FOnDrawMinorRowHdr(Self, ACanvas, ARect, RowNum, Selected); +end; + +function TJvTFDays.GetMinorLabel(RowNum: Integer): string; +const + Full24 = 'h:nn'; + FullAP = 'h:nna/p'; + MinOnly = ':nn'; +var + FirstHourRow: Integer; + TimeFmt: string; + RowTime: TTime; +// LastFullRow, LastHourStart: Integer; +// LastHour: Word; +begin + if Granularity = 60 then + TimeFmt := Full24 + else + TimeFmt := MinOnly; +// else +// if (RowNum = TopRow) and (not RowStartsHour(RowNum) or (PossVisibleRows = 1)) then +// TimeFmt := Full24 +// else +// begin +// LastFullRow := TopRow + FullVisibleRows - 1; +// LastHour := RowToHour(LastFullRow); +// LastHourStart := HourStartRow(LastHour); +// +// if (RowNum = LastHourStart) or +// ((LastHourStart = TopRow) and (RowNum = TopRow)) then +// TimeFmt := Full24 +// else +// TimeFmt := MinOnly; +// end; + + if (TimeFmt = Full24) and not FancyRowHdrAttr.Hr2400 then + TimeFmt := FullAP; + + // Get the Row Time + RowTime := RowToTime(RowNum); + + if (FancyRowHdrAttr.OnlyShow00Minutes and (ExtractMins(RowTime) = 0)) or + (not FancyRowHdrAttr.OnlyShow00Minutes) then + begin + if (not FancyRowHdrAttr.Hr2400) and (Granularity < 60) then + begin + // Get the first row with a 00 hour + FirstHourRow := TopRow; + while (FirstHourRow < BottomRow) and (ExtractMins(RowToTime(FirstHourRow)) <> 0) do + Inc(FirstHourRow); + if RowTime = 0 then + Result := {$IFDEF RTL220_UP}FormatSettings.{$ENDIF RTL220_UP}TimeAMString + else + if RowTime = 0.50 then + Result := {$IFDEF RTL220_UP}FormatSettings.{$ENDIF RTL220_UP}TimePMString + else + if (RowNum = FirstHourRow) and (ExtractMins(RowTime) = 0) then + begin + if RowTime < 0.50 then + Result := {$IFDEF RTL220_UP}FormatSettings.{$ENDIF RTL220_UP}TimeAMString + else + Result := {$IFDEF RTL220_UP}FormatSettings.{$ENDIF RTL220_UP}TimePMString; + end + else + Result := FormatDateTime(TimeFmt, RowTime); + end + else + Result := FormatDateTime(TimeFmt, RowTime); + end + else + Result := ''; +end; + +function TJvTFDays.GetMinorTickLength: Integer; +var + TempFont: TFont; +begin + TempFont := TFont.Create; + try + TempFont.Assign(Canvas.Font); + Canvas.Font.Assign(FancyRowHdrAttr.MinorFont); + Result := Canvas.TextWidth('22:22a') - 10; + Canvas.Font.Assign(TempFont); + finally + TempFont.Free; + end; +end; + +function TJvTFDays.GetMajorTickLength: Integer; +begin + Result := RowHdrWidth - 8; +end; + +procedure TJvTFDays.Resize; +var + ColsResized: Boolean; +begin + if Editing then + FinishEditAppt; + AlignScrollBars; + + if not (csLoading in ComponentState) then + begin + if RowHeight > GetDataHeight then + RowHeight := GetDataHeight; + + Cols.EnsureMaxColWidth; + + if AutoSizeCols then + begin + ColsResized := CheckSBVis; + if not (vsbHorz in VisibleScrollBars) and not ColsResized then + Cols.ResizeCols; + end + else + CheckSBVis; + end; + + CheckSBParams; + + inherited Resize; +end; + +procedure TJvTFDays.WMEraseBkgnd(var Msg: TLMessage); +begin + Msg.Result := LRESULT(False); +end; + +procedure TJvTFDays.CMFontChanged(var Msg: TLMessage); +begin + HdrAttr.ParentFontChanged; + SelHdrAttr.ParentFontChanged; + ApptAttr.ParentFontChanged; + SelApptAttr.ParentFontChanged; + inherited; +end; + +procedure TJvTFDays.CMEnabledChanged(var Msg: TLMessage); +begin + FVScrollBar.Enabled := Enabled; + FHScrollBar.Enabled := Enabled; + Invalidate; + + if Enabled and FNeedCheckSBParams then + begin + // This is needed because of a TScrollBar bug. If the Max or LargeChange + // properties are changed while the scrollbar is disabled, the + // scrollbar will magically enable itself. Very frustrating. Anyway... + // This check and call to CheckSBParams will work around the problem. + // See TJvTFDays.CheckSBParams for other part of workaround. + FNeedCheckSBParams := False; + CheckSBParams; + end; +end; + +procedure TJvTFDays.WMSetCursor(var Msg: TLMSetCursor); +var + Cur: HCURSOR; + Coord: TJvTFDaysCoord; +begin + exit; + + + + + Cur := 0; + with Msg do + if HitTest = HTCLIENT then + begin + Coord := PtToCell(FHitTest.X, FHitTest.Y); + case CanDragWhat(Coord) of + agsSizeCol, agsSizeRowHdr: + Cur := Screen.Cursors[crHSplit]; + agsSizeRow, agsSizeColHdr: + Cur := Screen.Cursors[crVSplit]; + agsSizeAppt: + Cur := Screen.Cursors[crSizeNS]; + agsMoveAppt: + Cur := Screen.Cursors[crDrag]; + end; + end; + + if Cur <> 0 then + SetCursor(Cur) + else + inherited; +end; + +procedure TJvTFDays.WMNCHitTest(var Msg: TLMNCHitTest); +begin + DefaultHandler(Msg); + FHitTest := ScreenToClient(SmallPointToPoint(Msg.Pos)); +end; + +procedure TJvTFDays.CMDesignHitTest(var Msg: TCMDesignHitTest); +var + TempState: TJvTFDaysState; + Coord: TJvTFDaysCoord; +begin + Coord := PtToCell(Msg.Pos.X, Msg.Pos.Y); + + TempState := CanDragWhat(Coord); + Msg.Result := LRESULT(Ord(TempState <> agsNormal)); +end; + +procedure TJvTFDays.CNRequestRefresh(var Msg: TCNRequestRefresh); +var + I: Integer; +begin + for I := 0 to Cols.Count - 1 do + if (Cols[I].Schedule = Msg.Schedule) or (Msg.Schedule = nil) then + Cols[I].RefreshMap; + inherited; +end; + +procedure TJvTFDays.Loaded; +var + I: Integer; +begin + FHScrollBar.Position := LeftCol; + FVScrollBar.Position := TopRow; + inherited Loaded; + CheckSBVis; + CheckSBParams; + + Template.UpdateGrid; + + Cols.FOldCount := Cols.Count; + + for I := 0 to Cols.Count - 1 do + Cols[I].Connect; + + AlignScrollBars; +end; + +procedure TJvTFDays.RefreshControl; +var + I: Integer; +begin + for I := 0 to Cols.Count - 1 do + // Should do some additional checking here (which is commented out) + //if (Cols[I].Schedule = Msg.Schedule) or (Msg.Schedule = nil) then + Cols[I].RefreshMap; + inherited RefreshControl; +end; + +procedure TJvTFDays.UpdateDesigner; +var + ParentForm: TCustomForm; +begin + if (csDesigning in ComponentState) and HandleAllocated and + not (csUpdating in ComponentState) then + begin + ParentForm := GetParentForm(Self); + if Assigned(ParentForm) and Assigned(ParentForm.Designer) then + ParentForm.Designer.Modified; + end; +end; + +procedure TJvTFDays.CheckSBParams; +var + I, TempWidth, lRightCol: Integer; +begin + if not Enabled then + begin + // This is needed because of a TScrollBar bug. if the Max or LargeChange + // properties are changed while the scrollbar is disabled, the + // scrollbar will magically enable itself. Very frustrating. Anyway... + // This check and exit will workaround the problem. + // See TJvTFDays.CMEnabledChanged for other part of workaround. + FNeedCheckSBParams := True; + Exit; + end; + + if vsbVert in VisibleScrollBars then + with FVScrollBar do + begin + Max := RowCount - 2; + LargeChange := FullVisibleRows; + end; + + if vsbHorz in VisibleScrollBars then + with FHScrollBar do + begin + Max := Cols.Count - 1; + lRightCol := LeftCol + VisibleCols - 1; + + TempWidth := 0; + for I := LeftCol to lRightCol do + Inc(TempWidth, Cols[I].Width); + + if TempWidth <= RectWidth(GetDataAreaRect) then + LargeChange := VisibleCols + else + LargeChange := VisibleCols - 1; + end; +end; + +procedure TJvTFDays.ScrollBarScroll(Sender: TObject; + ScrollCode: TScrollCode; var ScrollPos: Integer); +var + SB: TJvTFDaysScrollBar; + I, TempWidth: Integer; +begin + if csLoading in ComponentState then + Exit; + + if not (csDesigning in ComponentState) then + SetFocus; + + if Editing then + FinishEditAppt; + + SB := TJvTFDaysScrollBar(Sender); + + case ScrollCode of + scLineUp, scLineDown, scPageUp, scPageDown, scTrack: + if SB.Kind = sbVertical then + begin + if (ScrollCode = scLineDown) or (ScrollCode = scPageDown) then + ScrollPos := Lesser(ScrollPos, RowCount - FullVisibleRows); + TopRow := ScrollPos; + UpdateDesigner; + end + else + begin + if ScrollPos > LeftCol then + begin + TempWidth := 0; + for I := LeftCol to Cols.Count - 1 do + Inc(TempWidth, Cols[I].Width); + if TempWidth <= GetDataWidth then + ScrollPos := LeftCol; + end; + LeftCol := ScrollPos; + UpdateDesigner; + end; + end; +end; + +procedure TJvTFDays.MouseDown(Button: TMouseButton; + Shift: TShiftState; X, Y: Integer); +var + GridCoord: TJvTFDaysCoord; + DragWhat: TJvTFDaysState; +begin + if not Enabled then + Exit; + + FHint.ReleaseHandle; + + inherited; + + if ssDouble in Shift then + Exit; + + if not (csDesigning in ComponentState) then + SetFocus; + + GridCoord := PtToCell(X, Y); + + if ssLeft in Shift then + with GridCoord do + begin + SetSelAppt(Appt); + // need to recalculate GridCoord here because component user may have + // freed the appt (esp. in a multi-user environment). + GridCoord := PtToCell(X, Y); + + if Col > gcHdr then + FocusedCol := Col; + if Row > gcHdr then + FocusedRow := Row; + + if (Col > gcHdr) and (Row > gcHdr) then + SelStart := Point(Col, Row) + else + if (Col = gcHdr) and (Row > gcHdr) then + SelStart := Point(FocusedCol, Row) + else + if (Col > gcHdr) and (Row = gcHdr) then + SelStart := Point(Col, FocusedRow); + end; + + if (State = agsNormal) and (ssLeft in Shift) then + begin + DragWhat := CanDragWhat(GridCoord); + case DragWhat of + agsSizeCol, agsSizeRow, agsSizeColHdr, agsSizeRowHdr, + agsMoveCol, agsSizeAppt: + BeginDragging(GridCoord, DragWhat, GridCoord.Appt); + agsMoveAppt: + BeginDrag(False); + agsNormal: + if Assigned(SelAppt) then + EditAppt(GridCoord.Col, SelAppt); + end; + + if DragWhat in [agsSizeAppt, agsMoveAppt, agsNormal] then + begin + FAutoScrollDir := asdNowhere; + FLiveTimer := True; + SetTimer(Handle, 1, 60, nil); + end; + end; +end; + +procedure TJvTFDays.MouseMove(Shift: TShiftState; X, Y: Integer); +var + GridCoord: TJvTFDaysCoord; + AutoScrollMargin: TRect; + SelStartDate, SelEndDate: TDate; + SelStartTime, SelEndTime: TTime; + OldFSelEnd, HintTopLeft: TPoint; + FSelEndChanged: Boolean; + + procedure UpdateAutoScroll; + begin + AutoScrollMargin := GetDataAreaRect; + //Windows.InflateRect(AutoScrollMargin, -10, -10); + + if Y < AutoScrollMargin.Top then + FAutoScrollDir := asdUp + else + if Y > AutoScrollMargin.Bottom then + FAutoScrollDir := asdDown + else + if X < AutoScrollMargin.Left then + FAutoScrollDir := asdLeft + else + if X > AutoScrollMargin.Right then + FAutoScrollDir := asdRight + else + FAutoScrollDir := asdNowhere; + end; + +begin + if not Enabled then + Exit; + + inherited MouseMove(Shift, X, Y); + + GridCoord := PtToCell(X, Y); + + if State = agsNormal then + if Assigned(GridCoord.Appt) then + DoApptHint(GridCoord) + else + DoCellHint(GridCoord); + + if not Focused and not (csDesigning in ComponentState) then + Exit; + + FMouseMovePt := Point(X, Y); + FMouseMoveState := Shift; + + case State of + agsNormal: + if ssLeft in Shift then + begin + with GridCoord do + begin + if Col > gcHdr then + FocusedCol := Col + else + FocusedCol := LeftCol; + + if Row > gcHdr then + FocusedRow := Lesser(Row, Lesser(RowCount - 1, BottomRow + 1)) + else + if FAutoScrollDir = asdDown then + FocusedRow := RowCount - 1 + else + FocusedRow := TopRow; + end; + OldFSelEnd := FSelEnd; + SelEnd := Point(FocusedCol, FocusedRow); + FSelEndChanged := (OldFSelEnd.X <> FSelEnd.X) or + (OldFSelEnd.Y <> FSelEnd.Y); + + if (agoShowSelHint in Options) and + (SelStart.X > gcHdr) and (SelStart.Y > gcHdr) and + (SelEnd.X > gcHdr) and (SelEnd.Y > gcHdr) and + ((SelStart.X <> SelEnd.X) or (SelStart.Y <> SelEnd.Y)) then + begin + HintTopLeft := CellRect(GridCoord.Col, GridCoord.Row).TopLeft; + if FSelEndChanged then + begin + SelStartDate := Cols[SelStart.X].SchedDate; + SelStartTime := RowToTime(SelStart.Y); + SelEndDate := Cols[SelEnd.X].SchedDate; + SelEndTime := RowToTime(SelEnd.Y) + + EncodeTime(0, Granularity - 1, 0, 0); + + FHint.StartEndHint(SelStartDate, SelEndDate, SelStartTime, + SelEndTime, HintTopLeft.X, + HintTopLeft.Y, True); + + end + end + else + FHint.ReleaseHandle; + + UpdateAutoScroll; + end; + agsSizeCol..agsMoveCol: + ContinueDragging(GridCoord, nil); + agsSizeAppt: + begin + UpdateAutoScroll; + + if Y > GetDataAreaRect.Bottom then + GridCoord.Row := Lesser(BottomRow + 1, RowCount - 1); + + if FAutoScrollDir = asdNowhere then + ContinueDragging(GridCoord, nil); + end; + end; +end; + +procedure TJvTFDays.MouseUp(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); +var + GridCoord: TJvTFDaysCoord; +begin + if not Enabled then + Exit; + + inherited MouseUp(Button, Shift, X, Y); + + if not Focused and not (csDesigning in ComponentState) then + Exit; + + KillAutoScrollTimer; + + GridCoord := PtToCell(X, Y); + + case State of + agsSizeCol..agsSizeAppt: + EndDragging(GridCoord, nil); + agsNormal: + FHint.ReleaseHandle; + end; +end; + +procedure TJvTFDays.DblClick; +begin + if Editing then + FinishEditAppt; + inherited DblClick; +end; + +procedure TJvTFDays.DoStartDrag(var DragObject: TDragObject); +begin + if Editing then + FinishEditAppt; + + inherited DoStartDrag(DragObject); + + FDragInfo.Appt := SelAppt; + + if FocusedCol > gcHdr then + FDragInfo.Schedule := Cols[FocusedCol].Schedule; +end; + +procedure TJvTFDays.DragOver(Source: TObject; X, Y: Integer; + State: TDragState; var Accept: Boolean); +var + GridCoord: TJvTFDaysCoord; + Appt: TJvTFAppt; + SrcDragInfo: TJvTFDragInfo; + AutoScrollMargin: TRect; + + procedure UpdateAutoScroll; + begin + AutoScrollMargin := GetDataAreaRect; + InflateRect(AutoScrollMargin, -10, -10); + + if Y < AutoScrollMargin.Top then + FAutoScrollDir := asdUp + else + if Y > AutoScrollMargin.Bottom then + FAutoScrollDir := asdDown + else + if X < AutoScrollMargin.Left then + FAutoScrollDir := asdLeft + else + if X > AutoScrollMargin.Right then + FAutoScrollDir := asdRight + else + FAutoScrollDir := asdNowhere; + end; + +begin + inherited DragOver(Source, X, Y, State, Accept); + if Source is TJvTFControl then + begin + SrcDragInfo := TJvTFControl(Source).DragInfo; + GridCoord := PtToCell(X, Y); + Accept := GridCoord.DragAccept; + Appt := SrcDragInfo.Appt; + + case State of + dsDragEnter: + begin + if not Assigned(FDragInfo) then + FDragInfo := SrcDragInfo; + BeginDragging(GridCoord, agsMoveAppt, Appt); + end; + dsDragLeave: + begin + EndDragging(GridCoord, Appt); + if FDragInfo.ApptCtrl <> Self then + FDragInfo := nil; + end; + dsDragMove: + begin + FMouseMovePt := Point(X, Y); + UpdateAutoScroll; + + if Y > GetDataAreaRect.Bottom then + GridCoord.Row := Lesser(BottomRow + 1, RowCount - 1); + + if FAutoScrollDir = asdNowhere then + ContinueDragging(GridCoord, Appt); + end; + end; + end; +end; + +procedure TJvTFDays.DoEndDrag(Target: TObject; X, Y: Integer); +begin + KillAutoScrollTimer; + FState := agsNormal; + inherited DoEndDrag(Target, X, Y); +end; + +procedure TJvTFDays.DropAppt(ADragInfo: TJvTFDragInfo; X, Y: Integer); +const + cClassName = 'TJvTFCustomGlance'; +var + Appt: TJvTFAppt; + Coord: TJvTFDaysCoord; + Confirm, SchedNameChange, StartDateChange, Share: Boolean; + NewSchedName: string; + NewStartDate, NewEndDate: TDate; + NewStartTime: TTime; + NewEndTime: TDateTime; + NewStartDT, NewEndDT: TDateTime; +begin + FHint.ReleaseHandle; + // APPOINTMENT CAN ONLY BE DROPPED IN THE DATA AREA !!! + Appt := ADragInfo.Appt; + + // Calc new info + // DragAppt.Shift --> Ctrl = share, Shift = keep dates, Alt = keep times + Coord := PtToCell(X, Y); + NewSchedName := Cols[Coord.Col].SchedName; + CalcMoveStartEnd(Appt, Coord, ssShift in ADragInfo.Shift, + ssAlt in ADragInfo.Shift, NewStartDT, NewEndDT); + + NewStartDate := Trunc(NewStartDT); + NewStartTime := Frac(NewStartDT); + NewEndDate := Trunc(NewEndDT); + NewEndTime := Frac(NewEndDT); + + // Do a confirm drop event + Confirm := True; + if Assigned(FOnDropAppt) then + FOnDropAppt(Appt, NewSchedName, NewStartDate, NewStartTime, + NewEndDate, NewEndTime, ssCtrl in ADragInfo.Shift, Confirm); + + if Confirm then + begin + //SchedNameChange := NewSchedName <> ADragInfo.Schedule.SchedName; + SchedNameChange := IsClassByName(ADragInfo.ApptCtrl, cClassName) or + (NewSchedName <> ADragInfo.Schedule.SchedName); + StartDateChange := (Trunc(NewStartDate) <> Trunc(Appt.StartDate)) or + (Trunc(NewEndDate) <> Trunc(Appt.EndDate)); + Share := ssCtrl in ADragInfo.Shift; + + Appt.BeginUpdate; + try + if (SchedNameChange and not StartDateChange and not Share) or + (not SchedNameChange and StartDateChange and not Share) or + (SchedNameChange and StartDateChange and not Share) or + (not SchedNameChange and StartDateChange and Share) or + (SchedNameChange and StartDateChange and Share) then + begin + if ADragInfo.ApptCtrl is TJvTFDays then + Appt.RemoveSchedule(ADragInfo.Schedule.SchedName) + else + if IsClassByName(ADragInfo.ApptCtrl, cClassName) then + Appt.ClearSchedules; + + // THE FOLLOWING CODE SHOULD NOT BE NECESSARY. + // Make sure the old schedules get refreshed + { + aDate := Appt.StartDate; + while Trunc(aDate) <= Trunc(Appt.EndDate) do + begin + Sched := ScheduleManager.FindSchedule(ADragInfo.Schedule.SchedName, aDate); + if Assigned(Sched) then + ScheduleManager.RefreshConnections(Sched); + aDate := aDate + 1; + end; + } + end; + + // Now we set the new StartEnd + Appt.SetStartEnd(NewStartDate, NewStartTime, NewEndDate, NewEndTime); + // if there's a change in SchedName then add the appt to the schedule + Appt.AddSchedule(NewSchedName); + // THE FOLLOWING CODE SHOULD NOT BE NECESSARY. + //ScheduleManager.RefreshConnections(Appt); + finally + Appt.EndUpdate; + end; + end; + + if ADragInfo.ApptCtrl <> Self then + FState := agsNormal; +end; + +procedure TJvTFDays.BeginDragging(Coord: TJvTFDaysCoord; + DragWhat: TJvTFDaysState; Appt: TJvTFAppt); +begin + Update; + + FState := DragWhat; + FBeginDraggingCoord := Coord; + FDraggingCoord := Coord; + if (State <> agsMoveAppt) or Coord.DragAccept then + DrawDrag(Coord, Appt, False); +end; + +procedure TJvTFDays.DrawDrag(Coord: TJvTFDaysCoord; AAppt: TJvTFAppt; + AClear: Boolean); +var + OldPen: TPen; + DragRect: TRect; + I, LineLeft, StartRow, EndRow, DragRectHt: Integer; + Sched: TJvTFSched; + StartDT, EndDT: TDateTime; + SchedName: string; + + procedure InternalDrawFrame(ARect: TRect); + begin + Canvas.MoveTo(ARect.Left, ARect.Top); + Canvas.LineTo(ARect.Right - 2, ARect.Top); + Canvas.LineTo(ARect.Right - 2, ARect.Bottom - 2); + Canvas.LineTo(ARect.Left, ARect.Bottom - 2); + Canvas.LineTo(ARect.Left, ARect.Top); + end; + +begin + if ((State = agsSizeAppt) and not Assigned(Coord.Schedule)) or + ((State = agsMoveAppt) and ((Coord.Row < 0) or (Coord.Col < 0))) then + Exit; + + OldPen := TPen.Create; + try + with Canvas, Coord do + begin + OldPen.Assign(Pen); + Pen.Style := psDot; + Pen.Mode := pmXOR; + Pen.Width := 1; + + case State of + agsSizeCol, agsSizeRowHdr: + begin + MoveTo(AbsX, 0); + LineTo(AbsX, ClientHeight); + end; + agsSizeRow, agsSizeColHdr: + begin + MoveTo(0, AbsY); + LineTo(ClientWidth, AbsY); + end; + agsMoveCol: + begin + Pen.Mode := pmNotXOR; + Pen.Style := psSolid; + Pen.Width := 3; + + LineLeft := AbsX - CellX; + if FDraggingCoord.Col > FBeginDraggingCoord.Col then + Inc(LineLeft, Cols[FDraggingCoord.Col].Width); + + MoveTo(LineLeft, 0); + LineTo(LineLeft, ClientHeight); + end; + agsSizeAppt: + begin + Pen.Style := psSolid; + Pen.Mode := pmNotXOR; + + AAppt := FBeginDraggingCoord.Appt; + + CalcSizeEndTime(AAppt, EndDT); + + if AClear and FHint.HandleAllocated then + begin + FHint.ReleaseHandle; + // Control must be updated here. if not, drag lines will + // not be drawn properly. + Update; + end; + + SchedName := Coord.Schedule.SchedName; + for I := 0 to Cols.Count - 1 do + begin + Sched := Cols[I].Schedule; + if Assigned(Sched) and (Sched.SchedName = SchedName) and + ((Trunc(Sched.SchedDate) >= Trunc(AAppt.StartDate)) and + (Trunc(Sched.SchedDate) <= Trunc(EndDT))) then + begin + //Calc Start and end rows + if Trunc(Sched.SchedDate) = Trunc(AAppt.StartDate) then + StartRow := TimeToRow(AAppt.StartTime) + else + StartRow := 0; + if Trunc(Sched.SchedDate) = Trunc(EndDT) then + EndRow := TimeToRow(AdjustEndTime(EndDT)) + else + EndRow := RowCount - 1; + + DragRectHt := (EndRow - StartRow + 1) * RowHeight; + DragRect := VirtualCellRect(I, StartRow); + DragRect.Bottom := DragRect.Top + DragRectHt; + + DragRect.Top := Greater(DragRect.Top, GetDataAreaRect.Top); + DragRect.Bottom := Lesser(DragRect.Bottom, GetDataAreaRect.Bottom); + + InternalDrawFrame(DragRect); + end; + end; + + if not AClear and (agoShowApptHints in Options) then + FHint.StartEndHint(AAppt.StartDate, Trunc(EndDT), + AAppt.StartTime, Frac(EndDT), DragRect.Left + 2, + DragRect.Bottom + 2, True); + end; + agsMoveAppt: + begin + Pen.Style := psSolid; + Pen.Mode := pmNotXOR; + + Coord.Row := Greater(0, Greater(Coord.Row, TopRow - 1)); + + CalcMoveStartEnd(AAppt, Coord, ssShift in FDragInfo.Shift, + ssAlt in FDragInfo.Shift, StartDT, EndDT); + + if AClear and FHint.HandleAllocated then + begin + FHint.ReleaseHandle; + Update; + end; + + if Assigned(Coord.Schedule) then + SchedName := Coord.Schedule.SchedName; + DragRect := Classes.Rect(-1, -1, -1, -1); // Used to not show hint if outside a valid day. + for I := 0 to Cols.Count - 1 do + begin + Sched := Cols[I].Schedule; + if Assigned(Sched) and (Sched.SchedName = SchedName) and + ((Trunc(Sched.SchedDate) >= Trunc(StartDT)) and + (Trunc(Sched.SchedDate) <= Trunc(EndDT))) then + begin + //Calc Start and end rows + if Trunc(Sched.SchedDate) = Trunc(StartDT) then + StartRow := TimeToRow(StartDT) + else + StartRow := 0; + if Trunc(Sched.SchedDate) = Trunc(EndDT) then + EndRow := TimeToRow(AdjustEndTime(EndDT)) + else + EndRow := RowCount - 1; + + DragRectHt := (EndRow - StartRow + 1) * RowHeight; + DragRect := VirtualCellRect(I, StartRow); + DragRect.Bottom := DragRect.Top + DragRectHt; + DragRect.Top := Greater(DragRect.Top, GetDataAreaRect.Top); + InternalDrawFrame(DragRect); + end; + end; + if not AClear and (agoShowApptHints in Options) and + (DragRect.Top <> -1) and (DragRect.Left <> -1) and + (DragRect.Right <> -1) and (DragRect.Bottom <> -1) then + FHint.StartEndHint(Trunc(StartDT), Trunc(EndDT), + Frac(StartDT), Frac(EndDT), + DragRect.Right + 2, DragRect.Top + 2, + True); + end; + end; + end; + finally + Canvas.Pen.Assign(OldPen); + OldPen.Free; + end; +end; + +procedure TJvTFDays.ContinueDragging(Coord: TJvTFDaysCoord; Appt: TJvTFAppt); +var + ValidDrag, SameSchedName, ValidEnd, DiffCoord: Boolean; + SameDateLaterTime, LaterDate, DoDrawDrag: Boolean; + OldLeft, NewLeft: Integer; +begin + if State = agsSizeAppt then + begin + Coord.Row := Greater(Coord.Row, TopRow); + Coord.Row := Lesser(Coord.Row, BottomRow); + end; + + DoDrawDrag := False; + + case State of + agsSizeCol, agsSizeRowHdr, agsSizeRow, agsSizeColHdr: + DoDrawDrag := True; + agsMoveCol: + begin + OldLeft := FDraggingCoord.AbsX - FDraggingCoord.CellX; + NewLeft := Coord.AbsX - Coord.CellX; + DoDrawDrag := (OldLeft <> NewLeft) and + (Coord.Row = gcHdr) and (Coord.Col > gcHdr); + end; + agsSizeAppt: + begin + SameSchedName := False; + ValidEnd := False; + DiffCoord := False; + ValidDrag := Assigned(FBeginDraggingCoord.Schedule) and + Assigned(FDraggingCoord.Schedule) and Assigned(Coord.Schedule); + if ValidDrag then + begin + SameSchedName := + FDraggingCoord.Schedule.SchedName = FBeginDraggingCoord.Schedule.SchedName; + LaterDate := (Trunc(Coord.Schedule.SchedDate) > Trunc(FBeginDraggingCoord.Appt.StartDate)) and + (Coord.Row >= 0); + SameDateLaterTime := + (Trunc(Coord.Schedule.SchedDate) = Trunc(FBeginDraggingCoord.Appt.StartDate)) and + (Coord.Row >= TimeToRow(FBeginDraggingCoord.Appt.StartTime)); + ValidEnd := LaterDate or SameDateLaterTime; + DiffCoord := not ((Coord.Row = FDraggingCoord.Row) and (Coord.Col = FDraggingCoord.Col)); + end; + DoDrawDrag := ValidDrag and SameSchedName and ValidEnd and DiffCoord; + end; + agsMoveAppt: + DoDrawDrag := (Coord.Col <> FDraggingCoord.Col) or (Coord.Row <> FDraggingCoord.Row); + end; + + if DoDrawDrag then + begin + if (State <> agsMoveAppt) or FDraggingCoord.DragAccept then + DrawDrag(FDraggingCoord, Appt, True); // clear old line + FDraggingCoord := Coord; + if (State <> agsMoveAppt) or FDraggingCoord.DragAccept then + DrawDrag(FDraggingCoord, Appt, False); // draw new line + end; +end; + +procedure TJvTFDays.EndDragging(Coord: TJvTFDaysCoord; Appt: TJvTFAppt); +var + Confirm: Boolean; + ColNum, DeltaSize, NewSize: Integer; + NewEndDT: TDateTime; +begin + Confirm := True; + try + if (State <> agsMoveAppt) or FDraggingCoord.DragAccept then + DrawDrag(FDraggingCoord, Appt, True); // clear old line + + case State of + agsSizeCol: + begin + ColNum := FBeginDraggingCoord.Col; + DeltaSize := Coord.AbsX - FBeginDraggingCoord.AbsX; + NewSize := Cols[ColNum].Width + DeltaSize; + + if Assigned(FOnSizeCol) then + FOnSizeCol(Self, ColNum, NewSize, Confirm); + + if Confirm then + begin + Cols[ColNum].Width := NewSize; + UpdateDesigner; + end; + end; + agsSizeRow: + begin + DeltaSize := Coord.AbsY - FBeginDraggingCoord.AbsY; + NewSize := RowHeight + DeltaSize; + + if Assigned(FOnSizeRow) then + FOnSizeRow(Self, 0, NewSize, Confirm); + + if Confirm then + begin + RowHeight := NewSize; + UpdateDesigner; + end; + end; + agsSizeColHdr: + begin + DeltaSize := Coord.AbsY - FBeginDraggingCoord.AbsY; + NewSize := ColHdrHeight + DeltaSize; + + if Assigned(FOnSizeColHdr) then + FOnSizeColHdr(Self, 0, NewSize, Confirm); + + if Confirm then + begin + ColHdrHeight := NewSize; + UpdateDesigner; + end; + end; + agsSizeRowHdr: + begin + DeltaSize := Coord.AbsX - FBeginDraggingCoord.AbsX; + NewSize := RowHdrWidth + DeltaSize; + + if Assigned(FOnSizeRowHdr) then + FOnSizeRowHdr(Self, 0, NewSize, Confirm); + + if Confirm then + begin + RowHdrWidth := NewSize; + UpdateDesigner; + end; + end; + agsMoveCol: + begin + NewSize := FDraggingCoord.Col; + if Assigned(FOnMoveCol) then + FOnMoveCol(Self, FBeginDraggingCoord.Col, NewSize, Confirm); + + if Confirm then + begin + Cols.MoveCol(FBeginDraggingCoord.Col, NewSize); + UpdateDesigner; + end; + end; + agsSizeAppt: + begin + FHint.ReleaseHandle; + Appt := FBeginDraggingCoord.Appt; + CalcSizeEndTime(Appt, NewEndDT); + + if Assigned(FOnSizeAppt) then + FOnSizeAppt(Self, Appt, NewEndDT, Confirm); + + if Confirm then + begin + // WHY AM I CALLING RefreshControls HERE????? + ScheduleManager.RefreshConnections(Appt); + Appt.SetStartEnd(Appt.StartDate, Appt.StartTime, + Trunc(NewEndDT), Frac(NewEndDT)); + ScheduleManager.RefreshConnections(Appt); + end; + end; + //agsMoveAppt: nothing special here - see DropAppt method + end; + finally + // Don't reset state if moving appt. State will be reset in DoEndDrag + // and/or DropAppt methods. Resetting State here will cause problems when + // dragging between multiple appt controls. + if State <> agsMoveAppt then + FState := agsNormal; + end; +end; + +function TJvTFDays.CanDragWhat(Coord: TJvTFDaysCoord): TJvTFDaysState; +var + TopHandleRect, BottomHandleRect: TRect; +begin + case State of + agsSizeCol, agsSizeRow, agsSizeColHdr, agsSizeRowHdr, + agsMoveCol, agsSizeAppt, agsMoveAppt: + begin + Result := State; + Exit; + end; + else + Result := agsNormal; + end; + + with Coord do + begin + if ((agoSizeCols in Options) or (csDesigning in ComponentState)) and + (Row = gcHdr) and (Col > gcHdr) and + (CellX > Cols[Col].Width - SizingThreshold) then + begin + Result := agsSizeCol; + Exit; + end; + + if ((agoSizeRows in Options) or (csDesigning in ComponentState)) and + (Row > gcHdr) and (Col = gcHdr) and + (CellY > RowHeight - SizingThreshold) then + begin + Result := agsSizeRow; + Exit; + end; + + if ((agoSizeColHdr in Options) or (csDesigning in ComponentState)) and + (Row = gcHdr) and (Col > gcUndef) and + (CellY > ColHdrHeight - SizingThreshold) then + begin + Result := agsSizeColHdr; + Exit; + end; + + if ((agoSizeRowHdr in Options) or (csDesigning in ComponentState)) and + (Row > gcUndef) and (Col = gcHdr) and + (CellX > RowHdrWidth - SizingThreshold) then + begin + Result := agsSizeRowHdr; + Exit; + end; + + if ((agoMoveCols in Options) or (csDesigning in ComponentState)) and + (Coord.Row = gcHdr) and (Coord.Col > gcHdr) and + not (Template.ActiveTemplate = agtLinear) and + ((State = agsNormal) or (State = agsMoveCol)) and + (Cols.Count > 1) then + begin + Result := agsMoveCol; + Exit; + end; + + // move grab handles + if Assigned(SelAppt) then + begin + TopHandleRect := GetTopGrabHandleRect(Col, SelAppt); + BottomHandleRect := GetBottomGrabHandleRect(Col, SelAppt); + if PtInRect(TopHandleRect, Point(AbsX, AbsY)) and + (agoMoveAppt in Options) then + Result := agsMoveAppt + else + if PtInRect(BottomHandleRect, Point(AbsX, AbsY)) and + (agoSizeAppt in Options) then + Result := agsSizeAppt; + end; + +// if ((agoSizeAppt in Options) or (agoMoveAppt in Options)) and +// Assigned(Appt) and (Appt = SelAppt) then +// begin +// ApptRect := GetApptRect(Col, Appt); +// if (AbsY <= ApptRect.Top + GrabHandles.Height - 1) and +// (agoMoveAppt in Options) then +// begin +// Result := agsMoveAppt; +// Exit; +// end +// else +// if (AbsY >= ApptRect.Bottom - GrabHandles.Height + 1) and +// (agoSizeAppt in Options) then +// begin +// Result := agsSizeAppt; +// Exit; +// end; +// end; + end; +end; + +procedure TJvTFDays.CalcSizeEndTime(Appt: TJvTFAppt; var NewEndDT: TDateTime); +var + TimeOffset: TTime; + Sched: TJvTFSched; +begin + Sched := FDraggingCoord.Schedule; + if (Sched.SchedName = FBeginDraggingCoord.Schedule.SchedName) and + (Trunc(Sched.SchedDate) >= Trunc(Appt.StartDate)) then + if agoSnapSize in Options then + if FDraggingCoord.Row <> RowCount - 1 then + NewEndDT := Trunc(Sched.SchedDate) + Frac(RowToTime(FDraggingCoord.Row + 1)) + else + NewEndDT := Trunc(Sched.SchedDate) + Frac(RowEndTime(FDraggingCoord.Row)) + else + begin + TimeOffset := Frac(Appt.EndTime) - + Frac(RowToTime(TimeToRow(AdjustEndTime(Appt.EndTime)))); + NewEndDT := Trunc(Sched.SchedDate) + + Frac(RowToTime(FDraggingCoord.Row)) + TimeOffset; + end + else + NewEndDT := Trunc(Appt.EndDate) + Frac(Appt.EndTime); +end; + +{$IFNDEF Jv_TIMEBLOCKS} +// remove +{ +procedure TJvTFDays.CalcMoveStartEnd(Appt: TJvTFAppt; Coord: TJvTFDaysCoord; + KeepDates, KeepTimes: Boolean; var StartDT, EndDT: TDateTime); +var + NewStart, + NewEnd: TDateTime; +begin + NewStart := Trunc(Cols[Coord.Col].SchedDate) + Frac(RowToTime(Coord.Row)); + if not (agoSnapMove in Options) then + NewStart := NewStart + + Frac(Appt.StartTime) - RowToTime(TimeToRow(Appt.StartTime)); + + NewEnd := (Trunc(Appt.EndDate) + Frac(Appt.EndTime)) - + (Trunc(Appt.StartDate) + Frac(Appt.StartTime)) + + NewStart; + + if KeepDates then + begin + NewStart := Trunc(Appt.StartDate) + Frac(NewStart); + NewEnd := Trunc(Appt.EndDate) + Frac(NewEnd); + end; + + if KeepTimes then + begin + NewStart := Trunc(NewStart) + Frac(Appt.StartTime); + NewEnd := Trunc(NewEnd) + Frac(Appt.EndTime); + end; + + StartDT := NewStart; + EndDT := NewEnd; +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +{$IFDEF Jv_TIMEBLOCKS} +// ok +procedure TJvTFDays.CalcMoveStartEnd(Appt: TJvTFAppt; Coord: TJvTFDaysCoord; + KeepDates, KeepTimes: Boolean; var StartDT, EndDT: TDateTime); +var + NewStart, NewEnd: TDateTime; + TimeBlockIndex, BlockStartRow, BlockEndRow: Integer; + BlockStartTime, BlockEndTime: TTime; + H, M, S, MS: Word; +begin + TimeBlockIndex := RowToTimeBlock(Coord.Row); + if TimeBlockProps.SnapMove and (TimeBlockIndex > -1) then + begin + GetTimeBlockStartEnd(TimeBlockIndex, BlockStartRow, BlockEndRow); + BlockStartTime := RowToTime(BlockStartRow); + BlockEndTime := RowEndTime(BlockEndRow); + NewStart := Trunc(Cols[Coord.Col].SchedDate) + Frac(BlockStartTime); + NewEnd := Trunc(NewStart) + Frac(BlockEndTime); + end + else + begin + NewStart := Trunc(Cols[Coord.Col].SchedDate) + Frac(RowToTime(Coord.Row)); + if not (agoSnapMove in Options) then + NewStart := NewStart + + Frac(Appt.StartTime) - RowToTime(TimeToRow(Appt.StartTime)); + + NewEnd := (Trunc(Appt.EndDate) + Frac(Appt.EndTime)) - + (Trunc(Appt.StartDate) + Frac(Appt.StartTime)) + + NewStart; + + // NewEnd cannot fall exactly on midnight. Bad things happen. + DecodeTime(NewEnd, H, M, S, MS); + if (H = 0) and (M = 0) and (S = 0) then + NewEnd := NewEnd - ONE_SECOND; + + if KeepDates then + begin + NewStart := Trunc(Appt.StartDate) + Frac(NewStart); + NewEnd := Trunc(Appt.EndDate) + Frac(NewEnd); + end; + + if KeepTimes then + begin + NewStart := Trunc(NewStart) + Frac(Appt.StartTime); + NewEnd := Trunc(NewEnd) + Frac(Appt.EndTime); + end; + end; + + StartDT := NewStart; + EndDT := NewEnd; +end; +{$ENDIF Jv_TIMEBLOCKS} + +procedure TJvTFDays.EnsureCol(ACol: Integer); +begin + if (ACol < 0) or (ACol > Cols.Count - 1) then + raise EJvTFDaysError.CreateRes(@RsEColumnIndexOutOfBounds); +end; + +procedure TJvTFDays.EnsureRow(ARow: Integer); +begin + if (ARow < 0) or (ARow > RowCount - 1) then + raise EJvTFDaysError.CreateRes(@RsERowIndexOutOfBounds); +end; + +procedure TJvTFDays.KeyDown(var Key: Word; Shift: TShiftState); +var + H: Word; + Handled: Boolean; + + procedure DoSel; + begin + if ssShift in Shift then + SelEnd := Point(FocusedCol, FocusedRow) + else + SelStart := Point(FocusedCol, FocusedRow); + ColInView(FocusedCol); + RowInView(FocusedRow); + end; + +begin + Handled := True; + inherited KeyDown(Key, Shift); + + case Key of + VK_RETURN: + if ssAlt in Shift then + EditAppt(FocusedCol, SelAppt); + VK_UP: + if ssCtrl in Shift then + ScrollDays(-7) + else + if ssAlt in Shift then + SelPrevAppt + else + begin + FocusedRow := Greater(FocusedRow - 1, 0); + DoSel; + end; + VK_DOWN: + if ssCtrl in Shift then + ScrollDays(7) + else + if ssAlt in Shift then + SelNextAppt + else + begin + FocusedRow := Lesser(FocusedRow + 1, RowCount - 1); + DoSel; + end; + VK_RIGHT: + if ssCtrl in Shift then + NextDate + else + if ssAlt in Shift then + SelFirstApptNextCol + else + begin + FocusedCol := Lesser(FocusedCol + 1, Cols.Count - 1); + DoSel; + end; + VK_LEFT: + if ssCtrl in Shift then + PrevDate + else + if ssAlt in Shift then + SelFirstApptPrevCol + else + begin + FocusedCol := Greater(FocusedCol - 1, 0); + DoSel; + end; + VK_PRIOR: + if ssCtrl in Shift then + ScrollMonths(-1) + else + begin + TopRow := Greater(TopRow - FullVisibleRows, 0); + FocusedRow := Greater(FocusedRow - FullVisibleRows, TopRow); + DoSel; + end; + VK_NEXT: + if ssCtrl in Shift then + ScrollMonths(1) + else + begin + TopRow := Lesser(TopRow + FullVisibleRows, RowCount - FullVisibleRows); + FocusedRow := Lesser(FocusedRow + FullVisibleRows, RowCount - 1); + DoSel; + end; + VK_HOME: + if ssCtrl in Shift then + TopRow := TimeToRow(PrimeTime.StartTime) + else + begin + TopRow := 0; + FocusedRow := 0; + DoSel; + end; + VK_END: + if ssCtrl in Shift then + RowInView(TimeToRow(AdjustEndTime(PrimeTime.EndTime))) + else + begin + RowInView(RowCount - 1); + FocusedRow := RowCount - 1; + DoSel; + end; + VK_F1..VK_F12: + if ssCtrl in Shift then + begin + H := Key - VK_F1 + 1; + if ssShift in Shift then + Inc(H, 12); + if Key = VK_F12 then + Dec(H, 12); + RowInView(TimeToRow(EncodeTime(H, 0, 0, 0))); + end; + VK_INSERT: + if Shift = [ssCtrl] then + case Granularity of + 2: + Granularity := 1; + 3: + Granularity := 2; + 4: + Granularity := 3; + 5: + Granularity := 4; + 6: + Granularity := 5; + 10: + Granularity := 6; + 12: + Granularity := 10; + 15: + Granularity := 12; + 20: + Granularity := 15; + 30: + Granularity := 20; + 60: + Granularity := 30; + end + else + if Shift = [ssShift] then + DoInsertSchedule + else + if Shift = [] then + DoInsertAppt; + VK_DELETE: + if Shift = [ssCtrl] then + case Granularity of + 1: + Granularity := 2; + 2: + Granularity := 3; + 3: + Granularity := 4; + 4: + Granularity := 5; + 5: + Granularity := 6; + 6: + Granularity := 10; + 10: + Granularity := 12; + 12: + Granularity := 15; + 15: + Granularity := 20; + 20: + Granularity := 30; + 30: + Granularity := 60; + end + else + if Shift = [ssShift] then + DoDeleteSchedule + else + if Shift = [] then + DoDeleteAppt; + else + Handled := False; + end; + + if Handled then + Key := 0; +end; + +procedure TJvTFDays.KeyPress(var Key: Char); +begin + inherited KeyPress(Key); + QuickEntry(Key); +end; + +procedure TJvTFDays.DoInsertSchedule; +begin + if Assigned(FOnInsertSchedule) then + FOnInsertSchedule(Self); +end; + +procedure TJvTFDays.DoInsertAppt; +begin + if Assigned(FOnInsertAppt) then + FOnInsertAppt(Self); +end; + +procedure TJvTFDays.DoDeleteAppt; +begin + if Assigned(FOnDeleteAppt) then + FOnDeleteAppt(Self); +end; + +procedure TJvTFDays.DoDeleteSchedule; +begin + if Assigned(FOnDeleteSchedule) then + FOnDeleteSchedule(Self); +end; + +function TJvTFDays.DoMouseWheelDown(Shift: TShiftState; + MousePos: TPoint): Boolean; +begin + Result := inherited DoMouseWheelDown(Shift, MousePos); + if not Result then + begin + if TopRow < RowCount - FullVisibleRows then + TopRow := TopRow + 1; + Result := True; + end; +end; + +function TJvTFDays.DoMouseWheelUp(Shift: TShiftState; + MousePos: TPoint): Boolean; +begin + Result := inherited DoMouseWheelUp(Shift, MousePos); + if not Result then + begin + if TopRow > 0 then + TopRow := TopRow - 1; + Result := True; + end; +end; + +procedure TJvTFDays.DestroyApptNotification(AAppt: TJvTFAppt); +begin + if AAppt = SelAppt then + SelAppt := nil; + inherited DestroyApptNotification(AAppt); +end; + +procedure TJvTFDays.CMMouseLeave(var Msg: TLMessage); +begin + FHint.ReleaseHandle; + inherited; +end; + +procedure TJvTFDays.DoEnter; +begin + inherited DoEnter; + if Assigned(FOnFocusedColChanged) then + FOnFocusedColChanged(Self); + if Assigned(FOnFocusedRowChanged) then + FOnFocusedRowChanged(Self); + Invalidate; +end; + +procedure TJvTFDays.DoExit; +begin + if Assigned(FOnFocusedColChanged) then + FOnFocusedColChanged(Self); + if Assigned(FOnFocusedRowChanged) then + FOnFocusedRowChanged(Self); + Invalidate; + inherited DoExit; +end; + +function TJvTFDays.GetSelStart: TPoint; +begin + // This routine will always return the start of the selection regardless + // of whether FSelStart and FSelEnd are in the correct order or not. + if FFromToSel then + if (FSelStart.X < FSelEnd.X) or + ((FSelStart.X = FSelEnd.X) and (FSelStart.Y < FSelEnd.Y)) then + Result := FSelStart + else + Result := FSelEnd + else + Result := Point(Lesser(FSelStart.X, FSelEnd.X), + Lesser(FSelStart.Y, FSelEnd.Y)); +end; + +function TJvTFDays.GetSelEnd: TPoint; +begin + // This routine will always return the end of the selection regardless + // of whether FSelStart and FSelEnd are in the correct order or not. + if FFromToSel then + if (FSelStart.X < FSelEnd.X) or + ((FSelStart.X = FSelEnd.X) and (FSelStart.Y < FSelEnd.Y)) then + Result := FSelEnd + else + Result := FSelStart + else + Result := Point(Greater(FSelStart.X, FSelEnd.X), + Greater(FSelStart.Y, FSelEnd.Y)); +end; + +{$IFNDEF Jv_TIMEBLOCKS} +// remove +{ +procedure TJvTFDays.SetSelStart(Value: TPoint); +begin + FSelStart := Value; + FSelEnd := Value; + DoNavigate; + Invalidate; +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +{$IFDEF Jv_TIMEBLOCKS} +// ok +procedure TJvTFDays.SetSelStart(Value: TPoint); +var + TimeBlock, StartRow, EndRow: Integer; +begin + TimeBlock := RowToTimeBlock(Value.Y); + if (TimeBlock = -1) and (TimeBlocks.Count > 0) then + Exit; + + FSelStart := Value; + FSelEnd := Value; + + if TimeBlock > -1 then + begin + GetTimeBlockStartEnd(TimeBlock, StartRow, EndRow); + FSelStart.Y := StartRow; + FSelEnd.Y := EndRow; + end; + +// DoNavigate; + Invalidate; +end; +{$ENDIF Jv_TIMEBLOCKS} + +{$IFNDEF Jv_TIMEBLOCKS} +// remove +{ +procedure TJvTFDays.SetSelEnd(Value: TPoint); +var + SameName, + Consecutive: Boolean; + I, + TestStart, + TestEnd, + DateDiff: Integer; +begin + ///////////////////////////////////////////////////////////////////// + // This routine enforces the rules by which cells can be selected. + // There are two different types of selection: + // 1. From/To - As mouse moves from cell(1, 4) to cell(2, 8)... + // Cell(1, 4) through cell(1, LastRow) is selected, AND + // Cell(2, TopRow) through cell(2, 8) is selected. + // 2. Block - As mouse moves from cell(1, 4) to cell(2, 8)... + // Cell(1, 4) through cell(1, 8) is selected, AND + // Cell(2, 4) through cell(2, 8) is selected. + // + // There are six different cases that are possible: + // 1. Same SchedName (resource), contiguous dates ==> From/To selection + // (Mike - 1/1/99 and Mike - 1/2/99) + // 2. Same name, non-contiguous dates ==> Selection not allowed + // (Mike - 1/1/99 and Mike - 2/1/99) + // 3. Same name, same date ==> Block selection + // (Mike - 1/1/99 and Mike - 1/1/99) + // 4. Different name, contiguous dates ==> Selection not allowed + // (Mike - 1/1/99 and Jennifer - 1/2/99) + // 5. Different name, non-contiguous dates ==> Selection not allowed + // (Mike - 1/1/99 and Jennifer - 2/1/99) + // 6. Different name, same date ==> Block selection + // (Mike - 1/1/99 and Jennifer - 1/1/99) + /////////////////////////////////////////////////////////////////////// + + // Check for different end value + if (FSelEnd.X <> Value.X) or (FSelEnd.Y <> Value.Y) then + begin + // Check for valid end + if (FSelStart.X > gcHdr) and (Value.X > gcHdr) and (FSelEnd.X > gcHdr) and + (FSelStart.Y > gcHdr) and (Value.Y > gcHdr) and (FSelEnd.Y > gcHdr) then + begin + // FFromToSel flag needed for drawing selection frame when + // SelCellAttr.Style = scsFrame. Frame is drawn in DrawDataCell. + //FFromToSel := False; + + // We need a two-level check. First check new end (Value) against + // old end (FSelEnd). if that is NOT a valid end then check + // new end (Value) against start (FSelStart). + + // IMPORTANT NOTE: When in a case #1 and selection moves up or down + // within the same column, the code below will interpret that as + // Case #3. This is not exactly correct, but it still yields the + // correct results. + + // First check new end against old end + SameName := Cols[FSelEnd.X].SchedName = Cols[Value.X].SchedName; + DateDiff := Abs(Trunc(Cols[FSelEnd.X].SchedDate) - + Trunc(Cols[Value.X].SchedDate)); + + if ( SameName and (DateDiff = 1)) or // Case #1 + ( SameName and (DateDiff = 0)) or // Case #3 + (not SameName and (DateDiff = 0)) then // Case #6 + begin + FFromToSel := (SameName and (DateDiff = 1)) or + (FFromToSel and (SameName and (DateDiff = 0))); + + FSelEnd := Value; + DoNavigate; + Invalidate; + end + else + // if first check fails then check new end against start + begin + SameName := Cols[FSelStart.X].SchedName = Cols[Value.X].SchedName; + DateDiff := Abs(Trunc(Cols[FSelStart.X].SchedDate) - + Trunc(Cols[Value.X].SchedDate)); + if ( SameName and (DateDiff = 1)) or // Case #1 + ( SameName and (DateDiff = 0)) or // Case #3 + (not SameName and (DateDiff = 0)) then // Case #6 + begin + FFromToSel := (SameName and (DateDiff = 1)) or + (FFromToSel and (SameName and (DateDiff = 0))); + + FSelEnd := Value; + DoNavigate; + Invalidate; + end + else + // Do a third check for "lagging selection" + // (Sometimes mouse loses selection, especially when speed + // threshold is exceeded.) + begin + // Check for consecutive dates + TestStart := Lesser(SelStart.X, Value.X); + TestEnd := Greater(SelStart.X, Value.X); + I := TestStart; + Consecutive := True; + while (I < TestEnd) and Consecutive do + if Trunc(Cols[I + 1].SchedDate) - + Trunc(Cols[I].SchedDate) <> 1 then + Consecutive := False + else + Inc(I); + + if Consecutive then + begin + FFromToSel := True; + FSelEnd := Value; + DoNavigate; + Invalidate; + end + else + FFromToSel := False; + end; + end; + end; + end; +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +{$IFDEF Jv_TIMEBLOCKS} +// ok +procedure TJvTFDays.SetSelEnd(Value: TPoint); +var + SameName, Consecutive, InTimeBlock: Boolean; + I, TestStart, TestEnd, DateDiff, TimeBlock: Integer; + SelStartTimeBlock, StartRow, EndRow: Integer; + + procedure CheckFollowMouse; + begin + if (TimeBlocks.Count > 0) and SameName and (DateDiff = 1) and + (Value.X <> SelStart.X) then + SelStart := Point(Value.X, SelStart.Y); + end; + +begin + { + This routine enforces the rules by which cells can be selected. + There are two different types of selection: + 1. From/To - As mouse moves from cell(1, 4) to cell(2, 8)... + Cell(1, 4) through cell(1, LastRow) is selected, AND + Cell(2, TopRow) through cell(2, 8) is selected. + 2. Block - As mouse moves from cell(1, 4) to cell(2, 8)... + Cell(1, 4) through cell(1, 8) is selected, AND + Cell(2, 4) through cell(2, 8) is selected. + + NOTE: The Block selection type should not be confused with + Time Blocks. They are two different things. The only + type of allowable selection when using Time Blocks is + Block, however a Block selection can exist without + the use of Time Blocks. + + There are six different cases that are possible: + 1. Same SchedName (resource), contiguous dates ==> From/To selection + (Mike - 1/1/99 and Mike - 1/2/99) + 2. Same name, non-contiguous dates ==> Selection not allowed + (Mike - 1/1/99 and Mike - 2/1/99) + 3. Same name, same date ==> Block selection + (Mike - 1/1/99 and Mike - 1/1/99) + 4. Different name, contiguous dates ==> Selection not allowed + (Mike - 1/1/99 and Jennifer - 1/2/99) + 5. Different name, non-contiguous dates ==> Selection not allowed + (Mike - 1/1/99 and Jennifer - 2/1/99) + 6. Different name, same date ==> Block selection + (Mike - 1/1/99 and Jennifer - 1/1/99) + } + + // Do a time block check and adjust Value.Y if necessary to always + // select the entire time block. + TimeBlock := RowToTimeBlock(Value.Y); + if (TimeBlock = -1) and (TimeBlocks.Count > 0) then + Exit; + + SelStartTimeBlock := RowToTimeBlock(SelStart.Y); + InTimeBlock := (TimeBlock > -1) or (SelStartTimeBlock > -1); + if InTimeBlock then + begin + if TimeBlock > -1 then + begin + GetTimeBlockStartEnd(TimeBlock, StartRow, EndRow); + SelStart := Point(SelStart.X, StartRow); + end + else + SelStart := Point(SelStart.X, Value.Y); + Value.Y := EndRow; + end; + + // Check for different end value + if (FSelEnd.X <> Value.X) or (FSelEnd.Y <> Value.Y) then + begin + // Check for valid end + if (FSelStart.X > gcHdr) and (Value.X > gcHdr) and (FSelEnd.X > gcHdr) and + (FSelStart.Y > gcHdr) and (Value.Y > gcHdr) and (FSelEnd.Y > gcHdr) then + begin + // FFromToSel flag needed for drawing selection frame when + // SelCellAttr.Style = scsFrame. Frame is drawn in DrawDataCell. + //FFromToSel := False; + + // We need a two-level check. First check new end (Value) against + // old end (FSelEnd). if that is NOT a valid end then check + // new end (Value) against start (FSelStart). + + // IMPORTANT NOTE: When in a case #1 and selection moves up or down + // within the same column, the code below will interpret that as + // Case #3. This is not exactly correct, but it still yields the + // correct results. + + // First check new end against old end + SameName := Cols[FSelEnd.X].SchedName = Cols[Value.X].SchedName; + DateDiff := Abs(Trunc(Cols[FSelEnd.X].SchedDate) - + Trunc(Cols[Value.X].SchedDate)); + + CheckFollowMouse; + + if (SameName and (DateDiff = 1) and (TimeBlocks.Count = 0)) or // Case #1 only if no timeblocks + (SameName and (DateDiff = 0)) or // Case #3 + (not SameName and (DateDiff = 0)) then // Case #6 + begin + FFromToSel := (SameName and (DateDiff = 1)) or + (FFromToSel and (SameName and (DateDiff = 0))); + + FSelEnd := Value; +// DoNavigate; + Invalidate; + end + else + // if first check fails then check new end against start + begin + SameName := Cols[FSelStart.X].SchedName = Cols[Value.X].SchedName; + DateDiff := Abs(Trunc(Cols[FSelStart.X].SchedDate) - + Trunc(Cols[Value.X].SchedDate)); + + CheckFollowMouse; + + if (SameName and (DateDiff = 1) and (TimeBlocks.Count = 0)) or // Case #1 only if no timeblocks + (SameName and (DateDiff = 0)) or // Case #3 + (not SameName and (DateDiff = 0)) then // Case #6 + begin + FFromToSel := (SameName and (DateDiff = 1)) or + (FFromToSel and (SameName and (DateDiff = 0))); + + FSelEnd := Value; +// DoNavigate; + Invalidate; + end + else + // Do a third check for "lagging selection" + // (Sometimes mouse loses selection, especially when speed + // threshold is exceeded.) + begin + // Check for consecutive dates + TestStart := Lesser(SelStart.X, Value.X); + TestEnd := Greater(SelStart.X, Value.X); + I := TestStart; + Consecutive := False; + while (I < TestEnd) and Consecutive do + if Trunc(Cols[I + 1].SchedDate) - + Trunc(Cols[I].SchedDate) <> 1 then + Consecutive := False + else + Inc(I); + + if Consecutive then + begin + FFromToSel := True; + FSelEnd := Value; +// DoNavigate; + Invalidate; + end + else + FFromToSel := False; + end; + end; + end; + end; +end; +{$ENDIF Jv_TIMEBLOCKS} + +procedure TJvTFDays.QuickEntry(Key: Char); +var + Appt: TJvTFAppt; + ApptStartDate, ApptEndDate: TDate; + ApptStartTime, ApptEndTime: TTime; + I: Integer; + ID: string; + Confirm: Boolean; +begin + // Ord(key) must be >= 32 to quick entry an appt. + if (Ord(Key) >= 32) and ValidSelection and not Assigned(SelAppt) and + (agoQuickEntry in Options) and (agoEditing in Options) and CanEdit then + begin + // Calc the appt's start and end info + ApptStartDate := Cols[SelStart.X].SchedDate; + ApptEndDate := Cols[SelEnd.X].SchedDate; + ApptStartTime := RowToTime(SelStart.Y); + // subtract one min from granularity and then add it back in. This + // avoids min overflow when granularity = 60. + ApptEndTime := RowToTime(SelEnd.Y) + + EncodeTime(0, Granularity - 1, 0, 0) + + EncodeTime(0, 1, 0, 0); + // if we're on the last row make sure end time is not = 0 (12am next day) + // This avoids InvalidStartEnd exception when calling Appt.SetStartEnd + if SelEnd.Y = RowCount - 1 then + ApptEndTime := ApptEndTime - EncodeTime(0, 0, 1, 0); + + ID := ''; + Confirm := True; + + if Assigned(FOnCreateQuickEntry) then + FOnCreateQuickEntry(Self, ID, ApptStartDate, ApptStartTime, + ApptEndDate, ApptEndTime, Confirm); + + if Confirm and Assigned(ScheduleManager) then + begin + Appt := ScheduleManager.dbNewAppt(ID); + Appt.Persistent := True; + + // Set the Start/end info + Appt.SetStartEnd(ApptStartDate, ApptStartTime, ApptEndDate, ApptEndTime); + + // Set the Schedule (resource) names + for I := SelStart.X to SelEnd.X do + if ColIsSelected(I) then + Appt.AddSchedule(Cols[I].SchedName); + + Appt.Persistent := False; + + SetSelAppt(Appt); + EditAppt(SelStart.X, SelAppt); + // Put the Key in the editor and set the caret + FEditor.Text := Key; + FEditor.SelStart := 1; + FEditor.QuickCreate := True; + + if Assigned(FOnQuickEntry) then + FOnQuickEntry(Self); + end; + end; +end; + +function TJvTFDays.GetAdjClientRect: TRect; +begin + Result := GetClientRect; + + if Assigned(FVScrollBar) and FVScrollBar.Visible then + Dec(Result.Right, FVScrollBar.Width); + if Assigned(FHScrollBar) and FHScrollBar.Visible then + Dec(Result.Bottom, FHScrollBar.Height); +end; + +function TJvTFDays.GetDataAreaRect: TRect; +begin + Result := GetAdjClientRect; + + {$IFDEF Jv_TIMEBLOCKS} + // ok + Inc(Result.Left, CalcBlockRowHdrsWidth); + {$ELSE} + // remove + //Inc(Result.Left, RowHdrWidth); + {$ENDIF Jv_TIMEBLOCKS} + + //group Inc(Result.Top, ColHdrHeight); + Inc(Result.Top, CalcGroupColHdrsHeight); +end; + +function TJvTFDays.GetDataWidth: Integer; +begin + Result := RectWidth(GetDataAreaRect); +end; + +function TJvTFDays.GetDataHeight: Integer; +begin + Result := RectHeight(GetDataAreaRect); +end; + +{$IFNDEF Jv_TIMEBLOCKS} +// remove +{ +function TJvTFDays.PtToCell(X, Y: Integer): TJvTFDaysCoord; +Var + ColNum, + RowNum, + AdjX, + AdjY, + Temp, + TotalWidth, + SegCount, + MapCol: Integer; + Done: Boolean; + ApptRect: TRect; +begin + With Result do + begin + Col := gcUndef; + Row := gcUndef; + CellX := -100; + CellY := -100; + AbsX := X; + AbsY := Y; + Schedule := nil; + Appt := nil; + end; + + if X < RowHdrWidth then + begin + Result.Col := gcHdr; + Result.CellX := X; + end + else + if LeftCol > -1 then + begin + // Find the col that PtX falls in + ColNum := LeftCol; + AdjX := X - RowHdrWidth; + Done := False; + Temp := 0; + + while (ColNum < Cols.Count) and not Done do + begin + Inc(Temp, Cols[ColNum].Width); + if AdjX < Temp then + begin + Done := True; + Result.Col := ColNum; + Result.CellX := AdjX - (Temp - Cols[ColNum].Width); + end + else + Inc(ColNum); + end; + end; + + if Y < CalcGroupHdrHeight then + begin + Result.Row := gcGroupHdr; + Result.CellY := Y; + end + //else + //if Y < ColHdrHeight then + else + if Y < CalcGroupColHdrsHeight then + begin + Result.Row := gcHdr; + Result.CellY := Y - CalcGroupHdrHeight; + end + else + if TopRow > -1 then + begin + RowNum := TopRow; + //group AdjY := Y - ColHdrHeight; + AdjY := Y - CalcGroupColHdrsHeight; + Done := False; + Temp := 0; + + while (RowNum < RowCount) and not Done do + begin + Inc(Temp, RowHeight); + if AdjY < Temp then + begin + Done := True; + Result.Row := RowNum; + Result.CellY := AdjY - (Temp - RowHeight); + end + else + Inc(RowNum); + end; + end; + + if Result.Col > gcHdr then + begin + Result.Schedule := Cols[Result.Col].Schedule; + + if (Result.Row > gcHdr) and Assigned(Result.Schedule) then + begin + TotalWidth := Cols[Result.Col].Width; + SegCount := Cols[Result.Col].MapColCount(Result.Row); + if SegCount > 0 then + begin + MapCol := LocateDivCol(Result.CellX, TotalWidth, SegCount); + Result.Appt := Cols[Result.Col].MapLocation(MapCol, Result.Row); + + ApptRect := GetApptRect(Result.Col, Result.Appt); + if not Windows.PtInRect(ApptRect, Point(X, Y)) then + Result.Appt := nil; + end; + end; + end; + + Result.DragAccept := (Result.Row > gcHdr) and (Result.Col > gcHdr); +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +{$IFDEF Jv_TIMEBLOCKS} +// ok +function TJvTFDays.PtToCell(X, Y: Integer): TJvTFDaysCoord; +var + ColNum, RowNum, AdjX, AdjY, Temp, TotalWidth, SegCount, MapCol: Integer; + Done: Boolean; + ApptRect: TRect; +begin + with Result do + begin + Col := gcUndef; + Row := gcUndef; + CellX := -100; + CellY := -100; + AbsX := X; + AbsY := Y; + Schedule := nil; + Appt := nil; + end; + + if X < CalcBlockHdrWidth then + begin + // POSSIBLE BUG!! + //Result.Row := gcGroupHdr; // WRONG CODE + Result.Col := gcGroupHdr; // UNTESTED - CORRECT CODE + Result.CellX := X; + end + //block if X < RowHdrWidth then + else + if X < CalcBlockRowHdrsWidth then + begin + Result.Col := gcHdr; + Result.CellX := X - CalcBlockHdrWidth; + end + else + if LeftCol > -1 then + begin + // Find the col that PtX falls in + ColNum := LeftCol; + //block AdjX := X - RowHdrWidth; + AdjX := X - CalcBlockRowHdrsWidth; + Done := False; + Temp := 0; + + while (ColNum < Cols.Count) and not Done do + begin + Inc(Temp, Cols[ColNum].Width); + if AdjX < Temp then + begin + Done := True; + Result.Col := ColNum; + Result.CellX := AdjX - (Temp - Cols[ColNum].Width); + end + else + Inc(ColNum); + end; + if not Done then + begin + Result.Col := Cols.Count-1; + Result.CellX := AdjX - (Temp - Cols[Cols.Count-1].Width); + end; + end; + + if Y < CalcGroupHdrHeight then + begin + Result.Row := gcGroupHdr; + Result.CellY := Y; + end + //else if Y < ColHdrHeight then + else + if Y < CalcGroupColHdrsHeight then + begin + Result.Row := gcHdr; + Result.CellY := Y - CalcGroupHdrHeight; + end + else + if TopRow > -1 then + begin + RowNum := TopRow; + //group AdjY := Y - ColHdrHeight; + AdjY := Y - CalcGroupColHdrsHeight; + Done := False; + Temp := 0; + + while (RowNum < RowCount) and not Done do + begin + Inc(Temp, RowHeight); + if AdjY < Temp then + begin + Done := True; + Result.Row := RowNum; + Result.CellY := AdjY - (Temp - RowHeight); + end + else + Inc(RowNum); + end; + if not Done then + begin + Result.Row := RowCount-1; + Result.CellY := AdjY - (Temp - RowHeight); + end; + end; + + if Result.Col > gcHdr then + begin + Result.Schedule := Cols[Result.Col].Schedule; + + // move grab handles + if PtInTopHandle(Point(X, Y), Result.Col, SelAppt) then + Result.Appt := SelAppt + else + if PtInBottomHandle(Point(X, Y), Result.Col, SelAppt) then + Result.Appt := SelAppt + else + if (Result.Row > gcHdr) and Assigned(Result.Schedule) then + begin + TotalWidth := Cols[Result.Col].Width; + SegCount := Cols[Result.Col].MapColCount(Result.Row); + if SegCount > 0 then + begin + MapCol := LocateDivCol(Result.CellX, TotalWidth, SegCount); + Result.Appt := Cols[Result.Col].MapLocation(MapCol, Result.Row); + + ApptRect := GetApptRect(Result.Col, Result.Appt); + if not PtInRect(ApptRect, Point(X, Y)) then + Result.Appt := nil; + end; + end; + end; + + Result.DragAccept := (Result.Row > gcHdr) and (Result.Col > gcHdr); +end; +{$ENDIF Jv_TIMEBLOCKS} + +{$IFNDEF Jv_TIMEBLOCKS} +// remove +{ +function TJvTFDays.CellRect(Col, Row: Integer): TRect; +Var + I: Integer; + VisGrpHdrRect: TRect; +begin + if (Row = gcGroupHdr) and (Col > gcHdr) then + begin + VisGrpHdrRect := Classes.Rect(RowHdrWidth, 0, RowHdrWidth + GetDataWidth, + CalcGroupHdrHeight); + Windows.IntersectRect(Result, VisGrpHdrRect, VirtualGroupHdrRect(Col)); + end + else + if Col < 0 then // Row hdr + if Row < 0 then + //group Result := Classes.Rect(0, 0, RowHdrWidth, ColHdrHeight) // origin cell + Result := Classes.Rect(0, 0, RowHdrWidth, CalcGroupColHdrsHeight) // origin cell + else + if (Row >= TopRow) and (Row <= BottomRow) then + // Row Hdr for visible data row + begin + Result.Left := 0; + //group Top := ColHdrHeight + (Row - TopRow) * RowHeight; + Result.Top := CalcGroupColHdrsHeight + (Row - TopRow) * RowHeight; + Result.Right := RowHdrWidth; + Result.Bottom := Result.Top + RowHeight; + end + else + // Row Hdr for non-visible data row + Result := EmptyRect + + else + if (Col >= LeftCol) and (Col <= RightCol) then // visible data col + if Row < 0 then + // Col hdr for visible data col + begin + Result.Left := RowHdrWidth; + For I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + //group Top := 0; + Result.Top := CalcGroupHdrHeight; + //group Bottom := ColHdrHeight; + Result.Bottom := CalcGroupColHdrsHeight; + end + else + if (Row >= TopRow) and (Row <= BottomRow) then + // visible data cell + begin + Result.Left := RowHdrWidth; + For I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + //group Top := ColHdrHeight + (Row - TopRow) * RowHeight; + Result.Top := CalcGroupColHdrsHeight + (Row - TopRow) * RowHeight; + Result.Bottom := Result.Top + RowHeight; + end + else + // non-visible data cell (visible col, but non-visible row) + Result := EmptyRect + + else // non-visible data col + Result := EmptyRect; +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +{$IFDEF Jv_TIMEBLOCKS} +// ok +function TJvTFDays.CellRect(Col, Row: Integer): TRect; +var + I: Integer; + VisGrpHdrRect: TRect; +begin + if (Col = gcGroupHdr) and (Row > gcHdr) then + begin + VisGrpHdrRect := Classes.Rect(0, CalcGroupColHdrsHeight, CalcBlockRowHdrsWidth, + CalcGroupColHdrsHeight + GetDataHeight); + IntersectRect(Result, VisGrpHdrRect, VirtualBlockHdrRect(Row)); + end + else + if (Row = gcGroupHdr) and (Col > gcHdr) then + begin + //block VisGrpHdrRect := Classes.Rect(RowHdrWidth, 0, RowHdrWidth + GetDataWidth, + // CalcGroupHdrHeight); + VisGrpHdrRect := Classes.Rect(CalcBlockRowHdrsWidth, 0, + CalcBlockRowHdrsWidth + GetDataWidth, CalcGroupHdrHeight); + IntersectRect(Result, VisGrpHdrRect, VirtualGroupHdrRect(Col)); + end + else + if Col < 0 then // Row hdr + if Row < 0 then + //group Result := Classes.Rect(0, 0, RowHdrWidth, ColHdrHeight) // origin cell + //block Result := Classes.Rect(0, 0, RowHdrWidth, CalcGroupColHdrsHeight) // origin cell + Result := Classes.Rect(0, 0, CalcBlockRowHdrsWidth, CalcGroupColHdrsHeight) + else + if (Row >= TopRow) and (Row <= BottomRow) then + // Row Hdr for visible data row + begin + //block Left := 0; + Result.Left := CalcBlockHdrWidth; + //group Top := ColHdrHeight + (Row - TopRow) * RowHeight; + Result.Top := CalcGroupColHdrsHeight + (Row - TopRow) * RowHeight; + //block Right := RowHdrWidth; + Result.Right := Result.Left + RowHdrWidth; + Result.Bottom := Result.Top + RowHeight; + end + else + // Row Hdr for non-visible data row + Result := EmptyRect + else + if (Col >= LeftCol) and (Col <= RightCol) then // visible data col + if Row < 0 then + // Col hdr for visible data col + begin + //block Result.Left := RowHdrWidth; + Result.Left := CalcBlockRowHdrsWidth; + for I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + //group Result.Top := 0; + Result.Top := CalcGroupHdrHeight; + //group Result.Bottom := ColHdrHeight; + Result.Bottom := CalcGroupColHdrsHeight; + end + else + if (Row >= TopRow) and (Row <= BottomRow) then + // visible data cell + begin + //block Result.Left := RowHdrWidth; + Result.Left := CalcBlockRowHdrsWidth; + for I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + //group Result.Top := ColHdrHeight + (Row - TopRow) * RowHeight; + Result.Top := CalcGroupColHdrsHeight + (Row - TopRow) * RowHeight; + Result.Bottom := Result.Top + RowHeight; + end + else + // non-visible data cell (visible col, but non-visible row) + Result := EmptyRect + + else // non-visible data col + Result := EmptyRect; +end; +{$ENDIF Jv_TIMEBLOCKS} + +{$IFNDEF Jv_TIMEBLOCKS} +// remove +{ +function TJvTFDays.VirtualCellRect(Col, Row: Integer): TRect; +Var + I: Integer; +begin + if Row = gcGroupHdr then + Result := VirtualGroupHdrRect(Col) + else + begin + if Col > -1 then + begin + Result.Left := RowHdrWidth; + // At most, only one of the following For loops will execute + // depending on whether Col is to the left or to the right of LeftCol + For I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + + For I := LeftCol - 1 downto Col do + Dec(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + end + else + begin + Result.Left := 0; + Result.Right := RowHdrWidth; + end; + + if Row > -1 then + begin + //group Result.Top := ColHdrHeight + (Row - TopRow) * RowHeight; + Result.Top := CalcGroupColHdrsHeight + (Row - TopRow) * RowHeight; + Result.Bottom := Result.Top + RowHeight; + end + else + begin + //group Result.Top := 0; + Result.Top := CalcGroupHdrHeight; + Result.Bottom := Result.Top + ColHdrHeight; + end; + end; +end; +} +{$ENDIF !Jv_TIMEBLOCKS} + +{$IFDEF Jv_TIMEBLOCKS} +// ok +function TJvTFDays.VirtualCellRect(Col, Row: Integer): TRect; +var + I: Integer; +begin + if (Col = gcGroupHdr) and (Row > gcHdr) then + Result := VirtualBlockHdrRect(Row) + else + if (Row = gcGroupHdr) and (Col > gcHdr) then + Result := VirtualGroupHdrRect(Col) + else + begin + if Col > -1 then + begin + //block Result.Left := RowHdrWidth; + Result.Left := CalcBlockRowHdrsWidth; + // At most, only one of the following For loops will execute + // depending on whether Col is to the Result.Left or to the Result.Right of LeftCol + for I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + + for I := LeftCol - 1 downto Col do + Dec(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + end + else + begin + //block Result.Left := 0; + Result.Left := CalcBlockHdrWidth; + //block Result.Right := RowHdrWidth; + Result.Right := Result.Left + RowHdrWidth; + end; + + if Row > -1 then + begin + //group Result.Top := ColHdrHeight + (Row - TopRow) * RowHeight; + Result.Top := CalcGroupColHdrsHeight + (Row - TopRow) * RowHeight; + Result.Bottom := Result.Top + RowHeight; + end + else + begin + //group Result.Top := 0; + Result.Top := CalcGroupHdrHeight; + Result.Bottom := Result.Top + ColHdrHeight; + end; + end; +end; +{$ENDIF Jv_TIMEBLOCKS} + +function TJvTFDays.GetApptRect(Col: Integer; Appt: TJvTFAppt): TRect; +var + MapCol, MapColCount, Base, MakeUp, BaseWidth, MakeUpWidth: Integer; + BaseCount, GridColWidth, ApptWidth, StartRow, EndRow: Integer; + VirtCellRect: TRect; +begin + if not Assigned(Appt) then + begin + Result := EmptyRect; + Exit; + end; + + CalcStartEndRows(Appt, Cols[Col].SchedDate, StartRow, EndRow); + + if (StartRow < 0) and (EndRow >= 0) then + StartRow := 0; + // if the above condition fails and the StartRow is STILL invalid then + // let the 'Map col not found' catch the error. + + EndRow := Lesser(EndRow, RowCount - 1); + + MapCol := Cols[Col].LocateMapCol(Appt, StartRow); + + if MapCol < 1 then + begin + //Cols[Col].DumpMap; + raise EJvTFDaysError.CreateRes(@RsEMapColNotFoundForAppointment); + end; + + MapColCount := Cols[Col].MapColCount(StartRow); + if MapColCount < 1 then + begin + //Cols[Col].FMap.Dump('corrupt dump.txt'); !!! FOR DEBUGGING ONLY !!!! + //Cols[Col].DumpMap; + raise EJvTFDaysError.CreateRes(@RsECorruptAppointmentMap); + end; + + // Col guaranteed to be partially visible + VirtCellRect := VirtualCellRect(Col, StartRow); + GridColWidth := RectWidth(VirtCellRect); + + // The Base* and MakeUp* code that follows calcs the appt width and Result.Left + // and takes into account a total width that isn't evenly divisible by + // the map col count. If there is a discrepancy then that discrepancy + // is divided up among the cols working Result.Left to Result.Right. + // + // Example: Total width = 113, col count = 5 + // col 1 = 23 + // col 2 = 23 + // col 3 = 23 + // col 4 = 22 + // col 5 = 22 + // Total = 113 + // + // As opposed to: + // width of all cols = Total div colcount = 22 + // ==> Total = 22 * 5 = 110 [110 <> 113] + Base := GridColWidth div MapColCount; + MakeUp := GridColWidth mod MapColCount; + + MakeUpWidth := Lesser(MapCol - 1, MakeUp) * (Base + 1); + BaseCount := MapCol - 1 - MakeUp; + if BaseCount > 0 then + BaseWidth := BaseCount * Base + else + BaseWidth := 0; + + ApptWidth := Base; + if MapCol <= MakeUp then + Inc(ApptWidth); + + Result.Left := VirtCellRect.Left + MakeUpWidth + BaseWidth; + Result.Right := Result.Left + ApptWidth - ApptBuffer; + Result.Top := VirtCellRect.Top; + Result.Bottom := VirtualCellRect(Col, EndRow).Bottom; +end; + +function TJvTFDays.LocateDivCol(X, TotalWidth, SegCount: Integer): Integer; +var + Base, MakeUp, ApproxSeg, MakeUpWidth: Integer; + BaseCount, BaseWidth, SegWidth, NextSegStart: Integer; +begin + if X <= 0 then + Result := 1 + else + if X >= TotalWidth then + Result := SegCount + else + begin + Base := TotalWidth div SegCount; + // Protect against div by zero + if Base < 1 then + Base := 1; + MakeUp := TotalWidth mod SegCount; + + ApproxSeg := X div Base; + + MakeUpWidth := Lesser(ApproxSeg - 1, MakeUp) * (Base + 1); + BaseCount := ApproxSeg - 1 - MakeUp; + if BaseCount > 0 then + BaseWidth := BaseCount * Base + else + BaseWidth := 0; + + SegWidth := Base; + if ApproxSeg <= MakeUp then + Inc(SegWidth); + + NextSegStart := MakeUpWidth + BaseWidth + SegWidth; + if X < NextSegStart then + Result := ApproxSeg + else + Result := ApproxSeg + 1; + end; +end; + +procedure TJvTFDays.EditAppt(Col: Integer; Appt: TJvTFAppt); +var + Schedule: TJvTFSched; + ApptRect, EditorRect: TRect; + // EditHeightThreshold, EditWidthThreshold: Integer; + FailEditor: Boolean; + PicsHeight, PicsWidth, FrameOffset: Integer; + DrawList: TList; + CanDrawText, CanDrawPics: Boolean; + DrawInfo: TJvTFDaysApptDrawInfo; + AllowEdit: Boolean; +begin + FEditor.QuickCreate := False; + EnsureCol(Col); + Schedule := Cols[Col].Schedule; + if not Assigned(Schedule) or not Assigned(Appt) or + not (agoEditing in Options) or not CanEdit then + Exit; + + AllowEdit := True; + if Assigned(FOnBeginEdit) then + FOnBeginEdit(Self, Appt, AllowEdit); + if not AllowEdit then + Exit; + + DrawInfo := TJvTFDaysApptDrawInfo.Create; + try + GetApptDrawInfo(DrawInfo, Appt, SelApptAttr); + FrameOffset := DrawInfo.FrameWidth div 2 * 2; + Canvas.Font := DrawInfo.Font; + FEditor.Font := DrawInfo.Font; + FEditor.Color := DrawInfo.Color; + finally + DrawInfo.Free; + end; + + ApptRect := GetApptRect(Col, Appt); + + InflateRect(ApptRect, -FrameOffset, -FrameOffset); + + if ApptBar.Visible then + Inc(ApptRect.Left, ApptBar.Width); + + AdjustForMargins(ApptRect); + + DrawList := TList.Create; + try + CreatePicDrawList(ApptRect, Appt, DrawList); + FilterPicDrawList(ApptRect, DrawList, PicsHeight, PicsWidth); + CanDrawWhat(Canvas, ApptRect, PicsHeight, CanDrawText, CanDrawPics); + finally + ClearPicDrawList(DrawList); + DrawList.Free; + end; + + if CanDrawPics then + Inc(ApptRect.Left, PicsHeight); + + IntersectRect(EditorRect, GetDataAreaRect, ApptRect); + +// Commented out by Tim - No longer required since no editor failure. +// EditHeightThreshold := CanvasMaxTextHeight(Canvas) * Thresholds.EditHeight; +// EditWidthThreshold := Canvas.TextWidth('Bi') div 2 * Thresholds.EditWidth; + +// Commented out by Tim - The editor should no longer ever fail. +// FailEditor := (RectHeight(EditorRect) < EditHeightThreshold) or +// (RectWidth(EditorRect) < EditWidthThreshold); + FailEditor := False; + + if FailEditor then + begin + if Assigned(FOnFailEditor) then + FOnFailEditor(Self, Col, Appt, EditorRect, FailEditor); + if not FailEditor then + FEditor.BorderStyle := bsSingle; + end + else + FEditor.BorderStyle := bsNone; + + if not FailEditor then + with FEditor do + begin + FEditor.LinkedAppt := Appt; + BoundsRect := EditorRect; + + if agoFormattedDesc in Options then + Text := Appt.Description + else + Text := StripCRLF(Appt.Description); + + Self.Update; // not calling update here increases flicker + Visible := True; + + if not (csDesigning in ComponentState) and CanFocus then + SetFocus; + SelLength := 0; + SelStart := 0; + end; +end; + +procedure TJvTFDays.FinishEditAppt; +begin + if Assigned(FEditor.LinkedAppt) then + FEditor.LinkedAppt.Description := FEditor.Text; + FEditor.Visible := False; +end; + +function TJvTFDays.Editing: Boolean; +begin + Result := (FEditor <> nil) and FEditor.Visible; +end; + +function TJvTFDays.CanEdit: Boolean; +begin + Result := agoShowText in Options; +end; + +function TJvTFDays.RowsPerHour: Integer; +begin + Result := 60 div Granularity; +end; + +function TJvTFDays.RowCount: Integer; +var + Adjustment, H, M, S, MS: Word; + WorkTime: TTime; +begin + WorkTime := GridEndTime; + + DecodeTime(WorkTime, H, M, S, MS); + Adjustment := 0; + + if (H = 0) and (M = 0) then + begin + WorkTime := EncodeTime(23, 59, 59, 999); + Adjustment := 1; + end; + + //DecodeTime(GridEndTime - GridStartTime, H, M, S, MS); + DecodeTime(WorkTime - GridStartTime, H, M, S, MS); + Result := (H * 60 + M) div Granularity + Adjustment; +end; + +function TJvTFDays.PossVisibleRows: Integer; +var + DataHt: Integer; +begin + //group DataHt := GetAdjClientRect.Bottom - ColHdrHeight; + DataHt := GetAdjClientRect.Bottom - CalcGroupColHdrsHeight; + Result := DataHt div RowHeight; + if DataHt mod RowHeight <> 0 then + Inc(Result); +end; + +function TJvTFDays.VisibleRows: Integer; +begin + Result := Lesser(PossVisibleRows, RowCount - TopRow); +end; + +function TJvTFDays.FullVisibleRows: Integer; +var + Poss, Vis: Integer; +begin + Poss := PossVisibleRows; + Vis := VisibleRows; + + if Poss = Vis then + if GetDataHeight mod RowHeight = 0 then + Result := Vis + else + Result := Vis - 1 + else + Result := Vis; +end; + +function TJvTFDays.VisibleCols: Integer; +var + DataWidth, ColNum, TempColWidths: Integer; +begin + if Cols.Count > 0 then + begin + // Calc the width of the data area + DataWidth := GetDataWidth; + + // loop through cols until sum of col widths is >= width of data area + TempColWidths := 0; + ColNum := LeftCol; + repeat + Inc(TempColWidths, Cols[ColNum].Width); + Inc(ColNum); + until (TempColWidths >= DataWidth) or (ColNum = Cols.Count); + + Result := ColNum - LeftCol; + end + else + Result := 0; +end; + +function TJvTFDays.FullVisibleCols: Integer; +var + I, lRightCol, TempWidth: Integer; +begin + // sum the widths of all visible cols + lRightCol := LeftCol + VisibleCols - 1; + TempWidth := 0; + for I := LeftCol to lRightCol do + Inc(TempWidth, Cols[I].Width); + + // if TempWidth > Data width then fully vis cols = one less the visible cols + if TempWidth <= GetDataWidth then + Result := VisibleCols + else + Result := VisibleCols - 1; +end; + +function TJvTFDays.RowToTime(RowNum: Integer): TTime; +var + TotalMins: Integer; + WorkHours, WorkMins: Word; + H, M, S, MS: Word; + Offset: Integer; +begin + EnsureRow(RowNum); + + DecodeTime(GridStartTime, H, M, S, MS); + Offset := H * 60 + M; + TotalMins := RowNum * Granularity + Offset; + + WorkHours := TotalMins div 60; + WorkMins := TotalMins mod 60; + if WorkHours < 24 then + Result := EncodeTime(WorkHours, WorkMins, 0, 0) + else + Result := EncodeTime(23, 59, 59, 999); +end; + +function TJvTFDays.TimeToRow(ATime: TTime): Integer; +var + TotalMins: Integer; + WorkHours, WorkMins, WorkSecs, WorkMSecs: Word; + H, M, S, MS: Word; + Offset: Integer; +begin + DecodeTime(ATime, WorkHours, WorkMins, WorkSecs, WorkMSecs); + + // Convert the given time to minutes + DecodeTime(GridStartTime, H, M, S, MS); + Offset := H * 60 + M; + TotalMins := WorkHours * 60 + WorkMins - Offset; + + // Find the row number by dividing the time in minutes by the granularity + Result := TotalMins div Granularity; + if (TotalMins < 0) and (TotalMins mod Granularity <> 0) then + Dec(Result); +end; + +procedure TJvTFDays.TimeToTop(ATime: TTime); +begin + TopRow := TimeToRow(ATime); +end; + +function TJvTFDays.AdjustEndTime(ATime: TTime): TTime; +begin + Result := Frac(Frac(ATime) - Frac(EncodeTime(0, 0, 1, 0))); +end; + +function TJvTFDays.RowStartsHour(RowNum: Integer): Boolean; +var + H, M, S, MS: Word; +begin + EnsureRow(RowNum); + + DecodeTime(RowToTime(RowNum), H, M, S, MS); + Result := M = 0; +end; + +function TJvTFDays.RowEndsHour(RowNum: Integer): Boolean; +var + H, M, S, MS: Word; + TempTime: TTime; +begin + EnsureRow(RowNum); + + TempTime := RowToTime(RowNum) + EncodeTime(0, Granularity - 1, 0, 0); + DecodeTime(TempTime, H, M, S, MS); + Result := M = 59; +end; + +function TJvTFDays.RowEndTime(RowNum: Integer): TTime; +begin + Result := RowToTime(RowNum) + + Granularity * EncodeTime(0, 1, 0, 0) - EncodeTime(0, 0, 1, 0); +end; + +function TJvTFDays.RowToHour(RowNum: Integer): Word; +var + H, M, S, MS: Word; +begin + DecodeTime(RowToTime(RowNum), H, M, S, MS); + Result := H; +end; + +function TJvTFDays.HourStartRow(Hour: Word): Integer; +begin + Result := TimeToRow(EncodeTime(Hour, 0, 0, 0)); +end; + +function TJvTFDays.HourEndRow(Hour: Word): Integer; +begin + Result := TimeToRow(EncodeTime(Hour, 59, 0, 0)); +end; + +function TJvTFDays.BottomRow: Integer; +begin + Result := TopRow + VisibleRows - 1; +end; + +function TJvTFDays.RightCol: Integer; +begin + Result := LeftCol + VisibleCols - 1; +end; + +procedure TJvTFDays.DragDrop(Source: TObject; X, Y: Integer); +begin + if Source is TJvTFControl then + DropAppt(TJvTFControl(Source).DragInfo, X, Y); + + inherited DragDrop(Source, X, Y); +end; + +procedure TJvTFDays.CalcStartEndRows(AAppt: TJvTFAppt; SchedDate: TDate; + var StartRow, EndRow: Integer); +begin + if Trunc(AAppt.StartDate) = Trunc(SchedDate) then + StartRow := TimeToRow(AAppt.StartTime) + else + StartRow := 0; + + if Trunc(AAppt.EndDate) = Trunc(SchedDate) then + EndRow := TimeToRow(AdjustEndTime(AAppt.EndTime)) + else + EndRow := RowCount - 1; +end; + +procedure TJvTFDays.PrevDate; +begin + case Template.ActiveTemplate of + agtLinear: + Template.LinearStartDate := Template.LinearStartDate - 1; + agtComparative: + Template.CompDate := Template.CompDate - 1; + end; +end; + +procedure TJvTFDays.NextDate; +begin + case Template.ActiveTemplate of + agtLinear: + Template.LinearStartDate := Template.LinearStartDate + 1; + agtComparative: + Template.CompDate := Template.CompDate + 1; + end; +end; + +procedure TJvTFDays.GotoDate(aDate: TDate); +begin + case Template.ActiveTemplate of + agtLinear: + Template.LinearStartDate := aDate; + agtComparative: + Template.CompDate := aDate; + end; +end; + +procedure TJvTFDays.ScrollDays(NumDays: Integer); +var + OldDate: TDate; + CanScroll: Boolean; +begin + CanScroll := True; + OldDate := Template.LinearStartDate; + case Template.ActiveTemplate of + agtLinear: + OldDate := Template.LinearStartDate; + agtComparative: + OldDate := Template.CompDate; + else + CanScroll := False; + end; + + if CanScroll then + GotoDate(OldDate + NumDays); +end; + +procedure TJvTFDays.ScrollMonths(NumMonths: Integer); +var + OldDate, EOM: TDate; + CanScroll: Boolean; + Y, M, D, EOMY, EOMM, EOMD, DeltaY, DeltaM: Word; +begin + CanScroll := True; + OldDate := Template.LinearStartDate; + case Template.ActiveTemplate of + agtLinear: OldDate := Template.LinearStartDate; + agtComparative: OldDate := Template.CompDate; + else + CanScroll := False; + end; + + if CanScroll then + begin + DecodeDate(OldDate, Y, M, D); + + DeltaY := NumMonths div 12; + DeltaM := NumMonths mod 12; + M := M + DeltaM; + if M < 1 then + begin + Dec(DeltaY); + M := 12 + M; + end + else + if M > 12 then + begin + Inc(DeltaY); + M := M - 12; + end; + + Y := Y + DeltaY; + EOM := EndOfMonth(EncodeDate(Y, M, 1)); + DecodeDate(EOM, EOMY, EOMM, EOMD); + D := Lesser(D, EOMD); + GotoDate(EncodeDate(Y, M, D)); + end; +end; + +procedure TJvTFDays.ScrollYears(NumYears: Integer); +var + OldDate, EOM: TDate; + Y, M, D, EOMY, EOMM, EOMD: Word; + CanScroll: Boolean; +begin + CanScroll := True; + OldDate := Template.LinearStartDate; + case Template.ActiveTemplate of + agtLinear: + OldDate := Template.LinearStartDate; + agtComparative: + OldDate := Template.CompDate; + else + CanScroll := False; + end; + + if CanScroll then + begin + DecodeDate(OldDate, Y, M, D); + Inc(Y, NumYears); + EOM := EndOfMonth(EncodeDate(Y, M, 1)); + DecodeDate(EOM, EOMY, EOMM, EOMD); + D := Lesser(D, EOMD); + GotoDate(EncodeDate(Y, M, D)); + end; +end; + +procedure TJvTFDays.ReleaseSchedule(const SchedName: string; SchedDate: TDate); +var + Used: Boolean; + I: Integer; + Col: TJvTFDaysCol; +begin + // Only release schedule if not used by any grid cols + Used := False; + for I := 0 to Cols.Count - 1 do + begin + Col := Cols[I]; + if (Col.SchedName = SchedName) and + (Trunc(Col.SchedDate) = Trunc(SchedDate)) and Col.Connected then + Used := True and not (csDestroying in ScheduleManager.ComponentState); + end; + + if not Used then + inherited ReleaseSchedule(SchedName, SchedDate); +end; + +procedure TJvTFDays.RowInView(ARow: Integer); +begin + EnsureRow(ARow); + + if ARow < TopRow then + TopRow := ARow + else + if ARow > TopRow + FullVisibleRows - 1 then + TopRow := Greater(ARow - FullVisibleRows + 1, 0); +end; + +procedure TJvTFDays.ColInView(ACol: Integer); +var + I, ColSizes: Integer; + DataWidth: Integer; +begin + EnsureCol(ACol); + + if ACol < LeftCol then + LeftCol := ACol + else + if ACol > RightCol then + begin + ColSizes := 0; + DataWidth := RectWidth(GetDataAreaRect); + I := ACol + 1; + while (ColSizes < DataWidth) and (I >= 0) do + begin + Dec(I); + Inc(ColSizes, Cols[I].Width); + end; + LeftCol := I + 1; + end; +end; + +function TJvTFDays.CellIsSelected(ACell: TPoint): Boolean; +var + SelSameName, SelSameDate: Boolean; + NameList: TStringList; + I, TestStart, TestEnd: Integer; + TestDate: TDate; + + function PointInDataArea(APoint: TPoint): Boolean; + begin + Result := (APoint.X > gcHdr) and (APoint.Y > gcHdr); + end; + +begin + Result := False; + if PointInDataArea(SelStart) and PointInDataArea(SelEnd) and PointInDataArea(ACell) then + begin + SelSameName := Cols[SelStart.X].SchedName = Cols[SelEnd.X].SchedName; + SelSameDate := Trunc(Cols[SelStart.X].SchedDate) = + Trunc(Cols[SelEnd.X].SchedDate); + + if SelSameName and SelSameDate then + begin + if (Cols[ACell.X].SchedName = Cols[SelStart.X].SchedName) and + (Trunc(Cols[ACell.X].SchedDate) = Trunc(Cols[SelStart.X].SchedDate)) then + Result := (ACell.Y >= SelStart.Y) and (ACell.Y <= SelEnd.Y) + end + else + if SelSameName then + begin + if Cols[ACell.X].SchedName = Cols[SelStart.X].SchedName then + begin + TestDate := Cols[ACell.X].SchedDate; + if Trunc(TestDate) = Trunc(Cols[SelStart.X].SchedDate) then + Result := ACell.Y >= SelStart.Y + else + if (Trunc(TestDate) > Trunc(Cols[SelStart.X].SchedDate)) and + (Trunc(TestDate) < Trunc(Cols[SelEnd.X].SchedDate)) then + Result := True + else + if Trunc(TestDate) = Trunc(Cols[SelEnd.X].SchedDate) then + Result := ACell.Y <= SelEnd.Y; + end + end + else + if SelSameDate then + begin + NameList := TStringList.Create; + NameList.Sorted := True; + NameList.Duplicates := dupIgnore; + + try + for I := SelStart.X to SelEnd.X do + NameList.Add(Cols[I].SchedName); + + if (NameList.IndexOf(Cols[ACell.X].SchedName) > -1) and + (Trunc(Cols[SelStart.X].SchedDate) = Trunc(Cols[ACell.X].SchedDate)) then + begin + TestStart := Lesser(SelStart.Y, SelEnd.Y); + TestEnd := Greater(SelStart.Y, SelEnd.Y); + Result := (ACell.Y >= TestStart) and (ACell.Y <= TestEnd); + end; + finally + NameList.Free; + end; + end; + end; +end; + +function TJvTFDays.ColIsSelected(ACol: Integer): Boolean; +var + SelSameName, SelSameDate: Boolean; + I: Integer; + StartCol, EndCol, TestCol: TJvTFDaysCol; +begin + Result := False; + if (SelStart.X > gcHdr) and (SelEnd.X > gcHdr) then + // Don't know if we really should be doing the follow check + //and (ACol >= SelStart.X) and (ACol <= SelEnd.X) then + begin + // Determine type of selection (case) + StartCol := Cols[SelStart.X]; + EndCol := Cols[SelEnd.X]; + TestCol := Cols[ACol]; + + SelSameName := StartCol.SchedName = EndCol.SchedName; + SelSameDate := Trunc(StartCol.SchedDate) = Trunc(EndCol.SchedDate); + + if SelSameName and SelSameDate then + Result := (TestCol.SchedName = StartCol.SchedName) and + (Trunc(TestCol.SchedDate) = Trunc(StartCol.SchedDate)) + else + if SelSameName then + Result := (TestCol.SchedName = StartCol.SchedName) and + (Trunc(TestCol.SchedDate) >= Trunc(StartCol.SchedDate)) and + (Trunc(TestCol.SchedDate) <= Trunc(EndCol.SchedDate)) + else + if SelSameDate then + if Trunc(TestCol.SchedDate) = Trunc(StartCol.SchedDate) then + begin + I := SelStart.X; + while (I <= SelEnd.X) and not Result do + if TestCol.SchedName = Cols[I].SchedName then + Result := True + else + Inc(I); + end; + end; +end; + +function TJvTFDays.RowIsSelected(ARow: Integer): Boolean; +var + SelSameName, SelSameDate: Boolean; + StartCol, EndCol: TJvTFDaysCol; +begin + Result := False; + if (SelStart.Y > gcHdr) and (SelEnd.Y > gcHdr) and + (SelStart.X > gcHdr) and (SelEnd.X > gcHdr) then + begin + StartCol := Cols[SelStart.X]; + EndCol := Cols[SelEnd.X]; + + SelSameName := StartCol.SchedName = EndCol.SchedName; + SelSameDate := Trunc(StartCol.SchedDate) = Trunc(EndCol.SchedDate); + + if (SelSameName and SelSameDate) or SelSameDate then + Result := (ARow >= SelStart.Y) and (ARow <= SelEnd.Y) + else + if SelSameName then + Result := (ARow >= SelStart.Y) or (ARow <= SelEnd.Y); + end; +end; + +procedure TJvTFDays.ClearSelection; +begin + SelStart := Point(-1, -1); +end; + +function TJvTFDays.ValidSelection: Boolean; +begin + Result := (SelStart.X > gcHdr) and (SelStart.Y > gcHdr) and + (SelEnd.X > gcHdr) and (SelEnd.Y > gcHdr); +end; + +function TJvTFDays.EnumSelCells: TDynPointArray; +var + SelSameName, SelSameDate: Boolean; + NameList: TStringList; + NextEntry, ACol, ARow: Integer; + TestDate: TDate; + + procedure AddToArray(X, Y: Integer); + begin + Result[NextEntry] := Point(X, Y); + Inc(NextEntry); + end; + + procedure BumpLength(Bump: Integer); + begin + SetLength(Result, Length(Result) + Bump); + end; + +begin + SetLength(Result, 0); + NextEntry := 0; + + // EXIT IF NOTHING SELECTED + if (SelStart.X <= gcHdr) or (SelStart.Y <= gcHdr) or + (SelEnd.X <= gcHdr) or (SelEnd.Y <= gcHdr) then + Exit; + + SelSameName := Cols[SelStart.X].SchedName = Cols[SelEnd.X].SchedName; + SelSameDate := Trunc(Cols[SelStart.X].SchedDate) = + Trunc(Cols[SelEnd.X].SchedDate); + + if SelSameName and SelSameDate then + for ACol := 0 to Cols.Count - 1 do + begin + if (Cols[ACol].SchedName = Cols[SelStart.X].SchedName) and + (Trunc(Cols[ACol].SchedDate) = Trunc(Cols[SelStart.X].SchedDate)) then + begin + BumpLength(SelEnd.Y - SelStart.Y + 1); + for ARow := SelStart.Y to SelEnd.Y do + AddToArray(ACol, ARow); + end; + end + else + if SelSameName then + // only have to go to SelEnd.X?? + // What about if two cols have same SchedName and SchedDate?? + for ACol := 0 to Cols.Count - 1 do + begin + if Cols[ACol].SchedName = Cols[SelStart.X].SchedName then + begin + TestDate := Cols[ACol].SchedDate; + + if Trunc(TestDate) = Trunc(Cols[SelStart.X].SchedDate) then + begin + BumpLength(RowCount - SelStart.Y); + for ARow := SelStart.Y to RowCount - 1 do + AddToArray(ACol, ARow); + end + else + if (Trunc(TestDate) > Trunc(Cols[SelStart.X].SchedDate)) and + (Trunc(TestDate) < Trunc(Cols[SelEnd.X].SchedDate)) then + begin + BumpLength(RowCount); + for ARow := 0 to RowCount - 1 do + AddToArray(ACol, ARow); + end + else + if Trunc(TestDate) = Trunc(Cols[SelEnd.X].SchedDate) then + begin + BumpLength(SelEnd.Y + 1); + for ARow := 0 to SelEnd.Y do + AddToArray(ACol, ARow); + end; + end; + end + else + if SelSameDate then + begin + NameList := TStringList.Create; + NameList.Sorted := True; + NameList.Duplicates := dupIgnore; + TestDate := Cols[SelStart.X].SchedDate; + + try + for ACol := SelStart.X to SelEnd.X do + NameList.Add(Cols[ACol].SchedName); + + for ACol := 0 to Cols.Count - 1 do + if (NameList.IndexOf(Cols[ACol].SchedName) > -1) and + (Trunc(Cols[ACol].SchedDate) = Trunc(TestDate)) then + begin + BumpLength(SelEnd.Y - SelStart.Y + 1); + for ARow := SelStart.Y to SelEnd.Y do + AddToArray(ACol, ARow); + end; + finally + NameList.Free; + end; + end; +end; + +function TJvTFDays.EnumSelCols: TDynIntArray; +var + SelSameName, SelSameDate: Boolean; + I: Integer; + TempList: TStringList; + StartCol, EndCol, TestCol: TJvTFDaysCol; + + procedure AddToArray(ACol: Integer); + begin + SetLength(Result, Length(Result) + 1); + Result[Length(Result) - 1] := ACol; + end; + +begin + SetLength(Result, 0); + + if (SelStart.X > gcHdr) and (SelEnd.X > gcHdr) then + begin + StartCol := Cols[SelStart.X]; + EndCol := Cols[SelEnd.X]; + + SelSameName := StartCol.SchedName = EndCol.SchedName; + SelSameDate := Trunc(StartCol.SchedDate) = Trunc(EndCol.SchedDate); + + if SelSameName and SelSameDate then + for I := 0 to Cols.Count - 1 do + begin + TestCol := Cols[I]; + if (TestCol.SchedName = StartCol.SchedName) and + (Trunc(TestCol.SchedDate) = Trunc(StartCol.SchedDate)) then + AddToArray(I); + end + else + if SelSameName then + for I := 0 to Cols.Count - 1 do + begin + TestCol := Cols[I]; + if (TestCol.SchedName = StartCol.SchedName) and + ((Trunc(TestCol.SchedDate) >= Trunc(StartCol.SchedDate)) and + (Trunc(TestCol.SchedDate) <= Trunc(EndCol.SchedDate))) then + AddToArray(I); + end + else + if SelSameDate then + begin + TempList := TStringList.Create; + TempList.Sorted := True; + TempList.Duplicates := dupIgnore; + + try + for I := SelStart.X to SelEnd.X do + TempList.Add(Cols[I].SchedName); + + for I := 0 to Cols.Count - 1 do + begin + TestCol := Cols[I]; + if (Trunc(TestCol.SchedDate) = Trunc(StartCol.SchedDate)) and + (TempList.IndexOf(TestCol.SchedName) > -1) then + AddToArray(I); + end; + finally + TempList.Free; + end; + end; + end; +end; + +function TJvTFDays.EnumSelRows: TDynIntArray; +var + SelSameName, SelSameDate: Boolean; + StartCol, EndCol: TJvTFDaysCol; + I: Integer; + + procedure AddToArray(ACol: Integer); + begin + SetLength(Result, Length(Result) + 1); + Result[Length(Result) - 1] := ACol; + end; + +begin + SetLength(Result, 0); + + if (SelStart.Y > gcHdr) and (SelEnd.Y > gcHdr) and + (SelStart.X > gcHdr) and (SelEnd.X > gcHdr) then + begin + StartCol := Cols[SelStart.X]; + EndCol := Cols[SelEnd.X]; + + SelSameName := StartCol.SchedName = EndCol.SchedName; + SelSameDate := Trunc(StartCol.SchedDate) = Trunc(EndCol.SchedDate); + + if (SelSameName and SelSameDate) or SelSameDate then + for I := SelStart.Y to SelEnd.Y do + AddToArray(I) + else + if SelSameName then + for I := 0 to RowCount - 1 do + if (I >= SelStart.Y) or (I <= SelEnd.Y) then + AddToArray(I); + end; +end; + +function TJvTFDays.GetApptDispColor(Appt: TJvTFAppt; Selected: Boolean): TColor; +begin + if Selected then + if SelApptAttr.Color = clDefault then + if Appt.Color = clDefault then + Result := ApptAttr.Color + else + Result := Appt.Color + else + Result := SelApptAttr.Color + else + if Appt.Color = clDefault then + Result := ApptAttr.Color + else + Result := Appt.Color; +end; + +procedure TJvTFDays.ReqSchedNotification(Schedule: TJvTFSched); +var + I: Integer; + Col: TJvTFDaysCol; +begin + inherited ReqSchedNotification(Schedule); + + for I := 0 to Cols.Count - 1 do + begin + Col := Cols[I]; + if (Col.SchedName = Schedule.SchedName) and + (Trunc(Col.SchedDate) = Trunc(Schedule.SchedDate)) then + Col.Connect; + end; +end; + +procedure TJvTFDays.SelFirstAppt; +var + FirstAppt: TJvTFAppt; + RefCol: Integer; +begin + RefCol := 0; + FirstAppt := nil; + + while not Assigned(FirstAppt) and (RefCol < Cols.Count) do + begin + FirstAppt := Cols[RefCol].GetFirstAppt; + Inc(RefCol); + end; + + if Assigned(FirstAppt) then + begin + SelAppt := FirstAppt; + // The actual Reference Col will be one less than RefCol coming out of + // the above loop. + ApptInView(FirstAppt, RefCol - 1); + SelApptCell(FirstAppt, RefCol - 1); + end; +end; + +procedure TJvTFDays.SelLastAppt; +var + LastAppt: TJvTFAppt; + RefCol: Integer; +begin + RefCol := Cols.Count - 1; + LastAppt := nil; + + while not Assigned(LastAppt) and (RefCol > -1) do + begin + LastAppt := Cols[RefCol].GetLastAppt; + Dec(RefCol); + end; + + if Assigned(LastAppt) then + begin + SelAppt := LastAppt; + ApptInView(LastAppt, RefCol + 1); + SelApptCell(LastAppt, RefCol + 1); + end; + +{ + if Cols.Count > 0 then + LastAppt := Cols[Cols.Count - 1].GetLastAppt; + + if not Assigned(LastAppt) and (Cols.Count > 1) then + begin + RefCol := Cols.Count - 2; + while not Assigned(LastAppt) and (RefCol >= 0) do + begin + LastAppt := Cols[RefCol].GetLastAppt; + Dec(RefCol); + end; + if Assigned(LastAppt) then + Inc(RefCol); + end; + + SelAppt := LastAppt; + ApptInView(LastAppt, RefCol); + SelApptCell(LastAppt, RefCol); +} +end; + +procedure TJvTFDays.SelNextAppt; +var + RefAppt, NextAppt: TJvTFAppt; + RefCol: Integer; +begin + RefAppt := SelAppt; + RefCol := FocusedCol; + if RefCol < 0 then + RefCol := 0; + + NextAppt := nil; + while not Assigned(NextAppt) and (RefCol < Cols.Count) do + begin + NextAppt := Cols[RefCol].GetNextAppt(RefAppt); + Inc(RefCol); + end; + + if Assigned(NextAppt) then + begin + SelAppt := NextAppt; + ApptInView(NextAppt, RefCol - 1); + SelApptCell(NextAppt, RefCol - 1); + end; + +{ + RefAppt := SelAppt; + RefCol := Greater(FocusedCol, 0); + + if Assigned(RefAppt) then + NextAppt := Cols[RefCol].GetNextAppt(RefAppt) + else + NextAppt := Cols[RefCol].GetFirstAppt; + + if not Assigned(NextAppt) then + begin + NextCol := RefCol + 1; + if NextCol = Cols.Count then + NextCol := 0; + + while not Assigned(NextAppt) and (NextCol <> RefCol) do + begin + NextAppt := Cols[NextCol].GetFirstAppt; + if not Assigned(NextAppt) then + begin + Inc(NextCol); + if NextCol = Cols.Count then + NextCol := 0; + end; + end; + RefCol := NextCol; + end; + + SelAppt := NextAppt; + ApptInView(NextAppt, RefCol); + SelApptCell(NextAppt, RefCol); +} +end; + +procedure TJvTFDays.SelPrevAppt; +var + RefAppt, PrevAppt: TJvTFAppt; + RefCol: Integer; +begin + RefAppt := SelAppt; + RefCol := FocusedCol; + if RefCol < 0 then + RefCol := Cols.Count - 1; + + PrevAppt := nil; + while not Assigned(PrevAppt) and (RefCol > -1) do + begin + PrevAppt := Cols[RefCol].GetPrevAppt(RefAppt); + Dec(RefCol); + end; + + if Assigned(PrevAppt) then + begin + SelAppt := PrevAppt; + ApptInView(PrevAppt, RefCol + 1); + SelApptCell(PrevAppt, RefCol + 1); + end; + +{ + if Assigned(RefAppt) then + PrevAppt := Cols[RefCol].GetPrevAppt(RefAppt) + else + PrevAppt := Cols[RefCol].GetFirstAppt; + + if not Assigned(PrevAppt) then + begin + PrevCol := RefCol - 1; + if PrevCol = -1 then + PrevCol := Cols.Count - 1; + + while not Assigned(PrevAppt) and (PrevCol <> RefCol) do + begin + PrevAppt := Cols[PrevCol].GetLastAppt; + if not Assigned(PrevAppt) then + begin + Dec(PrevCol); + if PrevCol = -1 then + PrevCol := Cols.Count - 1; + end; + end; + + RefCol := PrevCol; + end; + + SelAppt := PrevAppt; + ApptInView(PrevAppt, RefCol); + SelApptCell(PrevAppt, RefCol); +} +end; + +procedure TJvTFDays.ApptInView(AAppt: TJvTFAppt; ACol: Integer); +var + StartRow, EndRow: Integer; +begin + if Assigned(AAppt) and Assigned(Cols[ACol].Schedule) then + begin + CalcStartEndRows(AAppt, Cols[ACol].Schedule.SchedDate, StartRow, EndRow); + RowInView(StartRow); + ColInView(ACol); + //TopRow := StartRow; + //LeftCol := ACol; + end; +end; + +procedure TJvTFDays.SelApptCell(AAppt: TJvTFAppt; ACol: Integer); +var + StartRow, EndRow: Integer; +begin + if Assigned(AAppt) and Assigned(Cols[ACol].Schedule) and + (Cols[ACol].Schedule.ApptByID(AAppt.ID) <> nil) then + begin + CalcStartEndRows(AAppt, Cols[ACol].Schedule.SchedDate, StartRow, EndRow); + SelStart := Point(ACol, StartRow); + FocusedCol := ACol; + FocusedRow := StartRow; + end; +end; + +procedure TJvTFDays.SetGrouping(Value: TJvTFDaysGrouping); +var + CheckSB: Boolean; +begin + if Value <> FGrouping then + begin + CheckSB := (Value = grNone) or (FGrouping = grNone); + FGrouping := Value; + Cols.UpdateTitles; + if CheckSB then + begin + AlignScrollBars; + if not (csLoading in ComponentState) then + begin + CheckSBVis; + CheckSBParams; + end; + end; + Invalidate; + end; +end; + +{ +procedure TJvTFDays.SetGroupTitles; +var + I: Integer; +begin + Case Grouping of + grNone : + For I := 0 to Cols.Count - 1 do + begin + Cols[I].GroupTitle := ''; + //Cols[I].UpdateTitle; + Cols[I].UpdateTitles; + end; + grDate : + For I := 0 to Cols.Count - 1 do + begin + Cols[I].GroupTitle := FormatDateTime(DateFormat, Cols[I].SchedDate); + Cols[I].Title := Cols[I].SchedName; + end; + grResource : + For I := 0 to Cols.Count - 1 do + begin + Cols[I].GroupTitle := Cols[I].SchedName; + Cols[I].Title := FormatDateTime(DateFormat, Cols[I].SchedDate); + end; + grCustom : + For I := 0 to Cols.Count - 1 do + begin + Cols[I].GroupTitle := ''; + end; + end; +end; +} + +procedure TJvTFDays.SetTFHintProps(Value: TJvTFHintProps); +begin + FHintProps.Assign(Value); +end; + +procedure TJvTFDays.DrawDither(ACanvas: TCanvas; ARect: TRect; + Color1, Color2: TColor); +var + DitherBitmap: TBitmap; + I, J: Integer; +// TL: TPoint; +// ClipRgn: HRgn; +begin + DitherBitmap := TBitmap.Create; + try + // create dithered bitmap +// DitherBitmap.Width := RectWidth(ARect); +// DitherBitmap.Height := RectHeight(ARect); + DitherBitmap.Width := 8; + DitherBitmap.Height := 8; + for I := 0 to DitherBitmap.Width - 1 do + for J := 0 to DitherBitmap.Height - 1 do + if (I + J) mod 2 = 0 then + DitherBitmap.Canvas.Pixels[I, J] := Color1 + else + DitherBitmap.Canvas.Pixels[I, J] := Color2; + + // copy bitmap into canvas +// ClipRgn := Windows.CreateRectRgn(ARect.Left, ARect.Top, ARect.Right + 1, ARect.Bottom + 1); +// try +// Windows.SelectClipRgn(ACanvas.Handle, ClipRgn); +// TL.X := ARect.Left; +// while (TL.X <= ARect.Right) do +// begin +// TL.Y := ARect.Top; +// while (TL.Y <= ARect.Bottom) do +// begin +// Windows.BitBlt(ACanvas.Handle, TL.X, TL.Y, DitherBitmap.Width, DitherBitmap.Height, +// DitherBitmap.Canvas.Handle, 0, 0, SRCCOPY); +// TL.Y := TL.Y + DitherBitmap.Height; +// end; +// TL.X := TL.X + DitherBitmap.Width; +// end; +// finally +// Windows.SelectClipRgn(ACanvas.Handle, 0); +// Windows.DeleteObject(ClipRgn); +// end; + + ACanvas.Brush.Bitmap := DitherBitmap; + ACanvas.FillRect(ARect); + +// Windows.BitBlt(ACanvas.Handle, ARect.Left, ARect.Top, DitherBitmap.Width, DitherBitmap.Height, +// DitherBitmap.Canvas.Handle, 0, 0, SRCCOPY); + finally + DitherBitmap.Free; + end; +end; + +procedure TJvTFDays.SelFirstApptNextCol; +var + FirstAppt: TJvTFAppt; + RefCol: Integer; +begin + RefCol := FocusedCol + 1; + FirstAppt := nil; + + while not Assigned(FirstAppt) and (RefCol < Cols.Count) do + begin + FirstAppt := Cols[RefCol].GetFirstAppt; + Inc(RefCol); + end; + + if Assigned(FirstAppt) then + begin + SelAppt := FirstAppt; + // The actual Reference Col will be one less than RefCol coming out of + // the above loop. + ApptInView(FirstAppt, RefCol - 1); + SelApptCell(FirstAppt, RefCol - 1); + end; +end; + +procedure TJvTFDays.SelFirstApptPrevCol; +var + FirstAppt: TJvTFAppt; + RefCol: Integer; +begin + if Cols.Count = 0 then + Exit; + + RefCol := FocusedCol - 1; + if RefCol < 0 then + RefCol := 0; + FirstAppt := nil; + + while not Assigned(FirstAppt) and (RefCol > -1) do + begin + FirstAppt := Cols[RefCol].GetFirstAppt; + Dec(RefCol); + end; + + if Assigned(FirstAppt) then + begin + SelAppt := FirstAppt; + ApptInView(FirstAppt, RefCol + 1); + SelApptCell(FirstAppt, RefCol + 1); + end; +end; + +procedure TJvTFDays.SetGroupHdrHeight(Value: Integer); +begin + if Value > RectHeight(GetAdjClientRect) then + Value := RectHeight(GetAdjClientRect); + if Value < 0 then + Value := 0; + + if Value <> FGroupHdrHeight then + begin + FGroupHdrHeight := Value; + AlignScrollBars; + if not (csLoading in ComponentState) then + begin + CheckSBVis; + CheckSBParams; + Invalidate; + end; + end; +end; + +procedure TJvTFDays.DrawGroupHdrs(ACanvas: TCanvas); +var + CurrGroup: string; + I: Integer; +begin + if (CalcGroupHdrHeight > 0) and (Cols.Count > 0) then + begin + CurrGroup := Cols[LeftCol].GroupTitle; + DrawColGroupHdr(ACanvas, LeftCol, True); + for I := LeftCol + 1 to RightCol do + if Cols[I].GroupTitle <> CurrGroup then + begin + CurrGroup := Cols[I].GroupTitle; + DrawColGroupHdr(ACanvas, I, True); + end; + end; +end; + +function TJvTFDays.CalcGroupColHdrsHeight: Integer; +begin + Result := CalcGroupHdrHeight + ColHdrHeight; +end; + +function TJvTFDays.CalcGroupHdrHeight: Integer; +begin + if Grouping = grNone then + Result := 0 + else + Result := GroupHdrHeight; +end; + +function TJvTFDays.VirtualGroupHdrRect(Col: Integer): TRect; +var + I, GroupStartCol, GroupEndCol, GroupWidth: Integer; +begin + EnsureCol(Col); + + Result.Top := 0; + Result.Bottom := CalcGroupHdrHeight; + + GetGroupStartEndCols(Col, GroupStartCol, GroupEndCol); + GroupWidth := 0; + for I := GroupStartCol to GroupEndCol do + Inc(GroupWidth, Cols[I].Width); + + {$IFDEF Jv_TIMEBLOCKS} + // ok + Result.Left := CalcBlockRowHdrsWidth; + {$ELSE} + // remove + //Result.Left := RowHdrWidth; + {$ENDIF Jv_TIMEBLOCKS} + + // At most, only one of the following For loops will execute + // depending on whether Col is to the left or to the right of LeftCol + for I := LeftCol - 1 downto GroupStartCol do + Dec(Result.Left, Cols[I].Width); + + for I := LeftCol to GroupStartCol - 1 do + Inc(Result.Left, Cols[I].Width); + + Result.Right := Result.Left + GroupWidth; +end; + +procedure TJvTFDays.GetGroupStartEndCols(Col: Integer; + var StartCol, EndCol: Integer); +var + I: Integer; +begin + EnsureCol(Col); + + // find group start col + I := Col; + while (I >= 0) and (Cols[I].GroupTitle = Cols[Col].GroupTitle) do + begin + StartCol := I; + Dec(I); + end; + + // find group end col + I := Col; + while (I < Cols.Count) and (Cols[I].GroupTitle = Cols[Col].GroupTitle) do + begin + EndCol := I; + Inc(I); + end; +end; + +(* +procedure TJvTFDays.DrawGroupHdr(ACanvas: TCanvas; ACol: Integer); +var + ARect: TRect; + Attr: TJvTFDaysHdrAttr; +begin + ARect := VirtualGroupHdrRect(ACol); + if GroupHdrIsSelected(ACol) then + Attr := SelGroupHdrAttr + else + Attr := GroupHdrAttr; + + With ACanvas do + begin + Font.Assign(Attr.Font); + Brush.Color := Attr.Color; + FillRect(ARect); + + { + Brush.Color := clWhite; + FillRect(ARect); + Pen.Color := clBlack; + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom - 1); + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Left, ARect.Bottom - 1); + } + { + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom - 1); + LineTo(ARect.Left, ARect.Bottom - 1); + } +{ end; +end; +*) + +procedure TJvTFDays.SetGroupHdrAttr(Value: TJvTFDaysHdrAttr); +begin + FGroupHdrAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFDays.SetSelGroupHdrAttr(Value: TJvTFDaysHdrAttr); +begin + FSelGroupHdrAttr.Assign(Value); + Invalidate; +end; + +function TJvTFDays.GroupHdrIsSelected(ACol: Integer): Boolean; +var + I, GroupStartCol, GroupEndCol: Integer; +begin + GetGroupStartEndCols(ACol, GroupStartCol, GroupEndCol); + Result := False; + I := GroupStartCol; + while (I <= GroupEndCol) and not Result do + begin + if ColIsSelected(I) then + Result := True; + Inc(I); + end; +end; + +procedure TJvTFDays.DrawColGroupHdr(ACanvas: TCanvas; Index: Integer; + IsGroupHdr: Boolean); +var + ARect, TxtRect, CalcRect, TxtBounds: TRect; + Txt: string; + PTxt: PChar; + UseAttr: TJvTFDaysHdrAttr; + Flags: UINT; + TxtHt, TxtRectHt: Integer; +begin + if IsGroupHdr then + begin + ARect := VirtualGroupHdrRect(Index); + ARect.Left := Greater(ARect.Left, GetDataAreaRect.Left); + Txt := Copy(Cols[Index].GroupTitle, 1, Length(Cols[Index].GroupTitle)); + if GroupHdrIsSelected(Index) then + UseAttr := SelGroupHdrAttr + else + UseAttr := GroupHdrAttr; + end + else + begin + ARect := CellRect(Index, -1); + //Txt := Copy(Cols[Index].Title, 1, Length(Cols[Index].Title)); + Txt := Copy(Cols[Index].Title, 1, Length(Cols[Index].Title)); + if ColIsSelected(Index) then + UseAttr := SelHdrAttr + else + UseAttr := HdrAttr; + end; + + ACanvas.Brush.Color := UseAttr.Color; + ACanvas.Font.Assign(UseAttr.Font); + + Flags := DT_NOPREFIX or DT_CENTER; + case ColTitleStyle of + ctsSingleClip: + Flags := Flags or DT_SINGLELINE or DT_VCENTER; + ctsSingleEllipsis: + Flags := Flags or DT_END_ELLIPSIS or DT_SINGLELINE or DT_VCENTER; + ctsMultiClip: + Flags := Flags or DT_WORDBREAK; + ctsMultiEllipsis: + Flags := Flags or DT_END_ELLIPSIS or DT_WORDBREAK or DT_EDITCONTROL; + ctsHide: + Flags := Flags or DT_SINGLELINE or DT_VCENTER; + end; + + ACanvas.FillRect(ARect); + TxtRect := ARect; + InflateRect(TxtRect, -2, -2); + CalcRect := TxtRect; + + // Allocate length of Txt + 4 chars + // (1 char for null terminator, 3 chars for ellipsis) + // Ahh, what the hell. Allocate + dozen chars for good measure. + // (This is continuing to give me problems and I don't know why.) + //PTxt := StrAlloc((Length(Txt) + 4) * SizeOf(Char)); + PTxt := StrAlloc((Length(Txt) + 12) * SizeOf(Char)); + try + StrPCopy(PTxt, Txt); + + if (ColTitleStyle = ctsMultiClip) or (ColTitleStyle = ctsMultiEllipsis) then + begin + TxtHt := DrawText(ACanvas.Handle, PTxt, -1, CalcRect, + Flags or DT_CALCRECT); + // "reset" PTxt + StrPCopy(PTxt, Txt); + + if TxtHt < RectHeight(TxtRect) then + begin + // we need to vertically center the text + TxtRectHt := RectHeight(TxtRect); + TxtRect.Top := TxtRect.Top + RectHeight(TxtRect) div 2 - TxtHt div 2; + TxtRect.Bottom := Lesser(TxtRect.Top + TxtRectHt, TxtRect.Bottom); + end; + end + else + if ColTitleStyle = ctsHide then + begin + DrawText(ACanvas.Handle, PTxt, -1, CalcRect, Flags or DT_CALCRECT); + if RectWidth(CalcRect) > RectWidth(TxtRect) then + StrPCopy(PTxt, ''); + end + {$IFDEF Jv_TIMEBLOCKS} + // okay to leave + else + if ColTitleStyle = ctsRotated then + //DrawAngleText(ACanvas, TxtRect, UseAttr.TitleRotation, Txt); + DrawAngleText(ACanvas, TxtRect, TxtBounds, UseAttr.TitleRotation, + taCenter, vaCenter, Txt); + {$ELSE} + // remove + //; // semi-colon needed to terminate last end + {$ENDIF Jv_TIMEBLOCKS} + + {$IFDEF Jv_TIMEBLOCKS} + // okay to leave + if ColTitleStyle <> ctsRotated then + DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + {$ELSE} + // remove + //Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + {$ENDIF Jv_TIMEBLOCKS} + finally + StrDispose(PTxt); + end; + + if not IsGroupHdr and (Index = FocusedCol) and Focused then + begin + CalcRect := ARect; + InflateRect(CalcRect, -2, -2); + ManualFocusRect(ACanvas, CalcRect); + { + if Windows.IsRectEmpty(TxtRect) then + Windows.InflateRect(TxtRect, 5, 5); + ManualFocusRect(ACanvas, TxtRect); + } + end; + + {$IFDEF Jv_TIMEBLOCKS} + // okay to leave + DrawFrame(ACanvas, ARect, UseAttr.Frame3D, UseAttr.FrameColor); + {$ELSE} + // remove + //DrawFrame(ACanvas, ARect, UseAttr.Frame3D); + {$ENDIF Jv_TIMEBLOCKS} + + if IsGroupHdr then + begin + if Assigned(FOnDrawGroupHdr) then + FOnDrawGroupHdr(Self, ACanvas, ARect, Index, GroupHdrIsSelected(Index)); + end + else + if Assigned(FOnDrawColHdr) then + FOnDrawColHdr(Self, ACanvas, ARect, Index, ColIsSelected(Index)); +end; + +{$IFDEF Jv_TIMEBLOCKS} +// ok + +procedure TJvTFDays.SetTimeBlocks(Value: TJvTFDaysTimeBlocks); +begin + FTimeBlocks.Assign(Value); +end; + +procedure TJvTFDays.SetTimeBlockProps(Value: TJvTFDaysBlockProps); +begin + FTimeBlockProps.Assign(Value); +end; + +procedure TJvTFDays.SetWeekend(Value: TTFDaysOfWeek); +begin + if Value <> FWeekend then + begin + FWeekend := Value; + Invalidate; + end; +end; + +procedure TJvTFDays.SetWeekendColor(Value: TColor); +begin + if Value <> FWeekendColor then + begin + FWeekendColor := Value; + UpdateWeekendFillPic; + Invalidate; + end; +end; + +procedure TJvTFDays.UpdateWeekendFillPic; +begin + FWeekendFillPic.Canvas.Brush.Color := WeekendColor; + FWeekendFillPic.Canvas.FillRect(Classes.Rect(0, 0, FWeekendFillPic.Width, + FWeekendFillPic.Height)); +end; + +procedure TJvTFDays.DrawBlockHdr(ACanvas: TCanvas; BlockIndex: Integer); +var + ARect, HdrPicRect, TxtBounds: TRect; + StartRow, EndRow: Integer; + ClipIt: Boolean; + Attr: TJvTFDaysHdrAttr; + TimeBlock: TJvTFDaysTimeBlock; + HdrPic: TBitmap; +begin + TimeBlock := TimeBlocks[BlockIndex]; + GetTimeBlockStartEnd(BlockIndex, StartRow, EndRow); + //ARect := VirtualBlockHdrRect(StartRow); + ARect := CellRect(gcGroupHdr, StartRow); + HdrPicRect := VirtualBlockHdrRect(StartRow); + ClipIt := HdrPicRect.Top < ARect.Top; + + OffsetRect(HdrPicRect, -HdrPicRect.Left, -HdrPicRect.Top); + + HdrPic := TBitmap.Create; + try + HdrPic.Width := RectWidth(HdrPicRect); + HdrPic.Height := RectHeight(HdrPicRect); + + if BlockHdrIsSelected(StartRow) then + Attr := TimeBlockProps.SelBlockHdrAttr + else + Attr := TimeBlockProps.BlockHdrAttr; + + //With ACanvas do + with HdrPic.Canvas do + begin + Brush.Color := Attr.Color; + FillRect(HdrPicRect); + + Font.Assign(Attr.Font); + //DrawAngleText(HdrPic.Canvas, HdrPicRect, Attr.TitleRotation, + //TimeBlock.Title); + DrawAngleText(HdrPic.Canvas, HdrPicRect, TxtBounds, Attr.TitleRotation, + taCenter, vaCenter, TimeBlock.Title); + + if Attr.Frame3D then + DrawFrame(HdrPic.Canvas, HdrPicRect, True, Attr.FrameColor) + else + begin + Pen.Color := Attr.FrameColor; + MoveTo(HdrPicRect.Right - 1, HdrPicRect.Top); + LineTo(HdrPicRect.Right - 1, HdrPicRect.Bottom); + MoveTo(HdrPicRect.Left, HdrPicRect.Bottom - 1); + LineTo(HdrPicRect.Right, HdrPicRect.Bottom - 1); + end; + end; + + if ClipIt then + HdrPicRect.Top := HdrPicRect.Bottom - RectHeight(ARect); + + BitBlt(ACanvas.Handle, ARect.Left, ARect.Top, RectWidth(ARect), + RectHeight(ARect), HdrPic.Canvas.Handle, 0, HdrPicRect.Top, SRCCOPY); + finally + HdrPic.Free; + end; +end; + +procedure TJvTFDays.FillBlockHdrDeadSpace(ACanvas: TCanvas); +var + ARect: TRect; + StartRow, EndRow: Integer; + + procedure FillIt; + begin + with ACanvas do + begin + //Brush.Color := TimeBlockProps.BlockHdrAttr.Color; + Brush.Color := TimeBlockProps.OffTimeColor; + FillRect(ARect); + + Pen.Color := TimeBlockProps.BlockHdrAttr.FrameColor; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + end; + end; + +begin + if TimeBlocks.Count = 0 then + Exit; + + ARect.Left := 0; + ARect.Right := CalcBlockHdrWidth; + + GetTimeBlockStartEnd(0, StartRow, EndRow); + if StartRow > TopRow then + begin + ARect.Top := CalcGroupColHdrsHeight; + ARect.Bottom := Lesser(VirtualBlockHdrRect(StartRow).Top, + GetDataAreaRect.Bottom); + FillIt; + end; + + GetTimeBlockStartEnd(TimeBlocks.Count - 1, StartRow, EndRow); + if EndRow < BottomRow then + begin + ARect.Top := Greater(VirtualBlockHdrRect(EndRow).Bottom, + GetDataAreaRect.Top); + ARect.Bottom := GetDataAreaRect.Bottom; + FillIt; + end; +end; + +////////////////////////////////////////////////////////////////// +// Credit for the CalcTextPos routine goes to Joerg Lingner. // +// It comes from his JLLabel component (freeware - Torry's). // +// It is used here with his permission. Thanks Joerg! // +// He can be reached at jlingner att t-online dott de // +////////////////////////////////////////////////////////////////// +{ +procedure TJvTFDays.CalcTextPos(var ARect: TRect; aAngle: Integer; + aTxt: string); +//========================================================================== +// Calculate text pos. depend. on: Font, Escapement, Alignment and length +//-------------------------------------------------------------------------- +var + DC : HDC; + hSavFont: HFont; + Size : TSize; + x,y : Integer; + cStr : array [0..255] of Char; + SaveRect: TRect; +begin + aAngle := aAngle div 10; + SaveRect := ARect; + + StrPCopy(cStr, aTxt); + DC := GetDC(HWND_DESKTOP); + hSavFont := SelectObject(DC, Font.Handle); + GetTextExtentPoint32(DC, cStr, Length(aTxt), Size); + SelectObject(DC, hSavFont); + ReleaseDC(HWND_DESKTOP, DC); + + x := 0; + y := 0; + + if aAngle<=90 then + begin // 1.Quadrant + x := 0; + y := Trunc(Size.cx * sin(aAngle*Pi/180)); + end + else + if aAngle<=180 then + begin // 2.Quadrant + x := Trunc(Size.cx * -cos(aAngle*Pi/180)); + y := Trunc(Size.cx * sin(aAngle*Pi/180) + Size.cy * cos((180-aAngle)*Pi/180)); + end + else + if aAngle<=270 then + begin // 3.Quadrant + x := Trunc(Size.cx * -cos(aAngle*Pi/180) + Size.cy * sin((aAngle-180)*Pi/180)); + y := Trunc(Size.cy * sin((270-aAngle)*Pi/180)); + end + else + if aAngle<=360 then + begin // 4.Quadrant + x := Trunc(Size.cy * sin((360-aAngle)*Pi/180)); + y := 0; + end; + ARect.Top := ARect.Top + y; + ARect.Left := ARect.Left + x; + + x := Abs(Trunc(Size.cx * cos(aAngle*Pi/180))) + Abs(Trunc(Size.cy * sin(aAngle*Pi/180))); + y := Abs(Trunc(Size.cx * sin(aAngle*Pi/180))) + Abs(Trunc(Size.cy * cos(aAngle*Pi/180))); + + //Mike: + ARect.Left := ARect.Left + ((RectWidth(SaveRect) - X) div 2); // align center + //ARect.Left := ARect.Left + RectWidth(SaveRect) - X; // align right + ARect.Top := ARect.Top + ((RectHeight(SaveRect) - Y) div 2); // align center + //ARect.Top := ARect.Top + RectHeight(SaveRect) - Y; // align bottom +end; +} + +{ +procedure TJvTFDays.DrawAngleText(ACanvas: TCanvas; ARect: TRect; + aAngle: Integer; aTxt: string); +var + LogFont: TLogFont; + TxtRect: TRect; + Flags: UINT; + PTxt: PChar; + ClipRgn: HRgn; +begin + TxtRect := ARect; + CalcTextPos(TxtRect, aAngle, aTxt); + + Windows.GetObject(ACanvas.Font.Handle, SizeOf(LogFont), @LogFont); + LogFont.lfEscapement := aAngle; + LogFont.lfOrientation := LogFont.lfEscapement; + ACanvas.Font.Handle := CreateFontIndirect(LogFont); + + Flags := DT_NOPREFIX or DT_LEFT or DT_TOP or DT_NOCLIP or DT_SINGLELINE; + + PTxt := StrAlloc((Length(aTxt) + 4) * SizeOf(Char)); + StrPCopy(PTxt, aTxt); + + ClipRgn := Windows.CreateRectRgn(ARect.Left, ARect.Top, + ARect.Right, ARect.Bottom); + Windows.SelectClipRgn(ACanvas.Handle, ClipRgn); + + Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + + Windows.SelectClipRgn(ACanvas.Handle, 0); + Windows.DeleteObject(ClipRgn); + StrDispose(PTxt); + ACanvas.Font.Handle := 0; +end; +} + +procedure TJvTFDays.EnsureBlockRules(GridGran, BlockGran: Integer; + DayStart: TTime); +var + GridHrs, GridMins, BlockHrs, BlockMins, S, MS: Word; + RowStartTime: TTime; +begin + if TimeBlocks.Count > 0 then + begin + if GridGran > BlockGran then + raise EJvTFBlockGranError.CreateRes(@RsEGridGranularityCannotBeGreater); + + if (BlockGran mod GridGran) <> 0 then + raise EJvTFBlockGranError.CreateRes(@RsETimeBlockGranularityMustBeEvenly); + + DecodeTime(DayStart, BlockHrs, BlockMins, S, MS); + RowStartTime := RowToTime(TimeToRow(DayStart)); + DecodeTime(RowStartTime, GridHrs, GridMins, S, MS); + if (BlockHrs <> GridHrs) or (BlockMins <> GridMins) then + raise EJvTFBlockGranError.CreateRes(@RsETimeBlocksMustBeginExactlyOn); + end; +end; + +function TJvTFDays.ValidateBlockRules(GridGran, BlockGran: Integer; + DayStart: TTime): Boolean; +var + GridHrs, GridMins, BlockHrs, BlockMins, S, MS: Word; + RowStartTime: TTime; +begin + Result := True; + if TimeBlocks.Count > 0 then + begin + if GridGran > BlockGran then + Result := False; + + if (BlockGran mod GridGran) <> 0 then + Result := False; + + DecodeTime(DayStart, BlockHrs, BlockMins, S, MS); + RowStartTime := RowToTime(TimeToRow(DayStart)); + DecodeTime(RowStartTime, GridHrs, GridMins, S, MS); + if (BlockHrs <> GridHrs) or (BlockMins <> GridMins) then + Result := False; + end; +end; + +function TJvTFDays.RowToTimeBlock(ARow: Integer): Integer; +var + I, BlockStart, BlockEnd: Integer; +begin + Result := -1; + if TimeBlocks.Count = 0 then + Exit; + + I := 0; + repeat + GetTimeBlockStartEnd(I, BlockStart, BlockEnd); + if (BlockStart <= ARow) and (ARow <= BlockEnd) then + Result := I; + Inc(I); + until (I = TimeBlocks.Count) or (Result <> -1); +end; + +procedure TJvTFDays.GetTimeBlockStartEnd(ATimeBlock: Integer; + var BlockStart, BlockEnd: Integer); +var + I: Integer; +begin + if ATimeBlock < 0 then + begin + BlockStart := -1; + BlockEnd := -1; + Exit; + end; + + BlockStart := TimeToRow(TimeBlockProps.DayStart); + I := 0; + while (I < ATimeBlock) do + begin + //Inc(BlockStart, TimeBlocks[I].Length); + Inc(BlockStart, TimeBlocks[I].GridLength); + Inc(I); + end; + //BlockEnd := BlockStart + TimeBlocks[ATimeBlock].Length - 1; + BlockEnd := BlockStart + TimeBlocks[ATimeBlock].GridLength - 1; +end; + +function TJvTFDays.CalcBlockHdrWidth: Integer; +begin + if TimeBlocks.Count > 0 then + Result := TimeBlockProps.BlockHdrWidth + else + Result := 0; +end; + +function TJvTFDays.CalcBlockRowHdrsWidth: Integer; +begin + Result := CalcBlockHdrWidth + RowHdrWidth; +end; + +procedure TJvTFDays.GetBlockStartEndRows(Row: Integer; + var StartRow, EndRow: Integer); +begin + GetTimeBlockStartEnd(RowToTimeBlock(Row), StartRow, EndRow); +end; + +function TJvTFDays.VirtualBlockHdrRect(Row: Integer): TRect; +var + BlockStartRow, BlockEndRow, BlockHeight: Integer; +begin + EnsureRow(Row); + + Result.Left := 0; + Result.Right := CalcBlockHdrWidth; + + GetBlockStartEndRows(Row, BlockStartRow, BlockEndRow); + BlockHeight := (BlockEndRow - BlockStartRow + 1) * RowHeight; + + Result.Top := CalcGroupColHdrsHeight + ((BlockStartRow - TopRow) * RowHeight); + Result.Bottom := Result.Top + BlockHeight; +end; + +function TJvTFDays.IsWeekend(ColIndex: Integer): Boolean; +begin + Result := BorlToDOW(DayOfWeek(Cols[ColIndex].SchedDate)) in Weekend; +end; + +function TJvTFDays.BlockHdrIsSelected(ARow: Integer): Boolean; +var + I, StartRow, EndRow: Integer; +begin + GetBlockStartEndRows(ARow, StartRow, EndRow); + Result := False; + I := StartRow; + while (I <= EndRow) and not Result do + begin + if RowIsSelected(I) then + Result := True; + Inc(I); + end; +end; + +procedure TJvTFDays.DrawFrame(ACanvas: TCanvas; ARect: TRect; Draw3D: Boolean; + FrameColour: TColor); +var + OldPenColor: TColor; +begin + with ACanvas, ARect do + begin + OldPenColor := Pen.Color; + + if Draw3D then + Pen.Color := clBtnShadow + else + Pen.Color := FrameColour; + + MoveTo(Right - 1, Top); + LineTo(Right - 1, Bottom); + MoveTo(Left, Bottom - 1); + LineTo(Right, Bottom - 1); + + if Draw3D then + begin + Pen.Color := clBtnHighlight; + MoveTo(Left, Top); + LineTo(Right, Top); + MoveTo(Left, Top); + LineTo(Left, Bottom); + end; + + Pen.Color := OldPenColor; + end; +end; + +{$ENDIF Jv_TIMEBLOCKS} + +procedure TJvTFDays.SetGridEndTime(Value: TTime); +var + I, NewTopRow: Integer; + TopTime: TTime; + WorkEnd: TTime; + H, M, S, MS: Word; +begin + WorkEnd := Value; + DecodeTime(WorkEnd, H, M, S, MS); + if (H = 0) and (M = 0) then + WorkEnd := EncodeTime(23, 59, 59, 999); + + if not (csLoading in ComponentState) and (WorkEnd <= GridStartTime) then + raise EJvTFDaysError.CreateRes(@RsEGridEndTimeCannotBePriorToGridStart); + + TopTime := RowToTime(TopRow); + FGridEndTime := Value; + + ClearSelection; + if not (csLoading in ComponentState) then + begin + for I := 0 to Cols.Count - 1 do + Cols[I].RefreshMap; + //TopRow := TimeToRow(TopTime); + + if RowCount <= PossVisibleRows then + TopRow := 0 + else + begin + if TopTime < GridStartTime then + NewTopRow := 0 + else + NewTopRow := TimeToRow(TopTime); + TopRow := Lesser(NewTopRow, RowCount - 1 - VisibleRows + 1); + end; + + CheckSBVis; + CheckSBParams; + Invalidate; + end; +end; + +procedure TJvTFDays.SetGridStartTime(Value: TTime); +var + I, NewTopRow: Integer; + TopTime: TTime; + WorkEnd: TTime; + H, M, S, MS: Word; +begin + WorkEnd := GridEndTime; + DecodeTime(WorkEnd, H, M, S, MS); + if (H = 0) and (M = 0) then + WorkEnd := EncodeTime(23, 59, 59, 999); + + if not (csLoading in ComponentState) and (Value >= WorkEnd) then + raise EJvTFDaysError.CreateRes(@RsEGridStartTimeCannotBeAfterGridEndTi); + + TopTime := RowToTime(TopRow); + FGridStartTime := Value; + + ClearSelection; + if not (csLoading in ComponentState) then + begin + for I := 0 to Cols.Count - 1 do + Cols[I].RefreshMap; + //TopRow := TimeToRow(TopTime); + + if RowCount <= PossVisibleRows then + TopRow := 0 + else + begin + if TopTime < GridStartTime then + NewTopRow := 0 + else + NewTopRow := TimeToRow(TopTime); + TopRow := Lesser(NewTopRow, RowCount - 1 - VisibleRows + 1); + end; + + CheckSBVis; + CheckSBParams; + Invalidate; + end; +end; + +procedure TJvTFDays.WMTimer(var Msg: TLMTimer); +var + I, TempWidth: Integer; + PtInfo: TJvTFDaysCoord; + OldTopRow, OldLeftCol: Integer; + X, Y: Integer; +begin + if Cols.Count = 0 then + Exit; + + OldTopRow := TopRow; + OldLeftCol := LeftCol; + + case FAutoScrollDir of + asdUp: + TopRow := Greater(TopRow - 1, 0); + asdDown: + TopRow := Lesser(TopRow + 1, RowCount - FullVisibleRows); + asdLeft: + LeftCol := Greater(LeftCol - 1, 0); + asdRight: + begin + TempWidth := 0; + for I := LeftCol to Cols.Count - 1 do + Inc(TempWidth, Cols[I].Width); + if TempWidth > GetDataWidth then + LeftCol := LeftCol + 1; + end; + end; + + if (FAutoScrollDir <> asdNowhere) and + ((TopRow <> OldTopRow) or (LeftCol <> OldLeftCol)) then + begin + X := FMouseMovePt.X; + Y := FMouseMovePt.Y; + + if State <> agsMoveAppt then + MouseMove(FMouseMoveState, X, Y); + + Update; + + PtInfo := PtToCell(FMouseMovePt.X, FMouseMovePt.Y); + + if Y >= GetDataAreaRect.Bottom then + PtInfo.Row := Lesser(BottomRow + 1, RowCount - 1); + + if State = agsSizeAppt then + begin + DrawDrag(PtInfo, nil, False); + ContinueDragging(PtInfo, nil); + end + else + if State = agsMoveAppt then + begin + DrawDrag(PtInfo, FDragInfo.Appt, False); + FDraggingCoord.Row := PtInfo.Row; + end; + end; +end; + +procedure TJvTFDays.KillAutoScrollTimer; +begin + if FLiveTimer then + begin + FLiveTimer := False; + KillTimer(Handle, 1); + end; +end; + +procedure TJvTFDays.Navigate(AControl: TJvTFControl; + SchedNames: TStringList; Dates: TJvTFDateList); +var + I, J: Integer; + ACol: TJvTFDaysCol; +begin + inherited Navigate(AControl, SchedNames, Dates); + + if not Template.IgnoreNav and (Dates.Count > 0) then + case Template.ActiveTemplate of + agtLinear: + Template.LinearStartDate := Dates[0]; + agtComparative: + Template.CompDate := Dates[0]; + agtNone: + begin + Cols.BeginUpdate; + try + Cols.Clear; + if Grouping = grDate then + for I := 0 to Dates.Count - 1 do + for J := 0 to SchedNames.Count - 1 do + begin + ACol := Cols.Add; + ACol.SchedName := SchedNames[J]; + ACol.SchedDate := Dates[I]; + end + else + for I := 0 to SchedNames.Count - 1 do + for J := 0 to Dates.Count - 1 do + begin + ACol := Cols.Add; + ACol.SchedName := SchedNames[I]; + ACol.SchedDate := Dates[J]; + end; + finally + Cols.EndUpdate; + end; + end; + end; +end; + +{ +procedure TJvTFDays.ReorderCols; +var + NewList: TStringList; + I, Slot: Integer; + ColToAdd: TJvTFDaysCol; + + function SortCompare: Boolean; + var + CurrCol: TJvTFDaysCol; + begin + CurrCol := TJvTFDaysCol(NewList.Objects[Slot]); + if Grouping = grDate then + Result := Trunc(CurrCol.SchedDate) > Trunc(ColToAdd.SchedDate) + else + if Grouping = grResource then + Result := CurrCol.SchedName > ColToAdd.SchedName + else + Result := True; + end; + +begin + NewList := TStringList.Create; + Try + For I := 0 to Cols.Count - 1 do + begin + ColToAdd := Cols[I]; + + Slot := 0; + while (Slot < NewList.Count) and not SortCompare do + Inc(Slot); + + NewList.InsertObject(Slot, '', ColToAdd); + end; + + For I := 0 to NewList.Count - 1 do + TJvTFDaysCol(NewList.Objects[I]).Index := I; + Finally + NewList.Free; + end; +end; +} + +//procedure TJvTFDays.DoNavigate; +//var +// SchedNameList: TStringList; +// DateList: TJvTFDateList; +// I, +// SMIndex: Integer; +// ACol: TJvTFDaysCol; +//begin +// if not Assigned(Navigator) then +// Exit; +// +// SchedNameList := TStringList.Create; +// DateList := TJvTFDateList.Create; +// try +// for I := 0 to Cols.Count - 1 do +// begin +// ACol := Cols[I]; +// if ColIsSelected(I) then +// begin +// SMIndex := SchedNameList.IndexOf(ACol.SchedName); +// if SMIndex = -1 then +// SchedNameList.Add(ACol.SchedName); +// DateList.Add(ACol.SchedDate); +// end; +// end; +// +// Navigator.Navigate(Self, SchedNameList, DateList); +// finally +// SchedNameList.Free; +// DateList.Free; +// end; +//end; + +function TJvTFDays.GetTFHintClass: TJvTFHintClass; +begin + Result := TJvTFHint; +end; + +procedure TJvTFDays.DoApptHint(GridCoord: TJvTFDaysCoord); +var + ApptRect, VisApptRect: TRect; +begin + if Assigned(GridCoord.Appt) and not Editing and (agoShowApptHints in Options) then + begin + ApptRect := GetApptRect(GridCoord.Col, GridCoord.Appt); + IntersectRect(VisApptRect, ApptRect, GetDataAreaRect); + FHint.ApptHint(GridCoord.Appt, VisApptRect.Left + 2, + VisApptRect.Bottom + 2, True, True, + agoFormattedDesc in Options); + end; +end; + +procedure TJvTFDays.DoCellHint(GridCoord: TJvTFDaysCoord); +var + ColHdrRect: TRect; + HintText: string; +begin + if csDesigning in ComponentState then + Exit; + + if (GridCoord.Row = -1) and (GridCoord.Col > -1) and (agoShowColHdrHints in Options) then + HintText := Cols[GridCoord.Col].Title + else + HintText := ''; + + ColHdrRect := CellRect(GridCoord.Col, GridCoord.Row); + FHint.CellHint(GridCoord.Row, GridCoord.Col, HintText, ColHdrRect); +end; + +procedure TJvTFDays.GetApptDrawInfo(DrawInfo: TJvTFDaysApptDrawInfo; + AAppt: TJvTFAppt; Attr: TJvTFDaysApptAttr); +begin + DrawInfo.Color := GetApptDispColor(AAppt, AAppt = SelAppt); + DrawInfo.FrameColor := Attr.FrameColor; + DrawInfo.FrameWidth := Attr.FrameWidth; + DrawInfo.Font := Attr.Font; + DrawInfo.Visible := True; + + if Assigned(FOnGetApptDrawInfo) then + FOnGetApptDrawInfo(Self, AAppt, DrawInfo); +end; + +// move grab handles +//function TJvTFDays.GetBottomGrabHandleRect(Col: Integer; Appt: TJvTFAppt): TRect; +//begin +// Result := Classes.Rect(0, 0, 0, 0); +// if (Col = FocusedCol) and (Col > gcHdr) and Assigned(Appt) and +// Cols[Col].ApptInCol(Appt) then +// begin +// Result := GetApptRect(Col, Appt); +// Result.Top := Result.Bottom - GrabHandles.Height; +// Windows.OffsetRect(Result, 0, GrabHandles.Height); +// end; +//end; +// +//// move grab handles +//function TJvTFDays.GetTopGrabHandleRect(Col: Integer; Appt: TJvTFAppt): TRect; +//begin +// Result := Classes.Rect(0, 0, 0, 0); +// if (Col = FocusedCol) and (Col > gcHdr) and Assigned(Appt) and +// Cols[Col].ApptInCol(Appt) then +// begin +// Result := GetApptRect(Col, Appt); +// Result.Bottom := Result.Top + GrabHandles.Height; +// Windows.OffsetRect(Result, 0, -GrabHandles.Height); +// end; +//end; + +// move grab handles + +function TJvTFDays.GetBottomGrabHandleRect(Col: Integer; Appt: TJvTFAppt): TRect; +begin + Result := Classes.Rect(0, 0, 0, 0); +// if (Col = FocusedCol) and (Col > gcHdr) and Assigned(Appt) and + if (Col > gcHdr) and Assigned(Appt) and Cols[Col].ApptInCol(Appt) then + begin + Result := GetApptRect(Col, Appt); + Result.Top := Result.Bottom - GrabHandles.Height; + OffsetRect(Result, 0, GrabHandles.Height); + end; +end; + +// move grab handles + +function TJvTFDays.GetTopGrabHandleRect(Col: Integer; Appt: TJvTFAppt): TRect; +begin + Result := Classes.Rect(0, 0, 0, 0); +// if (Col = FocusedCol) and (Col > gcHdr) and Assigned(Appt) and + if (Col > gcHdr) and Assigned(Appt) and Cols[Col].ApptInCol(Appt) then + begin + Result := GetApptRect(Col, Appt); + Result.Bottom := Result.Top + GrabHandles.Height; + OffsetRect(Result, 0, -GrabHandles.Height); + end; +end; + +function TJvTFDays.PtInBottomHandle(APoint: TPoint; Col: Integer; + Appt: TJvTFAppt): Boolean; +var + HandleRect: TRect; +begin + Result := False; + // move grab handles + if Assigned(Appt) and Cols[Col].ApptInCol(Appt) then + begin + HandleRect := GetBottomGrabHandleRect(Col, Appt); + Result := PtInRect(HandleRect, APoint) and + (agoSizeAppt in Options); + end; +end; + +function TJvTFDays.PtInTopHandle(APoint: TPoint; Col: Integer; + Appt: TJvTFAppt): Boolean; +var + HandleRect: TRect; +begin + Result := False; + // move grab handles + if Assigned(Appt) and Cols[Col].ApptInCol(Appt) then + begin + HandleRect := GetTopGrabHandleRect(Col, Appt); + Result := PtInRect(HandleRect, APoint) and + (agoMoveAppt in Options); + end; +end; + +procedure TJvTFDays.SetDitheredBackground(const Value: Boolean); +begin + FDitheredBackground := Value; + Refresh; +end; + +procedure TJvTFDays.SetShowFocus(const Value: Boolean); +begin + if FShowFocus <> Value then + begin + FShowFocus := Value; + Invalidate; + end; +end; + +class function TJvTFDays.GetControlClassDefaultSize: TSize; +begin + Result.CX := 500; + Result.CY := 300; +end; + + +//=== { TJvTFDaysPrinter } =================================================== + +constructor TJvTFDaysPrinter.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + + FGroupHdrHeight := 25; + + FPageInfoList := TStringList.Create; + FApptAttr := TJvTFDaysApptAttr.Create(nil); + FApptBar := TJvTFDaysApptBar.Create(nil); + FCols := TJvTFDaysCols.CreateForPrinter(Self); + FFancyRowHdrAttr := TJvTFDaysFancyRowHdrAttr.Create(nil); + FHdrAttr := TJvTFDaysHdrAttr.Create(nil); + FGroupHdrAttr := TJvTFDaysHdrAttr.Create(nil); + FPrimeTime := TJvTFDaysPrimeTime.Create(nil); + FThresholds := TJvTFDaysThresholds.Create(nil); +end; + +destructor TJvTFDaysPrinter.Destroy; +begin + FCols.Free; + FApptAttr.Free; + FApptBar.Free; + FFancyRowHdrAttr.Free; + FHdrAttr.Free; + FGroupHdrAttr.Free; + FPrimeTime.Free; + FThresholds.Free; + + // ClearPageInfo *MUST* be called here. FreeDoc will not call ClearPageInfo + // since we are freeing FPageInfoList here and the inherited Destroy calls + // FreeDoc. (That call to FreeDoc would call ClearPageInfo AFTER + // FPageInfoList has been destroyed.) + ClearPageInfo; + FPageInfoList.Free; + FPageInfoList := nil; + + inherited Destroy; +end; + +function TJvTFDaysPrinter.AdjustEndTime(ATime: TTime): TTime; +begin + Result := Frac(Frac(ATime) - Frac(EncodeTime(0, 0, 1, 0))); +end; + +procedure TJvTFDaysPrinter.CalcPageColInfo(ShowRowHdrs: Boolean; + var CalcColsPerPage, CalcColWidth: Integer); +var + DataWidth, TargetColsPerPage: Integer; +begin + // Calculate the cols per page + if DaysPageLayout.ColsPerPage = 0 then + TargetColsPerPage := Cols.Count + else + TargetColsPerPage := DaysPageLayout.ColsPerPage; + + DataWidth := GetDataWidth(ShowRowHdrs); + if TargetColsPerPage > 0 then + begin + CalcColWidth := DataWidth div TargetColsPerPage; + CalcColWidth := Greater(CalcColWidth, MinColWidth); + CalcColsPerPage := DataWidth div CalcColWidth; + end + else + begin + CalcColsPerPage := 1; + CalcColWidth := DataWidth; + end; +end; + +procedure TJvTFDaysPrinter.CalcPageInfo; +var + Segments: TStringList; + lPageInfo, SegmentInfo: TJvTFDaysPageInfo; + WorkRowHeight, WorkRowsPerPage, WorkColWidth, WorkColsPerPage: Integer; + CurrRow, CurrCol, I, WorkEndCol: Integer; + WorkShowRowHdr: Boolean; +begin + // ALL MEASUREMENTS ARE ASSUMED TO BE IN PIXELS !! + ClearPageInfo; + + // Calculate the segments + // A segment is concerned with rows only (if all rows fit on one page then + // there is one segment. if the rows fit on two pages then there are two + // segments...) + Segments := TStringList.Create; + + try + // create the segments + CurrRow := 0; + while CurrRow < RowCount do + begin + lPageInfo := TJvTFDaysPageInfo.Create; + Segments.AddObject('', lPageInfo); + with lPageInfo do + begin + PageNum := Segments.Count; + StartRow := CurrRow; + + ShowColHdr := (CurrRow = 0) or DaysPageLayout.AlwaysShowColHdr; + CalcPageRowInfo(ShowColHdr, WorkRowsPerPage, WorkRowHeight); + EndRow := Lesser(CurrRow + WorkRowsPerPage - 1, RowCount - 1); + RowHeight := WorkRowHeight; + end; + CurrRow := lPageInfo.EndRow + 1; + end; + + // create the pages + CurrCol := 0; + while CurrCol < Cols.Count do + begin + WorkShowRowHdr := (CurrCol = 0) or DaysPageLayout.AlwaysShowRowHdr; + CalcPageColInfo(WorkShowRowHdr, WorkColsPerPage, WorkColWidth); + WorkEndCol := CurrCol + WorkColsPerPage - 1; + WorkEndCol := Lesser(WorkEndCol, Cols.Count - 1); + + for I := 0 to Segments.Count - 1 do + begin + SegmentInfo := TJvTFDaysPageInfo(Segments.Objects[I]); + + lPageInfo := TJvTFDaysPageInfo.Create; + FPageInfoList.AddObject('', lPageInfo); + with lPageInfo do + begin + PageNum := FPageInfoList.Count; + StartRow := SegmentInfo.StartRow; + EndRow := SegmentInfo.EndRow; + RowHeight := SegmentInfo.RowHeight; + ShowColHdr := SegmentInfo.ShowColHdr; + StartCol := CurrCol; + EndCol := WorkEndCol; + ColWidth := WorkColWidth; + ShowRowHdr := WorkShowRowHdr; + end; + end; + CurrCol := WorkEndCol + 1; + end; + finally + // clean up the segments + while Segments.Count > 0 do + begin + Segments.Objects[0].Free; + Segments.Delete(0); + end; + Segments.Free; + FValidPageInfo := True; + end; +end; + +procedure TJvTFDaysPrinter.CalcPageRowInfo(ShowColHdrs: Boolean; + var CalcRowsPerPage, CalcRowHeight: Integer); +var + DataHeight, TargetRowsPerPage: Integer; +begin + // Calculate the rows per page + if DaysPageLayout.RowsPerPage = 0 then + TargetRowsPerPage := RowCount + else + TargetRowsPerPage := DaysPageLayout.RowsPerPage; + + DataHeight := GetDataHeight(ShowColHdrs); + CalcRowHeight := DataHeight div TargetRowsPerPage; + CalcRowHeight := Greater(CalcRowHeight, MinRowHeight); + CalcRowsPerPage := DataHeight div CalcRowHeight; +end; + +procedure TJvTFDaysPrinter.CalcStartEndRows(AAppt: TJvTFAppt; + SchedDate: TDate; var StartRow, EndRow: Integer); +begin + if Trunc(AAppt.StartDate) = Trunc(SchedDate) then + StartRow := TimeToRow(AAppt.StartTime) + else + StartRow := 0; + + if Trunc(AAppt.EndDate) = Trunc(SchedDate) then + EndRow := TimeToRow(AdjustEndTime(AAppt.EndTime)) + else + EndRow := RowCount - 1; +end; + +procedure TJvTFDaysPrinter.CanDrawWhat(ACanvas: TCanvas; ApptRect: TRect; + PicsHeight, PicsWidth: Integer; var CanDrawText, CanDrawPics: Boolean); +var + TextHeightThreshold, TextWidthThreshold: Integer; +begin + TextHeightThreshold := ACanvas.TextHeight('Wq') * Thresholds.TextHeight; + TextWidthThreshold := ACanvas.TextWidth('Bi') div 2 * Thresholds.TextWidth; + + if TextHeightThreshold < RectHeight(ApptRect) then + begin + CanDrawText := RectWidth(ApptRect) >= TextWidthThreshold; + CanDrawPics := True; + end + else + if Thresholds.DropTextFirst then + begin + CanDrawText := False; + CanDrawPics := True; + if Thresholds.WholePicsOnly then + if PicsHeight > RectHeight(ApptRect) then + CanDrawPics := False; + end + else + begin + CanDrawText := (RectHeight(ApptRect) >= TextHeightThreshold) and + (RectWidth(ApptRect) >= TextWidthThreshold); + CanDrawPics := False; + end; + + if not ShowPics then + CanDrawPics := False; + if not ShowText then + CanDrawText := False; +end; + +function TJvTFDaysPrinter.CellRect(Col, Row: Integer; + PageInfo: TJvTFDaysPageInfo): TRect; +var + VisGrpHdrRect: TRect; +begin + if (Row = gcGroupHdr) and (Col > gcHdr) then + begin + VisGrpHdrRect := Classes.Rect(RowHdrWidth, 0, + RowHdrWidth + GetDataWidth(PageInfo.ShowRowHdr), + CalcGroupHdrHeight); + IntersectRect(Result, VisGrpHdrRect, + VirtualGroupHdrRect(Col, PageInfo)); + end + else + if Col < 0 then // Row hdr + if Row < 0 then + // origin cell + if PageInfo.ShowColHdr and PageInfo.ShowRowHdr then + //group Result := Classes.Rect(0, 0, RowHdrWidth, ColHdrHeight) + Result := Classes.Rect(0, 0, RowHdrWidth, CalcGroupColHdrsHeight) + else + Result := EmptyRect + else + if (Row >= PageInfo.StartRow) and (Row <= PageInfo.EndRow) then + // Row Hdr for visible data row + if PageInfo.ShowRowHdr then + begin + Result.Left := 0; + if PageInfo.ShowColHdr then + //group Result.Top := ColHdrHeight + Result.Top := CalcGroupColHdrsHeight + else + Result.Top := 0; + Result.Top := Result.Top + (Row - PageInfo.StartRow) * PageInfo.RowHeight; + Result.Right := RowHdrWidth; + Result.Bottom := Result.Top + PageInfo.RowHeight; + end + else + Result := EmptyRect + else + // Row Hdr for non-visible data row + Result := EmptyRect + else + if (Col >= PageInfo.StartCol) and (Col <= PageInfo.EndCol) then + // visible data col + if Row < 0 then + // Col hdr for visible data col + if PageInfo.ShowColHdr then + begin + if PageInfo.ShowRowHdr then + Result.Left := RowHdrWidth + else + Result.Left := 0; + Inc(Result.Left, PageInfo.ColWidth * (Col - PageInfo.StartCol)); + Result.Right := Result.Left + PageInfo.ColWidth; + + { variable width columns, leave for future reference + For I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + } + + //group Result.Top := 0; + Result.Top := CalcGroupHdrHeight; + //group Result.Bottom := ColHdrHeight; + Result.Bottom := Result.Top + ColHdrHeight; + end + else + Result := EmptyRect + else + if (Row >= PageInfo.StartRow) and (Row <= PageInfo.EndRow) then + // visible data cell + begin + if PageInfo.ShowRowHdr then + Result.Left := RowHdrWidth + else + Result.Left := 0; + Inc(Result.Left, PageInfo.ColWidth * (Col - PageInfo.StartCol)); + Result.Right := Result.Left + PageInfo.ColWidth; + + { variable width cols, leave for future reference + For I := LeftCol to Col - 1 do + Inc(Result.Left, Cols[I].Width); + Result.Right := Result.Left + Cols[Col].Width; + } + + if PageInfo.ShowColHdr then + //group Result.Top := ColHdrHeight + Result.Top := CalcGroupColHdrsHeight + else + Result.Top := 0; + Inc(Result.Top, (Row - PageInfo.StartRow) * PageInfo.RowHeight); + Result.Bottom := Result.Top + PageInfo.RowHeight; + end + else + // non-visible data cell (visible col, but non-visible row) + Result := EmptyRect + + else // non-visible data col + Result := EmptyRect; +end; + +procedure TJvTFDaysPrinter.ClearPageInfo; +begin + if not Assigned(FPageInfoList) then + Exit; + + while FPageInfoList.Count > 0 do + begin + FPageInfoList.Objects[0].Free; + FPageInfoList.Delete(0); + end; + FValidPageInfo := False; +end; + +procedure TJvTFDaysPrinter.ClearPicDrawList(DrawList: TList); +begin + while DrawList.Count > 0 do + begin + TJvTFDrawPicInfo(DrawList[0]).Free; + DrawList.Delete(0); + end; +end; + +procedure TJvTFDaysPrinter.CreateLayout; +begin + FPageLayout := TJvTFDaysPrinterPageLayout.Create(Self); +end; + +procedure TJvTFDaysPrinter.CreatePicDrawList(ARect: TRect; Appt: TJvTFAppt; + DrawList: TList); +var + I, NextPicLeft, ImageIndex, PicWidth: Integer; + ImageList: TCustomImageList; + ImageMap: TJvTFStateImageMap; + CustomImageMap: TJvTFCustomImageMap; + + procedure AddToList(AImageList: TCustomImageList; AImageIndex: Integer; + APicLeft, APicTop: Integer); + var + DrawInfo: TJvTFDrawPicInfo; + begin + DrawInfo := TJvTFDrawPicInfo.Create; + DrawInfo.ImageList := AImageList; + DrawInfo.ImageIndex := AImageIndex; + DrawInfo.PicLeft := APicLeft; + DrawInfo.PicTop := APicTop; + DrawList.Add(DrawInfo); + end; + +begin + NextPicLeft := ARect.Left; + + if ShowPics and Assigned(ScheduleManager.CustomImages) then + begin + ImageList := ScheduleManager.CustomImages; + CustomImageMap := Appt.ImageMap; + PicWidth := ScreenToPrinter(ImageList.Width + 2, True); + + for I := 0 to CustomImageMap.Count - 1 do + begin + ImageIndex := CustomImageMap[I]; + AddToList(ImageList, ImageIndex, NextPicLeft, ARect.Top); + Inc(NextPicLeft, PicWidth); + end; + end; + + if ShowPics and Assigned(ScheduleManager.StateImages) then + begin + ImageList := ScheduleManager.StateImages; + PicWidth := ScreenToPrinter(ImageList.Width + 2, True); + ImageMap := ScheduleManager.StateImageMap; + + if Appt.AlarmEnabled then + begin + ImageIndex := ImageMap.AlarmEnabled; + if ImageIndex > -1 then + begin + AddToList(ImageList, ImageIndex, NextPicLeft, ARect.Top); + Inc(NextPicLeft, PicWidth); + end + end + else + begin + ImageIndex := ImageMap.AlarmDisabled; + if ImageIndex > -1 then + begin + AddToList(ImageList, ImageIndex, NextPicLeft, ARect.Top); + Inc(NextPicLeft, PicWidth); + end; + end; + + ImageIndex := ImageMap.Shared; + if Appt.Shared and (ImageIndex > -1) then + begin + AddToList(ImageList, ImageIndex, NextPicLeft, ARect.Top); + // The following line generates a compiler hint so comment out, + // but leave here as reminder in case method is expanded. + //Inc(NextPicLeft, ImageList.Width + 2); + end; + + { don't show modified pic in printed page + if Appt.Modified and (ImageMap.Modified > -1) then + begin + AddToList(ImageList, ImageMap.Modified, NextPicLeft, ARect.Top); + // The following line generates a compiler hint so comment out, + // but leave here as reminder in case method is expanded. + //Inc(NextPicLeft, ImageList.Width + 2); + end; + } + end; +end; + +function TJvTFDaysPrinter.DaysPageLayout: TJvTFDaysPrinterPageLayout; +begin + Result := TJvTFDaysPrinterPageLayout(PageLayout); +end; + +{*************************************************************************** + * The