diff --git a/components/virtualtreeview/virtualtrees.pas b/components/virtualtreeview/virtualtrees.pas new file mode 100644 index 000000000..c892673b4 --- /dev/null +++ b/components/virtualtreeview/virtualtrees.pas @@ -0,0 +1,25775 @@ +unit VirtualTrees; + +// Version 4.0.17 +// +// The contents of this file are subject to the Mozilla Public License +// Version 1.1 (the "License"); you may not use this file except in compliance +// with the License. You may obtain a copy of the License at http://www.mozilla.org/MPL/ +// +// Alternatively, you may redistribute this library, use and/or modify it under the terms of the +// GNU Lesser General Public License as published by the Free Software Foundation; +// either version 2.1 of the License, or (at your option) any later version. +// You may obtain a copy of the LGPL at http://www.gnu.org/copyleft/. +// +// Software distributed under the License is distributed on an "AS IS" basis, +// WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License for the +// specific language governing rights and limitations under the License. +// +// The original code is VirtualTrees.pas, released September 30, 2000. +// +// The initial developer of the original code is digital publishing AG (Munich, Germany, www.digitalpublishing.de), +// written by Dipl. Ing. Mike Lischke (public@lischke-online.de, www.lischke-online.de). +// +// Portions created by digital publishing AG are Copyright +// (C) 1999-2001 digital publishing AG. All Rights Reserved. +//---------------------------------------------------------------------------------------------------------------------- +// +// December 2003 +// - Bug fix: check for existing window handle before posting a message for the node editor. +// - Change: published property OnAdvancedHeaderDraw in TVirtualDrawTree. +// +// For full document history see help file. +// +// Credits for their valuable assistance and code donations go to: +// Freddy Ertl, Marian Aldenhövel, Thomas Bogenrieder, Jim Kuenemann, Werner Lehmann, Jens Treichler, +// Paul Gallagher (IBO tree), Ondrej Kelle, Ronaldo Melo Ferraz, Heri Bender, Roland Bedürftig (BCB) +// Anthony Mills, Alexander Egorushkin (BCB), Mathias Torell (BCB), Frank van den Bergh, Vadim Sedulin, Peter Evans, +// Milan Vandrovec (BCB), Steve Moss (system check images), Joe White, David Clark (local node memory manager), +// Anders Thomsen, Igor Afanasyev, Eugene Programmer +// Beta testers: +// Freddy Ertl, Hans-Jürgen Schnorrenberg, Werner Lehmann, Jim Kueneman, Vadim Sedulin, Moritz Franckenstein, +// Wim van der Vegt, Franc v/d Westelaken +// Indirect contribution (via publicly accessible work of those persons): +// Alex Denissov, Hiroyuki Hori (MMXAsm expert) +// Documentation: +// Markus Spoettl and toolsfactory GbR (http://www.doc-o-matic.com/, sponsoring Virtual Treeview +// with a free copy of the Doc-O-Matic help authoring system), Sven H. (Step by step tutorial) +// CLX: +// Dmitri Dmitrienko (initial developer) +// LCL: +// Joerg Thaler,Christian Ulrich +//---------------------------------------------------------------------------------------------------------------------- + +interface + +{$BOOLEVAL OFF} // Use fastest possible boolean evaluation. +{$H+} // longstrings on +{$C+} // Assertion support +{$ifdef I386} + {$ASMMODE intel} +{$endif} + + +{$I Compilers.inc} +{.$define UseFlatScrollbars} +{.$define ReverseFullExpandHotKey} // Used to define Ctrl+'+' instead of Ctrl+Shift+'+' for full expand (and similar for collapsing). + +// Virtual Treeview can use a tiny but very effective local memory manager for node allocation. +// The local memory manager was implemented by David Clark from Caelo Software Inc. +// See below for more info about it. +{.$define UseLocalMemoryManager} + +uses + LCLProc, LCLType, Types, LMessages, LCLIntf, SysUtils, Classes, Graphics, Controls, Forms, ImgList, {ActiveX,} StdCtrls, Menus, Printers, + LResources, GraphType, CustomTimer, + SyncObjs, // critical sections + CommCtrl // image lists, common controls tree structures + ; + +const + VTVersion = '4.0.17'; + VTTreeStreamVersion = 2; + VTHeaderStreamVersion = 3; // The header needs an own stream version to indicate changes only relevant to the header. + + CacheThreshold = 2000; // Number of nodes a tree must at least have to start caching and at the same + // time the maximum number of nodes between two cache entries. + FadeAnimationStepCount = 255; // Number of animation steps for hint fading (0..255). + ShadowSize = 5; // Size in pixels of the hint shadow. This value has no influence on Win2K and XP systems + // as those OSes have native shadow support. + + // Special identifiers for columns. + NoColumn = -1; + InvalidColumn = -2; + + // Indices for check state images used for checking. + ckEmpty = 0; // an empty image used as place holder + // radio buttons + ckRadioUncheckedNormal = 1; + ckRadioUncheckedHot = 2; + ckRadioUncheckedPressed = 3; + ckRadioUncheckedDisabled = 4; + ckRadioCheckedNormal = 5; + ckRadioCheckedHot = 6; + ckRadioCheckedPressed = 7; + ckRadioCheckedDisabled = 8; + // check boxes + ckCheckUncheckedNormal = 9; + ckCheckUncheckedHot = 10; + ckCheckUncheckedPressed = 11; + ckCheckUncheckedDisabled = 12; + ckCheckCheckedNormal = 13; + ckCheckCheckedHot = 14; + ckCheckCheckedPressed = 15; + ckCheckCheckedDisabled = 16; + ckCheckMixedNormal = 17; + ckCheckMixedHot = 18; + ckCheckMixedPressed = 19; + ckCheckMixedDisabled = 20; + // simple button + ckButtonNormal = 21; + ckButtonHot = 22; + ckButtonPressed = 23; + ckButtonDisabled = 24; + + // Instead using a TTimer class for each of the various events I use Windows timers with messages + // as this is more economical. + ExpandTimer = 1; + EditTimer = 2; + HeaderTimer = 3; + ScrollTimer = 4; + ChangeTimer = 5; + StructureChangeTimer = 6; + SearchTimer = 7; + + WM_APP = $8000; + + // Need to use this message to release the edit link interface asynchronly. + WM_CHANGESTATE = WM_APP + 32; + + // Virtual Treeview does not need to be subclass by an eventual Theme Manager class as it handles + // Windows XP theme painting itself. Hence the special non-subclass message is used to prevent subclassing. + CM_DENYSUBCLASSING = CM_BASE + 2000; + + // Decoupling message for auto-adjusting the internal edit window. + CM_AUTOADJUST = CM_BASE + 2005; + + // VT's own clipboard formats, + // Note: The reference format is used internally to allow to link to a tree reference + // to implement optimized moves and other back references. + CFSTR_VIRTUALTREE = 'Virtual Tree Data'; + CFSTR_VTREFERENCE = 'Virtual Tree Reference'; + CFSTR_HTML = 'HTML Format'; + CFSTR_RTF = 'Rich Text Format'; + CFSTR_RTFNOOBJS = 'Rich Text Format Without Objects'; + CFSTR_CSV = 'CSV'; + + // Drag image helpers for Windows 2000 and up. + IID_IDropTargetHelper: TGUID = (D1: $4657278B; D2: $411B; D3: $11D2; D4: ($83, $9A, $00, $C0, $4F, $D9, $18, $D0)); + IID_IDragSourceHelper: TGUID = (D1: $DE5BF786; D2: $477A; D3: $11D2; D4: ($83, $9D, $00, $C0, $4F, $D9, $18, $D0)); + IID_IDropTarget: TGUID = (D1: $00000122; D2: $0000; D3: $0000; D4: ($C0, $00, $00, $00, $00, $00, $00, $46)); + CLSID_DragDropHelper: TGUID = (D1: $4657278A; D2: $411B; D3: $11D2; D4: ($83, $9A, $00, $C0, $4F, $D9, $18, $D0)); + + SID_IDropTargetHelper = '{4657278B-411B-11D2-839A-00C04FD918D0}'; + SID_IDragSourceHelper = '{DE5BF786-477A-11D2-839D-00C04FD918D0}'; + SID_IDropTarget = '{00000122-0000-0000-C000-000000000046}'; + + // Help identifiers for exceptions. Application developers are responsible to link them with actual help topics. + hcTFEditLinkIsNil = 2000; + hcTFWrongMoveError = 2001; + hcTFWrongStreamFormat = 2002; + hcTFWrongStreamVersion = 2003; + hcTFStreamTooSmall = 2004; + hcTFCorruptStream1 = 2005; + hcTFCorruptStream2 = 2006; + hcTFClipboardFailed = 2007; + hcTFCannotSetUserData = 2008; + + // Header standard split cursor. + crHeaderSplit = TCursor(100); + + UtilityImageSize = 16; // Needed by descentants for hittests. + +var // Clipboard format IDs used in OLE drag'n drop and clipboard transfers. + CF_VIRTUALTREE, + CF_VTREFERENCE, + CF_VRTF, + CF_VRTFNOOBJS, // Unfortunately CF_RTF* is already defined as being + // registration strings so I have to use different identifiers. + CF_HTML, + CF_CSV: Word; + + MMXAvailable: Boolean; // necessary to know because the blend code uses MMX instructions + +{$MinEnumSize 1, make enumerations as small as possible} + +type + // later: remove, only now a dummy + TBidiMode = Byte; + + // The exception used by the trees. + EVirtualTreeError = class(Exception); + + // Limits the speed interval which can be used for auto scrolling (milliseconds). + TAutoScrollInterval = 1..1000; + + // Need to declare the correct WMNCPaint record as the VCL (D5-) doesn't. + TRealWMNCPaint = packed record + Msg: Cardinal; + Rgn: HRGN; + lParam: Integer; + Result: Integer; + end; + + // The next two message records are not declared in Delphi 6 and lower. + TWMPrint = packed record + Msg: Cardinal; + DC: HDC; + Flags: Cardinal; + Result: Integer; + end; + + TWMPrintClient = TWMPrint; + + {$ifndef COMPILER_5_UP} // todo: find right thisn + TWMContextMenu = Pointer;//TWMMouse; + {$endif COMPILER_5_UP} + + // Be careful when adding new states as this might change the size of the type which in turn + // changes the alignment in the node record as well as the stream chunks. + // Do not reorder the states and always add new states at the end of this enumeration in order to avoid + // breaking existing code. + TVirtualNodeState = ( + vsInitialized, // Set after the node has been initialized. + vsChecking, // Node's check state is changing, avoid propagation. + vsCutOrCopy, // Node is selected as cut or copy and paste source. + vsDisabled, // Set if node is disabled. + vsDeleting, // Set when the node is about to be freed. + vsExpanded, // Set if the node is expanded. + vsHasChildren, // Indicates the presence of child nodes without actually setting them. + vsVisible, // Indicate whether the node is visible or not (independant of the expand states of its parents). + vsSelected, // Set if the node is in the current selection. + vsInitialUserData, // Set if (via AddChild or InsertNode) initial user data has been set which requires OnFreeNode. + vsAllChildrenHidden, // Set if vsHasChildren is set and no child node has the vsVisible flag set. + vsClearing, // A node's children are being deleted. Don't register structure change event. + vsMultiline, // Node text is wrapped at the cell boundaries instead of being shorted. + vsHeightMeasured // Node height has been determined and does not need a recalculation. + ); + TVirtualNodeStates = set of TVirtualNodeState; + + // States used in InitNode to indicate states a node shall initially have. + TVirtualNodeInitState = ( + ivsDisabled, + ivsExpanded, + ivsHasChildren, + ivsMultiline, + ivsSelected + ); + TVirtualNodeInitStates = set of TVirtualNodeInitState; + + TScrollBarStyle = ( + sbmRegular, + sbmFlat, + sbm3D + ); + + // Options per column. + TVTColumnOption = ( + coAllowClick, // Column can be clicked (must be enabled too). + coDraggable, // Column can be dragged. + coEnabled, // Column is enabled. + coParentBidiMode, // Column uses the parent's bidi mode. + coParentColor, // Column uses the parent's background color. + coResizable, // Column can be resized. + coShowDropMark, // Column shows the drop mark if it is currently the drop target. + coVisible, // Column is shown. + coAutoSpring, // Column takes part in the auto spring feature of the header (must be resizable too). + coFixed // Column is fixed and can not be selected or scrolled etc. + ); + TVTColumnOptions = set of TVTColumnOption; + + // These flags are returned by the hit test method. + THitPosition = ( + hiAbove, // above the client area (if relative) or the absolute tree area + hiBelow, // below the client area (if relative) or the absolute tree area + hiNowhere, // no node is involved (possible only if the tree is not as tall as the client area) + hiOnItem, // on the bitmaps/buttons or label associated with an item + hiOnItemButton, // on the button associated with an item + hiOnItemCheckbox, // on the checkbox if enabled + hiOnItemIndent, // in the indentation area in front of a node + hiOnItemLabel, // on the normal text area associated with an item + hiOnItemLeft, // in the area to the left of a node's text area (e.g. when right aligned or centered) + hiOnItemRight, // in the area to the right of a node's text area (e.g. if left aligned or centered) + hiOnNormalIcon, // on the "normal" image + hiOnStateIcon, // on the state image + hiToLeft, // to the left of the client area (if relative) or the absolute tree area + hiToRight // to the right of the client area (if relative) or the absolute tree area + ); + THitPositions = set of THitPosition; + + TCheckType = ( + ctNone, + ctTriStateCheckBox, + ctCheckBox, + ctRadioButton, + ctButton + ); + + // The check states include both, transient and fluent (temporary) states. The only temporary state defined so + // far is the pressed state. + TCheckState = ( + csUncheckedNormal, // unchecked and not pressed + csUncheckedPressed, // unchecked and pressed + csCheckedNormal, // checked and not pressed + csCheckedPressed, // checked and pressed + csMixedNormal, // 3-state check box and not pressed + csMixedPressed // 3-state check box and pressed + ); + + TCheckImageKind = ( + ckLightCheck, // gray cross + ckDarkCheck, // black cross + ckLightTick, // gray tick mark + ckDarkTick, // black tick mark + ckFlat, // flat images (no 3D border) + ckXP, // Windows XP style + ckCustom, // application defined check images + ckSystem, // System defined check images. + ckSystemFlat // Flat system defined check images. + ); + + // mode to describe a move action + TVTNodeAttachMode = ( + amNoWhere, // just for simplified tests, means to ignore the Add/Insert command + amInsertBefore, // insert node just before destination (as sibling of destination) + amInsertAfter, // insert node just after destionation (as sibling of destination) + amAddChildFirst, // add node as first child of destination + amAddChildLast // add node as last child of destination + ); + + // modes to determine drop position further + TDropMode = ( + dmNowhere, + dmAbove, + dmOnNode, + dmBelow + ); + + // operations basically allowed during drag'n drop + TDragOperation = ( + doCopy, + doMove, + doLink + ); + TDragOperations = set of TDragOperation; + + TVTImageKind = ( + ikNormal, + ikSelected, + ikState, + ikOverlay + ); + + TVTHintMode = ( + hmDefault, // show the hint of the control + hmHint, // show node specific hint string returned by the application + hmHintAndDefault, // same as hmHint but show the control's hint if no node is concerned + hmTooltip // show the text of the node if it isn't already fully shown + ); + + TMouseButtons = set of TMouseButton; + + // Used to describe the action to do when using the OnBeforeItemErase event. + TItemEraseAction = ( + eaColor, // Use the provided color to erase the background instead the one of the tree. + eaDefault, // The tree should erase the item's background (bitmap or solid). + eaNone // Do nothing. Let the application paint the background. + ); + + + // There is a heap of switchable behavior in the tree. Since published properties may never exceed 4 bytes, + // which limits sets to at most 32 members, and because for better overview tree options are splitted + // in various sub-options and are held in a commom options class. + // + // Options to customize tree appearance: + TVTPaintOption = ( + toHideFocusRect, // Avoid drawing the dotted rectangle around the currently focused node. + toHideSelection, // Selected nodes are drawn as unselected nodes if the tree is unfocused. + toHotTrack, // Track which node is under the mouse cursor. + toPopupMode, // Paint tree as would it always have the focus (useful for tree combo boxes etc.) + toShowBackground, // Use the background image if there's one. + toShowButtons, // Display collapse/expand buttons left to a node. + toShowDropmark, // Show the dropmark during drag'n drop operations. + toShowHorzGridLines, // Display horizontal lines to simulate a grid. + toShowRoot, // Show lines also at top level (does not show the hidden/internal root node). + toShowTreeLines, // Display tree lines to show hierarchy of nodes. + toShowVertGridLines, // Display vertical lines (depending on columns) to simulate a grid. + toThemeAware, // Draw UI elements (header, tree buttons etc.) according to the current theme if + // enabled (Windows XP+ only, application must be themed). + toUseBlendedImages, // Enable alpha blending for ghosted nodes or those which are being cut/copied. + toGhostedIfUnfocused, // Ghosted images are still shown as ghosted if unfocused (otherwise the become non-ghosted + // images). + toFullVertGridLines, // Display vertical lines over the full client area, not only the space occupied by nodes. + // This option only has an effect if toShowVertGridLines is enabled too. + toAlwaysHideSelection, // Do not draw node selection, regardless of focused state. + toUseBlendedSelection // Enable alpha blending for node selections. + ); + TVTPaintOptions = set of TVTPaintOption; + + // Options to toggle animation support: + TVTAnimationOption = ( + toAnimatedToggle // Expanding and collapsing a node is animated (quick window scroll). + ); + TVTAnimationOptions = set of TVTAnimationOption; + + // Options which toggle automatic handling of certain situations: + TVTAutoOption = ( + toAutoDropExpand, // Expand node if it is the drop target for more than certain time. + toAutoExpand, // Nodes are expanded (collapsed) when getting (losing) the focus. + toAutoScroll, // Scroll if mouse is near the border while dragging or selecting. + toAutoScrollOnExpand, // Scroll as many child nodes in view as possible after expanding a node. + toAutoSort, // Sort tree when Header.SortColumn or Header.SortDirection change or sort node if + // child nodes are added. + toAutoSpanColumns, // Large entries continue into next column(s) if there's no text in them (no clipping). + toAutoTristateTracking, // Checkstates are automatically propagated for tri state check boxes. + toAutoHideButtons, // Node buttons are hidden when there are child nodes, but all are invisible. + toAutoDeleteMovedNodes, // Delete nodes which where moved in a drag operation (if not directed otherwise). + toDisableAutoscrollOnFocus,// Disable scrolling a column entirely into view if it gets focused. + toAutoChangeScale, // Change default node height automatically if the system's font scale is set to big fonts. + toAutoFreeOnCollapse // Frees any child node after a node has been collapsed (HasChildren flag stays there). + ); + TVTAutoOptions = set of TVTAutoOption; + + // Options which determine the tree's behavior when selecting nodes: + TVTSelectionOption = ( + toDisableDrawSelection, // Prevent user from selecting with the selection rectangle in multiselect mode. + toExtendedFocus, // Entries other than in the main column can be selected, edited etc. + toFullRowSelect, // Hit test as well as selection highlight are not constrained to the text of a node. + toLevelSelectConstraint, // Constrain selection to the same level as the selection anchor. + toMiddleClickSelect, // Allow selection, dragging etc. with the middle mouse button. This and toWheelPanning + // are mutual exclusive. + toMultiSelect, // Allow more than one node to be selected. + toRightClickSelect, // Allow selection, dragging etc. with the right mouse button. + toSiblingSelectConstraint, // constrain selection to nodes with same parent + toCenterScrollIntoView, // Center nodes vertically in the client area when scrolling into view. + toSimpleDrawSelection // Simplifies draw selection, so a node's caption does not need to intersect with the + // selection rectangle. + ); + TVTSelectionOptions = set of TVTSelectionOption; + + // Options which do not fit into any of the other groups: + TVTMiscOption = ( + toAcceptOLEDrop, // Register tree as OLE accepting drop target + toCheckSupport, // Show checkboxes/radio buttons. + toEditable, // Node captions can be edited. + toFullRepaintOnResize, // Fully invalidate the tree when its window is resized (CS_HREDRAW/CS_VREDRAW). + toGridExtensions, // Use some special enhancements to simulate and support grid behavior. + toInitOnSave, // Initialize nodes when saving a tree to a stream. + toReportMode, // Tree behaves like TListView in report mode. + toToggleOnDblClick, // Toggle node expansion state when it is double clicked. + toWheelPanning, // Support for mouse panning (wheel mice only). This option and toMiddleClickSelect are + // mutal exclusive, where panning has precedence. + toReadOnly, // The tree does not allow to be modified in any way. No action is executed and + // node editing is not possible. + toVariableNodeHeight, // When set then GetNodeHeight will trigger OnMeasureItem to allow variable node heights. + toFullRowDrag // Start node dragging by clicking anywhere in it instead only on the caption or image. + // Must be used together with toDisableDrawSelection. + ); + TVTMiscOptions = set of TVTMiscOption; + +const + DefaultPaintOptions = [toShowButtons, toShowDropmark, toShowTreeLines, toShowRoot, toThemeAware, + toUseBlendedImages]; + DefaultAnimationOptions = []; + DefaultAutoOptions = [toAutoDropExpand, toAutoTristateTracking, toAutoScrollOnExpand, toAutoDeleteMovedNodes]; + DefaultSelectionOptions = []; + DefaultMiscOptions = [toAcceptOLEDrop, toFullRepaintOnResize, toInitOnSave, toToggleOnDblClick, toWheelPanning]; + DefaultColumnOptions = [coAllowClick, coDraggable, coEnabled, coParentColor, coParentBidiMode, coResizable, + coShowDropmark, coVisible]; + +type + TBaseVirtualTree = class; + TVirtualTreeClass = class of TBaseVirtualTree; + + PVirtualNode = ^TVirtualNode; + + TColumnIndex = type Integer; + TColumnPosition = type Cardinal; + + // This record must already be defined here and not later because otherwise BCB users will not be able + // to compile (conversion done by BCB is wrong). + TCacheEntry = record + Node: PVirtualNode; + AbsoluteTop: Cardinal; + end; + + TCache = array of TCacheEntry; + TNodeArray = array of PVirtualNode; + + TCustomVirtualTreeOptions = class(TPersistent) + private + FOwner: TBaseVirtualTree; + FAnimationOptions: TVTAnimationOptions; + FAutoOptions: TVTAutoOptions; + FSelectionOptions: TVTSelectionOptions; + FMiscOptions: TVTMiscOptions; + FPaintOptions: TVTPaintOptions; + procedure SetAnimationOptions(const Value: TVTAnimationOptions); + procedure SetAutoOptions(const Value: TVTAutoOptions); + procedure SetMiscOptions(const Value: TVTMiscOptions); + procedure SetPaintOptions(const Value: TVTPaintOptions); + procedure SetSelectionOptions(const Value: TVTSelectionOptions); + protected + property AnimationOptions: TVTAnimationOptions read FAnimationOptions write SetAnimationOptions + default DefaultAnimationOptions; + property AutoOptions: TVTAutoOptions read FAutoOptions write SetAutoOptions default DefaultAutoOptions; + property MiscOptions: TVTMiscOptions read FMiscOptions write SetMiscOptions default DefaultMiscOptions; + property PaintOptions: TVTPaintOptions read FPaintOptions write SetPaintOptions default DefaultPaintOptions; + property SelectionOptions: TVTSelectionOptions read FSelectionOptions write SetSelectionOptions + default DefaultSelectionOptions; + public + constructor Create(AOwner: TBaseVirtualTree); virtual; + procedure AssignTo(Dest: TPersistent); override; + property Owner: TBaseVirtualTree read FOwner; + end; + + TTreeOptionsClass = class of TVirtualTreeOptions; + + TVirtualTreeOptions = class(TCustomVirtualTreeOptions) + published + property AnimationOptions; + property AutoOptions; + property MiscOptions; + property PaintOptions; + property SelectionOptions; + end; + + // Used in the CF_VTREFERENCE clipboard format. + PVTReference = ^TVTReference; + TVTReference = record + Process: Cardinal; + Tree: TBaseVirtualTree; + end; + + TVirtualNode = packed record + Index, // index of node with regard to its parent + ChildCount: Cardinal; // number of child nodes + NodeHeight: Word; // height in pixels + States: TVirtualNodeStates; // states describing various properties of the node (expanded, initialized etc.) + Align: Byte; // line/button alignment + CheckState: TCheckState; // indicates the current check state (e.g. checked, pressed etc.) + CheckType: TCheckType; // indicates which check type shall be used for this node + Dummy: Byte; // dummy value to fill DWORD boundary + TotalCount, // sum of this node, all of its child nodes and their child nodes etc. + TotalHeight: Cardinal; // height in pixels this node covers on screen including the height of all of its + // children + Dummy2: Word; // FPC: Sets need 4 bytes / in Delphi only 2 bytes + // Note: Some copy routines require that all pointers (as well as the data area) in a node are + // located at the end of the node! Hence if you want to add new member fields (except pointers to internal + // data) then put them before field Parent. + Parent, // reference to the node's parent (for the root this contains the treeview) + PrevSibling, // link to the node's previous sibling or nil if it is the first node + NextSibling, // link to the node's next sibling or nil if it is the last node + FirstChild, // link to the node's first child... + LastChild: PVirtualNode; // link to the node's last child... + Data: record end; // this is a placeholder, each node gets extra data determined by NodeDataSize + end; + + // TVTNodeMemoryManager is a high-performance local memory manager for allocating TVirtualNode structures. + // It is not thread-safe in itself, because it assumes that the virtual tree is being used within a single + // thread. The local memory manager supports only fixed-length allocation requests - all requests must be of + // the same size. The performance improvements are a result of TVTNodeMemoryManager getting 16K blocks + // of memory from the Delphi memory manager and then managing them in a highly efficient manner. + // A consequence is that node memory allocations/deallocations are not visible to memory debugging tools. + // + // The local memory manager is disabled by default - to enable it {$define UseLocalMemoryManager}. For smaller trees, + // say less than 10,000 nodes, there is really no major performance benefit in using the local memory manager. + {$ifdef UseLocalMemoryManager} + TVTNodeMemoryManager = class + private + FAllocSize: Cardinal; // The memory allocated for each node + FBlockList: TList; // List of allocated blocks + FBytesAvailable: Cardinal; // Bytes available in current block + FNext: PVirtualNode; // Pointer to next available node in current block + FFreeSpace: PVirtualNode; // Pointer to free space chain + public + constructor Create; + destructor Destroy; override; + + function AllocNode(const Size: Cardinal): PVirtualNode; + procedure FreeNode(const Node: PVirtualNode); + procedure Clear; + end; + {$endif UseLocalMemoryManager} + + // structure used when info about a certain position in the tree is needed + THitInfo = record + HitNode: PVirtualNode; + HitPositions: THitPositions; + HitColumn: TColumnIndex; + end; + + // auto scroll directions + TScrollDirections = set of ( + sdLeft, + sdUp, + sdRight, + sdDown + ); + + PVTHintData = ^TVTHintData; + TVTHintData = record + Tree: TBaseVirtualTree; + Node: PVirtualNode; + Column: TColumnIndex; + HintRect: TRect; // used for draw trees only, string trees get the size from the hint string + DefaultHint: WideString; // used only if there is no node specific hint string available + // or a header hint is about to appear + HintText: WideString; // set when size of the hint window is calculated +//b BidiMode: TBidiMode; + Alignment: TAlignment; + end; + + // Determines the kind of animation when a hint is activated. + THintAnimationType = ( + hatNone, // no animation at all, just display hint/tooltip + hatFade, // fade in the hint/tooltip, like in Windows 2000 + hatSlide, // slide in the hint/tooltip, like in Windows 98 + hatSystemDefault // use what the system is using (slide for Win9x, slide/fade for Win2K+, depends on settings) + ); + + // The trees need an own hint window class because of Unicode output and adjusted font. + TVirtualTreeHintWindow = class(THintWindow) + private + FHintData: TVTHintData; + FBackground, + FDrawBuffer, + FTarget: TBitmap; + FTextHeight: Integer; + function AnimationCallback(Step, StepSize: Integer; Data: Pointer): Boolean; + procedure InternalPaint(Step, StepSize: Integer); + procedure CMTextChanged(var Message: TLMessage); message CM_TEXTCHANGED; + procedure WMEraseBkgnd(var Message: TLMEraseBkgnd); message LM_ERASEBKGND; + procedure WMNCPaint(var Message: TLMessage); message LM_NCPAINT; + procedure WMShowWindow(var Message: TLMShowWindow); message LM_SHOWWINDOW; + protected + procedure CreateParams(var Params: TCreateParams); override; + + procedure Paint; override; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + procedure ActivateHint(Rect: TRect; const AHint: string); override; + function CalcHintRect(MaxWidth: Integer; const AHint: string; AData: Pointer): TRect; override; + function IsHintMsg(var Msg: TMsg): Boolean; // override; + end; + + // Drag image support for the tree. + TVTTransparency = 0..255; + TVTBias = -128..127; + + // Simple move limitation for the drag image. + TVTDragMoveRestriction = ( + dmrNone, + dmrHorizontalOnly, + dmrVerticalOnly + ); + + TVTDragImageStates = set of ( + disHidden, // Internal drag image is currently hidden (always hidden if drag image helper interfaces are used). + disInDrag, // Drag image class is currently being used. + disPrepared, // Drag image class is prepared. + disSystemSupport // Running on Windows 2000 or higher. System supports drag images natively. + ); + + // Class to manage header and tree drag image during a drag'n drop operation. + TVTDragImage = class + private + FOwner: TBaseVirtualTree; + FBackImage, // backup of overwritten screen area + FAlphaImage, // target for alpha blending + FDragImage: TBitmap; // the actual drag image to blend to screen + FImagePosition, // position of image (upper left corner) in screen coordinates + FLastPosition: TPoint; // last mouse position in screen coordinates + FTransparency: TVTTransparency; // alpha value of the drag image (0 - fully transparent, 255 - fully opaque) + FPreBlendBias, // value to darken or lighten the drag image before it is blended + FPostBlendBias: TVTBias; // value to darken or lighten the alpha blend result + FFade: Boolean; // determines whether to fade the drag image from center to borders or not + FRestriction: TVTDragMoveRestriction; // determines in which directions the drag image can be moved + FColorKey: TColor; // color to make fully transparent regardless of any other setting + FStates: TVTDragImageStates; // Determines the states of the drag image class. + function GetVisible: Boolean; // True if the drag image is currently hidden (used only when dragging) + protected + procedure InternalShowDragImage(ScreenDC: HDC); + procedure MakeAlphaChannel(Source, Target: TBitmap); + public + constructor Create(AOwner: TBaseVirtualTree); + destructor Destroy; override; + + function DragTo(P: TPoint; ForceRepaint: Boolean): Boolean; + procedure EndDrag; + function GetDragImageRect: TRect; + procedure HideDragImage; + procedure PrepareDrag(DragImage: TBitmap; ImagePosition, HotSpot: TPoint); + procedure RecaptureBackground(Tree: TBaseVirtualTree; R: TRect; VisibleRegion: HRGN; CaptureNCArea, + ReshowDragImage: Boolean); + procedure ShowDragImage; + function WillMove(P: TPoint): Boolean; + + property ColorKey: TColor read FColorKey write FColorKey default clWindow; + property Fade: Boolean read FFade write FFade default False; + property MoveRestriction: TVTDragMoveRestriction read FRestriction write FRestriction default dmrNone; + property PostBlendBias: TVTBias read FPostBlendBias write FPostBlendBias default 0; + property PreBlendBias: TVTBias read FPreBlendBias write FPreBlendBias default 0; + property Transparency: TVTTransparency read FTransparency write FTransparency default 128; + property Visible: Boolean read GetVisible; + end; + + // tree columns implementation + TVirtualTreeColumns = class; + TVTHeader = class; + + TVirtualTreeColumnStyle = ( + vsText, + vsOwnerDraw + ); + + TVTHeaderColumnLayout = ( + blGlyphLeft, + blGlyphRight, + blGlyphTop, + blGlyphBottom + ); + + TVirtualTreeColumn = class(TCollectionItem) + private + FText, + FHint: WideString; + FLeft, + FWidth: Integer; + FPosition: TColumnPosition; + FMinWidth: Integer; + FMaxWidth: Integer; + FStyle: TVirtualTreeColumnStyle; + FImageIndex: TImageIndex; +//b FBiDiMode: TBiDiMode; + FLayout: TVTHeaderColumnLayout; + FMargin, + FSpacing: Integer; + FOptions: TVTColumnOptions; + FTag: Integer; + FAlignment: TAlignment; + FLastWidth: Integer; + FColor: TColor; + FSpringRest: Single; // Akkumulator for width adjustment when auto spring option is enabled. + function GetLeft: Integer; + function IsBiDiModeStored: Boolean; + function IsColorStored: Boolean; + procedure SetAlignment(const Value: TAlignment); +//b procedure SetBiDiMode(Value: TBiDiMode); + procedure SetColor(const Value: TColor); + procedure SetImageIndex(Value: TImageIndex); + procedure SetLayout(Value: TVTHeaderColumnLayout); + procedure SetMargin(Value: Integer); + procedure SetMaxWidth(Value: Integer); + procedure SetMinWidth(Value: Integer); + procedure SetOptions(Value: TVTColumnOptions); + procedure SetPosition(Value: TColumnPosition); + procedure SetSpacing(Value: Integer); + procedure SetStyle(Value: TVirtualTreeColumnStyle); + procedure SetText(const Value: WideString); + procedure SetWidth(Value: Integer); + protected + procedure ComputeHeaderLayout(DC: HDC; const Client: TRect; UseHeaderGlyph, UseSortGlyph: Boolean; + var HeaderGlyphPos, SortGlyphPos: TPoint; var TextBounds: TRect); virtual; + procedure DefineProperties(Filer: TFiler); override; + procedure GetAbsoluteBounds(var Left, Right: Integer); +// function GetDisplayName: string; override; + function GetOwner: TVirtualTreeColumns; reintroduce; + procedure ReadHint(Reader: TReader); + procedure ReadText(Reader: TReader); + procedure SetIndex(Value: Integer); override; + procedure WriteHint(Writer: TWriter); + procedure WriteText(Writer: TWriter); + public + constructor Create(xCollection: TCollection); override; + destructor Destroy; override; + + procedure Assign(Source: TPersistent); override; + function Equals(OtherColumn: TVirtualTreeColumn): Boolean; virtual; + function GetRect: TRect; virtual; + procedure LoadFromStream(const Stream: TStream; Version: Integer); + procedure ParentBiDiModeChanged; + procedure ParentColorChanged; + procedure RestoreLastWidth; + procedure SaveToStream(const Stream: TStream); + function UseRightToLeftReading: Boolean; + + property Left: Integer read GetLeft; + property Owner: TVirtualTreeColumns read GetOwner; + published + property Alignment: TAlignment read FAlignment write SetAlignment default taLeftJustify; +//b property BiDiMode: TBiDiMode read FBiDiMode write SetBiDiMode stored IsBiDiModeStored default bdLeftToRight; + property Color: TColor read FColor write SetColor stored IsColorStored default clWindow; + property Hint: WideString read FHint write FHint stored False; + property ImageIndex: TImageIndex read FImageIndex write SetImageIndex default -1; + property Layout: TVTHeaderColumnLayout read FLayout write SetLayout default blGlyphLeft; + property Margin: Integer read FMargin write SetMargin default 4; + property MaxWidth: Integer read FMaxWidth write SetMaxWidth default 10000; + property MinWidth: Integer read FMinWidth write SetMinWidth default 10; + property Options: TVTColumnOptions read FOptions write SetOptions default DefaultColumnOptions; + property Position: TColumnPosition read FPosition write SetPosition; + property Spacing: Integer read FSpacing write SetSpacing default 4; + property Style: TVirtualTreeColumnStyle read FStyle write SetStyle default vsText; + property Tag: Integer read FTag write FTag default 0; + property Text: WideString read FText write SetText stored False; // Never let the VCL store the wide string, + // it is simply unable to write it correctly. + // We use DefineProperties here. + property Width: Integer read FWidth write SetWidth default 50; + end; + + TVirtualTreeColumnClass = class of TVirtualTreeColumn; + + TColumnsArray = array of TVirtualTreeColumn; + TCardinalArray = array of Cardinal; + TIndexArray = array of TColumnIndex; + + TVirtualTreeColumns = class(TCollection) + private + FHeader: TVTHeader; + FHeaderBitmap: TBitmap; // backbuffer for drawing + FHoverIndex, // currently "hot" column + FDownIndex, // Column on which a mouse button is held down. + FTrackIndex: TColumnIndex; // Index of column which is currently being resized + FClickIndex: TColumnIndex; // last clicked column + FPositionToIndex: TIndexArray; + FNeedPositionsFix: Boolean; // True if FixPositions must still be called after DFM loading. + FClearing: Boolean; // True if columns are being deleted entirely. + + // drag support + FDragIndex: TColumnIndex; // index of column currently being dragged + FDropTarget: TColumnIndex; // current target column (index) while dragging + FDropBefore: Boolean; // True if drop position is in the left half of a column, False for the right + // side to drop the dragged column to + function GetItem(Index: TColumnIndex): TVirtualTreeColumn; + function GetNewIndex(P: TPoint; var OldIndex: TColumnIndex): Boolean; + procedure SetItem(Index: TColumnIndex; Value: TVirtualTreeColumn); + protected + procedure AdjustAutoSize(CurrentIndex: TColumnIndex; Force: Boolean = False); + function AdjustDownColumn(P: TPoint): TColumnIndex; + function AdjustHoverColumn(P: TPoint): Boolean; + procedure AdjustPosition(Column: TVirtualTreeColumn; Position: Cardinal); + procedure DrawButtonText(DC: HDC; Caption: WideString; Bounds: TRect; Enabled, Hot: Boolean; DrawFormat: Cardinal); + procedure DrawXPButton(DC: HDC; ButtonR: TRect; DrawSplitter, Down, Hover: Boolean); + procedure FixPositions; + function GetColumnAndBounds(P: TPoint; var ColumnLeft, ColumnRight: Integer; Relative: Boolean = True): Integer; + function GetOwner: TPersistent; override; + procedure HandleClick(P: TPoint; Button: TMouseButton; Force, DblClick: Boolean); + procedure IndexChanged(OldIndex, NewIndex: Integer); + procedure InitializePositionArray; + procedure Update(Item: TCollectionItem); override; + procedure UpdatePositions(Force: Boolean = False); + + property HeaderBitmap: TBitmap read FHeaderBitmap; + property PositionToIndex: TIndexArray read FPositionToIndex; + public + constructor Create(AOwner: TVTHeader); + destructor Destroy; override; + + function Add: TVirtualTreeColumn; virtual; + procedure AnimatedResize(Column: TColumnIndex; NewWidth: Integer); + procedure Assign(Source: TPersistent); override; + procedure Clear; virtual; + function ColumnFromPosition(P: TPoint; Relative: Boolean = True): TColumnIndex; overload; virtual; + function ColumnFromPosition(PositionIndex: TColumnPosition): TColumnIndex; overload; virtual; + function Equals(OtherColumns: TVirtualTreeColumns): Boolean; + procedure GetColumnBounds(Column: TColumnIndex; var Left, Right: Integer); + function GetFirstVisibleColumn: TColumnIndex; + function GetLastVisibleColumn: TColumnIndex; + function GetNextColumn(Column: TColumnIndex): TColumnIndex; + function GetNextVisibleColumn(Column: TColumnIndex): TColumnIndex; + function GetPreviousColumn(Column: TColumnIndex): TColumnIndex; + function GetPreviousVisibleColumn(Column: TColumnIndex): TColumnIndex; + function GetVisibleColumns: TColumnsArray; + function GetVisibleFixedWidth: Integer; + function IsValidColumn(Column: TColumnIndex): Boolean; + procedure LoadFromStream(const Stream: TStream; Version: Integer); + procedure PaintHeader(DC: HDC; R: TRect; HOffset: Integer; VOffset: Integer = 0;PixelFormat : TPixelFormat = pfDevice); virtual; + procedure SaveToStream(const Stream: TStream); + function TotalWidth: Integer; + + property ClickIndex: TColumnIndex read FClickIndex; + property Items[Index: TColumnIndex]: TVirtualTreeColumn read GetItem write SetItem; default; + property Header: TVTHeader read FHeader; + property TrackIndex: TColumnIndex read FTrackIndex; + end; + + TVirtualTreeColumnsClass = class of TVirtualTreeColumns; + + TVTHeaderStyle = ( + hsThickButtons, // TButton look and feel + hsFlatButtons, // flatter look than hsThickButton, like an always raised flat TToolButton + hsPlates, // flat TToolButton look and feel (raise on hover etc.) + hsXPStyle // Windows XP style + ); + + TVTHeaderOption = ( + hoAutoResize, // Adjust a column so that the header never exceeds client width of owner control. + hoColumnResize, // Resizing columns with the mouse is allowed. + hoDblClickResize, // Allows a column to resize itself to its largest entry. + hoDrag, // Dragging columns is allowed. + hoHotTrack, // Header captions are highlighted when mouse is over a particular column. + hoOwnerDraw, // Header items with the owner draw style can be drawn by the application via event. + hoRestrictDrag, // Header can only be dragged horizontally. + hoShowHint, // Show application defined header hint. + hoShowImages, // Show header images. + hoShowSortGlyphs, // Allow visible sort glyphs. + hoVisible, // Header is visible. + hoAutoSpring // Distribute size changes of the header to all columns, which are sizable and have the + // coAutoSpring option enabled. hoAutoResize must be enabled too. + ); + TVTHeaderOptions = set of TVTHeaderOption; + + THeaderState = ( + hsAutoSizing, // auto size chain is in progess, do not trigger again on WM_SIZE + hsDragging, // header dragging is in progress (only if enabled) + hsDragPending, // left button is down, user might want to start dragging a column + hsLoading, // The header currently loads from stream, so updates are not necessary. + hsTracking, // column resizing is in progress + hsTrackPending // left button is down, user might want to start resize a column + ); + THeaderStates = set of THeaderState; + + TSortDirection = ( + sdAscending, + sdDescending + ); + + // desribes what made a structure change event happen + TChangeReason = ( + crIgnore, // used as placeholder + crAccumulated, // used for delayed changes + crChildAdded, // one or more child nodes have been added + crChildDeleted, // one or more child nodes have been deleted + crNodeAdded, // a node has been added + crNodeCopied, // a node has been duplicated + crNodeMoved // a node has been moved to a new place + ); + + TVTHeader = class(TPersistent) + private + FOwner: TBaseVirtualTree; + FColumns: TVirtualTreeColumns; + FHeight: Cardinal; + FFont: TFont; + FParentFont: Boolean; + FOptions: TVTHeaderOptions; + FTrackPos: Integer; // Left/right border of this column to quickly calculate its width on resize. + FStates: THeaderStates; // used to keep track of internal states the header can enter + FLeftTrackPos: Integer; // left border of this column to quickly calculate its width on resize + FStyle: TVTHeaderStyle; // button style + FBackground: TColor; + FAutoSizeIndex: TColumnIndex; + FPopupMenu: TPopupMenu; + FMainColumn: TColumnIndex; // the column which holds the tree + FImages: TCustomImageList; + FImageChangeLink: TChangeLink; // connections to the image list to get notified about changes + FSortColumn: TColumnIndex; + FSortDirection: TSortDirection; + FTrackStart: TPoint; // client coordinates of the tracking start point + FDragStart: TPoint; // initial mouse drag position + FDragImage: TVTDragImage; // drag image management during header drag + FLastWidth: Integer; // Used to adjust spring columns. This is the width of all visible columns, + // not the header rectangle. + procedure FontChanged(Sender: TObject); + function GetMainColumn: TColumnIndex; + function GetUseColumns: Boolean; + procedure SetAutoSizeIndex(Value: TColumnIndex); + procedure SetBackground(Value: TColor); + procedure SetColumns(Value: TVirtualTreeColumns); + procedure SetFont(const Value: TFont); + procedure SetHeight(Value: Cardinal); + procedure SetImages(const Value: TCustomImageList); + procedure SetMainColumn(Value: TColumnIndex); + procedure SetOptions(Value: TVTHeaderOptions); + procedure SetParentFont(Value: Boolean); + procedure SetSortColumn(Value: TColumnIndex); + procedure SetSortDirection(const Value: TSortDirection); + procedure SetStyle(Value: TVTHeaderStyle); + protected + function CanWriteColumns: Boolean; virtual; + procedure ChangeScale(M, D: Integer); virtual; + function DetermineSplitterIndex(P: TPoint): Boolean; virtual; + procedure DragTo(P: TPoint); + function GetColumnsClass: TVirtualTreeColumnsClass; virtual; + function GetOwner: TPersistent; override; + function GetShiftState: TShiftState; + function HandleHeaderMouseMove(var Message: TLMMouseMove): Boolean; + function HandleMessage(var Message: TLMessage): Boolean; virtual; + procedure ImageListChange(Sender: TObject); + procedure PrepareDrag(P, Start: TPoint); + procedure ReadColumns(Reader: TReader); + procedure RecalculateHeader; virtual; + procedure UpdateMainColumn; + procedure UpdateSpringColumns; + procedure WriteColumns(Writer: TWriter); + public + constructor Create(AOwner: TBaseVirtualTree); virtual; + destructor Destroy; override; + + procedure Assign(Source: TPersistent); override; + procedure AutoFitColumns(Animated: Boolean = True); + function InHeader(P: TPoint): Boolean; virtual; + procedure Invalidate(Column: TVirtualTreeColumn; ExpandToBorder: Boolean = False); + procedure LoadFromStream(const Stream: TStream); virtual; + procedure RestoreColumns; + procedure SaveToStream(const Stream: TStream); virtual; + + property DragImage: TVTDragImage read FDragImage; + property States: THeaderStates read FStates; + property Treeview: TBaseVirtualTree read FOwner; + property UseColumns: Boolean read GetUseColumns; + published + property AutoSizeIndex: TColumnIndex read FAutoSizeIndex write SetAutoSizeIndex; + property Background: TColor read FBackground write SetBackground default clBtnFace; + property Columns: TVirtualTreeColumns read FColumns write SetColumns stored False; // Stored by the owner tree to + // support VFI. + property Font: TFont read FFont write SetFont; + property Height: Cardinal read FHeight write SetHeight default 17; + property Images: TCustomImageList read FImages write SetImages; + property MainColumn: TColumnIndex read GetMainColumn write SetMainColumn default 0; + property Options: TVTHeaderOptions read FOptions write SetOptions default [hoColumnResize, hoDrag, hoShowSortGlyphs]; + property ParentFont: Boolean read FParentFont write SetParentFont default False; + property PopupMenu: TPopupMenu read FPopupMenu write FPopUpMenu; + property SortColumn: TColumnIndex read FSortColumn write SetSortColumn default NoColumn; + property SortDirection: TSortDirection read FSortDirection write SetSortDirection default sdAscending; + property Style: TVTHeaderStyle read FStyle write SetStyle default hsThickButtons; + end; + + TVTHeaderClass = class of TVTHeader; + + // Communication interface between a tree editor and the tree itself (declared as using stdcall in case it + // is implemented in a (C/C++) DLL). The GUID is not nessecary in Delphi but important for BCB users + // to allow QueryInterface and _uuidof calls. + IVTEditLink = interface + ['{2BE3EAFA-5ACB-45B4-9D9A-B58BCC496E17}'] + function BeginEdit: Boolean; stdcall; // Called when editing actually starts. + function CancelEdit: Boolean; stdcall; // Called when editing has been cancelled by the tree. + function EndEdit: Boolean; stdcall; // Called when editing has been finished by the tree. + function PrepareEdit(Tree: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex): Boolean; stdcall; + // Called after creation to allow a setup. + function GetBounds: TRect; stdcall; // Called to get the current size of the edit window + // (only important if the edit resizes itself). + procedure ProcessMessage(var Message: TLMessage); stdcall; + // Used to forward messages to the edit window(s)- + procedure SetBounds(R: TRect); stdcall; // Called to place the editor. + end; + + // Indicates in the OnUpdating event what state the tree is currently in. + TVTUpdateState = ( + usBegin, // The tree just entered the update state (BeginUpdate call for the first time). + usBeginSynch, // The tree just entered the synch update state (BeginSynch call for the first time). + usSynch, // Begin/EndSynch has been called but the tree did not change the update state. + usUpdate, // Begin/EndUpdate has been called but the tree did not change the update state. + usEnd, // The tree just left the update state (EndUpdate called for the last level). + usEndSynch // The tree just left the synch update state (EndSynch called for the last level). + ); + + // Used during owner draw of the header to indicate which drop mark for the column must be drawn. + TVTDropMarkMode = ( + dmmNone, + dmmLeft, + dmmRight + ); + + // This structure carries all important information about header painting and is used in the advanced header painting. + THeaderPaintInfo = record + TargetCanvas: TCanvas; + Column: TVirtualTreeColumn; + PaintRectangle: TRect; + TextRectangle: TRect; + IsHoverIndex, + IsDownIndex, + IsEnabled, + ShowHeaderGlyph, + ShowSortGlyph, + ShowRightBorder: Boolean; + DropMark: TVTDropMarkMode; + GlyphPos, + SortGlyphPos: TPoint; + end; + + // These elements are used both to query the application, which of them it wants to draw itself and to tell it during + // painting, which elements must be drawn during the advanced custom draw events. + THeaderPaintElements = set of ( + hpeBackground, + hpeDropMark, + hpeHeaderGlyph, + hpeSortGlyph, + hpeText + ); + + // Various events must be handled at different places than they were initiated or need + // a persistent storage until they are reset. + TVirtualTreeStates = set of ( + tsCancelHintAnimation, // Set when a new hint is about to show but an old hint is still being animated. + tsChangePending, // A selection change is pending. + tsCheckPropagation, // Set during automatic check state propagation. + tsCollapsing, // A full collapse operation is in progress. + tsToggleFocusedSelection, // Node selection was modifed using Ctrl-click. Change selection state on next mouse up. + tsClearPending, // Need to clear the current selection on next mouse move. + tsClipboardFlushing, // Set during flushing the clipboard to avoid freeing the content. + tsCopyPending, // Indicates a pending copy operation which needs to be finished. + tsCutPending, // Indicates a pending cut operation which needs to be finished. + tsDrawSelPending, // Multiselection only. User held down the left mouse button on a free + // area and might want to start draw selection. + tsDrawSelecting, // Multiselection only. Draw selection has actually started. + tsEditing, // Indicates that an edit operation is currently in progress. + tsEditPending, // An mouse up start edit if dragging has not started. + tsExpanding, // A full expand operation is in progress. + tsHint, // Set when our hint is visible or soon will be. + tsInAnimation, // Set if the tree is currently in an animation loop. + tsIncrementalSearching, // Set when the user starts incremental search. + tsIncrementalSearchPending, // Set in WM_KEYDOWN to tell to use the char in WM_CHAR for incremental search. + tsIterating, // Set when IterateSubtree is currently in progress. + tsKeyCheckPending, // A check operation is under way, initiated by a key press (space key). Ignore mouse. + tsLeftButtonDown, // Set when the left mouse button is down. + tsMouseCheckPending, // A check operation is under way, initiated by a mouse click. Ignore space key. + tsMiddleButtonDown, // Set when the middle mouse button is down. + tsNeedScale, // On next ChangeScale scale the default node height. + tsNeedRootCountUpdate, // Set if while loading a root node count is set. + tsOLEDragging, // OLE dragging in progress. + tsOLEDragPending, // User has requested to start delayed dragging. + tsPainting, // The tree is currently painting itself. + tsRightButtonDown, // Set when the right mouse button is down. + tsPopupMenuShown, // The user clicked the right mouse button, which might cause a popup menu to appear. + tsScrolling, // Set when autoscrolling is active. + tsScrollPending, // Set when waiting for the scroll delay time to elapse. + tsSizing, // Set when the tree window is being resized. This is used to prevent recursive calls + // due to setting the scrollbars when sizing. + tsStopValidation, // Cache validation can be stopped (usually because a change has occured meanwhile). + tsStructureChangePending, // The structure of the tree has been changed while the update was locked. + tsSynchMode, // Set when the tree is in synch mode, where no timer events are triggered. + tsThumbTracking, // Stop updating the horizontal scroll bar while dragging the vertical thumb and vice versa. + tsUpdateHiddenChildrenNeeded, // Pending update for the hidden children flag after massive visibility changes. + tsUpdating, // The tree does currently not update its window because a BeginUpdate has not yet ended. + tsUseCache, // The tree's node caches are validated and non-empty. + tsUserDragObject, // Signals that the application created an own drag object in OnStartDrag. + tsUseThemes, // The tree runs under WinXP+, is theme aware and themes are enabled. + tsValidating, // The tree's node caches are currently validated. + tsValidationNeeded, // Something in the structure of the tree has changed. The cache needs validation. + tsVCLDragging, // VCL drag'n drop in progress. + tsVCLDragPending, // One-shot flag to avoid clearing the current selection on implicit mouse up for VCL drag. + tsWheelPanning, // Wheel mouse panning is active or soon will be. + tsWheelScrolling, // Wheel mouse scrolling is active or soon will be. + tsWindowCreating // Set during window handle creation to avoid frequent unnecessary updates. + ); + + TChangeStates = set of ( + csStopValidation, // Cache validation can be stopped (usually because a change has occured meanwhile). + csUseCache, // The tree's node caches are validated and non-empty. + csValidating, // The tree's node caches are currently validated. + csValidationNeeded // Something in the structure of the tree has changed. The cache needs validation. + ); + + // determines whether and how the drag image is to show + TVTDragImageKind = ( + diComplete, // show a complete drag image with all columns, only visible columns are shown + diMainColumnOnly, // show only the main column (the tree column) + diNoImage // don't show a drag image at all + ); + + // Switch for OLE and VCL drag'n drop. Because it is not possible to have both simultanously. + TVTDragType = ( + dtOLE, + dtVCL + ); + + // options which determine what to draw in PaintTree + TVTInternalPaintOption = ( + poBackground, // draw background image if there is any and it is enabled + poColumnColor, // erase node's background with the column's color + poDrawFocusRect, // draw focus rectangle around the focused node + poDrawSelection, // draw selected nodes with the normal selection color + poDrawDropMark, // draw drop mark if a node is currently the drop target + poGridLines, // draw grid lines if enabled + poMainOnly, // draw only the main column + poSelectedOnly // draw only selected nodes + ); + TVTInternalPaintOptions = set of TVTInternalPaintOption; + + // Determines the look of a tree's lines. + TVTLineStyle = ( + lsCustomStyle, // application provides a line pattern + lsDotted, // usual dotted lines (default) + lsSolid // simple solid lines + ); + + // TVTLineType is used during painting a tree + TVTLineType = ( + ltNone, // no line at all + ltBottomRight, // a line from bottom to the center and from there to the right + ltTopDown, // a line from top to bottom + ltTopDownRight, // a line from top to bottom and from center to the right + ltRight, // a line from center to the right + ltTopRight, // a line from bottom to center and from there to the right + // special styles for alternative drawings of tree lines + ltLeft, // a line from top to bottom at the left + ltLeftBottom // a combination of ltLeft and a line at the bottom from left to right + ); + + // Determines how to draw tree lines. + TVTLineMode = ( + lmNormal, // usual tree lines (as in TTreeview) + lmBands // looks similar to a Nassi-Schneidermann diagram + ); + + // A collection of line type IDs which is used while painting a node. + TLineImage = array of TVTLineType; + + TVTScrollIncrement = 1..10000; + + // A class to manage scroll bar aspects. + TScrollBarOptions = class(TPersistent) + private + FAlwaysVisible: Boolean; + FOwner: TBaseVirtualTree; + FScrollBars: TScrollStyle; // used to hide or show vertical and/or horizontal scrollbar + FScrollBarStyle: TScrollBarStyle; // kind of scrollbars to use + FIncrementX, + FIncrementY: TVTScrollIncrement; // number of pixels to scroll in one step (when auto scrolling) + procedure SetAlwaysVisible(Value: Boolean); + procedure SetScrollBars(Value: TScrollStyle); + procedure SetScrollBarStyle(Value: TScrollBarStyle); + protected + function GetOwner: TPersistent; override; + public + constructor Create(AOwner: TBaseVirtualTree); + + procedure Assign(Source: TPersistent); override; + published + property AlwaysVisible: Boolean read FAlwaysVisible write SetAlwaysVisible default False; + property HorizontalIncrement: TVTScrollIncrement read FIncrementX write FIncrementX default 20; + property ScrollBars: TScrollStyle read FScrollbars write SetScrollBars default ssBoth; + property ScrollBarStyle: TScrollBarStyle read FScrollBarStyle write SetScrollBarStyle default sbmRegular; + property VerticalIncrement: TVTScrollIncrement read FIncrementY write FIncrementY default 20; + end; + + // class to collect all switchable colors into one place + TVTColors = class(TPersistent) + private + FOwner: TBaseVirtualTree; + FColors: array[0..14] of TColor; + function GetColor(const Index: Integer): TColor; + procedure SetColor(const Index: Integer; const Value: TColor); + public + constructor Create(AOwner: TBaseVirtualTree); + + procedure Assign(Source: TPersistent); override; + published + property BorderColor: TColor index 7 read GetColor write SetColor default clBtnFace; + property DisabledColor: TColor index 0 read GetColor write SetColor default clBtnShadow; + property DropMarkColor: TColor index 1 read GetColor write SetColor default clHighlight; + property DropTargetColor: TColor index 2 read GetColor write SetColor default clHighLight; + property DropTargetBorderColor: TColor index 11 read GetColor write SetColor default clHighLight; + property FocusedSelectionColor: TColor index 3 read GetColor write SetColor default clHighLight; + property FocusedSelectionBorderColor: TColor index 9 read GetColor write SetColor default clHighLight; + property GridLineColor: TColor index 4 read GetColor write SetColor default clBtnFace; + property HeaderHotColor: TColor index 14 read GetColor write SetColor default clBtnShadow; + property HotColor: TColor index 8 read GetColor write SetColor default clWindowText; + property SelectionRectangleBlendColor: TColor index 12 read GetColor write SetColor default clHighlight; + property SelectionRectangleBorderColor: TColor index 13 read GetColor write SetColor default clHighlight; + property TreeLineColor: TColor index 5 read GetColor write SetColor default clBtnShadow; + property UnfocusedSelectionColor: TColor index 6 read GetColor write SetColor default clBtnFace; + property UnfocusedSelectionBorderColor: TColor index 10 read GetColor write SetColor default clBtnFace; + end; + + // For painting a node and its columns/cells a lot of information must be passed frequently to + // the paint methode. + TVTImageInfo = record + Index: Integer; // index in the associated image list + XPos, // horizontal position in the current target canvas + YPos: Integer; // vertical position in the current target canvas + Ghosted: Boolean; // flag to indicate that the image must be drawn slightly lighter + end; + + TVTImageInfoIndex = ( + iiNormal, + iiState, + iiCheck + ); + + // Options which are used when modifying the scroll offsets. + TScrollUpdateOptions = set of ( + suoRepaintHeader, // if suoUpdateNCArea is also set then invalidate the header + suoRepaintScrollbars, // if suoUpdateNCArea is also set then repaint both scrollbars after updating them + suoScrollClientArea, // scroll and invalidate the proper part of the client area + suoUpdateNCArea // update non-client area (scrollbars, header) + ); + + // Determines the look of a tree's buttons. + TVTButtonStyle = ( + bsRectangle, // traditional Windows look (plus/minus buttons) + bsTriangle // traditional Macintosh look + ); + + // TButtonFillMode is only used when the button style is bsRectangle and determines how to fill the interior. + TVTButtonFillMode = ( + fmTreeColor, // solid color, uses the tree's background color + fmWindowColor, // solid color, uses clWindow + fmShaded, // color gradient, Windows XP style (legacy code, use toThemeAware on Windows XP instead) + fmTransparent // transparent color, use the item's background color + ); + + TVTPaintInfo = record + Canvas: TCanvas; // the canvas to paint on + PaintOptions: TVTInternalPaintOptions; // a copy of the paint options passed to PaintTree + Node: PVirtualNode; // the node to paint + Column: TColumnIndex; // the node's column index to paint + Position: TColumnPosition; // the column position of the node + CellRect, // the node cell + ContentRect: TRect; // the area of the cell used for the node's content + NodeWidth: Integer; // the actual node width + Alignment: TAlignment; // how to align within the node rectangle +//b BidiMode: TBidiMode; // directionality to be used for painting + BrushOrigin: TPoint; // the alignment for the brush used to draw dotted lines + ImageInfo: array[TVTImageInfoIndex] of TVTImageInfo; // info about each possible node image + end; + + // Method called by the Animate routine for each animation step. + TVTAnimationCallback = function(Step, StepSize: Integer; Data: Pointer): Boolean of object; + + TVTIncrementalSearch = ( + isAll, // search every node in tree, initialize if necessary + isNone, // disable incremental search + isInitializedOnly, // search only initialized nodes, skip others + isVisibleOnly // search only visible nodes, initialize if necessary + ); + + // Determines which direction to use when advancing nodes during an incremental search. + TVTSearchDirection = ( + sdForward, + sdBackward + ); + + // Determines where to start incremental searching for each key press. + TVTSearchStart = ( + ssAlwaysStartOver, // always use the first/last node (depending on direction) to search from + ssLastHit, // use the last found node + ssFocusedNode // use the currently focused node + ); + + // Determines how to use the align member of a node. + TVTNodeAlignment = ( + naFromBottom, // the align member specifies amount of units (usually pixels) from top border of the node + naFromTop, // align is to be measured from bottom + naProportional // align is to be measure in percent of the entire node height and relative to top + ); + + // Determines how to draw the selection rectangle used for draw selection. + TVTDrawSelectionMode = ( + smDottedRectangle, // same as DrawFocusRect + smBlendedRectangle // alpha blending, uses special colors (see TVTColors) + ); + + TClipboardFormats = class(TStringList) + private + FOwner: TBaseVirtualTree; + public + constructor Create(AOwner: TBaseVirtualTree); virtual; + + function Add(const S: string): Integer; override; + procedure Insert(Index: Integer; const S: string); override; + property Owner: TBaseVirtualTree read FOwner; + end; + + // ----- Event prototypes: + + // node enumeration + TVTGetNodeProc = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Data: Pointer; var Abort: Boolean) of object; + + // node events + TVTChangingEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; var Allowed: Boolean) of object; + TVTCheckChangingEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; var NewState: TCheckState; + var Allowed: Boolean) of object; + TVTChangeEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode) of object; + TVTStructureChangeEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Reason: TChangeReason) of object; + TVTEditCancelEvent = procedure(Sender: TBaseVirtualTree; Column: TColumnIndex) of object; + TVTEditChangingEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex; + var Allowed: Boolean) of object; + TVTEditChangeEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex) of object; + TVTFreeNodeEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode) of object; + TVTFocusChangingEvent = procedure(Sender: TBaseVirtualTree; OldNode, NewNode: PVirtualNode; OldColumn, + NewColumn: TColumnIndex; var Allowed: Boolean) of object; + TVTFocusChangeEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex) of object; + TVTGetImageEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Kind: TVTImageKind; Column: TColumnIndex; + var Ghosted: Boolean; var ImageIndex: Integer) of object; + TVTHotNodeChangeEvent = procedure(Sender: TBaseVirtualTree; OldNode, NewNode: PVirtualNode) of object; + TVTInitChildrenEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; var ChildCount: Cardinal) of object; + TVTInitNodeEvent = procedure(Sender: TBaseVirtualTree; ParentNode, Node: PVirtualNode; + var InitialStates: TVirtualNodeInitStates) of object; + TVTPopupEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex; const P: TPoint; + var AskParent: Boolean; var PopupMenu: TPopupMenu) of object; + TVTHelpContextEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex; + var HelpContext: Integer) of object; + TVTCreateEditorEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex; + out EditLink: IVTEditLink) of object; + TVTSaveNodeEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Stream: TStream) of object; + + // header/column events + TVTHeaderClickEvent = procedure(Sender: TVTHeader; Column: TColumnIndex; Button: TMouseButton; Shift: TShiftState; X, + Y: Integer) of object; + TVTHeaderMouseEvent = procedure(Sender: TVTHeader; Button: TMouseButton; Shift: TShiftState; X, Y: Integer) of object; + TVTHeaderMouseMoveEvent = procedure(Sender: TVTHeader; Shift: TShiftState; X, Y: Integer) of object; + TVTHeaderNotifyEvent = procedure(Sender: TVTHeader; Column: TColumnIndex) of object; + TVTHeaderDraggingEvent = procedure(Sender: TVTHeader; Column: TColumnIndex; var Allowed: Boolean) of object; + TVTHeaderDraggedEvent = procedure(Sender: TVTHeader; Column: TColumnIndex; OldPosition: Integer) of object; + TVTHeaderDraggedOutEvent = procedure(Sender: TVTHeader; Column: TColumnIndex; DropPosition: TPoint) of object; + TVTHeaderPaintEvent = procedure(Sender: TVTHeader; HeaderCanvas: TCanvas; Column: TVirtualTreeColumn; R: TRect; Hover, + Pressed: Boolean; DropMark: TVTDropMarkMode) of object; + TVTHeaderPaintQueryElementsEvent = procedure(Sender: TVTHeader; var PaintInfo: THeaderPaintInfo; + var Elements: THeaderPaintElements) of object; + TVTAdvancedHeaderPaintEvent = procedure(Sender: TVTHeader; var PaintInfo: THeaderPaintInfo; + const Elements: THeaderPaintElements) of object; + TVTColumnClickEvent = procedure (Sender: TBaseVirtualTree; Column: TColumnIndex; Shift: TShiftState) of object; + TVTColumnDblClickEvent = procedure (Sender: TBaseVirtualTree; Column: TColumnIndex; Shift: TShiftState) of object; + TVTGetHeaderCursorEvent = procedure(Sender: TVTHeader; var Cursor: HCURSOR) of object; + + // move and copy events + TVTNodeMovedEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode) of object; + TVTNodeMovingEvent = procedure(Sender: TBaseVirtualTree; Node, Target: PVirtualNode; + var Allowed: Boolean) of object; + TVTNodeCopiedEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode) of object; + TVTNodeCopyingEvent = procedure(Sender: TBaseVirtualTree; Node, Target: PVirtualNode; + var Allowed: Boolean) of object; + + // drag'n drop/OLE events +//x TVTCreateDragManagerEvent = procedure(Sender: TBaseVirtualTree; out DragManager: IVTDragManager) of object; +//x TVTDragAllowedEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex; +//x var Allowed: Boolean) of object; +//x TVTDragOverEvent = procedure(Sender: TBaseVirtualTree; Source: TObject; Shift: TShiftState; State: TDragState; +//x Pt: TPoint; Mode: TDropMode; var Effect: Integer; var Accept: Boolean) of object; +//x TVTDragDropEvent = procedure(Sender: TBaseVirtualTree; Source: TObject; DataObject: IDataObject; +//x Formats: TFormatArray; Shift: TShiftState; Pt: TPoint; var Effect: Integer; Mode: TDropMode) of object; +//x TVTGetUserClipboardFormatsEvent = procedure(Sender: TBaseVirtualTree; var Formats: TFormatEtcArray) of object; + + // paint events + TVTBeforeItemEraseEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect; + var ItemColor: TColor; var EraseAction: TItemEraseAction) of object; + TVTAfterItemEraseEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; Node: PVirtualNode; + ItemRect: TRect) of object; + TVTBeforeItemPaintEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; Node: PVirtualNode; + ItemRect: TRect; var CustomDraw: Boolean) of object; + TVTAfterItemPaintEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; Node: PVirtualNode; + ItemRect: TRect) of object; + TVTBeforeCellPaintEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; Node: PVirtualNode; + Column: TColumnIndex; CellRect: TRect) of object; + TVTAfterCellPaintEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; Node: PVirtualNode; + Column: TColumnIndex; CellRect: TRect) of object; + TVTPaintEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas) of object; + TVTBackgroundPaintEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; R: TRect; + var Handled: Boolean) of object; + TVTGetLineStyleEvent = procedure(Sender: TBaseVirtualTree; var Bits: Pointer) of object; + TVTMeasureItemEvent = procedure(Sender: TBaseVirtualTree; TargetCanvas: TCanvas; Node: PVirtualNode; + var NodeHeight: Integer) of object; + + // search, sort + TVTCompareEvent = procedure(Sender: TBaseVirtualTree; Node1, Node2: PVirtualNode; Column: TColumnIndex; + var Result: Integer) of object; + TVTIncrementalSearchEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; const SearchText: WideString; + var Result: Integer) of object; + + // miscellaneous + TVTGetNodeDataSizeEvent = procedure(Sender: TBaseVirtualTree; var NodeDataSize: Integer) of object; + TVTKeyActionEvent = procedure(Sender: TBaseVirtualTree; var CharCode: Word; var Shift: TShiftState; + var DoDefault: Boolean) of object; + TVTScrollEvent = procedure(Sender: TBaseVirtualTree; DeltaX, DeltaY: Integer) of object; + TVTUpdatingEvent = procedure(Sender: TBaseVirtualTree; State: TVTUpdateState) of object; + TVTGetCursorEvent = procedure(Sender: TBaseVirtualTree; var Cursor: TCursor) of object; + TVTStateChangeEvent = procedure(Sender: TBaseVirtualTree; Enter, Leave: TVirtualTreeStates) of object; + TVTGetCellIsEmptyEvent = procedure(Sender: TBaseVirtualTree; Node: PVirtualNode; Column: TColumnIndex; + var IsEmpty: Boolean) of object; + + // Helper types for node iterations. + TGetFirstNodeProc = function: PVirtualNode of object; + TGetNextNodeProc = function(Node: PVirtualNode): PVirtualNode of object; + + // ----- TBaseVirtualTree + TBaseVirtualTree = class(TCustomControl) + private + FBorderStyle: TBorderStyle; + FHeader: TVTHeader; + FRoot: PVirtualNode; + FDefaultNodeHeight, + FUpdateCount: Cardinal; // update stopper, updates of the tree control are only done if = 0 + FSynchUpdateCount: Cardinal; // synchronizer, causes all events which are usually done via timers + // to happen immediately, regardless of the normal update state + FNodeDataSize: Integer; // number of bytes to allocate with each node (in addition to its base + // structure and the internal data), if -1 then do callback + {$ifdef UseLocalMemoryManager} + FNodeMemoryManager: TVTNodeMemoryManager; // High-performance local memory manager. + {$endif UseLocalMemoryManager} + FLastSelected, + FFocusedNode: PVirtualNode; + FEditColumn, // column to be edited (focused node) + FFocusedColumn: TColumnIndex; // NoColumn if no columns are active otherwise the last hit column of + // the currently focused node + FScrollDirections: TScrollDirections; // directions to scroll client area into depending on mouse position + FLastStructureChangeReason: TChangeReason; // used for delayed structur change event + FLastStructureChangeNode, // dito + FLastChangedNode, // used for delayed change event + FCurrentHotNode: PVirtualNode; // Node over which the mouse is hovering. + FLastSelRect, + FNewSelRect: TRect; // used while doing draw selection + FHotCursor: TCursor; // can be set to additionally indicate the current hot node + FAnimationType: THintAnimationType; // none, fade in, slide in animation (just like those animations used + // in Win98 (slide) and Windows 2000 (fade)) + FHintMode: TVTHintMode; // determines the kind of the hint window + FHintData: TVTHintData; // used while preparing the hint window + FChangeDelay: Cardinal; // used to delay OnChange event + FEditDelay: Cardinal; // determines time to elapse before a node goes into edit mode + FPositionCache: TCache; // array which stores node references ordered by vertical positions + // (see also DoValidateCache for more information) + FVisibleCount: Cardinal; // number of currently visible nodes + FStartIndex: Cardinal; // index to start validating cache from + FSelection: TNodeArray; // list of currently selected nodes + FSelectionCount: Integer; // number of currently selected nodes (size of FSelection might differ) + FRangeAnchor: PVirtualNode; // anchor node for selection with the keyboard, determines start of a + // selection range + FCheckNode: PVirtualNode; // node which "captures" an check event + FPendingCheckState: TCheckState; // the new state the check node will get if all wents fine + FLastSelectionLevel: Integer; // keeps the last node level for constrained multiselection + FDrawSelShiftState: TShiftState; // keeps the initial shift state when the user starts selection with + // the mouse + FEditLink: IVTEditLink; // used to comunicate with an application defined editor + FTempNodeCache: TNodeArray; // used at various places to hold temporarily a bunch of node refs. + FTempNodeCount: Cardinal; // number of nodes in FTempNodeCache + FBackground: TPicture; // A background image loadable at design and runtime. + FBackgroundOffsetX, + FBackgroundOffsetY: Integer; // used to fine tune the position of the background image + FAnimationDuration: Cardinal; // specifies how long an animation shall take (expanding, hint) + FWantTabs: Boolean; // If True then the tree also consumes the tab key. + FNodeAlignment: TVTNodeAlignment; // determines how to interpret the align member of a node + FHeaderRect: TRect; // Space which the header currently uses in the control (window coords). + FLastHintRect: TRect; // Area which the must must leave to reshow a hint. + FUpdateRect: TRect; + + // paint support and images + FPlusBM, + FMinusBM: TBitmap; // small bitmaps used for tree buttons + FImages, // normal images in the tree + FStateImages, // state images in the tree + FCustomCheckImages: TCustomImageList; // application defined check images + FCheckImageKind: TCheckImageKind; // light or dark, cross marks or tick marks + FCheckImages: TCustomImageList; // Reference to global image list to be used for the check images. + FImageChangeLink, + FStateChangeLink, + FCustomCheckChangeLink: TChangeLink; // connections to the image lists + FOldFontChange: TNotifyEvent; // helper method pointer for tracking font changes in the off screen buffer + FButtonStyle: TVTButtonStyle; // style of the tree buttons + FButtonFillMode: TVTButtonFillMode; // for rectangular tree buttons only: how to fill them + FLineStyle: TVTLineStyle; // style of the tree lines + FLineMode: TVTLineMode; // tree lines or bands etc. + FSelectionCurveRadius: Cardinal; // radius for rounded selection rectangles + FSelectionBlendFactor: Byte; // Determines the factor by which the selection rectangle is to be + // faded if enabled. + FDrawSelectionMode: TVTDrawSelectionMode; // determines the paint mode for draw selection + + // alignment and directionality support + FAlignment: TAlignment; // default alignment of the tree if no columns are shown + + FClipboardFormats: TClipboardFormats; // a list of clipboard format descriptions enabled for this tree + + // scroll support + FScrollBarOptions: TScrollBarOptions; // common properties of horizontal and vertical scrollbar + FAutoScrollInterval: TAutoScrollInterval; // determines speed of auto scrolling + FAutoScrollDelay: Cardinal; // amount of milliseconds to wait until autoscrolling becomes active + FAutoExpandDelay: Cardinal; // amount of milliseconds to wait until a node is expanded if it is the + // drop target + FOffsetX, + FOffsetY: Integer; // determines left and top scroll offset + FEffectiveOffsetX: Integer; // Actual position of the horizontal scroll bar (varies depending on bidi mode). + FRangeX, + FRangeY: Cardinal; // current virtual width and height of the tree + + FDefaultPasteMode: TVTNodeAttachMode; // Used to determine where to add pasted nodes to. + FSingletonNodeArray: TNodeArray; // Contains only one element for quick addition of single nodes + // to the selection. + + // search + FIncrementalSearch: TVTIncrementalSearch; // Used to determine whether and how incremental search is to be used. + FSearchTimeout: Cardinal; // Number of milliseconds after which to stop incremental searching. + FSearchBuffer: WideString; // Collects a sequence of keypresses used to do incremental searching. + FLastSearchNode: PVirtualNode; // Reference to node which was last found as search fit. + FSearchDirection: TVTSearchDirection; // Direction to incrementally search the tree. + FSearchStart: TVTSearchStart; // Where to start iteration on each key press. + + // miscellanous + FTotalInternalDataSize: Cardinal; // Cache of the sum of the necessary internal data size for all tree + // classes derived from this base class. + FPanningWindow: HWND; // Helper window for wheel panning + FPanningCursor: HCURSOR; // Current wheel panning cursor. + FPanningImage: TBitmap; // A little 32x32 bitmap to indicate the panning reference point. + FLastClickPos: TPoint; // Used for retained drag start and wheel mouse scrolling. + FTimers: array[1..7] of TCustomTimer; // Helper Array for Timers + + // common events + FOnChange: TVTChangeEvent; // selection change + FOnStructureChange: TVTStructureChangeEvent; // structural change like adding nodes etc. + FOnInitChildren: TVTInitChildrenEvent; // called when a node's children are needed (expanding etc.) + FOnInitNode: TVTInitNodeEvent; // called when a node needs to be initialized (child count etc.) + FOnFreeNode: TVTFreeNodeEvent; // called when a node is about to be destroyed, user data can and should + // be freed in this event + FOnGetImage: TVTGetImageEvent; // used to retrieve the image index of a given node + FOnHotChange: TVTHotNodeChangeEvent; // called when the current "hot" node (that is, the node under the mouse) + // changes and hot tracking is enabled + FOnExpanding, // called just before a node is expanded + FOnCollapsing: TVTChangingEvent; // called just before a node is collapsed + FOnChecking: TVTCheckChangingEvent; // called just before a node's check state is changed + FOnExpanded, // called after a node has been expanded + FOnCollapsed, // called after a node has been collapsed + FOnChecked: TVTChangeEvent; // called after a node's check state has been changed + FOnResetNode: TVTChangeEvent; // called when a node is set to be uninitialized + FOnNodeMoving: TVTNodeMovingEvent; // called just before a node is moved from one parent node to another + // (this can be cancelled) + FOnNodeMoved: TVTNodeMovedEvent; // called after a node and its children have been moved to another + // parent node (probably another tree, but within the same application) + FOnNodeCopying: TVTNodeCopyingEvent; // called when an node is copied to another parent node (probably in + // another tree, but within the same application, can be cancelled) + FOnNodeCopied: TVTNodeCopiedEvent; // call after a node has been copied + FOnEditing: TVTEditChangingEvent; // called just before a node goes into edit mode + FOnEditCancelled: TVTEditCancelEvent; // called when editing has been cancelled + FOnEdited: TVTEditChangeEvent; // called when editing has successfully been finished + FOnFocusChanging: TVTFocusChangingEvent; // called when the focus is about to go to a new node and/or column + // (can be cancelled) + FOnFocusChanged: TVTFocusChangeEvent; // called when the focus goes to a new node and/or column + FOnGetPopupMenu: TVTPopupEvent; // called when the popup for a node needs to be shown + FOnGetHelpContext: TVTHelpContextEvent; // called when a node specific help theme should be called + FOnCreateEditor: TVTCreateEditorEvent; // called when a node goes into edit mode, this allows applications + // to supply their own editor + FOnLoadNode, // called after a node has been loaded from a stream (file, clipboard, + // OLE drag'n drop) to allow an application to load their own data + // saved in OnSaveNode + FOnSaveNode: TVTSaveNodeEvent; // called when a node needs to be serialized into a stream + // (see OnLoadNode) to give the application the opportunity to save + // their node specific, persistent data (note: never save memory + // references) + + // header/column mouse events + FOnHeaderClick, // mouse events for the header, just like those for a control + FOnHeaderDblClick: TVTHeaderClickEvent; + FOnHeaderMouseDown, + FOnHeaderMouseUp: TVTHeaderMouseEvent; + FOnHeaderMouseMove: TVTHeaderMouseMoveEvent; + FOnColumnClick: TVTColumnClickEvent; + FOnColumnDblClick: TVTColumnDblClickEvent; + FOnColumnResize: TVTHeaderNotifyEvent; + FOnGetHeaderCursor: TVTGetHeaderCursorEvent; // triggered to allow the app. to use customized cursors for the header + + // paint events + FOnAfterPaint, // triggered when the tree has entirely been painted + FOnBeforePaint: TVTPaintEvent; // triggered when the tree is about to be painted + FOnAfterItemPaint: TVTAfterItemPaintEvent; // triggered after an item has been painted + FOnBeforeItemPaint: TVTBeforeItemPaintEvent; // triggered when an item is about to be painted + FOnBeforeItemErase: TVTBeforeItemEraseEvent; // triggered when an item's background is about to be erased + FOnAfterItemErase: TVTAfterItemEraseEvent; // triggered after an item's background has been erased + FOnAfterCellPaint: TVTAfterCellPaintEvent; // triggered after a column of an item has been painted + FOnBeforeCellPaint: TVTBeforeCellPaintEvent; // triggered when a column of an item is about to be painted + FOnHeaderDraw: TVTHeaderPaintEvent; // Used when owner draw is enabled for the header and a column is set + // to owner draw mode. + FOnHeaderDrawQueryElements: TVTHeaderPaintQueryElementsEvent; // Used for advanced header painting to query the + // application for the elements, which are drawn by it and which should + // be drawn by the tree. + FOnAdvancedHeaderDraw: TVTAdvancedHeaderPaintEvent; // Used when owner draw is enabled for the header and a column + // is set to owner draw mode. But only if OnHeaderDrawQueryElements + // returns at least one element to be drawn by the application. + // In this case OnHeaderDraw is not used. + FOnGetLineStyle: TVTGetLineStyleEvent; // triggered when a custom line style is used and the pattern brush + // needs to be build + FOnPaintBackground: TVTBackgroundPaintEvent; // triggered if a part of the tree's background must be erased which is + // not covered by any node + FOnMeasureItem: TVTMeasureItemEvent; // Triggered when a node is about to be drawn and its height was not yet + // determined by the application. + + // miscellanous events + FOnGetNodeDataSize: TVTGetNodeDataSizeEvent; // Called if NodeDataSize is -1. + FOnKeyAction: TVTKeyActionEvent; // Used to selectively prevent key actions (full expand on Ctrl+'+' etc.). + FOnScroll: TVTScrollEvent; // Called when one or both paint offsets changed. + FOnUpdating: TVTUpdatingEvent; // Called from BeginUpdate, EndUpdate, BeginSynch and EndSynch. + FOnGetCursor: TVTGetCursorEvent; // Called to allow the app. to set individual cursors. + FOnStateChange: TVTStateChangeEvent; // Called whenever a state in the tree changes. + FOnGetCellIsEmpty: TVTGetCellIsEmptyEvent; // Called when the tree needs to know if a cell is empty. + + // search, sort + FOnCompareNodes: TVTCompareEvent; // used during sort + + procedure AdjustCoordinatesByIndent(var PaintInfo: TVTPaintInfo; Indent: Integer); + procedure AdjustImageBorder(Images: TCustomImageList; BidiMode: TBidiMode; VAlign: Integer; var R: TRect; + var ImageInfo: TVTImageInfo); + procedure AdjustTotalCount(Node: PVirtualNode; Value: Integer; relative: Boolean = False); + procedure AdjustTotalHeight(Node: PVirtualNode; Value: Integer; relative: Boolean = False); + function CalculateCacheEntryCount: Integer; + procedure CalculateVerticalAlignments(ShowImages, ShowStateImages: Boolean; Node: PVirtualNode; var VAlign, + VButtonAlign: Integer); + function ChangeCheckState(Node: PVirtualNode; Value: TCheckState): Boolean; + function CollectSelectedNodesLTR(MainColumn, NodeLeft, NodeRight: Integer; Alignment: TAlignment; OldRect, + NewRect: TRect): Boolean; + function CollectSelectedNodesRTL(MainColumn, NodeLeft, NodeRight: Integer; Alignment: TAlignment; OldRect, + NewRect: TRect): Boolean; + procedure ClearNodeBackground(const PaintInfo: TVTPaintInfo; UseBackground, xFloating: Boolean; R: TRect); + function CompareNodePositions(Node1, Node2: PVirtualNode): Integer; + procedure DrawLineImage(const PaintInfo: TVTPaintInfo; X, Y, H, VAlign: Integer; Style: TVTLineType; Reverse: Boolean); + function FindInPositionCache(Node: PVirtualNode; var CurrentPos: Cardinal): PVirtualNode; overload; + function FindInPositionCache(Position: Cardinal; var CurrentPos: Cardinal): PVirtualNode; overload; + function GetCheckState(Node: PVirtualNode): TCheckState; + function GetCheckType(Node: PVirtualNode): TCheckType; + function GetChildCount(Node: PVirtualNode): Cardinal; + function GetChildrenInitialized(Node: PVirtualNode): Boolean; + function GetDisabled(Node: PVirtualNode): Boolean; + function GetExpanded(Node: PVirtualNode): Boolean; + function GetFullyVisible(Node: PVirtualNode): Boolean; + function GetHasChildren(Node: PVirtualNode): Boolean; + function GetMultiline(Node: PVirtualNode): Boolean; + function GetNodeHeight(Node: PVirtualNode): Cardinal; + function GetNodeParent(Node: PVirtualNode): PVirtualNode; + function GetOffsetXY: TPoint; + function GetRootNodeCount: Cardinal; + function GetSelected(Node: PVirtualNode): Boolean; + function GetTopNode: PVirtualNode; + function GetTotalCount: Cardinal; + function GetVerticalAlignment(Node: PVirtualNode): Byte; + function GetVisible(Node: PVirtualNode): Boolean; + function GetVisiblePath(Node: PVirtualNode): Boolean; + procedure HandleClickSelection(LastFocused, NewNode: PVirtualNode; Shift: TShiftState; DragPending: Boolean); + function HandleDrawSelection(X, Y: Integer): Boolean; + function HasVisibleNextSibling(Node: PVirtualNode): Boolean; + procedure ImageListChange(Sender: TObject); + procedure InitializeFirstColumnValues(var PaintInfo: TVTPaintInfo); + function InitializeLineImageAndSelectLevel(Node: PVirtualNode; var LineImage: TLineImage): Integer; + procedure InitRootNode(OldSize: Cardinal = 0); + procedure InterruptValidation; + function IsFirstVisibleChild(xParent, Node: PVirtualNode): Boolean; + function IsLastVisibleChild(xParent, Node: PVirtualNode): Boolean; + procedure LimitPaintingToArea(xCanvas: TCanvas; ClipRect: TRect; VisibleRegion: HRGN = 0); + function MakeNewNode: PVirtualNode; + function PackArray(TheArray: TNodeArray; Count: Integer): Integer; + procedure PrepareBitmaps(NeedButtons, NeedLines: Boolean); + procedure PrepareCell(var PaintInfo: TVTPaintInfo; WindowOrgX, MaxWidth: Integer); + procedure SetAlignment(const Value: TAlignment); + procedure SetAnimationDuration(const Value: Cardinal); + procedure SetBackground(const Value: TPicture); + procedure SetBackgroundOffset(const Index, Value: Integer); + procedure SetBorderStyle(Value: TBorderStyle); override; + procedure SetButtonFillMode(const Value: TVTButtonFillMode); + procedure SetButtonStyle(const Value: TVTButtonStyle); + procedure SetCheckImageKind(Value: TCheckImageKind); + procedure SetCheckState(Node: PVirtualNode; Value: TCheckState); + procedure SetCheckType(Node: PVirtualNode; Value: TCheckType); + procedure SetChildCount(Node: PVirtualNode; NewChildCount: Cardinal); + procedure SetClipboardFormats(const Value: TClipboardFormats); + procedure SetColors(const Value: TVTColors); + procedure SetCustomCheckImages(const Value: TCustomImageList); + procedure SetDefaultNodeHeight(Value: Cardinal); + procedure SetDisabled(Node: PVirtualNode; Value: Boolean); + procedure SetExpanded(Node: PVirtualNode; Value: Boolean); + procedure SetFocusedColumn(Value: TColumnIndex); + procedure SetFocusedNode(Value: PVirtualNode); + procedure SetFullyVisible(Node: PVirtualNode; Value: Boolean); + procedure SetHasChildren(Node: PVirtualNode; Value: Boolean); + procedure SetHeader(const Value: TVTHeader); + procedure SetImages(const Value: TCustomImageList); + procedure SetIndent(Value: Cardinal); + procedure SetLineMode(const Value: TVTLineMode); + procedure SetLineStyle(const Value: TVTLineStyle); + procedure SetMargin(Value: Integer); + procedure