following routine was based off of a routine originally found in the + * PrinterDemo #1 project of Earl F. Glynn's Computer Lab and is used with + * permission. + * http://www.efg2.com/Lab/OtherProjects/PrinterDemo1.htm + * + * This routine solves a color "washing" problem encountered on some printers. + * It demonstrates the proper use of StretchDIBits. Many thanks to Earl + * for providing the Computer Lab. This solution saved me several hours + * of research and trial and error. + ****************************************************************************} + +procedure TJvTFDaysPrinter.PrintBitmap(ACanvas: TCanvas; SourceRect, + DestRect: TRect; aBitmap: TBitmap); +var + BitmapHeader: pBitmapInfo; + BitmapImage: POINTER; + + HeaderSize: LongWord; + ImageSize: LongWord; + +begin + { wp --- to do (GetDIBSizes not in LCL) + GetDIBSizes(aBitmap.Handle, HeaderSize, ImageSize); + GetMem(BitmapHeader, HeaderSize); + GetMem(BitmapImage, ImageSize); + try + GetDIB(aBitmap.Handle, aBitmap.Palette, BitmapHeader^, BitmapImage^); + StretchDIBits(ACanvas.Handle, + DestRect.Left, DestRect.Top, + DestRect.Right - DestRect.Left, + DestRect.Bottom - DestRect.Top, + SourceRect.Left, SourceRect.Top, + RectWidth(SourceRect), + RectHeight(SourceRect), + BitmapImage, + TBitmapInfo(BitmapHeader^), + DIB_RGB_COLORS, + SRCCOPY); + finally + FreeMem(BitmapHeader); + FreeMem(BitmapImage) + end; + } +end; + +procedure TJvTFDaysPrinter.DrawAppt(ACanvas: TCanvas; Col: Integer; + Appt: TJvTFAppt; StartRow, EndRow: Integer; PageInfo: TJvTFDaysPageInfo); +var + ApptRect, DataRect: TRect; + ClipRgn: HRgn; +begin + ApptRect := GetApptRect(Col, Appt, PageInfo); + + if IsRectEmpty(ApptRect) then + Exit; + + // Printer bug start, fixed + // Calc the data area rect on the given canvas + if PageInfo.ShowRowHdr then + DataRect.Left := RowHdrWidth + else + DataRect.Left := 0; + + if PageInfo.ShowColHdr then + DataRect.Top := CalcGroupColHdrsHeight + else + DataRect.Top := 0; + + DataRect.Right := DataRect.Left + BodyWidth; + DataRect.Bottom := DataRect.Top + BodyHeight; + + // Need to add BodyLeft and BodyTop to account for ViewPortOrg adjustment + ClipRgn := CreateRectRgn(DataRect.Left + BodyLeft, + DataRect.Top + BodyTop, DataRect.Right + BodyLeft, DataRect.Bottom + BodyTop); + + SelectClipRgn(ACanvas.Handle, ClipRgn); + DrawApptDetail(ACanvas, ApptRect, Appt, Col, StartRow, EndRow); + SelectClipRgn(ACanvas.Handle, 0); + DeleteObject(ClipRgn); + // Printer bug end, fixed +end; + +function TJvTFDaysPrinter.CalcTimeStampRect(Appt: TJvTFAppt; BarRect: TRect; + Col, StartRow, EndRow: Integer): TRect; +var + Offset, ApptLength: TTime; + ColDate: TDate; + StartPercent, EndPercent: Double; +begin + Result := BarRect; + + if StartRow < 0 then + StartRow := 0; + + if EndRow > RowCount - 1 then + EndRow := RowCount - 1; + + Offset := RowToTime(StartRow); + ApptLength := RowEndTime(EndRow) - Offset; + ColDate := Cols[Col].SchedDate; + + if Trunc(ColDate) <> Trunc(Appt.StartDate) then + StartPercent := 0 + else + StartPercent := (Appt.StartTime - Offset) / ApptLength; + + if Trunc(ColDate) <> Trunc(Appt.EndDate) then + EndPercent := 1.0 + else + EndPercent := (Appt.EndTime - Offset) / ApptLength; + + Result.Top := Round((BarRect.Bottom - BarRect.Top) * StartPercent) + + BarRect.Top; + Result.Bottom := Round((BarRect.Bottom - BarRect.Top) * EndPercent) + + BarRect.Top; +end; + +procedure TJvTFDaysPrinter.DrawTimeStamp(ACanvas: TCanvas; TimeStampRect: TRect); +var + OldColor: TColor; + StampLeft: Integer; +begin + with ACanvas do + case ApptBar.TimeStampStyle of + tssFullI: + begin + OldColor := Pen.Color; + Pen.Color := ApptBar.TimeStampColor; + Pen.Width := ScreenToPrinter(2, False); + + MoveTo(TimeStampRect.Left + 1, TimeStampRect.Top); + LineTo(TimeStampRect.Right - 1, TimeStampRect.Top); + MoveTo(TimeStampRect.Left + 1, TimeStampRect.Bottom - 1); + LineTo(TimeStampRect.Right - 1, TimeStampRect.Bottom - 1); + + if ApptBar.Width > 5 then + Pen.Width := ScreenToPrinter(2, True) + else + Pen.Width := ScreenToPrinter(1, True); + + // Printer bug, fixed + StampLeft := TimeStampRect.Left + RectWidth(TimeStampRect) div 2; + MoveTo(StampLeft, TimeStampRect.Top + 1); + LineTo(StampLeft, TimeStampRect.Bottom - 1); + + Pen.Width := 1; + + Pen.Color := OldColor; + end; + tssHalfI: + begin + // we only want the left half of the time stamp rect + TimeStampRect.Right := (TimeStampRect.Left + TimeStampRect.Right) div 2; + + OldColor := Pen.Color; + Pen.Color := ApptBar.TimeStampColor; + Pen.Width := ScreenToPrinter(2, False); + + MoveTo(TimeStampRect.Left, TimeStampRect.Top); + LineTo(TimeStampRect.Right - 0, TimeStampRect.Top); + MoveTo(TimeStampRect.Left, TimeStampRect.Bottom - 0); + LineTo(TimeStampRect.Right - 0, TimeStampRect.Bottom - 0); + + if ApptBar.Width > 5 then + Pen.Width := ScreenToPrinter(2, True) + else + Pen.Width := ScreenToPrinter(1, True); + + MoveTo(TimeStampRect.Right - 0, TimeStampRect.Top + 1); + LineTo(TimeStampRect.Right - 0, TimeStampRect.Bottom); + Pen.Color := OldColor; + Pen.Width := 1; + end; + tssBlock: + begin + // we only want the left half of the time stamp rect + TimeStampRect.Right := (TimeStampRect.Left + TimeStampRect.Right) div 2; + + OldColor := Brush.Color; + Brush.Color := ApptBar.TimeStampColor; + FillRect(TimeStampRect); + Brush.Color := OldColor; + end; + end; +end; + +procedure TJvTFDaysPrinter.DrawApptBar(ACanvas: TCanvas; Appt: TJvTFAppt; + BarRect: TRect; Col, StartRow, EndRow: Integer); +var + OldColor: TColor; + TimeStampRect: TRect; +begin + with ACanvas do + begin + // Fill Bar Color + OldColor := Brush.Color; + if Appt.BarColor = clDefault then + Brush.Color := ApptBar.Color + else + Brush.Color := Appt.BarColor; + + FillRect(BarRect); + Brush.Color := OldColor; + + // Draw Bar Border + Pen.Width := 1; + Pen.Color := ApptAttr.FrameColor; + MoveTo(BarRect.Right - 1, BarRect.Top); + LineTo(BarRect.Right - 1, BarRect.Bottom); + + // Draw Time Stamp + TimeStampRect := CalcTimeStampRect(Appt, BarRect, Col, StartRow, EndRow); + if ApptBar.TimeStampStyle <> tssNone then + DrawTimeStamp(ACanvas, TimeStampRect); + + if Assigned(FOnDrawApptBar) then + FOnDrawApptBar(Self, ACanvas, Appt, Col, BarRect, TimeStampRect); + end; +end; + +{ +procedure TJvTFDaysPrinter.DrawApptBar(ACanvas: TCanvas; Appt: TJvTFAppt; + BarRect: TRect; Col, StartRow, EndRow: Integer); +var + OldColor: TColor; + MarkerRect: TRect; + Offset, + ApptLength: TTime; + ColDate: TDate; + StartPercent, + EndPercent: Double; +begin + With ACanvas do + begin + // Fill Bar Color + OldColor := Brush.Color; + if Appt.BarColor = clDefault then + Brush.Color := ApptBar.Color + else + Brush.Color := Appt.BarColor; + + FillRect(BarRect); + Brush.Color := OldColor; + + // Draw Bar Border + Pen.Width := 1; + Pen.Color := ApptAttr.FrameColor; + MoveTo(BarRect.Right - 1, BarRect.Top); + LineTo(BarRect.Right - 1, BarRect.Bottom); + + // Draw Time Stamp + Case ApptBar.TimeStampStyle of + tssFullI : + begin + MarkerRect := BarRect; + + Offset := RowToTime(StartRow); + ApptLength := RowEndTime(EndRow) - Offset; + ColDate := Cols[Col].SchedDate; + + if Trunc(ColDate) <> Trunc(Appt.StartDate) then + StartPercent := 0 + else + StartPercent := (Appt.StartTime - Offset) / ApptLength; + + if Trunc(ColDate) <> Trunc(Appt.EndDate) then + EndPercent := 1.0 + else + EndPercent := (Appt.EndTime - Offset) / ApptLength; + + MarkerRect.Top := Round((BarRect.Bottom - BarRect.Top) * + StartPercent) + BarRect.Top; + MarkerRect.Bottom := Round((BarRect.Bottom - BarRect.Top) * + EndPercent) + BarRect.Top; + + OldColor := Pen.Color; + Pen.Color := ApptBar.TimeStampColor; + Pen.Width := ScreenToPrinter(2, False); + + MoveTo(MarkerRect.Left + 1, MarkerRect.Top); + LineTo(MarkerRect.Right - 1, MarkerRect.Top); + MoveTo(MarkerRect.Left + 1, MarkerRect.Bottom - 1); + LineTo(MarkerRect.Right - 1, MarkerRect.Bottom - 1); + + if ApptBar.Width > 5 then + Pen.Width := ScreenToPrinter(2, True) + else + Pen.Width := ScreenToPrinter(1, True); + + MoveTo((MarkerRect.Right) div 2, MarkerRect.Top + 1); + LineTo((MarkerRect.Right) div 2, MarkerRect.Bottom - 1); + Pen.Width := 1; + + Pen.Color := OldColor; + end; + + tssHalfI : + begin + MarkerRect := BarRect; + MarkerRect.Right := MarkerRect.Right div 2; + + Offset := RowToTime(StartRow); + ApptLength := RowEndTime(EndRow) - Offset; + ColDate := Cols[Col].SchedDate; + + if Trunc(ColDate) <> Trunc(Appt.StartDate) then + StartPercent := 0 + else + StartPercent := (Appt.StartTime - Offset) / ApptLength; + + if Trunc(ColDate) <> Trunc(Appt.EndDate) then + EndPercent := 1.0 + else + EndPercent := (Appt.EndTime - Offset) / ApptLength; + + MarkerRect.Top := Round((BarRect.Bottom - BarRect.Top) * + StartPercent) + BarRect.Top; + MarkerRect.Bottom := Round((BarRect.Bottom - BarRect.Top) * + EndPercent) + BarRect.Top; + + OldColor := Pen.Color; + Pen.Color := ApptBar.TimeStampColor; + Pen.Width := ScreenToPrinter(2, False); + + MoveTo(MarkerRect.Left, MarkerRect.Top); + LineTo(MarkerRect.Right - 0, MarkerRect.Top); + MoveTo(MarkerRect.Left, MarkerRect.Bottom - 0); + LineTo(MarkerRect.Right - 0, MarkerRect.Bottom - 0); + + if ApptBar.Width > 5 then + Pen.Width := ScreenToPrinter(2, True) + else + Pen.Width := ScreenToPrinter(1, True); + MoveTo(MarkerRect.Right - 0, MarkerRect.Top + 1); + LineTo(MarkerRect.Right - 0, MarkerRect.Bottom); + Pen.Color := OldColor; + Pen.Width := 1; + end; + + tssBlock : + begin + MarkerRect := BarRect; + MarkerRect.Right := MarkerRect.Right div 2; + + Offset := RowToTime(StartRow); + ApptLength := RowEndTime(EndRow) - Offset; + ColDate := Cols[Col].SchedDate; + + if Trunc(ColDate) <> Trunc(Appt.StartDate) then + StartPercent := 0 + else + StartPercent := (Appt.StartTime - Offset) / ApptLength; + + if Trunc(ColDate) <> Trunc(Appt.EndDate) then + EndPercent := 1.0 + else + EndPercent := (Appt.EndTime - Offset) / ApptLength; + + MarkerRect.Top := Round((BarRect.Bottom - BarRect.Top) * + StartPercent) + BarRect.Top; + MarkerRect.Bottom := Round((BarRect.Bottom - BarRect.Top) * + EndPercent) + BarRect.Top; + + OldColor := Brush.Color; + Brush.Color := ApptBar.TimeStampColor; + FillRect(MarkerRect); + Brush.Color := OldColor; + end; + end; + end; +end; +} + +procedure TJvTFDaysPrinter.DrawApptDetail(ACanvas: TCanvas; ARect: TRect; + Appt: TJvTFAppt; Col, StartRow, EndRow: Integer); +var + TheFrameRect, TxtRect, DetailRect, BarRect: TRect; + Txt: string; + Flags: UINT; + CanDrawText, CanDrawPics, CanDrawAppt: Boolean; + PicsHeight, PicsWidth: Integer; + DrawList: TList; + DrawInfo: TJvTFDaysApptDrawInfo; +begin + with ACanvas do + begin + DrawInfo := TJvTFDaysApptDrawInfo.Create; + try + GetApptDrawInfo(DrawInfo, Appt); + Font.Assign(DrawInfo.Font); + Brush.Color := DrawInfo.Color; + Pen.Color := DrawInfo.FrameColor; + Pen.Width := DrawInfo.FrameWidth; + CanDrawAppt := DrawInfo.Visible; + finally + DrawInfo.Free; + end; + + // !!!!!!!!!!!!!!!!!!!!!!!!!! + // EXIT IF NOTHING TO DRAW !! + // !!!!!!!!!!!!!!!!!!!!!!!!!! + if not CanDrawAppt then + Exit; + + //Brush.Color := GetApptDispColor(Appt); + FillRect(ARect); + + //Pen.Color := ApptAttr.FrameColor; + //Pen.Width := ApptAttr.FrameWidth; + TheFrameRect := ARect; + InflateRect(TheFrameRect, -(ApptAttr.FrameWidth div 2), -(ApptAttr.FrameWidth div 2)); + + // Need to fine tune the frame rect + if ApptAttr.FrameWidth mod 2 = 0 then + begin + Inc(TheFrameRect.Right); + Inc(TheFrameRect.Bottom); + end; + + MoveTo(TheFrameRect.Left, TheFrameRect.Top); + LineTo(TheFrameRect.Right - 1, TheFrameRect.Top); + LineTo(TheFrameRect.Right - 1, TheFrameRect.Bottom - 1); + LineTo(TheFrameRect.Left, TheFrameRect.Bottom - 1); + LineTo(TheFrameRect.Left, TheFrameRect.Top); + + // Only go through the following work if all details must be drawn + if (RectHeight(ARect) > Thresholds.DetailHeight) and + (RectWidth(ARect) > Thresholds.DetailWidth) then + begin + InflateRect(TheFrameRect, -(ApptAttr.FrameWidth div 2), -(ApptAttr.FrameWidth div 2)); + + DetailRect := TheFrameRect; + + if ApptBar.Visible then + begin + Inc(DetailRect.Left, ApptBar.Width); + SubtractRect(BarRect, TheFrameRect, DetailRect); + Dec(BarRect.Bottom); + DrawApptBar(ACanvas, Appt, BarRect, Col, StartRow, EndRow); + end; + + TxtRect := DetailRect; + + InflateRect(TxtRect, -2, -2); + + DrawList := TList.Create; + try + // Set the canvas' font now so text height and width calc's will + // be correct. + //Font := ApptAttr.Font; + CreatePicDrawList(TxtRect, Appt, DrawList); + FilterPicDrawList(TxtRect, DrawList, PicsHeight, PicsWidth); + // Calc'ing text height and width in CanDrawWhat + CanDrawWhat(ACanvas, TxtRect, PicsHeight, PicsWidth, CanDrawText, CanDrawPics); + + if CanDrawPics then + begin + DrawListPics(ACanvas, TxtRect, DrawList); + Inc(TxtRect.Left, PicsWidth); // Mantis 2340: Be coherent with JvTFDays + end; + finally + ClearPicDrawList(DrawList); + DrawList.Free; + end; + + if CanDrawText then + begin + Flags := DT_WORDBREAK or DT_NOPREFIX or DT_EDITCONTROL; + + Txt := ScheduleManager.GetApptDisplayText(Self, Appt); + + if not FormattedDesc then + begin + Txt := StripCRLF(Txt); + Flags := Flags or DT_END_ELLIPSIS; + end; + + DrawText(ACanvas.Handle, PChar(Txt), -1, TxtRect, Flags); + end; + end; + + if Assigned(FOnDrawAppt) then + FOnDrawAppt(Self, ACanvas, ARect, Appt, False); + end; +end; + +procedure TJvTFDaysPrinter.DrawAppts(ACanvas: TCanvas; DrawAll: Boolean; + PageInfo: TJvTFDaysPageInfo); +var + FromCol, ToCol, FromRow, ToRow, Col, I: Integer; + ApptStartRow, ApptEndRow, SchedDate: Integer; + Appt: TJvTFAppt; +begin + if Aborted then + Exit; + + if DrawAll then + begin + FromCol := 0; + ToCol := Cols.Count - 1; + FromRow := 0; + ToRow := RowCount - 1; + end + else + begin + FromCol := PageInfo.StartCol; + ToCol := PageInfo.EndCol; + FromRow := PageInfo.StartRow; + ToRow := PageInfo.EndRow; + end; + + if Assigned(FOnApptProgress) and (FApptsDrawn = 0) then + FOnApptProgress(Self, 0, ApptCount); + Application.ProcessMessages; + + Col := FromCol; + while (Col <= ToCol) and not Aborted do + //For Col := FromCol to ToCol do + begin + if Cols[Col].Connected and not Aborted then + begin + SchedDate := Trunc(Cols[Col].SchedDate); + I := 0; + while (I < Cols[Col].Schedule.ApptCount) and not Aborted do + //For I := 0 to Cols[Col].Schedule.ApptCount - 1 do + begin + Appt := Cols[Col].Schedule.Appts[I]; + + CalcStartEndRows(Appt, SchedDate, ApptStartRow, ApptEndRow); + + if (ApptStartRow <= ToRow) and (ApptEndRow >= FromRow) then + begin + DrawAppt(ACanvas, Col, Appt, ApptStartRow, ApptEndRow, PageInfo); + Inc(FApptsDrawn); + if Assigned(FOnApptProgress) then + FOnApptProgress(Self, FApptsDrawn, ApptCount); + Application.ProcessMessages; + end; + Inc(I); + end; + end; + Inc(Col); + end; +end; + +procedure TJvTFDaysPrinter.DrawBody(ACanvas: TCanvas; ARect: TRect; + PageNum: Integer); +var + SaveMeasure: TJvTFPrinterMeasure; + lPageInfo: TJvTFDaysPageInfo; + I, J: Integer; +begin + if Aborted then + Exit; + + SaveMeasure := Measure; + Measure := pmPixels; + + lPageInfo := TJvTFDaysPageInfo(FPageInfoList.Objects[PageNum - 1]); + + with ACanvas do + begin + Brush.Color := Self.Color; + FillRect(ARect); + + DrawCorner(ACanvas); + + if lPageInfo.ShowColHdr then + begin + if Cols.Count = 0 then + DrawEmptyColHdr(ACanvas, lPageInfo) + else + begin + DrawGroupHdrs(ACanvas, lPageInfo); + for I := lPageInfo.StartCol to lPageInfo.EndCol do + begin + if Aborted then + Break; + //DrawColHdr(ACanvas, I, lPageInfo); + DrawColGroupHdr(ACanvas, I, lPageInfo, False); + end; + end; + end; + + if lPageInfo.ShowRowHdr then + if RowHdrType = rhFancy then + DrawFancyRowHdrs(ACanvas, lPageInfo) + else + for I := lPageInfo.StartRow to lPageInfo.EndRow do + begin + if Aborted then + Break; + DrawRowHdr(ACanvas, I, lPageInfo); + end; + + for I := lPageInfo.StartRow to lPageInfo.EndRow do + for J := lPageInfo.StartCol to lPageInfo.EndCol do + begin + if Aborted then + Break; + DrawDataCell(ACanvas, J, I, lPageInfo); + end; + + if not (csDesigning in ComponentState) and not Aborted then + DrawAppts(ACanvas, False, lPageInfo); + end; + + Measure := SaveMeasure; + + inherited DrawBody(ACanvas, ARect, PageNum); +end; + +{ +procedure TJvTFDaysPrinter.DrawColHdr(ACanvas: TCanvas; Index: Integer; + PageInfo: TJvTFDaysPageInfo); +var + ARect, + TxtRect, + CalcRect: TRect; + Txt: string; + PTxt: PChar; + Flags: UINT; + TxtHt, + TxtRectHt: Integer; +begin + ARect := CellRect(Index, -1, PageInfo); + + //Txt := Copy(Cols[Index].Title, 1, Length(Cols[Index].Title)); + Txt := Cols[Index].Title; + + ACanvas.Brush.Color := HdrAttr.Color; + ACanvas.Font.Assign(HdrAttr.Font); + + Flags := DT_NOPREFIX or DT_CENTER; + Case ColTitleStyle of + ctsSingleClip : Flags := Flags or DT_SINGLELINE or DT_VCENTER; + ctsSingleEllipsis: Flags := Flags or DT_END_ELLIPSIS or DT_SINGLELINE or + DT_VCENTER; + ctsMultiClip : Flags := Flags or DT_WORDBREAK; + ctsMultiEllipsis : Flags := Flags or DT_END_ELLIPSIS or DT_WORDBREAK or + DT_EDITCONTROL; + ctsHide : Flags := Flags or DT_SINGLELINE or DT_VCENTER; + end; + + ACanvas.FillRect(ARect); + TxtRect := ARect; + Windows.InflateRect(TxtRect, -2, -2); + CalcRect := TxtRect; + + //PTxt := StrNew(PChar(Txt)); + PTxt := StrAlloc((Length(Txt) + 4) * SizeOf(Char)); + StrPCopy(PTxt, Txt); + + if (ColTitleStyle = ctsMultiClip) or + (ColTitleStyle = ctsMultiEllipsis) then + begin + TxtHt := Windows.DrawText(ACanvas.Handle, PTxt, -1, CalcRect, + Flags or DT_CALCRECT); + + if TxtHt < RectHeight(TxtRect) then + begin + // we need to vertically center the text + TxtRectHt := RectHeight(TxtRect); + TxtRect.Top := TxtRect.Top + RectHeight(TxtRect) div 2 - TxtHt div 2; + TxtRect.Bottom := Lesser(TxtRect.Top + TxtRectHt, TxtRect.Bottom); + end; + end + else + if ColTitleStyle = ctsHide then + begin + Windows.DrawText(ACanvas.Handle, PTxt, -1, CalcRect, Flags or DT_CALCRECT); + if RectWidth(CalcRect) > RectWidth(TxtRect) then + StrPCopy(PTxt, ''); + end; + + Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + StrDispose(PTxt); + + DrawFrame(ACanvas, ARect, HdrAttr.Frame3D); + + if Assigned(FOnDrawColHdr) then + FOnDrawColHdr(Self, ACanvas, ARect, Index, False); +end; +} + +procedure TJvTFDaysPrinter.DrawCorner(ACanvas: TCanvas); +var + ARect: TRect; +begin + //group ARect := Classes.Rect(0, 0, RowHdrWidth, ColHdrHeight); + ARect := Classes.Rect(0, 0, RowHdrWidth, CalcGroupColHdrsHeight); + with ACanvas do + begin + Brush.Color := HdrAttr.Color; + FillRect(ARect); + + if HdrAttr.Frame3D then + DrawFrame(ACanvas, ARect, HdrAttr.Frame3D) + else + begin + if RowHdrType = rhFancy then + begin + Pen.Color := FancyRowHdrAttr.TickColor; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom - 1); + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + end + else + DrawFrame(ACanvas, ARect, False); + end; + + if Assigned(FOnDrawCorner) then + FOnDrawCorner(Self, ACanvas, ARect, agcTopLeft); + end; +end; + +procedure TJvTFDaysPrinter.DrawDataCell(ACanvas: TCanvas; ColIndex, + RowIndex: Integer; PageInfo: TJvTFDaysPageInfo); +var + ARect: TRect; + PrimeStartRow, PrimeEndRow: Integer; + CellColor: TColor; +begin + // Calc the cell rect + if PageInfo.ShowRowHdr then + ARect.Left := RowHdrWidth + else + ARect.Left := 0; + + ARect.Left := ARect.Left + (ColIndex - PageInfo.StartCol) * PageInfo.ColWidth; + ARect.Right := ARect.Left + PageInfo.ColWidth; + + { variable col widths, leave for future reference + For I := LeftCol to ColIndex - 1 do + Inc(ARect.Left, Cols[I].Width); + ARect.Right := ARect.Left + Cols[ColIndex].Width; + } + + if PageInfo.ShowColHdr then + //group ARect.Top := ColHdrHeight + ARect.Top := CalcGroupColHdrsHeight + else + ARect.Top := 0; + + ARect.Top := ARect.Top + (RowIndex - PageInfo.StartRow) * PageInfo.RowHeight; + ARect.Bottom := ARect.Top + PageInfo.RowHeight; + + PrimeStartRow := TimeToRow(PrimeTime.StartTime); + PrimeEndRow := TimeToRow(AdjustEndTime(PrimeTime.EndTime)); + + if (RowIndex >= PrimeStartRow) and (RowIndex <= PrimeEndRow) then + CellColor := PrimeTime.Color + else + CellColor := Color; + + if Assigned(FOnShadeCell) then + FOnShadeCell(Self, ColIndex, RowIndex, CellColor); + + if CellColor <> Color then + begin + ACanvas.Brush.Color := CellColor; + ACanvas.FillRect(ARect); + end; + + // Draw a line across the ARect.Bottom and down the ARect.Right side + with ACanvas do + begin + Pen.Color := GridLineColor; + Pen.Width := 1; + + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom - 1); + end; + + if Assigned(FOnDrawDataCell) then + FOnDrawDataCell(Self, ACanvas, ARect, ColIndex, RowIndex); +end; + +procedure TJvTFDaysPrinter.DrawEmptyColHdr(ACanvas: TCanvas; + PageInfo: TJvTFDaysPageInfo); +var + ARect: TRect; +begin + ARect.Left := RowHdrWidth; + ARect.Top := 0; + ARect.Right := ARect.Left + GetDataWidth(PageInfo.ShowRowHdr); + //group ARect.Bottom := ColHdrHeight; + ARect.Bottom := CalcGroupColHdrsHeight; + + with ACanvas do + begin + Brush.Color := HdrAttr.Color; + FillRect(ARect); + Pen.Color := clGray; + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + end; +end; + +procedure TJvTFDaysPrinter.DrawFancyRowHdrs(ACanvas: TCanvas; + PageInfo: TJvTFDaysPageInfo); +var + I, MajorTickLength, MinorTickLength, TickLength: Integer; + ARect: TRect; + Lbl: string; + PrevHour, CurrentHour: Word; + FirstMajor, Switch: Boolean; +begin + MajorTickLength := GetMajorTickLength; + MinorTickLength := GetMinorTickLength(ACanvas); + + FirstMajor := True; + PrevHour := RowToHour(PageInfo.StartRow); + for I := PageInfo.StartRow to PageInfo.EndRow do + begin + CurrentHour := RowToHour(I); + + Switch := (CurrentHour <> PrevHour) or (I = PageInfo.EndRow); + + ARect := CellRect(-1, I, PageInfo); + Lbl := GetMinorLabel(I, PageInfo); + if not RowEndsHour(I) then + TickLength := MinorTickLength + else + TickLength := MajorTickLength; + + DrawMinor(ACanvas, ARect, I, Lbl, TickLength); + + // Draw Major if needed + if Switch and (Granularity <> 60) then + begin + if I <> PageInfo.StartRow + 1 then + begin + ARect.Left := 1; // Allow for a small margin on ARect.Left side + ARect.Right := RowHdrWidth; // No "cutting" before the end of the cell. + ARect.Top := CellRect(-1, HourStartRow(PrevHour), PageInfo).Top; + + //group if ARect.Top < ColHdrHeight then + //group ARect.Top := ColHdrHeight; + if ARect.Top < CalcGroupColHdrsHeight then + ARect.Top := CalcGroupColHdrsHeight; + ARect.Bottom := CellRect(-1, HourEndRow(PrevHour), PageInfo).Bottom - 1; + + // No need to check for ARect.Bottom to be outside the page, CellRect + // calculates it so that it does not happen. And using GetDataHeight + // is not a good idea as it removes the column header height, which + // is NOT what we want here as we want the page's integral height. + // If we wer to use it, we would trigger Mantis 2340. + + if FancyRowHdrAttr.Hr2400 then + Lbl := IntToStr(PrevHour) + else + begin + if PrevHour = 0 then + Lbl := '12' + else + if PrevHour > 12 then + Lbl := IntToStr(PrevHour - 12) + else + Lbl := IntToStr(PrevHour); + + if FirstMajor or (PrevHour = 0) or (PrevHour = 12) then + if PrevHour < 12 then + Lbl := Lbl + 'a' + else + Lbl := Lbl + 'p'; + end; + + ACanvas.Font.Assign(FancyRowHdrAttr.MajorFont); + ACanvas.Brush.Style := bsClear; + + DrawText(ACanvas.Handle, PChar(Lbl), -1, ARect, + DT_NOPREFIX or DT_SINGLELINE or DT_LEFT or DT_VCENTER); + + if Assigned(FOnDrawMajorRowHdr) then + FOnDrawMajorRowHdr(Self, ACanvas, ARect, I - 1, False); + + FirstMajor := False; + end; + if Switch then + PrevHour := CurrentHour; + end; + end; +end; + +procedure TJvTFDaysPrinter.DrawFrame(ACanvas: TCanvas; ARect: TRect; + Draw3D: Boolean); +var + OldPenColor: TColor; +begin + with ACanvas do + begin + OldPenColor := Pen.Color; + + if Draw3D then + Pen.Color := clBtnShadow + else + Pen.Color := GridLineColor; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + + if Draw3D then + begin + Pen.Color := clBtnHighlight; + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Right, ARect.Top); + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Left, ARect.Bottom); + end; + + Pen.Color := OldPenColor; + end; +end; + +procedure TJvTFDaysPrinter.DrawListPics(ACanvas: TCanvas; + var ARect: TRect; DrawList: TList); +var + I: Integer; + DrawInfo: TJvTFDrawPicInfo; + Pic: TBitmap; + DestRect: TRect; +begin + Pic := TBitmap.Create; + Pic.Canvas.Brush.Color := ACanvas.Brush.Color; + try + for I := 0 to DrawList.Count - 1 do + begin + DrawInfo := TJvTFDrawPicInfo(DrawList[I]); + Pic.Height := DrawInfo.ImageList.Height; + Pic.Width := DrawInfo.ImageList.Width; + Pic.Canvas.FillRect(Classes.Rect(0, 0, Pic.Width, Pic.Height)); + with DrawInfo do + ImageList.Draw(Pic.Canvas, 0, 0, ImageIndex); + DestRect.Left := DrawInfo.PicLeft; + DestRect.Top := DrawInfo.PicTop; + DestRect.Right := DrawInfo.PicLeft + + ScreenToPrinter(DrawInfo.ImageList.Width + 2, True); + DestRect.Bottom := DrawInfo.PicTop + + ScreenToPrinter(DrawInfo.ImageList.Height + 2, False); + PrintBitmap(ACanvas, Classes.Rect(0, 0, Pic.Width, Pic.Height), DestRect, Pic); + end; + finally + Pic.Free; + end; +end; + +procedure TJvTFDaysPrinter.DrawMinor(ACanvas: TCanvas; ARect: TRect; + RowNum: Integer; const LabelStr: string; TickLength: Integer); +var + MinorRect, TxtRect: TRect; +begin + // do the background shading + ACanvas.Brush.Color := FancyRowHdrAttr.Color; + ACanvas.FillRect(ARect); + + MinorRect := ARect; + MinorRect.Left := MinorRect.Right - GetMinorTickLength(ACanvas); + + with ACanvas do + begin + // draw the right border line + Pen.Color := FancyRowHdrAttr.TickColor; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + + // now draw the tick + MoveTo(ARect.Right - 1, ARect.Bottom - 1); + LineTo(ARect.Right - 1 - TickLength, ARect.Bottom - 1); + end; + + // set up a 2 pel margin on the right and bottom sides + TxtRect := ARect; + TxtRect.Right := TxtRect.Right - 2; + TxtRect.Bottom := TxtRect.Bottom - 2; + + // now draw the LabelStr right aligned + ACanvas.Font.Assign(FancyRowHdrAttr.MinorFont); + ACanvas.Brush.Style := bsClear; + + DrawText(ACanvas.Handle, PChar(LabelStr), -1, TxtRect, + DT_SINGLELINE or DT_RIGHT or DT_NOPREFIX or DT_VCENTER); + + if Assigned(FOnDrawMinorRowHdr) then + FOnDrawMinorRowHdr(Self, ACanvas, ARect, RowNum, False); +end; + +procedure TJvTFDaysPrinter.DrawRowHdr(ACanvas: TCanvas; Index: Integer; + PageInfo: TJvTFDaysPageInfo); +var + ARect: TRect; + Txt: string; +begin + ARect.Left := 0; + if PageInfo.ShowColHdr then + //group Top := ColHdrHeight + ARect.Top := CalcGroupColHdrsHeight + else + ARect.Top := 0; + ARect.Top := ARect.Top + (Index - PageInfo.StartRow) * PageInfo.RowHeight; + ARect.Right := RowHdrWidth; + ARect.Bottom := ARect.Top + PageInfo.RowHeight; + + Txt := FormatDateTime(TimeFormat, RowToTime(Index)); + + ACanvas.Brush.Color := HdrAttr.Color; + ACanvas.Font.Assign(HdrAttr.Font); + + DrawTxt(ACanvas, ARect, Txt, taCenter, vaCenter); + + DrawFrame(ACanvas, ARect, HdrAttr.Frame3D); + + if Assigned(FOnDrawRowHdr) then + FOnDrawRowHdr(Self, ACanvas, ARect, Index, False); +end; + +procedure TJvTFDaysPrinter.EnsureRow(RowNum: Integer); +begin + if RowNum >= RowCount then + raise EJvTFPrinterError.CreateResFmt(@RsEInvalidRowd, [RowNum]); +end; + +procedure TJvTFDaysPrinter.FilterPicDrawList(ARect: TRect; + DrawList: TList; var PicsHeight: Integer; var PicsWidth: Integer); +var + I, NextPicLeft, PicRight, PicBottom: Integer; + DrawIt: Boolean; + DrawInfo: TJvTFDrawPicInfo; +begin + PicsHeight := 0; + PicsWidth := 0; + if DrawList.Count = 0 then + Exit; + + if Thresholds.PicsAllOrNone then + begin + DrawInfo := TJvTFDrawPicInfo(DrawList[DrawList.Count - 1]); + PicRight := DrawInfo.PicLeft + ScreenToPrinter(DrawInfo.ImageList.Width, True); + if PicRight >= ARect.Right then + begin + while DrawList.Count > 0 do + begin + TJvTFDrawPicInfo(DrawList[0]).Free; + DrawList.Delete(0); + end; + end; + end; + + PicsHeight := 0; + NextPicLeft := ARect.Left; + I := 0; + while I < DrawList.Count do + begin + DrawInfo := TJvTFDrawPicInfo(DrawList[I]); + with DrawInfo do + begin + PicRight := PicLeft + ScreenToPrinter(ImageList.Width + 2, True); + PicBottom := PicTop + ScreenToPrinter(ImageList.Height + 2, False); + DrawIt := True; + + if Thresholds.WholePicsOnly and + (PicRight >= ARect.Right) or (PicBottom >= ARect.Bottom) then + DrawIt := False; + + if DrawIt then + begin + //PicsHeight := Greater(PicsHeight, ImageList.Height + 2); + PicsHeight := Greater(PicsHeight, PicBottom - PicTop + 2); + PicLeft := NextPicLeft; + //Inc(NextPicLeft, ImageList.Width + 2); + Inc(NextPicLeft, PicRight - PicLeft + 2); + // Increment I to move onto next pic in list + Inc(I); + end + else // Remove pic from list + begin + // Remove pic from list + DrawInfo.Free; + DrawList.Delete(I); + // DO NOT increment I - Since pic was removed from list + // I will now point to next pic + end; + end; + end; + PicsWidth := NextPicLeft - ARect.Left; +end; + +function TJvTFDaysPrinter.GetApptDispColor(Appt: TJvTFAppt): TColor; +begin + if Appt.Color = clDefault then + Result := ApptAttr.Color + else + Result := Appt.Color; +end; + +function TJvTFDaysPrinter.GetApptRect(Col: Integer; Appt: TJvTFAppt; + PageInfo: TJvTFDaysPageInfo): TRect; +var + MapCol, MapColCount, Base, MakeUp, BaseWidth, MakeUpWidth: Integer; + BaseCount, GridColWidth, ApptWidth, StartRow, EndRow: Integer; + WorkLeft, WorkTop: Integer; +begin + if not Assigned(Appt) then + begin + Result := EmptyRect; + Exit; + end; + + CalcStartEndRows(Appt, Cols[Col].SchedDate, StartRow, EndRow); + + if (StartRow < 0) and (EndRow >= 0) then + StartRow := 0; + // if the above condition fails and the StartRow is STILL invalid then + // let the 'Map col not found' catch the error. + + // Printer bug, fixed + EndRow := Lesser(EndRow, PageInfo.EndRow); + + MapCol := Cols[Col].LocateMapCol(Appt, StartRow); + if MapCol < 1 then + begin + raise EJvTFDaysError.CreateRes(@RsEMapColNotFoundForAppointment); + end; + + MapColCount := Cols[Col].MapColCount(StartRow); + if MapColCount < 1 then + begin + //Cols[Col].FMap.Dump('corrupt dump.txt'); !!! FOR DEBUGGING ONLY !!!! + raise EJvTFPrinterError.CreateRes(@RsECorruptAppointmentMap); + end; + + // Col guaranteed to be partially visible + // Printer bug start, fixed + WorkLeft := CellRect(Col, Greater(StartRow, PageInfo.StartRow), PageInfo).Left; + if StartRow < PageInfo.StartRow then + WorkTop := CellRect(Col, PageInfo.StartRow, PageInfo).Top - + PageInfo.RowHeight * (PageInfo.StartRow - StartRow) + else + WorkTop := CellRect(Col, StartRow, PageInfo).Top; + // Printer bug end, fixed + + GridColWidth := PageInfo.ColWidth; + + // The Base* and MakeUp* code that follows calc's the appt width and left + // and takes into account a total width that isn't evenly divisible by + // the map col count. if there is a discrepency then that discrepency + // is divvied up amoung the cols working Result.Left to Result.Right. + // + // Example: Total width = 113, col count = 5 + // col 1 = 23 + // col 2 = 23 + // col 3 = 23 + // col 4 = 22 + // col 5 = 22 + // Total = 113 + // + // As opposed to: + // width of all cols = Total div colcount = 22 + // ==> Total = 22 * 5 = 110 [110 <> 113] + Base := GridColWidth div MapColCount; + MakeUp := GridColWidth mod MapColCount; + + MakeUpWidth := Lesser(MapCol - 1, MakeUp) * (Base + 1); + BaseCount := MapCol - 1 - MakeUp; + if BaseCount > 0 then + BaseWidth := BaseCount * Base + else + BaseWidth := 0; + + ApptWidth := Base; + if MapCol <= MakeUp then + Inc(ApptWidth); + + // Printer bug, fixed + Result.Left := WorkLeft + MakeUpWidth + BaseWidth; + + Result.Right := Result.Left + ApptWidth - ApptBuffer; + + // Printer bug, fixed + Result.Top := WorkTop; + + Result.Bottom := CellRect(Col, EndRow, PageInfo).Bottom; +end; + +function TJvTFDaysPrinter.GetDataHeight(ShowColHdr: Boolean): Integer; +begin + Result := BodyHeight; + if ShowColHdr then + //group Dec(Result, ConvertMeasure(ColHdrHeight, Measure, pmPixels, False)); + Dec(Result, ConvertMeasure(CalcGroupColHdrsHeight, Measure, pmPixels, False)); +end; + +function TJvTFDaysPrinter.GetDataWidth(ShowRowHdr: Boolean): Integer; +begin + Result := BodyWidth; + if ShowRowHdr then + Dec(Result, ConvertMeasure(RowHdrWidth, Measure, pmPixels, True)); +end; + +function TJvTFDaysPrinter.GetMajorTickLength: Integer; +begin + Result := RowHdrWidth; +end; + +function TJvTFDaysPrinter.GetMinorLabel(RowNum: Integer; + PageInfo: TJvTFDaysPageInfo): string; +const + Full24 = 'h:nn'; + FullAP = 'h:nna/p'; + MinOnly = ':nn'; +var + TimeFmt: string; + LastFullRow, LastHourStart: Integer; + LastHour: Word; +begin + if Granularity = 60 then + TimeFmt := Full24 + else + if (RowNum = PageInfo.StartRow) and not RowStartsHour(RowNum) then + TimeFmt := Full24 + else + begin + LastFullRow := PageInfo.EndRow; + LastHour := RowToHour(LastFullRow); + LastHourStart := HourStartRow(LastHour); + + if ((RowNum = LastHourStart) and not RowStartsHour(RowNum)) or + ((LastHourStart = PageInfo.StartRow) and (RowNum = PageInfo.StartRow)) then + TimeFmt := Full24 + else + TimeFmt := MinOnly; + end; + + if (TimeFmt = Full24) and not FancyRowHdrAttr.Hr2400 then + TimeFmt := FullAP; + + Result := FormatDateTime(TimeFmt, RowToTime(RowNum)); +end; + +function TJvTFDaysPrinter.GetMinorTickLength(ACanvas: TCanvas): Integer; +var + TempFont: TFont; +begin + TempFont := TFont.Create; + try + TempFont.Assign(ACanvas.Font); + ACanvas.Font.Assign(FancyRowHdrAttr.MinorFont); + Result := ACanvas.TextWidth('22:22a'); + ACanvas.Font.Assign(TempFont); + finally + TempFont.Free; + end; +end; + +function TJvTFDaysPrinter.HourEndRow(Hour: Word): Integer; +begin + Result := TimeToRow(EncodeTime(Hour, 59, 0, 0)); +end; + +function TJvTFDaysPrinter.HourStartRow(Hour: Word): Integer; +begin + Result := TimeToRow(EncodeTime(Hour, 0, 0, 0)); +end; + +procedure TJvTFDaysPrinter.Loaded; +var + I: Integer; +begin + inherited Loaded; + for I := 0 to Cols.Count - 1 do + Cols[I].Connect; +end; + +procedure TJvTFDaysPrinter.Prepare; +var + I: Integer; +begin + NewDoc; + try + FApptsDrawn := 0; + CalcPageInfo; + if FPageInfoList.Count = 0 then + raise EJvTFPrinterError.CreateRes(@RsEThereIsNoDataToPrint); + + for I := 0 to FPageInfoList.Count - 1 do + NewPage; + //Except on EJvTFPrinterError do + except + begin + FreeDoc; + raise; + end; + end; + FApptsDrawn := 0; + FinishDoc; +end; + +function TJvTFDaysPrinter.RowCount: Integer; +var + Adjustment, H, M, S, MS: Word; + WorkTime: TTime; +begin + WorkTime := GridEndTime; + + DecodeTime(WorkTime, H, M, S, MS); + Adjustment := 0; + + if (H = 0) and (M = 0) then + begin + WorkTime := EncodeTime(23, 59, 59, 999); + Adjustment := 1; + end; + + //DecodeTime(GridEndTime - GridStartTime, H, M, S, MS); + DecodeTime(WorkTime - GridStartTime, H, M, S, MS); + Result := (H * 60 + M) div Granularity + Adjustment; +end; + +function TJvTFDaysPrinter.RowEndsHour(RowNum: Integer): Boolean; +var + H, M, S, MS: Word; + TempTime: TTime; +begin + EnsureRow(RowNum); + + TempTime := RowToTime(RowNum) + EncodeTime(0, Granularity - 1, 0, 0); + DecodeTime(TempTime, H, M, S, MS); + Result := M = 59; +end; + +function TJvTFDaysPrinter.RowEndTime(RowNum: Integer): TTime; +begin + Result := RowToTime(RowNum) + + Granularity * EncodeTime(0, 1, 0, 0) - EncodeTime(0, 0, 1, 0); +end; + +function TJvTFDaysPrinter.RowStartsHour(RowNum: Integer): Boolean; +var + H, M, S, MS: Word; +begin + EnsureRow(RowNum); + + DecodeTime(RowToTime(RowNum), H, M, S, MS); + Result := M = 0; +end; + +function TJvTFDaysPrinter.RowToHour(RowNum: Integer): Word; +var + H, M, S, MS: Word; +begin + DecodeTime(RowToTime(RowNum), H, M, S, MS); + Result := H; +end; + +function TJvTFDaysPrinter.RowToTime(RowNum: Integer): TTime; +var + TotalMins: Integer; + WorkHours, WorkMins: Word; + H, M, S, MS: Word; + Offset: Integer; +begin + DecodeTime(GridStartTime, H, M, S, MS); + Offset := H * 60 + M; + TotalMins := RowNum * Granularity + Offset; + + WorkHours := TotalMins div 60; + WorkMins := TotalMins mod 60; + if WorkHours < 24 then + Result := EncodeTime(WorkHours, WorkMins, 0, 0) + else + Result := EncodeTime(23, 59, 59, 999); +end; + +procedure TJvTFDaysPrinter.SetApptAttr(Value: TJvTFDaysApptAttr); +begin + SetPropertyCheck; + FApptAttr.Assign(Value); +end; + +procedure TJvTFDaysPrinter.SetApptBar(Value: TJvTFDaysApptBar); +begin + SetPropertyCheck; + FApptBar.Assign(Value); +end; + +procedure TJvTFDaysPrinter.SetApptBuffer(Value: Integer); +begin + SetPropertyCheck; + if Value < 0 then + Value := 0; + FApptBuffer := Value; +end; + +procedure TJvTFDaysPrinter.SetColHdrHeight(Value: Integer); +begin + SetPropertyCheck; + if Value < 0 then + Value := 0; + FColHdrHeight := Value; +end; + +procedure TJvTFDaysPrinter.SetColor(Value: TColor); +begin + SetPropertyCheck; + FColor := Value; +end; + +procedure TJvTFDaysPrinter.SetCols(Value: TJvTFDaysCols); +begin + FCols.Assign(Value); +end; + +procedure TJvTFDaysPrinter.SetTFColTitleStyle(Value: TJvTFColTitleStyle); +begin + SetPropertyCheck; + FColTitleStyle := Value; +end; + +procedure TJvTFDaysPrinter.SetFancyRowHdrAttr(Value: TJvTFDaysFancyRowHdrAttr); +begin + SetPropertyCheck; + FFancyRowHdrAttr.Assign(Value); +end; + +procedure TJvTFDaysPrinter.SetGranularity(Value: Integer); +var + MaxRowHeight, I: Integer; +begin + SetPropertyCheck; + + // Enforce minimum granularity of 1 min and max of 60 mins + if Value < 1 then + Value := 1 + else + if Value > 60 then + Value := 60; + + // Ensure that granularity is evenly divisable by an hour + while 60 mod Value <> 0 do + Dec(Value); + + // Sum of row heights cannot exceed 32767 + MaxRowHeight := 32767 div (60 div Value * 24); + if RowHeight > MaxRowHeight then + RowHeight := MaxRowHeight; + + if Value <> FGranularity then + begin + FGranularity := Value; + if not (csLoading in ComponentState) then + begin + for I := 0 to Cols.Count - 1 do + Cols[I].RefreshMap; + end; + end; +end; + +procedure TJvTFDaysPrinter.SetGridLineColor(Value: TColor); +begin + SetPropertyCheck; + FGridLineColor := Value; +end; + +procedure TJvTFDaysPrinter.SetHdrAttr(Value: TJvTFDaysHdrAttr); +begin + SetPropertyCheck; + FHdrAttr.Assign(Value); +end; + +procedure TJvTFDaysPrinter.SetMeasure(Value: TJvTFPrinterMeasure); +var + I: Integer; +begin + try + FConvertingProps := True; + if Value <> Measure then + begin + // convert properties + ApptAttr.FrameWidth := ConvertMeasure(ApptAttr.FrameWidth, Measure, + Value, False); + ApptBar.Width := ConvertMeasure(ApptBar.Width, Measure, Value, True); + ApptBuffer := ConvertMeasure(ApptBuffer, Measure, Value, True); + ColHdrHeight := ConvertMeasure(ColHdrHeight, Measure, Value, False); + GroupHdrHeight := ConvertMeasure(GroupHdrHeight, Measure, Value, False); + + for I := 0 to Cols.Count - 1 do + Cols[I].Width := ConvertMeasure(Cols[I].Width, Measure, Value, True); + + MinColWidth := ConvertMeasure(MinColWidth, Measure, Value, True); + MinRowHeight := ConvertMeasure(MinRowHeight, Measure, Value, False); + RowHdrWidth := ConvertMeasure(RowHdrWidth, Measure, Value, True); + RowHeight := ConvertMeasure(RowHeight, Measure, Value, False); + Thresholds.DetailHeight := ConvertMeasure(Thresholds.DetailHeight, + Measure, Value, False); + Thresholds.DetailWidth := ConvertMeasure(Thresholds.DetailWidth, + Measure, Value, True); + + inherited SetMeasure(Value); + end; + finally + FConvertingProps := False; + end; +end; + +procedure TJvTFDaysPrinter.SetMinColWidth(Value: Integer); +begin + SetPropertyCheck; + if Value < AbsMinColWidth then + Value := AbsMinColWidth; + FMinColWidth := Value; +end; + +procedure TJvTFDaysPrinter.SetMinRowHeight(Value: Integer); +begin + SetPropertyCheck; + if Value < 1 then + Value := 1; + FMinRowHeight := Value; +end; + +procedure TJvTFDaysPrinter.SetPrimeTime(Value: TJvTFDaysPrimeTime); +begin + SetPropertyCheck; + FPrimeTime.Assign(Value); +end; + +procedure TJvTFDaysPrinter.SetProperties(aJvTFDays: TJvTFDays); +begin + ApptAttr := aJvTFDays.ApptAttr; + ApptAttr.FrameWidth := + ConvertMeasure(ScreenToPrinter(ApptAttr.FrameWidth, False), pmPixels, + Measure, False); + + ApptBar := aJvTFDays.ApptBar; + ApptBar.Width := ConvertMeasure(ScreenToPrinter(ApptBar.Width, True), pmPixels, + Measure, True); + + ApptBuffer := ConvertMeasure(ScreenToPrinter(aJvTFDays.ApptBuffer, True), + pmPixels, Measure, True); + ColHdrHeight := ConvertMeasure(ScreenToPrinter(aJvTFDays.ColHdrHeight, False), + pmPixels, Measure, False); + + Color := aJvTFDays.Color; + ColTitleStyle := aJvTFDays.ColTitleStyle; + DateFormat := aJvTFDays.DateFormat; + FancyRowHdrAttr := aJvTFDays.FancyRowHdrAttr; + FormattedDesc := agoFormattedDesc in aJvTFDays.Options; + Granularity := aJvTFDays.Granularity; + GridLineColor := aJvTFDays.GridLineColor; + GroupHdrAttr := aJvTFDays.GroupHdrAttr; + //GroupHdrHeight := aJvTFDays.GroupHdrHeight; + GroupHdrHeight := ConvertMeasure(ScreenToPrinter(aJvTFDays.GroupHdrHeight, + False), pmPixels, Measure, False); + Grouping := aJvTFDays.Grouping; + HdrAttr := aJvTFDays.HdrAttr; + + MinColWidth := ConvertMeasure(ScreenToPrinter(aJvTFDays.MinColWidth, True), + pmPixels, Measure, True); + + PrimeTime := aJvTFDays.PrimeTime; + RowHdrType := aJvTFDays.RowHdrType; + + RowHdrWidth := ConvertMeasure(ScreenToPrinter(aJvTFDays.RowHdrWidth, True), + pmPixels, Measure, True); + RowHeight := ConvertMeasure(ScreenToPrinter(aJvTFDays.RowHeight, False), + pmPixels, Measure, False); + + ShowPics := agoShowPics in aJvTFDays.Options; + ShowText := agoShowText in aJvTFDays.Options; + Thresholds := aJvTFDays.Thresholds; + Thresholds.DetailHeight := + ConvertMeasure(ScreenToPrinter(Thresholds.DetailHeight, False), pmPixels, + Measure, False); + Thresholds.DetailWidth := + ConvertMeasure(ScreenToPrinter(Thresholds.DetailWidth, True), pmPixels, + Measure, True); + + TimeFormat := aJvTFDays.TimeFormat; + + // Set the property fields directly to avoid validity check. Assume + // settings from aJvTFDays are already validated. + FGridStartTime := aJvTFDays.GridStartTime; + FGridEndTime := aJvTFDays.GridEndTime; +end; + +procedure TJvTFDaysPrinter.SetTFRowHdrType(Value: TJvTFRowHdrType); +begin + SetPropertyCheck; + FRowHdrType := Value; +end; + +procedure TJvTFDaysPrinter.SetRowHdrWidth(Value: Integer); +begin + SetPropertyCheck; + if Value < 0 then + Value := 0; + FRowHdrWidth := Value; +end; + +procedure TJvTFDaysPrinter.SetRowHeight(Value: Integer); +begin + SetPropertyCheck; + if Value < 0 then + Value := 0; + FRowHeight := Value; +end; + +procedure TJvTFDaysPrinter.SetShowPics(Value: Boolean); +begin + SetPropertyCheck; + FShowPics := Value; +end; + +procedure TJvTFDaysPrinter.SetShowText(Value: Boolean); +begin + SetPropertyCheck; + FShowText := Value; +end; + +procedure TJvTFDaysPrinter.SetThresholds(Value: TJvTFDaysThresholds); +begin + SetPropertyCheck; + FThresholds.Assign(Value); +end; + +function TJvTFDaysPrinter.TimeToRow(ATime: TTime): Integer; +var + TotalMins: Integer; + WorkHours, WorkMins, WorkSecs, WorkMSecs: Word; + H, M, S, MS: Word; + Offset: Integer; +begin + DecodeTime(ATime, WorkHours, WorkMins, WorkSecs, WorkMSecs); + + // Convert the given time to minutes + DecodeTime(GridStartTime, H, M, S, MS); + Offset := H * 60 + M; + TotalMins := WorkHours * 60 + WorkMins - Offset; + + // Find the row number by dividing the time in minutes by the granularity + Result := TotalMins div Granularity; + if (TotalMins < 0) and (TotalMins mod Granularity <> 0) then + Dec(Result); +end; + +function TJvTFDaysPrinter.GetPageLayout: TJvTFDaysPrinterPageLayout; +begin + Result := TJvTFDaysPrinterPageLayout(inherited PageLayout); +end; + +procedure TJvTFDaysPrinter.SetPageLayout(Value: TJvTFDaysPrinterPageLayout); +begin + inherited PageLayout := Value; +end; + +procedure TJvTFDaysPrinter.CreateDoc; +var + I: Integer; +begin + inherited CreateDoc; + FApptCount := 0; + for I := 0 to Cols.Count - 1 do + Inc(FApptCount, Cols[I].Schedule.ApptCount); +end; + +function TJvTFDaysPrinter.GetApptCount: Integer; +var + I: Integer; +begin + if State = spsNoDoc then + begin + Result := 0; + for I := 0 to Cols.Count - 1 do + Inc(Result, Cols[I].Schedule.ApptCount); + end + else + Result := FApptCount; +end; + +function TJvTFDaysPrinter.GetPageInfo(PageNum: Integer): TJvTFDaysPageInfo; +begin + if not FValidPageInfo then + raise EJvTFPrinterError.CreateRes(@RsENoPageInfoExists); + + Result := TJvTFDaysPageInfo(FPageInfoList.Objects[PageNum - 1]); +end; + +procedure TJvTFDaysPrinter.FreeDoc; +begin + inherited FreeDoc; + + // Do not call ClearPageInfo if component is being destroyed. This must be + // done in TJvTFDaysPrinter.Destroy. TJvTFPrinter.Destroy calls FreeDoc + // and since TJvTFDaysPrinter.Destroy frees FPageInfo a NASTY AV happens. + if not (csDestroying in ComponentState) then + ClearPageInfo; +end; + +procedure TJvTFDaysPrinter.SetFormattedDesc(Value: Boolean); +begin + SetPropertyCheck; + FFormattedDesc := Value; +end; + +procedure TJvTFDaysPrinter.SetGroupHdrAttr(Value: TJvTFDaysHdrAttr); +begin + SetPropertyCheck; + FGroupHdrAttr.Assign(Value); +end; + +procedure TJvTFDaysPrinter.SetGroupHdrHeight(Value: Integer); +begin + SetPropertyCheck; + if Value < 0 then + Value := 0; + FGroupHdrHeight := Value; +end; + +procedure TJvTFDaysPrinter.SetGrouping(Value: TJvTFDaysGrouping); +begin + SetPropertyCheck; + FGrouping := Value; + Cols.UpdateTitles; +end; + +procedure TJvTFDaysPrinter.DrawColGroupHdr(ACanvas: TCanvas; + Index: Integer; PageInfo: TJvTFDaysPageInfo; IsGroupHdr: Boolean); +var + ARect, TxtRect, CalcRect: TRect; + Txt: string; + Flags: UINT; + TxtHt, TxtRectHt: Integer; + UseAttr: TJvTFDaysHdrAttr; +begin + if IsGroupHdr then + begin + ARect := VirtualGroupHdrRect(Index, PageInfo); + Txt := Cols[Index].GroupTitle; + UseAttr := GroupHdrAttr; + end + else + begin + ARect := CellRect(Index, -1, PageInfo); + Txt := Cols[Index].Title; + UseAttr := HdrAttr; + end; + + ACanvas.Brush.Color := UseAttr.Color; + ACanvas.Font.Assign(UseAttr.Font); + + Flags := DT_NOPREFIX or DT_CENTER; + case ColTitleStyle of + ctsSingleClip: + Flags := Flags or DT_SINGLELINE or DT_VCENTER; + ctsSingleEllipsis: + Flags := Flags or DT_END_ELLIPSIS or DT_SINGLELINE or DT_VCENTER; + ctsMultiClip: + Flags := Flags or DT_WORDBREAK; + ctsMultiEllipsis: + Flags := Flags or DT_END_ELLIPSIS or DT_WORDBREAK or DT_EDITCONTROL; + ctsHide: + Flags := Flags or DT_SINGLELINE or DT_VCENTER; + end; + + ACanvas.FillRect(ARect); + TxtRect := ARect; + InflateRect(TxtRect, -2, -2); + CalcRect := TxtRect; + + if (ColTitleStyle = ctsMultiClip) or (ColTitleStyle = ctsMultiEllipsis) then + begin + TxtHt := DrawText(ACanvas.Handle, PChar(Txt), -1, CalcRect, + Flags or DT_CALCRECT); + + if TxtHt < RectHeight(TxtRect) then + begin + // we need to vertically center the text + TxtRectHt := RectHeight(TxtRect); + TxtRect.Top := TxtRect.Top + RectHeight(TxtRect) div 2 - TxtHt div 2; + TxtRect.Bottom := Lesser(TxtRect.Top + TxtRectHt, TxtRect.Bottom); + end; + end + else + if ColTitleStyle = ctsHide then + begin + DrawText(ACanvas.Handle, PChar(Txt), -1, CalcRect, Flags or DT_CALCRECT); + if RectWidth(CalcRect) > RectWidth(TxtRect) then + Txt := ''; + end; + + DrawText(ACanvas.Handle, PChar(Txt), -1, TxtRect, Flags); + + DrawFrame(ACanvas, ARect, HdrAttr.Frame3D); + + if IsGroupHdr then + begin + if Assigned(FOnDrawGroupHdr) then + FOnDrawGroupHdr(Self, ACanvas, ARect, Index, False); + end + else + if Assigned(FOnDrawColHdr) then + FOnDrawColHdr(Self, ACanvas, ARect, Index, False); +end; + +procedure TJvTFDaysPrinter.DrawGroupHdrs(ACanvas: TCanvas; + PageInfo: TJvTFDaysPageInfo); +var + CurrGroup: string; + I: Integer; +begin + if CalcGroupHdrHeight > 0 then + begin + CurrGroup := Cols[PageInfo.StartCol].GroupTitle; + DrawColGroupHdr(ACanvas, PageInfo.StartCol, PageInfo, True); + for I := PageInfo.StartCol + 1 to PageInfo.EndCol do + if Cols[I].GroupTitle <> CurrGroup then + begin + CurrGroup := Cols[I].GroupTitle; + DrawColGroupHdr(ACanvas, I, PageInfo, True); + end; + end; +end; + +function TJvTFDaysPrinter.CalcGroupColHdrsHeight: Integer; +begin + Result := CalcGroupHdrHeight + ColHdrHeight; +end; + +function TJvTFDaysPrinter.CalcGroupHdrHeight: Integer; +begin + if Grouping = grNone then + Result := 0 + else + Result := GroupHdrHeight; +end; + +function TJvTFDaysPrinter.VirtualGroupHdrRect(Col: Integer; + APageInfo: TJvTFDaysPageInfo): TRect; +var + I, GroupStartCol, GroupEndCol, GroupWidth: Integer; +begin + Result.Top := 0; + Result.Bottom := CalcGroupHdrHeight; + + GetGroupStartEndCols(Col, GroupStartCol, GroupEndCol); + GroupWidth := 0; + for I := GroupStartCol to GroupEndCol do + Inc(GroupWidth, APageInfo.ColWidth); + + Result.Left := RowHdrWidth; + // At most, only one of the following For loops will execute + // depending on whether Col is to the left or to the right of LeftCol + //For I := LeftCol - 1 downto GroupStartCol do + for I := APageInfo.StartCol - 1 downto GroupStartCol do + Dec(Result.Left, APageInfo.ColWidth); + + //For I := LeftCol to GroupStartCol - 1 do + for I := APageInfo.StartCol to GroupStartCol - 1 do + Inc(Result.Left, APageInfo.ColWidth); + + Result.Right := Result.Left + GroupWidth; +end; + +procedure TJvTFDaysPrinter.GetGroupStartEndCols(Col: Integer; + var StartCol, EndCol: Integer); +var + I: Integer; +begin + // find group start col + I := Col; + while (I >= 0) and (Cols[I].GroupTitle = Cols[Col].GroupTitle) do + begin + StartCol := I; + Dec(I); + end; + + // find group end col + I := Col; + while (I < Cols.Count) and (Cols[I].GroupTitle = Cols[Col].GroupTitle) do + begin + EndCol := I; + Inc(I); + end; +end; + +procedure TJvTFDaysPrinter.PrintDirect; +begin + DirectPrint := True; + try + try + Prepare; + finally + FreeDoc; + end; + finally + DirectPrint := False; + end; +end; + +procedure TJvTFDaysPrinter.GetApptDrawInfo(DrawInfo: TJvTFDaysApptDrawInfo; + Appt: TJvTFAppt); +begin + DrawInfo.Color := GetApptDispColor(Appt); + DrawInfo.FrameColor := ApptAttr.FrameColor; + DrawInfo.FrameWidth := ApptAttr.FrameWidth; + DrawInfo.Font := ApptAttr.Font; + DrawInfo.Visible := True; + + if Assigned(FOnGetApptDrawInfo) then + FOnGetApptDrawInfo(Self, Appt, DrawInfo); +end; + +procedure TJvTFDaysPrinter.SetGridEndTime(Value: TTime); +var + I: Integer; + WorkEnd: TTime; + H, M, S, MS: Word; +begin + WorkEnd := Value; + DecodeTime(WorkEnd, H, M, S, MS); + if (H = 0) and (M = 0) then + WorkEnd := EncodeTime(23, 59, 59, 999); + + if not (csLoading in ComponentState) and (WorkEnd <= GridStartTime) then + raise EJvTFDaysError.CreateRes(@RsEGridEndTimeCannotBePriorToGridStart); + + FGridEndTime := Value; + + if not (csLoading in ComponentState) then + for I := 0 to Cols.Count - 1 do + Cols[I].RefreshMap; +end; + +procedure TJvTFDaysPrinter.SetGridStartTime(Value: TTime); +var + I: Integer; + WorkEnd: TTime; + H, M, S, MS: Word; +begin + WorkEnd := GridEndTime; + DecodeTime(WorkEnd, H, M, S, MS); + if (H = 0) and (M = 0) then + WorkEnd := EncodeTime(23, 59, 59, 999); + + if not (csLoading in ComponentState) and (Value >= WorkEnd) then + raise EJvTFDaysError.CreateRes(@RsEGridStartTimeCannotBeAfterGridEndTi); + + FGridStartTime := Value; + + if not (csLoading in ComponentState) then + for I := 0 to Cols.Count - 1 do + Cols[I].RefreshMap; +end; + +//=== { TJvTFDaysPrinterPageLayout } ========================================= + +procedure TJvTFDaysPrinterPageLayout.Assign(Source: TPersistent); +begin + inherited Assign(Source); + if Source is TJvTFDaysPrinterPageLayout then + begin + FColsPerPage := TJvTFDaysPrinterPageLayout(Source).ColsPerPage; + FRowsPerPage := TJvTFDaysPrinterPageLayout(Source).RowsPerPage; + FAlwaysShowColHdr := TJvTFDaysPrinterPageLayout(Source).AlwaysShowColHdr; + FAlwaysShowRowHdr := TJvTFDaysPrinterPageLayout(Source).AlwaysShowRowHdr; + // Don't call Change. Ancestor will call it. + end; +end; + +procedure TJvTFDaysPrinterPageLayout.SetAlwaysShowColHdr(Value: Boolean); +begin + SetPropertyCheck; + + if Value <> FAlwaysShowColHdr then + begin + FAlwaysShowColHdr := Value; + Change; + end; +end; + +procedure TJvTFDaysPrinterPageLayout.SetAlwaysShowRowHdr(Value: Boolean); +begin + SetPropertyCheck; + + if Value <> FAlwaysShowRowHdr then + begin + FAlwaysShowRowHdr := Value; + Change; + end; +end; + +procedure TJvTFDaysPrinterPageLayout.SetColsPerPage(Value: Integer); +begin + SetPropertyCheck; + + if Value < 0 then + Value := 0; + if Value <> FColsPerPage then + begin + FColsPerPage := Value; + Change; + end; +end; + +procedure TJvTFDaysPrinterPageLayout.SetRowsPerPage(Value: Integer); +begin + SetPropertyCheck; + + if Value < 0 then + Value := 0; + if Value <> FRowsPerPage then + begin + FRowsPerPage := Value; + Change; + end; +end; + +//=== { TJvTFCompNamesList } ================================================= + +procedure TJvTFCompNamesList.Move(CurIndex, NewIndex: Integer); +begin + inherited Move(CurIndex, NewIndex); + if Assigned(FOnMove) then + FOnMove(Self, CurIndex, NewIndex); +end; + +{$IFDEF Jv_TIMEBLOCKS} +// ok + +//=== { TJvTFDaysTimeBlock } ================================================= + +constructor TJvTFDaysTimeBlock.Create(ACollection: TCollection); +begin + inherited Create(ACollection); + FLength := 1; + FName := 'Block' + IntToStr(Index); + FTitle := Name; + FAllowAppts := True; +end; + +procedure TJvTFDaysTimeBlock.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysTimeBlock then + begin + FLength := TJvTFDaysTimeBlock(Source).Length; + FTitle := TJvTFDaysTimeBlock(Source).Title; + FAllowAppts := TJvTFDaysTimeBlock(Source).AllowAppts; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDaysTimeBlock.Change; +begin + if Assigned(BlockCollection) and Assigned(BlockCollection.DaysControl) then + BlockCollection.DaysControl.Invalidate; +end; + +function TJvTFDaysTimeBlock.GetBlockCollection: TJvTFDaysTimeBlocks; +begin + Result := TJvTFDaysTimeBlocks(Collection); +end; + +function TJvTFDaysTimeBlock.GetDisplayName: string; +begin + Result := Name; + if Result = '' then + Result := inherited GetDisplayName; +end; + +function TJvTFDaysTimeBlock.GetGridLength: Integer; +var + Days: TJvTFDays; +begin + Days := BlockCollection.DaysControl; + Result := Length * (Days.TimeBlockProps.BlockGran div Days.Granularity); +end; + +procedure TJvTFDaysTimeBlock.SetAllowAppts(Value: Boolean); +begin + FAllowAppts := Value; +end; + +procedure TJvTFDaysTimeBlock.SetLength(Value: Integer); +begin + if Value < 1 then + Value := 1; + if Value <> FLength then + begin + FLength := Value; + Change; + end; +end; + +procedure TJvTFDaysTimeBlock.SetName(const Value: string); +begin + if Value = '' then + raise EJvTFDaysError.CreateRes(@RsEATimeBlockNameCannotBeNull); + + if Value <> FName then + if not Assigned(BlockCollection.FindBlock(Value)) then + begin + if Title = Name then + Title := Value; + FName := Value; + Change; + end + else + raise EJvTFDaysError.CreateResFmt(@RsEAnotherTimeBlockWithTheName, [Value]); +end; + +procedure TJvTFDaysTimeBlock.SetTitle(const Value: string); +begin + if Value <> FTitle then + begin + FTitle := Value; + Change; + end; +end; + +//=== { TJvTFDaysTimeBlocks } ================================================ + +constructor TJvTFDaysTimeBlocks.Create(ADaysControl: TJvTFDays); +begin + inherited Create(TJvTFDaysTimeBlock); + FDaysControl := ADaysControl; +end; + +function TJvTFDaysTimeBlocks.Add: TJvTFDaysTimeBlock; +begin + Result := TJvTFDaysTimeBlock(inherited Add); +end; + +procedure TJvTFDaysTimeBlocks.Assign(Source: TPersistent); +var + I: Integer; +begin + if Source is TJvTFDaysTimeBlocks then + begin + BeginUpdate; + try + Clear; + for I := 0 to TJvTFDaysTimeBlocks(Source).Count - 1 do + Add.Assign(TJvTFDaysTimeBlocks(Source).Items[I]); + finally + EndUpdate; + end; + end + else + inherited Assign(Source); +end; + +function TJvTFDaysTimeBlocks.BlockByName(const BlockName: string): TJvTFDaysTimeBlock; +begin + Result := FindBlock(BlockName); + if not Assigned(Result) then + raise EJvTFDaysError.CreateResFmt(@RsEATimeBlockWithTheNamesDoesNotExist, + [BlockName]); +end; + +function TJvTFDaysTimeBlocks.FindBlock(const BlockName: string): TJvTFDaysTimeBlock; +var + I: Integer; +begin + Result := nil; + I := 0; + while (I < Count) and not Assigned(Result) do + begin + if Items[I].Name = BlockName then + Result := Items[I]; + Inc(I); + end; +end; + +function TJvTFDaysTimeBlocks.GetItem(Index: Integer): TJvTFDaysTimeBlock; +begin + Result := TJvTFDaysTimeBlock(inherited GetItem(Index)); +end; + +function TJvTFDaysTimeBlocks.GetOwner: TPersistent; +begin + Result := DaysControl; +end; + +procedure TJvTFDaysTimeBlocks.SetItem(Index: Integer; + Value: TJvTFDaysTimeBlock); +begin + inherited SetItem(Index, Value); +end; + +//=== { TJvTFDaysBlockProps } ================================================ + +constructor TJvTFDaysBlockProps.Create(ADaysControl: TJvTFDays); +begin + inherited Create; + FBlockGran := 60; + FDaysControl := ADaysControl; + FBlockHdrWidth := 50; + FBlockHdrAttr := TJvTFDaysHdrAttr.Create(DaysControl); + FSelBlockHdrAttr := TJvTFDaysHdrAttr.Create(DaysControl); + FOffTimeColor := clGray; + FDataDivColor := clBlack; + FSnapMove := True; + FDrawOffTime := True; + with FSelBlockHdrAttr do + begin + Color := clBtnFace; + Font.Color := clBlack; + FrameColor := clBlack; + end; +end; + +destructor TJvTFDaysBlockProps.Destroy; +begin + FBlockHdrAttr.Free; + FSelBlockHdrAttr.Free; + inherited Destroy; +end; + +procedure TJvTFDaysBlockProps.Assign(Source: TPersistent); +begin + if Source is TJvTFDaysBlockProps then + begin + FBlockGran := TJvTFDaysBlockProps(Source).BlockGran; + FDayStart := TJvTFDaysBlockProps(Source).DayStart; + FBlockHdrWidth := TJvTFDaysBlockProps(Source).BlockHdrWidth; + FBlockHdrAttr.Assign(TJvTFDaysBlockProps(Source).BlockHdrAttr); + FSelBlockHdrAttr.Assign(TJvTFDaysBlockProps(Source).SelBlockHdrAttr); + FOffTimeColor := TJvTFDaysBlockProps(Source).OffTimeColor; + FDataDivColor := TJvTFDaysBlockProps(Source).DataDivColor; + FSnapMove := TJvTFDaysBlockProps(Source).SnapMove; + FDrawOffTime := TJvTFDaysBlockProps(Source).DrawOffTime; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDaysBlockProps.Change; +begin + if Assigned(DaysControl) then + DaysControl.Invalidate; +end; + +procedure TJvTFDaysBlockProps.SetBlockGran(Value: Integer); +begin + if csLoading in DaysControl.ComponentState then + begin + FBlockGran := Value; + Exit; + end; + + // Enforce minimum granularity of 1 min and max of 60 mins + if Value < 1 then + Value := 1 + else + if Value > 60 then + Value := 60; + + // Ensure that granularity is evenly divisible by an hour + //while 60 mod Value <> 0 do + //Dec(Value); + Value := Value - 60 mod Value; + + if Value <> FBlockGran then + begin + DaysControl.EnsureBlockRules(DaysControl.Granularity, Value, DayStart); + FBlockGran := Value; + Change; + end; +end; + +procedure TJvTFDaysBlockProps.SetBlockHdrAttr(Value: TJvTFDaysHdrAttr); +begin + FBlockHdrAttr.Assign(Value); + DaysControl.Invalidate; +end; + +procedure TJvTFDaysBlockProps.SetBlockHdrWidth(Value: Integer); +begin + if Value <> FBlockHdrWidth then + begin + FBlockHdrWidth := Value; + Change; + end; +end; + +procedure TJvTFDaysBlockProps.SetDataDivColor(Value: TColor); +begin + if Value <> FDataDivColor then + begin + FDataDivColor := Value; + Change; + end; +end; + +procedure TJvTFDaysBlockProps.SetDayStart(Value: TTime); +begin + if Value <> FDayStart then + begin + DaysControl.EnsureBlockRules(DaysControl.Granularity, BlockGran, Value); + FDayStart := Value; + Change; + end; +end; + +procedure TJvTFDaysBlockProps.SetDrawOffTime(Value: Boolean); +begin + if Value <> FDrawOffTime then + begin + FDrawOffTime := Value; + Change; + end; +end; + +procedure TJvTFDaysBlockProps.SetOffTimeColor(Value: TColor); +begin + if Value <> FOffTimeColor then + begin + FOffTimeColor := Value; + Change; + end; +end; + +procedure TJvTFDaysBlockProps.SetSelBlockHdrAttr(Value: TJvTFDaysHdrAttr); +begin + FSelBlockHdrAttr.Assign(Value); + DaysControl.Invalidate; +end; + +{$ENDIF Jv_TIMEBLOCKS} + +//=== { TJvTFDaysApptDrawInfo } ============================================== + +constructor TJvTFDaysApptDrawInfo.Create; +begin + inherited Create; + FFont := TFont.Create; +end; + +destructor TJvTFDaysApptDrawInfo.Destroy; +begin + FFont.Free; + inherited Destroy; +end; + +procedure TJvTFDaysApptDrawInfo.SetColor(Value: TColor); +begin + FColor := Value; +end; + +procedure TJvTFDaysApptDrawInfo.SetFont(Value: TFont); +begin + FFont.Assign(Value); +end; + +procedure TJvTFDaysApptDrawInfo.SetFrameColor(Value: TColor); +begin + FFrameColor := Value; +end; + +procedure TJvTFDaysApptDrawInfo.SetFrameWidth(const Value: Integer); +begin + FFrameWidth := Value; +end; + +procedure TJvTFDaysApptDrawInfo.SetVisible(Value: Boolean); +begin + FVisible := Value; +end; + + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfgantt.pas b/components/jvcllaz/run/JvTimeFramework/jvtfgantt.pas new file mode 100644 index 000000000..e0f03a162 --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfgantt.pas @@ -0,0 +1,548 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFGantt.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + + .CDK.REGLINK=JvTFGanttComponentsReg.pas + Created 10/6/2001 6:14:06 PM + Eagle Software CDK, Version 5.13 Rev. B + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFGantt; + +{$mode objfpc}{$H+} + +interface + +uses + LCLIntf, LCLType, LMessages, + SysUtils, Classes, Graphics, Controls, Forms, Dialogs, StdCtrls, + JvTFUtils, JvTFManager; + +type + TJvTFGanttScrollBar = class(TScrollBar) + private + procedure CMDesignHitTest(var Msg: TCMDesignHitTest); message CM_DESIGNHITTEST; + protected + procedure CreateWnd; override; + function GetLargeChange: Integer; virtual; + procedure SetLargeChange(Value: Integer); virtual; + procedure UpdateRange; virtual; + public + constructor Create(AOwner: TComponent); override; + published + property LargeChange: Integer read GetLargeChange write SetLargeChange default 1; + end; + + TJvTFGanttScale = (ugsYear, ugsQuarter, ugsMonth, ugsWeek, ugsDay, ugsHour, ugsHalfHour, ugsQuarterHour, ugsMinute); + + TJvTFGanttScaleFormat = class(TPersistent) + private + FScale: TJvTFGanttScale; + FFont: TFont; + FFormat: string; + FWidth: Integer; + function GetFont: TFont; + procedure SetFont(const Value: TFont); + public + constructor Create; + destructor Destroy; override; + published + property Format: string read FFormat write FFormat; + property Font: TFont read GetFont write SetFont; + property Scale: TJvTFGanttScale read FScale write FScale; + property Width: Integer read FWidth write FWidth; + end; + + TJvTFGantt = class(TJvTFControl) + private + // property fields + FMajorScale: TJvTFGanttScaleFormat; + FMinorScale: TJvTFGanttScaleFormat; + FHScrollBar: TJvTFGanttScrollBar; + FVScrollBar: TJvTFGanttScrollBar; + FVisibleScrollBars: TJvTFVisibleScrollBars; + FCustomGlyphs: TBitmap; + // Other class variables + FPaintBuffer: TBitmap; + procedure CMSysColorChange(var Msg: TLMessage); message CM_SYSCOLORCHANGE; + procedure CMDesignHitTest(var Msg: TCMDesignHitTest); message CM_DESIGNHITTEST; + procedure CMFontChanged(var Msg: TLMessage); message CM_FONTCHANGED; + protected + procedure DrawMajor(ACanvas: TCanvas); virtual; + procedure DrawMinor(ACanvas: TCanvas); virtual; + procedure SetVisibleScrollBars(Value: TJvTFVisibleScrollBars); virtual; + function CalcHeaderHeight: Integer; + procedure AlignScrollBars; virtual; + function GetMinorScale: TJvTFGanttScaleFormat; virtual; + procedure SetMinorScale(const Value: TJvTFGanttScaleFormat); virtual; + function GetMajorScale: TJvTFGanttScaleFormat; virtual; + procedure SetMajorScale(const Value: TJvTFGanttScaleFormat); virtual; + procedure DrawClientArea; virtual; + procedure DrawHeader(ACanvas: TCanvas); virtual; + procedure Loaded; override; + procedure Resize; override; + procedure DrawCustomGlyph(SomeBitmap: TBitmap; + TargetLeft, TargetTop, ImageIndex, NumGlyphsPerBitmap: Integer); dynamic; + function ClientCursorPos: TPoint; + function ValidMouseAtDesignTime: Boolean; + procedure AdjustComponentHeightBasedOnFontChange; virtual; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + procedure PrepareAllBitmaps; + procedure PrepareBitmaps(SomeGlyph: TBitmap; ResourceName: PChar); dynamic; + procedure Paint; override; + published + property MajorScale: TJvTFGanttScaleFormat read GetMajorScale write SetMajorScale; + property MinorScale: TJvTFGanttScaleFormat read GetMinorScale write SetMinorScale; + property VisibleScrollBars: TJvTFVisibleScrollBars read FVisibleScrollBars write SetVisibleScrollBars + default [vsbHorz, vsbVert]; + property Align; + property Anchors; + end; + + +implementation + +uses + JvJVCLUtils, JvResources; + +//=== { TJvTFGantt } ========================================================= + +constructor TJvTFGantt.