SetMultiline(Node: PVirtualNode; const Value: Boolean); + procedure SetNodeAlignment(const Value: TVTNodeAlignment); + procedure SetNodeDataSize(Value: Integer); + procedure SetNodeHeight(Node: PVirtualNode; Value: Cardinal); + procedure SetNodeParent(Node: PVirtualNode; const Value: PVirtualNode); + procedure SetOffsetX(const Value: Integer); + procedure SetOffsetXY(const Value: TPoint); + procedure SetOffsetY(const Value: Integer); + procedure SetOptions(const Value: TVirtualTreeOptions); + procedure SetRootNodeCount(Value: Cardinal); + procedure SetScrollBarOptions(Value: TScrollBarOptions); + procedure SetSearchOption(const Value: TVTIncrementalSearch); + procedure SetSelected(Node: PVirtualNode; Value: Boolean); + procedure SetSelectionCurveRadius(const Value: Cardinal); + procedure SetStateImages(const Value: TCustomImageList); + procedure SetTextMargin(Value: Integer); + procedure SetTopNode(Node: PVirtualNode); + procedure SetUpdateState(xUpdating: Boolean); + procedure SetVerticalAlignment(Node: PVirtualNode; Value: Byte); + procedure SetVisible(Node: PVirtualNode; Value: Boolean); + procedure SetVisiblePath(Node: PVirtualNode; Value: Boolean); + procedure StartTimer(ID: Integer; Interval: Integer); + procedure OnTimer(Sender: TObject); + procedure StopTimer(ID: Integer); + procedure TileBackground(Source: TBitmap; Target: TCanvas; Offset: TPoint; R: TRect); + function ToggleCallback(Step, StepSize: Integer; Data: Pointer): Boolean; +//nfl = not found/supported in lcl +//nfl procedure CMColorChange(var Message: TLMessage); message CM_COLORCHANGED; +//nfl procedure CMCtl3DChanged(var Message: TLMessage); message CM_CTL3DCHANGED; +//nfl procedure CMDenySubclassing(var Message: TLMessage); message CM_DENYSUBCLASSING; +//later:test if we need it procedure CMEnabledChanged(var Message: TLMessage); message CM_ENABLEDCHANGED; +//nfl procedure CMFontChanged(var Message: TLMessage); message CM_FONTCHANGED; +//later:buggy procedure CMHintShow(var Message: TCMHintShow); message CM_HINTSHOW; +//nfl procedure CMHintShowPause(var Message: TCMHintShowPause); message CM_HINTSHOWPAUSE; + procedure CMMouseLeave(var Message: TLMessage); message CM_MOUSELEAVE; + procedure CMMouseWheel(var Message: TLMMouseEvent); message LM_MOUSEWHEEL; +//nfl procedure CMSysColorChange(var Message: TLMessage); message CM_SYSCOLORCHANGE; +//? procedure TVMGetItem(var Message: TLMessage); message TVM_GETITEM; +//? procedure TVMGetItemRect(var Message: TLMessage); message TVM_GETITEMRECT; +//? procedure TVMGetNextItem(var Message: TLMessage); message TVM_GETNEXTITEM; + procedure WMCancelMode(var Message: TLMNoParams {TWMCancelMode}); message LM_CANCELMODE; +//later:test if we need it procedure WMChangeState(var Message: TLMessage); message WM_CHANGESTATE; + procedure WMChar(var Message: TLMChar); message LM_CHAR; +//todo procedure WMContextMenu(var Message: TLMContextMenu); message LM_CONTEXTMENU; + procedure WMCopy(var Message: TLMNoParams {TWMCopy}); message LM_COPYTOCLIP; + procedure WMCut(var Message: TLMNoParams {TWMCut}); message LM_CUTTOCLIP; +//later:test if we need it procedure WMEnable(var Message: TLMEnable); message LM_ENABLE;*) + procedure WMEraseBkgnd(var Message: TLMEraseBkgnd); message LM_ERASEBKGND; + procedure WMGetDlgCode(var Message: TLMNoParams {TWMGetDlgCode}); message LM_GETDLGCODE; + procedure WMHScroll(var Message: TLMHScroll); message LM_HSCROLL; + procedure WMKeyDown(var Message: TLMKeyDown); message LM_KEYDOWN; + procedure WMKeyUp(var Message: TLMKeyUp); message LM_KEYUP; + procedure WMKillFocus(var Msg: TLMKillFocus); message LM_KILLFOCUS; + procedure WMLButtonDblClk(var Message: TLMLButtonDblClk); message LM_LBUTTONDBLCLK; + procedure WMLButtonDown(var Message: TLMLButtonDown); message LM_LBUTTONDOWN; + procedure WMLButtonUp(var Message: TLMLButtonUp); message LM_LBUTTONUP; + procedure WMMButtonDblClk(var Message: TLMMButtonDblClk); message LM_MBUTTONDBLCLK; + procedure WMMButtonDown(var Message: TLMMButtonDown); message LM_MBUTTONDOWN; + procedure WMMButtonUp(var Message: TLMMButtonUp); message LM_MBUTTONUP; +//nfl procedure WMNCCalcSize(var Message: TLMNCCalcSize); message LM_NCCALCSIZE; +//nfl procedure WMNCDestroy(var Message: TLMNCDestroy); message LM_NCDESTROY; +//nfl procedure WMNCHitTest(var Message: TLMNCHitTest); message LM_NCHITTEST; +//nfl procedure WMNCPaint(var Message: TRealWMNCPaint); message LM_NCPAINT; + procedure WMPaint(var Message: TLMPaint); message LM_PAINT; + procedure WMPaste(var Message: TLMNoParams {TWMPaste}); message LM_PASTEFROMCLIP; +//nfl procedure WMPrint(var Message: TLMPrint); message LM_PRINT; +//nfl procedure WMPrintClient(var Message: TLMPrintClient); message LM_PRINTCLIENT;*) + procedure WMRButtonDblClk(var Message: TLMRButtonDblClk); message LM_RBUTTONDBLCLK; + procedure WMRButtonDown(var Message: TLMRButtonDown); message LM_RBUTTONDOWN; + procedure WMRButtonUp(var Message: TLMRButtonUp); message LM_RBUTTONUP; +{ todo: LCL never sends WM_SETCURSOR messages, use OnMouseMove and then set cursor } +//nfl procedure WMSetCursor(var Message: TWMSetCursor); message WM_SETCURSOR; + procedure WMSetFocus(var Msg: TLMSetFocus); message LM_SETFOCUS; + procedure Resize; override; // was WMSize(var Message: TWMSize); message WM_SIZE; + procedure WMTimer(var Message: TLMessage); // message LM_TIMER; called by OnTimer function + {$ifdef ThemeSupport} + procedure WMThemeChanged(var Message: TLMessage); message WM_THEMECHANGED; + {$endif ThemeSupport} + procedure WMVScroll(var Message: TLMVScroll); message LM_VSCROLL; +// procedure Invalidate; override; +// procedure InvalidateRect(xHandle: Integer; aRect: PRect; Erase: Boolean); + protected + FOptions: TVirtualTreeOptions; + FTextMargin: Integer; // space between the node's text and its horizontal bounds + FStates: TVirtualTreeStates; // various active/pending states the tree needs to consider + FColors: TVTColors; // class comprising all customizable colors in the tree + FFontChanged: Boolean; // flag for keeping informed about font changes in the off screen buffer + FOnIncrementalSearch: TVTIncrementalSearchEvent; // triggered on every key press (not key down) + FMargin: Integer; // horizontal border distance + FIndent: Cardinal; + procedure AddToSelection(Node: PVirtualNode); overload; + procedure AddToSelection(const NewItems: TNodeArray; NewLength: Integer; ForceInsert: Boolean = False); overload; + procedure AdjustPaintCellRect(var PaintInfo: TVTPaintInfo; var NextNonEmpty: TColumnIndex); virtual; + procedure AdjustPanningCursor(X, Y: Integer); + procedure AdviseChangeEvent(StructureChange: Boolean; Node: PVirtualNode; Reason: TChangeReason); + function AllocateInternalDataArea(Size: Cardinal): Cardinal; + procedure Animate(Steps, Duration: Cardinal; Callback: TVTAnimationCallback; Data: Pointer); + function CalculateSelectionRect(X, Y: Integer): Boolean; + function CanAutoScroll: Boolean; virtual; + function CanEdit(Node: PVirtualNode; Column: TColumnIndex): Boolean; virtual; + procedure Change(Node: PVirtualNode); + procedure ChangeScale(M, D: Integer); override; + function CheckParentCheckState(Node: PVirtualNode; NewCheckState: TCheckState): Boolean; + procedure ClearTempCache; + function ColumnIsEmpty(Node: PVirtualNode; Column: TColumnIndex): Boolean; virtual; + function CountLevelDifference(Node1, Node2: PVirtualNode): Integer; + function CountVisibleChildren(Node: PVirtualNode): Cardinal; + procedure CreateParams(var Params: TCreateParams); override; + procedure CreateWnd; override; + procedure DefineProperties(Filer: TFiler); override; + procedure DetermineHiddenChildrenFlag(Node: PVirtualNode); + procedure DetermineHiddenChildrenFlagAllNodes; + procedure DetermineHitPositionLTR(var HitInfo: THitInfo; Offset, Right: Integer; Alignment: TAlignment); virtual; + procedure DetermineHitPositionRTL(var HitInfo: THitInfo; Offset, Right: Integer; Alignment: TAlignment); virtual; + function DetermineNextCheckState(CheckType: TCheckType; CheckState: TCheckState): TCheckState; virtual; + function DetermineScrollDirections(X, Y: Integer): TScrollDirections; + procedure DoAdvancedHeaderDraw(var PaintInfo: THeaderPaintInfo; const Elements: THeaderPaintElements); virtual; + procedure DoAfterCellPaint(xCanvas: TCanvas; Node: PVirtualNode; Column: TColumnIndex; CellRect: TRect); virtual; + procedure DoAfterItemErase(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect); virtual; + procedure DoAfterItemPaint(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect); virtual; + procedure DoAfterPaint(xCanvas: TCanvas); virtual; + procedure DoAutoScroll(X, Y: Integer); virtual; + procedure DoBeforeCellPaint(xCanvas: TCanvas; Node: PVirtualNode; Column: TColumnIndex; CellRect: TRect); virtual; + procedure DoBeforeItemErase(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect; var xColor: TColor; + var EraseAction: TItemEraseAction); virtual; + function DoBeforeItemPaint(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect): Boolean; virtual; + procedure DoBeforePaint(xCanvas: TCanvas); virtual; + function DoCancelEdit: Boolean; virtual; + procedure DoCanEdit(Node: PVirtualNode; Column: TColumnIndex; var Allowed: Boolean); virtual; + procedure DoChange(Node: PVirtualNode); virtual; + procedure DoCheckClick(Node: PVirtualNode; NewCheckState: TCheckState); virtual; + procedure DoChecked(Node: PVirtualNode); virtual; + function DoChecking(Node: PVirtualNode; var NewCheckState: TCheckState): Boolean; virtual; + procedure DoCollapsed(Node: PVirtualNode); virtual; + function DoCollapsing(Node: PVirtualNode): Boolean; virtual; + procedure DoColumnClick(Column: TColumnIndex; Shift: TShiftState); virtual; + procedure DoColumnDblClick(Column: TColumnIndex; Shift: TShiftState); virtual; + procedure DoColumnResize(Column: TColumnIndex); virtual; + function DoCompare(Node1, Node2: PVirtualNode; Column: TColumnIndex): Integer; virtual; + function DoCreateEditor(Node: PVirtualNode; Column: TColumnIndex): IVTEditLink; virtual; + procedure DoEdit; virtual; + function DoEndEdit: Boolean; virtual; + procedure DoExpanded(Node: PVirtualNode); virtual; + function DoExpanding(Node: PVirtualNode): Boolean; virtual; + procedure DoFocusChange(Node: PVirtualNode; Column: TColumnIndex); virtual; + function DoFocusChanging(OldNode, NewNode: PVirtualNode; OldColumn, NewColumn: TColumnIndex): Boolean; virtual; + procedure DoFocusNode(Node: PVirtualNode; Ask: Boolean); virtual; + procedure DoFreeNode(Node: PVirtualNode); virtual; + function DoGetAnimationType: THintAnimationType; virtual; + procedure DoGetCursor(var xCursor: TCursor); virtual; + procedure DoGetHeaderCursor(var xCursor: HCURSOR); virtual; + procedure DoGetImageIndex(Node: PVirtualNode; Kind: TVTImageKind; Column: TColumnIndex; + var Ghosted: Boolean; var Index: Integer); virtual; + procedure DoGetLineStyle(var Bits: Pointer); virtual; + function DoGetNodeHint(Node: PVirtualNode; Column: TColumnIndex): WideString; virtual; + function DoGetNodeTooltip(Node: PVirtualNode; Column: TColumnIndex): WideString; virtual; + function DoGetNodeWidth(Node: PVirtualNode; Column: TColumnIndex; xCanvas: TCanvas = nil): Integer; virtual; + function DoGetPopupMenu(Node: PVirtualNode; Column: TColumnIndex; Position: TPoint): TPopupMenu; virtual; +//x procedure DoGetUserClipboardFormats(var Formats: TFormatEtcArray); virtual; + procedure DoHeaderClick(Column: TColumnIndex; Button: TMouseButton; Shift: TShiftState; X, Y: Integer); virtual; + procedure DoHeaderDblClick(Column: TColumnIndex; Button: TMouseButton; Shift: TShiftState; X, Y: Integer); virtual; + procedure DoHeaderDraw(xCanvas: TCanvas; Column: TVirtualTreeColumn; R: TRect; Hover, Pressed: Boolean; + DropMark: TVTDropMarkMode); virtual; + procedure DoHeaderDrawQueryElements(var PaintInfo: THeaderPaintInfo; var Elements: THeaderPaintElements); virtual; + procedure DoHeaderMouseDown(Button: TMouseButton; Shift: TShiftState; X, Y: Integer); virtual; + procedure DoHeaderMouseMove(Shift: TShiftState; X, Y: Integer); virtual; + procedure DoHeaderMouseUp(Button: TMouseButton; Shift: TShiftState; X, Y: Integer); virtual; + procedure DoHotChange(Old, New: PVirtualNode); virtual; + function DoIncrementalSearch(Node: PVirtualNode; const xText: WideString): Integer; virtual; + procedure DoInitChildren(Node: PVirtualNode; var ChildCount: Cardinal); virtual; + procedure DoInitNode(xParent, Node: PVirtualNode; var InitStates: TVirtualNodeInitStates); virtual; + function DoKeyAction(var CharCode: Word; var Shift: TShiftState): Boolean; virtual; + procedure DoLoadUserData(Node: PVirtualNode; Stream: TStream); virtual; + procedure DoMeasureItem(TargetCanvas: TCanvas; Node: PVirtualNode; var NodeHeight: Integer); virtual; + procedure DoNodeCopied(Node: PVirtualNode); virtual; + function DoNodeCopying(Node, NewParent: PVirtualNode): Boolean; virtual; + procedure DoNodeMoved(Node: PVirtualNode); virtual; + function DoNodeMoving(Node, NewParent: PVirtualNode): Boolean; virtual; + function DoPaintBackground(xCanvas: TCanvas; R: TRect): Boolean; virtual; + procedure DoPaintNode(var PaintInfo: TVTPaintInfo); virtual; + procedure DoPopupMenu(Node: PVirtualNode; Column: TColumnIndex; Position: TPoint); virtual; + procedure DoReset(Node: PVirtualNode); virtual; + procedure DoSaveUserData(Node: PVirtualNode; Stream: TStream); virtual; + procedure DoScroll(DeltaX, DeltaY: Integer); virtual; + function DoSetOffsetXY(Value: TPoint; Options: TScrollUpdateOptions; ClipRect: PRect = nil): Boolean; virtual; + procedure DoStateChange(Enter: TVirtualTreeStates; Leave: TVirtualTreeStates = []); virtual; + procedure DoStructureChange(Node: PVirtualNode; Reason: TChangeReason); virtual; + procedure DoTimerScroll; + procedure DoUpdating(State: TVTUpdateState); virtual; + function DoValidateCache: Boolean; + procedure DrawDottedHLine(const PaintInfo: TVTPaintInfo; xLeft, Right, xTop: Integer); + procedure DrawDottedVLine(const PaintInfo: TVTPaintInfo; xTop, Bottom, xLeft: Integer); + function FindNodeInSelection(P: PVirtualNode; var Index: Integer; LowBound, HighBound: Integer): Boolean; + procedure FinishChunkHeader(Stream: TStream; StartPos, EndPos: Integer); + procedure FontChanged(AFont: TObject); override; + function GetBorderDimensions: TSize; + function GetCheckImage(Node: PVirtualNode): Integer; virtual; + function GetColumnClass: TVirtualTreeColumnClass; virtual; + function GetHeaderClass: TVTHeaderClass; virtual; + function GetImageIndex(Node: PVirtualNode; Kind: TVTImageKind; Column: TColumnIndex; var Ghosted: Boolean): Integer; + function GetMaxRightExtend: Cardinal; +//x procedure GetNativeClipboardFormats(var Formats: TFormatEtcArray); virtual;*) + function GetOptionsClass: TTreeOptionsClass; virtual; + procedure GetTextInfo(Node: PVirtualNode; Column: TColumnIndex; const AFont: TFont; var R: TRect; + var xText: WideString); virtual; + procedure HandleHotTrack(X, Y: Integer); + procedure HandleIncrementalSearch(CharCode: Word); + procedure HandleMouseDblClick(var Message: TLMMouse; const