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + FPaintBuffer := TBitmap.Create; + FCustomGlyphs := TBitmap.Create; + FVisibleScrollBars := [vsbHorz, vsbVert]; + + FVScrollBar := TJvTFGanttScrollBar.Create(Self); + with FVScrollBar do + begin + Kind := sbVertical; + TabStop := False; + Anchors := []; + Parent := Self; + Visible := True; + // OnScroll := ScrollBarScroll; + end; + + FHScrollBar := TJvTFGanttScrollBar.Create(Self); + with FHScrollBar do + begin + Kind := sbHorizontal; + TabStop := False; + Anchors := []; + Parent := Self; + Visible := True; + // OnScroll := ScrollBarScroll; + end; + + FMajorScale := TJvTFGanttScaleFormat.Create; + FMajorScale.Scale := ugsMonth; + FMajorScale.Format := 'mmmm'; + FMinorScale := TJvTFGanttScaleFormat.Create; + FMinorScale.Scale := ugsDay; + FMinorScale.Format := 'dd'; + + PrepareAllBitmaps; +end; + +destructor TJvTFGantt.Destroy; +begin + FPaintBuffer.Free; + FMajorScale.Free; + FMinorScale.Free; + FVScrollBar.Free; + FHScrollBar.Free; + FCustomGlyphs.Free; + inherited Destroy; +end; + +procedure TJvTFGantt.Loaded; +begin + inherited Loaded; + AlignScrollBars; +end; + +procedure TJvTFGantt.DrawMajor(ACanvas: TCanvas); +var + lCaption: string; +begin + ACanvas.Font.Assign(FMajorScale.Font); + lCaption := RsThisIsTheMajorScale; + ACanvas.TextOut((Width div 2) - (ACanvas.TextWidth(Caption) div 2), 2, lCaption); +end; + +procedure TJvTFGantt.DrawMinor(ACanvas: TCanvas); +var + lCaption: string; +begin + ACanvas.Font.Assign(FMinorScale.Font); + lCaption := RsThisIsTheMinorScale; + ACanvas.TextOut((Width div 2) - (ACanvas.TextWidth(Caption) div 2), + (CalcHeaderHeight div 2) + 2, lCaption); +end; + +function TJvTFGantt.CalcHeaderHeight: Integer; +begin + Result := 0; + + Canvas.Font.Assign(FMajorScale.Font); + Result := Result + CanvasMaxTextHeight(Canvas); + + Canvas.Font.Assign(FMinorScale.Font); + Result := Result + CanvasMaxTextHeight(Canvas); + + Result := Result + 4; +end; + +procedure TJvTFGantt.Resize; +begin + inherited Resize; + AlignScrollBars; +end; + +procedure TJvTFGantt.SetMajorScale(const Value: TJvTFGanttScaleFormat); +begin + FMajorScale.Assign(Value); +end; + +function TJvTFGantt.GetMajorScale: TJvTFGanttScaleFormat; +begin + Result := FMajorScale; +end; + +procedure TJvTFGantt.SetMinorScale(const Value: TJvTFGanttScaleFormat); +begin + FMinorScale.Assign(Value); +end; + +function TJvTFGantt.GetMinorScale: TJvTFGanttScaleFormat; +begin + Result := FMinorScale; +end; + +procedure TJvTFGantt.SetVisibleScrollBars(Value: TJvTFVisibleScrollBars); +begin + if Value <> FVisibleScrollBars then + begin + FVisibleScrollBars := Value; + AlignScrollBars; + FVScrollBar.Visible := vsbVert in FVisibleScrollBars; + FHScrollBar.Visible := vsbHorz in FVisibleScrollBars; + end; +end; + +procedure TJvTFGantt.AlignScrollBars; +begin + // DO NOT INVALIDATE GRID IN THIS METHOD + FVScrollBar.Left := ClientWidth - FVScrollBar.Width; + FVScrollBar.Top := CalcHeaderHeight; + FVScrollBar.Height := FHScrollBar.Top - FVScrollBar.Top; + + FHScrollBar.Top := ClientHeight - FHScrollBar.Height; + FHScrollBar.Left := 0; + FHScrollBar.Width := FVScrollBar.Left - FHScrollBar.Left; + + with FVScrollBar do + if vsbHorz in VisibleScrollBars then + Height := FHScrollBar.Top - Top + else + Height := Self.ClientHeight - Top; + + with FHScrollBar do + if vsbVert in VisibleScrollBars then + Width := FVScrollBar.Left - Left + else + Width := Self.ClientWidth - Left; +end; + +procedure TJvTFGantt.DrawClientArea; +begin + // Draw the client area +end; + +procedure TJvTFGantt.DrawHeader(ACanvas: TCanvas); +begin + DrawMajor(ACanvas); + DrawMinor(ACanvas); +end; + +procedure TJvTFGantt.Paint; +begin + inherited Paint; + with FPaintBuffer do + begin + Width := ClientWidth; + Height := ClientHeight; + + with Canvas do + begin + Brush.Color := Self.Color; + FillRect(Rect(0, 0, Width, Height)); + end; + + DrawHeader(Canvas); + DrawClientArea; + end; + if Enabled then + BitBlt(Canvas.Handle, 0, 0, ClientWidth, ClientHeight, FPaintBuffer.Canvas.Handle, 0, 0, SRCCOPY) + else + BitBlt(Canvas.Handle, 0, 0, ClientWidth, ClientHeight, FPaintBuffer.Canvas.Handle, 0, 0, SRCCOPY) + { wp --- to do: Above line is a workaround because DrawState is not available in the LCL + Windows.DrawState(Canvas.Handle, 0, nil, FPaintBuffer.Handle, 0, 0, 0, 0, 0, DST_BITMAP or DSS_UNION or + DSS_DISABLED); + } + +end; + +{ Draws SomeBitmap out to the canvas. Use ImageIndex = 0 and NumGlyphsPerBitmap = 1 to draw the entire image, + or use other values to specify sub-glyphs within the image (for bitmaps that contain several same-sized + images aligned side-to-side in a single row). + + TargetLeft and TargetTop are the left and top coordinates in the Canvas where you would like this image to appear. + Use 0 and 0 to place the image in the top left corner. + + CDK: Call this method from an appropriate point in your code (e.g., a "Paint" or "DrawItem" override). + + Examples: + + // Draws entire image: + DrawCustomGlyph(FCustomGlyphs, 0, 0, 0, 1); + + // Draws last image within FCustomGlyph (which contains four side-to-side images): + DrawCustomGlyph(FCustomGlyphs, 0, 0, 3, 4); +} + +procedure TJvTFGantt.DrawCustomGlyph(SomeBitmap: TBitmap; + TargetLeft, TargetTop, ImageIndex, NumGlyphsPerBitmap: Integer); +var + LocalImageWidth: Integer; + SourceRect, DestRect: TRect; +begin + with Canvas do + begin + if NumGlyphsPerBitmap = 0 then + NumGlyphsPerBitmap := 1; + LocalImageWidth := SomeBitmap.Width div NumGlyphsPerBitmap; + + SourceRect.Left := ImageIndex * LocalImageWidth; + SourceRect.Top := 0; + SourceRect.Right := SourceRect.Left + LocalImageWidth; + SourceRect.Bottom := SourceRect.Top + SomeBitmap.Height; + + DestRect.Left := TargetLeft; + DestRect.Top := TargetTop; + DestRect.Right := DestRect.Left + LocalImageWidth; + DestRect.Bottom := DestRect.Top + SomeBitmap.Height; + CopyRect(DestRect, SomeBitmap.Canvas, SourceRect); + end; +end; + +{ Prepares glyphs for display. + The following colors in your glyphs will be replaced: + + Yellow with clBtnHighlight + Silver with clBtnFace + Gray with clBtnShadow + White with clWindow + Red with clWindowText + + CDK: Modify your glyphs so that they conform to the colors above, or alternatively + modify the colors referenced in the code below. +} + +procedure TJvTFGantt.PrepareBitmaps(SomeGlyph: TBitmap; ResourceName: PChar); +var + LocalBitmap: TBitmap; + + procedure ReplaceColors(SourceBmp, TargetBmp: TBitmap; SourceColor, TargetColor: TColor); + begin + TargetBmp.Canvas.Brush.Color := TargetColor; + TargetBmp.Canvas.BrushCopy(SourceBmp.Canvas.ClipRect, SourceBmp, + SourceBmp.Canvas.ClipRect, SourceColor); + end; + +begin + LocalBitmap := TBitmap.Create; + try + LocalBitmap.LoadFromResourceName(HInstance, ResourceName); + SomeGlyph.Width := LocalBitmap.Width; + SomeGlyph.Height := LocalBitmap.Height; + + { Replace the following colors after loading bitmap: + + clYellow with clBtnHighlight + clSilver with clBtnFace + clGray with clBtnShadow + clWhite with clWindow + clRed with clWindowText + } + + { Must call ReplaceColors an odd number of times, to ensure that final image ends up in SomeGlyph. + As it turns out, we need to make exactly five replacements. Note that each subsequent call to + ReplaceColors switches the order of parameters LocalBitmap and SomeGlyph. This is because + we are copying the image back and forth, replacing individual colors with each copy. } + + ReplaceColors(LocalBitmap, SomeGlyph, clYellow, clBtnHighlight); + ReplaceColors(SomeGlyph, LocalBitmap, clSilver, clBtnFace); + ReplaceColors(LocalBitmap, SomeGlyph, clGray, clBtnShadow); + ReplaceColors(SomeGlyph, LocalBitmap, clWhite, clWindow); + ReplaceColors(LocalBitmap, SomeGlyph, clRed, clWindowText); + finally + LocalBitmap.Free; + end; +end; + +procedure TJvTFGantt.PrepareAllBitmaps; +begin + { CDK: Replace BITMAP_RESOURCE_NAME with the name of your bitmap resource. } +// PrepareBitmaps(FCustomGlyphs, 'BITMAP_RESOURCE_NAME'); + { CDK: If you have other Glyphs that need loading/preparing, place additional + calls to PrepareBitmaps here. } +end; + +procedure TJvTFGantt.CMSysColorChange(var Msg: TLMessage); +begin + inherited; + PrepareAllBitmaps; +end; + +function TJvTFGantt.ClientCursorPos: TPoint; +begin + GetCursorPos(Result); + Result := ScreenToClient(Result); +end; + +function TJvTFGantt.ValidMouseAtDesignTime: Boolean; +begin + Result := False; +end; + +procedure TJvTFGantt.CMDesignHitTest(var Msg: TCMDesignHitTest); +begin + // True = Allow design-time mouse hits to get through if Alt key is down. + Msg.Result := Ord(ValidMouseAtDesignTime); +end; + +procedure TJvTFGantt.CMFontChanged(var Msg: TLMessage); +begin + inherited; + AdjustComponentHeightBasedOnFontChange; +end; + +procedure TJvTFGantt.AdjustComponentHeightBasedOnFontChange; +begin +{ CDK: Add code to calculate the new height. If this is a composite component + and you have any edit boxes, the edit box size will have already changed + based on the new font (providing this method is called from a CM_FontChanged + message handler). + + For example, your code might look like this: + + LockHeight := False; + Height := Edit1.Height; + Button1.Height := Height; + LockHeight := True; +} +end; + +//=== { TJvTFGanttScaleFormat } ============================================== + +constructor TJvTFGanttScaleFormat.Create; +begin + // (rom) added inherited Create + inherited Create; + FFont := TFont.Create; +end; + +destructor TJvTFGanttScaleFormat.Destroy; +begin + FFont.Free; + inherited Destroy; +end; + +function TJvTFGanttScaleFormat.GetFont: TFont; +begin + Result := FFont; +end; + +procedure TJvTFGanttScaleFormat.SetFont(const Value: TFont); +begin + FFont.Assign(Value); +end; + +//=== { TJvTFGanttScrollBar } ================================================ + +constructor TJvTFGanttScrollBar.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + // If we set the csNoDesignVisible flag then visibility at design time + // is controlled by the Visible property, which is exactly what we want. + ControlStyle := ControlStyle + [csNoDesignVisible]; + { + ParentCtl3D := False; + Ctl3D := False; + } +end; + +procedure TJvTFGanttScrollBar.CMDesignHitTest(var Msg: TCMDesignHitTest); +begin + Msg.Result := 1; +end; + +procedure TJvTFGanttScrollBar.CreateWnd; +begin + inherited CreateWnd; + UpdateRange; +end; + +function TJvTFGanttScrollBar.GetLargeChange: Integer; +begin + Result := inherited LargeChange; +end; + +procedure TJvTFGanttScrollBar.SetLargeChange(Value: Integer); +begin + inherited LargeChange := Value; + UpdateRange; +end; + +procedure TJvTFGanttScrollBar.UpdateRange; +var + Info: TScrollInfo; +begin + FillChar(Info, SizeOf(Info), 0); + with Info do + begin + cbSize := SizeOf(Info); + fMask := SIF_PAGE; + nPage := LargeChange; + end; + SetScrollInfo(Handle, SB_CTL, Info, True); +end; + + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfglance.pas b/components/jvcllaz/run/JvTimeFramework/jvtfglance.pas new file mode 100644 index 000000000..1b66b9c30 --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfglance.pas @@ -0,0 +1,4076 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFGlance.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFGlance; + +{$mode objfpc}{$H+} + +interface + +uses + LCLIntf, LCLType, LMessages, + SysUtils, Classes, {Windows, Messages, } Graphics, Controls, Forms, Dialogs, ImgList, + JvTFUtils, JvTFManager; + +type + EJvTFGlanceError = class(Exception); + EGlanceViewerError = class(EJvTFGlanceError); + + TJvTFGlanceCell = class; + TJvTFGlanceCells = class; + TJvTFCustomGlance = class; + TJvTFGlanceViewer = class; + TJvTFCellPics = class; + + TJvTFUpdateTitleEvent = procedure(Sender: TObject; var NewTitle: string) of object; + TJvApptHintEvent = procedure(Sender: TObject; Appt: TJvTFAppt; var Handled: Boolean) of object; + + TJvTFCellPic = class(TCollectionItem) + private + FPicName: string; + FPicIndex: Integer; + FPicPoint: TPoint; + FHints: TStringList; + function GetHints: TStrings; + procedure SetPicName(const Value: string); + procedure SetPicIndex(Value: Integer); + procedure SetHints(Value: TStrings); + protected + function GetDisplayName: string; override; + procedure Change; virtual; + procedure SetPicPoint(X, Y: Integer); + public + constructor Create(ACollection: TCollection); override; + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + function PicCollection: TJvTFCellPics; + property PicPoint: TPoint read FPicPoint; + published + property PicName: string read FPicName write SetPicName; + property PicIndex: Integer read FPicIndex write SetPicIndex; + property Hints: TStrings read GetHints write SetHints; + end; + + TJvTFCellPics = class(TCollection) + private + function GetItem(Index: Integer): TJvTFCellPic; + procedure SetItem(Index: Integer; Value: TJvTFCellPic); + protected + FGlanceCell: TJvTFGlanceCell; + function GetOwner: TPersistent; override; + public + constructor Create(AGlanceCell: TJvTFGlanceCell); + function Add: TJvTFCellPic; + property GlanceCell: TJvTFGlanceCell read FGlanceCell; + procedure Assign(Source: TPersistent); override; + property Items[Index: Integer]: TJvTFCellPic read GetItem write SetItem; default; + function PicByName(const PicName: string): TJvTFCellPic; + function GetPicIndex(const PicName: string): Integer; + function AddPic(const PicName: string; PicIndex: Integer): TJvTFCellPic; + end; + + TJvTFSplitOrientation = (soHorizontal, soVertical); + + TJvTFGlanceCell = class(TCollectionItem) + private + FColor: TColor; + FCellDate: TDate; + FColIndex: Integer; + FRowIndex: Integer; + FCellPics: TJvTFCellPics; + FCanSelect: Boolean; + FSchedules: TStringList; + FTitleText: string; + + FSplitRef: TJvTFGlanceCell; + FSplitOrientation: TJvTFSplitOrientation; + FIsSubCell: Boolean; + + procedure SetColor(Value: TColor); + procedure SetCellPics(Value: TJvTFCellPics); + procedure SetCanSelect(Value: Boolean); + function GetSchedule(AIndex: Integer): TJvTFSched; + procedure SetSplitOrientation(Value: TJvTFSplitOrientation); + function GetParentCell: TJvTFGlanceCell; + function GetSubCell: TJvTFGlanceCell; + protected + // (rom) bad names + FDestroying: Boolean; + FCellCollection: TJvTFGlanceCells; + function GetDisplayName: string; override; + procedure InternalSetCellDate(Value: TDate); + procedure SetCellDate(Value: TDate); + procedure SetColIndex(Value: Integer); + procedure SetRowIndex(Value: Integer); + procedure Change; virtual; + procedure SetTitleText(const Value: string); + procedure Split; + procedure Combine; + public + constructor Create(ACollection: TCollection); override; + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + property CellCollection: TJvTFGlanceCells read FCellCollection; + + function ScheduleCount: Integer; + property Schedules[AIndex: Integer]: TJvTFSched read GetSchedule; + function IndexOfSchedule(const SchedName: string; SchedDate: TDate): Integer; + function IndexOfSchedObj(ASched: TJvTFSched): Integer; + procedure CheckConnections; + function IsSchedUsed(ASched: TJvTFSched): Boolean; + property TitleText: string read FTitleText; + property SplitOrientation: TJvTFSplitOrientation read FSplitOrientation + write SetSplitOrientation default soHorizontal; + property SplitRef: TJvTFGlanceCell read FSplitRef; + function IsParent: Boolean; + function IsSubCell: Boolean; + function IsSplit: Boolean; + property ParentCell: TJvTFGlanceCell read GetParentCell; + property SubCell: TJvTFGlanceCell read GetSubCell; + published + property Color: TColor read FColor write SetColor; + property CellDate: TDate read FCellDate write SetCellDate; + property ColIndex: Integer read FColIndex; + property RowIndex: Integer read FRowIndex; + property CellPics: TJvTFCellPics read FCellPics write SetCellPics; + property CanSelect: Boolean read FCanSelect write SetCanSelect; + end; + +{ TODO: Clean up AddError, DestroyError, etc. in TJvTFGlanceCells and TJvTFGlanceCell } + TJvTFGlanceCells = class(TCollection) + private + FGlanceControl: TJvTFCustomGlance; + FDestroying: Boolean; + function GetItem(Index: Integer): TJvTFGlanceCell; + procedure SetItem(Index: Integer; Value: TJvTFGlanceCell); + function GetCell(ColIndex, RowIndex: Integer): TJvTFGlanceCell; + protected + // (rom) bad names + FAllowAdd: Boolean; + FAllowDestroy: Boolean; + FCheckingAllConnections: Boolean; + FConfiguring: Boolean; + function GetOwner: TPersistent; override; + function InternalAdd: TJvTFGlanceCell; + procedure AddError; dynamic; + procedure DestroyError; dynamic; + procedure EnsureCellCount; + procedure EnsureCells; + procedure ConfigCells; virtual; + procedure Update(Item: TCollectionItem); override; + public + constructor Create(AGlanceControl: TJvTFCustomGlance); + destructor Destroy; override; + function Add: TJvTFGlanceCell; + property GlanceControl: TJvTFCustomGlance read FGlanceControl; + procedure Assign(Source: TPersistent); override; + property Items[Index: Integer]: TJvTFGlanceCell read GetItem write SetItem; default; + property AllowAdd: Boolean read FAllowAdd; + property AllowDestroy: Boolean read FAllowDestroy; + property Cells[ColIndex, RowIndex: Integer]: TJvTFGlanceCell read GetCell; + procedure CheckConnections; + property Configuring: Boolean read FConfiguring; + procedure ReconfigCells; + + function IsSchedUsed(ASched: TJvTFSched): Boolean; + end; + + TJvTFFrameStyle = (fs3DRaised, fs3DLowered, fsFlat, fsNone); + TJvTFFrameAttr = class(TPersistent) + private + FStyle: TJvTFFrameStyle; + FColor: TColor; + FWidth: Integer; + FControl: TJvTFControl; + FOnChange: TNotifyEvent; + procedure SetStyle(Value: TJvTFFrameStyle); + procedure SetColor(Value: TColor); + procedure SetWidth(Value: Integer); + protected + procedure Change; virtual; + public + constructor Create(AOwner: TJvTFControl); + procedure Assign(Source: TPersistent); override; + property Control: TJvTFControl read FControl; + property OnChange: TNotifyEvent read FOnChange write FOnChange; + published + property Style: TJvTFFrameStyle read FStyle write SetStyle default fsFlat; + property Color: TColor read FColor write SetColor default clBlack; + property Width: Integer read FWidth write SetWidth default 1; + end; + + TJvTFGlanceFrameAttr = class(TJvTFFrameAttr) + private + FGlanceControl: TJvTFCustomGlance; + protected + procedure Change; override; + public + constructor Create(AOwner: TJvTFCustomGlance); + property GlanceControl: TJvTFCustomGlance read FGlanceControl; + end; + + TJvTFTextAttr = class(TPersistent) + private + FFont: TFont; + FOnChange: TNotifyEvent; + FRotation: Integer; + FAlignH: TAlignment; + FAlignV: TJvTFVAlignment; + procedure SetFont(Value: TFont); + procedure SetRotation(Value: Integer); + procedure SetAlignH(Value: TAlignment); + procedure SetAlignV(Value: TJvTFVAlignment); + protected + procedure FontChange(Sender: TObject); + procedure DoChange; virtual; + public + constructor Create; + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + property OnChange: TNotifyEvent read FOnChange write FOnChange; + published + property Font: TFont read FFont write SetFont; + property Rotation: Integer read FRotation write SetRotation default 0; + property AlignH: TAlignment read FAlignH write SetAlignH default taLeftJustify; + property AlignV: TJvTFVAlignment read FAlignV write SetAlignV default vaCenter; + end; + + TJvTFGlanceTitlePicAttr = class(TPersistent) + private + FAlignH: TAlignment; + FAlignV: TJvTFVAlignment; + FOnChange: TNotifyEvent; + procedure SetAlignH(Value: TAlignment); + procedure SetAlignV(Value: TJvTFVAlignment); + protected + procedure DoChange; + public + constructor Create; + procedure Assign(Source: TPersistent); override; + property OnChange: TNotifyEvent read FOnChange write FOnChange; + published + property AlignH: TAlignment read FAlignH write SetAlignH default taLeftJustify; + property AlignV: TJvTFVAlignment read FAlignV write SetAlignV default vaCenter; + end; + + TJvTFTitleAlign = alTop..alRight; + TJvTFGlanceTitleAttr = class(TPersistent) + private + FAlign: TJvTFTitleAlign; + //FDayFormat: string; + FColor: TColor; + FHeight: Integer; + FVisible: Boolean; + FFrameAttr: TJvTFGlanceFrameAttr; + FGlanceControl: TJvTFCustomGlance; + FDayTxtAttr: TJvTFTextAttr; + FPicAttr: TJvTFGlanceTitlePicAttr; + procedure SetAlign(Value: TJvTFTitleAlign); + //procedure SetDayFormat(Value: string); + procedure SetColor(Value: TColor); + procedure SetHeight(Value: Integer); + procedure SetVisible(Value: Boolean); + procedure SetFrameAttr(Value: TJvTFGlanceFrameAttr); + procedure SetDayTxtAttr(Value: TJvTFTextAttr); + procedure SetPicAttr(Value: TJvTFGlanceTitlePicAttr); + protected + procedure Change; + procedure TxtAttrChange(Sender: TObject); + procedure PicAttrChange(Sender: TObject); + public + constructor Create(AOwner: TJvTFCustomGlance); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + property GlanceControl: TJvTFCustomGlance read FGlanceControl; + published + property Align: TJvTFTitleAlign read FAlign write SetAlign default alTop; + //property DayFormat: string read FDayFormat write SetDayFormat; + property Color: TColor read FColor write SetColor default clBtnFace; + property Height: Integer read FHeight write SetHeight default 20; + property Visible: Boolean read FVisible write SetVisible default True; + property FrameAttr: TJvTFGlanceFrameAttr read FFrameAttr write SetFrameAttr; + property DayTxtAttr: TJvTFTextAttr read FDayTxtAttr write SetDayTxtAttr; + property PicAttr: TJvTFGlanceTitlePicAttr read FPicAttr write SetPicAttr; + end; + + TJvTFGlanceCellAttr = class(TPersistent) + private + FColor: TColor; + FFrameAttr: TJvTFGlanceFrameAttr; + FTitleAttr: TJvTFGlanceTitleAttr; + FGlanceControl: TJvTFCustomGlance; + FFont: TFont; + FDrawBottomLine: Boolean; + procedure SetColor(Value: TColor); + procedure SetFrameAttr(Value: TJvTFGlanceFrameAttr); + procedure SetTitleAttr(Value: TJvTFGlanceTitleAttr); + procedure SetFont(Value: TFont); + procedure SetDrawBottomLine(Value: Boolean); + protected + procedure FontChange(Sender: TObject); + procedure Change; + public + constructor Create(AOwner: TJvTFCustomGlance); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + property GlanceControl: TJvTFCustomGlance read FGlanceControl; + published + property Color: TColor read FColor write SetColor default clWhite; + property Font: TFont read FFont write SetFont; + property FrameAttr: TJvTFGlanceFrameAttr read FFrameAttr write SetFrameAttr; + property TitleAttr: TJvTFGlanceTitleAttr read FTitleAttr write SetTitleAttr; + property DrawBottomLine: Boolean read FDrawBottomLine write SetDrawBottomLine; + end; + + TJvTFGlanceTitle = class(TPersistent) + private + FColor: TColor; + FHeight: Integer; + FVisible: Boolean; + FGlanceControl: TJvTFCustomGlance; + FFrameAttr: TJvTFGlanceFrameAttr; + FTxtAttr: TJvTFTextAttr; + FOnChange: TNotifyEvent; + procedure SetColor(Value: TColor); + procedure SetHeight(Value: Integer); + procedure SetVisible(Value: Boolean); + procedure SetFrameAttr(Value: TJvTFGlanceFrameAttr); + procedure SetTxtAttr(Value: TJvTFTextAttr); + protected + procedure Change; + procedure TxtAttrChange(Sender: TObject); + public + constructor Create(AOwner: TJvTFCustomGlance); + destructor Destroy; override; + + procedure Assign(Source: TPersistent); override; + property GlanceControl: TJvTFCustomGlance read FGlanceControl; + property OnChange: TNotifyEvent read FOnChange write FOnChange; + published + property Color: TColor read FColor write SetColor default clBtnFace; + property FrameAttr: TJvTFGlanceFrameAttr read FFrameAttr write SetFrameAttr; + property Height: Integer read FHeight write SetHeight default 40; + property Visible: Boolean read FVisible write SetVisible default True; + property TxtAttr: TJvTFTextAttr read FTxtAttr write SetTxtAttr; + end; + + TJvTFGlanceMainTitle = class(TJvTFGlanceTitle) + private + FTitle: string; + procedure SetTitle(const Value: string); + public + constructor Create(AOwner: TJvTFCustomGlance); + procedure Assign(Source: TPersistent); override; + published + property Title: string read FTitle write SetTitle; + end; + + TJvTFGlanceCoord = record + Col: Integer; + Row: Integer; + Cell: TJvTFGlanceCell; + CellX: Integer; + CellY: Integer; + AbsX: Integer; + AbsY: Integer; + DragAccept: Boolean; + InCellTitle: Boolean; + CellTitlePic: TJvTFCellPic; + Appt: TJvTFAppt; + end; + + TJvTFGlanceSelOrder = (soColMajor, soRowMajor, soRect); + + TJvTFGlanceSelList = class(TJvTFDateList) + private + FGlanceControl: TJvTFCustomGlance; + public + constructor Create(AOwner: TJvTFCustomGlance); + property GlanceControl: TJvTFCustomGlance read FGlanceControl; + end; + + TJvTFGlanceDrawTitleEvent = procedure(Sender: TObject; ACanvas: TCanvas; + ARect: TRect) of object; + TJvTFGlanceDrawCellEvent = procedure(Sender: TObject; ACanvas: TCanvas; + ACellRect, ATitleRect, ABodyRect: TRect; Attr: TJvTFGlanceCellAttr; + Cell: TJvTFGlanceCell) of object; + + TJvTFGlanceDropApptEvent = procedure(Sender: TObject; Appt: TJvTFAppt; + var NewStartDate, NewEndDate: TDate; var Confirm: Boolean) of object; + + TJvTFUpdateCellTitleTextEvent = procedure(Sender: TObject; Cell: TJvTFGlanceCell; + var NewText: string) of object; + + TJvTFCustomGlance = class(TJvTFControl) + private + FGapSize: Integer; + FBorderStyle: TBorderStyle; + //FStartOfWeek: Word; + FStartOfWeek: TTFDayOfWeek; + + FRowCount: Integer; + FColCount: Integer; + FCells: TJvTFGlanceCells; + FStartDate: TDate; + FOriginDate: TDate; + FCellPics: TCustomImageList; + + FTitleAttr: TJvTFGlanceMainTitle; + FAllowCustomDates: Boolean; + + FCellAttr: TJvTFGlanceCellAttr; + FSelCellAttr: TJvTFGlanceCellAttr; + FSelOrder: TJvTFGlanceSelOrder; + FSel: TJvTFGlanceSelList; + FUpdatingSel: Boolean; + + FViewer: TJvTFGlanceViewer; + + FOnConfigCells: TNotifyEvent; + FOnDrawTitle: TJvTFGlanceDrawTitleEvent; + FOnDrawCell: TJvTFGlanceDrawCellEvent; + FOnSelChanged: TNotifyEvent; + FOnDropAppt: TJvTFGlanceDropApptEvent; + FOnUpdateCellTitleText: TJvTFUpdateCellTitleTextEvent; + + FHintProps: TJvTFHintProps; + + FSchedNames: TStringList; + + FSelAppt: TJvTFAppt; + FOnApptHint: TJvApptHintEvent; + + function GetSchedNames: TStrings; + procedure SetBorderStyle(Value: TBorderStyle); + + procedure SetRowCount(Value: Integer); + procedure SetCells(Value: TJvTFGlanceCells); + procedure SetStartDate(Value: TDate); + procedure SetOriginDate(Value: TDate); + procedure SetTitleAttr(Value: TJvTFGlanceMainTitle); + + procedure SetCellAttr(Value: TJvTFGlanceCellAttr); + procedure SetTFSelCellAttr(Value: TJvTFGlanceCellAttr); + procedure SetViewer(Value: TJvTFGlanceViewer); + procedure SetCellPics(Value: TCustomImageList); + + procedure SetHintProps(Value: TJvTFHintProps); + procedure SetSchedNames(Value: TStrings); + + procedure SetSelAppt(Value: TJvTFAppt); + protected + // (rom) bad names + FCreatingControl: Boolean; + + FPaintBuffer: TBitmap; + FSelAnchor: TJvTFGlanceCell; + FMouseCell: TJvTFGlanceCell; + FImageChangeLink: TChangeLink; + FHint: TJvTFHint; + + procedure SetColCount(Value: Integer); virtual; + procedure SetStartOfWeek(Value: TTFDayOfWeek); virtual; + + procedure EnsureCol(Col: Integer); + procedure EnsureRow(Row: Integer); + procedure EnsureCell(ACell: TJvTFGlanceCell); + function ValidCol(Col: Integer): Boolean; + function ValidRow(Row: Integer): Boolean; + function ValidCell(Col, Row: Integer): Boolean; + + procedure WMEraseBkgnd(var Msg: TLMessage); message LM_ERASEBKGND; + procedure CMCtl3DChanged(var Msg: TLMessage); message CM_CTL3DCHANGED; + procedure Loaded; override; + procedure Notification(AComponent: TComponent; Operation: TOperation); override; + procedure ImageListChange(Sender: TObject); + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); override; + + procedure GlanceTitleChange(Sender: TObject); + + // mouse routines + procedure MouseDown(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); override; + procedure MouseMove(Shift: TShiftState; X, Y: Integer); override; + procedure MouseUp(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); override; + procedure DblClick; override; + procedure Click; override; + + procedure CheckApptHint(Info: TJvTFGlanceCoord); virtual; + + // Drag/Drop routines + procedure DoStartDrag(var DragObject: TDragObject); override; + procedure DragOver(Source: TObject; X, Y: Integer; State: TDragState; + var Accept: Boolean); override; + procedure DoEndDrag(Target: TObject; X, Y: Integer); override; + procedure DropAppt(ADragInfo: TJvTFDragInfo; X, Y: Integer); + + // selection routines + procedure UpdateSelection; + procedure SelChange(Sender: TObject); virtual; + property SelOrder: TJvTFGlanceSelOrder read FSelOrder write FSelOrder; + procedure InternalSelectCell(ACell: TJvTFGlanceCell); virtual; + procedure InternalDeselectCell(ACell: TJvTFGlanceCell); virtual; + + // Drawing routines + procedure Paint; override; + procedure DrawTitle(ACanvas: TCanvas); virtual; + procedure DrawCells(ACanvas: TCanvas); + procedure DrawCell(ACanvas: TCanvas; ACell: TJvTFGlanceCell); + procedure DrawCellTitle(ACanvas: TCanvas; ATitleRect: TRect; + Attr: TJvTFGlanceCellAttr; Cell: TJvTFGlanceCell); + procedure DrawCellTitleFrame(ACanvas: TCanvas; ATitleRect: TRect; + Attr: TJvTFGlanceCellAttr); + procedure DrawCellFrame(ACanvas: TCanvas; ARect: TRect; + Attr: TJvTFGlanceCellAttr; ACell: TJvTFGlanceCell); + procedure Draw3DFrame(ACanvas: TCanvas; ARect: TRect; TLColor, + BRColor: TColor); + function PicsToDraw(ACell: TJvTFGlanceCell): Boolean; + procedure GetPicsWidthHeight(ACell: TJvTFGlanceCell; PicBuffer: Integer; + Horz: Boolean; var PicsWidth, PicsHeight: Integer); + function ValidPicIndex(PicIndex: Integer): Boolean; + + // Drawing event dispatch methods + procedure DoDrawTitle(ACanvas: TCanvas; ARect: TRect); virtual; + procedure DoDrawCell(ACanvas: TCanvas; ACellRect, ATitleRect, + ABodyRect: TRect; Attr: TJvTFGlanceCellAttr; Cell: TJvTFGlanceCell); virtual; + + procedure ConfigCells; virtual; + procedure DoConfigCells; virtual; + procedure SetCellDate(ACell: TJvTFGlanceCell; CellDate: TDate); + procedure UpdateCellTitles; + procedure UpdateCellTitleText(Cell: TJvTFGlanceCell); + function GetCellTitleText(Cell: TJvTFGlanceCell): string; virtual; + + procedure CreateParams(var Params: TCreateParams); override; + + procedure SchedNamesChange(Sender: TObject); + property SelAppt: TJvTFAppt read FSelAppt write SetSelAppt; + property AllowCustomDates: Boolean read FAllowCustomDates write FAllowCustomDates; + // configuration properties and events + property RowCount: Integer read FRowCount write SetRowCount default 6; + property ColCount: Integer read FColCount write SetColCount default 7; + property StartDate: TDate read FStartDate write SetStartDate; + property OriginDate: TDate read FOriginDate write SetOriginDate; + property OnConfigCells: TNotifyEvent read FOnConfigCells write FOnConfigCells; + property StartOfWeek: TTFDayOfWeek read FStartOfWeek write SetStartOfWeek default dowSunday; + public + function GetTFHintClass: TJvTFHintClass; dynamic; + + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + procedure SetBounds(ALeft, ATop, AWidth, AHeight: Integer); override; + + procedure ReleaseSchedule(const SchedName: string; SchedDate: TDate); override; + procedure SafeReleaseSchedule(ASched: TJvTFSched); + + function GetDataTop: Integer; dynamic; + function GetDataLeft: Integer; dynamic; + function GetDataWidth: Integer; dynamic; + function GetDataHeight: Integer; dynamic; + + procedure SplitRects(Col, Row: Integer; var ParentRect, SubRect: TRect); + function CellRect(ACell: TJvTFGlanceCell): TRect; + function WholeCellRect(Col, Row: Integer): TRect; + function TitleRect: TRect; + function CellTitleRect(ACell: TJvTFGlanceCell): TRect; + function CellBodyRect(ACell: TJvTFGlanceCell): TRect; + function CalcCellTitleRect(ACell: TJvTFGlanceCell; Selected, Full: Boolean): TRect; + function CalcCellBodyRect(ACell: TJvTFGlanceCell; Selected, Full: Boolean): TRect; + function PtToCell(X, Y: Integer): TJvTFGlanceCoord; + property Sel: TJvTFGlanceSelList read FSel write FSel; + function DateIsSelected(ADate: TDate): Boolean; + function CellIsSelected(ACell: TJvTFGlanceCell): Boolean; + procedure SelectCell(ACell: TJvTFGlanceCell; Clear: Boolean = True); virtual; + procedure DeselectCell(ACell: TJvTFGlanceCell); virtual; + procedure BeginSelUpdate; + procedure EndSelUpdate; + property UpdatingSel: Boolean read FUpdatingSel; + + function GetCellAttr(ACell: TJvTFGlanceCell): TJvTFGlanceCellAttr; virtual; + procedure CheckViewerApptHint(X, Y: Integer); + + procedure DragDrop(Source: TObject; X, Y: Integer); override; + procedure ReconfigCells; + procedure SplitCell(ACell: TJvTFGlanceCell); + procedure CombineCell(ACell: TJvTFGlanceCell); + published + property Cells: TJvTFGlanceCells read FCells write SetCells; + property BorderStyle: TBorderStyle read FBorderStyle write SetBorderStyle default bsSingle; + property GapSize: Integer read FGapSize write FGapSize; + property TitleAttr: TJvTFGlanceMainTitle read FTitleAttr write SetTitleAttr; + property CellAttr: TJvTFGlanceCellAttr read FCellAttr write SetCellAttr; + property SelCellAttr: TJvTFGlanceCellAttr read FSelCellAttr write SetTFSelCellAttr; + property CellPics: TCustomImageList read FCellPics write SetCellPics; + property Viewer: TJvTFGlanceViewer read FViewer write SetViewer; + property HintProps: TJvTFHintProps read FHintProps write SetHintProps; + property SchedNames: TStrings read GetSchedNames write SetSchedNames; + property OnDrawTitle: TJvTFGlanceDrawTitleEvent read FOnDrawTitle write FOnDrawTitle; + property OnDrawCell: TJvTFGlanceDrawCellEvent read FOnDrawCell write FOnDrawCell; + property OnSelChanged: TNotifyEvent read FOnSelChanged write FOnSelChanged; + property OnDropAppt: TJvTFGlanceDropApptEvent read FOnDropAppt write FOnDropAppt; + property OnUpdateCellTitleText: TJvTFUpdateCellTitleTextEvent read FOnUpdateCellTitleText + write FOnUpdateCellTitleText; + property OnApptHint: TJvApptHintEvent read FOnApptHint write FOnApptHint; + + property DateFormat; // from TJvTFControl + property TimeFormat; // from TJvTFControl + + property Align; + property Color default clWindow; + property ParentColor default False; + property TabStop default True; + property TabOrder; + property Anchors; + property Constraints; + property DragKind; + property DragCursor; + property DragMode; + property Enabled; + property ParentShowHint; + property PopupMenu; + property ShowHint; + property Visible; + + property OnClick; + property OnDblClick; + property OnDragDrop; + property OnDragOver; + property OnEndDrag; + property OnEnter; + property OnExit; + property OnKeyDown; + property OnKeyPress; + property OnKeyUp; + property OnMouseDown; + property OnMouseMove; + property OnMouseUp; + property OnMouseWheelDown; + property OnMouseWheelUp; + property OnEndDock; + property OnStartDock; + property OnStartDrag; + end; + + TJvTFGlanceViewer = class(TComponent) + private + FGlanceControl: TJvTFCustomGlance; + FVisible: Boolean; + FCell: TJvTFGlanceCell; + FPhysicalCell: TJvTFGlanceCell; + FRepeatGrouped: Boolean; + FShowSchedNamesInHint: Boolean; + FShowStartEndTimeInHint: Boolean; + FOnApptHint: TJvApptHintEvent; + procedure DoGlanceControlApptHint(Sender: TObject; Appt: TJvTFAppt; var Handled: Boolean); + procedure SetShowSchedNamesInHint(const Value: Boolean); + function GetRepeatAppt(Index: Integer): TJvTFAppt; + function GetSchedule(Index: Integer): TJvTFSched; + function GetDate: TDate; + procedure SetRepeatGrouped(Value: Boolean); + function GetDistinctAppt(Index: Integer): TJvTFAppt; + function GetAppt(Index: Integer): TJvTFAppt; + procedure SetShowStartEndTimeInHint(const Value: Boolean); + protected + FInPlaceEdit: Boolean; + + procedure SetInplaceEdit(const Value: Boolean); virtual; + procedure SetVisible(Value: Boolean); virtual; abstract; + procedure SetGlanceControl(Value: TJvTFCustomGlance); virtual; + procedure ParentReconfig; virtual; + procedure EnsureCol(ACol: Integer); + procedure EnsureRow(ARow: Integer); + procedure MouseAccel(X, Y: Integer); virtual; + procedure GetDistinctAppts(ApptList: TStringList); + + procedure FinishEditAppt; virtual; + function Editing: Boolean; virtual; + function CanEdit: Boolean; virtual; + public + constructor Create(AOwner: TComponent); override; + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); virtual; + + procedure SetTo(ACell: TJvTFGlanceCell); virtual; + procedure MoveTo(ACell: TJvTFGlanceCell); virtual; + procedure Refresh; virtual; abstract; + procedure Realign; virtual; abstract; + procedure PaintTo(ACanvas: TCanvas; ACell: TJvTFGlanceCell); virtual; abstract; + + property GlanceControl: TJvTFCustomGlance read FGlanceControl; + property Cell: TJvTFGlanceCell read FCell; + property PhysicalCell: TJvTFGlanceCell read FPhysicalCell; + property Date: TDate read GetDate; + property Visible: Boolean read FVisible write SetVisible; + function CalcBoundsRect(ACell: TJvTFGlanceCell): TRect; virtual; + + function ApptCount: Integer; + property Appts[Index: Integer]: TJvTFAppt read GetAppt; + function ScheduleCount: Integer; + property Schedules[Index: Integer]: TJvTFSched read GetSchedule; + function GetApptAt(X, Y: Integer): TJvTFAppt; virtual; + published + property RepeatGrouped: Boolean read FRepeatGrouped write SetRepeatGrouped default True; + property ShowSchedNamesInHint: Boolean read FShowSchedNamesInHint write SetShowSchedNamesInHint default True; + property ShowStartEndTimeInHint: Boolean read FShowStartEndTimeInHint write SetShowStartEndTimeInHint default True; + property InPlaceEdit: Boolean read FInPlaceEdit write SetInplaceEdit default True; + property OnApptHint: TJvApptHintEvent read FOnApptHint write FOnApptHint; + end; + + TJvTFGlance = class(TJvTFCustomGlance) + public + constructor Create(AOwner: TComponent); override; + published + property RowCount; + property ColCount; + property OriginDate; + property OnConfigCells; + end; + + +implementation + +uses + JvResources, {JclStrings,} JvJVCLUtils; + +//=== { TJvTFGlanceCell } ==================================================== + +constructor TJvTFGlanceCell.Create(ACollection: TCollection); +begin + inherited Create(ACollection); + FCellCollection := TJvTFGlanceCells(ACollection); + + if Assigned(CellCollection) and not CellCollection.AllowAdd then + CellCollection.AddError; + + FCellPics := TJvTFCellPics.Create(Self); + FCanSelect := True; + + FSchedules := TStringList.Create; + FSplitOrientation := soHorizontal; +end; + +destructor TJvTFGlanceCell.Destroy; +var + DisconnectList: TStringList; + I: Integer; + ASched: TJvTFSched; +begin + FDestroying := True; + + //if not CellCollection.AllowDestroy and not CellCollection.FDestroying then + //CellCollection.DestroyError; + + if not IsSubCell then + FSplitRef.Free + else + if Assigned(FSplitRef) then + begin + FSplitRef.FSplitRef := nil; + FSplitRef := nil; + end; + + FCellPics.Free; + + DisconnectList := TStringList.Create; + try + DisconnectList.Assign(FSchedules); + FSchedules.Clear; + + for I := 0 to DisconnectList.Count - 1 do + begin + ASched := TJvTFSched(DisconnectList.Objects[I]); + CellCollection.GlanceControl.ReleaseSchedule(ASched.SchedName, + ASched.SchedDate); + end; + finally + DisconnectList.Free; + end; + FSchedules.Free; + + inherited Destroy; +end; + +{ TODO 3 -cMisc: Complete TGlance.Assign } + +procedure TJvTFGlanceCell.Assign(Source: TPersistent); +begin + if Source is TJvTFGlanceCell then + begin + end + else + inherited Assign(Source); +end; + +procedure TJvTFGlanceCell.Change; +begin + if Assigned(CellCollection.GlanceControl) then + CellCollection.GlanceControl.Invalidate; +end; + +procedure TJvTFGlanceCell.CheckConnections; +var + GlanceControl: TJvTFCustomGlance; + I: Integer; + ASched: TJvTFSched; + ASchedName, ASchedID: string; +begin + GlanceControl := CellCollection.GlanceControl; + + if CellCollection.Configuring or not Assigned(GlanceControl.ScheduleManager) or + (csLoading in GlanceControl.ComponentState) then + Exit; + + // First, disconnect any schedules that shouldn't be connected + I := 0; + while I < FSchedules.Count do + begin + ASched := TJvTFSched(FSchedules.Objects[I]); + if (GlanceControl.SchedNames.IndexOf(ASched.SchedName) = -1) or + not EqualDates(ASched.SchedDate, CellDate) then + begin + FSchedules.Delete(I); + GlanceControl.SafeReleaseSchedule(ASched); + end + else + Inc(I); + end; + + // Now connect any schedules that are not connected and should be + for I := 0 to GlanceControl.SchedNames.Count - 1 do + begin + ASchedName := GlanceControl.SchedNames[I]; + ASchedID := TJvTFScheduleManager.GetScheduleID(ASchedName, CellDate); + if FSchedules.IndexOf(ASchedID) = -1 then + begin + ASched := GlanceControl.RetrieveSchedule(ASchedName, CellDate); + FSchedules.AddObject(ASchedID, ASched); + end; + end; + + if not CellCollection.FCheckingAllConnections then + GlanceControl.ScheduleManager.ProcessBatches; +end; + +procedure TJvTFGlanceCell.Combine; +var + LSubCell: TJvTFGlanceCell; +begin + if IsSplit then + begin + LSubCell := SubCell; + FSplitRef.FSplitRef := nil; + FSplitRef := nil; + CellCollection.ReconfigCells; + if not FDestroying and (LSubCell <> Self) then + LSubCell.Free; + end; +end; + +function TJvTFGlanceCell.GetDisplayName: string; +var + Glance: TJvTFCustomGlance; +begin + Glance := CellCollection.GlanceControl; + if Assigned(Glance) then + Result := FormatDateTime(Glance.DateFormat, CellDate) + else + Result := FormatDateTime('m/d/yyyy', CellDate); +end; + +function TJvTFGlanceCell.GetParentCell: TJvTFGlanceCell; +begin + if IsParent then + Result := Self + else + Result := SplitRef; +end; + +function TJvTFGlanceCell.GetSchedule(AIndex: Integer): TJvTFSched; +begin + Result := TJvTFSched(FSchedules.Objects[AIndex]); +end; + +function TJvTFGlanceCell.GetSubCell: TJvTFGlanceCell; +begin + if IsSubCell then + Result := Self + else + Result := SplitRef; +end; + +function TJvTFGlanceCell.IndexOfSchedObj(ASched: TJvTFSched): Integer; +begin + Result := FSchedules.IndexOfObject(ASched); +end; + +function TJvTFGlanceCell.IndexOfSchedule(const SchedName: string; SchedDate: TDate): Integer; +begin + Result := FSchedules.IndexOf(TJvTFScheduleManager.GetScheduleID(SchedName, SchedDate)); +end; + +procedure TJvTFGlanceCell.InternalSetCellDate(Value: TDate); +begin + if not EqualDates(Value, FCellDate) then + begin + FCellDate := Value; + if not CellCollection.Configuring and + not (csLoading in CellCollection.GlanceControl.ComponentState) then + begin + CellCollection.GlanceControl.UpdateCellTitleText(Self); + CheckConnections; + end; + end; +end; + +function TJvTFGlanceCell.IsParent: Boolean; +begin + Result := not IsSubCell; +end; + +function TJvTFGlanceCell.IsSchedUsed(ASched: TJvTFSched): Boolean; +begin + Result := IndexOfSchedObj(ASched) <> -1; +end; + +function TJvTFGlanceCell.IsSplit: Boolean; +begin + //Result := Assigned(ParentCell.SubCell); + Result := Assigned(FSplitRef); +end; + +function TJvTFGlanceCell.IsSubCell: Boolean; +begin + Result := FIsSubCell; +end; + +function TJvTFGlanceCell.ScheduleCount: Integer; +begin + Result := FSchedules.Count; +end; + +procedure TJvTFGlanceCell.SetCanSelect(Value: Boolean); +begin + FCanSelect := Value; +end; + +procedure TJvTFGlanceCell.SetCellDate(Value: TDate); +begin + if Assigned(CellCollection.GlanceControl) and + (not CellCollection.GlanceControl.AllowCustomDates and + not (csLoading in CellCollection.GlanceControl.ComponentState)) then + raise EJvTFGlanceError.CreateRes(@RsECellDatesCannotBeChanged); + + InternalSetCellDate(Value); +end; + +procedure TJvTFGlanceCell.SetCellPics(Value: TJvTFCellPics); +begin + FCellPics.Assign(Value); + Change; +end; + +procedure TJvTFGlanceCell.SetColIndex(Value: Integer); +begin + FColIndex := Value; +end; + +procedure TJvTFGlanceCell.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFGlanceCell.SetRowIndex(Value: Integer); +begin + FRowIndex := Value; +end; + +//=== { TJvTFGlanceCells } =================================================== + +constructor TJvTFGlanceCells.Create(AGlanceControl: TJvTFCustomGlance); +begin + inherited Create(TJvTFGlanceCell); + FGlanceControl := AGlanceControl; +end; + +destructor TJvTFGlanceCells.Destroy; +begin + FDestroying := True; + inherited Destroy; +end; + +function TJvTFGlanceCells.Add: TJvTFGlanceCell; +begin + Result := nil; + AddError; +end; + +procedure TJvTFGlanceCells.AddError; +begin + //if Assigned(GlanceControl) and not (csLoading in GlanceControl.ComponentState) then + //raise EJvTFGlanceError.Create('Cells cannot be manually added'); +end; + +procedure TJvTFGlanceCells.Assign(Source: TPersistent); +var + I: Integer; +begin + if Source is TJvTFGlanceCells then + begin + BeginUpdate; + try + FAllowDestroy := True; + try + Clear; + finally + FAllowDestroy := False; + end; + + for I := 0 to TJvTFGlanceCells(Source).Count - 1 do + InternalAdd.Assign(TJvTFGlanceCells(Source).Items[I]); + finally + EndUpdate; + end; + end + else + inherited Assign(Source); +end; + +procedure TJvTFGlanceCells.CheckConnections; +var + I: Integer; +begin + if (not Assigned(GlanceControl) or not Assigned(GlanceControl.ScheduleManager)) or + (csLoading in GlanceControl.ComponentState) then + Exit; + + FCheckingAllConnections := True; + try + { + for I := 0 to Count - 1 do + Items[I].CheckConnections; + } + for I := 0 to Count - 1 do + with Items[I] do + begin + CheckConnections; + if IsSplit then + SubCell.CheckConnections; + end; + finally + FCheckingAllConnections := False; + GlanceControl.ScheduleManager.ProcessBatches; + end; +end; + +procedure TJvTFGlanceCells.ConfigCells; +begin + { + if not Assigned(GlanceControl) or + (csDesigning in GlanceControl.ComponentState) then + Exit; + } + if Configuring then + Exit; + + FConfiguring := True; + try + GlanceControl.ConfigCells; + finally + FConfiguring := False; + end; + + // connect and release cells to/from schedule objects here. + CheckConnections; + + if Assigned(GlanceControl.Viewer) then + GlanceControl.Viewer.ParentReconfig; +end; + +procedure TJvTFGlanceCells.DestroyError; +begin + //raise EJvTFGlanceError.Create('Cells cannot be manually destroyed'); +end; + +procedure TJvTFGlanceCells.EnsureCellCount; +var + I, DeltaCount: Integer; +begin + { + if not Assigned(GlanceControl) or + (csDesigning in GlanceControl.ComponentState) then + Exit; + } + if not Assigned(GlanceControl) then + Exit; + + // Adjust the cell count + DeltaCount := GlanceControl.RowCount * GlanceControl.ColCount - Count; + + for I := 1 to DeltaCount do + InternalAdd; + + FAllowDestroy := True; + try + for I := -1 downto DeltaCount do + Items[Count - 1].Free; + finally + FAllowDestroy := False; + end; +end; + +procedure TJvTFGlanceCells.EnsureCells; +var + I, J, K: Integer; + SaveConfiguring: Boolean; +begin + SaveConfiguring := Configuring; + FConfiguring := True; + try + EnsureCellCount; + + K := 0; + for I := 0 to GlanceControl.RowCount - 1 do + for J := 0 to GlanceControl.ColCount - 1 do + with Items[K] do + begin + SetColIndex(J); + SetRowIndex(I); + CellPics.Clear; + Combine; + Inc(K); + end; + finally + FConfiguring := SaveConfiguring; + end; +end; + +function TJvTFGlanceCells.GetCell(ColIndex, RowIndex: Integer): TJvTFGlanceCell; +var + AbsIndex: Integer; + S: string; +begin + Result := nil; + if not Assigned(GlanceControl) then + Exit; + + AbsIndex := RowIndex * GlanceControl.ColCount + ColIndex; + if (AbsIndex >= 0) and (AbsIndex < Count) then + begin + Result := Items[AbsIndex]; + if ((Result.ColIndex <> ColIndex) or (Result.RowIndex <> RowIndex)) and not (csDesigning in GlanceControl.ComponentState) then + begin + S := '(' + IntToStr(Result.ColIndex) + ':' + IntToStr(ColIndex) + ') ' + + '(' + IntToStr(Result.RowIndex) + ':' + IntToStr(RowIndex) + ')'; + raise EJvTFGlanceError.CreateResFmt(@RsECellMapHasBeenCorrupteds, [S]); + end; + end; +end; + +function TJvTFGlanceCells.GetItem(Index: Integer): TJvTFGlanceCell; +begin + Result := TJvTFGlanceCell(inherited GetItem(Index)); +end; + +function TJvTFGlanceCells.GetOwner: TPersistent; +begin + Result := GlanceControl; +end; + +function TJvTFGlanceCells.InternalAdd: TJvTFGlanceCell; +begin + FAllowAdd := True; + try + Result := TJvTFGlanceCell(inherited Add); + finally + FAllowAdd := False; + end; +end; + +function TJvTFGlanceCells.IsSchedUsed(ASched: TJvTFSched): Boolean; +var + I: Integer; + ACell: TJvTFGlanceCell; +begin + Result := False; + I := 0; + while (I < Count) and not Result do + begin + ACell := Items[I]; + + if ACell.IsSchedUsed(ASched) then + Result := True + else + if ACell.IsSplit and ACell.SubCell.IsSchedUsed(ASched) then + Result := True + else + Inc(I); + end; +end; + +procedure TJvTFGlanceCells.ReconfigCells; +var + I: Integer; +begin + if FConfiguring then + Exit; + + FConfiguring := True; + try + for I := 0 to Count - 1 do + with Items[I] do + begin + CellPics.Clear; + if IsSplit then + SubCell.CellPics.Clear; + end; + EnsureCells; + GlanceControl.ConfigCells; + finally + FConfiguring := False; + end; + + // connect and release cells to/from schedule objects here. + CheckConnections; + + if Assigned(GlanceControl.Viewer) then + GlanceControl.Viewer.ParentReconfig; + GlanceControl.Invalidate; +end; + +procedure TJvTFGlanceCells.SetItem(Index: Integer; Value: TJvTFGlanceCell); +begin + inherited SetItem(Index, Value); +end; + +procedure TJvTFGlanceCells.Update(Item: TCollectionItem); +begin +end; + +//=== { TJvTFCustomGlance } ================================================== + +constructor TJvTFCustomGlance.Create(AOwner: TComponent); +begin + FCreatingControl := True; + + AllowCustomDates := False; + inherited Create(AOwner); + ControlStyle := ControlStyle + [csOpaque, csCaptureMouse, csClickEvents, + csDoubleClicks]; + TabStop := True; + Height := 300; + Width := 300; + + //Color := clRed; + FBorderStyle := bsSingle; + FStartOfWeek := dowSunday; + FGapSize := 0; + FRowCount := 6; + FColCount := 7; + + FPaintBuffer := TBitmap.Create; + + FSchedNames := TStringList.Create; + FSchedNames.OnChange := @SchedNamesChange; + + FCells := TJvTFGlanceCells.Create(Self); + StartDate := Date; + + FTitleAttr := TJvTFGlanceMainTitle.Create(Self); + +// obones: Commented out, it goes against the default value in TJvTFGlanceMainTitle +// FTitleAttr.Visible := False; // not visible by default. (Tim) + FTitleAttr.OnChange := @GlanceTitleChange; + + FCellAttr := TJvTFGlanceCellAttr.Create(Self); + FCellAttr.TitleAttr.DayTxtAttr.AlignH := taLeftJustify; + FSelCellAttr := TJvTFGlanceCellAttr.Create(Self); + FSelCellAttr.TitleAttr.Color := clNavy; + FSelCellAttr.TitleAttr.DayTxtAttr.Font.Color := clWhite; + + //FSelOrder := soColMajor; + FSelOrder := soRowMajor; + FSel := TJvTFGlanceSelList.Create(Self); + FSel.OnChange := @SelChange; + + FImageChangeLink := TChangeLink.Create; + FImageChangeLink.OnChange := @ImageListChange; + + FHintProps := TJvTFHintProps.Create(Self); + //FHint := TJvTFHint.Create(Self); + FHint := GetTFHintClass.Create(Self); + FHint.RefProps := FHintProps; + + FCreatingControl := False; + + Cells.EnsureCells; + Cells.ConfigCells; +end; + +destructor TJvTFCustomGlance.Destroy; +begin + FCells.Free; + FTitleAttr.Free; + FCellAttr.Free; + FSelCellAttr.Free; + FSel.OnChange := nil; + FSel.Free; + FPaintBuffer.Free; + FImageChangeLink.Free; + + FHint.Free; + FHintProps.Free; + + FSchedNames.OnChange := nil; + FSchedNames.Free; + + Viewer := nil; + + inherited Destroy; +end; + +function TJvTFCustomGlance.CalcCellBodyRect(ACell: TJvTFGlanceCell; + Selected, Full: Boolean): TRect; +var + Attr: TJvTFGlanceCellAttr; + Offset: Integer; +begin + { + Windows.SubtractRect(Result, CellRect(ACell), + CalcCellTitleRect(ACell, Selected, True)); + } + SubtractRect(Result, CellRect(ACell), + CalcCellTitleRect(ACell, Selected, True)); + if not Full then + begin + if Selected then + Attr := SelCellAttr + else + Attr := CellAttr; + + case Attr.FrameAttr.Style of + fs3DRaised, fs3DLowered: + Offset := 1; + fsFlat: + Offset := Attr.FrameAttr.Width; + else + Offset := 0; + end; + + // Col 0 has frame running down left side of cell, whereas others + // do not. + if ACell.ColIndex = 0 then + Inc(Result.Left, Offset); + + Dec(Result.Bottom, Offset); + Dec(Result.Right, Offset); + end; +end; + +function TJvTFCustomGlance.CellIsSelected(ACell: TJvTFGlanceCell): Boolean; +begin + Result := False; + if Assigned(ACell) then + Result := DateIsSelected(ACell.CellDate); +end; + +function TJvTFCustomGlance.CellRect(ACell: TJvTFGlanceCell): TRect; +var + ParentRect, SubRect: TRect; +begin + Result := EmptyRect; + if Assigned(ACell) then + begin + SplitRects(ACell.ColIndex, ACell.RowIndex, ParentRect, SubRect); + if ACell.IsParent then + Result := ParentRect + else + Result := SubRect; + end; +end; + +function TJvTFCustomGlance.CalcCellTitleRect(ACell: TJvTFGlanceCell; + Selected, Full: Boolean): TRect; +var + Attr: TJvTFGlanceCellAttr; +begin + if Selected then + Attr := SelCellAttr + else + Attr := CellAttr; + + if not Attr.TitleAttr.Visible then + begin + Result := Rect(0, 0, 0, 0); + Exit; + end + else + Result := CellRect(ACell); + + case Attr.TitleAttr.Align of + alTop: + Result.Bottom := Result.Top + Attr.TitleAttr.Height; + alBottom: + Result.Top := Result.Bottom - Attr.TitleAttr.Height; + alLeft: + Result.Right := Result.Left + Attr.TitleAttr.Height; + alRight: + Result.Left := Result.Right - Attr.TitleAttr.Height; + end; + + if not Full then + begin + case Attr.TitleAttr.FrameAttr.Style of + fs3DLowered, fs3DRaised: + InflateRect(Result, -1, -1); + fsFlat: + case Attr.TitleAttr.Align of + alTop: + Dec(Result.Bottom, Attr.TitleAttr.FrameAttr.Width); + alBottom: + Inc(Result.Top, Attr.TitleAttr.FrameAttr.Width); + alLeft: + Dec(Result.Right, Attr.TitleAttr.FrameAttr.Width); + alRight: + Inc(Result.Left, Attr.TitleAttr.FrameAttr.Width); + end; + end; + end; +end; + + + +procedure TJvTFCustomGlance.CMCtl3DChanged(var Msg: TLMessage); +begin + if FBorderStyle = bsSingle then +// RecreateWnd; + RecreateWnd(self); + inherited; +end; + +procedure TJvTFCustomGlance.CreateParams(var Params: TCreateParams); +const + BorderStyles: array [TBorderStyle] of DWORD = (0, WS_BORDER); +begin + inherited CreateParams(Params); + with Params do + begin + Style := Style or BorderStyles[FBorderStyle] or WS_CLIPCHILDREN; + if {Ctl3D and} (FBorderStyle = bsSingle) then // wp: commented Ctl3D + begin + Style := Style and not WS_BORDER; + ExStyle := ExStyle or WS_EX_CLIENTEDGE; + end; + end; +end; + + + +function TJvTFCustomGlance.DateIsSelected(ADate: TDate): Boolean; +begin + Result := Sel.IndexOf(ADate) <> -1; +end; + +procedure TJvTFCustomGlance.DblClick; +begin + inherited DblClick; +end; + +procedure TJvTFCustomGlance.Click; +begin + inherited Click; +end; + +procedure TJvTFCustomGlance.DoConfigCells; +begin + if Assigned(FOnConfigCells) then + FOnConfigCells(Self); +end; + +procedure TJvTFCustomGlance.Draw3DFrame(ACanvas: TCanvas; ARect: TRect; + TLColor, BRColor: TColor); +var + OldPenColor: TColor; +begin + with ACanvas do + begin + OldPenColor := Pen.Color; + Pen.Color := TLColor; + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Right, ARect.Top); + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Left, ARect.Bottom); + + Pen.Color := BRColor; + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + Pen.Color := OldPenColor; + end; +end; + +procedure TJvTFCustomGlance.DrawCell(ACanvas: TCanvas; ACell: TJvTFGlanceCell); +var + ARect, lTitleRect, BodyRect: TRect; + Attr: TJvTFGlanceCellAttr; +begin + with ACanvas do + begin + ARect := CellRect(ACell); + Attr := GetCellAttr(ACell); + lTitleRect := CellTitleRect(ACell); + + // Calc the body rect + SubtractRect(BodyRect, ARect, lTitleRect); + + // Draw the cell title + if Attr.TitleAttr.Visible then + DrawCellTitle(ACanvas, lTitleRect, Attr, ACell); + + // Shade the body of the cell + Brush.Color := Attr.Color; + FillRect(BodyRect); + + DrawCellFrame(ACanvas, ARect, Attr, ACell); + + // Draw the cell data + if Assigned(Viewer) and not (csDesigning in ComponentState) then + Viewer.PaintTo(ACanvas, ACell); + + DoDrawCell(ACanvas, ARect, lTitleRect, BodyRect, Attr, ACell); + end; +end; + +procedure TJvTFCustomGlance.DrawCells(ACanvas: TCanvas); +var + Col, Row: Integer; + ACell: TJvTFGlanceCell; +begin + for Col := 0 to ColCount - 1 do + for Row := 0 to RowCount - 1 do + begin + ACell := Cells.Cells[Col, Row]; + DrawCell(ACanvas, ACell); + if Assigned(ACell.SubCell) then + DrawCell(ACanvas, ACell.SubCell); + end; +end; + +procedure TJvTFCustomGlance.DrawTitle(ACanvas: TCanvas); +var + ARect, TxtRect: TRect; + OldPen: TPen; + OldBrush: TBrush; + OldFont: TFont; + I, LineBottom: Integer; + ts: TTextStyle; +begin + if not TitleAttr.Visible then + Exit; + + ARect := TitleRect; + TxtRect := ARect; + InflateRect(TxtRect, -2, -2); + + with ACanvas do + begin + OldPen := TPen.Create; + OldPen.Assign(Pen); + OldBrush := TBrush.Create; + OldBrush.Assign(Brush); + OldFont := TFont.Create; + OldFont.Assign(Font); + + Brush.Color := TitleAttr.Color; + FillRect(ARect); + + //Pen.Color := clBlack; + //MoveTo(ARect.Left, ARect.Bottom - 1); + //LineTo(ARect.Right, ARect.Bottom - 1); + + case TitleAttr.FrameAttr.Style of + fs3DRaised: + Draw3DFrame(ACanvas, ARect, clBtnHighlight, clBtnShadow); + fs3DLowered: + Draw3DFrame(ACanvas, ARect, clBtnShadow, clBtnHighlight); + { + fs3DRaised, fs3DLowered : + begin + if TitleAttr.FrameAttr.Style = fs3DRaised then + Pen.Color := clBtnHighlight + else + Pen.Color := clBtnShadow; + + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Right, ARect.Top); + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Left, ARect.Bottom); + + if TitleAttr.FrameAttr.Style = fs3DRaised then + Pen.Color := clBtnShadow + else + Pen.Color := clBtnHighlight; + + MoveTo(ARect.Right - 1, ARect.Top); + LineTo(ARect.Right - 1, ARect.Bottom); + MoveTo(ARect.Left, ARect.Bottom - 1); + LineTo(ARect.Right, ARect.Bottom - 1); + end; + } + fsFlat: + begin + Pen.Color := TitleAttr.FrameAttr.Color; + { + Pen.Width := TitleAttr.FrameAttr.Width; + LineBottom := ARect.Bottom - Pen.Width div 2; + if Odd(Pen.Width) then + Dec(LineBottom); + MoveTo(ARect.Left, LineBottom); + LineTo(ARect.Right, LineBottom); + } + Pen.Width := 1; + LineBottom := ARect.Bottom - 1; + for I := 1 to TitleAttr.FrameAttr.Width do + begin + MoveTo(ARect.Left, LineBottom); + LineTo(ARect.Right, LineBottom); + Dec(LineBottom); + end; + end; + end; + + //Font.Assign(TitleAttr.Font); + Font.Assign(TitleAttr.TxtAttr.Font); + ts := Canvas.TextStyle; + ts.Alignment := taCenter; + ts.Layout := tlCenter; + ACanvas.TextRect(TxtRect, txtRect.Left, txtRect.Top, TitleAttr.Title, ts); + + Pen.Assign(OldPen); + Brush.Assign(OldBrush); + Font.Assign(OldFont); + OldPen.Free; + OldBrush.Free; + OldFont.Free; + end; + + DoDrawTitle(ACanvas, ARect); +end; + +procedure TJvTFCustomGlance.EnsureCell(ACell: TJvTFGlanceCell); +begin + if not Assigned(ACell) then + raise EJvTFGlanceError.CreateRes(@RsECellObjectNotAssigned); +end; + +procedure TJvTFCustomGlance.EnsureCol(Col: Integer); +begin + if (Col < 0) or (Col >= ColCount) then + raise EJvTFGlanceError.CreateResFmt(@RsEInvalidColIndexd, [Col]); +end; + +procedure TJvTFCustomGlance.EnsureRow(Row: Integer); +begin + if (Row < 0) or (Row >= RowCount) then + raise EJvTFGlanceError.CreateResFmt(@RsEInvalidRowIndexd, [Row]); +end; + +function TJvTFCustomGlance.GetCellAttr(ACell: TJvTFGlanceCell): TJvTFGlanceCellAttr; +begin + if CellIsSelected(ACell) then + Result := SelCellAttr + else + Result := CellAttr; +end; + +function TJvTFCustomGlance.GetDataHeight: Integer; +begin + Result := ClientHeight - GetDataTop; +end; + +function TJvTFCustomGlance.GetDataLeft: Integer; +begin + Result := 0; +end; + +function TJvTFCustomGlance.GetDataTop: Integer; +begin + Result := 0; + if TitleAttr.Visible then + Inc(Result, TitleAttr.Height); +end; + +function TJvTFCustomGlance.GetDataWidth: Integer; +begin + Result := ClientWidth - GetDataLeft; +end; + +procedure TJvTFCustomGlance.ImageListChange(Sender: TObject); +begin + Invalidate; +end; + +procedure TJvTFCustomGlance.InternalSelectCell(ACell: TJvTFGlanceCell); +begin + if Assigned(ACell) and ACell.CanSelect then + Sel.Add(ACell.CellDate); +end; + +procedure TJvTFCustomGlance.Loaded; +begin + inherited Loaded; + Cells.EnsureCells; + Cells.ConfigCells; +end; + +procedure TJvTFCustomGlance.MouseDown(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); +var + Info: TJvTFGlanceCoord; +begin + inherited MouseDown(Button, Shift, X, Y); + + if Enabled then + SetFocus; + + Info := PtToCell(X, Y); + if Assigned(Viewer) and (Viewer.Cell <> Info.Cell) then + Viewer.Visible := False; + + if ssLeft in Shift then + begin + if ssShift in Shift then + begin + // contiguous selection + if Info.Cell.CanSelect then + begin + FMouseCell := Info.Cell; + UpdateSelection; + end; + end + else + if ssCtrl in Shift then + begin + // non-contiguous selection + if CellIsSelected(Info.Cell) then + DeselectCell(Info.Cell) + else + SelectCell(Info.Cell, False); + end + else + begin + if Assigned(Info.Cell) and Info.Cell.CanSelect then + SelectCell(Info.Cell, True); + SelAppt := Info.Appt; + if Assigned(Info.Appt) then + BeginDrag(False); + end; + end; +end; + +procedure TJvTFCustomGlance.MouseMove(Shift: TShiftState; X, Y: Integer); +var + //S: string; + Info: TJvTFGlanceCoord; + Hints: TStrings; +begin + inherited MouseMove(Shift, X, Y); + + Info := PtToCell(X, Y); + + if not Focused and not (csDesigning in ComponentState) then + Exit; + + if Assigned(Info.CellTitlePic) then + Hints := Info.CellTitlePic.Hints + else + Hints := nil; + + FHint.MultiLineObjHint(Info.CellTitlePic, X, Y, Hints); + { + if Assigned(Info.CellTitlePic) then + FHint.MultiLineObjHint(Info.CellTitlePic, X, Y, Info.CellTitlePic.Hints) + else + FHint.ReleaseHandle; + } + + if (Info.Col > -1) and (Info.Row > -1) and not Info.InCellTitle then + CheckApptHint(Info); + + // EXIT if we've already processed a mouse move for the current cell + if Info.Cell = FMouseCell then + Exit; + + FMouseCell := Info.Cell; + + // TESTING ONLY!!! + //S := IntToStr(Info.Col) + ', ' + IntToStr(Info.Row); + //GetParentForm(Self).Caption := S; + + if ssLeft in Shift then + begin + UpdateSelection; + end; +end; + +procedure TJvTFCustomGlance.MouseUp(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); +var + Info: TJvTFGlanceCoord; +begin + inherited MouseUp(Button, Shift, X, Y); + + if (Sel.Count = 1) and Assigned(Viewer) then + begin + Info := PtToCell(X, Y); + Viewer.MoveTo(Info.Cell); + Viewer.Visible := True; + if not Info.InCellTitle then + Viewer.MouseAccel(X, Y); + end; +end; + +procedure TJvTFCustomGlance.Notification(AComponent: TComponent; + Operation: TOperation); +begin + inherited Notification(AComponent, Operation); + if Operation = opRemove then + if AComponent = Viewer then + Viewer := nil + else + if AComponent = CellPics then + CellPics := nil; +end; + +procedure TJvTFCustomGlance.Paint; +begin + with FPaintBuffer do + begin + Height := ClientHeight; + Width := ClientWidth; + + with Canvas do + begin + Brush.Color := Color; + FillRect(ClientRect); + end; + + DrawTitle(Canvas); + DrawCells(Canvas); + end; + + if Enabled then + //Windows.BitBlt(Canvas.Handle, 0, 0, ClientWidth, ClientHeight, + BitBlt(Canvas.Handle, 0, 0, ClientWidth, ClientHeight, + FPaintBuffer.Canvas.Handle, 0, 0, SRCCOPY) + else + { wp ---- to do: the following BitBlt is a workaround for DrawState missing in LCL + Windows.DrawState(Canvas.Handle, 0, nil, FPaintBuffer.Handle, 0, + 0, 0, 0, 0, DST_BITMAP or DSS_UNION or DSS_DISABLED); + } + BitBlt(Canvas.Handle, 0, 0, ClientWidth, ClientHeight, + FPaintBuffer.Canvas.Handle, 0, 0, SRCCOPY) +end; + +function TJvTFCustomGlance.PtToCell(X, Y: Integer): TJvTFGlanceCoord; +var + I, AdjX, AdjY, ViewerX, ViewerY: Integer; + PicRect, ViewerBounds, ParentRect, SubRect: TRect; + VCell: TJvTFGlanceCell; + InSubRect: Boolean; +begin + with Result do + begin + AbsX := X; + AbsY := Y; + + AdjY := Y - GetDataTop; + if AdjY < 0 then + Row := -1 + else + Row := GetDivNum(GetDataHeight, RowCount, AdjY); + + AdjX := X - GetDataLeft; + if AdjX < 0 then + Col := -1 + else + Col := GetDivNum(GetDataWidth, ColCount, AdjX); + + if (Col >= 0) and (Row >= 0) then + begin + Cell := Cells.Cells[Col, Row]; + SplitRects(Col, Row, ParentRect, SubRect); + InSubRect := PtInRect(SubRect, Point(X, Y)); + if InSubRect then + Cell := Cell.SubCell; + end + else + begin + InSubRect := False; + Cell := nil; + end; + + if Col < 0 then + CellX := X + else + if InSubRect and (Cell.SplitOrientation = soVertical) then + CellX := X - SubRect.Left + else + CellX := X - ParentRect.Left; + + if Row < 0 then + CellY := Y + else + if InSubRect and (Cell.SplitOrientation = soHorizontal) then + CellY := Y - SubRect.Top + else + CellY := Y - ParentRect.Top; + + DragAccept := (Col > -1) and (Row > -1) and Assigned(ScheduleManager); + + CellTitlePic := nil; + InCellTitle := PtInRect(CellTitleRect(Cell), Point(X, Y)); + if InCellTitle and Assigned(Cell) and Assigned(CellPics) then + begin + I := 0; + while (I < Cell.CellPics.Count) and not Assigned(CellTitlePic) do + begin + PicRect.TopLeft := Cell.CellPics[I].PicPoint; + PicRect.Right := PicRect.Left + CellPics.Width; + PicRect.Bottom := PicRect.Top + CellPics.Height; + if PtInRect(PicRect, Point(X, Y)) then + CellTitlePic := Cell.CellPics[I] + else + Inc(I); + end; + end; + + Appt := nil; + if Assigned(Viewer) and not InCellTitle and + (Col > -1) and (Row > -1) then + begin + VCell := Viewer.Cell; + + Viewer.SetTo(Cell); + ViewerBounds := Viewer.CalcBoundsRect(Cell); + + ViewerX := AbsX - ViewerBounds.Left; + ViewerY := AbsY - ViewerBounds.Top; + + Appt := Viewer.GetApptAt(ViewerX, ViewerY); + + Viewer.SetTo(VCell); + end; + end; +end; + +// Parameter Clear defaults to True for D4+ versions + +procedure TJvTFCustomGlance.SelectCell(ACell: TJvTFGlanceCell; Clear: Boolean); +begin + EnsureCell(ACell); + + BeginSelUpdate; + try + if Clear then + begin + Sel.Clear; + FSelAnchor := ACell; + end; + InternalSelectCell(ACell); + finally + EndSelUpdate; + end; +end; + +procedure TJvTFCustomGlance.SetBorderStyle(Value: TBorderStyle); +begin + if FBorderStyle <> Value then + begin + FBorderStyle := Value; + RecreateWnd(self); +// RecreateWnd; + end; +end; + +procedure TJvTFCustomGlance.SetBounds(ALeft, ATop, AWidth, AHeight: Integer); +begin + inherited SetBounds(ALeft, ATop, AWidth, AHeight); + if Assigned(Viewer) then + Viewer.Realign; +end; + +procedure TJvTFCustomGlance.SetCellAttr(Value: TJvTFGlanceCellAttr); +begin + FCellAttr.Assign(Value); +end; + +procedure TJvTFCustomGlance.SetCellPics(Value: TCustomImageList); +begin + if ReplaceImageListReference (Self, Value, FCellPics, FImageChangeLink) then + Invalidate; +end; + +procedure TJvTFCustomGlance.SetCells(Value: TJvTFGlanceCells); +begin + FCells.Assign(Value); +end; + +procedure TJvTFCustomGlance.SetColCount(Value: Integer); +begin + Value := Greater(Value, 1); + + if Value <> FColCount then + begin + FColCount := Value; + Cells.EnsureCells; + Cells.ConfigCells; + if Assigned(Viewer) then + Viewer.Realign; + Invalidate; + end; +end; + +procedure TJvTFCustomGlance.SetOriginDate(Value: TDate); +begin + if not EqualDates(Value, FOriginDate) then + begin + FOriginDate := Value; + StartOfWeek := BorlToDOW(DayOfWeek(Value)); + if not FCreatingControl and not (csLoading in ComponentState) then + Cells.ConfigCells; + Invalidate; + end; +end; + +procedure TJvTFCustomGlance.SetRowCount(Value: Integer); +begin + Value := Greater(Value, 1); + + if Value <> FRowCount then + begin + FRowCount := Value; + Cells.EnsureCells; + Cells.ConfigCells; + if Assigned(Viewer) then + Viewer.Realign; + Invalidate; + end; +end; + +procedure TJvTFCustomGlance.SetTFSelCellAttr(Value: TJvTFGlanceCellAttr); +begin + FSelCellAttr.Assign(Value); +end; + +procedure TJvTFCustomGlance.SetStartDate(Value: TDate); +begin + if not EqualDates(Value, FStartDate) then + begin + FStartDate := Value; + while BorlToDOW(DayOfWeek(Value)) <> StartOfWeek do + Value := Value - 1; + OriginDate := Value; + end; +end; + +procedure TJvTFCustomGlance.SetStartOfWeek(Value: TTFDayOfWeek); +var + WorkDate: TDate; +begin + if Value <> FStartOfWeek then + begin + FStartOfWeek := Value; + + WorkDate := StartDate; + while BorlToDOW(DayOfWeek(WorkDate)) <> FStartOfWeek do + WorkDate := WorkDate - 1; + OriginDate := WorkDate; + + Invalidate; + end; +end; + +procedure TJvTFCustomGlance.SetTitleAttr(Value: TJvTFGlanceMainTitle); +begin + FTitleAttr.Assign(Value); + Invalidate; +end; + +procedure TJvTFCustomGlance.SetViewer(Value: TJvTFGlanceViewer); +begin + if Value <> FViewer then + begin + if Assigned(FViewer) then + FViewer.Notify(Self, sncDisconnectControl); + if Assigned(Value) then + Value.Notify(Self, sncConnectControl); + ReplaceComponentReference(Self, Value, TComponent(FViewer)); + if Assigned(FViewer) then + begin + FViewer.MoveTo(Cells.Cells[0, 0]); + FViewer.Visible := (csDesigning in ComponentState); + end; + end; +end; + +function TJvTFCustomGlance.TitleRect: TRect; +begin + Result := Rect(0, 0, ClientWidth, 0); + if TitleAttr.Visible then + Result.Bottom := TitleAttr.Height; +end; + +procedure TJvTFCustomGlance.UpdateSelection; +var + Col, Row, StartCol, EndCol, StartRow, EndRow: Integer; + ACell, ACell1, ACell2: TJvTFGlanceCell; +begin + BeginSelUpdate; + + try + if not Assigned(FMouseCell) or not Assigned(FSelAnchor) then + Exit; + + Sel.Clear; + if SelOrder = soColMajor then + begin + // handle the first sel col + if FMouseCell.ColIndex < FSelAnchor.ColIndex then // sel end is left of anchor + begin + for Row := 0 to FSelAnchor.RowIndex do + begin + ACell := Cells.Cells[FSelAnchor.ColIndex, Row]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + if not FSelAnchor.IsSubCell then + InternalDeselectCell(FSelAnchor.SubCell); + end + else + if FMouseCell.ColIndex = FSelAnchor.ColIndex then // sel end is in same col as anchor + begin + StartRow := Lesser(FSelAnchor.RowIndex, FMouseCell.RowIndex); + EndRow := Greater(FSelAnchor.RowIndex, FMouseCell.RowIndex); + for Row := StartRow to EndRow do + begin + ACell := Cells.Cells[FSelAnchor.ColIndex, Row]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + + if (FMouseCell.RowIndex < FSelAnchor.RowIndex) then + begin + if FMouseCell.IsSubCell then + InternalDeselectCell(FMouseCell.ParentCell); + if FSelAnchor.IsParent then + InternalDeselectCell(FSelAnchor.SubCell); + end + else + if FMouseCell = FSelAnchor then + InternalDeselectCell(FMouseCell.SplitRef) + else + if FMouseCell.RowIndex > FSelAnchor.RowIndex then + begin + if FMouseCell.IsParent then + InternalDeselectCell(FMouseCell.SubCell); + if FSelAnchor.IsSubCell then + InternalDeselectCell(FSelAnchor.ParentCell); + end; + end + else // sel end is to the right of anchor + begin + InternalSelectCell(FSelAnchor); + if FSelAnchor.IsParent then + InternalSelectCell(FSelAnchor.SubCell); + + for Row := FSelAnchor.RowIndex + 1 to RowCount - 1 do + begin + InternalSelectCell(FSelAnchor.ParentCell); + InternalSelectCell(FSelAnchor.SubCell); + end; + end; + + // handle any intermediate cols (all rows in col will be selected) + StartCol := Lesser(FSelAnchor.ColIndex, FMouseCell.ColIndex); + EndCol := Greater(FSelAnchor.ColIndex, FMouseCell.ColIndex); + for Col := StartCol + 1 to EndCol - 1 do + for Row := 0 to RowCount - 1 do + begin + ACell := Cells.Cells[Col, Row]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + + // handle the last sel col + if FMouseCell.ColIndex < FSelAnchor.ColIndex then + begin + InternalSelectCell(FMouseCell); + if FMouseCell.IsParent then + InternalSelectCell(FMouseCell.SubCell); + + for Row := FMouseCell.RowIndex + 1 to RowCount - 1 do + begin + ACell := Cells.Cells[FMouseCell.ColIndex, Row]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + end + else + if FMouseCell.ColIndex > FSelAnchor.ColIndex then + begin + for Row := 0 to FMouseCell.RowIndex do + begin + ACell := Cells.Cells[FMouseCell.ColIndex, Row]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + if FMouseCell.IsParent then + InternalDeselectCell(FMouseCell.SubCell); + end + end + else + if SelOrder = soRowMajor then + begin + // handle the first sel row + if FMouseCell.RowIndex < FSelAnchor.RowIndex then + begin + for Col := 0 to FSelAnchor.ColIndex do + begin + ACell := Cells.Cells[Col, FSelAnchor.RowIndex]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + if FSelAnchor.IsParent then + InternalDeselectCell(FSelAnchor.SubCell); + end + else + if FMouseCell.RowIndex = FSelAnchor.RowIndex then + begin + if FMouseCell = FSelAnchor then + InternalSelectCell(FMouseCell) + else + begin + if FMouseCell.ColIndex < FSelAnchor.ColIndex then + begin + ACell1 := FMouseCell; + ACell2 := FSelAnchor; + end + else + begin + ACell1 := FSelAnchor; + ACell2 := FMouseCell; + end; + + InternalSelectCell(ACell1); + if ACell1.IsParent then + InternalSelectCell(ACell1.SubCell); + + InternalSelectCell(ACell2); + if ACell2.IsSubCell then + InternalSelectCell(ACell2.ParentCell); + + for Col := ACell1.ColIndex + 1 to ACell2.ColIndex - 1 do + begin + ACell := Cells.Cells[Col, FMouseCell.RowIndex]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + end; + end + else + begin + InternalSelectCell(FSelAnchor); + if FSelAnchor.IsParent then + InternalSelectCell(FSelAnchor.SubCell); + + for Col := FSelAnchor.ColIndex + 1 to ColCount - 1 do + begin + ACell := Cells.Cells[Col, FSelAnchor.RowIndex]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + end; + + // handle any intermediate rows (all cols in row will be selected) + StartRow := Lesser(FSelAnchor.RowIndex, FMouseCell.RowIndex); + EndRow := Greater(FSelAnchor.RowIndex, FMouseCell.RowIndex); + for Col := 0 to ColCount - 1 do + for Row := StartRow + 1 to EndRow - 1 do + begin + ACell := Cells.Cells[Col, Row]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + + // handle last sel row + if FMouseCell.RowIndex < FSelAnchor.RowIndex then + begin + InternalSelectCell(FMouseCell); + if FMouseCell.IsParent then + InternalSelectCell(FMouseCell.SubCell); + + for Col := FMouseCell.ColIndex + 1 to ColCount - 1 do + begin + ACell := Cells.Cells[Col, FMouseCell.RowIndex]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + end + else + if FMouseCell.RowIndex > FSelAnchor.RowIndex then + begin + for Col := 0 to FMouseCell.ColIndex do + begin + ACell := Cells.Cells[Col, FMouseCell.RowIndex]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + if FMouseCell.IsParent then + InternalDeselectCell(FMouseCell.SubCell); + end + end + else + begin + StartRow := Lesser(FSelAnchor.RowIndex, FMouseCell.RowIndex); + EndRow := Greater(FSelAnchor.RowIndex, FMouseCell.RowIndex); + StartCol := Lesser(FSelAnchor.ColIndex, FMouseCell.ColIndex); + EndCol := Greater(FSelAnchor.ColIndex, FMouseCell.ColIndex); + + // select all cells and subcells in square + for Col := StartCol to EndCol do + for Row := StartRow to EndRow do + begin + ACell := Cells.Cells[Col, Row]; + InternalSelectCell(ACell); + InternalSelectCell(ACell.SubCell); + end; + + // for direction (anchor --> mouse) + // W, NW, N, NE: if anchor is parent, anchor subcell is NOT selected and + // if mouse is subcell, mouse parent is NOT selected + if (FMouseCell.RowIndex < FSelAnchor.RowIndex) or // all northerly dir + ((FMouseCell.RowIndex = FSelAnchor.RowIndex) and + (FMouseCell.ColIndex < FSelAnchor.ColIndex)) then // west + begin + if FSelAnchor.IsParent then + InternalDeselectCell(FSelAnchor.SubCell); + + if FMouseCell.IsSubCell then + InternalDeselectCell(FMouseCell.ParentCell); + end + // for direction E, SE, S, SW: + // if anchor is subcell, anchor parent is NOT selected and + // if mouse is parent, mouse subcell is NOT selected + else + begin + if FSelAnchor.IsSubCell then + InternalDeselectCell(FSelAnchor.ParentCell); + + if FMouseCell.IsParent then + InternalDeselectCell(FMouseCell.SubCell); + end; + end; + finally + EndSelUpdate; + end; +end; + +function TJvTFCustomGlance.ValidCell(Col, Row: Integer): Boolean; +begin + Result := False; + if ValidCol(Col) and ValidRow(Row) then + Result := Assigned(Cells.Cells[Col, Row]); +end; + +function TJvTFCustomGlance.ValidCol(Col: Integer): Boolean; +begin + Result := (Col >= 0) and (Col < ColCount); +end; + +function TJvTFCustomGlance.ValidRow(Row: Integer): Boolean; +begin + Result := (Row >= 0) and (Row < RowCount); +end; + +procedure TJvTFCustomGlance.WMEraseBkgnd(var Msg: TLMessage); +begin + Msg.Result := LRESULT(False); +end; + +function TJvTFCustomGlance.CellBodyRect(ACell: TJvTFGlanceCell): TRect; +begin + Result := CalcCellBodyRect(ACell, CellIsSelected(ACell), True); +end; + +function TJvTFCustomGlance.CellTitleRect(ACell: TJvTFGlanceCell): TRect; +begin + Result := CalcCellTitleRect(ACell, CellIsSelected(ACell), True); +end; + +procedure TJvTFCustomGlance.DrawCellTitle(ACanvas: TCanvas; ATitleRect: TRect; + Attr: TJvTFGlanceCellAttr; Cell: TJvTFGlanceCell); +const + PicBuffer = 2; +var + Txt: string; + DayRect, PicRect, AdjTitleRect, TextBounds: TRect; + HorzLayout: Boolean; + I, PicIndex, PicLeft, PicTop, PicsHeight, PicsWidth: Integer; +begin + // shade the title + ACanvas.Brush.Color := Attr.TitleAttr.Color; + ACanvas.FillRect(ATitleRect); + + HorzLayout := (Attr.TitleAttr.Align = alTop) or + (Attr.TitleAttr.Align = alBottom); + + if Assigned(Cell) then + begin + //Txt := FormatDateTime(Attr.TitleAttr.DayFormat, Cell.CellDate); + Txt := Cell.TitleText; + AdjTitleRect := ATitleRect; + InflateRect(AdjTitleRect, -2, -2); + + // Draw the day text and Calc the rects + if Txt <> '' then + begin + ACanvas.Font := Attr.TitleAttr.DayTxtAttr.Font; + DrawAngleText(ACanvas, AdjTitleRect, TextBounds, + Attr.TitleAttr.DayTxtAttr.Rotation, + Attr.TitleAttr.DayTxtAttr.AlignH, + Attr.TitleAttr.DayTxtAttr.AlignV, Txt); + + DayRect := AdjTitleRect; + case Attr.TitleAttr.Align of + alTop, alBottom: + case Attr.TitleAttr.DayTxtAttr.AlignH of + taLeftJustify: + DayRect.Right := TextBounds.Right; + taRightJustify: + DayRect.Left := TextBounds.Left; + end; + alLeft, alRight: + case Attr.TitleAttr.DayTxtAttr.AlignV of + vaTop: + DayRect.Bottom := TextBounds.Bottom; + vaBottom: + DayRect.Top := TextBounds.Top; + end; + end; + SubtractRect(PicRect, AdjTitleRect, DayRect); +// Windows.SubtractRect(PicRect, AdjTitleRect, DayRect); + end + else + begin + DayRect := Rect(0, 0, 0, 0); + PicRect := AdjTitleRect; + end; + + // draw the pics + if PicsToDraw(Cell) then + begin + GetPicsWidthHeight(Cell, PicBuffer, HorzLayout, PicsWidth, PicsHeight); + + // find PicLeft of first pic + case Attr.TitleAttr.PicAttr.AlignH of + taLeftJustify: + PicLeft := PicRect.Left; + taCenter: + PicLeft := PicRect.Left + RectWidth(PicRect) div 2 - PicsWidth div 2; + else + PicLeft := PicRect.Right - PicsWidth; + end; + + // find PicTop of first pic + case Attr.TitleAttr.PicAttr.AlignV of + vaTop: + PicTop := PicRect.Top; + vaCenter: + PicTop := PicRect.Top + RectHeight(PicRect) div 2 - PicsHeight div 2; + else + PicTop := PicRect.Bottom - PicsHeight; + end; + + for I := 0 to Cell.CellPics.Count - 1 do + begin + PicIndex := Cell.CellPics[I].PicIndex; + if ValidPicIndex(PicIndex) then + begin + Cell.CellPics[I].SetPicPoint(PicLeft, PicTop); + CellPics.Draw(ACanvas, PicLeft, PicTop, PicIndex); + if HorzLayout then + Inc(PicLeft, CellPics.Width + PicBuffer) + else + Inc(PicTop, CellPics.Height + PicBuffer); + end; + end; + end; + end; + + // draw the title frame + DrawCellTitleFrame(ACanvas, ATitleRect, Attr); +end; + +procedure TJvTFCustomGlance.DrawCellFrame(ACanvas: TCanvas; ARect: TRect; + Attr: TJvTFGlanceCellAttr; ACell: TJvTFGlanceCell); +var + I, LineBottom: Integer; +begin + with ACanvas do + begin + // draw the cell frame + case Attr.FrameAttr.Style of + fs3DRaised: + Draw3DFrame(ACanvas, ARect, clBtnHighlight, clBtnShadow); + fs3DLowered: + Draw3DFrame(ACanvas, ARect, clBtnShadow, clBtnHighlight); + fsFlat: + begin + Pen.Color := Attr.FrameAttr.Color; + Pen.Width := 1; + + // draw the bottom line + LineBottom := ARect.Bottom - 1; + for I := 1 to Attr.FrameAttr.Width do + begin + MoveTo(ARect.Left, LineBottom); + LineTo(ARect.Right, LineBottom); + Dec(LineBottom); + end; + + // draw the right line + LineBottom := ARect.Right - 1; + for I := 1 to Attr.FrameAttr.Width do + begin + MoveTo(LineBottom, ARect.Top); + LineTo(LineBottom, ARect.Bottom); + Dec(LineBottom); + end; + + // draw the left line only for col 0 cells + if ACell.ColIndex = 0 then + begin + LineBottom := ARect.Left; + for I := 1 to Attr.FrameAttr.Width do + begin + MoveTo(LineBottom, ARect.Top); + LineTo(LineBottom, ARect.Bottom); + Inc(LineBottom); + end; + end; + end; + end; + end; +end; + +procedure TJvTFCustomGlance.DrawCellTitleFrame(ACanvas: TCanvas; ATitleRect: TRect; + Attr: TJvTFGlanceCellAttr); +var + I, LineBottom: Integer; +begin + with ACanvas do + begin + // draw the title frame + case Attr.TitleAttr.FrameAttr.Style of + fs3DRaised: + Draw3DFrame(ACanvas, ATitleRect, clBtnHighlight, clBtnShadow); + fs3DLowered: + Draw3DFrame(ACanvas, ATitleRect, clBtnShadow, clBtnHighlight); + fsFlat: + begin + Pen.Color := Attr.TitleAttr.FrameAttr.Color; + case Attr.TitleAttr.Align of + alTop: + begin + if Attr.DrawBottomLine then + begin + LineBottom := ATitleRect.Bottom - 1; + for I := 1 to Attr.TitleAttr.FrameAttr.Width do + begin + MoveTo(ATitleRect.Left + FGapSize, LineBottom); + LineTo(ATitleRect.Right - FGapSize, LineBottom); + Dec(LineBottom); + end; + end; + end; + alBottom: + begin + LineBottom := ATitleRect.Top; + for I := 1 to Attr.TitleAttr.FrameAttr.Width do + begin + MoveTo(ATitleRect.Left + 4, LineBottom); + LineTo(ATitleRect.Right - 4, LineBottom); + Inc(LineBottom); + end; + end; + alLeft: + begin + LineBottom := ATitleRect.Right - 1; + for I := 1 to Attr.TitleAttr.FrameAttr.Width do + begin + MoveTo(LineBottom, ATitleRect.Top); + LineTo(LineBottom, ATitleRect.Bottom); + Dec(LineBottom); + end; + end; + alRight: + begin + LineBottom := ATitleRect.Left; + for I := 1 to Attr.TitleAttr.FrameAttr.Width do + begin + MoveTo(LineBottom, ATitleRect.Top); + LineTo(LineBottom, ATitleRect.Bottom); + Inc(LineBottom); + end; + end; + end; + end; + end; + end; +end; + +function TJvTFCustomGlance.PicsToDraw(ACell: TJvTFGlanceCell): Boolean; +var + I: Integer; +begin + Result := False; + if Assigned(CellPics) and (CellPics.Count > 0) then + begin + I := 0; + while (I < ACell.CellPics.Count) and not Result do + if ACell.CellPics[I].PicIndex > -1 then + Result := True + else + Inc(I); + end; +end; + +procedure TJvTFCustomGlance.GetPicsWidthHeight(ACell: TJvTFGlanceCell; + PicBuffer: Integer; Horz: Boolean; var PicsWidth, PicsHeight: Integer); +var + I, PicIndex: Integer; +begin + if Horz then + begin + PicsWidth := 0; + PicsHeight := CellPics.Height; + end + else + begin + PicsWidth := CellPics.Width; + PicsHeight := 0; + end; + + for I := 0 to ACell.CellPics.Count - 1 do + begin + PicIndex := ACell.CellPics[I].PicIndex; + if ValidPicIndex(PicIndex) then + if Horz then + Inc(PicsWidth, CellPics.Width + PicBuffer) + else + Inc(PicsHeight, CellPics.Height + PicBuffer); + end; + + if Horz and (PicsWidth > 0) then + Dec(PicsWidth, PicBuffer); + + if not Horz and (PicsHeight > 0) then + Dec(PicsHeight, PicBuffer); +end; + +function TJvTFCustomGlance.ValidPicIndex(PicIndex: Integer): Boolean; +begin + Result := (PicIndex >= 0) and (PicIndex < CellPics.Count); +end; + +procedure TJvTFCustomGlance.SetHintProps(Value: TJvTFHintProps); +begin + FHintProps.Assign(Value); +end; + +procedure TJvTFCustomGlance.DoDrawCell(ACanvas: TCanvas; + ACellRect, ATitleRect, ABodyRect: TRect; Attr: TJvTFGlanceCellAttr; + Cell: TJvTFGlanceCell); +begin + if Assigned(FOnDrawCell) then + FOnDrawCell(Self, ACanvas, ACellRect, ATitleRect, ABodyRect, Attr, Cell); +end; + +procedure TJvTFCustomGlance.DoDrawTitle(ACanvas: TCanvas; ARect: TRect); +begin + if Assigned(FOnDrawTitle) then + FOnDrawTitle(Self, ACanvas, ARect); +end; + +procedure TJvTFCustomGlance.InternalDeselectCell(ACell: TJvTFGlanceCell); +var + I: Integer; +begin + if Assigned(ACell) then + begin + I := Sel.IndexOf(ACell.CellDate); + if I > -1 then + Sel.Delete(I); + end; +end; + +procedure TJvTFCustomGlance.DeselectCell(ACell: TJvTFGlanceCell); +begin + EnsureCell(ACell); + InternalDeselectCell(ACell); +end; + +procedure TJvTFCustomGlance.BeginSelUpdate; +begin + FUpdatingSel := True; +end; + +procedure TJvTFCustomGlance.EndSelUpdate; +begin + FUpdatingSel := False; + SelChange(Self); +end; + +procedure TJvTFCustomGlance.SelChange(Sender: TObject); +//var +// SchedNameList: TStringList; +// DateList: TJvTFDateList; +// I: Integer; +begin + if not UpdatingSel then + begin + if Assigned(FOnSelChanged) then + FOnSelChanged(Self); + + // DoNavigate +// if Assigned(Navigator) then +// begin +// SchedNameList := TStringList.Create; +// DateList := TJvTFDateList.Create; +// Try +// SchedNameList.Assign(SchedNames); +// +// For I := 0 to Sel.Count - 1 do +// DateList.Add(Sel[I]); +// +// Navigator.Navigate(Self, SchedNameList, DateList); +// Finally +// SchedNameList.Free; +// DateList.Free; +// end; +// end; + + Invalidate; + end; +end; + +procedure TJvTFCustomGlance.ReleaseSchedule(const SchedName: string; + SchedDate: TDate); +begin + // ALWAYS RELEASE SCHEDULE HERE + inherited ReleaseSchedule(SchedName, SchedDate); +end; + +function TJvTFCustomGlance.GetSchedNames: TStrings; +begin + Result := FSchedNames; +end; + +procedure TJvTFCustomGlance.SetSchedNames(Value: TStrings); +begin + FSchedNames.Assign(Value); + // SchedNamesChange will run +end; + +procedure TJvTFCustomGlance.SafeReleaseSchedule(ASched: TJvTFSched); +begin + if not Cells.IsSchedUsed(ASched) then + ReleaseSchedule(ASched.SchedName, ASched.SchedDate); +end; + +procedure TJvTFCustomGlance.SchedNamesChange(Sender: TObject); +begin + if not (csDesigning in ComponentState) and not (csCreating in ControlState) then + Cells.CheckConnections; +end; + +procedure TJvTFCustomGlance.Notify(Sender: TObject; Code: TJvTFServNotifyCode); +begin + inherited Notify(Sender, Code); + + // WHAT IS THIS CODE FOR ??!!?!! + if Assigned(Viewer) then + Viewer.Refresh; +end; + +procedure TJvTFCustomGlance.CheckApptHint(Info: TJvTFGlanceCoord); +var + ExtraDesc: string = ''; + Handled: Boolean; +begin + if Assigned(FViewer) and FViewer.ShowSchedNamesInHint then + ExtraDesc := StringsToStr(SchedNames, ', ', False); + ExtraDesc := ExtraDesc + #13#10; + + Handled := False; + if Assigned(OnApptHint) then + FOnApptHint(Self, Info.Appt, Handled); + if not Handled then + FHint.ApptHint(Info.Appt, Info.AbsX + 8, Info.AbsY + 8, + not Assigned(FViewer) or FViewer.ShowStartEndTimeInHint, True, False, ExtraDesc); +end; + +procedure TJvTFCustomGlance.CheckViewerApptHint(X, Y: Integer); +var + Info: TJvTFGlanceCoord; +begin + Info := PtToCell(X, Y); + CheckApptHint(Info); +end; + +procedure TJvTFCustomGlance.DoEndDrag(Target: TObject; X, Y: Integer); +begin + inherited DoEndDrag(Target, X, Y); +end; + +procedure TJvTFCustomGlance.DoStartDrag(var DragObject: TDragObject); +begin + if Assigned(Viewer) and Viewer.Editing then + Viewer.FinishEditAppt; + + inherited DoStartDrag(DragObject); + + FDragInfo.Appt := SelAppt; +end; + +procedure TJvTFCustomGlance.DragOver(Source: TObject; X, Y: Integer; + State: TDragState; var Accept: Boolean); +var + SrcDragInfo: TJvTFDragInfo; + PtInfo: TJvTFGlanceCoord; + //Appt: TJvTFAppt; +begin + //Viewer.Visible := False; + + inherited DragOver(Source, X, Y, State, Accept); + + if Source is TJvTFControl then + begin + SrcDragInfo := TJvTFControl(Source).DragInfo; + PtInfo := PtToCell(X, Y); + Accept := PtInfo.DragAccept; + //Appt := SrcDragInfo.Appt; + + case State of + dsDragEnter: + begin + if not Assigned(FDragInfo) then + FDragInfo := SrcDragInfo; + //BeginDragging(GridCoord, agsMoveAppt, Appt); + end; + dsDragLeave: + begin + //EndDragging(GridCoord, Appt); + if FDragInfo.ApptCtrl <> Self then + FDragInfo := nil; + end; + //dsDragMove: ContinueDragging(GridCoord, Appt); + end; + end; +end; + +procedure TJvTFCustomGlance.SetSelAppt(Value: TJvTFAppt); +begin + if Value <> FSelAppt then + begin + FSelAppt := Value; + Invalidate; + end; +end; + +procedure TJvTFCustomGlance.DragDrop(Source: TObject; X, Y: Integer); +begin + if Source is TJvTFControl then + DropAppt(TJvTFControl(Source).DragInfo, X, Y); + + inherited DragDrop(Source, X, Y); +end; + +procedure TJvTFCustomGlance.DropAppt(ADragInfo: TJvTFDragInfo; X, Y: Integer); +var + NewStart, NewEnd: TDate; + Appt: TJvTFAppt; + PtInfo: TJvTFGlanceCoord; + Confirm: Boolean; +begin + FHint.ReleaseHandle; + Appt := ADragInfo.Appt; + + if not Assigned(Appt) then + Exit; // happens sometimes + + // calc new info + // Schedule(s) do not change + PtInfo := PtToCell(X, Y); + NewStart := PtInfo.Cell.CellDate; + NewEnd := Trunc(Appt.EndDate) - Trunc(Appt.StartDate) + NewStart; + + Confirm := True; + if Assigned(FOnDropAppt) then + FOnDropAppt(Self, Appt, NewStart, NewEnd, Confirm); + + if Confirm then + begin + { + DateChange := (Trunc(Appt.StartDate) <> Trunc(NewStart)) or + (Trunc(Appt.EndDate) <> Trunc(NewEnd)); + + if DateChange then + begin + end; + } + + Appt.SetStartEnd(NewStart, Appt.StartTime, NewEnd, Appt.EndTime); + ScheduleManager.RefreshConnections(Appt); + end; +end; + +procedure TJvTFCustomGlance.ConfigCells; +begin + // DO NOT DIRECTLY CALL THIS ROUTINE! + // This routine is called by TJvTFGlanceCells.ConfigCells. + // Use this routine to set the cell dates by calling + // TJvTFCustomGlance.SetCellDate. + // Override this routine in successors to customize + // cell/date configuration. + + { Example: + CellDate := OriginDate; + For Row := 0 to RowCount - 1 do + For Col := 0 to ColCount - 1 do + begin + SetCellDate(Col, Row, CellDate); + CellDate := CellDate + 1; + end; + } + DoConfigCells; + UpdateCellTitles; +end; + +procedure TJvTFCustomGlance.SetCellDate(ACell: TJvTFGlanceCell; CellDate: TDate); +begin + ACell.InternalSetCellDate(CellDate); +end; + +procedure TJvTFCustomGlance.ReconfigCells; +begin + Cells.ReconfigCells; +end; + +procedure TJvTFCustomGlance.GlanceTitleChange(Sender: TObject); +begin + if Assigned(Viewer) then + Viewer.Realign; + Invalidate; +end; + +procedure TJvTFCustomGlance.UpdateCellTitleText(Cell: TJvTFGlanceCell); +var + NewTitleText: string; +begin + NewTitleText := GetCellTitleText(Cell); + if Assigned(FOnUpdateCellTitleText) then + FOnUpdateCellTitleText(Self, Cell, NewTitleText); + Cell.SetTitleText(NewTitleText); +end; + +function TJvTFCustomGlance.GetCellTitleText(Cell: TJvTFGlanceCell): string; +begin + Result := FormatDateTime('mm/d/yyyy', Cell.CellDate); +end; + +function TJvTFCustomGlance.WholeCellRect(Col, Row: Integer): TRect; +begin + Result.Left := GetDataLeft + GetDivStart(GetDataWidth, ColCount, Col); + Result.Right := Result.Left + GetDivLength(GetDataWidth, ColCount, Col); + Result.Top := GetDataTop + GetDivStart(GetDataHeight, RowCount, Row); + Result.Bottom := Result.Top + GetDivLength(GetDataHeight, RowCount, Row); +end; + +procedure TJvTFCustomGlance.SplitRects(Col, Row: Integer; + var ParentRect, SubRect: TRect); +var + ACell: TJvTFGlanceCell; + WorkRect: TRect; +begin + ParentRect := EmptyRect; + SubRect := EmptyRect; + if not (ValidCol(Col) and ValidRow(Row)) then + Exit; + + WorkRect := WholeCellRect(Col, Row); + ParentRect := WorkRect; + + ACell := Cells.Cells[Col, Row]; + if ACell.IsSplit then + begin + if ACell.SplitOrientation = soHorizontal then + ParentRect.Bottom := ParentRect.Top + RectHeight(ParentRect) div 2 + else + ParentRect.Right := ParentRect.Left + RectWidth(ParentRect) div 2; + SubtractRect(SubRect, WorkRect, ParentRect); +// Windows.SubtractRect(SubRect, WorkRect, ParentRect); + end; +end; + +procedure TJvTFCustomGlance.UpdateCellTitles; +var + I: Integer; + ACell: TJvTFGlanceCell; +begin + for I := 0 to Cells.Count - 1 do + begin + ACell := Cells[I]; + UpdateCellTitleText(ACell); + if Assigned(ACell.SubCell) then + UpdateCellTitleText(ACell.SubCell); + end; +end; + +procedure TJvTFCustomGlance.SplitCell(ACell: TJvTFGlanceCell); +begin + ACell.Split; +end; + +procedure TJvTFCustomGlance.CombineCell(ACell: TJvTFGlanceCell); +begin + ACell.Combine; +end; + +function TJvTFCustomGlance.GetTFHintClass: TJvTFHintClass; +begin + Result := TJvTFHint; +end; + +//=== { TJvTFGlanceTitle } =================================================== + +constructor TJvTFGlanceTitle.Create(AOwner: TJvTFCustomGlance); +begin + inherited Create; + FGlanceControl := AOwner; + + FTxtAttr := TJvTFTextAttr.Create; + FTxtAttr.Font.Size := 16; + FTxtAttr.Font.Style := FTxtAttr.Font.Style + [fsBold]; + FTxtAttr.OnChange := @TxtAttrChange; + + FFrameAttr := TJvTFGlanceFrameAttr.Create(AOwner); + + FColor := clBtnFace; + FHeight := 40; + FVisible := True; +end; + +destructor TJvTFGlanceTitle.Destroy; +begin + FFrameAttr.Free; + FTxtAttr.OnChange := nil; + FTxtAttr.Free; + + inherited Destroy; +end; + +procedure TJvTFGlanceTitle.Assign(Source: TPersistent); +begin + if Source is TJvTFGlanceTitle then + begin + FColor := TJvTFGlanceTitle(Source).Color; + FHeight := TJvTFGlanceTitle(Source).Height; + FVisible := TJvTFGlanceTitle(Source).Visible; + FFrameAttr.Assign(TJvTFGlanceTitle(Source).FrameAttr); + FTxtAttr.Assign(TJvTFGlanceTitle(Source).TxtAttr); + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFGlanceTitle.Change; +begin + if Assigned(FOnChange) then + FOnChange(Self); +end; + +procedure TJvTFGlanceTitle.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFGlanceTitle.SetFrameAttr(Value: TJvTFGlanceFrameAttr); +begin + FFrameAttr.Assign(Value); +end; + +procedure TJvTFGlanceTitle.SetHeight(Value: Integer); +begin + Value := Greater(Value, 0); + if Assigned(GlanceControl) then + Value := Lesser(Value, GlanceControl.Height - 5); + + if Value <> FHeight then + begin + FHeight := Value; + Change; + end; +end; + +procedure TJvTFGlanceTitle.SetTxtAttr(Value: TJvTFTextAttr); +begin + FTxtAttr.Assign(Value); + Change; +end; + +procedure TJvTFGlanceTitle.SetVisible(Value: Boolean); +begin + if Value <> FVisible then + begin + FVisible := Value; + Change; + end; +end; + +procedure TJvTFGlanceTitle.TxtAttrChange(Sender: TObject); +begin + Change; +end; + +//=== { TJvTFFrameAttr } ===================================================== + +constructor TJvTFFrameAttr.Create(AOwner: TJvTFControl); +begin + inherited Create; + FControl := AOwner; + + FStyle := fsFlat; + FColor := clBlack; + FWidth := 1; +end; + +procedure TJvTFFrameAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFFrameAttr then + begin + FStyle := TJvTFFrameAttr(Source).Style; + FColor := TJvTFFrameAttr(Source).Color; + FWidth := TJvTFFrameAttr(Source).Width; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFFrameAttr.Change; +begin + if Assigned(FOnChange) then + FOnChange(Self); + + if Assigned(Control) then + Control.Invalidate; +end; + +procedure TJvTFFrameAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFFrameAttr.SetStyle(Value: TJvTFFrameStyle); +begin + if Value <> FStyle then + begin + FStyle := Value; + Change; + end; +end; + +procedure TJvTFFrameAttr.SetWidth(Value: Integer); +begin + Value := Greater(Value, 1); + + if Value <> FWidth then + begin + FWidth := Value; + Change; + end; +end; + +//=== { TJvTFGlanceCellAttr } ================================================ + +constructor TJvTFGlanceCellAttr.Create(AOwner: TJvTFCustomGlance); +begin + inherited Create; + FGlanceControl := AOwner; + + FColor := clWhite; + FFrameAttr := TJvTFGlanceFrameAttr.Create(AOwner); + FTitleAttr := TJvTFGlanceTitleAttr.Create(AOwner); + + FFont := TFont.Create; + FFont.OnChange := @FontChange; +end; + +destructor TJvTFGlanceCellAttr.Destroy; +begin + FFrameAttr.Free; + FTitleAttr.Free; + FFont.Free; + + inherited Destroy; +end; + +procedure TJvTFGlanceCellAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFGlanceCellAttr then + begin + FColor := TJvTFGlanceCellAttr(Source).Color; + FFrameAttr.Assign(TJvTFGlanceCellAttr(Source).FrameAttr); + FTitleAttr.Assign(TJvTFGlanceCellAttr(Source).TitleAttr); + FFont.Assign(TJvTFGlanceCellAttr(Source).Font); + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFGlanceCellAttr.Change; +begin + if Assigned(GlanceControl) then + GlanceControl.Invalidate; +end; + +procedure TJvTFGlanceCellAttr.FontChange(Sender: TObject); +begin + Change; +end; + +procedure TJvTFGlanceCellAttr.SetDrawBottomLine(Value: Boolean); +begin + if Value <> FDrawBottomLine then + begin + FDrawBottomLine := Value; + Change; + end; +end; + +procedure TJvTFGlanceCellAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFGlanceCellAttr.SetFont(Value: TFont); +begin + FFont.Assign(Value); +end; + +procedure TJvTFGlanceCellAttr.SetFrameAttr(Value: TJvTFGlanceFrameAttr); +begin + FFrameAttr.Assign(Value); +end; + +procedure TJvTFGlanceCellAttr.SetTitleAttr(Value: TJvTFGlanceTitleAttr); +begin + FTitleAttr.Assign(Value); +end; + +//=== { TJvTFGlanceTitleAttr } =============================================== + +constructor TJvTFGlanceTitleAttr.Create(AOwner: TJvTFCustomGlance); +begin + inherited Create; + FGlanceControl := AOwner; + + FAlign := alTop; + + FColor := clBtnFace; + FHeight := 20; + FVisible := True; + //FDayFormat := 'd'; + + FFrameAttr := TJvTFGlanceFrameAttr.Create(AOwner); + + FDayTxtAttr := TJvTFTextAttr.Create; + FDayTxtAttr.OnChange := @TxtAttrChange; + + FPicAttr := TJvTFGlanceTitlePicAttr.Create; + FPicAttr.OnChange := @PicAttrChange; +end; + +destructor TJvTFGlanceTitleAttr.Destroy; +begin + FFrameAttr.Free; + FDayTxtAttr.OnChange := nil; + FDayTxtAttr.Free; + FPicAttr.OnChange := nil; + FPicAttr.Free; + + inherited Destroy; +end; + +procedure TJvTFGlanceTitleAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFGlanceTitleAttr then + begin + FAlign := TJvTFGlanceTitleAttr(Source).Align; + //FDayFormat := TJvTFGlanceTitleAttr(Source).DayFormat; + FColor := TJvTFGlanceTitleAttr(Source).Color; + FHeight := TJvTFGlanceTitleAttr(Source).Height; + FVisible := TJvTFGlanceTitleAttr(Source).Visible; + FFrameAttr.Assign(TJvTFGlanceTitleAttr(Source).FrameAttr); + FDayTxtAttr.Assign(TJvTFGlanceTitleAttr(Source).DayTxtAttr); + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFGlanceTitleAttr.Change; +begin + if Assigned(GlanceControl) then + begin + if Assigned(GlanceControl.Viewer) then + GlanceControl.Viewer.Realign; + GlanceControl.Invalidate; + end; +end; + +procedure TJvTFGlanceTitleAttr.PicAttrChange(Sender: TObject); +begin + Change; +end; + +procedure TJvTFGlanceTitleAttr.SetAlign(Value: TJvTFTitleAlign); +begin + if Value <> FAlign then + begin + FAlign := Value; + Change; + end; +end; + +procedure TJvTFGlanceTitleAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +{ +procedure TJvTFGlanceTitleAttr.SetDayFormat(const Value: string); +begin + if Value <> FDayFormat then + begin + FDayFormat := Value; + Change; + end; +end; +} + +procedure TJvTFGlanceTitleAttr.SetDayTxtAttr(Value: TJvTFTextAttr); +begin + FDayTxtAttr.Assign(Value); + Change; +end; + +procedure TJvTFGlanceTitleAttr.SetFrameAttr(Value: TJvTFGlanceFrameAttr); +begin + FFrameAttr.Assign(Value); + Change; +end; + +procedure TJvTFGlanceTitleAttr.SetHeight(Value: Integer); +begin + if Value <> FHeight then + begin + FHeight := Value; + Change; + end; +end; + +procedure TJvTFGlanceTitleAttr.SetPicAttr(Value: TJvTFGlanceTitlePicAttr); +begin + FPicAttr.Assign(Value); + Change; +end; + +procedure TJvTFGlanceTitleAttr.SetVisible(Value: Boolean); +begin + if Value <> FVisible then + begin + FVisible := Value; + Change; + end; +end; + +procedure TJvTFGlanceTitleAttr.TxtAttrChange(Sender: TObject); +begin + Change; +end; + +//=== { TJvTFGlanceSelList } ================================================= + +constructor TJvTFGlanceSelList.Create(AOwner: TJvTFCustomGlance); +begin + inherited Create; + FGlanceControl := AOwner; +end; + +//=== { TJvTFGlanceViewer } ================================================== + +constructor TJvTFGlanceViewer.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + FRepeatGrouped := True; + FShowSchedNamesInHint := True; + FInplaceEdit := True; +end; + +function TJvTFGlanceViewer.ApptCount: Integer; +var + I: Integer; + ApptList: TStringList; +begin + if RepeatGrouped then + begin + Result := 0; + for I := 0 to ScheduleCount - 1 do + Inc(Result, Schedules[I].ApptCount); + end + else + begin + ApptList := TStringList.Create; + try + GetDistinctAppts(ApptList); + Result := ApptList.Count; + finally + ApptList.Free; + end; + end; +end; + +procedure TJvTFGlanceViewer.EnsureCol(ACol: Integer); +begin + GlanceControl.EnsureCol(ACol); +end; + +procedure TJvTFGlanceViewer.EnsureRow(ARow: Integer); +begin + GlanceControl.EnsureRow(ARow); +end; + +function TJvTFGlanceViewer.GetRepeatAppt(Index: Integer): TJvTFAppt; +var + I, AbsIndex: Integer; +begin + if (Index < 0) or (Index > ApptCount - 1) then + raise EGlanceViewerError.CreateResFmt(@RsEApptIndexOutOfBoundsd, [Index]); + + AbsIndex := 0; + I := -1; + + repeat + Inc(I); + Inc(AbsIndex, Schedules[I].ApptCount); + until AbsIndex - 1 >= Index; + + Result := Schedules[I].Appts[Schedules[I].ApptCount - (AbsIndex - Index)]; +end; + +function TJvTFGlanceViewer.GetDate: TDate; +begin + Result := Cell.CellDate; +end; + +function TJvTFGlanceViewer.GetDistinctAppt(Index: Integer): TJvTFAppt; +var + ApptList: TStringList; +begin + Result := nil; + ApptList := TStringList.Create; + try + GetDistinctAppts(ApptList); + if (Index < 0) or (Index >= ApptList.Count) then + raise EGlanceViewerError.CreateResFmt(@RsEApptIndexOutOfBoundsd, [Index]); + + Result := TJvTFAppt(ApptList.Objects[Index]); + finally + ApptList.Free; + end; +end; + +procedure TJvTFGlanceViewer.GetDistinctAppts(ApptList: TStringList); +var + I, + J: Integer; + Sched: TJvTFSched; + Appt: TJvTFAppt; +begin + ApptList.Clear; + + for I := 0 to ScheduleCount - 1 do + begin + Sched := Schedules[I]; + for J := 0 to Sched.ApptCount - 1 do + begin + Appt := Sched.Appts[J]; + if ApptList.IndexOf(Appt.ID) = -1 then + ApptList.AddObject(Appt.ID, Appt); + end; + end; +end; + +function TJvTFGlanceViewer.GetSchedule(Index: Integer): TJvTFSched; +begin + Result := Cell.Schedules[Index]; +end; + +procedure TJvTFGlanceViewer.MouseAccel(X, Y: Integer); +begin + // do nothing, leave implemenation to successors +end; + +procedure TJvTFGlanceViewer.MoveTo(ACell: TJvTFGlanceCell); +begin + SetTo(ACell); + FPhysicalCell := ACell; + Realign; +end; + +procedure TJvTFGlanceViewer.Notify(Sender: TObject; Code: TJvTFServNotifyCode); +begin + case Code of + sncConnectControl: + SetGlanceControl(TJvTFCustomGlance(Sender)); + sncDisconnectControl: + if GlanceControl = Sender then + SetGlanceControl(nil); + end; +end; + +procedure TJvTFGlanceViewer.ParentReconfig; +begin + // do nothing, leave implementation to successors +end; + +function TJvTFGlanceViewer.ScheduleCount: Integer; +begin + if Assigned(Cell) then + Result := Cell.ScheduleCount + else + Result := 0; +end; + +procedure TJvTFGlanceViewer.SetGlanceControl(Value: TJvTFCustomGlance); +begin + FGlanceControl := Value; + if Assigned(FGlanceControl) then + FGlanceControl.OnApptHint := @DoGlanceControlApptHint; +end; + +procedure TJvTFGlanceViewer.SetInplaceEdit(const Value: Boolean); +begin + FInPlaceEdit := Value; +end; + +procedure TJvTFGlanceViewer.SetRepeatGrouped(Value: Boolean); +begin + if Value <> FRepeatGrouped then + begin + FRepeatGrouped := Value; + Refresh; + end; +end; + +procedure TJvTFGlanceViewer.SetShowSchedNamesInHint( + const Value: Boolean); +begin + if FShowSchedNamesInHint <> Value then + begin + FShowSchedNamesInHint := Value; + Refresh; + end; +end; + +procedure TJvTFGlanceViewer.SetTo(ACell: TJvTFGlanceCell); +begin + FCell := ACell; +end; + +function TJvTFGlanceViewer.GetAppt(Index: Integer): TJvTFAppt; +begin + if RepeatGrouped then + Result := GetRepeatAppt(Index) + else + Result := GetDistinctAppt(Index); +end; + +function TJvTFGlanceViewer.CalcBoundsRect(ACell: TJvTFGlanceCell): TRect; +begin + if Assigned(GlanceControl) and Assigned(ACell) then + with GlanceControl do + Result := CalcCellBodyRect(ACell, CellIsSelected(ACell), False) + else + Result := Rect(0, 0, 0, 0); +end; + +function TJvTFGlanceViewer.GetApptAt(X, Y: Integer): TJvTFAppt; +begin + Result := nil; +end; + +function TJvTFGlanceViewer.CanEdit: Boolean; +begin + Result := False; +end; + +function TJvTFGlanceViewer.Editing: Boolean; +begin + Result := False; +end; + +procedure TJvTFGlanceViewer.FinishEditAppt; +begin + // do nothing, leave implementation to successors +end; + +//=== { TJvTFGlanceFrameAttr } =============================================== + +procedure TJvTFGlanceFrameAttr.Change; +begin + inherited Change; + if Assigned(GlanceControl) and Assigned(GlanceControl.Viewer) then + GlanceControl.Viewer.Realign; +end; + +constructor TJvTFGlanceFrameAttr.Create(AOwner: TJvTFCustomGlance); +begin + inherited Create(AOwner); + FGlanceControl := AOwner; +end; + +//=== { TJvTFTextAttr } ====================================================== + +constructor TJvTFTextAttr.Create; +begin + inherited Create; + + FFont := TFont.Create; + FFont.OnChange := @FontChange; + FAlignH := taLeftJustify; + FAlignV := vaCenter; +end; + +destructor TJvTFTextAttr.Destroy; +begin + FFont.OnChange := nil; + FFont.Free; + inherited Destroy; +end; + +procedure TJvTFTextAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFTextAttr then + begin + FFont.Assign(TJvTFTextAttr(Source).Font); + FRotation := TJvTFTextAttr(Source).Rotation; + FAlignH := TJvTFTextAttr(Source).AlignH; + FAlignV := TJvTFTextAttr(Source).AlignV; + DoChange; + end + else + inherited Assign(Source); +end; + +procedure TJvTFTextAttr.DoChange; +begin + if Assigned(FOnChange) then + FOnChange(Self); +end; + +procedure TJvTFTextAttr.FontChange(Sender: TObject); +begin + DoChange; +end; + +procedure TJvTFTextAttr.SetAlignH(Value: TAlignment); +begin + if Value <> FAlignH then + begin + FAlignH := Value; + DoChange; + end; +end; + +procedure TJvTFTextAttr.SetAlignV(Value: TJvTFVAlignment); +begin + if Value <> FAlignV then + begin + FAlignV := Value; + DoChange; + end; +end; + +procedure TJvTFTextAttr.SetFont(Value: TFont); +begin + FFont.Assign(Value); + DoChange; +end; + +procedure TJvTFTextAttr.SetRotation(Value: Integer); +begin + if Value <> FRotation then + begin + FRotation := Value; + DoChange; + end; +end; + +//=== { TJvTFCellPics } ====================================================== + +constructor TJvTFCellPics.Create(AGlanceCell: TJvTFGlanceCell); +begin + inherited Create(TJvTFCellPic); + FGlanceCell := AGlanceCell; +end; + +function TJvTFCellPics.Add: TJvTFCellPic; +begin + Result := TJvTFCellPic(inherited Add); +end; + +function TJvTFCellPics.AddPic(const PicName: string; PicIndex: Integer): TJvTFCellPic; +begin + Result := Add; + Result.PicName := PicName; + Result.PicIndex := PicIndex; +end; + +procedure TJvTFCellPics.Assign(Source: TPersistent); +var + I: Integer; +begin + if Source is TJvTFCellPics then + begin + BeginUpdate; + try + Clear; + for I := 0 to TJvTFCellPics(Source).Count - 1 do + Add.Assign(TJvTFCellPics(Source).Items[I]); + finally + EndUpdate; + end + end + else + inherited Assign(Source); +end; + +function TJvTFCellPics.GetItem(Index: Integer): TJvTFCellPic; +begin + Result := TJvTFCellPic(inherited GetItem(Index)); +end; + +function TJvTFCellPics.GetOwner: TPersistent; +begin + Result := GlanceCell; +end; + +function TJvTFCellPics.GetPicIndex(const PicName: string): Integer; +var + CellPic: TJvTFCellPic; +begin + Result := -1; + CellPic := PicByName(PicName); + if Assigned(CellPic) then + Result := CellPic.PicIndex; +end; + +function TJvTFCellPics.PicByName(const PicName: string): TJvTFCellPic; +var + I: Integer; +begin + Result := nil; + I := 0; + while (I < Count) and not Assigned(Result) do + begin + if Items[I].PicName = PicName then + Result := Items[I]; + Inc(I); + end; +end; + +procedure TJvTFCellPics.SetItem(Index: Integer; Value: TJvTFCellPic); +begin + inherited SetItem(Index, Value); +end; + +//=== { TJvTFCellPic } ======================================================= + +constructor TJvTFCellPic.Create(ACollection: TCollection); +begin + inherited Create(ACollection); + FPicIndex := -1; + FHints := TStringList.Create; +end; + +destructor TJvTFCellPic.Destroy; +begin + FHints.Free; + inherited Destroy; +end; + +procedure TJvTFCellPic.Assign(Source: TPersistent); +begin + if Source is TJvTFCellPic then + begin + FPicName := TJvTFCellPic(Source).PicName; + FPicIndex := TJvTFCellPic(Source).PicIndex; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFCellPic.Change; +begin + if Assigned(PicCollection.GlanceCell.CellCollection.GlanceControl) then + PicCollection.GlanceCell.CellCollection.GlanceControl.Invalidate; +end; + +function TJvTFCellPic.GetDisplayName: string; +begin + if PicName <> '' then + Result := PicName + else + Result := inherited GetDisplayName; +end; + +function TJvTFCellPic.PicCollection: TJvTFCellPics; +begin + Result := TJvTFCellPics(Collection); +end; + +function TJvTFCellPic.GetHints: TStrings; +begin + Result := FHints; +end; + +procedure TJvTFCellPic.SetHints(Value: TStrings); +begin + FHints.Assign(Value); +end; + +procedure TJvTFCellPic.SetPicIndex(Value: Integer); +begin + if Value <> FPicIndex then + begin + FPicIndex := Value; + Change; + end; +end; + +procedure TJvTFCellPic.SetPicName(const Value: string); +begin + if Value <> FPicName then + begin + FPicName := Value; + Change; + end; +end; + +procedure TJvTFCellPic.SetPicPoint(X, Y: Integer); +begin + FPicPoint := Point(X, Y); +end; + +//=== { TJvTFGlanceTitlePicAttr } ============================================ + +constructor TJvTFGlanceTitlePicAttr.Create; +begin + inherited Create; + FAlignH := taLeftJustify; + FAlignV := vaCenter; +end; + +procedure TJvTFGlanceTitlePicAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFGlanceTitlePicAttr then + begin + FAlignH := TJvTFGlanceTitlePicAttr(Source).AlignH; + FAlignV := TJvTFGlanceTitlePicAttr(Source).AlignV; + DoChange; + end + else + inherited Assign(Source); +end; + +procedure TJvTFGlanceTitlePicAttr.DoChange; +begin + if Assigned(FOnChange) then + FOnChange(Self); +end; + +procedure TJvTFGlanceTitlePicAttr.SetAlignH(Value: TAlignment); +begin + if Value <> FAlignH then + begin + FAlignH := Value; + DoChange; + end; +end; + +procedure TJvTFGlanceTitlePicAttr.SetAlignV(Value: TJvTFVAlignment); +begin + if Value <> FAlignV then + begin + FAlignV := Value; + DoChange; + end; +end; + +//=== { TJvTFGlance } ======================================================== + +constructor TJvTFGlance.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + AllowCustomDates := True; +end; + +//=== { TJvTFGlanceMainTitle } =============================================== + +constructor TJvTFGlanceMainTitle.Create(AOwner: TJvTFCustomGlance); +begin + inherited Create(AOwner); + FTitle := RsGlanceMainTitle; +end; + +procedure TJvTFGlanceMainTitle.Assign(Source: TPersistent); +begin + if Source is TJvTFGlanceMainTitle then + FTitle := TJvTFGlanceMainTitle(Source).Title; + + inherited Assign(Source); +end; + +procedure TJvTFGlanceMainTitle.SetTitle(const Value: string); +begin + if Value <> FTitle then + begin + FTitle := Value; + Change; + end; +end; + +procedure TJvTFGlanceCell.SetSplitOrientation(Value: TJvTFSplitOrientation); +begin + if Value <> FSplitOrientation then + begin + FSplitOrientation := Value; + if IsSubCell then + ParentCell.SplitOrientation := Value + else + if IsSplit then + begin + SubCell.SplitOrientation := Value; + Change; + end; + end; +end; + +procedure TJvTFGlanceCell.SetTitleText(const Value: string); +begin + FTitleText := Value; +end; + +procedure TJvTFGlanceCell.Split; +begin + if Assigned(CellCollection.GlanceControl) and + not CellCollection.GlanceControl.AllowCustomDates and + not CellCollection.Configuring then + raise EJvTFGlanceError.CreateRes(@RsECellCannotBeSplit); + + if IsSubCell then + raise EJvTFGlanceError.CreateRes(@RsEASubcellCannotBeSplit); + + if not IsSplit then + begin + FSplitRef := TJvTFGlanceCell.Create(nil); + //FSplitRef := TJvTFGlanceCell.Create(CellCollection); + FSplitRef.FCellCollection := CellCollection; + FSplitRef.SetColIndex(ColIndex); + FSplitRef.SetRowIndex(RowIndex); + FSplitRef.FSplitOrientation := SplitOrientation; + FSplitRef.FSplitRef := Self; + FSplitRef.FIsSubCell := True; + if not CellCollection.Configuring then + CellCollection.ReconfigCells; + end; +end; + +procedure TJvTFGlanceViewer.SetShowStartEndTimeInHint(const Value: Boolean); +begin + if FShowStartEndTimeInHint <> Value then + begin + FShowStartEndTimeInHint := Value; + Refresh; + end; +end; + +procedure TJvTFGlanceViewer.DoGlanceControlApptHint(Sender: TObject; + Appt: TJvTFAppt; var Handled: Boolean); +begin + if Assigned(FOnApptHint) then + FOnApptHint(Sender, Appt, Handled); +end; + + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfglancetextviewer.pas b/components/jvcllaz/run/JvTimeFramework/jvtfglancetextviewer.pas new file mode 100644 index 000000000..2c79a695d --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfglancetextviewer.pas @@ -0,0 +1,1585 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFGlanceTextViewer.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFGlanceTextViewer; + +{$mode objfpc}{$H+} + +interface + +uses + LCLIntf, LCLType, LMessages, + SysUtils, Classes, Graphics, Controls, Forms, Dialogs, StdCtrls, + JvComponent, + JvTFManager, JvTFGlance, JvTFUtils; + +type + TJvTFGlanceTextViewer = class; + + TJvTFGlTxtVwDrawInfo = record + Cell: TJvTFGlanceCell; + Font: TFont; + Color: TColor; + aRect: TRect; + end; + + TJvTFGlTxtVwPointInfo = record + AbsX: Integer; + AbsY: Integer; + AbsLineNum: Integer; + RelLineNum: Integer; + end; + + TJvDrawApptEvent = procedure(Sender: TObject; ACanvas: TCanvas; DrawInfo: TJvTFGlTxtVwDrawInfo; + Appt: TJvTFAppt; Rect:TRect; var Handled: Boolean) of object; + TJvApptHintEvent = procedure(Sender: TObject; Appt: TJvTFAppt; var Handled: Boolean) of object; + + TJvTFGVTxtEditor = class(TMemo) + private + FLinkedAppt: TJvTFAppt; + protected + FCancelEdit: Boolean; + procedure DoExit; override; + procedure KeyDown(var Key: Word; Shift: TShiftState); override; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + property LinkedAppt: TJvTFAppt read FLinkedAppt write FLinkedAppt; + end; + + TJvTFGVTextControl = class(TJvCustomControl) + private + FViewer: TJvTFGlanceTextViewer; + FReplicating: Boolean; + FMouseLine: Integer; + FCanEdit: Boolean; + FShowDDButton: Boolean; + + function GetGlanceControl: TJvTFCustomGlance; + procedure SetTopLine(Value: Integer); + function GetTopLine: Integer; + procedure SetCanEdit(const Value: Boolean); + procedure SetShowDDButton(const Value: Boolean); + protected + FMousePtInfo: TJvTFGlTxtVwPointInfo; + FDDBtnRect: TRect; + FMouseInControl: Boolean; + FScrollUpBtnBMP: TBitmap; + FScrollDnBtnBMP: TBitmap; + FEditor: TJvTFGVTxtEditor; + + // See in MouseDown for details on usage of these three members + FWasMovedTicks: Cardinal; + FWasInDblClick: Boolean; + FHasScrolled: Boolean; + + procedure MouseEnter(Control: TControl); override; + procedure MouseLeave(Control: TControl); override; + + procedure WMEraseBkgnd(var Msg: TLMessage); message LM_ERASEBKGND; + procedure DoEnter; override; + procedure DoExit; override; + + procedure SetMouseLine(Value: Integer); + property MouseLine: Integer read FMouseLine write SetMouseLine; + procedure UpdateDDBtnRect; + + procedure DblClick; override; + procedure DoViewerDblClick; + procedure DoViewerClick; + procedure DoViewerEnter; + + procedure MouseDown(Button: TMouseButton; Shift: TShiftState; X, Y: Integer); override; + procedure MouseUp(Button: TMouseButton; Shift: TShiftState; X, Y: Integer); override; + procedure MouseMove(Shift: TShiftState; X, Y: Integer); override; + procedure MouseAccel(X, Y: Integer); + procedure Click; override; + + procedure DragOver(Source: TObject; X, Y: Integer; State: TDragState; + var Accept: Boolean); override; + + property Replicating: Boolean read FReplicating; + procedure Paint; override; + procedure DrawDDButton(ACanvas: TCanvas); + procedure DrawArrow(ACanvas: TCanvas; aRect: TRect; Direction: TJvTFDirection); + procedure DrawScrollUpBtn(ACanvas: TCanvas; aCellRect: TRect); + procedure DrawScrollDnBtn(ACanvas: TCanvas; aCellRect: TRect); + function GetStartEndString(Appt: TJvTFAppt): string; + + function CalcLineHeight: Integer; + function CalcAbsLineNum(Y: Integer): Integer; + function LineRect(AbsLineNum: Integer): TRect; + function CalcPointInfo(X, Y: Integer): TJvTFGlTxtVwPointInfo; + function RelToAbs(Rel: Integer): Integer; + function AbsToRel(Abs: Integer): Integer; + function FindApptAtLine(RelLineNum: Integer): TJvTFAppt; + function GetApptRelLineNum(Appt: TJvTFAppt): Integer; + + procedure Scroll(ADelta: Integer); + function ScrollUpBtnRect(aCellRect: TRect): TRect; + function ScrollDnBtnRect(aCellRect: TRect): TRect; + procedure InitScrollUpBtnBMP; + procedure InitScrollDnBtnBMP; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + procedure PaintTo(ACanvas: TCanvas; DrawInfo: TJvTFGlTxtVwDrawInfo); overload; + procedure SetBounds(ALeft, ATop, AWidth, AHeight: Integer); override; + + property Viewer: TJvTFGlanceTextViewer read FViewer; + property GlanceControl: TJvTFCustomGlance read GetGlanceControl; + + // editor management routines + //procedure EditAppt(Col, Row: Integer; Appt: TJvTFAppt); + procedure EditAppt(ACell: TJvTFGlanceCell; RelLine: Integer; Appt: TJvTFAppt); + procedure FinishEditAppt; + function Editing: Boolean; + + function LineCount: Integer; + function AbsLineCount: Integer; + function ViewableLines: Integer; + function FullViewableLines: Integer; + property TopLine: Integer read GetTopLine write SetTopLine; + + function GetApptAt(X, Y: Integer): TJvTFAppt; + function GetApptAccel(X, Y: Integer): TJvTFAppt; + + property CanEdit: Boolean read FCanEdit write SetCanEdit; + property ShowDDButton: Boolean read FShowDDButton write SetShowDDButton default True; + end; + + TJvTFLineDDClickEvent = procedure(Sender: TObject; LineNum: Integer) of object; + + TJvTFTxtVwApptAttr = class(TPersistent) + private + FColor: TColor; + FFontColor: TColor; + FOnChange: TNotifyEvent; + procedure SetColor(Value: TColor); + procedure SetFontColor(Value: TColor); + protected + procedure Change; + public + constructor Create(AOwner: TComponent); + procedure Assign(Source: TPersistent); override; + property OnChange: TNotifyEvent read FOnChange write FOnChange; + published + property Color: TColor read FColor write SetColor default clBlue; + property FontColor: TColor read FFontColor write SetFontColor default clWhite; + end; + + TJvTFGlTxtVwEditorAlign = (eaLine, eaCell); + + TJvTFGlanceTextViewer = class(TJvTFGlanceViewer) + private + FViewControl: TJvTFGVTextControl; + FLineSpacing: Integer; + FEditorAlign: TJvTFGlTxtVwEditorAlign; + FOnLineDDClick: TJvTFLineDDClickEvent; + FShowStartEnd: Boolean; + FTopLines: TStringList; + FSelApptAttr: TJvTFTxtVwApptAttr; + FSelAppt: TJvTFAppt; + FOnDblClick: TNotifyEvent; + FOnClick: TNotifyEvent; + FOnEnter: TNotifyEvent; + FOnDrawAppt: TJvDrawApptEvent; + + procedure SetLineSpacing(Value: Integer); + procedure SetSelApptAttr(Value: TJvTFTxtVwApptAttr); + procedure SetEditorAlign(Value: TJvTFGlTxtVwEditorAlign); + procedure SetShowStartEnd(Value: Boolean); + function GetCellString(ACell: TJvTFGlanceCell): string; + procedure SetShowLineDDButton(const Value: Boolean); + function GetShowLineDDButton: Boolean; + protected + procedure SetVisible(Value: Boolean); override; + procedure SetGlanceControl(Value: TJvTFCustomGlance); override; + procedure SelApptAttrChange(Sender: TObject); + procedure Change; virtual; + procedure LineDDClick(LineNum: Integer); virtual; + + procedure DoDblClick(); virtual; + procedure DoClick; virtual; + procedure DoEnter; virtual; + procedure DoDrawAppt(ACanvas: TCanvas; DrawInfo: TJvTFGlTxtVwDrawInfo; + Appt: TJvTFAppt; Rect: TRect; var Handled: Boolean); + + procedure ParentReconfig; override; + procedure SetSelAppt(Value: TJvTFAppt); + procedure SetInplaceEdit(const Value: Boolean); override; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); override; + procedure MouseAccel(X, Y: Integer); override; + + procedure Refresh; override; + procedure Realign; override; + procedure PaintTo(ACanvas: TCanvas; ACell: TJvTFGlanceCell); override; + function GetDrawInfo(ACell: TJvTFGlanceCell): TJvTFGlTxtVwDrawInfo; + procedure ResetTopLines; + property SelAppt: TJvTFAppt read FSelAppt; + + procedure SetTopLine(ACell: TJvTFGlanceCell; Value: Integer); + function GetTopLine(ACell: TJvTFGlanceCell): Integer; + function GetApptAt(X, Y: Integer): TJvTFAppt; override; + + // editor management routines + procedure EditAppt(ACell: TJvTFGlanceCell; RelLine: Integer; Appt: TJvTFAppt); + procedure FinishEditAppt; override; + function Editing: Boolean; override; + function CanEdit: Boolean; override; + published + property LineSpacing: Integer read FLineSpacing write SetLineSpacing default 0; + property OnLineDDClick: TJvTFLineDDClickEvent read FOnLineDDClick write FOnLineDDClick; + property SelApptAttr: TJvTFTxtVwApptAttr read FSelApptAttr write SetSelApptAttr; + property EditorAlign: TJvTFGlTxtVwEditorAlign read FEditorAlign write SetEditorAlign default eaLine; + property ShowStartEnd: Boolean read FShowStartEnd write SetShowStartEnd default True; + property ShowLineDDButton: Boolean read GetShowLineDDButton write SetShowLineDDButton default True; + property OnDblClick: TNotifyEvent read FOnDblClick write FOnDblClick; + property OnClick: TNotifyEvent read FOnClick write FOnClick; + property OnEnter: TNotifyEvent read FOnEnter write FOnEnter; + property OnDrawAppt: TJvDrawApptEvent read FOnDrawAppt write FOnDrawAppt; + property OnApptHint; + end; + + +implementation + +uses + JvResources; + +//=== { TJvTFGVTextControl } ================================================= + +constructor TJvTFGVTextControl.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + if AOwner is TJvTFGlanceTextViewer then + FViewer := TJvTFGlanceTextViewer(AOwner); + + DoubleBuffered := True; + FShowDDButton := True; + + FReplicating := True; + FMouseLine := -1; + + FScrollUpBtnBMP := TBitmap.Create; + InitScrollUpBtnBMP; + FScrollDnBtnBMP := TBitmap.Create; + InitScrollDnBtnBMP; + + FEditor := TJvTFGVTxtEditor.Create(Self); + FEditor.Visible := False; + FEditor.Parent := Self; + + FWasMovedTicks := 0; + FWasInDblClick := False; + + //FEditor.Parent := Viewer.GlanceControl; + // (rom) deactivated seems of no use + // if FEditor.Parent = nil then + // Beep; +end; + +function TJvTFGVTextControl.CalcAbsLineNum(Y: Integer): Integer; +begin + Result := Y div CalcLineHeight; +end; + +procedure TJvTFGVTextControl.DrawDDButton(ACanvas: TCanvas); +begin + with ACanvas do + begin + Brush.Color := clBtnFace; + FillRect(FDDBtnRect); + + DrawArrow(ACanvas, FDDBtnRect, dirDown); + + Pen.Color := clBlack; + Polyline([FDDBtnRect.TopLeft, Point(FDDBtnRect.Right, FDDBtnRect.Top), + FDDBtnRect.BottomRight, Point(FDDBtnRect.Left, FDDBtnRect.Bottom), + FDDBtnRect.TopLeft]); + { + if Windows.PtInRect(aRect, FMouseLoc) then + begin + Pen.Color := clBtnHighlight; + MoveTo(aRect.Left, aRect.Top); + LineTo(aRect.Left, aRect.Bottom); + MoveTo(aRect.Left, aRect.Top); + LineTo(aRect.Right, aRect.Top); + + Pen.Color := clBtnShadow; + MoveTo(aRect.Right - 1, aRect.Top); + LineTo(aRect.Right - 1, aRect.Bottom); + MoveTo(aRect.Right, aRect.Bottom - 1); + LineTo(aRect.Left, aRect.Bottom - 1); + end; + } + end; +end; + +function TJvTFGVTextControl.GetGlanceControl: TJvTFCustomGlance; +begin + Result := nil; + if Assigned(Viewer) then + Result := Viewer.GlanceControl; +end; + +function TJvTFGVTextControl.CalcLineHeight: Integer; +begin + Result := Canvas.TextHeight('Wq') + Viewer.LineSpacing; +end; + +function TJvTFGVTextControl.LineRect(AbsLineNum: Integer): TRect; +var + LineHt: Integer; +begin + LineHt := CalcLineHeight; + Result := ClientRect; + Result.Top := LineHt * AbsLineNum; + Result.Bottom := Lesser(Result.Top + LineHt, Result.Bottom); +end; + +procedure TJvTFGVTextControl.Paint; +var + DrawInfo: TJvTFGlTxtVwDrawInfo; +begin + { + All drawing should be done in a PaintTo method. PaintTo should have ACanvas + and aRect Params. All drawing code within PaintTo should rely solely on + the ACanvas and aRect parameters given. + + This method (Paint) should then call PaintTo(Canvas, ClientRect) to draw the + info on the viewer control. TJvTFCustomGlance.DrawCell should call + PaintTo(PaintBuffer, CellBodyRect(Col, Row, Selected, False)) to draw the + info on the GlanceControl. + } + + Viewer.SetTo(Viewer.PhysicalCell); + DrawInfo := Viewer.GetDrawInfo(Viewer.Cell); + DrawInfo.aRect := ClientRect; + + FReplicating := False; + try + PaintTo(Canvas, DrawInfo); + finally + FReplicating := True; + end; + +{ + // for TESTING PURPOSES ONLY!! + with Canvas do + begin + Pen.Color := clBlack; + MoveTo(0, 0); + LineTo(ClientWidth, ClientHeight); + end; +} +end; + +procedure TJvTFGVTextControl.PaintTo(ACanvas: TCanvas; DrawInfo: TJvTFGlTxtVwDrawInfo); +var + I, NextLineTop, LastLine, lLine: Integer; + aRect, lLineRect, TxtRect, BtnRect: TRect; + Flags: UINT; + Txt: string; + Appt: TJvTFAppt; + RegFontColor, + RegBrushColor: TColor; + DrawingHandled: Boolean; +begin + Viewer.SetTo(DrawInfo.Cell); + + with ACanvas do + begin + aRect := DrawInfo.aRect; + + //Brush.Color := Viewer.Color; + Brush.Color := DrawInfo.Color; + FillRect(aRect); + + //Font.Assign(Viewer.Font); + Font.Assign(DrawInfo.Font); + Self.Canvas.Font.Assign(DrawInfo.Font); + + RegBrushColor := Brush.Color; + RegFontColor := Font.Color; + + NextLineTop := aRect.Top; + lLineRect.Left := aRect.Left; + lLineRect.Right := aRect.Right; + + //Flags := DT_LEFT or DT_NOPREFIX or DT_SINGLELINE or DT_VCENTER; + Flags := DT_LEFT or DT_NOPREFIX or DT_SINGLELINE or DT_TOP; + + if csDesigning in ComponentState then + LastLine := 2 + else + LastLine := Lesser(ViewableLines - 1, LineCount - TopLine - 1); + + for I := 0 to LastLine do + begin + Brush.Color := RegBrushColor; + Font.Color := RegFontColor; + + lLineRect.Top := NextLineTop; + lLineRect.Bottom := Lesser(NextLineTop + CalcLineHeight, aRect.Bottom); + + if csDesigning in ComponentState then + begin + Txt := 'Appt ' + IntToStr(I); + Appt := nil; + end + else + begin + lLine := AbsToRel(I); + if lLine < 0 then + lLine := 0; + if lLine >= Viewer.ApptCount then + lLine := 0; + Appt := Viewer.Appts[lLine]; + + Txt := ''; + if Viewer.ShowStartEnd then + Txt := GetStartEndString(Appt) + ': '; + Txt := Txt + StringReplace(Appt.Description, #13#10, ' ', [rfReplaceAll]); + + if Appt = Viewer.SelAppt then + begin + Brush.Color := Viewer.SelApptAttr.Color; + Font.Color := Viewer.SelApptAttr.FontColor; + + FillRect(lLineRect); + + if I <> 0 then + begin + MoveTo(aRect.Left, lLineRect.Top); + LineTo(aRect.Right, lLineRect.Top); + end; + if I <> AbsLineCount - 1 then + begin + MoveTo(aRect.Left, lLineRect.Bottom - 1); + LineTo(aRect.Right, lLineRect.Bottom - 1); + end; + end + else + begin + if Appt.Color <> clDefault then + begin + Brush.Color := Appt.Color; + FillRect(lLineRect); + end; + end; + end; + + TxtRect := lLineRect; + InflateRect(TxtRect, -1, -1); + + DrawingHandled := False; + if Assigned(Viewer) then + Viewer.DoDrawAppt(ACanvas, DrawInfo, Appt, lLineRect, DrawingHandled); + + if not DrawingHandled then + begin + // PTxt := StrAlloc((Length(Txt) + 4) * SizeOf(Char)); + // StrPCopy(PTxt, Txt); + // Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + // StrDispose(PTxt); + DrawText(ACanvas.Handle, PChar(Txt), Length(Txt), TxtRect, Flags); + end; + + Inc(NextLineTop, CalcLineHeight); + end; + end; + + if not (csDesigning in ComponentState) then + begin + if not Replicating and (FMousePtInfo.RelLineNum < Viewer.ApptCount) and + FMouseInControl and FShowDDButton then + DrawDDButton(ACanvas); + + BtnRect := ScrollUpBtnRect(DrawInfo.aRect); + if not IsRectEmpty(BtnRect) then + DrawScrollUpBtn(ACanvas, DrawInfo.aRect); + + BtnRect := ScrollDnBtnRect(DrawInfo.aRect); + if not IsRectEmpty(BtnRect) then + DrawScrollDnBtn(ACanvas, DrawInfo.aRect); + + { + if TopLine > 0 then + DrawScrollUpBtn(ACanvas, DrawInfo.aRect); + + BottomLine := TopLine + FullViewableLines - 1; + LastLine := LineCount - 1; + if BottomLine < LastLine then + DrawScrollDnBtn(ACanvas, DrawInfo.aRect); + } + end; +end; + +procedure TJvTFGVTextControl.WMEraseBkgnd(var Msg: TLMessage); +begin + Msg.Result := LRESULT(False); +end; + +procedure TJvTFGVTextControl.MouseMove(Shift: TShiftState; X, Y: Integer); +var + GlancePt: TPoint; +begin + inherited MouseMove(Shift, X, Y); + FMousePtInfo := CalcPointInfo(X, Y); + MouseLine := FMousePtInfo.AbsLineNum; + //SetFocus; + + GlancePt := Point(X, Y); + GlancePt := Viewer.GlanceControl.ScreenToClient(ClientToScreen(Point(X, Y))); + Viewer.GlanceControl.CheckViewerApptHint(GlancePt.X, GlancePt.Y); + + // for TESTING ONLY!!! + //Invalidate; + //////////////////// +end; + +procedure TJvTFGVTextControl.SetBounds(ALeft, ATop, AWidth, AHeight: Integer); +begin + // If the control is being moved, we keep track of when this happened. + // See in MouseUp for details of usage of this value. + if (Left <> ALeft) or (Top <> ATop) then + FWasMovedTicks := GetTickCount + else + FWasMovedTicks := 0; + + inherited SetBounds(ALeft, ATop, AWidth, AHeight); +end; + +procedure TJvTFGVTextControl.SetMouseLine(Value: Integer); +begin + if Value <> FMouseLine then + begin + FMouseLine := Value; + UpdateDDBtnRect; + Invalidate; + end; +end; + +procedure TJvTFGVTextControl.DrawArrow(ACanvas: TCanvas; aRect: TRect; + Direction: TJvTFDirection); +var + I, ArrowHeight, ArrowWidth, BaseX, BaseY: Integer; +begin + ArrowWidth := RectWidth(aRect) - 2; + if not Odd(ArrowWidth) then + Dec(ArrowWidth); + ArrowHeight := (ArrowWidth + 1) div 2; + + case Direction of + dirUp: + begin + BaseX := aRect.Left + RectWidth(aRect) div 2 - ArrowWidth div 2; + BaseY := aRect.Top + RectHeight(aRect) div 2 + ArrowHeight div 2 - 1; + + for I := ArrowHeight downto 1 do + with ACanvas do + begin + MoveTo(BaseX, BaseY); + LineTo(BaseX + I * 2 - 1, BaseY); + Inc(BaseX); + Dec(BaseY); + end; + end; + dirDown: + begin + BaseX := aRect.Left + RectWidth(aRect) div 2 - ArrowWidth div 2; + BaseY := aRect.Top + RectHeight(aRect) div 2 - ArrowHeight div 2 + 1; + + for I := ArrowHeight downto 1 do + with ACanvas do + begin + MoveTo(BaseX, BaseY); + LineTo(BaseX + I * 2 - 1, BaseY); + Inc(BaseX); + Inc(BaseY); + end; + end; + dirLeft: + begin + BaseX := aRect.Left + RectWidth(aRect) div 2 + ArrowHeight div 2; + BaseY := aRect.Top + RectHeight(aRect) div 2 - ArrowWidth div 2; + + for I := ArrowHeight downto 1 do + with ACanvas do + begin + MoveTo(BaseX, BaseY); + LineTo(BaseX, BaseY + I * 2 - 1); + Dec(BaseX); + Inc(BaseY); + end; + end; + else + BaseX := aRect.Left + RectWidth(aRect) div 2 - ArrowHeight div 2; + BaseY := aRect.Top + RectHeight(aRect) div 2 - ArrowWidth div 2; + + for I := ArrowHeight downto 1 do + with ACanvas do + begin + MoveTo(BaseX, BaseY); + LineTo(BaseX, BaseY + I * 2 - 1); + Inc(BaseX); + Inc(BaseY); + end; + end; +end; + +procedure TJvTFGVTextControl.UpdateDDBtnRect; +begin + FDDBtnRect := LineRect(FMousePtInfo.AbsLineNum); + FDDBtnRect.Right := ClientRect.Right - 1; + FDDBtnRect.Left := FDDBtnRect.Right - 10; + Inc(FDDBtnRect.Top, 2); + Dec(FDDBtnRect.Bottom, 1); +end; + +procedure TJvTFGVTextControl.DoEnter; +begin + inherited DoEnter; + Viewer.SetSelAppt(FindApptAtLine(FMousePtInfo.RelLineNum)); + DoViewerEnter; +end; + +procedure TJvTFGVTextControl.DoExit; +begin + inherited DoExit; + FMouseLine := -1; +end; + +{ +function TJvTFGVTextControl.LineCount: Integer; +var + ACell: TJvTFGlanceCell; + I: Integer; +begin + Result := 0; + ACell := Viewer.GlanceControl.Cells.Cells[Viewer.Col, Viewer.Row]; + + for I := 0 to ACell.ScheduleCount - 1 do + Inc(Result, ACell.Schedules[I].ApptCount); +end; +} + +function TJvTFGVTextControl.LineCount: Integer; +begin + Result := Viewer.ApptCount; +end; + +procedure TJvTFGVTextControl.SetTopLine(Value: Integer); +begin + Viewer.SetTopLine(Viewer.Cell, Value); +end; + +function TJvTFGVTextControl.CalcPointInfo(X, Y: Integer): TJvTFGlTxtVwPointInfo; +begin + with Result do + begin + AbsX := X; + AbsY := Y; + AbsLineNum := CalcAbsLineNum(Y); + RelLineNum := TopLine + AbsLineNum; + end; +end; + +function TJvTFGVTextControl.ViewableLines: Integer; +var + aRect: TRect; +begin + aRect := GlanceControl.CalcCellBodyRect(Viewer.Cell, + GlanceControl.CellIsSelected(Viewer.Cell), False); + + Result := RectHeight(aRect) div CalcLineHeight; + if RectHeight(aRect) mod CalcLineHeight > 0 then + Inc(Result); +end; + +function TJvTFGVTextControl.AbsToRel(Abs: Integer): Integer; +begin + Result := TopLine + Abs; +end; + +function TJvTFGVTextControl.RelToAbs(Rel: Integer): Integer; +begin + Result := Rel - TopLine; +end; + +procedure TJvTFGVTextControl.DoViewerDblClick; +begin + if FHasScrolled then + Exit; + + Viewer.DoDblClick; + FWasInDblClick := True; +end; + +procedure TJvTFGVTextControl.DoViewerClick; +begin + Viewer.DoClick; +end; + +procedure TJvTFGVTextControl.DoViewerEnter; +begin + Viewer.DoEnter; +end; + +procedure TJvTFGVTextControl.DblClick; +begin + if FHasScrolled then + Exit; + + inherited DblClick; + DoViewerDblClick; +end; + +procedure TJvTFGVTextControl.MouseDown(Button: TMouseButton; + Shift: TShiftState; X, Y: Integer); +var + Appt: TJvTFAppt; + ticks: Cardinal; +begin + inherited MouseDown(Button, Shift, X, Y); + SetFocus; + + // In order not to trigger double clicks when clicking too fast on the + // little arrows in the list, we keep track of wether or not scrolling + // occured. But of course, we have to reinitialize this, and the best + // Place to do it is here, in MouseDown. + FHasScrolled := False; + + if PtInRect(ScrollDnBtnRect(ClientRect), Point(X, Y)) then + Scroll(1) + else + if PtInRect(ScrollUpBtnRect(ClientRect), Point(X, Y)) then + Scroll(-1) + else + begin + Appt := FindApptAtLine(FMousePtInfo.RelLineNum); + if Assigned(Appt) then + begin + if Viewer.SelAppt <> Appt then + begin + Viewer.SetSelAppt(Appt); + Click; + end; + end; + + if PtInRect(FDDBtnRect, Point(X, Y)) and Assigned(Viewer) then + begin + EditAppt(Viewer.Cell, FMousePtInfo.RelLineNum, Appt); + Viewer.LineDDClick(MouseLine); + end + else + begin + // When the user double clicks in a cell that is not already selected, + // we are moved to the new place. As a result, the second MouseUp is + // sent to us, not the grid, which result in a double click not being + // triggered. In order to trigger the double click, we keep track of + // the change of location in SetBounds and if we get a MouseUp event + // in less than the double click time, we know it's a because of a + // double click and we trigger the appropriate event. + ticks := GetTickCount; + if (ticks - FWasMovedTicks < GetDoubleClickTime) then + begin + DoViewerDblClick; + end; + FWasMovedTicks := 0; + + // only start dragging if the mouse down has not happened in the double + // click window. That's because if we get a MouseDown right after a + // DoubleClick, then we will never receive the MouseUp. The code below + // would lead to the start of a drag of an appointment leading to potential + // problems when clicking again (like dropping an non existent appointment). + // To avoid this, we keep track of the fact that we went through a double + // click and do nothing when we get a mouse down right after that. + if not PtInRect(FDDBtnRect, Point(X, Y)) and Assigned(Appt) and + not FWasInDblClick then + Viewer.GlanceControl.BeginDrag(False); + end; + end; + + FWasInDblClick := False; +end; + +procedure TJvTFGVTextControl.MouseUp(Button: TMouseButton; + Shift: TShiftState; X, Y: Integer); +begin + inherited MouseUp(Button, Shift, X, Y); +end; + +procedure TJvTFGVTextControl.MouseEnter(Control: TControl); +begin + FMouseInControl := True; + inherited MouseEnter(Control); + Invalidate; +end; + +procedure TJvTFGVTextControl.MouseLeave(Control: TControl); +begin + FMouseInControl := False; + inherited MouseLeave(Control); + Invalidate; +end; + +procedure TJvTFGVTextControl.Scroll(ADelta: Integer); +var + CurrTop: Integer; +begin + CurrTop := Viewer.GetTopLine(Viewer.Cell); + Viewer.SetTopLine(Viewer.Cell, CurrTop + ADelta); + FHasScrolled := True; +end; + +function TJvTFGVTextControl.GetTopLine: Integer; +begin + Result := Viewer.GetTopLine(Viewer.Cell); +end; + +function TJvTFGVTextControl.ScrollDnBtnRect(aCellRect: TRect): TRect; +var + BtnLeft, + BtnTop: Integer; +begin + if TopLine + FullViewableLines - 1 < LineCount - 1 then + begin + Result := Rect(0, 0, FScrollDnBtnBMP.Width, FScrollDnBtnBMP.Height); + BtnLeft := aCellRect.Right - 10 - RectWidth(Result); + BtnTop := aCellRect.Bottom - RectHeight(Result); + OffsetRect(Result, BtnLeft, BtnTop); + end + else + Result := Rect(0, 0, 0, 0); +end; + +function TJvTFGVTextControl.ScrollUpBtnRect(aCellRect: TRect): TRect; +var + BtnLeft: Integer; +begin + if TopLine > 0 then + begin + Result := Rect(0, 0, FScrollUpBtnBMP.Width, FScrollUpBtnBMP.Height); + BtnLeft := aCellRect.Right - 10 - RectWidth(Result); + OffsetRect(Result, BtnLeft, aCellRect.Top); + end + else + Result := Rect(0, 0, 0, 0); +end; + +procedure TJvTFGVTextControl.SetCanEdit(const Value: Boolean); +begin + FCanEdit := Value; +end; + +procedure TJvTFGVTextControl.SetShowDDButton(const Value: Boolean); +begin + FShowDDButton := Value; +end; + +destructor TJvTFGVTextControl.Destroy; +begin + FEditor.Free; + FScrollUpBtnBMP.Free; + FScrollDnBtnBMP.Free; + + inherited Destroy; +end; + +procedure TJvTFGVTextControl.InitScrollDnBtnBMP; +begin + with FScrollDnBtnBMP do + begin + Height := 9; + Width := 16; + + with Canvas do + begin + Brush.Color := clBtnFace; + FillRect(Rect(0, 0, Width, Height)); + + Pen.Color := clBlack; + Polyline([Point(0, 0), Point(Width - 1, 0), + Point(Width - 1, Height - 1), Point(0, Height - 1), + Point(0, 0)]); + + MoveTo(2, 2); + LineTo(14, 2); + MoveTo(2, 3); + LineTo(14, 3); + MoveTo(7, 4); + LineTo(13, 4); + MoveTo(8, 5); + LineTo(12, 5); + MoveTo(9, 6); + LineTo(11, 6); + end; + end; +end; + +procedure TJvTFGVTextControl.InitScrollUpBtnBMP; +begin + with FScrollUpBtnBMP do + begin + Height := 9; + Width := 16; + + with Canvas do + begin + Brush.Color := clBtnFace; + FillRect(Rect(0, 0, Width, Height)); + + Pen.Color := clBlack; + Polyline([Point(0, 0), Point(Width - 1, 0), + Point(Width - 1, Height - 1), Point(0, Height - 1), + Point(0, 0)]); + + MoveTo(9, 2); + LineTo(11, 2); + MoveTo(8, 3); + LineTo(12, 3); + MoveTo(7, 4); + LineTo(13, 4); + MoveTo(2, 5); + LineTo(14, 5); + MoveTo(2, 6); + LineTo(14, 6); + end; + end; +end; + +procedure TJvTFGVTextControl.DrawScrollDnBtn(ACanvas: TCanvas; aCellRect: TRect); +var + aRect: TRect; +begin + aRect := ScrollDnBtnRect(aCellRect); + BitBlt(ACanvas.Handle, aRect.Left, aRect.Top, RectWidth(aRect), + RectHeight(aRect), FScrollDnBtnBMP.Canvas.Handle, 0, 0, SRCCOPY); +end; + +procedure TJvTFGVTextControl.DrawScrollUpBtn(ACanvas: TCanvas; aCellRect: TRect); +var + aRect: TRect; +begin + aRect := ScrollUpBtnRect(aCellRect); + BitBlt(ACanvas.Handle, aRect.Left, aRect.Top, RectWidth(aRect), + RectHeight(aRect), FScrollUpBtnBMP.Canvas.Handle, 0, 0, SRCCOPY); +end; + +function TJvTFGVTextControl.FullViewableLines: Integer; +var + aRect: TRect; +begin + aRect := GlanceControl.CalcCellBodyRect(Viewer.Cell, + GlanceControl.CellIsSelected(Viewer.Cell), False); + + Result := RectHeight(aRect) div CalcLineHeight; +end; + +(* +procedure TJvTFGVTextControl.EditAppt(Col, Row: Integer; Appt: TJvTFAppt); +var + EditLine: Integer; + EditorRect: TRect; +begin + EditLine := RelToAbs(GetApptRelLineNum(Appt)); + if not Assigned(Appt) or not CanEdit or + ((EditLine < 0) or (EditLine > AbsLineCount)) then + Exit; + + Viewer.EnsureCol(Col); + Viewer.EnsureRow(Row); + if (Viewer.Col <> Col) or (Viewer.Row <> Row) then + Viewer.MoveTo(Col, Row); + + if Viewer.EditorAlign = eaLine then + begin + EditorRect := LineRect(EditLine); + FEditor.WordWrap := False; + FEditor.BorderStyle := bsSingle; + end + else + begin + EditorRect := ClientRect; + FEditor.WordWrap := True; + FEditor.BorderStyle := bsNone; + end; + + with FEditor do + begin + LinkedAppt := Appt; + Color := Viewer.SelApptAttr.Color; + Font := Viewer.GlanceControl.SelCellAttr.Font; + Font.Color := Viewer.SelApptAttr.FontColor; + BoundsRect := EditorRect; + + Text := Appt.Description; + { + if agoFormattedDesc in Options then + Text := Appt.Description + else + Text := StripCRLF(Appt.Description); + } + +{ //Self.Update; // not calling update here increases flicker + Visible := True; + SetFocus; + SelLength := 0; + SelStart := 0; + end; +end; +} +*) + +procedure TJvTFGVTextControl.EditAppt(ACell: TJvTFGlanceCell; RelLine: Integer; Appt: TJvTFAppt); +var + EditLine: Integer; + EditorRect: TRect; +begin + //EditLine := RelToAbs(GetApptRelLineNum(Appt)); + EditLine := RelToAbs(RelLine); + if not Assigned(Appt) or not CanEdit or + ((EditLine < 0) or (EditLine > AbsLineCount)) then + Exit; + + Viewer.MoveTo(ACell); + + if Viewer.EditorAlign = eaLine then + begin + EditorRect := LineRect(EditLine); + FEditor.WordWrap := False; + FEditor.BorderStyle := bsSingle; + end + else + begin + EditorRect := ClientRect; + FEditor.WordWrap := True; + FEditor.BorderStyle := bsNone; + end; + + with FEditor do + begin + LinkedAppt := Appt; + Color := Viewer.SelApptAttr.Color; + Font := Viewer.GlanceControl.SelCellAttr.Font; + Font.Color := Viewer.SelApptAttr.FontColor; + BoundsRect := EditorRect; + + Text := Appt.Description; + { + if agoFormattedDesc in Options then + Text := Appt.Description + else + Text := StripCRLF(Appt.Description); + } + + //Self.Update; // not calling update here increases flicker + Visible := True; + SetFocus; + SelLength := 0; + SelStart := 0; + end; +end; + + +function TJvTFGVTextControl.Editing: Boolean; +begin + Result := FEditor.Visible; +end; + +procedure TJvTFGVTextControl.FinishEditAppt; +begin + if Assigned(FEditor.LinkedAppt) then + FEditor.LinkedAppt.Description := FEditor.Text; + FEditor.Visible := False; +end; + +function TJvTFGVTextControl.FindApptAtLine(RelLineNum: Integer): TJvTFAppt; +begin + if Assigned(Viewer) and + (RelLineNum >= 0) and (RelLineNum < Viewer.ApptCount) then + Result := Viewer.Appts[RelLineNum] + else + Result := nil; +end; + +function TJvTFGVTextControl.GetApptRelLineNum(Appt: TJvTFAppt): Integer; +var + I: Integer; +begin + Result := -1; + if not Assigned(Appt) then + Exit; + + I := 0; + while (I < Viewer.ApptCount) and (Result = -1) do + if Viewer.Appts[I] = Appt then + Result := I + else + Inc(I); +end; + +function TJvTFGVTextControl.AbsLineCount: Integer; +begin + //Result := Lesser(ViewableLines - 1, LineCount - TopLine - 1); + Result := RectHeight(ClientRect) div CalcLineHeight; + if RectHeight(ClientRect) mod CalcLineHeight > 0 then + Inc(Result); +end; + +procedure TJvTFGVTextControl.MouseAccel(X, Y: Integer); +var + Appt: TJvTFAppt; +begin + Appt := GetApptAccel(X, Y); + if Assigned(Appt) then + Viewer.SetSelAppt(Appt); +end; + +procedure TJvTFGVTextControl.Click; +begin + DoViewerClick; +end; + +function TJvTFGVTextControl.GetStartEndString(Appt: TJvTFAppt): string; +var + ShowDates: Boolean; + DateFormat, + TimeFormat: string; +begin + ShowDates := (Trunc(Appt.StartDate) <> Trunc(Viewer.Date)) or + (Trunc(Appt.EndDate) <> Trunc(Viewer.Date)); + DateFormat := Viewer.GlanceControl.DateFormat; + TimeFormat := Viewer.GlanceControl.TimeFormat; + + Result := ''; + if ShowDates then + Result := FormatDateTime(DateFormat, Appt.StartDate) + ' '; + + Result := Result + FormatDateTime(TimeFormat, Appt.StartTime) + ' - '; + + if ShowDates then + Result := Result + FormatDateTime(DateFormat, Appt.EndDate) + ' '; + + Result := Result + FormatDateTime(TimeFormat, Appt.EndTime); +end; + +function TJvTFGVTextControl.GetApptAccel(X, Y: Integer): TJvTFAppt; +var + LocalPt: TPoint; +begin + LocalPt := ScreenToClient(Viewer.GlanceControl.ClientToScreen(Point(X, Y))); + Result := GetApptAt(LocalPt.X, LocalPt.Y); +end; + +function TJvTFGVTextControl.GetApptAt(X, Y: Integer): TJvTFAppt; +var + PtInfo: TJvTFGlTxtVwPointInfo; +begin + PtInfo := CalcPointInfo(X, Y); + Result := FindApptAtLine(PtInfo.RelLineNum); +end; + +procedure TJvTFGVTextControl.DragOver(Source: TObject; X, Y: Integer; + State: TDragState; var Accept: Boolean); +begin + inherited DragOver(Source, X, Y, State, Accept); + if Source is TJvTFControl then + Viewer.Visible := False; +end; + +//=== { TJvTFGlanceTextViewer } ============================================== + +constructor TJvTFGlanceTextViewer.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + + FTopLines := TStringList.Create; + FViewControl := TJvTFGVTextControl.Create(Self); + FSelApptAttr := TJvTFTxtVwApptAttr.Create(Self); + FSelApptAttr.OnChange := @SelApptAttrChange; + FEditorAlign := eaLine; + FShowStartEnd := True; +end; + +destructor TJvTFGlanceTextViewer.Destroy; +begin + FViewControl.Free; + FTopLines.Free; + FSelApptAttr.OnChange := nil; + FSelApptAttr.Free; + inherited Destroy; +end; + +procedure TJvTFGlanceTextViewer.Change; +begin + Refresh; +end; + +procedure TJvTFGlanceTextViewer.SetEditorAlign(Value: TJvTFGlTxtVwEditorAlign); +begin + FEditorAlign := Value; +end; + +function TJvTFGlanceTextViewer.GetDrawInfo(ACell: TJvTFGlanceCell): TJvTFGlTxtVwDrawInfo; +var + Attr: TJvTFGlanceCellAttr; +begin + if not Assigned(GlanceControl) then + raise EGlanceViewerError.CreateRes(@RsEGlanceControlNotAssigned); + + with Result do + begin + Cell := ACell; + Attr := GlanceControl.GetCellAttr(ACell); + Font := Attr.Font; + Color := Attr.Color; + aRect := GlanceControl.CalcCellBodyRect(ACell, + GlanceControl.CellIsSelected(ACell), False); + end; +end; + +function TJvTFGlanceTextViewer.GetTopLine(ACell: TJvTFGlanceCell): Integer; +var + I: Integer; +begin + I := FTopLines.IndexOf(GetCellString(ACell)); + if I > -1 then + Result := Integer(FTopLines.Objects[I]) + else + Result := 0; +end; + +procedure TJvTFGlanceTextViewer.LineDDClick(LineNum: Integer); +begin + if Assigned(FOnLineDDClick) then + FOnLineDDClick(Self, LineNum); +end; + +procedure TJvTFGlanceTextViewer.DoDblClick; +begin + if Assigned(FOnDblClick) then + FOnDblClick(Self); +end; + +procedure TJvTFGlanceTextViewer.DoClick; +begin + if Assigned(FOnClick) then + FOnClick(Self); +end; + +procedure TJvTFGlanceTextViewer.DoEnter; +begin + if Assigned(FOnEnter) then + FOnEnter(Self); +end; + +procedure TJvTFGlanceTextViewer.MouseAccel(X, Y: Integer); +begin + inherited MouseAccel(X, Y); + FViewControl.MouseAccel(X, Y); + DoClick; +end; + +procedure TJvTFGlanceTextViewer.Notify(Sender: TObject; + Code: TJvTFServNotifyCode); +begin + inherited Notify(Sender, Code); +end; + +procedure TJvTFGlanceTextViewer.PaintTo(ACanvas: TCanvas; ACell: TJvTFGlanceCell); +begin + FViewControl.PaintTo(ACanvas, GetDrawInfo(ACell)); +end; + +procedure TJvTFGlanceTextViewer.ParentReconfig; +begin + inherited ParentReconfig; + FTopLines.Clear; +end; + +procedure TJvTFGlanceTextViewer.Realign; +begin + if not Assigned(GlanceControl) then + Exit; + + FViewControl.BoundsRect := CalcBoundsRect(Cell); + if not FViewControl.Replicating then + SetSelAppt(nil); +end; + +procedure TJvTFGlanceTextViewer.Refresh; +begin + FViewControl.Invalidate; +end; + +procedure TJvTFGlanceTextViewer.ResetTopLines; +begin + FTopLines.Clear; + GlanceControl.Invalidate; +end; + +procedure TJvTFGlanceTextViewer.SelApptAttrChange(Sender: TObject); +begin + //Change; + FViewControl.Invalidate; +end; + +procedure TJvTFGlanceTextViewer.SetGlanceControl(Value: TJvTFCustomGlance); +begin + inherited SetGlanceControl(Value); + if csDestroying in ComponentState then + exit; + FViewControl.Parent := Value; +end; + +procedure TJvTFGlanceTextViewer.SetInplaceEdit(const Value: Boolean); +begin + inherited SetInplaceEdit(Value); + + FViewControl.CanEdit := InPlaceEdit; + FViewControl.Invalidate; +end; + +procedure TJvTFGlanceTextViewer.SetLineSpacing(Value: Integer); +begin + //Value := Greater(Value, 0); + if Value <> FLineSpacing then + begin + FLineSpacing := Value; + Change; + end; +end; + +procedure TJvTFGlanceTextViewer.SetSelAppt(Value: TJvTFAppt); +begin + FSelAppt := Value; + FViewControl.Invalidate; +end; + +procedure TJvTFGlanceTextViewer.SetSelApptAttr(Value: TJvTFTxtVwApptAttr); +begin + FSelApptAttr.Assign(Value); +end; + +procedure TJvTFGlanceTextViewer.SetTopLine(ACell: TJvTFGlanceCell; Value: Integer); +var + I: Integer; + CellStr: string; +begin + Value := Greater(Value, 0); + Value := Lesser(Value, ApptCount - 1); + + // bug fix - this effectively hides the hint window. The showing/hiding + // of the hint window was causing the viewer to be positioned at the + // wrong cell due to repainting as the hint window would hide/show. + GlanceControl.CheckViewerApptHint(-1, -1); + + CellStr := GetCellString(ACell); + I := FTopLines.IndexOf(CellStr); + if I > -1 then + if Value = 0 then + FTopLines.Delete(I) + else + FTopLines.Objects[I] := TObject(Value) + else + if Value <> 0 then + FTopLines.AddObject(CellStr, TObject(Value)); + Refresh; +end; + +procedure TJvTFGlanceTextViewer.SetVisible(Value: Boolean); +begin + // MORE STUFF NEEDS TO BE ADDED HERE! + FViewControl.Visible := Value; +end; + +procedure TJvTFGlanceTextViewer.SetShowStartEnd(Value: Boolean); +begin + if Value <> FShowStartEnd then + begin + FShowStartEnd := Value; + if not (csLoading in ComponentState) then + begin + GlanceControl.Invalidate; + FViewControl.Invalidate; + end; + end; +end; + +function TJvTFGlanceTextViewer.GetApptAt(X, Y: Integer): TJvTFAppt; +begin + Result := FViewControl.GetApptAt(X, Y); +end; + +function TJvTFGlanceTextViewer.CanEdit: Boolean; +begin + Result := FViewControl.CanEdit and InPlaceEdit; +end; + +procedure TJvTFGlanceTextViewer.EditAppt(ACell: TJvTFGlanceCell; RelLine: Integer; + Appt: TJvTFAppt); +begin + FViewControl.EditAppt(ACell, RelLine, Appt); +end; + +function TJvTFGlanceTextViewer.Editing: Boolean; +begin + Result := FViewControl.Editing; +end; + +procedure TJvTFGlanceTextViewer.FinishEditAppt; +begin + FViewControl.FinishEditAppt; +end; + +function TJvTFGlanceTextViewer.GetCellString(ACell: TJvTFGlanceCell): string; +begin + Result := ''; + if Assigned(ACell) then + begin + Result := IntToStr(ACell.ColIndex) + ',' + IntToStr(ACell.RowIndex); + if ACell.IsSubcell then + Result := Result + 'S'; + end; +end; + +function TJvTFGlanceTextViewer.GetShowLineDDButton: Boolean; +begin + Result := FViewControl.ShowDDButton; +end; + +procedure TJvTFGlanceTextViewer.DoDrawAppt(ACanvas: TCanvas; + DrawInfo: TJvTFGlTxtVwDrawInfo; Appt: TJvTFAppt; Rect: TRect; var Handled: Boolean); +begin + if Assigned(FOnDrawAppt) then + FOnDrawAppt(Self, ACanvas, DrawInfo, Appt, Rect, Handled); +end; + +procedure TJvTFGlanceTextViewer.SetShowLineDDButton(const Value: Boolean); +begin + FViewControl.ShowDDButton := Value; +end; + +//=== { TJvTFGVTxtEditor } =================================================== + +constructor TJvTFGVTxtEditor.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + + ControlStyle := ControlStyle + [csNoDesignVisible]; + { + ParentCtl3D := False; + Ctl3D := False; + } +end; + +destructor TJvTFGVTxtEditor.Destroy; +begin + inherited Destroy; +end; + +procedure TJvTFGVTxtEditor.DoExit; +begin + inherited DoExit; + try + if not FCancelEdit then + TJvTFGVTextControl(Owner).FinishEditAppt; + finally + FCancelEdit := False; + Parent.SetFocus; + end; +end; + +procedure TJvTFGVTxtEditor.KeyDown(var Key: Word; Shift: TShiftState); +begin + inherited KeyDown(Key, Shift); + + if Key = VK_ESCAPE then + begin + FCancelEdit := True; + Key := 0; + Visible := False; + end + else + if (Key = VK_RETURN) and (ssCtrl in Shift) then + TJvTFGVTextControl(Owner).FinishEditAppt; +end; + +//=== { TJvTFTxtVwApptAttr } ================================================= + +constructor TJvTFTxtVwApptAttr.Create(AOwner: TComponent); +begin + inherited Create; + FColor := clBlue; + FFontColor := clWhite; +end; + +procedure TJvTFTxtVwApptAttr.Assign(Source: TPersistent); +begin + if Source is TJvTFTxtVwApptAttr then + begin + FColor := TJvTFTxtVwApptAttr(Source).Color; + FFontColor := TJvTFTxtVwApptAttr(Source).FontColor; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFTxtVwApptAttr.Change; +begin + if Assigned(FOnChange) then + FOnChange(Self); +end; + +procedure TJvTFTxtVwApptAttr.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + Change; + end; +end; + +procedure TJvTFTxtVwApptAttr.SetFontColor(Value: TColor); +begin + if Value <> FFontColor then + begin + FFontColor := Value; + Change; + end; +end; + + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfmanager.pas b/components/jvcllaz/run/JvTimeFramework/jvtfmanager.pas new file mode 100644 index 000000000..cd396fea0 --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfmanager.pas @@ -0,0 +1,5369 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFManager.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFManager; + +{$mode objfpc}{$H+} + +interface + +uses + LCLIntf, LCLType, + Classes, SysUtils, Controls, //Windows, Messages, + Graphics, ImgList, ExtCtrls, Printers, Forms, + //JvComponentBase, + JvComponent, JvTypes, JvTFUtils; + +const + CN_REQUESTREFRESH = $BD01; + +type + // Redeclaration of this type. It is used in JvTFMonths.TJvTFDrawDWTitleEvent. + // If not redeclared here, Delphi complains of 'unknown type' because it + // will not automatically bring in 'JvTFUtils' into the uses clause when + // a TJvTFDrawDWTitleEvent prototype is created. + TTFDayOfWeek = JvTFUtils.TTFDayOfWeek; + EJvTFScheduleManagerError = class(Exception); + + TJvTFTimeRange = record + StartTime: TTime; + EndTime: TTime; + end; + + TJvTFServNotifyCode = (sncDestroyAppt, + sncDestroySchedule, + sncLoadAppt, + sncSchedLoadAppt, + sncSchedUnloadAppt, + sncPostAppt, + sncDeleteAppt, + sncRequestSchedule, + sncReleaseSchedule, + sncConnectComponent, + sncDisconnectComponent, + sncConnectControl, + sncDisconnectControl, + sncConnectAppt, + sncDisconnectAppt, + sncRefresh); + + TJvTFScheduleManager = class; + {$M+} + TJvTFSched = class; + {$M-} + TJvTFAppt = class; + TJvTFComponent = class; + TJvTFControl = class; + TJvTFPrinter = class; + TJvTFHint = class; + // TJvTFNavigator = class; + + TJvTFSchedClass = class of TJvTFSched; + TJvTFApptClass = class of TJvTFAppt; + TJvTFHintClass = class of TJvTFHint; + + TCNRequestRefresh = record + Msg: Cardinal; + Schedule: TJvTFSched; + Unused: Longint; + Result: Longint; + end; + + TJvTFDateList = class + private + FOnChange: TNotifyEvent; + protected + FList: TStringList; + function GetDate(Index: Integer): TDate; + procedure Change; virtual; + public + constructor Create; + destructor Destroy; override; + function Add(ADate: TDate): Integer; + procedure Delete(Index: Integer); + procedure Clear; + function Count: Integer; + function IndexOf(ADate: TDate): Integer; + property Dates[Index: Integer]: TDate read GetDate; default; + property OnChange: TNotifyEvent read FOnChange write FOnChange; + end; + + TJvTFNavEvent = procedure(Sender: TObject; aControl: TJvTFControl; + SchedNames: TStringList; Dates: TJvTFDateList) of object; + TJvTFControlEvent = procedure(Sender: TObject; aControl: TJvTFControl) of object; + TJvTFSchedEvent = procedure(Sender: TObject; Schedule: TJvTFSched) of object; + TJvTFApptEvent = procedure(Sender: TObject; Appt: TJvTFAppt) of object; + TJvTFVarApptEvent = procedure(Sender: TObject; var Appt: TJvTFAppt) of object; + TJvTFFlushEvent = procedure(Sender, FlushObj: TObject; var FlushIt: Boolean) of object; + + // implicit post fix + TJvTFPostApptQueryEvent = procedure(Sender: TObject; Appt: TJvTFAppt; + var CanPost: Boolean) of object; + + TJvTFCustomImageMap = class(TPersistent) + private + FMap: TStringList; + function GetImage(MapIndex: Integer): Integer; + procedure SetImage(MapIndex: Integer; Value: Integer); + function GetImageName(MapIndex: Integer): string; + protected + FAppt: TJvTFAppt; + procedure Change; + public + constructor Create(anAppt: TJvTFAppt); + destructor Destroy; override; + property Images[MapIndex: Integer]: Integer read GetImage write SetImage; default; + property ImageNames[MapIndex: Integer]: string read GetImageName; + function Count: Integer; + procedure Add(const ImageName: string; ImageIndex: Integer); + procedure Delete(MapIndex: Integer); + procedure Move(SrcMapIndex, DestMapIndex: Integer); + function FindMapIndex(const ImageName: string): Integer; + function FindImageIndex(const ImageName: string): Integer; + procedure Clear; + procedure Assign(Source: TPersistent); override; + end; + + TJvTFStatePic = (spAlarmEnabled, spAlarmDisabled, spShared, spRecurring, + spModified); + + TJvTFStateImageMap = class(TPersistent) + private + FPics: array[Low(TJvTFStatePic)..High(TJvTFStatePic)] of Integer; + + procedure SetImage(StatePicID: TJvTFStatePic; Value: Integer); + function GetImage(StatePicID: TJvTFStatePic): Integer; + function GetAlarmDisabled: Integer; + function GetAlarmEnabled: Integer; + function GetModified: Integer; + function GetRecurring: Integer; + function GetShared: Integer; + procedure SetAlarmDisabled(const Value: Integer); + procedure SetAlarmEnabled(const Value: Integer); + procedure SetModified(const Value: Integer); + procedure SetRecurring(const Value: Integer); + procedure SetShared(const Value: Integer); + protected + FScheduleManager: TJvTFScheduleManager; + FUpdating: Boolean; + procedure Change; + public + constructor Create(Serv: TJvTFScheduleManager); + procedure BeginUpdate; + procedure EndUpdate; + procedure Clear; + procedure Assign(Source: TPersistent); override; + property Pics[Index: TJvTFStatePic]: Integer read GetImage write SetImage; + published + property AlarmEnabled: Integer {index spAlarmEnabled} + read GetAlarmEnabled write SetAlarmEnabled; + property AlarmDisabled: Integer {index spAlarmDisabled} + read GetAlarmDisabled write SetAlarmDisabled; + property Shared: Integer {index spShared} + read GetShared write SetShared; + property Recurring: Integer {index spRecurring} + read GetRecurring write SetRecurring; + //read GetImage write SetImage; + property Modified: Integer {index spModified} + read GetModified write SetModified; + end; + + TDynTimeRangeArray = array of TJvTFTimeRange; + + TDynApptArray = array of TJvTFAppt; + + TDynSchedArray = array of TJvTFSched; + + TJvTFAppt = class(TPersistent) + private + FStartDate: TDate; + FEndDate: TDate; + FStartTime: TTime; + FEndTime: TTime; + FDescription: string; + FAlarmEnabled: Boolean; + FAlarmAdvance: Integer; + FImageMap: TJvTFCustomImageMap; + FData: Integer; + FPersistent: Boolean; + FColor: TColor; + FBarColor: TColor; + FRefreshed: Boolean; + FGlyph: TPicture; + FDestroying: Boolean; + + function GetDescription: string; + procedure SetDescription(Value: string); + procedure SetAlarmEnabled(Value: Boolean); + procedure SetAlarmAdvance(Value: Integer); + procedure SetColor(Value: TColor); + procedure SetBarColor(Value: TColor); + function GetStartDateTime: TDateTime; + function GetEndDateTime: TDateTime; + function GetStartDate: TDate; + function GetEndDate: TDate; + function GetStartTime: TTime; + function GetEndTime: TTime; + procedure SetRefreshed(Value: Boolean); + procedure SetGlyph(const Value: TPicture); + protected + FID: string; + FModified: Boolean; + FScheduleManager: TJvTFScheduleManager; + FConnections: TStringList; + FSchedules: TStringList; + FDeleting: Boolean; + // implicit post fix + FUpdating: Boolean; + + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); + procedure NotifyManager(Serv: TJvTFScheduleManager; Sender: TObject; + Code: TJvTFServNotifyCode); + procedure NotifySchedule(Sched: TJvTFSched; Sender: TObject; + Code: TJvTFServNotifyCode); + + function GetConnection(Index: Integer): TJvTFSched; + function GetSchedule(Index: Integer): string; + procedure CheckConnections; + + procedure Connect(Schedule: TJvTFSched); + procedure Disconnect(Schedule: TJvTFSched); + procedure Change; + procedure InternalClearSchedules; + procedure DeleteApptNotification; + // implicit post fix + procedure PostApptNotification; + procedure RefreshNotification; + + property Destroying: Boolean read FDestroying; + public + constructor Create(Serv: TJvTFScheduleManager; const ApptID: string); virtual; + destructor Destroy; override; + + procedure Assign(Source: TPersistent); override; + procedure SetStartEnd(NewStartDate: TDate; NewStartTime: TTime; + NewEndDate: TDate; NewEndTime: TTime); + + procedure SetModified; + function Modified: Boolean; dynamic; + property ScheduleManager: TJvTFScheduleManager read FScheduleManager; + + function ConnectionCount: Integer; + property Connections[Index: Integer]: TJvTFSched read GetConnection; + + function ScheduleCount: Integer; + property Schedules[Index: Integer]: string read GetSchedule; + procedure AddSchedule(const SchedName: string); + procedure RemoveSchedule(const SchedName: string); + procedure AssignSchedules(List: TStrings); + procedure ClearSchedules; + function IndexOfSchedule(const SchedName: string): Integer; + function Shared: Boolean; + + procedure Post; + procedure Refresh; + procedure Delete; + + // implicit post fix + procedure BeginUpdate; + procedure EndUpdate; + property Updating: Boolean read FUpdating; + + property ImageMap: TJvTFCustomImageMap read FImageMap write FImageMap; + procedure RefreshControls; + property Refreshed: Boolean read FRefreshed write SetRefreshed; + published + property ID: string read FID; + property StartDate: TDate read GetStartDate; + property EndDate: TDate read GetEndDate; + property StartTime: TTime read GetStartTime; + property EndTime: TTime read GetEndTime; + property StartDateTime: TDateTime read GetStartDateTime; + property EndDateTime: TDateTime read GetEndDateTime; + property Description: string read GetDescription write SetDescription; + property AlarmEnabled: Boolean read FAlarmEnabled write SetAlarmEnabled; + property AlarmAdvance: Integer read FAlarmAdvance write SetAlarmAdvance; + property Data: Integer read FData write FData; + property Persistent: Boolean read FPersistent write FPersistent; + property Color: TColor read FColor write SetColor default clDefault; + property BarColor: TColor read FBarColor write SetBarColor default clDefault; + property Glyph: TPicture read FGlyph write SetGlyph; + end; + + {$M+} + TJvTFSched = class(TObject) + private + FAppts: TStringList; + FConControls: TStringList; + FConComponents: TStringList; + FDestroying: Boolean; + FData: Integer; + FPersistent: Boolean; + FSchedDisplayName: string; + procedure SetSchedDisplayName(const Value: string); + + function GetAppt(Index: Integer): TJvTFAppt; + protected + FSchedName: string; + FSchedDate: TDate; + FScheduleManager: TJvTFScheduleManager; + FCached: Boolean; + FCachedTime: Int64; //DWORD; + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); + procedure NotifyManager(Serv: TJvTFScheduleManager; Sender: TObject; + Code: TJvTFServNotifyCode); + procedure NotifyAppt(Appt: TJvTFAppt; Sender: TObject; + Code: TJvTFServNotifyCode); + function GetConControl(Index: Integer): TJvTFControl; + function GetConComponent(Index: Integer): TJvTFComponent; + procedure ConnectAppt(Appt: TJvTFAppt); + procedure DisconnectAppt(Appt: TJvTFAppt); + procedure ConnectionsOnChange(Sender: TObject); + procedure CheckConnections; + function GetFreeUsedTime(FreeTime: Boolean): TDynTimeRangeArray; dynamic; + public + constructor Create(Serv: TJvTFScheduleManager; const AName: string; ADate: TDate); virtual; + destructor Destroy; override; + + function ApptCount: Integer; + function ApptByID(const ID: string): TJvTFAppt; + property Appts[Index: Integer]: TJvTFAppt read GetAppt; + + function ConControlCount: Integer; + property ConControls[Index: Integer]: TJvTFControl read GetConControl; + + function ConComponentCount: Integer; + property ConComponents[Index: Integer]: TJvTFComponent read GetConComponent; + + procedure AddAppt(Appt: TJvTFAppt); + procedure RemoveAppt(Appt: TJvTFAppt); + + //procedure RefreshAppts; + procedure Refresh; + procedure PostAppts; + + // Conflict and free time methods + function GetFreeTime: TDynTimeRangeArray; dynamic; + function GetUsedTime: TDynTimeRangeArray; dynamic; + function TimeIsFree(TimeRange: TJvTFTimeRange): Boolean; overload; dynamic; + function TimeIsFree(RangeStart, RangeEnd: TTime): Boolean; overload; dynamic; + // The ApptHasConflicts(anAppt: TJvTFAppt) method declared here checks + // ONLY THIS SCHEDULE!! + function ApptHasConflicts(anAppt: TJvTFAppt): Boolean; dynamic; + function EnumConflicts(TimeRange: TJvTFTimeRange): TDynApptArray; + overload; dynamic; + function EnumConflicts(RangeStart, RangeEnd: TTime): TDynApptArray; + overload; dynamic; + // The following EnumConflicts(anAppt: TJvTFAppt) checks + // ONLY THIS SCHEDULE!! + function EnumConflicts(anAppt: TJvTFAppt): TDynApptArray; + overload; dynamic; + + property Cached: Boolean read FCached; + property CachedTime: Int64 {DWORD} read FCachedTime; + property Destroying: Boolean read FDestroying; + + function GetFirstAppt: TJvTFAppt; + function GetLastAppt: TJvTFAppt; + published + property SchedDisplayName: string read FSchedDisplayName + write SetSchedDisplayName; + property SchedName: string read FSchedName; + property SchedDate: TDate read FSchedDate; + property ScheduleManager: TJvTFScheduleManager read FScheduleManager; + property Data: Integer read FData write FData; + property Persistent: Boolean read FPersistent write FPersistent; + end; + {$M-} + + TJvTFScheduleManagerCacheType = (ctNone, ctTimed, ctBuffer); + TJvTFScheduleManagerCache = class(TPersistent) + private + FCacheType: TJvTFScheduleManagerCacheType; + FTimedDelay: Integer; + FBufferCount: Integer; + FTimer: TTimer; + procedure SetCacheType(Value: TJvTFScheduleManagerCacheType); + procedure SetTimedDelay(Value: Integer); + procedure SetBufferCount(Value: Integer); + protected + FScheduleManager: TJvTFScheduleManager; + procedure FlushManager; virtual; + procedure TimerOnTimer(Sender: TObject); virtual; + public + constructor Create(SchedManager: TJvTFScheduleManager); + destructor Destroy; override; + procedure Assign(Source: TPersistent); override; + published + property CacheType: TJvTFScheduleManagerCacheType read FCacheType write SetCacheType + default ctTimed; + property TimedDelay: Integer read FTimedDelay write SetTimedDelay + default 30000; + property BufferCount: Integer read FBufferCount write SetBufferCount + default 7; + end; + + TJvTFSchedLoadMode = (slmOnDemand, slmBatch); + TJvTFLoadBatchEvent = procedure(Sender: TObject; BatchName: string; + BatchStartDate, BatchEndDate: TDate) of object; + + TJvTFGetApptDisplayTextEvent = procedure(Sender: TObject; Source: TComponent; + Appt: TJvTFAppt; var DisplayText: string) of object; + + TJvTFApptDescEvent = procedure(Sender: TObject; Appt: TJvTFAppt; + var Description: string) of object; + + {$IFDEF RTL230_UP} + [ComponentPlatformsAttribute(pidWin32 or pidWin64)] + {$ENDIF RTL230_UP} + TJvTFScheduleManager = class(TComponent) + private + FAlwaysPost: Boolean; + FAppts: TStringList; + FSchedules: TStringList; + FConControls: TStringList; + FConComponents: TStringList; + FOnNeedAppts: TJvTFSchedEvent; + FOnRefreshAppt: TJvTFApptEvent; + FOnRefreshSched: TJvTFSchedEvent; + FOnRefreshAll: TNotifyEvent; + FOnDeleteAppt: TJvTFApptEvent; + FOnPostAppt: TJvTFApptEvent; + FOnFlush: TJvTFFlushEvent; + FOnCreateAppt: TJvTFApptEvent; + FOnCreateSchedule: TJvTFSchedEvent; + FOnDestroyAppt: TJvTFApptEvent; + FOnDestroySchedule: TJvTFSchedEvent; + FOnGetApptDisplayText: TJvTFGetApptDisplayTextEvent; + FOnGetApptDescription: TJvTFApptDescEvent; + FOnSetApptDescription: TJvTFApptDescEvent; + + FSchedLoadMode: TJvTFSchedLoadMode; + FOnLoadBatch: TJvTFLoadBatchEvent; + FOnBatchesProcessed: TNotifyEvent; + + FRefreshAutoReconcile: Boolean; + + FStateImages: TCustomImageList; + FCustomImages: TCustomImageList; + FStateImageMap: TJvTFStateImageMap; + FCache: TJvTFScheduleManagerCache; + + // implicit post fix + FOnPostApptQuery: TJvTFPostApptQueryEvent; + + function GetAppt(Index: Integer): TJvTFAppt; + function GetSchedule(Index: Integer): TJvTFSched; + function GetConControl(Index: Integer): TJvTFControl; + function GetConComponent(Index: Integer): TJvTFComponent; + procedure SetStateImages(Value: TCustomImageList); + procedure SetCustomImages(Value: TCustomImageList); + procedure SetCache(Value: TJvTFScheduleManagerCache); + + procedure SetTFSchedLoadMode(Value: TJvTFSchedLoadMode); + procedure SetRefreshAutoReconcile(Value: Boolean); + protected + FLoadingAppts: Boolean; + FRefreshing: Boolean; + FImageChangeLink: TChangeLink; + FFlushing: Boolean; + FDestroying: Boolean; + FSchedBatch: TStringList; + FApptBeingDestroyed: TJvTFAppt; + + procedure Notification(AComponent: TComponent; Operation: TOperation); override; + procedure ConnectControl(ApptCtrl: TJvTFControl); + procedure DisconnectControl(ApptCtrl: TJvTFControl); + procedure ConnectComponent(Comp: TJvTFComponent); + procedure DisconnectComponent(Comp: TJvTFComponent); + + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); virtual; + procedure NotifyAppt(Appt: TJvTFAppt; Sender: TObject; + Code: TJvTFServNotifyCode); + procedure NotifySchedule(Sched: TJvTFSched; Sender: TObject; + Code: TJvTFServNotifyCode); + procedure NotifyApptCtrl(ApptCtrl: TJvTFControl; Sender: TObject; + Code: TJvTFServNotifyCode); + procedure NotifyComp(Comp: TJvTFComponent; Sender: TObject; + Code: TJvTFServNotifyCode); + + procedure RetrieveSchedule(const SchedName: string; SchedDate: TDate; + var Schedule: TJvTFSched; var LoadedNow: Boolean); + + procedure NeedAppts(Schedule: TJvTFSched); virtual; + procedure AddAppt(Appt: TJvTFAppt); + procedure RemoveAppt(Appt: TJvTFAppt); + procedure RemoveSchedule(Sched: TJvTFSched); + + //procedure RefreshAppt(Appt: TJvTFAppt); + procedure DeleteAppt(Appt: TJvTFAppt); + procedure PostAppt(Appt: TJvTFAppt); + + // implicit post fix + function QueryPostAppt(Appt: TJvTFAppt): Boolean; + + procedure AddToBatch(ASched: TJvTFSched); + procedure LoadBatch(const BatchName: string; BatchStartDate, + BatchEndDate: TDate); virtual; + + procedure RequestRefresh(ApptCtrl: TJvTFControl; + Schedule: TJvTFSched); overload; dynamic; + procedure RequestRefresh(Comp: TJvTFComponent; + Schedule: TJvTFSched); overload; dynamic; + + procedure ImageListChange(Sender: TObject); + procedure FlushAppts; + function FlushObject(FlushObj: TObject): Boolean; + + procedure DoCreateApptEvent(anAppt: TJvTFAppt); dynamic; + procedure DoCreateScheduleEvent(aSchedule: TJvTFSched); dynamic; + procedure DoDestroyApptEvent(anAppt: TJvTFAppt); dynamic; + procedure DoDestroyScheduleEvent(aSchedule: TJvTFSched); dynamic; + + procedure SetApptDescription(Appt: TJvTFAppt; var Value: string); virtual; + procedure GetApptDescription(Appt: TJvTFAppt; var Value: string); virtual; + public + class function GetScheduleID(const SchedName: string; SchedDate: TDate): string; + class function GenerateApptID: string; virtual; + + function GetSchedClass: TJvTFSchedClass; dynamic; + function GetApptClass: TJvTFApptClass; dynamic; + + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + function ApptCount: Integer; + property Appts[Index: Integer]: TJvTFAppt read GetAppt; + function FindAppt(const ID: string): TJvTFAppt; + + function ScheduleCount: Integer; + property Schedules[Index: Integer]: TJvTFSched read GetSchedule; + function FindSchedule(const SchedName: string; SchedDate: TDate): TJvTFSched; + + function ConControlCount: Integer; + property ConControls[Index: Integer]: TJvTFControl read GetConControl; + function ConComponentCount: Integer; + property ConComponents[Index: Integer]: TJvTFComponent read GetConComponent; + + function RequestSchedule(ApptCtrl: TJvTFControl; const SchedName: string; + SchedDate: TDate): TJvTFSched; overload; + function RequestSchedule(ApptCtrl: TJvTFControl; const SchedName: string; + SchedDate: TDate; var LoadedNow: Boolean): TJvTFSched; overload; + + function RequestSchedule(Comp: TJvTFComponent; const SchedName: string; + SchedDate: TDate): TJvTFSched; overload; + function RequestSchedule(Comp: TJvTFComponent; const SchedName: string; + SchedDate: TDate; var LoadedNow: Boolean): TJvTFSched; overload; + + procedure ReleaseSchedule(ApptCtrl: TJvTFControl; const SchedName: string; + SchedDate: TDate); overload; + procedure ReleaseSchedule(Comp: TJvTFComponent; const SchedName: string; + SchedDate: TDate); overload; + + procedure ProcessBatches; + + procedure RequestAppt(const ID: string; var Appt: TJvTFAppt; var New: Boolean); + + property LoadingAppts: Boolean read FLoadingAppts; + property Refreshing: Boolean read FRefreshing; + + procedure dbPostAppt(Appt: TJvTFAppt); + procedure dbDeleteAppt(Appt: TJvTFAppt); + procedure dbDeleteAllAppt; + procedure dbRefreshAppt(Appt: TJvTFAppt); + procedure dbRefreshSched(Sched: TJvTFSched); + procedure dbRefreshAll; + procedure dbRefreshOrphans; + function dbNewAppt(const ID: string): TJvTFAppt; + + procedure PostAppts; + procedure RefreshAppts; + procedure ReconcileRefresh(Scope: TObject); + + procedure RefreshConnections(Trigger: TObject); virtual; + property Flushing: Boolean read FFlushing; + procedure Flush(All: Boolean = False); virtual; + + function GetApptDisplayText(AComponent: TComponent; + Appt: TJvTFAppt): string; virtual; + published + property AlwaysPost: Boolean read FAlwaysPost write FAlwaysPost default False; + property OnNeedAppts: TJvTFSchedEvent read FOnNeedAppts write FOnNeedAppts; + property OnRefreshAppt: TJvTFApptEvent read FOnRefreshAppt write FOnRefreshAppt; + property OnRefreshSched: TJvTFSchedEvent read FOnRefreshSched + write FOnRefreshSched; + property OnRefreshAll: TNotifyEvent read FOnRefreshAll write FOnRefreshAll; + property OnPostAppt: TJvTFApptEvent read FOnPostAppt write FOnPostAppt; + property OnDeleteAppt: TJvTFApptEvent read FOnDeleteAppt write FOnDeleteAppt; + property StateImages: TCustomImageList read FStateImages write SetStateImages; + property CustomImages: TCustomImageList read FCustomImages write SetCustomImages; + property StateImageMap: TJvTFStateImageMap read FStateImageMap write FStateImageMap; + property Cache: TJvTFScheduleManagerCache read FCache write SetCache; + // implicit post fix + property OnPostApptQuery: TJvTFPostApptQueryEvent read FOnPostApptQuery + write FOnPostApptQuery; + property OnFlush: TJvTFFlushEvent read FOnFlush write FOnFlush; + property OnCreateAppt: TJvTFApptEvent read FOnCreateAppt write FOnCreateAppt; + property OnDestroyAppt: TJvTFApptEvent read FOnDestroyAppt write FOnDestroyAppt; + property OnCreateSchedule: TJvTFSchedEvent read FOnCreateSchedule + write FOnCreateSchedule; + property OnDestroySchedule: TJvTFSchedEvent read FOnDestroySchedule + write FOnDestroySchedule; + property OnLoadBatch: TJvTFLoadBatchEvent read FOnLoadBatch write FOnLoadBatch; + property OnBatchesProcessed: TNotifyEvent read FOnBatchesProcessed + write FOnBatchesProcessed; + property OnGetApptDisplayText: TJvTFGetApptDisplayTextEvent + read FOnGetApptDisplayText write FOnGetApptDisplayText; + property OnGetApptDescription: TJvTFApptDescEvent read FOnGetApptDescription + write FOnGetApptDescription; + property OnSetApptDescription: TJvTFApptDescEvent read FOnSetApptDescription + write FOnSetApptDescription; + + property SchedLoadMode: TJvTFSchedLoadMode read FSchedLoadMode + write SetTFSchedLoadMode default slmOnDemand; + property RefreshAutoReconcile: Boolean read FRefreshAutoReconcile + write SetRefreshAutoReconcile default False; + end; + + TJvTFHintProps = class(TPersistent) + private + FHintColor: TColor; + FHintHidePause: Integer; + FHintPause: Integer; + procedure SetHintColor(Value: TColor); + procedure SetHintHidePause(Value: Integer); + procedure SetHintPause(Value: Integer); + protected + FControl: TJvTFControl; + procedure Change; virtual; + public + constructor Create(AOwner: TJvTFControl); + procedure Assign(Source: TPersistent); override; + published + property HintColor: TColor read FHintColor write SetHintColor default clDefault; + property HintHidePause: Integer read FHintHidePause write SetHintHidePause default -1; + property HintPause: Integer read FHintPause write SetHintPause default -1; + end; + + TJvTFHintType = (shtAppt, shtStartEnd, shtCell, shtObj); + + TJvTFShowHintEvent = procedure(Sender: TObject; HintType: TJvTFHintType; + Ref: TObject; var HintRect: TRect; var HintText: string) of object; + + // NOTE: + // The Pause property has the same meaning as the Application.HintPause + // property. The ShortPause property has the same meaning as the + // Application.HintHidePause property. + TJvTFHint = class(THintWindow) + private + FTimer: TTimer; + FPause: Integer; + FShortPause: Integer; + FOnShowHint: TJvTFShowHintEvent; + FRefProps: TJvTFHintProps; + procedure SetPause(Value: Integer); + procedure SetShortPause(Value: Integer); + protected + FApptCtrl: TJvTFControl; + FOldAppt: TJvTFAppt; + FOldObj: TObject; + FShortTimer: Boolean; + FHintRect: TRect; + FHintText: string; + FHintCell: TPoint; + FHintType: TJvTFHintType; + procedure TimerOnTimer(Sender: TObject); virtual; + procedure PrepTimer(Short: Boolean); + procedure SetHintText(StartDate, EndDate: TDate; StartTime, EndTime: TTime; + const Desc: string; ShowDatesTimes, ShowDesc: Boolean); + procedure DoHint(Sustained: Boolean); + procedure CreateParams(var Params: TCreateParams); override; + procedure PropertyCheck; dynamic; + public + constructor Create(anApptCtrl: TJvTFControl); reintroduce; + destructor Destroy; override; + procedure ActivateHint(Rect: TRect; const AHint: THintString); override; + procedure ApptHint(Appt: TJvTFAppt; X, Y: Integer; + ShowDatesTimes, ShowDesc, FormattedDesc: Boolean; const ExtraDesc: string = ''); virtual; + procedure StartEndHint(StartDate, EndDate: TDate; StartTime, EndTime: TTime; + X, Y: Integer; ShowDates: Boolean); + procedure CellHint(Row, Col: Integer; const HintText: string; CellRect: TRect); + + procedure MultiLineObjHint(Obj: TObject; X, Y: Integer; Hints: TStrings); + + procedure ReleaseHandle; virtual; + // See above note on Pause and ShortPause properties + property Pause: Integer read FPause write SetPause default 3000; + property ShortPause: Integer read FShortPause write SetShortPause default 1500; + property OnShowHint: TJvTFShowHintEvent read FOnShowHint write FOnShowHint; + property HintType: TJvTFHintType read FHintType; + property RefProps: TJvTFHintProps read FRefProps write FRefProps; + end; + + TJvTFDragInfo = class(TObject) + private + FApptCtrl: TJvTFControl; + FSchedule: TJvTFSched; + FAppt: TJvTFAppt; + FShift: TShiftState; + public + property ApptCtrl: TJvTFControl read FApptCtrl write FApptCtrl; + property Schedule: TJvTFSched read FSchedule write FSchedule; + property Appt: TJvTFAppt read FAppt write FAppt; + property Shift: TShiftState read FShift write FShift; + end; + + TJvTFComponent = class(TComponent) //TJvComponent) + private + FScheduleManager: TJvTFScheduleManager; + FSchedules: TStringList; + procedure SetManager(Value: TJvTFScheduleManager); + function GetSchedule(Index: Integer): TJvTFSched; + protected + FDateFormat: string; + FTimeFormat: string; + + procedure UpdateDesigner; + + procedure SetDateFormat(const Value: string); virtual; + procedure SetTimeFormat(const Value: string); virtual; + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); virtual; + procedure ReqSchedNotification(Schedule: TJvTFSched); virtual; + procedure RelSchedNotification(Schedule: TJvTFSched); virtual; + procedure NotifyManager(Serv: TJvTFScheduleManager; Sender: TObject; + Code: TJvTFServNotifyCode); + procedure RefreshComponent; dynamic; + property DateFormat: string read FDateFormat write SetDateFormat; + property TimeFormat: string read FTimeFormat write SetTimeFormat; + procedure DestroyApptNotification(anAppt: TJvTFAppt); virtual; + procedure DestroySchedNotification(ASched: TJvTFSched); virtual; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + function ScheduleCount: Integer; + property Schedules[Index: Integer]: TJvTFSched read GetSchedule; + function FindSchedule(const SchedName: string; SchedDate: TDate): TJvTFSched; + function RetrieveSchedule(const SchedName: string; SchedDate: TDate): TJvTFSched; + procedure ReleaseSchedule(const SchedName: string; SchedDate: TDate); virtual; + procedure ReleaseSchedules; + procedure ProcessBatches; + published + property ScheduleManager: TJvTFScheduleManager read FScheduleManager write SetManager; + end; + + TJvTFControl = class(TJvCustomControl) + private + FScheduleManager: TJvTFScheduleManager; + FSchedules: TStringList; + // FNavigator: TJvTFNavigator; + // FOnNavigate: TJvTFNavEvent; + procedure SetManager(Value: TJvTFScheduleManager); + function GetSchedule(Index: Integer): TJvTFSched; + // procedure SetNavigator(Value: TJvTFNavigator); + protected + FDateFormat: string; + FTimeFormat: string; + FDragInfo: TJvTFDragInfo; + FShift: TShiftState; + procedure Notification(AComponent: TComponent; Operation: TOperation); override; + procedure SetDateFormat(const Value: string); virtual; + procedure SetTimeFormat(const Value: string); virtual; + procedure Notify(Sender: TObject; Code: TJvTFServNotifyCode); virtual; + procedure ReqSchedNotification(Schedule: TJvTFSched); virtual; + procedure RelSchedNotification(Schedule: TJvTFSched); virtual; + procedure NotifyManager(Serv: TJvTFScheduleManager; Sender: TObject; + Code: TJvTFServNotifyCode); + procedure CNRequestRefresh(var Msg: TCNRequestRefresh); message CN_REQUESTREFRESH; + procedure RefreshControl; dynamic; + property DateFormat: string read FDateFormat write SetDateFormat; + property TimeFormat: string read FTimeFormat write SetTimeFormat; + procedure DestroyApptNotification(anAppt: TJvTFAppt); virtual; + procedure DestroySchedNotification(ASched: TJvTFSched); virtual; + procedure DoStartDrag(var DragObject: TDragObject); override; + procedure DoEndDrag(Target: TObject; X, Y: Integer); override; + procedure MouseDown(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); override; + procedure Navigate(aControl: TJvTFControl; SchedNames: TStringList; + Dates: TJvTFDateList); virtual; + // property Navigator: TJvTFNavigator read FNavigator write SetNavigator; + // property OnNavigate: TJvTFNavEvent read FOnNavigate write FOnNavigate; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + function ScheduleCount: Integer; + property Schedules[Index: Integer]: TJvTFSched read GetSchedule; + function FindSchedule(const SchedName: string; SchedDate: TDate): TJvTFSched; + function RetrieveSchedule(const SchedName: string; SchedDate: TDate): TJvTFSched; + procedure ReleaseSchedule(const SchedName: string; SchedDate: TDate); virtual; + procedure ReleaseSchedules; + property DragInfo: TJvTFDragInfo read FDragInfo; + procedure ProcessBatches; + published + property ScheduleManager: TJvTFScheduleManager read FScheduleManager write SetManager; + end; + + EJvTFPrinterError = class(Exception); + TJvTFMargins = TRect; + TJvTFPrinterMeasure = (pmPixels, pmInches, pmMM); + TJvTFPrinterState = (spsNoDoc, spsCreating, spsAssembling, spsFinished); + TJvTFPrinterDrawEvent = procedure(Sender: TObject; aCanvas: TCanvas; + ARect: TRect; PageNum: Integer) of object; + + TJvTFProgressEvent = procedure(Sender: TObject; Current, Total: Integer) + of object; + + TJvTFPrinterPageLayout = class(TPersistent) + private + FFooterHeight: Integer; + FHeaderHeight: Integer; + FMargins: TJvTFMargins; + FPrinter: TJvTFPrinter; + procedure SetFooterHeight(Value: Integer); + procedure SetHeaderHeight(Value: Integer); + function GetMargin(Index: Integer): Integer; + procedure SetMargin(Index: Integer; Value: Integer); + protected + procedure Change; virtual; + property Printer: TJvTFPrinter read FPrinter; + procedure SetPropertyCheck; + public + constructor Create(aPrinter: TJvTFPrinter); virtual; + procedure Assign(Source: TPersistent); override; + published + property FooterHeight: Integer read FFooterHeight write SetFooterHeight; + property HeaderHeight: Integer read FHeaderHeight write SetHeaderHeight; + property MarginLeft: Integer index 1 read GetMargin write SetMargin; + property MarginTop: Integer index 2 read GetMargin write SetMargin; + property MarginRight: Integer index 3 read GetMargin write SetMargin; + property MarginBottom: Integer index 4 read GetMargin write SetMargin; + end; + + TJvTFPrinter = class(TJvTFComponent) + private + FPages: TStringList; + FBodies: TStringList; + FMarginOffsets: TJvTFMargins; // always in pixels + FMeasure: TJvTFPrinterMeasure; + FOnDrawBody: TJvTFPrinterDrawEvent; + FOnDrawHeader: TJvTFPrinterDrawEvent; + FOnDrawFooter: TJvTFPrinterDrawEvent; + FOnPrintProgress: TJvTFProgressEvent; + FOnAssembleProgress: TJvTFProgressEvent; + FOnMarginError: TNotifyEvent; + FTitle: string; + FDirectPrint: Boolean; + { wp --- to do + function GetPage(Index: Integer): TMetafile; + } + function GetBodyHeight: Integer; // always in pixels + function GetBodyWidth: Integer; // always in pixels + function GetBodyLeft: Integer; // always in pixels + function GetBodyTop: Integer; // always in pixels + function GetDocDateTime: TDateTime; + procedure SetPageLayout(Value: TJvTFPrinterPageLayout); + procedure SetDirectPrint(Value: Boolean); + protected + FPageLayout: TJvTFPrinterPageLayout; + FState: TJvTFPrinterState; + FDocDateTime: TDateTime; + FPageCount: Integer; // NOTE: SEE GetPageCount !! + FConvertingProps: Boolean; + FAborted: Boolean; + procedure SetMarginOffset(Index: Integer; Value: Integer); // always in pixels + function GetMarginOffset(Index: Integer): Integer; // always in pixels + function GetUnprintable: TJvTFMargins; // always in pixels + procedure MarginError; dynamic; + procedure InitializeMargins; + property BodyHeight: Integer read GetBodyHeight; // always in pixels + property BodyWidth: Integer read GetBodyWidth; // always in pixels + property BodyLeft: Integer read GetBodyLeft; // always in pixels + property BodyTop: Integer read GetBodyTop; // always in pixels + procedure DrawBody(aCanvas: TCanvas; ARect: TRect; PageNum: Integer); virtual; + procedure DrawHeader(aCanvas: TCanvas; ARect: TRect; PageNum: Integer); virtual; + procedure DrawFooter(aCanvas: TCanvas; ARect: TRect; PageNum: Integer); virtual; + procedure SetTitle(const Value: string); virtual; + function GetPageCount: Integer; + procedure SetMeasure(Value: TJvTFPrinterMeasure); virtual; + procedure CreateLayout; virtual; + procedure SetPropertyCheck; dynamic; + + procedure GetHeaderFooterRects(var HeaderRect, FooterRect: TRect); + + // document management methods + procedure CreateDoc; dynamic; + procedure NewPage; dynamic; + procedure FinishDoc; dynamic; + procedure NewDoc; dynamic; + property DirectPrint: Boolean read FDirectPrint write SetDirectPrint + default False; + public + + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + property PageCount: Integer read GetPageCount; + { wp --- to do + property Pages[Index: Integer]: TMetafile read GetPage; + } + function ConvertMeasure(Value: Integer; FromMeasure, + ToMeasure: TJvTFPrinterMeasure; Horizontal: Boolean): Integer; + function ScreenToPrinter(Value: Integer; Horizontal: Boolean): Integer; + function PrinterToScreen(Value: Integer; Horizontal: Boolean): Integer; + + property State: TJvTFPrinterState read FState; + procedure FreeDoc; dynamic; + procedure Print; dynamic; + procedure AbortPrint; + property DocDateTime: TDateTime read GetDocDateTime; + property ConvertingProps: Boolean read FConvertingProps; + procedure SaveDocToFiles(BaseFileName: TFileName); + property Aborted: Boolean read FAborted; + published + property PageLayout: TJvTFPrinterPageLayout read FPageLayout + write SetPageLayout; + property Measure: TJvTFPrinterMeasure read FMeasure write SetMeasure + default pmInches; + property OnDrawBody: TJvTFPrinterDrawEvent read FOnDrawBody + write FOnDrawBody; + property OnDrawHeader: TJvTFPrinterDrawEvent read FOnDrawHeader + write FOnDrawHeader; + property OnDrawFooter: TJvTFPrinterDrawEvent read FOnDrawFooter + write FOnDrawFooter; + property OnPrintProgress: TJvTFProgressEvent read FOnPrintProgress + write FOnPrintProgress; + property OnAssembleProgress: TJvTFProgressEvent read FOnAssembleProgress + write FOnAssembleProgress; + property OnMarginError: TNotifyEvent read FOnMarginError + write FOnMarginError; + property Title: string read FTitle write SetTitle; + end; + + {$IFDEF RTL230_UP} + [ComponentPlatformsAttribute(pidWin32 or pidWin64)] + {$ENDIF RTL230_UP} + TJvTFUniversalPrinter = class(TJvTFPrinter) + public + procedure NewDoc; override; + procedure CreateDoc; override; + procedure NewPage; override; + procedure FinishDoc; override; + published + property DirectPrint; + end; + + TJvTFDWNameSource = (dwnsSysLong, dwnsSysShort, dwnsCustom); + + TJvTFDrawDWTitleEvent = procedure(Sender: TObject; aCanvas: TCanvas; + ARect: TRect; DOW: TTFDayOfWeek; DWName: string) of object; + + TJvTFDWNames = class(TPersistent) + private + FSource: TJvTFDWNameSource; + FDWN_Sunday: string; + FDWN_Monday: string; + FDWN_Tuesday: string; + FDWN_Wednesday: string; + FDWN_Thursday: string; + FDWN_Friday: string; + FDWN_Saturday: string; + FOnChange: TNotifyEvent; + procedure SetDWN(Index: Integer; const Value: string); + function GetDWN(Index: Integer): string; + procedure SetSource(Value: TJvTFDWNameSource); + protected + procedure Change; virtual; + public + constructor Create; + procedure Assign(Source: TPersistent); override; + function GetDWName(DWIndex: Integer): string; + published + property Source: TJvTFDWNameSource read FSource write SetSource default dwnsSysShort; + property DWN_Sunday: string index 1 read GetDWN write SetDWN; + property DWN_Monday: string index 2 read GetDWN write SetDWN; + property DWN_Tuesday: string index 3 read GetDWN write SetDWN; + property DWN_Wednesday: string index 4 read GetDWN write SetDWN; + property DWN_Thursday: string index 5 read GetDWN write SetDWN; + property DWN_Friday: string index 6 read GetDWN write SetDWN; + property DWN_Saturday: string index 7 read GetDWN write SetDWN; + property OnChange: TNotifyEvent read FOnChange write FOnChange; + end; + + // TJvTFNavigator = class(TComponent) + // private + // FBeforeNavigate: TJvTFNavEvent; + // FAfterNavigate: TJvTFNavEvent; + // FControls: TStringList; + // function GetControl(Index: Integer): TJvTFControl; + // protected + // FNavigating: Boolean; + // procedure RegisterControl(aControl: TJvTFControl); + // procedure UnregisterControl(aControl: TJvTFControl); + // public + // constructor Create(AOwner: TComponent); override; + // destructor Destroy; override; + // + // function ControlCount: Integer; + // property Controls[Index: Integer]: TJvTFControl read GetControl; + // + // procedure Navigate(aControl: TJvTFControl; SchedNames: TStringList; + // Dates: TJvTFDateList); virtual; + // property Navigating: Boolean read FNavigating; + // published + // property BeforeNavigate: TJvTFNavEvent read FBeforeNavigate + // write FBeforeNavigate; + // property AfterNavigate: TJvTFNavEvent read FAfterNavigate + // write FAfterNavigate; + // end; + + +implementation + +uses + Dialogs, + JvResources, JvJVCLUtils; //, JclSysUtils; + +function AdjustEndTime(ATime: TTime): TTime; +begin + Result := Frac(Frac(ATime) - Frac(EncodeTime(0, 0, 1, 0))); +end; + +function CenterRect(Rect1, Rect2: TRect): TRect; +var + Rect1Width, Rect1Height, Rect2Width, Rect2Height: Integer; +begin + Rect1Width := Rect1.Right - Rect1.Left - 1; + Rect1Height := Rect1.Bottom - Rect1.Top - 1; + Rect2Width := Rect2.Right - Rect2.Left - 1; + Rect2Height := Rect2.Bottom - Rect2.Top - 1; + + Result.Left := Rect1.Left + ((Rect1Width - Rect2Width) div 2) - 1; + Result.Top := Rect1.Top + ((Rect1Height - Rect2Height) div 2) - 1; + Result.Right := Result.Left + Rect2Width; + Result.Bottom := Result.Top + Rect2Height; +end; + +function MoveRect(ARect: TRect; NewLeft, NewTop: Integer): TRect; +begin + Result := ARect; + OffsetRect(Result, NewLeft - ARect.Left, NewTop - ARect.Top); +end; + +function StripCRLF(const S: string): string; +var + I: Integer; +begin + Result := ''; + for I := 1 to Length(S) do + if (S[I] <> #13) and (S[I] <> #10) then + Result := Result + S[I]; +end; + +//=== { TJvTFCustomImageMap } ================================================ + +constructor TJvTFCustomImageMap.Create(anAppt: TJvTFAppt); +begin + if not Assigned(anAppt) then + raise EJvTFScheduleManagerError.CreateRes(@RsECouldNotCreateCustomImageMap); + + inherited Create; + FAppt := anAppt; + FMap := TStringList.Create; +end; + +destructor TJvTFCustomImageMap.Destroy; +begin + FMap.Free; + inherited Destroy; +end; + +function TJvTFCustomImageMap.GetImage(MapIndex: Integer): Integer; +begin + Result := Integer(FMap.Objects[MapIndex]); +end; + +procedure TJvTFCustomImageMap.SetImage(MapIndex, Value: Integer); +begin + FMap.Objects[MapIndex] := TObject(Value); +end; + +function TJvTFCustomImageMap.GetImageName(MapIndex: Integer): string; +begin + Result := FMap[MapIndex]; +end; + +procedure TJvTFCustomImageMap.Change; +begin + if Assigned(FAppt.ScheduleManager) then + begin + FAppt.ScheduleManager.RefreshConnections(FAppt); + // implicit post fix + FAppt.Change; + end; +end; + +function TJvTFCustomImageMap.Count: Integer; +begin + Result := FMap.Count; +end; + +procedure TJvTFCustomImageMap.Add(const ImageName: string; ImageIndex: Integer); +begin + if FMap.IndexOf(ImageName) = -1 then + begin + FMap.AddObject(ImageName, TObject(ImageIndex)); + Change; + end; +end; + +procedure TJvTFCustomImageMap.Delete(MapIndex: Integer); +begin + FMap.Delete(MapIndex); + Change; +end; + +procedure TJvTFCustomImageMap.Move(SrcMapIndex, DestMapIndex: Integer); +begin + FMap.Move(SrcMapIndex, DestMapIndex); +end; + +function TJvTFCustomImageMap.FindMapIndex(const ImageName: string): Integer; +begin + Result := FMap.IndexOf(ImageName); +end; + +function TJvTFCustomImageMap.FindImageIndex(const ImageName: string): Integer; +begin + Result := FindMapIndex(ImageName); + if Result > -1 then + Result := GetImage(Result); +end; + +procedure TJvTFCustomImageMap.Clear; +begin + while FMap.Count > 0 do + FMap.Delete(0); + Change; +end; + +procedure TJvTFCustomImageMap.Assign(Source: TPersistent); +var + I: Integer; +begin + if Source is TJvTFCustomImageMap then + begin + while FMap.Count > 0 do + FMap.Delete(0); + + for I := 0 to TJvTFCustomImageMap(Source).Count - 1 do + Add(TJvTFCustomImageMap(Source).ImageNames[I], + TJvTFCustomImageMap(Source).Images[I]); + Change; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFStateImageMap } ================================================= + +constructor TJvTFStateImageMap.Create(Serv: TJvTFScheduleManager); +var + I: TJvTFStatePic; +begin + inherited Create; + + for I := Low(TJvTFStatePic) to High(TJvTFStatePic) do + FPics[I] := -1; + + FUpdating := False; +end; + +procedure TJvTFStateImageMap.SetImage(StatePicID: TJvTFStatePic; Value: Integer); +begin + if Value < -1 then + Value := -1; + if FPics[StatePicID] <> Value then + begin + FPics[StatePicID] := Value; + Change; + end; +end; + +function TJvTFStateImageMap.GetImage(StatePicID: TJvTFStatePic): Integer; +begin + Result := FPics[StatePicID]; +end; + +function TJvTFStateImageMap.GetAlarmDisabled: Integer; +begin + Result := GetImage(spAlarmDisabled); +end; + +function TJvTFStateImageMap.GetAlarmEnabled: Integer; +begin + Result := GetImage(spAlarmEnabled); +end; + +function TJvTFStateImageMap.GetModified: Integer; +begin + Result := GetImage(spModified); +end; + +function TJvTFStateImageMap.GetRecurring: Integer; +begin + Result := GetImage(spRecurring); +end; + +function TJvTFStateImageMap.GetShared: Integer; +begin + Result := GetImage(spShared); +end; + +procedure TJvTFStateImageMap.SetAlarmDisabled(const Value: Integer); +begin + SetImage(spAlarmDisabled, Value); +end; + +procedure TJvTFStateImageMap.SetAlarmEnabled(const Value: Integer); +begin + SetImage(spAlarmEnabled, Value); +end; + +procedure TJvTFStateImageMap.SetModified(const Value: Integer); +begin + SetImage(spModified, Value); +end; + +procedure TJvTFStateImageMap.SetRecurring(const Value: Integer); +begin + SetImage(spRecurring, Value); +end; + +procedure TJvTFStateImageMap.SetShared(const Value: Integer); +begin + SetImage(spShared, Value); +end; + +procedure TJvTFStateImageMap.Change; +begin + if Assigned(FScheduleManager) and not (csLoading in FScheduleManager.ComponentState) and + not (csDesigning in FScheduleManager.ComponentState) and not FUpdating then + FScheduleManager.RefreshConnections(nil); +end; + +procedure TJvTFStateImageMap.BeginUpdate; +begin + FUpdating := True; +end; + +procedure TJvTFStateImageMap.EndUpdate; +begin + if FUpdating then + begin + FUpdating := False; + Change; + end; +end; + +procedure TJvTFStateImageMap.Clear; +var + I: TJvTFStatePic; +begin + for I := Low(TJvTFStatePic) to High(TJvTFStatePic) do + FPics[I] := -1; + Change; +end; + +procedure TJvTFStateImageMap.Assign(Source: TPersistent); +var + Pic: TJvTFStatePic; +begin + if Source is TJvTFStateImageMap then + begin + for Pic := Low(TJvTFStatePic) to High(TJvTFStatePic) do + FPics[Pic] := TJvTFStateImageMap(Source).Pics[Pic]; + Change; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFAppt } ========================================================== + +constructor TJvTFAppt.Create(Serv: TJvTFScheduleManager; const ApptID: string); +begin + if not Assigned(Serv) then + raise EJvTFScheduleManagerError.CreateRes(@RsECouldNotCreateAppointmentObject); + + inherited Create; + + FGlyph := TPicture.Create; + + FSchedules := TStringList.Create; + FConnections := TStringList.Create; + + FStartDate := Date; + FStartTime := Time; + FEndDate := Date; + FEndTime := FStartTime + EncodeTime(0, 1, 0, 0); + FScheduleManager := Serv; + FDestroying := False; + + if ApptID <> '' then + FID := ApptID + else + FID := FScheduleManager.GenerateApptID; + + FModified := False; + FColor := clDefault; + FBarColor := clDefault; + + FImageMap := TJvTFCustomImageMap.Create(Self); + + ScheduleManager.Notify(Self, sncLoadAppt); + + Serv.DoCreateApptEvent(Self); +end; + +destructor TJvTFAppt.Destroy; +begin + FDestroying := True; + if Assigned(ScheduleManager) then + ScheduleManager.DoDestroyApptEvent(Self); + + ScheduleManager.Notify(Self, sncDestroyAppt); + + FSchedules.Free; + FConnections.Free; + FImageMap.Free; + + FGlyph.Free; + + inherited Destroy; +end; + +function TJvTFAppt.GetDescription: string; +begin + Result := FDescription; + ScheduleManager.GetApptDescription(Self, Result); +end; + +procedure TJvTFAppt.SetDescription(Value: string); +begin + ScheduleManager.SetApptDescription(Self, Value); + if Value <> FDescription then + begin + FDescription := Value; + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + Change; + end; + end; +end; + +procedure TJvTFAppt.SetAlarmEnabled(Value: Boolean); +begin + if Value <> FAlarmEnabled then + begin + FAlarmEnabled := Value; + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + Change; + end; + end; +end; + +procedure TJvTFAppt.SetAlarmAdvance(Value: Integer); +begin + if Value < 0 then + Value := 0; + + if Value <> FAlarmAdvance then + begin + FAlarmAdvance := Value; + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + Change; + end; + end; +end; + +procedure TJvTFAppt.SetColor(Value: TColor); +begin + if Value <> FColor then + begin + FColor := Value; + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + Change; + end; + end; +end; + +procedure TJvTFAppt.SetBarColor(Value: TColor); +begin + if Value <> FBarColor then + begin + FBarColor := Value; + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + Change; + end; + end; +end; + +procedure TJvTFAppt.Notify(Sender: TObject; Code: TJvTFServNotifyCode); +begin + case Code of + sncConnectAppt: + Connect(TJvTFSched(Sender)); + sncDisconnectAppt: + Disconnect(TJvTFSched(Sender)); + // implicit post fix + //sncPostAppt: FModified := False; + sncPostAppt: + PostApptNotification; + sncDeleteAppt: + InternalClearSchedules; + sncRefresh: + FModified := False; + end; +end; + +procedure TJvTFAppt.NotifyManager(Serv: TJvTFScheduleManager; Sender: TObject; + Code: TJvTFServNotifyCode); +begin + if Assigned(Serv) then + Serv.Notify(Sender, Code) + else + raise EJvTFScheduleManagerError.CreateRes(@RsEScheduleManagerNotificationFailedSc); +end; + +procedure TJvTFAppt.NotifySchedule(Sched: TJvTFSched; Sender: TObject; + Code: TJvTFServNotifyCode); +begin + if Assigned(Sched) then + Sched.Notify(Sender, Code) + else + raise EJvTFScheduleManagerError.CreateRes(@RsEScheduleNotificationFailed); +end; + +function TJvTFAppt.GetConnection(Index: Integer): TJvTFSched; +begin + Result := TJvTFSched(FConnections.Objects[Index]); +end; + +function TJvTFAppt.GetSchedule(Index: Integer): string; +begin + Result := FSchedules[Index]; +end; + +procedure TJvTFAppt.CheckConnections; +var + Schedule: TJvTFSched; + I: Integer; + ADate: TDate; + Temp: TStringList; +begin + // Schedules --> Connections + for I := 0 to ScheduleCount - 1 do + begin + ADate := StartDate; + while Trunc(ADate) <= Trunc(EndDate) do + begin + Schedule := ScheduleManager.FindSchedule(Schedules[I], ADate); + if Assigned(Schedule) and (FConnections.IndexOfObject(Schedule) = -1) then + Connect(Schedule); + + ADate := ADate + 1; + end; + end; + + // Connections --> Schedules + Temp := TStringList.Create; + try + Temp.Assign(FConnections); + for I := 0 to Temp.Count - 1 do + begin + Schedule := TJvTFSched(Temp.Objects[I]); + if (FSchedules.IndexOf(Schedule.SchedName) = -1) or + ((Trunc(Schedule.SchedDate) < Trunc(StartDate)) or + (Trunc(Schedule.SchedDate) > Trunc(EndDate))) then + Disconnect(Schedule); + end; + finally + Temp.Free; + end; + + { implicit post fix + If not FDeleting and not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing Then + // To avoid display anomolies we need to post the appt here. + Post; + } +end; + +procedure TJvTFAppt.Connect(Schedule: TJvTFSched); +var + SchedID: string; + I: Integer; +begin + if Assigned(Schedule) then + begin + Schedule.Notify(Self, sncConnectAppt); + + SchedID := ScheduleManager.GetScheduleID(Schedule.SchedName, Schedule.SchedDate); + I := FConnections.IndexOf(SchedID); + if I = -1 then + begin + FConnections.AddObject(SchedID, Schedule); + ScheduleManager.RefreshConnections(Schedule); + end; + end; +end; + +procedure TJvTFAppt.Disconnect(Schedule: TJvTFSched); +var + I: Integer; +begin + if Assigned(Schedule) then + begin + Schedule.Notify(Self, sncDisconnectAppt); + + I := FConnections.IndexOfObject(Schedule); + if I > -1 then + begin + FConnections.Delete(I); + ScheduleManager.RefreshConnections(Schedule); + end; + end; +end; + +procedure TJvTFAppt.Change; +begin + // implicit post fix + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing and not Updating then + Post; + ScheduleManager.RefreshConnections(Self); +end; + +procedure TJvTFAppt.InternalClearSchedules; +begin + FSchedules.Clear; + CheckConnections; +end; + +procedure TJvTFAppt.Assign(Source: TPersistent); +var + I: Integer; +begin + if Source is TJvTFAppt then + begin + for I := 0 to TJvTFAppt(Source).ScheduleCount - 1 do + AddSchedule(TJvTFAppt(Source).Schedules[I]); + ImageMap.Assign(TJvTFAppt(Source).ImageMap); + SetStartEnd(TJvTFAppt(Source).StartDate, TJvTFAppt(Source).StartTime, + TJvTFAppt(Source).EndDate, TJvTFAppt(Source).EndTime); + Description := TJvTFAppt(Source).Description; + AlarmEnabled := TJvTFAppt(Source).AlarmEnabled; + AlarmAdvance := TJvTFAppt(Source).AlarmAdvance; + Data := TJvTFAppt(Source).Data; + end + else + inherited Assign(Source); +end; + +procedure TJvTFAppt.SetStartEnd(NewStartDate: TDate; NewStartTime: TTime; + NewEndDate: TDate; NewEndTime: TTime); +begin + // The following avoids time overflow into next day when it is not + // intended. (Add appt to last row of days would cause invalid + // start/end exception.) + if Frac(NewEndTime) <= EncodeTime(0, 0, 0, 999) then + NewEndTime := EncodeTime(23, 59, 59, 0); + + if Trunc(NewStartDate) <= Trunc(NewEndDate) then + begin + if Trunc(NewStartDate) = Trunc(NewEndDate) then + if Frac(NewStartTime) >= Frac(NewEndTime) then + raise EJvTFScheduleManagerError.CreateRes(@RsEInvalidStartAndEndTimes); + + FStartDate := NewStartDate; + FEndDate := NewEndDate; + FStartTime := NewStartTime; + FEndTime := NewEndTime; + + CheckConnections; + + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + Change; + end + end + else + raise EJvTFScheduleManagerError.CreateRes(@RsEInvalidStartAndEndDates); +end; + +procedure TJvTFAppt.SetModified; +begin + FModified := True; + // implicit post fix + Change; +end; + +function TJvTFAppt.Modified: Boolean; +begin + Result := FModified; +end; + +function TJvTFAppt.ConnectionCount: Integer; +begin + Result := FConnections.Count; +end; + +function TJvTFAppt.ScheduleCount: Integer; +begin + Result := FSchedules.Count; +end; + +procedure TJvTFAppt.AddSchedule(const SchedName: string); +var + ADate: TDate; + Schedule: TJvTFSched; +begin + if SchedName = '' then + Exit; + + // Add it to the schedules list + if FSchedules.IndexOf(SchedName) = -1 then + begin + FSchedules.Add(SchedName); + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + // implicit post fix + Change; + end; + end; + + // Check for needed connections + // (Only connects to currently loaded schedules. Will not load a schedule.) + ADate := StartDate; + while Trunc(ADate) <= Trunc(EndDate) do + begin + Schedule := ScheduleManager.FindSchedule(SchedName, ADate); + if Assigned(Schedule) then + Connect(Schedule); + ADate := ADate + 1; + end; + + { implicit post fix + // To avoid display anomolies we need to post the appt here. + If not FDeleting and not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing Then + Post; + } +end; + +procedure TJvTFAppt.RemoveSchedule(const SchedName: string); +var + I: Integer; + ADate: TDate; + Schedule: TJvTFSched; +begin + if SchedName = '' then + Exit; + + // Remove it from the schedule list + I := FSchedules.IndexOf(SchedName); + if I > -1 then + begin + FSchedules.Delete(I); + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + // implicit post fix + Change; + end; + end; + + // Check for invalid connections and disconnect + ADate := StartDate; + while Trunc(ADate) <= Trunc(EndDate) do + begin + Schedule := ScheduleManager.FindSchedule(SchedName, ADate); + if Assigned(Schedule) then + Disconnect(Schedule); + + ADate := ADate + 1; + end; + + { implicit post fix + // To avoid display anomolies we need to post the appt here. + If not FDeleting and not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing Then + Post; + } +end; + +procedure TJvTFAppt.AssignSchedules(List: TStrings); +begin + FSchedules.Assign(List); + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + // implicit post fix + Change; + end; + + CheckConnections; +end; + +procedure TJvTFAppt.ClearSchedules; +begin + FSchedules.Clear; + + if not ScheduleManager.LoadingAppts and not ScheduleManager.Refreshing then + begin + FModified := True; + // implicit post fix + Change; + end; + + CheckConnections; +end; + +function TJvTFAppt.IndexOfSchedule(const SchedName: string): Integer; +begin + Result := FSchedules.IndexOf(SchedName); +end; + +function TJvTFAppt.Shared: Boolean; +begin + Result := ScheduleCount > 1; +end; + +procedure TJvTFAppt.Post; +begin + ScheduleManager.dbPostAppt(Self); +end; + +procedure TJvTFAppt.Refresh; +begin + ScheduleManager.dbRefreshAppt(Self); +end; + +procedure TJvTFAppt.Delete; +begin + ScheduleManager.dbDeleteAppt(Self); +end; + +procedure TJvTFAppt.RefreshControls; +begin + ScheduleManager.RefreshConnections(Self); +end; + +function TJvTFAppt.GetEndDateTime: TDateTime; +begin + Result := Trunc(EndDate) + Frac(EndTime); +end; + +function TJvTFAppt.GetStartDateTime: TDateTime; +begin + Result := Trunc(StartDate) + Frac(StartTime); +end; + +function TJvTFAppt.GetEndDate: TDate; +begin + Result := Int(FEndDate); +end; + +function TJvTFAppt.GetEndTime: TTime; +begin + Result := Frac(FEndTime); +end; + +function TJvTFAppt.GetStartDate: TDate; +begin + Result := Int(FStartDate); +end; + +function TJvTFAppt.GetStartTime: TTime; +begin + Result := Frac(FStartTime); +end; + +procedure TJvTFAppt.DeleteApptNotification; +begin + FDeleting := True; + try + InternalClearSchedules; + finally + FDeleting := False; + end; +end; + +procedure TJvTFAppt.PostApptNotification; +begin + FModified := False; + FUpdating := False; +end; + +procedure TJvTFAppt.BeginUpdate; +begin + FUpdating := True; +end; + +procedure TJvTFAppt.EndUpdate; +begin + if FUpdating then + begin + FUpdating := False; + Change; + end; +end; + +procedure TJvTFAppt.SetRefreshed(Value: Boolean); +begin + FRefreshed := Value; +end; + +procedure TJvTFAppt.SetGlyph(const Value: TPicture); +begin + FGlyph.Assign(Value); +end; + +procedure TJvTFAppt.RefreshNotification; +begin + FModified := False; + Refreshed := False; +end; + +//=== { TJvTFSched } ========================================================= + +constructor TJvTFSched.Create(Serv: TJvTFScheduleManager; const AName: string; + ADate: TDate); +begin + inherited Create; + + FScheduleManager := Serv; + FSchedName := AName; + FSchedDate := ADate; + + FAppts := TStringList.Create; + FConControls := TStringList.Create; + FConControls.OnChange := @ConnectionsOnChange; + FConComponents := TStringList.Create; + FConComponents.OnChange := @ConnectionsOnChange; + + if Assigned(Serv) then + Serv.DoCreateScheduleEvent(Self); +end; + +destructor TJvTFSched.Destroy; +var + Ctrl: TJvTFControl; + Comp: TJvTFComponent; + Appt: TJvTFAppt; +begin + FDestroying := True; + + if Assigned(ScheduleManager) then + ScheduleManager.DoDestroyScheduleEvent(Self); + + while ConControlCount > 0 do + begin + Ctrl := TJvTFControl(FConControls.Objects[0]); + ScheduleManager.ReleaseSchedule(Ctrl, SchedName, SchedDate); + end; + + while ConComponentCount > 0 do + begin + Comp := TJvTFComponent(FConComponents.Objects[0]); + ScheduleManager.ReleaseSchedule(Comp, SchedName, SchedDate); + end; + + while ApptCount > 0 do + begin + Appt := Appts[0]; + Appt.Notify(Self, sncDisconnectAppt); + end; + + ScheduleManager.Notify(Self, sncDestroySchedule); + + FAppts.Free; + FConControls.Free; + FConComponents.Free; + + inherited Destroy; +end; + +function TJvTFSched.GetAppt(Index: Integer): TJvTFAppt; +begin + Result := TJvTFAppt(FAppts.Objects[Index]); +end; + +procedure TJvTFSched.Notify(Sender: TObject; Code: TJvTFServNotifyCode); +var + I: Integer; + ConList: TStringList; +begin + if Sender is TJvTFControl then + ConList := FConControls + else + if Sender is TJvTFComponent then + ConList := FConComponents + else + ConList := nil; + + case Code of + sncRequestSchedule: + if ConList.IndexOfObject(Sender) = -1 then + ConList.AddObject('', Sender); + sncReleaseSchedule: + begin + I := ConList.IndexOfObject(Sender); + if I > -1 then + ConList.Delete(I); + end; + sncConnectAppt: + ConnectAppt(TJvTFAppt(Sender)); + sncDisconnectAppt: + DisconnectAppt(TJvTFAppt(Sender)); + end; +end; + +procedure TJvTFSched.NotifyManager(Serv: TJvTFScheduleManager; Sender: TObject; + Code: TJvTFServNotifyCode); +begin + if Assigned(Serv) then + Serv.Notify(Sender, Code) + else + raise EJvTFScheduleManagerError.CreateRes(@RsEScheduleManagerNotificationFailedSc); +end; + +procedure TJvTFSched.NotifyAppt(Appt: TJvTFAppt; Sender: TObject; + Code: TJvTFServNotifyCode); +begin + if Assigned(Appt) then + Appt.Notify(Sender, Code) + else + raise EJvTFScheduleManagerError.CreateRes(@RsEAppointmentNotificationFailed); +end; + +function TJvTFSched.GetConControl(Index: Integer): TJvTFControl; +begin + Result := TJvTFControl(FConControls.Objects[Index]); +end; + +function TJvTFSched.GetConComponent(Index: Integer): TJvTFComponent; +begin + Result := TJvTFComponent(FConComponents.Objects[Index]); +end; + +procedure TJvTFSched.ConnectAppt(Appt: TJvTFAppt); +begin + if FAppts.IndexOf(Appt.ID) = -1 then + FAppts.AddObject(Appt.ID, Appt); +end; + +procedure TJvTFSched.DisconnectAppt(Appt: TJvTFAppt); +var + I: Integer; +begin + I := FAppts.IndexOf(Appt.ID); + if I > -1 then + FAppts.Delete(I); +end; + +procedure TJvTFSched.ConnectionsOnChange(Sender: TObject); +begin + if (FConControls.Count = 0) and (FConComponents.Count = 0) then + begin + FCached := True; + FCachedTime := GetTickCount64; //Windows.GetTickCount; + end + else + FCached := False; +end; + +procedure TJvTFSched.CheckConnections; +var + I: Integer; + Appt: TJvTFAppt; + DateHit, NameMatch, NotConnected: Boolean; +begin + // Check each appt in the ScheduleManager to see if that appt should be connected + // to this schedule. If so, then connect it. + for I := 0 to ScheduleManager.ApptCount - 1 do + begin + Appt := ScheduleManager.Appts[I]; + DateHit := (Trunc(SchedDate) >= Trunc(Appt.StartDate)) and + (Trunc(SchedDate) <= Trunc(Appt.EndDate)); + NameMatch := Appt.IndexOfSchedule(SchedName) > -1; + NotConnected := ApptByID(Appt.ID) = nil; + if DateHit and NameMatch and NotConnected then + Appt.Notify(Self, sncConnectAppt); + end; +end; + +function TJvTFSched.GetFreeUsedTime(FreeTime: Boolean): TDynTimeRangeArray; +var + // 60 mins X 24 hrs = 1440 ==> minutes in a day + DayArray: array [0..1439] of Boolean; // I'm a poet and don't know it. + I, J, MinStart, MinEnd: Integer; + anAppt: TJvTFAppt; + StartTime, EndTime: TTime; + Switch, MinIsFree, InRange: Boolean; + + function TimeToMinNum(ATime: TTime): Integer; + var + H, M, S, MS: Word; + begin + DecodeTime(ATime, H, M, S, MS); + Result := H * 60 + M; + end; + + function MinNumToTime(MinNum: Integer): TTime; + begin + Result := EncodeTime(MinNum div 60, MinNum mod 60, 0, 0); + end; + + procedure StartRange; + begin + StartTime := MinNumToTime(I); + InRange := True; + end; + + procedure EndRange; + begin + EndTime := MinNumToTime(I); + + // add range to resultant array + SetLength(Result, Length(Result) + 1); + Result[High(Result)].StartTime := StartTime; + Result[High(Result)].EndTime := EndTime; + + InRange := False; + end; + +begin + // Initialize resultant array + SetLength(Result, 1); + Result[0].StartTime := 0.0; + Result[0].EndTime := EncodeTime(23, 59, 59, 0); + + // EXIT if nothing to do + if ApptCount = 0 then + begin + if not FreeTime then + SetLength(Result, 0); + Exit; + end; + + // Initialize working array + // True ==> free minute + // False ==> used minute + for I := 0 to 1439 do + DayArray[I] := True; + + // Go through the appts and mark used minutes in the working array + for I := 0 to ApptCount - 1 do + begin + anAppt := Appts[I]; + MinStart := TimeToMinNum(anAppt.StartTime); + MinEnd := TimeToMinNum(AdjustEndTime(anAppt.EndTime)); + + for J := MinStart to MinEnd do + DayArray[J] := False; + end; + + // Now convert working array to resultant array + SetLength(Result, 0); + MinIsFree := not FreeTime; + for I := 0 to 1439 do + begin + Switch := DayArray[I] xor MinIsFree; + MinIsFree := DayArray[I]; + if Switch then + if MinIsFree then + if FreeTime then + StartRange + else + EndRange + else + if FreeTime then + EndRange + else + StartRange + end; + + // close and add the last range if needed + if InRange then + begin + I := 1439; // set I to last min of day + EndRange; + end; +end; + +function TJvTFSched.ApptCount: Integer; +begin + Result := FAppts.Count; +end; + +function TJvTFSched.ApptByID(const ID: string): TJvTFAppt; +var + I: Integer; +begin + Result := nil; + I := FAppts.IndexOf(ID); + if I > -1 then + Result := TJvTFAppt(FAppts.Objects[I]); +end; + +function TJvTFSched.ConControlCount: Integer; +begin + Result := FConControls.Count; +end; + +function TJvTFSched.ConComponentCount: Integer; +begin + Result := FConComponents.Count; +end; + +procedure TJvTFSched.AddAppt(Appt: TJvTFAppt); +begin + if Assigned(Appt) then + Appt.AddSchedule(SchedName); +end; + +procedure TJvTFSched.RemoveAppt(Appt: TJvTFAppt); +begin + if Assigned(Appt) then + Appt.RemoveSchedule(SchedName); +end; +{ +procedure TJvTFSched.RefreshAppts; +Var + I, + J, + K: Integer; + ApptIDList, + RefList: TStringList; + Appt: TJvTFAppt; + Sched: TJvTFSched; + RefID: string; +begin + // In a multi-user environment, appt objects may be deleted as a result + // of calling dbRefreshAppt. (Component user may call Appt.Free.) + // To account for this we need to build a list of appt ID's instead of + // working directly from the ScheduleManager's appointment list. + // We also need to build a list of connections (Components and + // TJvTFControls) that need to be refreshed. + + ApptIDList := TStringList.Create; + RefList := TStringList.Create; + RefList.Duplicates := dupIgnore; + Try + For I := 0 to ApptCount - 1 do + Begin + Appt := Appts[I]; + ApptIDList.Add(Appt.ID); + For J := 0 to Appt.ConnectionCount - 1 do + Begin + Sched := Appt.Connections[J]; + For K := 0 to Sched.ConComponentCount - 1 do + Begin + RefID := IntToStr(Integer(Sched.ConComponents[K])); + RefList.AddObject(RefID, Sched.ConComponents[K]); + End; + For K := 0 to Sched.ConControlCount - 1 do + Begin + RefID := IntToStr(Integer(Sched.ConControls[K])); + RefList.AddObject(RefID, Sched.ConControls[K]); + End; + End; + End; + + For I := 0 to ApptIDList.Count - 1 do + Begin + Appt := ScheduleManager.FindAppt(ApptIDList[I]); + If Assigned(Appt) Then + ScheduleManager.dbRefreshAppt(Appt); + End; + + For I := 0 to RefList.Count - 1 do + ScheduleManager.RefreshConnections(RefList.Objects[I]); + Finally + ApptIDList.Free; + RefList.Free; + End; +end; +} + +procedure TJvTFSched.PostAppts; +var + I: Integer; +begin + for I := 0 to ApptCount - 1 do + ScheduleManager.dbPostAppt(Appts[I]); +end; + +function TJvTFSched.GetFreeTime: TDynTimeRangeArray; +begin + Result := GetFreeUsedTime(True); +end; + +function TJvTFSched.GetUsedTime: TDynTimeRangeArray; +begin + Result := GetFreeUsedTime(False); +end; + +function TJvTFSched.TimeIsFree(TimeRange: TJvTFTimeRange): Boolean; +var + Appt: TJvTFAppt; + I: Integer; +begin + Result := True; + I := 0; + + while (I < ApptCount) and Result do + begin + Appt := Appts[I]; + if (Frac(Appt.StartTime) <= Frac(AdjustEndTime(TimeRange.EndTime))) and + (Frac(AdjustEndTime(Appt.EndTime)) >= Frac(TimeRange.StartTime)) then + Result := False + else + Inc(I); + end; +end; + +function TJvTFSched.TimeIsFree(RangeStart, RangeEnd: TTime): Boolean; +var + TimeRange: TJvTFTimeRange; +begin + TimeRange.StartTime := RangeStart; + TimeRange.EndTime := RangeEnd; + Result := TimeIsFree(TimeRange); +end; + +function TJvTFSched.ApptHasConflicts(anAppt: TJvTFAppt): Boolean; +var + Appt: TJvTFAppt; + I: Integer; +begin + Result := False; + I := 0; + + while (I < ApptCount) and not Result do + begin + Appt := Appts[I]; + if (Appt <> anAppt) and // Don't flag for the given appt + (Frac(Appt.StartTime) <= Frac(AdjustEndTime(anAppt.EndTime))) and + (Frac(AdjustEndTime(Appt.EndTime)) >= Frac(anAppt.StartTime)) then + Result := True + else + Inc(I); + end; +end; + +function TJvTFSched.EnumConflicts(TimeRange: TJvTFTimeRange): TDynApptArray; +var + Appt: TJvTFAppt; + I: Integer; +begin + SetLength(Result, 0); + for I := 0 to ApptCount - 1 do + begin + Appt := Appts[I]; + if (Frac(Appt.StartTime) <= Frac(AdjustEndTime(TimeRange.EndTime))) and + (Frac(AdjustEndTime(Appt.EndTime)) >= Frac(TimeRange.StartTime)) then + begin + SetLength(Result, Length(Result) + 1); + Result[High(Result)] := Appt; + end; + end; +end; + +function TJvTFSched.EnumConflicts(RangeStart, RangeEnd: TTime): TDynApptArray; +var + TimeRange: TJvTFTimeRange; +begin + TimeRange.StartTime := RangeStart; + TimeRange.EndTime := RangeEnd; + Result := EnumConflicts(TimeRange); +end; + +function TJvTFSched.EnumConflicts(anAppt: TJvTFAppt): TDynApptArray; +var + Appt: TJvTFAppt; + I: Integer; +begin + SetLength(Result, 0); + for I := 0 to ApptCount - 1 do + begin + Appt := Appts[I]; + if (Appt <> anAppt) and // don't add the given appt + (Frac(Appt.StartTime) <= Frac(AdjustEndTime(anAppt.EndTime))) and + (Frac(AdjustEndTime(Appt.EndTime)) >= Frac(anAppt.StartTime)) then + begin + SetLength(Result, Length(Result) + 1); + Result[High(Result)] := Appt; + end; + end; +end; + +function TJvTFSched.GetFirstAppt: TJvTFAppt; +var + I: Integer; + anAppt: TJvTFAppt; +begin + Result := nil; + I := 0; + while (I < ApptCount) do + begin + anAppt := Appts[I]; + if Trunc(anAppt.StartDate) < Trunc(SchedDate) then + begin + Result := anAppt; + Break; // APPOINTMENT STARTS AT 0:00 (12:00am) SO LEAVE LOOP + end + else + if not Assigned(Result) then + Result := anAppt + else + if Frac(anAppt.StartTime) < Frac(Result.StartTime) then + Result := anAppt; + Inc(I); + end; +end; + +function TJvTFSched.GetLastAppt: TJvTFAppt; +var + I: Integer; + anAppt: TJvTFAppt; +begin + Result := nil; + I := 0; + while (I < ApptCount) do + begin + anAppt := Appts[I]; + if Trunc(anAppt.EndDate) > Trunc(SchedDate) then + begin + Result := anAppt; + Break; // APPOINTMENT ENDS AT 23:59 (11:59pm) SO LEAVE LOOP + end + else + if not Assigned(Result) then + Result := anAppt + else + if Frac(anAppt.EndTime) > Frac(Result.EndTime) then + Result := anAppt; + Inc(I); + end; +end; + +procedure TJvTFSched.Refresh; +begin + ScheduleManager.dbRefreshSched(Self); +end; + +procedure TJvTFSched.SetSchedDisplayName(const Value: string); +begin + if FSchedDisplayName <> Value then + begin + FSchedDisplayName := Value; + ScheduleManager.RefreshConnections(Self); + end; +end; + +//=== { TJvTFScheduleManagerCache } ========================================== + +constructor TJvTFScheduleManagerCache.Create(SchedManager: TJvTFScheduleManager); +begin + inherited Create; + FScheduleManager := SchedManager; + + FCacheType := ctTimed; + FTimedDelay := 30000; + FBufferCount := 7; + + FTimer := TTimer.Create(nil); + FTimer.OnTimer := @TimerOnTimer; + FTimer.Interval := FTimedDelay; + FTimer.Enabled := FCacheType = ctTimed; +end; + +destructor TJvTFScheduleManagerCache.Destroy; +begin + FTimer.Free; + inherited Destroy; +end; + +procedure TJvTFScheduleManagerCache.SetCacheType(Value: TJvTFScheduleManagerCacheType); +begin + if Value <> FCacheType then + begin + FCacheType := Value; + FTimer.Enabled := Value = ctTimed; + FlushManager; + end; +end; + +procedure TJvTFScheduleManagerCache.SetTimedDelay(Value: Integer); +begin + if Value < 0 then + Value := 0; + if Value <> FTimedDelay then + begin + FTimedDelay := Value; + FTimer.Enabled := False; + FTimer.Interval := Value; + if CacheType = ctTimed then + begin + FTimer.Enabled := True; + FlushManager; + end; + end; +end; + +procedure TJvTFScheduleManagerCache.SetBufferCount(Value: Integer); +begin + if Value < 0 then + Value := 0; + if Value <> FBufferCount then + begin + FBufferCount := Value; + if CacheType = ctBuffer then + FlushManager; + end; +end; + +procedure TJvTFScheduleManagerCache.FlushManager; +begin + if Assigned(FScheduleManager) then + FScheduleManager.Flush(False); +end; + +procedure TJvTFScheduleManagerCache.TimerOnTimer(Sender: TObject); +begin + FlushManager; +end; + +procedure TJvTFScheduleManagerCache.Assign(Source: TPersistent); +begin + if Source is TJvTFScheduleManagerCache then + begin + FCacheType := TJvTFScheduleManagerCache(Source).CacheType; + FTimedDelay := TJvTFScheduleManagerCache(Source).TimedDelay; + FBufferCount := TJvTFScheduleManagerCache(Source).BufferCount; + if FTimer.Enabled then + begin + FTimer.Enabled := False; + FTimer.Interval := FTimedDelay; + FTimer.Enabled := FCacheType = ctTimed; + end; + FlushManager; + end + else + inherited Assign(Source); +end; + +//=== { TJvTFScheduleManager } =============================================== + +constructor TJvTFScheduleManager.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + + FSchedLoadMode := slmOnDemand; + FAppts := TStringList.Create; + FSchedules := TStringList.Create; + + FSchedBatch := TStringList.Create; + FSchedBatch.Sorted := True; + FSchedBatch.Duplicates := dupIgnore; + + FConControls := TStringList.Create; + FConComponents := TStringList.Create; + + FStateImageMap := TJvTFStateImageMap.Create(Self); + FImageChangeLink := TChangeLink.Create; + FImageChangeLink.OnChange := @ImageListChange; + + FCache := TJvTFScheduleManagerCache.Create(Self); + FApptBeingDestroyed := nil; +end; + +destructor TJvTFScheduleManager.Destroy; +begin + FDestroying := True; + + while ConControlCount > 0 do + ConControls[0].ScheduleManager := nil; + + while ConComponentCount > 0 do + ConComponents[0].ScheduleManager := nil; + + while ScheduleCount > 0 do + Schedules[0].Free; + + while ApptCount > 0 do + Appts[0].Free; + + FAppts.Free; + FSchedBatch.Free; + FSchedules.Free; + FConControls.Free; + FConComponents.Free; + FStateImageMap.Free; + + StateImages := nil; + CustomImages := nil; + FImageChangeLink.Free; + + FCache.Free; + + inherited Destroy; +end; + +class function TJvTFScheduleManager.GetScheduleID(const SchedName: string; + SchedDate: TDate): string; +begin + Result := SchedName + IntToStr(Trunc(SchedDate)); +end; + +class function TJvTFScheduleManager.GenerateApptID: string; +var + I: Integer; +begin + Result := FloatToStr(Now); + Randomize; + for I := 1 to 5 do + Result := Result + Chr(Random(25) + 65); +end; + +function TJvTFScheduleManager.GetAppt(Index: Integer): TJvTFAppt; +begin + Result := TJvTFAppt(FAppts.Objects[Index]); +end; + +function TJvTFScheduleManager.GetSchedule(Index: Integer): TJvTFSched; +begin + Result := TJvTFSched(FSchedules.Objects[Index]); +end; + +function TJvTFScheduleManager.GetConControl(Index: Integer): TJvTFControl; +begin + Result := TJvTFControl(FConControls.Objects[Index]); +end; + +function TJvTFScheduleManager.GetConComponent(Index: Integer): TJvTFComponent; +begin + Result := TJvTFComponent(FConComponents.Objects[Index]); +end; + +procedure TJvTFScheduleManager.SetStateImages(Value: TCustomImageList); +begin + ReplaceImageListReference(Self, Value, FStateImages, FImageChangeLink); +end; + +procedure TJvTFScheduleManager.SetCustomImages(Value: TCustomImageList); +begin + ReplaceImageListReference(Self, Value, FCustomImages, FImageChangeLink); +end; + +procedure TJvTFScheduleManager.SetCache(Value: TJvTFScheduleManagerCache); +begin + FCache.Assign(Value); +end; + +procedure TJvTFScheduleManager.Notification(AComponent: TComponent; + Operation: TOperation); +begin + inherited Notification(AComponent, Operation); + if Operation = opRemove then + if AComponent = StateImages then + begin + StateImages := nil; + RefreshConnections(nil); + end + else + if AComponent = CustomImages then + begin + CustomImages := nil; + RefreshConnections(nil); + end; +end; + +procedure TJvTFScheduleManager.ConnectControl(ApptCtrl: TJvTFControl); +var + I: Integer; +begin + if not Assigned(ApptCtrl) then + Exit; + + I := FConControls.IndexOfObject(ApptCtrl); + if I = -1 then + FConControls.AddObject('', ApptCtrl); +end; + +procedure TJvTFScheduleManager.DisconnectControl(ApptCtrl: TJvTFControl); +var + I: Integer; +begin + if not Assigned(ApptCtrl) then + Exit; + + I := FConControls.IndexOfObject(ApptCtrl); + if I > -1 then + begin + ApptCtrl.ReleaseSchedules; + FConControls.Delete(I); + end; +end; + +procedure TJvTFScheduleManager.ConnectComponent(Comp: TJvTFComponent); +var + I: Integer; +begin + if not Assigned(Comp) then + Exit; + + I := FConComponents.IndexOfObject(Comp); + if I = -1 then + FConComponents.AddObject('', Comp); +end; + +procedure TJvTFScheduleManager.DisconnectComponent(Comp: TJvTFComponent); +var + I: Integer; +begin + if not Assigned(Comp) then + Exit; + + I := FConComponents.IndexOfObject(Comp); + if I > -1 then + begin + Comp.ReleaseSchedules; + FConComponents.Delete(I); + end; +end; + +procedure TJvTFScheduleManager.Notify(Sender: TObject; Code: TJvTFServNotifyCode); +begin + case Code of + sncConnectComponent: + ConnectComponent(TJvTFComponent(Sender)); + sncDisconnectComponent: + DisconnectComponent(TJvTFComponent(Sender)); + sncConnectControl: + ConnectControl(TJvTFControl(Sender)); + sncDisconnectControl: + DisconnectControl(TJvTFControl(Sender)); + sncLoadAppt: + AddAppt(TJvTFAppt(Sender)); + sncDestroyAppt: + RemoveAppt(TJvTFAppt(Sender)); + sncDestroySchedule: + RemoveSchedule(TJvTFSched(Sender)); + end; +end; + +procedure TJvTFScheduleManager.NotifyAppt(Appt: TJvTFAppt; Sender: TObject; + Code: TJvTFServNotifyCode); +begin + if Assigned(Appt) then + Appt.Notify(Sender, Code); +end; + +procedure TJvTFScheduleManager.NotifySchedule(Sched: TJvTFSched; Sender: TObject; + Code: TJvTFServNotifyCode); +begin + if Assigned(Sched) then + Sched.Notify(Sender, Code); +end; + +procedure TJvTFScheduleManager.NotifyApptCtrl(ApptCtrl: TJvTFControl; + Sender: TObject; Code: TJvTFServNotifyCode); +begin + if Assigned(ApptCtrl) then + ApptCtrl.Notify(Sender, Code); +end; + +procedure TJvTFScheduleManager.NotifyComp(Comp: TJvTFComponent; + Sender: TObject; Code: TJvTFServNotifyCode); +begin + if Assigned(Comp) then + Comp.Notify(Sender, Code); +end; + +procedure TJvTFScheduleManager.RetrieveSchedule(const SchedName: string; SchedDate: TDate; + var Schedule: TJvTFSched; var LoadedNow: Boolean); +var + SchedID: string; + I: Integer; +begin + SchedID := GetScheduleID(SchedName, SchedDate); + I := FSchedules.IndexOf(SchedID); + + if I > -1 then + begin + Schedule := TJvTFSched(FSchedules.Objects[I]); + LoadedNow := False; + end + else + begin + //Schedule := TJvTFSched.Create(Self, SchedName, SchedDate); + Schedule := GetSchedClass.Create(Self, SchedName, SchedDate); + FSchedules.AddObject(SchedID, Schedule); + LoadedNow := True; + if Cache.CacheType = ctBuffer then + Flush(False); + Schedule.CheckConnections; + end; +end; + +procedure TJvTFScheduleManager.NeedAppts(Schedule: TJvTFSched); +begin + FLoadingAppts := True; + try + if Assigned(FOnNeedAppts) then + FOnNeedAppts(Self, Schedule); + finally + FLoadingAppts := False; + RefreshConnections(Schedule); + end; +end; + +procedure TJvTFScheduleManager.AddAppt(Appt: TJvTFAppt); +begin + if FAppts.IndexOfObject(Appt) = -1 then + FAppts.AddObject(Appt.ID, Appt); +end; + +procedure TJvTFScheduleManager.RemoveAppt(Appt: TJvTFAppt); +var + I: Integer; + IndexOfAppt: Integer; +begin + if Appt = FApptBeingDestroyed then + Exit; // Do Nothing if this is already the Appt we are + // destroying ourselves + + IndexOfAppt := FAppts.IndexOfObject(Appt); + if IndexOfAppt = -1 then + Exit; // Nothing to do if the appt is not in our list + + for I := 0 to ConControlCount - 1 do + NotifyApptCtrl(ConControls[I], Appt, sncDestroyAppt); + + for I := 0 to ConComponentCount - 1 do + NotifyComp(ConComponents[I], Appt, sncDestroyAppt); + + while Appt.ConnectionCount > 0 do + Appt.Notify(Appt.Connections[0], sncDisconnectAppt); + + FAppts.Delete(IndexOfAppt); + + // Do not free if the appt is being destroyed by someone else + if not Appt.Destroying then + begin + FApptBeingDestroyed := Appt; + try + Appt.Free; + finally + FApptBeingDestroyed := nil; + end; + end; +end; + +procedure TJvTFScheduleManager.RemoveSchedule(Sched: TJvTFSched); +var + I: Integer; +begin + for I := 0 to ConControlCount - 1 do + NotifyApptCtrl(ConControls[I], Sched, sncDestroySchedule); + + for I := 0 to ConComponentCount - 1 do + NotifyComp(ConComponents[I], Sched, sncDestroySchedule); + + FSchedules.Delete(FSchedules.IndexOfObject(Sched)); + Flush(False); +end; + +{ +procedure TJvTFScheduleManager.RefreshAppt(Appt: TJvTFAppt); +begin + FLoadingAppts := True; + Try + NotifyAppt(Appt, Self, sncRefresh); + If Assigned(FOnRefreshAppt) Then + FOnRefreshAppt(Self, Appt); + Finally + FLoadingAppts := False; + End; +end; +} + +procedure TJvTFScheduleManager.DeleteAppt(Appt: TJvTFAppt); +begin + if Assigned(FOnDeleteAppt) then + FOnDeleteAppt(Self, Appt); +end; + +procedure TJvTFScheduleManager.PostAppt(Appt: TJvTFAppt); +begin + if Assigned(FOnPostAppt) then + FOnPostAppt(Self, Appt); +end; + +procedure TJvTFScheduleManager.RequestRefresh(ApptCtrl: TJvTFControl; + Schedule: TJvTFSched); +begin + NotifyApptCtrl(ApptCtrl, Self, sncRefresh); + { + If Assigned(ApptCtrl) Then + Windows.PostMessage(ApptCtrl.Handle, CN_REQUESTREFRESH, WPARAM(Schedule), 0) + Else + Raise EJvTFScheduleManagerError.Create('Could not send refresh request. ' + + 'ApptCtrl not assigned'); + } +end; + +procedure TJvTFScheduleManager.RequestRefresh(Comp: TJvTFComponent; + Schedule: TJvTFSched); +begin + NotifyComp(Comp, Self, sncRefresh); +end; + +procedure TJvTFScheduleManager.ImageListChange(Sender: TObject); +begin + if not (csDestroying in ComponentState) then + RefreshConnections(nil); +end; + +procedure TJvTFScheduleManager.FlushAppts; +var + I: Integer; +begin + I := 0; + while I < ApptCount do + if (Appts[I].ConnectionCount = 0) and not Appts[I].Persistent then + begin + if not FlushObject(Appts[I]) then + Inc(I); + end + else + Inc(I); +end; + +function TJvTFScheduleManager.FlushObject(FlushObj: TObject): Boolean; +var + FlushIt: Boolean; +begin + Result := False; + if Assigned(FlushObj) then + begin + FlushIt := True; + if Assigned(FOnFlush) then + FOnFlush(Self, FlushObj, FlushIt); + if FlushIt then + FlushObj.Free; + Result := FlushIt; + end; +end; + +procedure TJvTFScheduleManager.DoCreateApptEvent(anAppt: TJvTFAppt); +begin + if Assigned(FOnCreateAppt) then + FOnCreateAppt(Self, anAppt); +end; + +procedure TJvTFScheduleManager.DoCreateScheduleEvent(aSchedule: TJvTFSched); +begin + if Assigned(FOnCreateSchedule) then + FOnCreateSchedule(Self, aSchedule); +end; + +procedure TJvTFScheduleManager.DoDestroyApptEvent(anAppt: TJvTFAppt); +begin + if Assigned(FOnDestroyAppt) then + FOnDestroyAppt(Self, anAppt); +end; + +procedure TJvTFScheduleManager.DoDestroyScheduleEvent(aSchedule: TJvTFSched); +begin + if Assigned(FOnDestroySchedule) then + FOnDestroySchedule(Self, aSchedule); +end; + +function TJvTFScheduleManager.ApptCount: Integer; +begin + Result := FAppts.Count; +end; + +function TJvTFScheduleManager.FindAppt(const ID: string): TJvTFAppt; +var + I: Integer; +begin + Result := nil; + I := FAppts.IndexOf(ID); + if I > -1 then + Result := TJvTFAppt(FAppts.Objects[I]); +end; + +function TJvTFScheduleManager.ScheduleCount: Integer; +begin + Result := FSchedules.Count; +end; + +function TJvTFScheduleManager.FindSchedule(const SchedName: string; + SchedDate: TDate): TJvTFSched; +var + I: Integer; +begin + Result := nil; + I := FSchedules.IndexOf(GetScheduleID(SchedName, SchedDate)); + if I > -1 then + Result := TJvTFSched(FSchedules.Objects[I]); +end; + +function TJvTFScheduleManager.ConControlCount: Integer; +begin + Result := FConControls.Count; +end; + +function TJvTFScheduleManager.ConComponentCount: Integer; +begin + Result := FConComponents.Count; +end; + +function TJvTFScheduleManager.RequestSchedule(ApptCtrl: TJvTFControl; + const SchedName: string; SchedDate: TDate): TJvTFSched; +var + ApptsNeeded: Boolean; +begin + RetrieveSchedule(SchedName, SchedDate, Result, ApptsNeeded); + + if Assigned(ApptCtrl) then + begin + Result.Notify(ApptCtrl, sncRequestSchedule); + ApptCtrl.Notify(Result, sncRequestSchedule); + end; + + if ApptsNeeded then + if SchedLoadMode = slmOnDemand then + NeedAppts(Result) + else + begin + AddToBatch(Result); + end; +end; + +function TJvTFScheduleManager.RequestSchedule(ApptCtrl: TJvTFControl; + const SchedName: string; SchedDate: TDate; var LoadedNow: Boolean): TJvTFSched; +begin + RetrieveSchedule(SchedName, SchedDate, Result, LoadedNow); + + if Assigned(ApptCtrl) then + begin + Result.Notify(ApptCtrl, sncRequestSchedule); + ApptCtrl.Notify(Result, sncRequestSchedule); + end; + + if LoadedNow then + begin + if SchedLoadMode = slmOnDemand then + NeedAppts(Result) + else + AddToBatch(Result); + end; +end; + +function TJvTFScheduleManager.RequestSchedule(Comp: TJvTFComponent; + const SchedName: string; SchedDate: TDate): TJvTFSched; +var + ApptsNeeded: Boolean; +begin + RetrieveSchedule(SchedName, SchedDate, Result, ApptsNeeded); + + if Assigned(Comp) then + begin + Result.Notify(Comp, sncRequestSchedule); + Comp.Notify(Result, sncRequestSchedule); + end; + + if ApptsNeeded then + begin + if SchedLoadMode = slmOnDemand then + NeedAppts(Result) + else + AddToBatch(Result); + end; +end; + +function TJvTFScheduleManager.RequestSchedule(Comp: TJvTFComponent; + const SchedName: string; SchedDate: TDate; var LoadedNow: Boolean): TJvTFSched; +begin + RetrieveSchedule(SchedName, SchedDate, Result, LoadedNow); + + if Assigned(Comp) then + begin + Result.Notify(Comp, sncRequestSchedule); + Comp.Notify(Result, sncRequestSchedule); + end; + + if LoadedNow then + begin + if SchedLoadMode = slmOnDemand then + NeedAppts(Result) + else + AddToBatch(Result); + end; +end; + +procedure TJvTFScheduleManager.ReleaseSchedule(ApptCtrl: TJvTFControl; + const SchedName: string; SchedDate: TDate); +var + SchedID: string; + I: Integer; + Schedule: TJvTFSched; +begin + SchedID := GetScheduleID(SchedName, SchedDate); + I := FSchedules.IndexOf(SchedID); + + if I > -1 then + begin + Schedule := TJvTFSched(FSchedules.Objects[I]); + + if Assigned(ApptCtrl) then + begin + Schedule.Notify(ApptCtrl, sncReleaseSchedule); + ApptCtrl.Notify(Schedule, sncReleaseSchedule); + end; + + if (Cache.CacheType = ctBuffer) then + Flush(False); + end; +end; + +procedure TJvTFScheduleManager.ReleaseSchedule(Comp: TJvTFComponent; + const SchedName: string; SchedDate: TDate); +var + SchedID: string; + I: Integer; + Schedule: TJvTFSched; +begin + SchedID := GetScheduleID(SchedName, SchedDate); + I := FSchedules.IndexOf(SchedID); + + if I > -1 then + begin + Schedule := TJvTFSched(FSchedules.Objects[I]); + + if Assigned(Comp) then + begin + Schedule.Notify(Comp, sncReleaseSchedule); + Comp.Notify(Schedule, sncReleaseSchedule); + end; + + if Cache.CacheType = ctBuffer then + Flush(False); + end; +end; + +procedure TJvTFScheduleManager.RequestAppt(const ID: string; var Appt: TJvTFAppt; + var New: Boolean); +var + I: Integer; +begin + I := -1; + if ID <> '' then + I := FAppts.IndexOf(ID); + + if I > -1 then + begin + Appt := TJvTFAppt(FAppts.Objects[I]); + New := False; + end + else + begin + //Appt := TJvTFAppt.Create(Self, ID); + Appt := GetApptClass.Create(Self, ID); + New := True; + end; +end; + +procedure TJvTFScheduleManager.dbPostAppt(Appt: TJvTFAppt); +begin + { implicit post fix + If Assigned(Appt) Then + If (AlwaysPost or Appt.Modified) Then + Begin + PostAppt(Appt); + Appt.Notify(Self, sncPostAppt); + End; + } + + // implicit post fix + if Assigned(Appt) and + (AlwaysPost or Appt.Modified) and + QueryPostAppt(Appt) then + begin + PostAppt(Appt); + Appt.Notify(Self, sncPostAppt); + end; +end; + +procedure TJvTFScheduleManager.dbDeleteAppt(Appt: TJvTFAppt); +begin + if Assigned(Appt) then + begin + DeleteAppt(Appt); + Appt.Notify(Self, sncDeleteAppt); + end; +end; + +procedure TJvTFScheduleManager.dbDeleteAllAppt; +var + I: Integer; +begin + for I := FAppts.Count - 1 downto 0 do + RemoveAppt(TJvTFAppt(FAppts.Objects[0])); +end; + +procedure TJvTFScheduleManager.dbRefreshAppt(Appt: TJvTFAppt); +begin + if Assigned(Appt) then + begin + FRefreshing := True; + try + Appt.Notify(Self, sncRefresh); + if Assigned(FOnRefreshAppt) then + FOnRefreshAppt(Self, Appt); + if RefreshAutoReconcile then + ReconcileRefresh(Appt); + finally + FRefreshing := False; + + // BUG - IT'S A LITTLE LATE TO BE USING THE APPT AS A REFRESH TRIGGER!!! + //RefreshConnections(Appt); + // Use nil as trigger to refresh everything + RefreshConnections(nil); + end; + end; + { + If Assigned(Appt) Then + RefreshAppt(Appt); + } +end; + +function TJvTFScheduleManager.dbNewAppt(const ID: string): TJvTFAppt; +var + New: Boolean; +begin + Result := nil; + RequestAppt(ID, Result, New); + if not New then + raise EJvTFScheduleManagerError.CreateRes(@RsECouldNotCreateNewAppointment); +end; + +procedure TJvTFScheduleManager.PostAppts; +var + I: Integer; +begin + for I := 0 to ApptCount - 1 do + dbPostAppt(Appts[I]); +end; + +procedure TJvTFScheduleManager.RefreshAppts; +var + I: Integer; + ApptIDList: TStringList; + Appt: TJvTFAppt; +begin + // In a multi-user environment, appt objects may be deleted as a result + // of calling dbRefreshAppt. (Component user may call Appt.Free.) + // To account for this we need to build a list of appt ID's instead of + // working directly from the ScheduleManager's appointment list. + + ApptIDList := TStringList.Create; + try + for I := 0 to ApptCount - 1 do + begin + Appt := Appts[I]; + ApptIDList.Add(Appt.ID); + end; + + for I := 0 to ApptIDList.Count - 1 do + begin + Appt := FindAppt(ApptIDList[I]); + if Assigned(Appt) then + dbRefreshAppt(Appt); + end; + + RefreshConnections(nil); + finally + ApptIDList.Free; + end; +end; + +procedure TJvTFScheduleManager.RefreshConnections(Trigger: TObject); +var + Sched: TJvTFSched; + Appt: TJvTFAppt; + I: Integer; +begin + // Do not refresh if we're loading or refreshing appts + if FLoadingAppts or Refreshing then + Exit; + + if Trigger = nil then + begin + // refresh all schedules for all controls connected to ScheduleManager + for I := 0 to ConControlCount - 1 do + RequestRefresh(ConControls[I], nil); + // refresh all schedules for all components connected to the ScheduleManager + for I := 0 to ConComponentCount - 1 do + RequestRefresh(ConComponents[I], nil); + end + else + if Trigger is TJvTFComponent then + begin + // refresh all schedules for given component + RequestRefresh(TJvTFComponent(Trigger), nil); + end + else + if Trigger is TJvTFControl then + begin + // refresh all schedules for given control + RequestRefresh(TJvTFControl(Trigger), nil); + end + else + if Trigger is TJvTFSched then + begin + // refresh all appt controls connected to schedule + Sched := TJvTFSched(Trigger); + for I := 0 to Sched.ConControlCount - 1 do + RequestRefresh(Sched.ConControls[I], Sched); + // refresh all utf components connected to schedule + for I := 0 to Sched.ConComponentCount - 1 do + RequestRefresh(Sched.ConComponents[I], Sched); + end + else + if Trigger is TJvTFAppt then + begin + // refresh all appt controls for all schedules connected to this appt + Appt := TJvTFAppt(Trigger); + for I := 0 to Appt.ConnectionCount - 1 do + RefreshConnections(Appt.Connections[I]); + end + else + raise EJvTFScheduleManagerError.CreateRes(@RsEInvalidTriggerForRefreshControls) +end; + +procedure TJvTFScheduleManager.Flush(All: Boolean); //param All defaults to False +var + I: Integer; + Sched: TJvTFSched; + MRUList: TStringList; + CacheTimeUp: Boolean; +begin + if FFlushing or FDestroying then + Exit; + + FFlushing := True; + try + if All then + begin + I := 0; + while I < ScheduleCount do + begin + Sched := Schedules[I]; + if Sched.Cached and not Sched.Persistent then + begin + if not FlushObject(Sched) then + Inc(I); + end + else + Inc(I); + end; + FlushAppts; + end + else + if Cache.CacheType = ctTimed then + begin + I := 0; + while I < ScheduleCount do + begin + Sched := Schedules[I]; + CacheTimeUp := GetTickCount64 - Sched.CachedTime >= Cache.TimedDelay; +// CacheTimeUp := Windows.GetTickCount - Sched.CachedTime >= UINT(Cache.TimedDelay); + if Sched.Cached and CacheTimeUp then + begin + if not FlushObject(Sched) then + Inc(I); + end + else + Inc(I); + end; + FlushAppts; + end + else + if Cache.CacheType = ctBuffer then + begin + MRUList := TStringList.Create; + try + MRUList.Sorted := True; + MRUList.Duplicates := dupAccept; + for I := 0 to ScheduleCount - 1 do + begin + Sched := Schedules[I]; + if Sched.Cached then + MRUList.AddObject(IntToHex(Sched.CachedTime, 8), Sched); + end; + for I := 0 to MRUList.Count - 1 - Cache.BufferCount do + FlushObject(MRUList.Objects[I]); + FlushAppts; + finally + MRUList.Free; + end; + end; + + finally + FFlushing := False; + end; +end; + +procedure TJvTFScheduleManager.dbRefreshAll; +var + I: Integer; +begin + FRefreshing := True; + try + for I := 0 to ApptCount - 1 do + NotifyAppt(Appts[I], Self, sncRefresh); + if Assigned(FOnRefreshAll) then + FOnRefreshAll(Self); + if RefreshAutoReconcile then + ReconcileRefresh(Self); + finally + FRefreshing := False; + RefreshConnections(nil); + end; +end; + +procedure TJvTFScheduleManager.dbRefreshOrphans; +var + I: Integer; +begin + for I := 0 to ApptCount - 1 do + if Appts[I].ConnectionCount = 0 then + dbRefreshAppt(Appts[I]); +end; + +procedure TJvTFScheduleManager.dbRefreshSched(Sched: TJvTFSched); +var + I: Integer; +begin + if Assigned(Sched) then + begin + FRefreshing := True; + try + for I := 0 to Sched.ApptCount - 1 do + NotifyAppt(Sched.Appts[I], Self, sncRefresh); + if Assigned(FOnRefreshSched) then + FOnRefreshSched(Self, Sched); + if RefreshAutoReconcile then + ReconcileRefresh(Sched); + finally + FRefreshing := False; + RefreshConnections(Sched); + end; + end; +end; + +procedure TJvTFScheduleManager.SetTFSchedLoadMode(Value: TJvTFSchedLoadMode); +begin + if (Value <> FSchedLoadMode) and (Value = slmOnDemand) then + // make sure we process any queued batches before changing mode + ProcessBatches; + + FSchedLoadMode := Value; +end; + +procedure TJvTFScheduleManager.AddToBatch(ASched: TJvTFSched); +var + SchedID: string; +begin + SchedID := TJvTFScheduleManager.GetScheduleID(ASched.SchedName, ASched.SchedDate); + FSchedBatch.AddObject(SchedID, ASched); +end; + +procedure TJvTFScheduleManager.ProcessBatches; +var + I: Integer; + ASched: TJvTFSched; + CompName: string; + CompDate: TDate; + BatchName: string; + BatchStartDate: TDate; + BatchEndDate: TDate; + + procedure UpdateCompares(ASched: TJvTFSched); + begin + CompName := ASched.SchedName; + CompDate := ASched.SchedDate; + end; + + procedure NewBatch(ASched: TJvTFSched); + begin + BatchName := ASched.SchedName; + BatchStartDate := ASched.SchedDate; + BatchEndDate := ASched.SchedDate; + end; + +begin + if FSchedBatch.Count = 0 then + Exit; + + // added by Mike 1/14/01 + FLoadingAppts := True; + try + // Prime the process (reminds me of COBOL - yuck!) + ASched := TJvTFSched(FSchedBatch.Objects[0]); + UpdateCompares(ASched); + NewBatch(ASched); + + for I := 1 to FSchedBatch.Count - 1 do + begin + ASched := TJvTFSched(FSchedBatch.Objects[I]); + + if (ASched.SchedName <> CompName) or + (Trunc(ASched.SchedDate) - 1 <> Trunc(CompDate)) then + begin + // Hit new batch. Load the current batch and then + // set batch info to new batch. + LoadBatch(BatchName, BatchStartDate, BatchEndDate); + NewBatch(ASched); + end + else + // Still in current batch. Update the batch end date. + BatchEndDate := ASched.SchedDate; + + UpdateCompares(ASched); + end; + + // Load the last batch + LoadBatch(BatchName, BatchStartDate, BatchEndDate); + + FSchedBatch.Clear; + + // ADD OnBatchesProcessed EVENT HERE !! + if Assigned(FOnBatchesProcessed) then + FOnBatchesProcessed(Self); + finally + // added by Mike 1/14/01 + FLoadingAppts := False; + // added by Mike 1/14/01 + RefreshConnections(nil); + end; +end; + +procedure TJvTFScheduleManager.LoadBatch(const BatchName: string; BatchStartDate, + BatchEndDate: TDate); +begin + if Assigned(FOnLoadBatch) then + FOnLoadBatch(Self, BatchName, BatchStartDate, BatchEndDate); +end; + +function TJvTFScheduleManager.QueryPostAppt(Appt: TJvTFAppt): Boolean; +begin + Result := True; + if Assigned(FOnPostApptQuery) then + FOnPostApptQuery(Self, Appt, Result); +end; + +function TJvTFScheduleManager.GetApptDisplayText(AComponent: TComponent; + Appt: TJvTFAppt): string; +begin + if Assigned(Appt) then + Result := Appt.Description + else + Result := ''; + + if Assigned(FOnGetApptDisplayText) then + FOnGetApptDisplayText(Self, AComponent, Appt, Result); +end; + +procedure TJvTFScheduleManager.SetApptDescription(Appt: TJvTFAppt; var Value: string); +begin + if Assigned(FOnSetApptDescription) then + FOnSetApptDescription(Self, Appt, Value); +end; + +procedure TJvTFScheduleManager.GetApptDescription(Appt: TJvTFAppt; var Value: string); +begin + if Assigned(FOnGetApptDescription) then + FOnGetApptDescription(Self, Appt, Value); +end; + +function TJvTFScheduleManager.GetApptClass: TJvTFApptClass; +begin + Result := TJvTFAppt; +end; + +function TJvTFScheduleManager.GetSchedClass: TJvTFSchedClass; +begin + Result := TJvTFSched; +end; + +procedure TJvTFScheduleManager.ReconcileRefresh(Scope: TObject); +var + Appt: TJvTFAppt; + Sched: TJvTFSched; + I: Integer; +begin + if Scope is TJvTFAppt then + begin + Appt := TJvTFAppt(Scope); + if not Appt.Refreshed then + Appt.ClearSchedules; + end + else + if Scope is TJvTFSched then + begin + Sched := TJvTFSched(Scope); + I := 0; + while I < Sched.ApptCount do + begin + Appt := Sched.Appts[I]; + if not Appt.Refreshed then + Appt.ClearSchedules + else + Inc(I); + end; + end + else + if Scope is TJvTFScheduleManager then + for I := 0 to ApptCount - 1 do + ReconcileRefresh(Appts[I]) + else + raise EJvTFScheduleManagerError.CreateRes(@RsEInvalidScopeInReconcileRefresh); +end; + +procedure TJvTFScheduleManager.SetRefreshAutoReconcile(Value: Boolean); +begin + FRefreshAutoReconcile := Value; +end; + +//=== { TJvTFHint } ========================================================== + +constructor TJvTFHint.Create(anApptCtrl: TJvTFControl); +begin + inherited Create(anApptCtrl); + FApptCtrl := anApptCtrl; + FTimer := TTimer.Create(Self); + FShortPause := 1000; + FPause := 3000; + FTimer.OnTimer := @TimerOnTimer; + PrepTimer(True); +end; + +destructor TJvTFHint.Destroy; +begin + FTimer.Free; + inherited Destroy; +end; + +procedure TJvTFHint.SetPause(Value: Integer); +begin + FPause := Value; +end; + +procedure TJvTFHint.SetShortPause(Value: Integer); +begin + FShortPause := Value; +end; + +procedure TJvTFHint.TimerOnTimer(Sender: TObject); +begin + FTimer.Enabled := False; + + if FShortTimer then + DoHint(False) + else + begin + ReleaseHandle; + PrepTimer(True); + end; +end; + +procedure TJvTFHint.PrepTimer(Short: Boolean); +begin + ReleaseHandle; + FShortTimer := Short; + if Short then + FTimer.Interval := FShortPause + else + FTimer.Interval := FPause; +end; + +procedure TJvTFHint.SetHintText(StartDate, EndDate: TDate; StartTime, + EndTime: TTime; const Desc: string; ShowDatesTimes, ShowDesc: Boolean); +var + ShowDates: Boolean; + HintText, DFormat, TFormat: string; +begin + HintText := ''; + if ShowDatesTimes then + begin + DFormat := FApptCtrl.DateFormat; + TFormat := FApptCtrl.TimeFormat; + ShowDates := Trunc(StartDate) <> Trunc(EndDate); + + if ShowDates then + HintText := FormatDateTime(DFormat, StartDate) + ' '; + HintText := HintText + FormatDateTime(TFormat, StartTime) + ' - '; + if ShowDates then + HintText := HintText + FormatDateTime(DFormat, EndDate) + ' '; + HintText := HintText + FormatDateTime(TFormat, EndTime); + end; + + if ShowDesc then + begin + if HintText <> '' then + HintText := HintText + #13#10; + HintText := HintText + Desc; + end; + FHintText := HintText; +end; + +procedure TJvTFHint.DoHint(Sustained: Boolean); +var + Ref: TObject; +begin + PropertyCheck; + { + If Assigned(FOnShowHint) Then + FOnShowHint(Self, HintType, FHintRect, FHintText); + } + + if Assigned(FOnShowHint) then + begin + if HintType = shtAppt then + Ref := FOldAppt + else + if HintType = shtObj then + Ref := FOldObj + else + Ref := nil; + + FOnShowHint(Self, HintType, Ref, FHintRect, FHintText); + end; +// if not Windows.IsRectEmpty(FHintRect) and (FHintText <> '') then + if not IsRectEmpty(FHintRect) and (FHintText <> '') then + if Sustained then + begin + inherited ActivateHint(FHintRect, FHintText); + end + else + ActivateHint(FHintRect, FHintText); +end; + + + +procedure TJvTFHint.CreateParams(var Params: TCreateParams); +begin + inherited CreateParams(Params); + { wp --- to do + with Params do + begin + WindowClass.Style := WindowClass.Style and not CS_SAVEBITS; + end; + } +end; + + +procedure TJvTFHint.ActivateHint(Rect: TRect; const AHint: THintString); +begin + PrepTimer(False); + inherited ActivateHint(Rect, AHint); + // Reset the timer so we get the full interval + FTimer.Enabled := False; + FTimer.Enabled := True; +end; + +procedure TJvTFHint.ApptHint(Appt: TJvTFAppt; X, Y: Integer; ShowDatesTimes, + ShowDesc, FormattedDesc: Boolean; const ExtraDesc: string = ''); +var + HintTopLeft: TPoint; + Immediate: Boolean; + ApptDesc: string; +begin + if Appt <> FOldAppt then + begin + FHintType := shtAppt; + Immediate := not FShortTimer; + FHintCell := Point(-100, -100); + FOldAppt := Appt; + if Assigned(Appt) then + begin + ApptDesc := Appt.Description; + if not FormattedDesc then + ApptDesc := StripCRLF(ApptDesc); + ApptDesc := ExtraDesc + ApptDesc; + SetHintText(Appt.StartDate, Appt.EndDate, Appt.StartTime, Appt.EndTime, + ApptDesc, ShowDatesTimes, ShowDesc); + FHintRect := CalcHintRect(FApptCtrl.Width, FHintText, nil); + HintTopLeft := FApptCtrl.ClientToScreen(Point(X, Y)); + FHintRect := MoveRect(FHintRect, HintTopLeft.X, HintTopLeft.Y); + if Immediate then + DoHint(False) + else + begin + PrepTimer(True); + FTimer.Enabled := True; + end; + end + else + begin + ReleaseHandle; + PrepTimer(True); + end; + end; +end; + +procedure TJvTFHint.StartEndHint(StartDate, EndDate: TDate; StartTime, + EndTime: TTime; X, Y: Integer; ShowDates: Boolean); +var + HintTopLeft: TPoint; +begin + FHintType := shtStartEnd; + SetHintText(StartDate, EndDate, StartTime, EndTime, '', True, False); + FHintRect := CalcHintRect(FApptCtrl.Width, FHintText, nil); + HintTopLeft := FApptCtrl.ClientToScreen(Point(X, Y)); + FHintRect := MoveRect(FHintRect, HintTopLeft.X, HintTopLeft.Y); + if HandleAllocated and Showing then + BoundsRect := FHintRect + else + DoHint(True); +end; + +procedure TJvTFHint.CellHint(Row, Col: Integer; const HintText: string; CellRect: TRect); +var + Immediate: Boolean; + DiffCell: Boolean; +begin + DiffCell := (Row <> FHintCell.Y) or (Col <> FHintCell.X); + if DiffCell or not FTimer.Enabled then + begin + FHintType := shtCell; + FOldAppt := nil; + ReleaseHandle; + FHintCell.X := Col; + FHintCell.Y := Row; + Immediate := not FShortTimer; + FHintText := HintText; + //If (FHintText <> '') and DiffCell Then + if FHintText <> '' then + begin + CellRect.TopLeft := FApptCtrl.ClientToScreen(CellRect.TopLeft); + CellRect.BottomRight := FApptCtrl.ClientToScreen(CellRect.BottomRight); + FHintRect := CalcHintRect(FApptCtrl.Width, FHintText, nil); + FHintRect := CenterRect(CellRect, FHintRect); + if Immediate then + DoHint(False) + else + begin + PrepTimer(True); + FTimer.Enabled := True; + end; + end + else + begin + ReleaseHandle; + PrepTimer(True); + end; + end; +end; + +procedure TJvTFHint.ReleaseHandle; +begin + FTimer.Enabled := False; + DestroyHandle; +end; + +procedure TJvTFHint.PropertyCheck; +begin + if Assigned(RefProps) then + begin + if RefProps.HintColor = clDefault then + Color := Application.HintColor + else + Color := RefProps.HintColor; + + if RefProps.HintHidePause = -1 then + Pause := Application.HintHidePause + else + Pause := RefProps.HintHidePause; + + if RefProps.HintPause = -1 then + ShortPause := Application.HintPause + else + ShortPause := RefProps.HintPause; + end; +end; + +procedure TJvTFHint.MultiLineObjHint(Obj: TObject; X, Y: Integer; + Hints: TStrings); +var + Immediate: Boolean; + HintTopLeft: TPoint; +begin + if Obj <> FOldObj then + begin + FOldAppt := nil; + FHintType := shtObj; + Immediate := not FShortTimer; + FHintCell := Point(-100, -100); + FOldObj := Obj; + if Assigned(Obj) and (Hints.Count > 0) then + begin + FHintText := Hints.Text; + FHintRect := CalcHintRect(FApptCtrl.Width, FHintText, nil); + HintTopLeft := FApptCtrl.ClientToScreen(Point(X + 8, Y + 16)); + FHintRect := MoveRect(FHintRect, HintTopLeft.X, HintTopLeft.Y); + + if Immediate then + DoHint(False) + else + begin + PrepTimer(True); + FTimer.Enabled := True; + end; + end + else + begin + ReleaseHandle; + PrepTimer(True); + end; + end; +end; + +//=== { TJvTFControl } ======================================================= + +constructor TJvTFControl.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + + FSchedules := TStringList.Create; + FTimeFormat := 't'; // global short time format + FDateFormat := 'ddddd'; // global short date format +end; + +destructor TJvTFControl.Destroy; +begin + ScheduleManager := nil; + FSchedules.Free; + + inherited Destroy; +end; + +procedure TJvTFControl.SetManager(Value: TJvTFScheduleManager); +begin + if Value <> FScheduleManager then + begin + if Assigned(FScheduleManager) then + FScheduleManager.Notify(Self, sncDisconnectControl); + FScheduleManager := nil; + + if Assigned(Value) then + Value.Notify(Self, sncConnectControl); + FScheduleManager := Value; + end; +end; + +function TJvTFControl.GetSchedule(Index: Integer): TJvTFSched; +begin + Result := TJvTFSched(FSchedules.Objects[Index]); +end; + +procedure TJvTFControl.SetDateFormat(const Value: string); +begin + if FDateFormat <> Value then + begin + FDateFormat := Value; + Invalidate; + end; +end; + +procedure TJvTFControl.SetTimeFormat(const Value: string); +begin + if FTimeFormat <> Value then + begin + FTimeFormat := Value; + Invalidate; + end; +end; + +procedure TJvTFControl.Notify(Sender: TObject; + Code: TJvTFServNotifyCode); +begin + case Code of + sncRequestSchedule: + ReqSchedNotification(TJvTFSched(Sender)); + sncReleaseSchedule: + RelSchedNotification(TJvTFSched(Sender)); + sncRefresh: + RefreshControl; + sncDestroyAppt: + DestroyApptNotification(TJvTFAppt(Sender)); + sncDestroySchedule: + DestroySchedNotification(TJvTFSched(Sender)); + end; +end; + +procedure TJvTFControl.ReqSchedNotification(Schedule: TJvTFSched); +var + SchedID: string; +begin + SchedID := TJvTFScheduleManager.GetScheduleID(Schedule.SchedName, Schedule.SchedDate); + if FSchedules.IndexOf(SchedID) = -1 then + FSchedules.AddObject(SchedID, Schedule); +end; + +procedure TJvTFControl.RelSchedNotification(Schedule: TJvTFSched); +var + I: Integer; +begin + I := FSchedules.IndexOfObject(Schedule); + if I > -1 then + FSchedules.Delete(I); +end; + +procedure TJvTFControl.NotifyManager(Serv: TJvTFScheduleManager; + Sender: TObject; Code: TJvTFServNotifyCode); +begin + if Assigned(Serv) then + Serv.Notify(Sender, Code) + else + raise EJvTFScheduleManagerError.CreateRes(@RsEScheduleManagerNotificationFailedSc); +end; + +procedure TJvTFControl.CNRequestRefresh(var Msg: TCNRequestRefresh); +begin + Invalidate; +end; + +procedure TJvTFControl.RefreshControl; +begin + Invalidate; +end; + +procedure TJvTFControl.DestroyApptNotification(anAppt: TJvTFAppt); +begin + // do nothing, leave implementation to successors +end; + +procedure TJvTFControl.DestroySchedNotification(ASched: TJvTFSched); +begin + // do nothing, leave implementation to successors +end; + +procedure TJvTFControl.DoStartDrag(var DragObject: TDragObject); +begin + inherited DoStartDrag(DragObject); + + FDragInfo := TJvTFDragInfo.Create; + with FDragInfo do + begin + ApptCtrl := Self; + Shift := Self.FShift; + end; + + { + Originally, a specific drag object was created and given to the DragObject + param. This worked fine. Because of differences in the VCL DragObject + hierarachy between D3 and D4, the decision was made to move away from + using a drag object. + + FDragAppt := TDragAppt.Create(Self); + With FDragAppt do + Begin + ApptCtrl := Self; + Schedule := SelSchedule; + Appt := SelAppt; + Shift := FDragShift; + End; + DragObject := FDragAppt; + } +end; + +procedure TJvTFControl.DoEndDrag(Target: TObject; X, Y: Integer); +begin + inherited DoEndDrag(Target, X, Y); + + FDragInfo.Free; + FDragInfo := nil; +end; + +procedure TJvTFControl.MouseDown(Button: TMouseButton; Shift: TShiftState; + X, Y: Integer); +begin + inherited MouseDown(Button, Shift, X, Y); + FShift := Shift; +end; + +function TJvTFControl.ScheduleCount: Integer; +begin + Result := FSchedules.Count; +end; + +function TJvTFControl.FindSchedule(const SchedName: string; + SchedDate: TDate): TJvTFSched; +var + I: Integer; +begin + Result := nil; + + I := FSchedules.IndexOf(TJvTFScheduleManager.GetScheduleID(SchedName, SchedDate)); + if I > -1 then + Result := TJvTFSched(FSchedules.Objects[I]); +end; + +function TJvTFControl.RetrieveSchedule(const SchedName: string; + SchedDate: TDate): TJvTFSched; +begin + Result := FindSchedule(SchedName, SchedDate); + + if not Assigned(Result) then + if Assigned(ScheduleManager) then + Result := ScheduleManager.RequestSchedule(Self, SchedName, SchedDate) + else + raise EJvTFScheduleManagerError.CreateRes(@RsECouldNotRetrieveSchedule); +end; + +procedure TJvTFControl.ReleaseSchedule(const SchedName: string; + SchedDate: TDate); +var + SchedID: string; +begin + SchedID := TJvTFScheduleManager.GetScheduleID(SchedName, SchedDate); + if FSchedules.IndexOf(SchedID) > -1 then + if Assigned(ScheduleManager) then + ScheduleManager.ReleaseSchedule(Self, SchedName, SchedDate) + else + raise EJvTFScheduleManagerError.CreateRes(@RsECouldNotReleaseSchedule); + +end; + +procedure TJvTFControl.ReleaseSchedules; +begin + while ScheduleCount > 0 do + ReleaseSchedule(Schedules[0].SchedName, Schedules[0].SchedDate); +end; + +procedure TJvTFControl.Notification(AComponent: TComponent; + Operation: TOperation); +begin + inherited Notification(AComponent, Operation); + // If (AComponent = Navigator) and (Operation = opRemove) Then + // Navigator := nil; +end; + +//procedure TJvTFControl.SetNavigator(Value: TJvTFNavigator); +//begin +// If Value <> FNavigator Then +// Begin +// If Assigned(FNavigator) Then +// FNavigator.UnregisterControl(Self); +// FNavigator := nil; +// +// If Assigned(Value) Then +// Value.RegisterControl(Self); +// FNavigator := Value; +// End; +//end; + +procedure TJvTFControl.Navigate(aControl: TJvTFControl; + SchedNames: TStringList; Dates: TJvTFDateList); +begin + // If Assigned(FOnNavigate) Then + // FOnNavigate(Self, aControl, SchedNames, Dates); +end; + +procedure TJvTFControl.ProcessBatches; +begin + if Assigned(ScheduleManager) and (ScheduleManager.SchedLoadMode = slmBatch) then + ScheduleManager.ProcessBatches; +end; + +//=== { TJvTFComponent } ===================================================== + +constructor TJvTFComponent.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + + FSchedules := TStringList.Create; + FTimeFormat := 't'; // global short time format + FDateFormat := 'ddddd'; // global short date format +end; + +destructor TJvTFComponent.Destroy; +begin + ScheduleManager := nil; + FSchedules.Free; + + inherited Destroy; +end; + +procedure TJvTFComponent.DestroyApptNotification(anAppt: TJvTFAppt); +begin + // do nothing, leave implementation to descendants +end; + +procedure TJvTFComponent.DestroySchedNotification(ASched: TJvTFSched); +begin + // do nothing, leave implementation to descendants +end; + +function TJvTFComponent.FindSchedule(const SchedName: string; + SchedDate: TDate): TJvTFSched; +var + I: Integer; +begin + Result := nil; + + I := FSchedules.IndexOf(TJvTFScheduleManager.GetScheduleID(SchedName, SchedDate)); + if I > -1 then + Result := TJvTFSched(FSchedules.Objects[I]); +end; + +function TJvTFComponent.GetSchedule(Index: Integer): TJvTFSched; +begin + Result := TJvTFSched(FSchedules.Objects[Index]); +end; + +procedure TJvTFComponent.Notify(Sender: TObject; Code: TJvTFServNotifyCode); +begin + case Code of + sncRequestSchedule: + ReqSchedNotification(TJvTFSched(Sender)); + sncReleaseSchedule: + RelSchedNotification(TJvTFSched(Sender)); + sncRefresh: + RefreshComponent; + sncDestroyAppt: + DestroyApptNotification(TJvTFAppt(Sender)); + sncDestroySchedule: + DestroySchedNotification(TJvTFSched(Sender)); + end; +end; + +procedure TJvTFComponent.NotifyManager(Serv: TJvTFScheduleManager; Sender: TObject; + Code: TJvTFServNotifyCode); +begin + if Assigned(Serv) then + Serv.Notify(Sender, Code) + else + raise EJvTFScheduleManagerError.CreateRes(@RsEScheduleManagerNotificationFailedSc); +end; + +procedure TJvTFComponent.ProcessBatches; +begin + if Assigned(ScheduleManager) and (ScheduleManager.SchedLoadMode = slmBatch) then + ScheduleManager.ProcessBatches; +end; + +procedure TJvTFComponent.RefreshComponent; +begin + // do nothing, leave implementation to descendants +end; + +procedure TJvTFComponent.ReleaseSchedule(const SchedName: string; + SchedDate: TDate); +var + SchedID: string; +begin + SchedID := TJvTFScheduleManager.GetScheduleID(SchedName, SchedDate); + if FSchedules.IndexOf(SchedID) > -1 then + if Assigned(ScheduleManager) then + ScheduleManager.ReleaseSchedule(Self, SchedName, SchedDate) + else + raise EJvTFScheduleManagerError.CreateRes(@RsECouldNotReleaseSchedule); +end; + +procedure TJvTFComponent.ReleaseSchedules; +begin + while ScheduleCount > 0 do + ReleaseSchedule(Schedules[0].SchedName, Schedules[0].SchedDate); +end; + +procedure TJvTFComponent.RelSchedNotification(Schedule: TJvTFSched); +var + I: Integer; +begin + I := FSchedules.IndexOfObject(Schedule); + if I > -1 then + FSchedules.Delete(I); +end; + +procedure TJvTFComponent.ReqSchedNotification(Schedule: TJvTFSched); +var + SchedID: string; +begin + SchedID := TJvTFScheduleManager.GetScheduleID(Schedule.SchedName, Schedule.SchedDate); + if FSchedules.IndexOf(SchedID) = -1 then + FSchedules.AddObject(SchedID, Schedule); +end; + +function TJvTFComponent.RetrieveSchedule(const SchedName: string; + SchedDate: TDate): TJvTFSched; +begin + Result := FindSchedule(SchedName, SchedDate); + + if not Assigned(Result) then + if Assigned(ScheduleManager) then + Result := ScheduleManager.RequestSchedule(Self, SchedName, SchedDate) + else + raise EJvTFScheduleManagerError.CreateRes(@RsECouldNotRetrieveSchedule); +end; + +function TJvTFComponent.ScheduleCount: Integer; +begin + Result := FSchedules.Count; +end; + +procedure TJvTFComponent.SetDateFormat(const Value: string); +begin + FDateFormat := Value; +end; + +procedure TJvTFComponent.SetManager(Value: TJvTFScheduleManager); +begin + if Value <> FScheduleManager then + begin + if Assigned(FScheduleManager) then + FScheduleManager.Notify(Self, sncDisconnectComponent); + FScheduleManager := nil; + + if Assigned(Value) then + Value.Notify(Self, sncConnectComponent); + FScheduleManager := Value; + end; +end; + +procedure TJvTFComponent.SetTimeFormat(const Value: string); +begin + FTimeFormat := Value; +end; + +procedure TJvTFComponent.UpdateDesigner; +var + ParentForm: TCustomForm; +begin + if (csDesigning in ComponentState) and not (csUpdating in ComponentState) then + begin + try + ParentForm := TCustomForm(Owner); + if Assigned(ParentForm) and Assigned(ParentForm.Designer) then + ParentForm.Designer.Modified; + except + // handle the exception by doing nothing + end; + end; +end; + +//=== { TJvTFPrinter } ======================================================= + +constructor TJvTFPrinter.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + CreateLayout; + FMeasure := pmInches; + FPages := TStringList.Create; + FBodies := TStringList.Create; + InitializeMargins; +end; + +destructor TJvTFPrinter.Destroy; +begin + FreeDoc; + FBodies.Free; + FPages.Free; + + FPageLayout.Free; + inherited Destroy; +end; + +procedure TJvTFPrinter.AbortPrint; +begin + if Printer.Printing then + Printer.Abort + else + FAborted := True; +end; + +function TJvTFPrinter.ConvertMeasure(Value: Integer; FromMeasure, + ToMeasure: TJvTFPrinterMeasure; Horizontal: Boolean): Integer; +const + MMFactor = 2.54; +var + PPI: Integer; +begin + PPI := 300; // wp -- just a workaround for next commented lines... + { wp --- to do + if Horizontal then + PPI := Windows.GetDeviceCaps(Printer.Handle, LOGPIXELSX) + else + PPI := Windows.GetDeviceCaps(Printer.Handle, LOGPIXELSY); + } + if (FromMeasure = pmPixels) and (ToMeasure = pmInches) then + Result := round(Value / PPI * 100) + else + if (FromMeasure = pmPixels) and (ToMeasure = pmMM) then + Result := round(Value / PPI * 100 * MMFactor) + else + if (FromMeasure = pmInches) and (ToMeasure = pmPixels) then + Result := round(Value / 100 * PPI) + else + if (FromMeasure = pmInches) and (ToMeasure = pmMM) then + Result := round(Value * MMFactor) + else + if (FromMeasure = pmMM) and (ToMeasure = pmPixels) then + Result := round(Value / MMFactor / 100 * PPI) + else + if (FromMeasure = pmMM) and (ToMeasure = pmInches) then + Result := round(Value / MMFactor) + else + Result := Value; +end; + +procedure TJvTFPrinter.CreateDoc; +begin + if State = spsNoDoc then + begin + FState := spsCreating; + FAborted := False; + + FDocDateTime := Now; + if DirectPrint then + Printer.BeginDoc; + end + else + raise EJvTFPrinterError.CreateRes(@RsECouldNotCreateADocumentBecauseA); +end; + +procedure TJvTFPrinter.CreateLayout; +begin + FPageLayout := TJvTFPrinterPageLayout.Create(Self); +end; + +procedure TJvTFPrinter.DrawBody(aCanvas: TCanvas; ARect: TRect; + PageNum: Integer); +begin + if Assigned(FOnDrawBody) then + FOnDrawBody(Self, aCanvas, ARect, PageNum); +end; + +procedure TJvTFPrinter.DrawFooter(aCanvas: TCanvas; ARect: TRect; + PageNum: Integer); +begin + if Assigned(FOnDrawFooter) then + FOnDrawFooter(Self, aCanvas, ARect, PageNum); +end; + +procedure TJvTFPrinter.DrawHeader(aCanvas: TCanvas; ARect: TRect; + PageNum: Integer); +begin + if Assigned(FOnDrawHeader) then + FOnDrawHeader(Self, aCanvas, ARect, PageNum); +end; + +procedure TJvTFPrinter.FinishDoc; +var + I: Integer; + { wp --- to do + aCanvas: TMetafileCanvas; + } + HeaderRect, FooterRect: TRect; +begin + if Aborted then + Exit; + + if State <> spsCreating then + raise EJvTFPrinterError.CreateRes(@RsECouldNotFinishDocumentBecauseNo); + + FPageCount := FBodies.Count; + FState := spsAssembling; + try + if Assigned(FOnAssembleProgress) then + FOnAssembleProgress(Self, 0, FBodies.Count); + + if DirectPrint then + Printer.EndDoc + else + begin + GetHeaderFooterRects(HeaderRect, FooterRect); + I := 0; + while (I < FBodies.Count) and not Aborted do + begin + { wp --- to do ... + aCanvas := TMetafileCanvas(FBodies.Objects[I]); + + try + DrawHeader(aCanvas, HeaderRect, I + 1); + DrawFooter(aCanvas, FooterRect, I + 1); + finally + aCanvas.Free; + FBodies.Objects[I] := nil; + end; + } + + if Assigned(FOnAssembleProgress) then + FOnAssembleProgress(Self, I + 1, FBodies.Count); + + Inc(I); + Application.ProcessMessages; + end; + end; + + FBodies.Clear; + finally + FState := spsFinished; + end; +end; + +procedure TJvTFPrinter.FreeDoc; +begin + while FBodies.Count > 0 do + begin + FBodies.Objects[0].Free; + FBodies.Delete(0); + end; + + while FPages.Count > 0 do + begin + FPages.Objects[0].Free; + FPages.Delete(0); + end; + + FState := spsNoDoc; +end; + +function TJvTFPrinter.GetBodyHeight: Integer; // always in pixels +var + PhysHeight, TopMarginPels, BottomMarginPels, HeaderPels, FooterPels: Integer; +begin + { wp --- to do + PhysHeight := Windows.GetDeviceCaps(Printer.Handle, PHYSICALHEIGHT); + } + TopMarginPels := ConvertMeasure(PageLayout.MarginTop, Measure, pmPixels, False); + BottomMarginPels := ConvertMeasure(PageLayout.MarginBottom, Measure, pmPixels, False); + HeaderPels := ConvertMeasure(PageLayout.HeaderHeight, Measure, pmPixels, False); + FooterPels := ConvertMeasure(PageLayout.FooterHeight, Measure, pmPixels, False); + + Result := PhysHeight - TopMarginPels - BottomMarginPels - + HeaderPels - FooterPels; +end; + +function TJvTFPrinter.GetBodyLeft: Integer; // always in pixels +begin + Result := GetMarginOffset(1); +end; + +function TJvTFPrinter.GetBodyTop: Integer; // always in pixels +begin + Result := GetMarginOffset(2) + + ConvertMeasure(PageLayout.HeaderHeight, Measure, pmPixels, False) + 1; +end; + +function TJvTFPrinter.GetBodyWidth: Integer; // always in pixels +var + PhysWidth, LeftMarginPels, RightMarginPels: Integer; +begin + { wp --- to do + PhysWidth := Windows.GetDeviceCaps(Printer.Handle, PHYSICALWIDTH); + } + LeftMarginPels := ConvertMeasure(PageLayout.MarginLeft, Measure, pmPixels, True); + RightMarginPels := ConvertMeasure(PageLayout.MarginRight, Measure, pmPixels, True); + + Result := PhysWidth - LeftMarginPels - RightMarginPels; +end; + +function TJvTFPrinter.GetDocDateTime: TDateTime; +begin + if State = spsNoDoc then + raise EJvTFPrinterError.CreateRes(@RsEDocumentDoesNotExist); + + Result := FDocDateTime; +end; + +procedure TJvTFPrinter.GetHeaderFooterRects(var HeaderRect, FooterRect: TRect); +begin + HeaderRect.Left := FMarginOffsets.Left; + HeaderRect.Top := FMarginOffsets.Top; + HeaderRect.Right := HeaderRect.Left + BodyWidth; + HeaderRect.Bottom := HeaderRect.Top + ConvertMeasure(PageLayout.HeaderHeight, + Measure, pmPixels, False); + + FooterRect.Left := HeaderRect.Left; + FooterRect.Right := HeaderRect.Right; + FooterRect.Top := BodyTop + BodyHeight; + FooterRect.Bottom := FooterRect.Top + ConvertMeasure(PageLayout.FooterHeight, + Measure, pmPixels, False); +end; + +function TJvTFPrinter.GetMarginOffset(Index: Integer): Integer; +begin + case Index of + 1: + Result := FMarginOffsets.Left; + 2: + Result := FMarginOffsets.Top; + 3: + Result := FMarginOffsets.Right; + else + Result := FMarginOffsets.Bottom; + end; +end; + + +{ wp --- to do +function TJvTFPrinter.GetPage(Index: Integer): TMetafile; +begin + if DirectPrint then + raise EJvTFPrinterError.CreateRes(@RsEDocumentPagesCannotBeAccessedIf); + + if State <> spsFinished then + raise EJvTFPrinterError.CreateRes(@RsEDocumentPagesAreInaccessibleUntil); + Result := TMetafile(FPages.Objects[Index]); +end; +} + +function TJvTFPrinter.GetPageCount: Integer; +begin + case State of + spsNoDoc: + raise EJvTFPrinterError.CreateRes(@RsECouldNotRetrievePageCount); + spsCreating: + Result := FBodies.Count; + spsAssembling: + Result := FPageCount; + spsFinished: + Result := FPages.Count; + else + Result := -1; + end; +end; + +function TJvTFPrinter.GetUnprintable: TJvTFMargins; +var + LeftMarg, TopMarg, WidthPaper, HeightPaper, WidthPrintable, HeightPrintable: Integer; +begin + { wp --- to do + LeftMarg := Windows.GetDeviceCaps(Printer.Handle, PHYSICALOFFSETX); + TopMarg := Windows.GetDeviceCaps(Printer.Handle, PHYSICALOFFSETY); + WidthPaper := Windows.GetDeviceCaps(Printer.Handle, PHYSICALWIDTH); + HeightPaper := Windows.GetDeviceCaps(Printer.Handle, PHYSICALHEIGHT); + } + WidthPrintable := Printer.PageWidth; + HeightPrintable := Printer.PageHeight; + + with Result do + begin + Left := LeftMarg; + Top := TopMarg; + Right := WidthPaper - WidthPrintable - LeftMarg; + Bottom := HeightPaper - HeightPrintable - TopMarg; + end; +end; + +procedure TJvTFPrinter.InitializeMargins; +var + I, Unprintable, NewMargin: Integer; + Horz: Boolean; +begin + for I := 1 to 4 do + begin + SetMarginOffset(I, 0); + + case I of + 1: + Unprintable := GetUnprintable.Left; + 2: + Unprintable := GetUnprintable.Top; + 3: + Unprintable := GetUnprintable.Right; + else + Unprintable := GetUnprintable.Bottom; + end; + + Horz := (I = 1) or (I = 3); + NewMargin := ConvertMeasure(Unprintable, pmPixels, Measure, Horz); + + case I of + 1: + PageLayout.FMargins.Left := NewMargin; + 2: + PageLayout.FMargins.Top := NewMargin; + 3: + PageLayout.FMargins.Right := NewMargin; + else + PageLayout.FMargins.Bottom := NewMargin; + end; + end; +end; + +procedure TJvTFPrinter.MarginError; +begin + if Assigned(FOnMarginError) then + FOnMarginError(Self); +end; + +procedure TJvTFPrinter.NewDoc; +begin + FreeDoc; + CreateDoc; +end; + +procedure TJvTFPrinter.NewPage; +var + { wp --- to do + aMetafile: TMetafile; + } + aCanvas: TCanvas; + HeaderRect, FooterRect: TRect; +begin + if Aborted then + Exit; + + { wp --- to do + if DirectPrint then + begin + if PageCount > 0 then + Printer.NewPage; + aCanvas := Printer.Canvas; + FPages.Add(''); + end + else + begin + // Create a TMetafile for the page + aMetafile := TMetafile.Create; + FPages.AddObject('', aMetafile); + // Create a TMetafileCanvas as a canvas for the page. + // Store the canvas in FBodies so we can retrieve it later to draw + // the header and footer. + aCanvas := TMetafileCanvas.Create(aMetafile, Printer.Handle); + end; + FBodies.AddObject('', aCanvas); + aCanvas.Font.PixelsPerInch := Windows.GetDeviceCaps(Printer.Handle, + LOGPIXELSX); + + Windows.SetViewPortOrgEx(aCanvas.Handle, BodyLeft, BodyTop, nil); + DrawBody(aCanvas, Rect(BodyLeft, BodyTop, BodyWidth - BodyLeft, + BodyHeight - BodyTop), FPages.Count); + Windows.SetViewPortOrgEx(aCanvas.Handle, 0, 0, nil); + if DirectPrint then + begin + GetHeaderFooterRects(HeaderRect, FooterRect); + DrawHeader(aCanvas, HeaderRect, PageCount); + DrawFooter(aCanvas, FooterRect, PageCount); + end; + } +end; + +procedure TJvTFPrinter.Print; +var + I: Integer; +begin + if Aborted or DirectPrint then + Exit; + + if State <> spsFinished then + raise EJvTFPrinterError.CreateRes(@RsEOnlyAFinishedDocumentCanBePrinted); + if PageCount = 0 then + raise EJvTFPrinterError.CreateRes(@RsEThereAreNoPagesToPrint); + + if Assigned(FOnPrintProgress) then + FOnPrintProgress(Self, 0, PageCount); + Application.ProcessMessages; + + Printer.Title := Title; + Printer.BeginDoc; + { wp --- to do ... + if not Printer.Aborted then + Printer.Canvas.Draw(0, 0, Pages[0]); + + if Assigned(FOnPrintProgress) then + FOnPrintProgress(Self, 1, PageCount); + Application.ProcessMessages; + + I := 1; + while (I < PageCount) and not Printer.Aborted do + begin + if not Printer.Aborted then + Printer.NewPage; + if not Printer.Aborted then + Printer.Canvas.Draw(0, 0, Pages[I]); + Inc(I); + if Assigned(FOnPrintProgress) then + FOnPrintProgress(Self, I, PageCount); + Application.ProcessMessages; + end; + } + if not Printer.Aborted then + Printer.EndDoc; +end; + +function TJvTFPrinter.PrinterToScreen(Value: Integer; + Horizontal: Boolean): Integer; +var + ScreenPPI, PrinterPPI: Integer; +begin + { wp --- to do + ScreenPPI := Screen.PixelsPerInch; + if Horizontal then + PrinterPPI := Windows.GetDeviceCaps(Printer.Handle, LOGPIXELSX) + else + PrinterPPI := Windows.GetDeviceCaps(Printer.Handle, LOGPIXELSY); + } + Result := Trunc(ScreenPPI / PrinterPPI * Value); +end; + +procedure TJvTFPrinter.SaveDocToFiles(BaseFileName: TFileName); +var + I: Integer; +begin + if State <> spsFinished then + raise EJvTFPrinterError.CreateRes(@RsEDocumentMustBeFinishedToSaveToFile); + + { wp --- to do + for I := 0 to PageCount - 1 do + Pages[I].SaveToFile(BaseFileName + '_' + IntToStr(I + 1) + '.emf'); + } +end; + +function TJvTFPrinter.ScreenToPrinter(Value: Integer; + Horizontal: Boolean): Integer; +var + ScreenPPI, PrinterPPI: Integer; +begin + ScreenPPI := Screen.PixelsPerInch; + { wp --- to do + if Horizontal then + PrinterPPI := Windows.GetDeviceCaps(Printer.Handle, LOGPIXELSX) + else + PrinterPPI := Windows.GetDeviceCaps(Printer.Handle, LOGPIXELSY); + } + Result := Trunc(PrinterPPI / ScreenPPI * Value); +end; + +procedure TJvTFPrinter.SetDirectPrint(Value: Boolean); +begin + SetPropertyCheck; + FDirectPrint := Value; +end; + +procedure TJvTFPrinter.SetMarginOffset(Index, Value: Integer); +begin + // Allow negative value... + // SetMargin will catch that case and throw exception + case Index of + 1: + FMarginOffsets.Left := Value; + 2: + FMarginOffsets.Top := Value; + 3: + FMarginOffsets.Right := Value; + else + FMarginOffsets.Bottom := Value; + end; +end; + +procedure TJvTFPrinter.SetMeasure(Value: TJvTFPrinterMeasure); +begin + try + FConvertingProps := True; + if Value <> FMeasure then + begin + PageLayout.FHeaderHeight := ConvertMeasure(PageLayout.FHeaderHeight, + FMeasure, Value, False); + PageLayout.FFooterHeight := ConvertMeasure(PageLayout.FFooterHeight, + FMeasure, Value, False); + + PageLayout.FMargins.Left := ConvertMeasure(PageLayout.FMargins.Left, + FMeasure, Value, True); + PageLayout.FMargins.Right := ConvertMeasure(PageLayout.FMargins.Right, + FMeasure, Value, True); + PageLayout.FMargins.Top := ConvertMeasure(PageLayout.FMargins.Top, + FMeasure, Value, False); + PageLayout.FMargins.Bottom := ConvertMeasure(PageLayout.FMargins.Bottom, + FMeasure, Value, False); + FMeasure := Value; + end; + finally + FConvertingProps := False; + end; +end; + +procedure TJvTFPrinter.SetPageLayout(Value: TJvTFPrinterPageLayout); +begin + FPageLayout.Assign(Value); +end; + +procedure TJvTFPrinter.SetPropertyCheck; +begin + if (State <> spsNoDoc) and not ConvertingProps then + raise EJvTFPrinterError.CreateRes(@RsEThisPropertyCannotBeChangedIfA); +end; + +procedure TJvTFPrinter.SetTitle(const Value: string); +begin + FTitle := Value; +end; + +//=== { TJvTFPrinterPageLayout } ============================================= + +constructor TJvTFPrinterPageLayout.Create(aPrinter: TJvTFPrinter); +begin + inherited Create; + if not Assigned(aPrinter) then + raise EJvTFPrinterError.CreateRes(@RsECouldNotCreateTJvTFPrinterPageLayou); + + FPrinter := aPrinter; +end; + +procedure TJvTFPrinterPageLayout.Assign(Source: TPersistent); +var + SourceMeas, DestMeas: TJvTFPrinterMeasure; + WorkVal: Integer; + SourceLayout: TJvTFPrinterPageLayout; +begin + if (Source is TJvTFPrinterPageLayout) then + begin + if not Assigned(Printer) or not Assigned(TJvTFPrinterPageLayout(Source).Printer) then + Exit; // raise? + SourceLayout := TJvTFPrinterPageLayout(Source); + SourceMeas := SourceLayout.Printer.Measure; + DestMeas := Printer.Measure; + + WorkVal := SourceLayout.MarginLeft; + WorkVal := Printer.ConvertMeasure(WorkVal, SourceMeas, DestMeas, True); + SetMargin(1, WorkVal); + + WorkVal := SourceLayout.MarginTop; + WorkVal := Printer.ConvertMeasure(WorkVal, SourceMeas, DestMeas, False); + SetMargin(2, WorkVal); + + WorkVal := SourceLayout.MarginRight; + WorkVal := Printer.ConvertMeasure(WorkVal, SourceMeas, DestMeas, True); + SetMargin(3, WorkVal); + + WorkVal := SourceLayout.MarginBottom; + WorkVal := Printer.ConvertMeasure(WorkVal, SourceMeas, DestMeas, False); + SetMargin(4, WorkVal); + + WorkVal := SourceLayout.HeaderHeight; + WorkVal := Printer.ConvertMeasure(WorkVal, SourceMeas, DestMeas, False); + SetHeaderHeight(WorkVal); + + WorkVal := SourceLayout.FooterHeight; + WorkVal := Printer.ConvertMeasure(WorkVal, SourceMeas, DestMeas, False); + SetFooterHeight(WorkVal); + end + else + inherited Assign(Source); +end; + +procedure TJvTFPrinterPageLayout.Change; +begin + // do nothing, leave to descendants +end; + +function TJvTFPrinterPageLayout.GetMargin(Index: Integer): Integer; +begin + case Index of + 1: + Result := FMargins.Left; + 2: + Result := FMargins.Top; + 3: + Result := FMargins.Right; + else + Result := FMargins.Bottom; + end; +end; + +procedure TJvTFPrinterPageLayout.SetFooterHeight(Value: Integer); +var + Check: Integer; +begin + SetPropertyCheck; + + if Value < 0 then + Value := 0; + + if Value <> FFooterHeight then + begin + Check := FFooterHeight; + FFooterHeight := Value; + if Printer.BodyHeight < 1 then + begin + FFooterHeight := Check; + raise EJvTFPrinterError.CreateResFmt(@RsEInvalidFooterHeightd, [Value]); + end + else + Change; + end; +end; + +procedure TJvTFPrinterPageLayout.SetHeaderHeight(Value: Integer); +var + Check: Integer; +begin + SetPropertyCheck; + + if Value < 0 then + Value := 0; + if Value <> FHeaderHeight then + begin + Check := FHeaderHeight; + FHeaderHeight := Value; + if Printer.BodyHeight < 1 then + begin + FHeaderHeight := Check; + raise EJvTFPrinterError.CreateResFmt(@RsEInvalidHeaderHeightd, [Value]); + end + else + Change; + end; +end; + +procedure TJvTFPrinterPageLayout.SetMargin(Index, Value: Integer); +var + Unprintable, UserMarginPels, CurrMargin, NewMargin: Integer; + Horz, Err: Boolean; +begin + SetPropertyCheck; + + CurrMargin := GetMargin(Index); + if Value <> CurrMargin then + begin + Horz := (Index = 1) or (Index = 3); + case Index of + 1: + Unprintable := Printer.GetUnprintable.Left; + 2: + Unprintable := Printer.GetUnprintable.Top; + 3: + Unprintable := Printer.GetUnprintable.Right; + else + Unprintable := Printer.GetUnprintable.Bottom; + end; + + UserMarginPels := Printer.ConvertMeasure(Value, Printer.Measure, + pmPixels, Horz); + Printer.SetMarginOffset(Index, UserMarginPels - Unprintable); + + if Printer.GetMarginOffset(Index) >= 0 then + begin + Err := False; + NewMargin := Value; + end + else + begin + Err := True; + Printer.SetMarginOffset(Index, 0); + NewMargin := Printer.ConvertMeasure(Unprintable, pmPixels, + Printer.Measure, Horz); + end; + + if not Err then + case Index of + 1: + FMargins.Left := NewMargin; + 2: + FMargins.Top := NewMargin; + 3: + FMargins.Right := NewMargin; + else + FMargins.Bottom := NewMargin; + end + else + //SetMargin(Index, NewMargin); + case Index of + 1: + MarginLeft := NewMargin; + 2: + MarginTop := NewMargin; + 3: + MarginRight := NewMargin; + else + MarginBottom := NewMargin; + end; + + if Err and Assigned(Printer) then + begin + Printer.UpdateDesigner; + Printer.MarginError; + end; + + Change; + end; +end; + +procedure TJvTFPrinterPageLayout.SetPropertyCheck; +begin + Printer.SetPropertyCheck; +end; + +//=== { TJvTFUniversalPrinter } ============================================== + +procedure TJvTFUniversalPrinter.CreateDoc; +begin + inherited CreateDoc; +end; + +procedure TJvTFUniversalPrinter.FinishDoc; +begin + inherited FinishDoc; +end; + +procedure TJvTFUniversalPrinter.NewDoc; +begin + inherited NewDoc; +end; + +procedure TJvTFUniversalPrinter.NewPage; +begin + inherited NewPage; +end; + +//=== { TJvTFHintProps } ===================================================== + +constructor TJvTFHintProps.Create(AOwner: TJvTFControl); +begin + inherited Create; + FControl := AOwner; + + FHintColor := clDefault; + FHintHidePause := -1; + FHintPause := -1; +end; + +procedure TJvTFHintProps.Assign(Source: TPersistent); +begin + if Source is TJvTFHint then + begin + FHintColor := TJvTFHintProps(Source).HintColor; + FHintHidePause := TJvTFHintProps(Source).HintHidePause; + FHintPause := TJvTFHintProps(Source).HintPause; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFHintProps.Change; +begin + // do nothing +end; + +procedure TJvTFHintProps.SetHintColor(Value: TColor); +begin + if Value <> FHintColor then + begin + FHintColor := Value; + Change; + end; +end; + +procedure TJvTFHintProps.SetHintHidePause(Value: Integer); +begin + if Value < -1 then + Value := -1; + + if Value <> FHintHidePause then + begin + FHintHidePause := Value; + Change; + end; +end; + +procedure TJvTFHintProps.SetHintPause(Value: Integer); +begin + if Value < -1 then + Value := -1; + + if Value <> HintPause then + begin + FHintPause := Value; + Change; + end; +end; + +//=== { TJvTFDWNames } ======================================================= + +constructor TJvTFDWNames.Create; +begin + inherited Create; + FSource := dwnsSysShort; + FDWN_Sunday := 'S'; + FDWN_Monday := 'M'; + FDWN_Tuesday := 'T'; + FDWN_Wednesday := 'W'; + FDWN_Thursday := 'T'; + FDWN_Friday := 'F'; + FDWN_Saturday := 'S'; +end; + +procedure TJvTFDWNames.Assign(Source: TPersistent); +begin + if Source is TJvTFDWNames then + begin + FDWN_Sunday := TJvTFDWNames(Source).DWN_Sunday; + FDWN_Monday := TJvTFDWNames(Source).DWN_Monday; + FDWN_Tuesday := TJvTFDWNames(Source).DWN_Tuesday; + FDWN_Wednesday := TJvTFDWNames(Source).DWN_Wednesday; + FDWN_Thursday := TJvTFDWNames(Source).DWN_Thursday; + FDWN_Friday := TJvTFDWNames(Source).DWN_Friday; + FDWN_Saturday := TJvTFDWNames(Source).DWN_Saturday; + FSource := TJvTFDWNames(Source).Source; + Change; + end + else + inherited Assign(Source); +end; + +procedure TJvTFDWNames.Change; +begin + if Assigned(FOnChange) then + FOnChange(Self); +end; + +function TJvTFDWNames.GetDWN(Index: Integer): string; +begin + case Index of + 1: + Result := FDWN_Sunday; + 2: + Result := FDWN_Monday; + 3: + Result := FDWN_Tuesday; + 4: + Result := FDWN_Wednesday; + 5: + Result := FDWN_Thursday; + 6: + Result := FDWN_Friday; + 7: + Result := FDWN_Saturday; + else + Result := ''; + end; +end; + +function TJvTFDWNames.GetDWName(DWIndex: Integer): string; +begin + case Source of + dwnsSysLong: + Result := FormatSettings.LongDayNames[DWIndex]; + dwnsSysShort: + Result := FormatSettings.ShortDayNames[DWIndex]; + else // dwnsCustom + Result := GetDWN(DWIndex); + end; +end; + +procedure TJvTFDWNames.SetDWN(Index: Integer; const Value: string); +begin + case Index of + 1: + FDWN_Sunday := Value; + 2: + FDWN_Monday := Value; + 3: + FDWN_Tuesday := Value; + 4: + FDWN_Wednesday := Value; + 5: + FDWN_Thursday := Value; + 6: + FDWN_Friday := Value; + 7: + FDWN_Saturday := Value; + end; + + if Source = dwnsCustom then + Change; +end; + +procedure TJvTFDWNames.SetSource(Value: TJvTFDWNameSource); +begin + if Value <> FSource then + begin + FSource := Value; + Change; + end; +end; + +//=== { TJvTFDateList } ====================================================== + +constructor TJvTFDateList.Create; +begin + inherited Create; + FList := TStringList.Create; + FList.Sorted := True; + FList.Duplicates := dupIgnore; +end; + +destructor TJvTFDateList.Destroy; +begin + FList.Free; + inherited Destroy; +end; + +function TJvTFDateList.Add(ADate: TDate): Integer; +begin + Result := FList.Add(IntToStr(Trunc(ADate))); + Change; +end; + +procedure TJvTFDateList.Change; +begin + if Assigned(FOnChange) then + FOnChange(Self); +end; + +procedure TJvTFDateList.Clear; +begin + FList.Clear; + Change; +end; + +function TJvTFDateList.Count: Integer; +begin + Result := FList.Count; +end; + +procedure TJvTFDateList.Delete(Index: Integer); +begin + FList.Delete(Index); + Change; +end; + +function TJvTFDateList.GetDate(Index: Integer): TDate; +begin + Result := StrToInt(FList[Index]); +end; + +function TJvTFDateList.IndexOf(ADate: TDate): Integer; +begin + Result := FList.IndexOf(IntToStr(Trunc(ADate))); +end; + +//=== { TJvTFNavigator } ===================================================== + +//constructor TJvTFNavigator.Create(AOwner: TComponent); +//begin +// inherited Create(AOwner); +// FControls := TStringList.Create; +//end; +// +//destructor TJvTFNavigator.Destroy; +//begin +// While ControlCount > 0 do +// UnregisterControl(Controls[0]); +// FControls.Free; +// +// inherited Destroy; +//end; +// +//function TJvTFNavigator.ControlCount: Integer; +//begin +// Result := FControls.Count; +//end; +// +//function TJvTFNavigator.GetControl(Index: Integer): TJvTFControl; +//begin +// Result := TJvTFControl(FControls.Objects[Index]); +//end; +// +//procedure TJvTFNavigator.Navigate(aControl: TJvTFControl; +// SchedNames: TStringList; Dates: TJvTFDateList); +//var +// I: Integer; +// Control: TJvTFControl; +//begin +// If Navigating or not Assigned(aControl) Then +// Exit; +// +// If Assigned(FBeforeNavigate) Then +// FBeforeNavigate(Self, aControl, SchedNames, Dates); +// +// FNavigating := True; +// Try +// For I := 0 to ControlCount - 1 do +// Begin +// Control := Controls[I]; +// If Control <> aControl Then +// //Controls[I].Notify(aControl, sncNavigate); +// Control.Navigate(aControl, SchedNames, Dates); +// End; +// Finally +// FNavigating := False; +// End; +// +// If Assigned(FAfterNavigate) Then +// FAfterNavigate(Self, aControl, SchedNames, Dates); +//end; +// +//procedure TJvTFNavigator.RegisterControl(aControl: TJvTFControl); +//var +// I: Integer; +//begin +// I := FControls.IndexOfObject(aControl); +// If I = -1 Then +// FControls.AddObject('', aControl); +//end; +// +//procedure TJvTFNavigator.UnregisterControl(aControl: TJvTFControl); +//var +// I: Integer; +//begin +// I := FControls.IndexOfObject(aControl); +// If I > -1 Then +// FControls.Delete(I); +//end; + + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfmonths.pas b/components/jvcllaz/run/JvTimeFramework/jvtfmonths.pas new file mode 100644 index 000000000..236f49dbd --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfmonths.pas @@ -0,0 +1,611 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFMonths.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFMonths; + +{$mode objfpc}{$H+} +//{$mode delphi} + +interface + +uses + LCLIntf, LCLType, LMessages, + SysUtils, Classes, Graphics, Controls, Forms, Dialogs, + JvTFGlance, JvTFUtils, JvTFManager; + +type + TJvTFMonthsScrollSize = (mssMonth, mssWeek); + + TJvTFMonths = class(TJvTFCustomGlance) + private + FDisplayDate: TDate; + FDWNames: TJvTFDWNames; + FDWTitleAttr: TJvTFGlanceTitle; + FOnDrawDWTitle: TJvTFDrawDWTitleEvent; + FOnUpdateTitle: TJvTFUpdateTitleEvent; + FOffDays: TTFDaysOfWeek; + FExtraDayCellAttr: TJvTFGlanceCellAttr; + FOffDayCellAttr: TJvTFGlanceCellAttr; + FScrollSize: TJvTFMonthsScrollSize; + FSplitSatSun: Boolean; + FDayFormat: string; + FFirstDayOfMonthFormat: string; + function GetMonth: Word; + procedure SetMonth(Value: Word); + function GetYear: Word; + procedure SetYear(Value: Word); + procedure SetDisplayDate(Value: TDate); + procedure SetDWNames(Value: TJvTFDWNames); + procedure SetDWTitleAttr(Value: TJvTFGlanceTitle); + procedure SetOffDays(Value: TTFDaysOfWeek); + procedure SetExtraDayCellAttr(Value: TJvTFGlanceCellAttr); + procedure SetOffDayCellAttr(Value: TJvTFGlanceCellAttr); + procedure SetSplitSatSun(Value: Boolean); + procedure SetDayFormat(const Value: string); + procedure SetFirstDayOfMonthFormat(const Value: string); + protected + procedure SetStartOfWeek(Value: TTFDayOfWeek); override; + procedure SetColCount(Value: Integer); override; + procedure ConfigCells; override; + procedure DWNamesChange(Sender: TObject); + procedure Navigate(AControl: TJvTFControl; ASchedNames: TStringList; + Dates: TJvTFDateList); override; + // draws the DWTitles + procedure DrawTitle(ACanvas: TCanvas); override; + procedure UpdateTitle; + procedure NextMonth; + procedure PrevMonth; + procedure NextWeek; + procedure PrevWeek; + function GetCellTitleText(Cell: TJvTFGlanceCell): string; override; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + function GetDataTop: Integer; override; + function GetCellAttr(ACell: TJvTFGlanceCell): TJvTFGlanceCellAttr; override; + function CellIsExtraDay(ACell: TJvTFGlanceCell): Boolean; + function CellIsOffDay(ACell: TJvTFGlanceCell): Boolean; + function DOWShowing(DOW: TTFDayOfWeek): Boolean; + procedure ScrollPrev; + procedure ScrollNext; + published + property ScrollSize: TJvTFMonthsScrollSize read FScrollSize write FScrollSize default mssMonth; + property Month: Word read GetMonth write SetMonth; + property Year: Word read GetYear write SetYear; + property DisplayDate: TDate read FDisplayDate write SetDisplayDate; + property DWNames: TJvTFDWNames read FDWNames write SetDWNames; + property DWTitleAttr: TJvTFGlanceTitle read FDWTitleAttr write SetDWTitleAttr; + property OffDays: TTFDaysOfWeek read FOffDays write SetOffDays default [dowSunday, dowSaturday]; + property ExtraDayCellAttr: TJvTFGlanceCellAttr read FExtraDayCellAttr write SetExtraDayCellAttr; + property OffDayCellAttr: TJvTFGlanceCellAttr read FOffDayCellAttr write SetOffDayCellAttr; + property SplitSatSun: Boolean read FSplitSatSun write SetSplitSatSun default False; + property OnDrawDWTitle: TJvTFDrawDWTitleEvent read FOnDrawDWTitle write FOnDrawDWTitle; + property OnUpdateTitle: TJvTFUpdateTitleEvent read FOnUpdateTitle write FOnUpdateTitle; + property StartOfWeek; + property ColCount; + property FirstDayOfMonthFormat: string read FFirstDayOfMonthFormat write SetFirstDayOfMonthFormat; + property DayFormat: string read FDayFormat write SetDayFormat; +// property Navigator; +// property OnNavigate; + end; + + +implementation + +uses + DateUtils; + +constructor TJvTFMonths.Create(AOwner: TComponent); +begin + inherited Create(AOwner); + DisplayDate := Date; + + FOffDays := [dowSunday, dowSaturday]; + FScrollSize := mssMonth; + + FDWNames := TJvTFDWNames.Create; + FDWNames.OnChange := @DWNamesChange; + + FExtraDayCellAttr := TJvTFGlanceCellAttr.Create(Self); + FOffDayCellAttr := TJvTFGlanceCellAttr.Create(Self); + + CellAttr.TitleAttr.Color := clWhite; + FExtraDayCellAttr.TitleAttr.Color := clWhite; + FOffDayCellAttr.TitleAttr.Color := clWhite; + + FDayFormat := 'd'; + FFirstDayOfMonthFormat := 'mmm d'; + + FDWTitleAttr := TJvTFGlanceTitle.Create(Self); + with FDWTitleAttr do + begin +// Assign(TitleAttr); + TxtAttr.Font.Size := 8; + TxtAttr.Font.Style := []; + Height := 20; + Visible := True; + FrameAttr.Style := fs3DRaised; + OnChange := @GlanceTitleChange; + end; +end; + +destructor TJvTFMonths.Destroy; +begin + FDWNames.OnChange := nil; + FDWNames.Free; + FDWTitleAttr.Free; + FExtraDayCellAttr.Free; + FOffDayCellAttr.Free; + + inherited Destroy; +end; + +function TJvTFMonths.CellIsExtraDay(ACell: TJvTFGlanceCell): Boolean; +var + Y, M, D: Word; +begin + DecodeDate(ACell.CellDate, Y, M, D); + Result := (Y <> Self.Year) or (M <> Self.Month); +end; + +function TJvTFMonths.CellIsOffDay(ACell: TJvTFGlanceCell): Boolean; +begin + Result := DateToDOW(ACell.CellDate) in OffDays +end; + +procedure TJvTFMonths.ConfigCells; +var + Row, Col, SplitCount: Integer; + Cell: TJvTFGlanceCell; +begin +(* + For Row := 0 to RowCount - 1 do + For Col := 0 to ColCount - 1 do + begin + Cell := Cells.Cells[Col, Row]; + if SplitSatSun and (DateToDow(Cell.CellDate) = dowSaturday) Then + SplitCell(Cell) + else + Cell.Combine; + end; + +{ + Found := False; + Col := 0; + While (Col < ColCount) and not Found do + if DateToDOW(Cells.Cells[Col, 0].CellDate) = dowSaturday Then + Found := True + else + Inc(Col); + + if Found Then + For Row := 0 to RowCount - 1 do + if SplitSatSun Then + SplitCell(Cells.Cells[Col, Row]) + else + Cells.Cells[Col, Row].Combine; +} +*) + + for Row := 0 to RowCount - 1 do + begin + SplitCount := 0; + + for Col := 0 to ColCount - 1 do + begin + Cell := Cells.Cells[Col, Row]; + SetCellDate(Cell, OriginDate + Row * 7 + Col + SplitCount); + + if SplitSatSun and (DateToDOW(Cell.CellDate) = dowSaturday) then + SplitCell(Cell) + else + CombineCell(Cell); + + if Cell.IsSplit then + begin + Inc(SplitCount); + SetCellDate(Cell.SubCell, OriginDate + Row * 7 + Col + SplitCount); + end; + end; + end; + + inherited ConfigCells; +end; + +function TJvTFMonths.DOWShowing(DOW: TTFDayOfWeek): Boolean; +var + I: Integer; + TestDOW: TTFDayOfWeek; +begin + // THIS ROUTINE SUPPORTS ONLY SAT/SUN SPLITS + if (DOW = dowSunday) and SplitSatSun then + Result := DOWShowing(dowSaturday) + else + begin + I := 0; + Result := False; + TestDOW := StartOfWeek; + while (I < ColCount) and not Result do + if TestDOW = DOW then + Result := True + else + IncDOW(TestDOW, 1); + end; +end; + +procedure TJvTFMonths.DrawTitle(ACanvas: TCanvas); +var + I, Col, LineBottom: Integer; + CurrDOW: TTFDayOfWeek; + R, TempRect, TxtRect, TextBounds: TRect; + OldPen: TPen; + OldBrush: TBrush; + OldFont: TFont; + Txt: string; +begin + inherited DrawTitle(ACanvas); + if not DWTitleAttr.Visible then + Exit; + + with ACanvas do + begin + OldPen := TPen.Create; + OldPen.Assign(Pen); + OldBrush := TBrush.Create; + OldBrush.Assign(Brush); + OldFont := TFont.Create; + OldFont.Assign(Font); + end; + + // draw the DWTitles + R.Top := inherited GetDataTop; + R.Bottom := GetDataTop; + + CurrDOW := StartOfWeek; + + for Col := 0 to ColCount - 1 do + begin + TempRect := WholeCellRect(Col, 0); + R.Left := TempRect.Left; + R.Right := TempRect.Right; + TxtRect := R; + InflateRect(TxtRect, -1, -1); + + with ACanvas do + begin + Brush.Color := DWTitleAttr.Color; + FillRect(R); + + case DWTitleAttr.FrameAttr.Style of + fs3DRaised: + Draw3DFrame(ACanvas, R, clBtnHighlight, clBtnShadow); + fs3DLowered: + Draw3DFrame(ACanvas, R, clBtnShadow, clBtnHighlight); + fsFlat: + begin + Pen.Color := DWTitleAttr.FrameAttr.Color; + Pen.Width := DWTitleAttr.FrameAttr.Width; + if Col = 0 then + begin + MoveTo(R.Left, R.Top); + LineTo(R.Left, R.Bottom); + end; + PolyLine([Point(R.Right - 1, R.Top), + Point(R.Right - 1, R.Bottom - 1), + Point(R.Left - 1, R.Bottom - 1)]); + end; + fsNone: + begin + Pen.Color := DWTitleAttr.FrameAttr.Color; + Pen.Width := 1; + LineBottom := R.Bottom - 1; + for I := 1 to DWTitleAttr.FrameAttr.Width do + begin + MoveTo(R.Left, LineBottom); + LineTo(R.Right, LineBottom); + Dec(LineBottom); + end; + end; + end; + + Txt := DWNames.GetDWName(DOWToBorl(CurrDOW)); + if SplitSatSun and (CurrDOW = dowSaturday) then + begin + IncDOW(CurrDOW, 1); + Txt := Txt + '/' + DWNames.GetDWName(DOWToBorl(CurrDOW)); + end; + + Font := DWTitleAttr.TxtAttr.Font; + DrawAngleText(ACanvas, TxtRect, TextBounds, + DWTitleAttr.TxtAttr.Rotation, + DWTitleAttr.TxtAttr.AlignH, + DWTitleAttr.TxtAttr.AlignV, Txt); + end; + + if Assigned(FOnDrawDWTitle) then + FOnDrawDWTitle(Self, ACanvas, R, CurrDOW, Txt); + + IncDOW(CurrDOW, 1); + end; + + with ACanvas do + begin + Pen.Assign(OldPen); + Brush.Assign(OldBrush); + Font.Assign(OldFont); + OldPen.Free; + OldBrush.Free; + OldFont.Free; + end; +end; + +procedure TJvTFMonths.DWNamesChange(Sender: TObject); +begin + Invalidate; +end; + +function TJvTFMonths.GetCellAttr(ACell: TJvTFGlanceCell): TJvTFGlanceCellAttr; +begin + if CellIsSelected(ACell) then + Result := SelCellAttr + else + if CellIsExtraDay(ACell) then + Result := ExtraDayCellAttr + else + if CellIsOffDay(ACell) then + Result := OffDayCellAttr + else + Result := CellAttr; +end; + +function TJvTFMonths.GetCellTitleText(Cell: TJvTFGlanceCell): string; +begin + if CellIsExtraDay(Cell) and (IsFirstOfMonth(Cell.CellDate) or EqualDates(Cell.CellDate, OriginDate)) then + Result := FormatDateTime(FirstDayOfMonthFormat, Cell.CellDate) + else + Result := FormatDateTime(DayFormat, Cell.CellDate); +end; + +function TJvTFMonths.GetDataTop: Integer; +begin + Result := inherited GetDataTop; + if DWTitleAttr.Visible then + Inc(Result, DWTitleAttr.Height); +end; + +function TJvTFMonths.GetMonth: Word; +begin + Result := ExtractMonth(DisplayDate); +end; + +function TJvTFMonths.GetYear: Word; +begin + Result := ExtractYear(DisplayDate); +end; + +procedure TJvTFMonths.Navigate(AControl: TJvTFControl; + ASchedNames: TStringList; Dates: TJvTFDateList); +begin + inherited Navigate(AControl, ASchedNames, Dates); + if Dates.Count > 0 then + DisplayDate := Dates[0]; +end; + +procedure TJvTFMonths.NextMonth; +var + Temp: TDateTime; +begin + Temp := DisplayDate; + IncMonths(Temp, 1); + DisplayDate := Temp; +end; + +procedure TJvTFMonths.NextWeek; +var + Temp: TDateTime; +begin + Temp := DisplayDate; + IncWeeks(Temp, 1); + DisplayDate := Temp; +end; + +procedure TJvTFMonths.PrevMonth; +var + Temp: TDateTime; +begin + Temp := DisplayDate; + IncMonths(Temp, -1); + DisplayDate := Temp; +end; + +procedure TJvTFMonths.PrevWeek; +var + Temp: TDateTime; +begin + Temp := DisplayDate; + IncWeeks(Temp, -1); + DisplayDate := Temp; +end; + +procedure TJvTFMonths.ScrollNext; +begin + if ScrollSize = mssMonth then + NextMonth + else + NextWeek; +end; + +procedure TJvTFMonths.ScrollPrev; +begin + if ScrollSize = mssMonth then + PrevMonth + else + PrevWeek; +end; + +procedure TJvTFMonths.SetColCount(Value: Integer); +begin + Value := Lesser(Value, 7); + inherited SetColCount(Value); +end; + +procedure TJvTFMonths.SetDayFormat(const Value: string); +begin + if Value <> FDayFormat then + begin + FDayFormat := Value; + Invalidate; + end; +end; + +procedure TJvTFMonths.SetDisplayDate(Value: TDate); +begin + FDisplayDate := Value; + if ScrollSize = mssMonth then + StartDate := FirstOfMonth(Value) + else + StartDate := Value; + UpdateTitle; +end; + +procedure TJvTFMonths.SetDWNames(Value: TJvTFDWNames); +begin + FDWNames.Assign(Value); +end; + +procedure TJvTFMonths.SetDWTitleAttr(Value: TJvTFGlanceTitle); +begin + FDWTitleAttr.Assign(Value); +end; + +procedure TJvTFMonths.SetExtraDayCellAttr(Value: TJvTFGlanceCellAttr); +begin + FExtraDayCellAttr.Assign(Value); +end; + +procedure TJvTFMonths.SetFirstDayOfMonthFormat(const Value: string); +begin + if Value <> FFirstDayOfMonthFormat then + begin + FFirstDayOfMonthFormat := Value; + Invalidate; + end; +end; + +procedure TJvTFMonths.SetMonth(Value: Word); +var + Y, M, D: Word; +begin + // Don't set the month while loading, the DisplayDate will be loaded as well + if csLoading in ComponentState then + Exit; + + EnsureMonth(Value); + + DecodeDate(DisplayDate, Y, M, D); + if Value <> M then + begin + // Ensure the day is still inside the valid values for the new month + if D > DaysInAMonth(Y, Value) then + D := DaysInAMonth(Y, Value); + DisplayDate := EncodeDate(Y, Value, D); + end; +end; + +procedure TJvTFMonths.SetOffDayCellAttr(Value: TJvTFGlanceCellAttr); +begin + FOffDayCellAttr.Assign(Value); +end; + +procedure TJvTFMonths.SetOffDays(Value: TTFDaysOfWeek); +begin + if Value <> FOffDays then + begin + FOffDays := Value; + Invalidate; + end; +end; + +procedure TJvTFMonths.SetSplitSatSun(Value: Boolean); +begin + if Value <> FSplitSatSun then + begin + if DOWShowing(dowSunday) or DOWShowing(dowSaturday) then + if Value then + begin + if StartOfWeek = dowSunday then + StartOfWeek := dowMonday; + ColCount := ColCount - 1; + end + else + ColCount := ColCount + 1; + + FSplitSatSun := Value; + Cells.ReconfigCells; + end; +end; + +procedure TJvTFMonths.SetStartOfWeek(Value: TTFDayOfWeek); +begin + if SplitSatSun and (Value = dowSunday) then + Value := dowSaturday; + inherited SetStartOfWeek(Value); +end; + +procedure TJvTFMonths.SetYear(Value: Word); +var + Y, M, D: Word; +begin + // Don't set the year while loading, the DisplayDate will be loaded as well + if csLoading in ComponentState then + Exit; + + DecodeDate(DisplayDate, Y, M, D); + if Value <> Y then + begin + // Ensure the day is still inside the valid values for the month of + // the new year. This case only happens with February, by the way. + if D > DaysInAMonth(Value, M) then + D := DaysInAMonth(Value, M); + DisplayDate := EncodeDate(Value, M, D); + end; +end; + +procedure TJvTFMonths.UpdateTitle; +var + NewTitle: string; +begin + NewTitle := FormatDateTime('mmmm yyyy', DisplayDate); + if NewTitle <> TitleAttr.Title then + begin + if Assigned(FOnUpdateTitle) then + FOnUpdateTitle(Self, NewTitle); + TitleAttr.Title := NewTitle; + end; +end; + + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfsparsematrix.pas b/components/jvcllaz/run/JvTimeFramework/jvtfsparsematrix.pas new file mode 100644 index 000000000..a9402f30f --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfsparsematrix.pas @@ -0,0 +1,269 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFSparseMatrix.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFSparseMatrix; + +{$mode objfpc}{$H+} + +interface + +uses + Classes, SysUtils; + +type +// NativeInt = Integer; + + EJvTFSparseMatrixError = class(Exception); + PSMQuantum = ^TSMQuantum; + TSMQuantum = record + Index: Integer; + Data: NativeInt; + Link: PSMQuantum; + end; + + TJvTFSparseMatrix = class(TObject) + private + FMatrix: TSMQuantum; + FNullValue: NativeInt; + procedure SetNullValue(Value: NativeInt); + function GetData(Row, Col: Integer): NativeInt; + procedure SetData(Row, Col: Integer; Value: NativeInt); + procedure Put(Row, Col: Integer; Data: NativeInt); + function Get(Row, Col: Integer): NativeInt; + function FindQuantum(Row, Col: Integer; + var Prev, Curr: PSMQuantum; var RowExists: Boolean): Boolean; + public + destructor Destroy; override; + procedure Clear; + procedure Pack; + procedure CopyTo(DestMatrix: TJvTFSparseMatrix); + property Data[Row, Col: Integer]: NativeInt read GetData write SetData; default; + property NullValue: NativeInt read FNullValue write SetNullValue default 0; + procedure Dump(const DumpList: TStrings); + end; + + +implementation + +uses + JvResources; + +destructor TJvTFSparseMatrix.Destroy; +begin + Clear; + inherited Destroy; +end; + +procedure TJvTFSparseMatrix.Clear; +var + P, CurrRow, CurrCol: PSMQuantum; +begin + CurrRow := PSMQuantum(FMatrix.Data); + + while CurrRow <> nil do + begin + CurrCol := CurrRow^.Link; + while CurrCol <> nil do + begin + P := CurrCol; + CurrCol := CurrCol^.Link; + Dispose(P); + end; + + P := CurrRow; + CurrRow := PSMQuantum(CurrRow^.Data); + Dispose(P); + end; + + FMatrix.Data := 0; +end; + +procedure TJvTFSparseMatrix.CopyTo(DestMatrix: TJvTFSparseMatrix); +var + CurrRow, CurrCol: PSMQuantum; +begin + DestMatrix.Clear; + DestMatrix.NullValue := NullValue; + + CurrRow := PSMQuantum(FMatrix.Data); + + while CurrRow <> nil do + begin + CurrCol := CurrRow^.Link; + while CurrCol <> nil do + begin + DestMatrix[CurrRow^.Index, CurrCol^.Index] := CurrCol^.Data; + CurrCol := CurrCol^.Link; + end; + + CurrRow := PSMQuantum(CurrRow^.Data); + end; +end; + +procedure TJvTFSparseMatrix.Dump(const DumpList: TStrings); +var + CurrRow, CurrCol: PSMQuantum; +begin + DumpList.Clear; + CurrRow := PSMQuantum(FMatrix.Data); + DumpList.BeginUpdate; + try + while CurrRow <> nil do + begin + CurrCol := CurrRow^.Link; + while CurrCol <> nil do + begin + DumpList.Add('(' + IntToStr(CurrRow^.Index) + ', ' + + IntToStr(CurrCol^.Index) + ') ' + + IntToStr(CurrCol^.Data)); + CurrCol := CurrCol^.Link; + end; + CurrRow := PSMQuantum(CurrRow^.Data); + end; + finally + DumpList.EndUpdate; + end; +end; + +function TJvTFSparseMatrix.FindQuantum(Row, Col: Integer; + var Prev, Curr: PSMQuantum; var RowExists: Boolean): Boolean; +begin + Prev := @FMatrix; + Curr := PSMQuantum(FMatrix.Data); + Result := False; + RowExists := False; + + // Find Row Header + while (Curr <> nil) and (Curr^.Index < Row) do + begin + Prev := Curr; + Curr := PSMQuantum(Curr^.Data); + end; + + // If Row Header found, then find col + if (Curr <> nil) and (Curr^.Index = Row) then + begin + RowExists := True; + Prev := Curr; + Curr := Curr^.Link; + while (Curr <> nil) and (Curr^.Index < Col) do + begin + Prev := Curr; + Curr := Curr^.Link; + end; + + Result := (Curr <> nil) and (Curr^.Index = Col); + end; +end; + +function TJvTFSparseMatrix.Get(Row, Col: Integer): NativeInt; +var + Prev, Curr: PSMQuantum; + RowExists: Boolean; +begin + if FindQuantum(Row, Col, Prev, Curr, RowExists) then + Result := Curr^.Data + else + Result := NullValue; +end; + +function TJvTFSparseMatrix.GetData(Row, Col: Integer): NativeInt; +begin + Result := Get(Row, Col); +end; + +procedure TJvTFSparseMatrix.Put(Row, Col: Integer; Data: NativeInt); +var + P, Prev, Curr: PSMQuantum; + RowExists: Boolean; +begin + if FindQuantum(Row, Col, Prev, Curr, RowExists) then + if Data <> NullValue then + Curr^.Data := Data + else + begin + Prev^.Link := Curr^.Link; + Dispose(Curr); + end + else + if Data <> NullValue then + begin + if not RowExists then + begin + New(P); + P^.Index := Row; + P^.Link := nil; + P^.Data := Prev^.Data; + PSMQuantum(Prev^.Data) := P; + Prev := P; + end; + + New(P); + P^.Index := Col; + P^.Data := Data; + P^.Link := Prev^.Link; + Prev^.Link := P; + end; +end; + +procedure TJvTFSparseMatrix.SetData(Row, Col: Integer; Value: NativeInt); +begin + Put(Row, Col, Value); +end; + +procedure TJvTFSparseMatrix.SetNullValue(Value: NativeInt); +begin + if FMatrix.Data = 0 then + FNullValue := Value + else + raise EJvTFSparseMatrixError.CreateRes(@RsEMatrixMustBeEmpty); +end; + +procedure TJvTFSparseMatrix.Pack; +var + P, Prev, CurrRow: PSMQuantum; +begin + CurrRow := PSMQuantum(FMatrix.Data); + Prev := @FMatrix; + + while CurrRow <> nil do + begin + if CurrRow^.Link <> nil then + begin + Prev := CurrRow; + CurrRow := PSMQuantum(CurrRow^.Data); + end + else + begin + P := CurrRow; + Prev^.Data := CurrRow^.Data; + Dispose(P); + CurrRow := PSMQuantum(Prev^.Data); + end; + end; +end; + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfutils.pas b/components/jvcllaz/run/JvTimeFramework/jvtfutils.pas new file mode 100644 index 000000000..b6bb036c6 --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfutils.pas @@ -0,0 +1,827 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFUtils.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFUtils; + +{$mode objfpc}{$H+} + +interface + +uses + //Windows, + LCLType, LCLIntf, Types, + Graphics, Controls, Classes, SysUtils; + +(* +{$IFNDEF COMPILER12_UP} // Delphi 2009 knows System::TDate and System::TTime +{$HPPEMIT '#ifndef TDate'} +{$HPPEMIT '#define TDate Controls::TDate'} +{$HPPEMIT '#define TTime Controls::TTime'} +{$HPPEMIT '#endif'} +{$ENDIF ~COMPILER12_UP} +*) + +type + TJvTFVisibleScrollBars = set of (vsbHorz, vsbVert); + EJvTFDateError = class(Exception); + + TTFDayOfWeek = (dowSunday, dowMonday, dowTuesday, dowWednesday, + dowThursday, dowFriday, dowSaturday); + TTFDaysOfWeek = set of TTFDayOfWeek; + + TJvTFVAlignment = (vaTop, vaCenter, vaBottom); + + TJvTFDirection = (dirUp, dirDown, dirLeft, dirRight); + +const + DOW_WEEK: TTFDaysOfWeek = [dowSunday..dowSaturday]; + DOW_WEEKEND: TTFDaysOfWeek = [dowSunday, dowSaturday]; + DOW_WORKWEEK: TTFDaysOfWeek = [dowMonday..dowFriday]; + + ONE_HOUR = 1 / 24; + ONE_MINUTE = ONE_HOUR / 60; + ONE_SECOND = ONE_MINUTE / 60; + ONE_MILLISECOND = ONE_SECOND / 1000; + +function ExtractYear(ADate: TDateTime): Word; +function ExtractMonth(ADate: TDateTime): Word; +function ExtractDay(ADate: TDateTime): Word; +function ExtractHours(ATime: TDateTime): Word; +function ExtractMins(ATime: TDateTime): Word; +function ExtractSecs(ATime: TDateTime): Word; +function ExtractMSecs(ATime: TDateTime): Word; +function FirstOfMonth(ADate: TDateTime): TDateTime; +function GetDayOfNthDOW(Year, Month, DOW, N: Word): Word; +function GetWeeksInMonth(Year, Month: Word; StartOfWeek: Integer): Word; + +procedure IncBorlDOW(var BorlDOW: Integer; N: Integer = 1); +procedure IncDOW(var DOW: TTFDayOfWeek; N: Integer = 1); +procedure IncDays(var ADate: TDateTime; N: Integer = 1); +procedure IncWeeks(var ADate: TDateTime; N: Integer = 1); +procedure IncMonths(var ADate: TDateTime; N: Integer = 1); +procedure IncYears(var ADate: TDateTime; N: Integer = 1); + +function EndOfMonth(ADate: TDateTime): TDateTime; +function IsFirstOfMonth(ADate: TDateTime): Boolean; +function IsEndOfMonth(ADate: TDateTime): Boolean; +procedure EnsureMonth(Month: Word); +procedure EnsureDOW(DOW: Word); +function EqualDates(D1, D2: TDateTime): Boolean; +function Lesser(N1, N2: Integer): Integer; +function Greater(N1, N2: Integer): Integer; +function GetDivLength(TotalLength, DivCount, DivNum: Integer): Integer; +function GetDivNum(TotalLength, DivCount, X: Integer): Integer; +function GetDivStart(TotalLength, DivCount, DivNum: Integer): Integer; +function DOWToBorl(ADOW: TTFDayOfWeek): Integer; +function BorlToDOW(BorlDOW: Integer): TTFDayOfWeek; +function DateToDOW(ADate: TDateTime): TTFDayOfWeek; + +procedure CalcTextPos(ACanvas: TCanvas; + HostRect: TRect; var TextLeft, TextTop: Integer; + var TextBounds: TRect; AFont: TFont; AAngle: Integer; + HAlign: TAlignment; VAlign: TJvTFVAlignment; ATxt: String); +{ +procedure CalcTextPos(HostRect: TRect; var TextLeft, TextTop: Integer; + var TextBounds: TRect; AFont: TFont; AAngle: Integer; + HAlign: TAlignment; VAlign: TJvTFVAlignment; ATxt: string); +} +procedure DrawAngleText(ACanvas: TCanvas; HostRect: TRect; + var TextBounds: TRect; AAngle: Integer; HAlign: TAlignment; + VAlign: TJvTFVAlignment; ATxt: string); + +function RectWidth(ARect: TRect): Integer; +function RectHeight(ARect: TRect): Integer; +function EmptyRect: TRect; +function IsClassByName(Obj: TObject; ClassName: string): Boolean; + +function StringsToStr(const List: TStrings; const Sep: string; + const AllowEmptyString: Boolean = True): string; + +implementation + +uses + Math, JvResources; + +function ExtractYear(ADate: TDateTime): Word; +var + M, D: Word; +begin + DecodeDate(ADate, Result, M, D); +end; + +function ExtractMonth(ADate: TDateTime): Word; +var + Y, D: Word; +begin + DecodeDate(ADate, Y, Result, D); +end; + +function ExtractDay(ADate: TDateTime): Word; +var + Y, M: Word; +begin + DecodeDate(ADate, Y, M, Result); +end; + +function FirstOfMonth(ADate: TDateTime): TDateTime; +var + Y, M, D: Word; +begin + DecodeDate(ADate, Y, M, D); + Result := EncodeDate(Y, M, 1); +end; + +function GetDayOfNthDOW(Year, Month, DOW, N: Word): Word; +var + FirstDayDOW: Word; + WorkDate: TDateTime; +begin + WorkDate := EncodeDate(Year, Month, 1); + FirstDayDOW := DayOfWeek(WorkDate); + WorkDate := WorkDate + (DOW - FirstDayDOW); + if DOW < FirstDayDOW then + WorkDate := WorkDate + 7; + + // WorkDate is now at the first DOW + // Now adjust for N + WorkDate := WorkDate + (7 * (N - 1)); + + Result := ExtractDay(WorkDate); + // Finally, check to make sure WorkDate is in the given month + if Trunc(EncodeDate(Year, Month, 1)) <> Trunc(FirstOfMonth(WorkDate)) then + raise EJvTFDateError.CreateRes(@RsEResultDoesNotFallInMonth); +end; + +function GetWeeksInMonth(Year, Month: Word; StartOfWeek: Integer): Word; +var + DOW, + EndOfWeek: Integer; + EOM, + WorkDate: TDateTime; +begin + // Get the end of the week + EndOfWeek := StartOfWeek; + IncBorlDOW(EndOfWeek, -1); + + // Start working at the first of the month + WorkDate := EncodeDate(Year, Month, 1); + + // Get the end of the month + EOM := EndOfMonth(WorkDate); + + // Get the day the first falls on + DOW := DayOfWeek(WorkDate); + + // Advance WorkDate to the end of the week + while DOW <> EndOfWeek do + begin + IncBorlDOW(DOW, 1); + WorkDate := WorkDate + 1; + end; + + // We're now on week 1 + Result := 1; + // Now roll through the rest of the month + while Trunc(WorkDate) < Trunc(EOM) do + begin + Inc(Result); + IncWeeks(WorkDate, 1); + end; +end; + +procedure IncBorlDOW(var BorlDOW: Integer; N: Integer); // N defaults to 1 +begin + BorlDOW := (BorlDOW + (N mod 7)) mod 7; + if BorlDOW = 0 then + BorlDOW := 7; + BorlDOW := Abs(BorlDOW); +end; + +procedure IncDOW(var DOW: TTFDayOfWeek; N: Integer); + // N defaults to 1 +var + BorlDOW: Integer; +begin + BorlDOW := DOWToBorl(DOW); + IncBorlDOW(BorlDOW, N); + DOW := BorlToDOW(BorlDOW); +end; + +procedure IncDays(var ADate: TDateTime; N: Integer); + // N defaults to 1 +begin + ADate := ADate + N; +end; + +procedure IncWeeks(var ADate: TDateTime; N: Integer); + // N defaults to 1 +begin + ADate := ADate + N * 7; +end; + +procedure IncMonths(var ADate: TDateTime; N: Integer); + // N defaults to 1 +var + Y, M, D, EOMD: Word; + X : Cardinal; +begin + DecodeDate(ADate, Y, M, D); + X := ((Y * 12) + M - 1 + N); + Y := X div 12; + M := (X mod 12) + 1; + + // Be careful not to get invalid date in Feb. + if M = 2 then + begin + EOMD := ExtractDay(EndOfMonth(EncodeDate(Y, M, 1))); + if D > EOMD then + D := EOMD; + end; + + ADate := EncodeDate(Y, M, D); +end; + +procedure IncYears(var ADate: TDateTime; N: Integer); + // N defaults to 1 +var + Y, M, D, EOMD: Word; +begin + DecodeDate(ADate, Y, M, D); + Inc(Y, N); + + // Be careful not to get invalid date in Feb. + if M = 2 then + begin + EOMD := ExtractDay(EndOfMonth(EncodeDate(Y, M, 1))); + if D > EOMD then + D := EOMD; + end; + + ADate := EncodeDate(Y, M, D); +end; + +function EndOfMonth(ADate: TDateTime): TDateTime; +var + Y, M, D: Word; +begin + DecodeDate(ADate, Y, M, D); + Inc(M); + if M > 12 then + begin + M := 1; + Inc(Y); + end; + Result := EncodeDate(Y, M, 1) - 1; +end; + +function IsFirstOfMonth(ADate: TDateTime): Boolean; +var + Y, M, D: Word; +begin + DecodeDate(ADate, Y, M, D); + Result := D = 1; +end; + +function IsEndOfMonth(ADate: TDateTime): Boolean; +begin + Result := EqualDates(ADate, EndOfMonth(ADate)); +end; + +procedure EnsureMonth(Month: Word); +begin + if (Month < 1) or (Month > 12) then + raise EJvTFDateError.CreateResFmt(@RsEInvalidMonthValue, [Month]); +end; + +procedure EnsureDOW(DOW: Word); +begin + if (DOW < 1) or (DOW > 7) then + raise EJvTFDateError.CreateResFmt(@RsEInvalidDayOfWeekValue, [DOW]); +end; + +function EqualDates(D1, D2: TDateTime): Boolean; +begin + Result := Trunc(D1) = Trunc(D2); +end; + +function ExtractHours(ATime: TDateTime): Word; +var + M, S, MS: Word; +begin + DecodeTime(ATime, Result, M, S, MS); +end; + +function ExtractMins(ATime: TDateTime): Word; +var + H, S, MS: Word; +begin + DecodeTime(ATime, H, Result, S, MS); +end; + +function ExtractSecs(ATime: TDateTime): Word; +var + H, M, MS: Word; +begin + DecodeTime(ATime, H, M, Result, MS); +end; + +function ExtractMSecs(ATime: TDateTime): Word; +var + H, M, S: Word; +begin + DecodeTime(ATime, H, M, S, Result); +end; + +function Lesser(N1, N2: Integer): Integer; +begin + if N1 < N2 then + Result := N1 + else + Result := N2; +end; + +function Greater(N1, N2: Integer): Integer; +begin + if N1 > N2 then + Result := N1 + else + Result := N2; +end; + +function GetDivLength(TotalLength, DivCount, DivNum: Integer): Integer; +begin + if (DivNum < 0) or (DivNum >= DivCount) then + Result := -1 + else + begin + Result := TotalLength div DivCount; + if DivNum < TotalLength mod DivCount then + Inc(Result); + end; +end; + +function GetDivNum(TotalLength, DivCount, X: Integer): Integer; +var + Base, + MakeUp, + MakeUpWidth: Integer; +begin + if (X < 0) or (X >= TotalLength) then + Result := -1 + else + begin + Base := TotalLength div DivCount; + MakeUp := TotalLength mod DivCount; + MakeUpWidth := MakeUp * (Base + 1); + + if X < MakeUpWidth then + Result := X div (Base + 1) + else + Result := (X - MakeUpWidth) div Base + MakeUp; + end; +end; + +function GetDivStart(TotalLength, DivCount, DivNum: Integer): Integer; +var + Base, + MakeUp, + MakeUpWidth: Integer; +begin + if (DivNum < 0) or (DivNum >= DivCount) then + Result := -1 + else + begin + Base := TotalLength div DivCount; + MakeUp := TotalLength mod DivCount; + MakeUpWidth := MakeUp * (Base + 1); + + if DivNum <= MakeUp then + Result := DivNum * (Base + 1) + else + Result := (DivNum - MakeUp) * Base + MakeUpWidth; + end; +end; + +function DOWToBorl(ADOW: TTFDayOfWeek): Integer; +begin + Result := Ord(ADOW) + 1; +end; + +function BorlToDOW(BorlDOW: Integer): TTFDayOfWeek; +begin + Result := TTFDayOfWeek(BorlDOW - 1); +end; + +function DateToDOW(ADate: TDateTime): TTFDayOfWeek; +var + BorlDOW: Integer; +begin + BorlDOW := DayOfWeek(ADate); + Result := BorlToDOW(BorlDOW); +end; + +procedure CalcTextPos(ACanvas: TCanvas; HostRect: TRect; var TextLeft, TextTop: Integer; + var TextBounds: TRect; AFont: TFont; AAngle: Integer; + HAlign: TAlignment; VAlign: TJvTFVAlignment; ATxt: String); +var + sinAngle, cosAngle: Extended; + size: TSize; + X, Y: Integer; + A, B, C, D: Integer; + lb, lt, rb, rt: TPoint; +begin + SinCos(AAngle * pi / 18000, sinAngle, cosAngle); + ACanvas.Font := AFont; + size := ACanvas.TextExtent(ATxt); + + X := 0; + Y := 0; + + if AAngle <= 90 then + begin { 1.Quadrant } + X := 0; + Y := Trunc(size.cx * sinAngle); +// Y := Trunc(Size.cx * Sin(AAngle * Pi / 180)); + end + else + if AAngle <= 180 then + begin { 2.Quadrant } + X := Trunc(size.cx * -cosAngle); +// X := Trunc(Size.cx * -Cos(AAngle * Pi / 180)); + Y := Trunc(size.cx * sinAngle + size.cy * -cosAngle); +// Y := Trunc(Size.cx * Sin(AAngle * Pi / 180) + Size.cy * Cos((180 - AAngle) * Pi / 180)); + end + else + if AAngle <= 270 then + begin { 3.Quadrant } + X := Trunc(size.cx * -cosAngle + size.cy * -sinAngle); +// X := Trunc(Size.cx * -Cos(AAngle * Pi / 180) + Size.cy * Sin((AAngle - 180) * Pi / 180)); + Y := Trunc(Size.cy * -cosAngle); +// Y := Trunc(Size.cy * Sin((270 - AAngle) * Pi / 180)); + end + else + if AAngle <= 360 then + begin { 4.Quadrant } + X := Trunc(size.cy * -sinAngle); +// X := Trunc(Size.cy * Sin((360 - AAngle) * Pi / 180)); + Y := 0; + end; + + TextLeft := HostRect.Left + X; + TextTop := HostRect.Top + Y; + //ARect.Top := ARect.Top + Y; + //ARect.Left := ARect.Left + X; + + X := Abs(Trunc(size.cx * cosAngle)) + Abs(Trunc(size.cy * sinAngle)); +// X := Abs(Trunc(Size.cx * Cos(AAngle * Pi / 180))) + Abs(Trunc(Size.cy * Sin(AAngle * Pi / 180))); + Y := Abs(Trunc(size.cx * sinAngle)) + Abs(Trunc(size.cy * cosAngle)); +// Y := Abs(Trunc(Size.cx * Sin(AAngle * Pi / 180))) + Abs(Trunc(Size.cy * Cos(AAngle * Pi / 180))); + + case HAlign of + taCenter: + //ARect.Left := ARect.Left + ((RectWidth(SaveRect) - X) div 2); + TextLeft := TextLeft + ((RectWidth(HostRect) - X) div 2); + taRightJustify: + //ARect.Left := ARect.Left + RectWidth(SaveRect) - X; + TextLeft := TextLeft + RectWidth(HostRect) - X; + end; + + case VAlign of + vaCenter: + //ARect.Top := ARect.Top + ((RectHeight(SaveRect) - Y) div 2); + TextTop := TextTop + ((RectHeight(HostRect) - Y) div 2); + vaBottom: + //ARect.Top := ARect.Top + RectHeight(SaveRect) - Y; + TextTop := TextTop + RectHeight(HostRect) - Y; + end; + + //ARect.Right := ARect.Left + X; + //ARect.Bottom := ARect.Top + Y; +//******************************************** +// calculate the border areas + + A := Trunc(size.cy * sinAngle); +// A := Trunc(size.cy * Sin(AAngle * Pi / 180)); + B := Trunc(size.cy * cosAngle); +// B := Trunc(size.cy * Cos(AAngle * Pi / 180)); + C := Trunc(size.cx * cosAngle); +// C := Trunc(size.cx * Cos(AAngle * Pi / 180)); + D := Trunc(size.cx * sinAngle); +// D := Trunc(Size.cx * Sin(AAngle * Pi / 180)); + + //lt := ARect.TopLeft; + lt := Point(TextLeft, TextTop); + lb := lt; + lb.X := lb.X + A; + lb.Y := lb.Y + B; + rb := lb; + rb.X := rb.X + C; + rb.Y := rb.Y - D; + rt := rb; + rt.X := rt.X - A; + rt.Y := rt.Y - B; + + TextBounds.Left := Lesser(Lesser(lt.X, lb.X), Lesser(rb.X, rt.X)); + TextBounds.Right := Greater(Greater(lt.X, lb.X), Greater(rb.X, rt.X)); + TextBounds.Top := Lesser(Lesser(lt.Y, lb.Y), Lesser(rb.Y, rt.Y)); + TextBounds.Bottom := Greater(Greater(lt.Y, lb.Y), Greater(rb.Y, rt.Y)); +//********************************************************************************************* +end; + + (* +////////////////////////////////////////////////////////////////// +// Credit for the CalcTextPos routine goes to Joerg Lingner. // +// It comes from his JLLabel component (freeware - Torry's). // +// It is used here with his permission. Thanks Joerg! // +// He can be reached at jlingner att t-online dott de // +////////////////////////////////////////////////////////////////// + +procedure CalcTextPos(HostRect: TRect; var TextLeft, TextTop: Integer; + var TextBounds: TRect; AFont: TFont; AAngle: Integer; + HAlign: TAlignment; VAlign: TJvTFVAlignment; ATxt: string); +{==========================================================================} +{ Calculate text pos. depend. on: Font, Escapement, Alignment and length } +{--------------------------------------------------------------------------} +var + DC: HDC; + hSavFont: HFONT; + Size: TSize; + X, Y: Integer; + //cStr : array[0..255] of Char; + PTxt: PChar; + A, B, C, D: Integer; + lb, lt, rb, rt: TPoint; +begin + AAngle := AAngle div 10; + + PTxt := StrAlloc((Length(ATxt) + 4) * SizeOf(Char)); + StrPCopy(PTxt, ATxt); + + //StrPCopy(cStr, ATxt); + DC := GetDC(HWND_DESKTOP); + hSavFont := SelectObject(DC, AFont.Handle); + //GetTextExtentPoint32(DC, cStr, Length(ATxt), Size); + Windows.GetTextExtentPoint32(DC, PTxt, StrLen(PTxt), Size); + StrDispose(PTxt); + SelectObject(DC, hSavFont); + ReleaseDC(HWND_DESKTOP, DC); + + X := 0; + Y := 0; + + if AAngle <= 90 then + begin { 1.Quadrant } + X := 0; + Y := Trunc(Size.cx * Sin(AAngle * Pi / 180)); + end + else + if AAngle <= 180 then + begin { 2.Quadrant } + X := Trunc(Size.cx * -Cos(AAngle * Pi / 180)); + Y := Trunc(Size.cx * Sin(AAngle * Pi / 180) + Size.cy * Cos((180 - AAngle) * Pi / 180)); + end + else + if AAngle <= 270 then + begin { 3.Quadrant } + X := Trunc(Size.cx * -Cos(AAngle * Pi / 180) + Size.cy * Sin((AAngle - 180) * Pi / 180)); + Y := Trunc(Size.cy * Sin((270 - AAngle) * Pi / 180)); + end + else + if AAngle <= 360 then + begin { 4.Quadrant } + X := Trunc(Size.cy * Sin((360 - AAngle) * Pi / 180)); + Y := 0; + end; + + TextLeft := HostRect.Left + X; + TextTop := HostRect.Top + Y; + //ARect.Top := ARect.Top + Y; + //ARect.Left := ARect.Left + X; + + X := Abs(Trunc(Size.cx * Cos(AAngle * Pi / 180))) + Abs(Trunc(Size.cy * Sin(AAngle * Pi / 180))); + Y := Abs(Trunc(Size.cx * Sin(AAngle * Pi / 180))) + Abs(Trunc(Size.cy * Cos(AAngle * Pi / 180))); + + case HAlign of + taCenter: + //ARect.Left := ARect.Left + ((RectWidth(SaveRect) - X) div 2); + TextLeft := TextLeft + ((RectWidth(HostRect) - X) div 2); + taRightJustify: + //ARect.Left := ARect.Left + RectWidth(SaveRect) - X; + TextLeft := TextLeft + RectWidth(HostRect) - X; + end; + + case VAlign of + vaCenter: + //ARect.Top := ARect.Top + ((RectHeight(SaveRect) - Y) div 2); + TextTop := TextTop + ((RectHeight(HostRect) - Y) div 2); + vaBottom: + //ARect.Top := ARect.Top + RectHeight(SaveRect) - Y; + TextTop := TextTop + RectHeight(HostRect) - Y; + end; + + //ARect.Right := ARect.Left + X; + //ARect.Bottom := ARect.Top + Y; +//******************************************** +// calculate the border areas + + A := Trunc(Size.cy * Sin(AAngle * Pi / 180)); + B := Trunc(Size.cy * Cos(AAngle * Pi / 180)); + C := Trunc(Size.cx * Cos(AAngle * Pi / 180)); + D := Trunc(Size.cx * Sin(AAngle * Pi / 180)); + + //lt := ARect.TopLeft; + lt := Point(TextLeft, TextTop); + lb := lt; + lb.X := lb.X + A; + lb.Y := lb.Y + B; + rb := lb; + rb.X := rb.X + C; + rb.Y := rb.Y - D; + rt := rb; + rt.X := rt.X - A; + rt.Y := rt.Y - B; + + TextBounds.Left := Lesser(Lesser(lt.X, lb.X), Lesser(rb.X, rt.X)); + TextBounds.Right := Greater(Greater(lt.X, lb.X), Greater(rb.X, rt.X)); + TextBounds.Top := Lesser(Lesser(lt.Y, lb.Y), Lesser(rb.Y, rt.Y)); + TextBounds.Bottom := Greater(Greater(lt.Y, lb.Y), Greater(rb.Y, rt.Y)); +//********************************************************************************************* +end; *) + +procedure DrawAngleText(ACanvas: TCanvas; HostRect: TRect; + var TextBounds: TRect; AAngle: Integer; HAlign: TAlignment; + VAlign: TJvTFVAlignment; ATxt: string); +var +// LogFont: TLogFont; + TxtRect: TRect; + Flags: UINT; + PTxt: PChar; + ClipRgn: HRgn; + TextLeft, TextTop: Integer; + ts: TTextStyle; +begin + //TxtRect := ARect; + CalcTextPos(ACanvas, HostRect, TextLeft, TextTop, TextBounds, ACanvas.Font, + AAngle, HAlign, VAlign, ATxt); + + ACanvas.Font.Orientation := AAngle; + { + Windows.GetObject(ACanvas.Font.Handle, SizeOf(LogFont), @LogFont); + LogFont.lfEscapement := AAngle; + LogFont.lfOrientation := LogFont.lfEscapement; + ACanvas.Font.Handle := CreateFontIndirect(LogFont); + Flags := DT_NOPREFIX or DT_LEFT or DT_TOP or DT_NOCLIP or DT_SINGLELINE; + } + ts := ACanvas.TextStyle; + ts.Alignment := taLeftJustify; + ts.Layout := tlTop; + ts.Clipping := false; // why need a ClipRect then? + + { + PTxt := StrAlloc((Length(ATxt) + 4) * SizeOf(Char)); + StrPCopy(PTxt, ATxt); + } + //ClipRgn := Windows.CreateRectRgn(ARect.Left, ARect.Top, + // ARect.Right, ARect.Bottom); + ACanvas.ClipRect := HostRect; + { + ClipRgn := Windows.CreateRectRgn(HostRect.Left, HostRect.Top, + HostRect.Right, HostRect.Bottom); + Windows.SelectClipRgn(ACanvas.Handle, ClipRgn); + } + + //Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + TxtRect := Rect(TextLeft, TextTop, TextLeft + 1, TextTop + 1); + ACanvas.TextRect(TxtRect, TxtRect.Left, TxtRect.Top, ATxt, ts); +// Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + +{ + Windows.SelectClipRgn(ACanvas.Handle, 0); + Windows.DeleteObject(ClipRgn); + StrDispose(PTxt); + ACanvas.Font.Handle := 0; +} + //ARect := TxtRect; +end; + +(* +procedure DrawAngleText(ACanvas: TCanvas; HostRect: TRect; + var TextBounds: TRect; AAngle: Integer; HAlign: TAlignment; + VAlign: TJvTFVAlignment; ATxt: string); +var + LogFont: TLogFont; + TxtRect: TRect; + Flags: UINT; + PTxt: PChar; + ClipRgn: HRgn; + TextLeft, + TextTop: Integer; +begin + //TxtRect := ARect; + //CalcTextPos(TxtRect, ACanvas.Font, AAngle, HAlign, VAlign, ATxt); + CalcTextPos(HostRect, TextLeft, TextTop, TextBounds, ACanvas.Font, AAngle, + HAlign, VAlign, ATxt); + Windows.GetObject(ACanvas.Font.Handle, SizeOf(LogFont), @LogFont); + LogFont.lfEscapement := AAngle; + LogFont.lfOrientation := LogFont.lfEscapement; + ACanvas.Font.Handle := CreateFontIndirect(LogFont); + Flags := DT_NOPREFIX or DT_LEFT or DT_TOP or DT_NOCLIP or DT_SINGLELINE; + + PTxt := StrAlloc((Length(ATxt) + 4) * SizeOf(Char)); + StrPCopy(PTxt, ATxt); + //ClipRgn := Windows.CreateRectRgn(ARect.Left, ARect.Top, + // ARect.Right, ARect.Bottom); + ClipRgn := Windows.CreateRectRgn(HostRect.Left, HostRect.Top, + HostRect.Right, HostRect.Bottom); + Windows.SelectClipRgn(ACanvas.Handle, ClipRgn); + + //Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + TxtRect := Rect(TextLeft, TextTop, TextLeft + 1, TextTop + 1); + Windows.DrawText(ACanvas.Handle, PTxt, -1, TxtRect, Flags); + + Windows.SelectClipRgn(ACanvas.Handle, 0); + Windows.DeleteObject(ClipRgn); + StrDispose(PTxt); + ACanvas.Font.Handle := 0; + + //ARect := TxtRect; +end; +*) +function RectWidth(ARect: TRect): Integer; +begin + Result := ARect.Right - ARect.Left; +end; + +function RectHeight(ARect: TRect): Integer; +begin + Result := ARect.Bottom - ARect.Top; +end; + +function EmptyRect: TRect; +begin + Result := Rect(0, 0, 0, 0); +end; + +function IsClassByName(Obj: TObject; ClassName: string): Boolean; +var + ClassRef: TClass; +begin + Result := False; + ClassRef := Obj.ClassType; + while (ClassRef <> nil) and not Result do + if ClassRef.ClassName = ClassName then + Result := True + else + ClassRef := ClassRef.ClassParent; +end; + + +{ Routines copied from JcStrings } + +function StringsToStr(const List: TStrings; const Sep: string; + const AllowEmptyString: Boolean = True): string; +var + I, L: SizeInt; +begin + Result := ''; + for I := 0 to List.Count - 1 do + begin + if (List[I] <> '') or AllowEmptyString then + begin + // don't combine these into one addition, somehow it hurts performance + Result := Result + List[I]; + Result := Result + Sep; + end; + end; + // remove terminating separator + if List.Count > 0 then + begin + L := Length(Sep); + Delete(Result, Length(Result) - L + 1, L); + end; +end; + +end. diff --git a/components/jvcllaz/run/JvTimeFramework/jvtfweeks.pas b/components/jvcllaz/run/JvTimeFramework/jvtfweeks.pas new file mode 100644 index 000000000..722519cee --- /dev/null +++ b/components/jvcllaz/run/JvTimeFramework/jvtfweeks.pas @@ -0,0 +1,494 @@ +{----------------------------------------------------------------------------- +The contents of this file are subject to the Mozilla Public License +Version 1.1 (the "License"); you may not use this file except in compliance +with the License. You may obtain a copy of the License at +http://www.mozilla.org/MPL/MPL-1.1.html + +Software distributed under the License is distributed on an "AS IS" basis, +WITHOUT WARRANTY OF ANY KIND, either expressed or implied. See the License for +the specific language governing rights and limitations under the License. + +The Original Code is: JvTFWeeks.PAS, released on 2003-08-01. + +The Initial Developer of the Original Code is Unlimited Intelligence Limited. +Portions created by Unlimited Intelligence Limited are Copyright (C) 1999-2002 Unlimited Intelligence Limited. +All Rights Reserved. + +Contributor(s): +Mike Kolter (original code) + +You may retrieve the latest version of this file at the Project JEDI's JVCL home page, +located at http://jvcl.delphi-jedi.org + +Known Issues: +-----------------------------------------------------------------------------} +// $Id$ + +unit JvTFWeeks; + +{$mode objfpc}{$H+} + +interface + +uses + LCLIntf, LCLType, LMessages, + SysUtils, Classes, Graphics, Controls, Forms, Dialogs, + JvTFManager, JvTFGlance, JvTFUtils; + +type + TJvTFDispOrder = (doLeftRight, doTopBottom); + + TJvTFWeeks = class(TJvTFCustomGlance) + private + FWeekCount: Integer; + FDisplayDays: TTFDaysOfWeek; + FSplitDay: TTFDayOfWeek; + FIgnoreSplit: Boolean; + FDisplayOrder: TJvTFDispOrder; + FDWNames: TJvTFDWNames; + FDWTitleAttr: TJvTFGlanceTitle; + FOnDrawDWTitle: TJvTFDrawDWTitleEvent; + FOnUpdateTitle: TJvTFUpdateTitleEvent; + function GetDisplayDate: TDate; + procedure SetDisplayDate(Value: TDate); + procedure SetWeekCount(Value: Integer); + procedure SetDisplayDays(Value: TTFDaysOfWeek); + procedure SetSplitDay(Value: TTFDayOfWeek); + procedure SetIgnoreSplit(Value: Boolean); + procedure SetDisplayOrder(Value: TJvTFDispOrder); + procedure SetDWNames(Value: TJvTFDWNames); + procedure SetDWTitleAttr(Value: TJvTFGlanceTitle); + protected + procedure ConfigCells; override; + procedure SetStartOfWeek(Value: TTFDayOfWeek); override; + procedure DWNamesChange(Sender: TObject); + procedure Navigate(AControl: TJvTFControl; ASchedNames: TStringList; + Dates: TJvTFDateList); override; + + function GetSplitParentDay: TTFDayOfWeek; + function GetCellTitleText(Cell: TJvTFGlanceCell): string; override; + + // draws the DW Titles + procedure DrawTitle(ACanvas: TCanvas); override; + procedure UpdateTitle; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + function GetDataTop: Integer; override; + function DisplayDayCount: Integer; + procedure PrevWeek; + procedure NextWeek; + published + property DisplayDate: TDate read GetDisplayDate write SetDisplayDate; + property DisplayDays: TTFDaysOfWeek read FDisplayDays write SetDisplayDays + default [dowSunday..dowSaturday]; + property DisplayOrder: TJvTFDispOrder read FDisplayOrder write SetDisplayOrder; + property DWNames: TJvTFDWNames read FDWNames write SetDWNames; + property DWTitleAttr: TJvTFGlanceTitle read FDWTitleAttr write SetDWTitleAttr; + property IgnoreSplit: Boolean read FIgnoreSplit write SetIgnoreSplit default False; + property SplitDay: TTFDayOfWeek read FSplitDay write SetSplitDay default dowSunday; + property WeekCount: Integer read FWeekCount write SetWeekCount default 1; + property OnDrawDWTitle: TJvTFDrawDWTitleEvent read FOnDrawDWTitle write FOnDrawDWTitle; + property OnUpdateTitle: TJvTFUpdateTitleEvent read FOnUpdateTitle write FOnUpdateTitle; + property StartOfWeek default dowMonday; +// property Navigator; +// property OnNavigate; + end; + + +implementation + +uses + JvResources; + +procedure TJvTFWeeks.ConfigCells; +var + Row, Col, CalcRowCount: Integer; + CurrDate: TDateTime; + DayToSplit: TTFDayOfWeek; + CanSplit: Boolean; + + procedure DisplayDateCheck; + begin + while not (DateToDOW(CurrDate) in DisplayDays) do + IncDays(CurrDate, 1); + end; + + procedure ConfigCell(ACell: TJvTFGlanceCell); + var + TestDay: TTFDayOfWeek; + begin + DisplayDateCheck; + SetCellDate(ACell, CurrDate); + TestDay := DateToDOW(CurrDate); + IncDays(CurrDate, 1); + + if (TestDay = DayToSplit) and (SplitDay in DisplayDays) and CanSplit then + begin + SplitCell(ACell); + DisplayDateCheck; + SetCellDate(ACell.Subcell, CurrDate); + IncDays(CurrDate, 1); + end + else + CombineCell(ACell); + end; + +begin + if WeekCount = 1 then + begin + ColCount := 2; + + CalcRowCount := DisplayDayCount; + if Odd(CalcRowCount) and not (SplitDay in DisplayDays) then + Inc(CalcRowCount); + RowCount := CalcRowCount div 2; + + CanSplit := not IgnoreSplit and Odd(DisplayDayCount); + end + else + begin + if not IgnoreSplit and (SplitDay in DisplayDays) then + ColCount := DisplayDayCount - 1 + else + ColCount := DisplayDayCount; + RowCount := WeekCount; + CanSplit := not IgnoreSplit; + end; + + DayToSplit := GetSplitParentDay; + + CurrDate := OriginDate; + if DisplayOrder = doLeftRight then + for Row := 0 to RowCount - 1 do + for Col := 0 to ColCount - 1 do + ConfigCell(Cells.Cells[Col, Row]) + else + for Col := 0 to ColCount - 1 do + for Row := 0 to RowCount - 1 do + ConfigCell(Cells.Cells[Col, Row]); + + inherited ConfigCells; +end; + +constructor TJvTFWeeks.Create(AOwner: TComponent); +begin + FWeekCount := 1; + FDisplayDays := DOW_WEEK; + FSplitDay := dowSunday; + FIgnoreSplit := False; + + inherited Create(AOwner); + + GapSize := 4; + CellAttr.TitleAttr.Color := clWhite; + CellAttr.TitleAttr.FrameAttr.Color := clGray; + + FDWNames := TJvTFDWNames.Create; + FDWNames.OnChange := @DWNamesChange; + + FDWTitleAttr := TJvTFGlanceTitle.Create(Self); + with FDWTitleAttr do + begin + Assign(TitleAttr); + TxtAttr.Font.Size := 8; + Height := 20; + OnChange := @GlanceTitleChange; + end; + + StartOfWeek := dowMonday; + DisplayDate := Date; +end; + +destructor TJvTFWeeks.Destroy; +begin + FDWNames.OnChange := nil; + FDWNames.Free; + FDWTitleAttr.OnChange := nil; + FDWTitleAttr.Free; + inherited Destroy; +end; + +function TJvTFWeeks.DisplayDayCount: Integer; +var + DOW: TTFDayOfWeek; +begin + Result := 0; + for DOW := Low(TTFDayOfWeek) to High(TTFDayOfWeek) do + if DOW in DisplayDays then + Inc(Result); +end; + +procedure TJvTFWeeks.DrawTitle(ACanvas: TCanvas); +var + I, Col, LineBottom: Integer; + SplitParentDay, CurrDOW: TTFDayOfWeek; + ARect, TempRect, TxtRect, TextBounds: TRect; + OldPen: TPen; + OldBrush: TBrush; + OldFont: TFont; + Txt: string; + + procedure CheckCurrDOW; + begin + while not (CurrDOW in DisplayDays) do + IncDOW(CurrDOW, 1); + end; + +begin + inherited DrawTitle(ACanvas); + + // Don't draw the DW Titles if we're only showing one week. + if not DWTitleAttr.Visible or (WeekCount = 1) then + Exit; + + with ACanvas do + begin + OldPen := TPen.Create; + OldPen.Assign(Pen); + OldBrush := TBrush.Create; + OldBrush.Assign(Brush); + OldFont := TFont.Create; + OldFont.Assign(Font); + end; + + // draw the DWTitles + ARect.Top := inherited GetDataTop; + ARect.Bottom := GetDataTop; + + CurrDOW := StartOfWeek; + SplitParentDay := GetSplitParentDay; + + for Col := 0 to ColCount - 1 do + begin + TempRect := WholeCellRect(Col, 0); + ARect.Left := TempRect.Left; + ARect.Right := TempRect.Right; + TxtRect := ARect; + InflateRect(TxtRect, -1, -1); + + with ACanvas do + begin + Brush.Color := DWTitleAttr.Color; + FillRect(ARect); + + case DWTitleAttr.FrameAttr.Style of + fs3DRaised: + Draw3DFrame(ACanvas, ARect, clBtnHighlight, clBtnShadow); + fs3DLowered: + Draw3DFrame(ACanvas, ARect, clBtnShadow, clBtnHighlight); + fsFlat: + begin + Pen.Color := DWTitleAttr.FrameAttr.Color; + Pen.Width := DWTitleAttr.FrameAttr.Width; + if Col = 0 then + begin + MoveTo(ARect.Left, ARect.Top); + LineTo(ARect.Left, ARect.Bottom); + end; + Polyline([ + Point(ARect.Right - 1, ARect.Top), + Point(ARect.Right - 1, ARect.Bottom - 1), + Point(ARect.Left - 1, ARect.Bottom - 1) + ]); + end; + fsNone: + begin + Pen.Color := DWTitleAttr.FrameAttr.Color; + Pen.Width := 1; + LineBottom := ARect.Bottom - 1; + for I := 1 to DWTitleAttr.FrameAttr.Width do + begin + MoveTo(ARect.Left, LineBottom); + LineTo(ARect.Right, LineBottom); + Dec(LineBottom); + end; + end; + end; + + CheckCurrDOW; + Txt := DWNames.GetDWName(DOWToBorl(CurrDOW)); + + if (CurrDOW = SplitParentDay) and (SplitDay in DisplayDays) and not IgnoreSplit then + begin + IncDOW(CurrDOW, 1); + CheckCurrDOW; + Txt := Txt + '/' + DWNames.GetDWName(DOWToBorl(CurrDOW)); + end; + + Font := DWTitleAttr.TxtAttr.Font; + DrawAngleText(ACanvas, TxtRect, TextBounds, + DWTitleAttr.TxtAttr.Rotation, + DWTitleAttr.TxtAttr.AlignH, + DWTitleAttr.TxtAttr.AlignV, Txt); + end; + + if Assigned(FOnDrawDWTitle) then + FOnDrawDWTitle(Self, ACanvas, ARect, CurrDOW, Txt); + + IncDOW(CurrDOW, 1); + end; + + with ACanvas do + begin + Pen.Assign(OldPen); + Brush.Assign(OldBrush); + Font.Assign(OldFont); + OldPen.Free; + OldBrush.Free; + OldFont.Free; + end; +end; + +procedure TJvTFWeeks.DWNamesChange(Sender: TObject); +begin + UpdateCellTitles; + Invalidate; +end; + +function TJvTFWeeks.GetCellTitleText(Cell: TJvTFGlanceCell): string; +begin + Result := ''; + //Result := FormatDateTime('dddd, mmm d', Cell.CellDate); + if Assigned(DWNames) then + begin + if WeekCount = 1 then + Result := DWNames.GetDWName(DayOfWeek(Cell.CellDate)) + ', '; + if DateFormat = '' then + Result := Result + FormatDateTime('mmm d', Cell.CellDate) + else + Result := Result + FormatDateTime(DateFormat, Cell.CellDate); + end + else + Result := FormatDateTime(DateFormat, Cell.CellDate); +end; + +function TJvTFWeeks.GetDataTop: Integer; +begin + Result := inherited GetDataTop; + if DWTitleAttr.Visible and (WeekCount > 1) then + Inc(Result, DWTitleAttr.Height); +end; + +function TJvTFWeeks.GetDisplayDate: TDate; +begin + Result := StartDate; +end; + +function TJvTFWeeks.GetSplitParentDay: TTFDayOfWeek; +begin + Result := SplitDay; + IncDOW(Result, -1); + while not (Result in DisplayDays) and (Result <> SplitDay) do + IncDOW(Result, -1); +end; + +procedure TJvTFWeeks.Navigate(AControl: TJvTFControl; + ASchedNames: TStringList; Dates: TJvTFDateList); +begin + inherited Navigate(AControl, ASchedNames, Dates); + if Dates.Count > 0 then + DisplayDate := Dates[0]; +end; + +procedure TJvTFWeeks.NextWeek; +begin + DisplayDate := DisplayDate + 7; +end; + +procedure TJvTFWeeks.PrevWeek; +begin + DisplayDate := DisplayDate - 7; +end; + +procedure TJvTFWeeks.SetDisplayDate(Value: TDate); +begin + StartDate := Value; + UpdateTitle; +end; + +procedure TJvTFWeeks.SetDisplayDays(Value: TTFDaysOfWeek); +begin + if Value = [] then + Exit; + + if Value <> FDisplayDays then + begin + FDisplayDays := Value; + ReconfigCells; + end; +end; + +procedure TJvTFWeeks.SetDisplayOrder(Value: TJvTFDispOrder); +begin + if WeekCount > 1 then + Value := doLeftRight; + + if Value <> FDisplayOrder then + begin + FDisplayOrder := Value; + ReconfigCells; + end; +end; + +procedure TJvTFWeeks.SetDWNames(Value: TJvTFDWNames); +begin + FDWNames.Assign(Value); +end; + +procedure TJvTFWeeks.SetDWTitleAttr(Value: TJvTFGlanceTitle); +begin + FDWTitleAttr.Assign(Value); +end; + +procedure TJvTFWeeks.SetIgnoreSplit(Value: Boolean); +begin + if Value <> FIgnoreSplit then + begin + FIgnoreSplit := Value; + ReconfigCells; + end; +end; + +procedure TJvTFWeeks.SetSplitDay(Value: TTFDayOfWeek); +begin + if Value <> FSplitDay then + begin + FSplitDay := Value; + ReconfigCells; + end; +end; + +procedure TJvTFWeeks.SetStartOfWeek(Value: TTFDayOfWeek); +begin + if not IgnoreSplit and (Value = SplitDay) then + IncDOW(Value, -1); + inherited SetStartOfWeek(Value); +end; + +procedure TJvTFWeeks.SetWeekCount(Value: Integer); +begin + Value := Greater(Value, 1); + if Value <> FWeekCount then + begin + DisplayOrder := doLeftRight; + FWeekCount := Value; + ReconfigCells; + end; +end; + +procedure TJvTFWeeks.UpdateTitle; +var + NewTitle: string; +begin + NewTitle := Format(RsWeekOf, [FormatDateTime('mmm d, yyyy', OriginDate)]); + if NewTitle <> TitleAttr.Title then + begin + if Assigned(FOnUpdateTitle) then + FOnUpdateTitle(Self, NewTitle); + TitleAttr.Title := NewTitle; + end; +end; + + +end.