HitInfo: THitInfo); + procedure HandleMouseDown(var Message: TLMMouse; const HitInfo: THitInfo); + procedure HandleMouseUp(var Message: TLMMouse; const HitInfo: THitInfo); + function HasPopupMenu(Node: PVirtualNode; Column: TColumnIndex; Pos: TPoint): Boolean; virtual; + procedure InitChildren(Node: PVirtualNode); + procedure InitNode(Node: PVirtualNode); + procedure InternalAddFromStream(Stream: TStream; Version: Integer; Node: PVirtualNode); + function InternalAddToSelection(Node: PVirtualNode; ForceInsert: Boolean): Boolean; overload; + function InternalAddToSelection(NewItems: TNodeArray; NewLength: Integer; + ForceInsert: Boolean): Boolean; overload; + procedure InternalCacheNode(Node: PVirtualNode); + procedure InternalClearSelection; + procedure InternalConnectNode(Node, Destination: PVirtualNode; Target: TBaseVirtualTree; Mode: TVTNodeAttachMode); + function InternalData(Node: PVirtualNode): Pointer; + procedure InternalDisconnectNode(Node: PVirtualNode; KeepFocus: Boolean; Reindex: Boolean = True); + procedure InternalRemoveFromSelection(Node: PVirtualNode); + procedure InvalidateCache; + procedure Loaded; override; + procedure MainColumnChanged; virtual; + procedure MarkCutCopyNodes; + procedure MouseMove(Shift: TShiftState; X, Y: Integer); override; + procedure Notification(AComponent: TComponent; Operation: TOperation); override; + procedure OriginalWMNCPaint(DC: HDC); + procedure Paint; override; + procedure PaintCheckImage(const PaintInfo: TVTPaintInfo); virtual; + procedure PaintImage(const PaintInfo: TVTPaintInfo; ImageInfoIndex: TVTImageInfoIndex; Images: TCustomImageList; + DoOverlay: Boolean); virtual; + procedure PaintNodeButton(xCanvas: TCanvas; Node: PVirtualNode; const R: TRect; ButtonX, ButtonY: Integer; + BidiMode: TBiDiMode); virtual; + procedure PaintTreeLines(const PaintInfo: TVTPaintInfo; VAlignment, IndentSize: Integer; + LineImage: TLineImage); virtual; + procedure PaintSelectionRectangle(Target: TCanvas; WindowOrgX: Integer; const SelectionRect: TRect; + TargetRect: TRect); + procedure PanningWindowProc(var Message: TLMessage); + function ReadChunk(Stream: TStream; Version: Integer; Node: PVirtualNode; ChunkType, + ChunkSize: Integer): Boolean; virtual; + procedure ReadNode(Stream: TStream; Version: Integer; Node: PVirtualNode); virtual; + procedure RedirectFontChangeEvent(xCanvas: TCanvas); + procedure RemoveFromSelection(Node: PVirtualNode); +//x function RenderOLEData(const FormatEtcIn: TFormatEtc; out Medium: TStgMedium; ForClipboard: Boolean): HResult; virtual; + procedure ResetRangeAnchor; + procedure RestoreFontChangeEvent(xCanvas: TCanvas); + procedure SelectNodes(StartNode, EndNode: PVirtualNode; AddOnly: Boolean); + procedure SetFocusedNodeAndColumn(Node: PVirtualNode; Column: TColumnIndex); + procedure SkipNode(Stream: TStream); virtual; + procedure StartWheelPanning(Position: TPoint); + procedure StopWheelPanning; + procedure StructureChange(Node: PVirtualNode; Reason: TChangeReason); + function SuggestDropEffect(Source: TObject; Shift: TShiftState; Pt: TPoint; AllowedEffects: Integer): Integer; virtual; + procedure ToggleSelection(StartNode, EndNode: PVirtualNode); + procedure UnselectNodes(StartNode, EndNode: PVirtualNode); + procedure UpdateDesigner; + procedure UpdateEditBounds; + procedure UpdateHeaderRect; + procedure ValidateCache; + procedure ValidateNodeDataSize(var Size: Integer); virtual; + procedure WndProc(var Message: TLMessage); override; + procedure WriteChunks(Stream: TStream; Node: PVirtualNode); virtual; + procedure WriteNode(Stream: TStream; Node: PVirtualNode); + + property Alignment: TAlignment read FAlignment write SetAlignment default taLeftJustify; + property AnimationDuration: Cardinal read FAnimationDuration write SetAnimationDuration default 200; + property AutoExpandDelay: Cardinal read FAutoExpandDelay write FAutoExpandDelay default 1000; + property AutoScrollDelay: Cardinal read FAutoScrollDelay write FAutoScrollDelay default 1000; + property AutoScrollInterval: TAutoScrollInterval read FAutoScrollInterval write FAutoScrollInterval default 1; + property Background: TPicture read FBackground write SetBackground; + property BackgroundOffsetX: Integer index 0 read FBackgroundOffsetX write SetBackgroundOffset default 0; + property BackgroundOffsetY: Integer index 1 read FBackgroundOffsetY write SetBackgroundOffset default 0; + property BorderStyle: TBorderStyle read FBorderStyle write SetBorderStyle default bsSingle; + property ButtonFillMode: TVTButtonFillMode read FButtonFillMode write SetButtonFillMode default fmTreeColor; + property ButtonStyle: TVTButtonStyle read FButtonStyle write SetButtonStyle default bsRectangle; + property ChangeDelay: Cardinal read FChangeDelay write FChangeDelay default 0; + property CheckImageKind: TCheckImageKind read FCheckImageKind write SetCheckImageKind default ckLightCheck; + property ClipboardFormats: TClipboardFormats read FClipboardFormats write SetClipboardFormats; + property Colors: TVTColors read FColors write SetColors; + property CustomCheckImages: TCustomImageList read FCustomCheckImages write SetCustomCheckImages; + property DefaultPasteMode: TVTNodeAttachMode read FDefaultPasteMode write FDefaultPasteMode default amAddChildLast; + property DefaultNodeHeight: Cardinal read FDefaultNodeHeight write SetDefaultNodeHeight default 18; + property DrawSelectionMode: TVTDrawSelectionMode read FDrawSelectionMode write FDrawSelectionMode + default smDottedRectangle; + property EditDelay: Cardinal read FEditDelay write FEditDelay default 1000; + property Header: TVTHeader read FHeader write SetHeader; + property HeaderRect: TRect read FHeaderRect; + property HintAnimation: THintAnimationType read FAnimationType write FAnimationType default hatSystemDefault; + property HintMode: TVTHintMode read FHintMode write FHintMode default hmDefault; + property HotCursor: TCursor read FHotCursor write FHotCursor default crDefault; + property Images: TCustomImageList read FImages write SetImages; + property IncrementalSearch: TVTIncrementalSearch read FIncrementalSearch write SetSearchOption default isNone; + property IncrementalSearchDirection: TVTSearchDirection read FSearchDirection write FSearchDirection default sdForward; + property IncrementalSearchStart: TVTSearchStart read FSearchStart write FSearchStart default ssFocusedNode; + property IncrementalSearchTimeout: Cardinal read FSearchTimeout write FSearchTimeout default 1000; + property Indent: Cardinal read FIndent write SetIndent default 18; + property LastClickPos: TPoint read FLastClickPos write FLastClickPos; + property LineMode: TVTLineMode read FLineMode write SetLineMode default lmNormal; + property LineStyle: TVTLineStyle read FLineStyle write SetLineStyle default lsDotted; + property Margin: Integer read FMargin write SetMargin default 4; + property NodeAlignment: TVTNodeAlignment read FNodeAlignment write SetNodeAlignment default naProportional; + property NodeDataSize: Integer read FNodeDataSize write SetNodeDataSize default -1; + property RootNodeCount: Cardinal read GetRootNodeCount write SetRootNodeCount default 0; + property ScrollBarOptions: TScrollBarOptions read FScrollBarOptions write SetScrollBarOptions; + property SelectionBlendFactor: Byte read FSelectionBlendFactor write FSelectionBlendFactor default 128; + property SelectionCurveRadius: Cardinal read FSelectionCurveRadius write SetSelectionCurveRadius default 0; + property StateImages: TCustomImageList read FStateImages write SetStateImages; + property TextMargin: Integer read FTextMargin write SetTextMargin default 4; + property TotalInternalDataSize: Cardinal read FTotalInternalDataSize; + property TreeOptions: TVirtualTreeOptions read FOptions write SetOptions; + property WantTabs: Boolean read FWantTabs write FWantTabs default False; + + property OnAdvancedHeaderDraw: TVTAdvancedHeaderPaintEvent read FOnAdvancedHeaderDraw write FOnAdvancedHeaderDraw; + property OnAfterCellPaint: TVTAfterCellPaintEvent read FOnAfterCellPaint write FOnAfterCellPaint; + property OnAfterItemErase: TVTAfterItemEraseEvent read FOnAfterItemErase write FOnAfterItemErase; + property OnAfterItemPaint: TVTAfterItemPaintEvent read FOnAfterItemPaint write FOnAfterItemPaint; + property OnAfterPaint: TVTPaintEvent read FOnAfterPaint write FOnAfterPaint; + property OnBeforeCellPaint: TVTBeforeCellPaintEvent read FOnBeforeCellPaint write FOnBeforeCellPaint; + property OnBeforeItemErase: TVTBeforeItemEraseEvent read FOnBeforeItemErase write FOnBeforeItemErase; + property OnBeforeItemPaint: TVTBeforeItemPaintEvent read FOnBeforeItemPaint write FOnBeforeItemPaint; + property OnBeforePaint: TVTPaintEvent read FOnBeforePaint write FOnBeforePaint; + property OnChange: TVTChangeEvent read FOnChange write FOnChange; + property OnChecked: TVTChangeEvent read FOnChecked write FOnChecked; + property OnChecking: TVTCheckChangingEvent read FOnChecking write FOnChecking; + property OnCollapsed: TVTChangeEvent read FOnCollapsed write FOnCollapsed; + property OnCollapsing: TVTChangingEvent read FOnCollapsing write FOnCollapsing; + property OnColumnClick: TVTColumnClickEvent read FOnColumnClick write FOnColumnClick; + property OnColumnDblClick: TVTColumnDblClickEvent read FOnColumnDblClick write FOnColumnDblClick; + property OnColumnResize: TVTHeaderNotifyEvent read FOnColumnResize write FOnColumnResize; + property OnCompareNodes: TVTCompareEvent read FOnCompareNodes write FOnCompareNodes; + property OnCreateEditor: TVTCreateEditorEvent read FOnCreateEditor write FOnCreateEditor; + property OnEditCancelled: TVTEditCancelEvent read FOnEditCancelled write FOnEditCancelled; + property OnEditing: TVTEditChangingEvent read FOnEditing write FOnEditing; + property OnEdited: TVTEditChangeEvent read FOnEdited write FOnEdited; + property OnExpanded: TVTChangeEvent read FOnExpanded write FOnExpanded; + property OnExpanding: TVTChangingEvent read FOnExpanding write FOnExpanding; + property OnFocusChanged: TVTFocusChangeEvent read FOnFocusChanged write FOnFocusChanged; + property OnFocusChanging: TVTFocusChangingEvent read FOnFocusChanging write FOnFocusChanging; + property OnFreeNode: TVTFreeNodeEvent read FOnFreeNode write FOnFreeNode; + property OnGetCellIsEmpty: TVTGetCellIsEmptyEvent read FOnGetCellIsEmpty write FOnGetCellIsEmpty; + property OnGetCursor: TVTGetCursorEvent read FOnGetCursor write FOnGetCursor; + property OnGetHeaderCursor: TVTGetHeaderCursorEvent read FOnGetHeaderCursor write FOnGetHeaderCursor; + property OnGetHelpContext: TVTHelpContextEvent read FOnGetHelpContext write FOnGetHelpContext; + property OnGetImageIndex: TVTGetImageEvent read FOnGetImage write FOnGetImage; + property OnGetLineStyle: TVTGetLineStyleEvent read FOnGetLineStyle write FOnGetLineStyle; + property OnGetNodeDataSize: TVTGetNodeDataSizeEvent read FOnGetNodeDataSize write FOnGetNodeDataSize; + property OnGetPopupMenu: TVTPopupEvent read FOnGetPopupMenu write FOnGetPopupMenu; +//x property OnGetUserClipboardFormats: TVTGetUserClipboardFormatsEvent read FOnGetUserClipboardFormats +//x write FOnGetUserClipboardFormats; + property OnHeaderClick: TVTHeaderClickEvent read FOnHeaderClick write FOnHeaderClick; + property OnHeaderDblClick: TVTHeaderClickEvent read FOnHeaderDblClick write FOnHeaderDblClick; + property OnHeaderDraw: TVTHeaderPaintEvent read FOnHeaderDraw write FOnHeaderDraw; + property OnHeaderDrawQueryElements: TVTHeaderPaintQueryElementsEvent read FOnHeaderDrawQueryElements + write FOnHeaderDrawQueryElements; + property OnHeaderMouseDown: TVTHeaderMouseEvent read FOnHeaderMouseDown write FOnHeaderMouseDown; + property OnHeaderMouseMove: TVTHeaderMouseMoveEvent read FOnHeaderMouseMove write FOnHeaderMouseMove; + property OnHeaderMouseUp: TVTHeaderMouseEvent read FOnHeaderMouseUp write FOnHeaderMouseUp; + property OnHotChange: TVTHotNodeChangeEvent read FOnHotChange write FOnHotChange; + property OnIncrementalSearch: TVTIncrementalSearchEvent read FOnIncrementalSearch write FOnIncrementalSearch; + property OnInitChildren: TVTInitChildrenEvent read FOnInitChildren write FOnInitChildren; + property OnInitNode: TVTInitNodeEvent read FOnInitNode write FOnInitNode; + property OnKeyAction: TVTKeyActionEvent read FOnKeyAction write FOnKeyAction; + property OnLoadNode: TVTSaveNodeEvent read FOnLoadNode write FOnLoadNode; + property OnMeasureItem: TVTMeasureItemEvent read FOnMeasureItem write FOnMeasureItem; + property OnNodeCopied: TVTNodeCopiedEvent read FOnNodeCopied write FOnNodeCopied; + property OnNodeCopying: TVTNodeCopyingEvent read FOnNodeCopying write FOnNodeCopying; + property OnNodeMoved: TVTNodeMovedEvent read FOnNodeMoved write FOnNodeMoved; + property OnNodeMoving: TVTNodeMovingEvent read FOnNodeMoving write FOnNodeMoving; + property OnPaintBackground: TVTBackgroundPaintEvent read FOnPaintBackground write FOnPaintBackground; + property OnResetNode: TVTChangeEvent read FOnResetNode write FOnResetNode; + property OnSaveNode: TVTSaveNodeEvent read FOnSaveNode write FOnSaveNode; + property OnScroll: TVTScrollEvent read FOnScroll write FOnScroll; + property OnStateChange: TVTStateChangeEvent read FOnStateChange write FOnStateChange; + property OnStructureChange: TVTStructureChangeEvent read FOnStructureChange write FOnStructureChange; + property OnUpdating: TVTUpdatingEvent read FOnUpdating write FOnUpdating; + public + constructor Create(AOwner: TComponent); override; + destructor Destroy; override; + + function AbsoluteIndex(Node: PVirtualNode): Cardinal; + function AddChild(xParent: PVirtualNode; UserData: Pointer = nil): PVirtualNode; + procedure AddFromStream(Stream: TStream; TargetNode: PVirtualNode); + procedure AfterConstruction; override; + procedure Assign(Source: TPersistent); override; + procedure BeginSynch; + procedure BeginUpdate; + procedure CancelCutOrCopy; + function CancelEditNode: Boolean; + function CanFocus: Boolean; {$ifdef COMPILER_5_UP} override;{$endif} + procedure Clear; virtual; + procedure ClearSelection; + function CopyTo(Source: PVirtualNode; Tree: TBaseVirtualTree; Mode: TVTNodeAttachMode; + ChildrenOnly: Boolean): PVirtualNode; overload; + function CopyTo(Source, Target: PVirtualNode; Mode: TVTNodeAttachMode; + ChildrenOnly: Boolean): PVirtualNode; overload; + procedure CopyToClipBoard; virtual; + procedure CutToClipBoard; virtual; + procedure DeleteChildren(Node: PVirtualNode; ResetHasChildren: Boolean = False); + procedure DeleteNode(Node: PVirtualNode; Reindex: Boolean = True); + procedure DeleteSelectedNodes; virtual; + function EditNode(Node: PVirtualNode; Column: TColumnIndex): Boolean; virtual; + function EndEditNode: Boolean; + procedure EndSynch; + procedure EndUpdate; + function ExecuteAction(xAction: TBasicAction): Boolean; override; + procedure FinishCutOrCopy; + procedure FlushClipboard; + procedure FullCollapse(Node: PVirtualNode = nil); virtual; + procedure FullExpand(Node: PVirtualNode = nil); virtual; + function GetControlsAlignment: TAlignment;// todo: add override; + function GetDisplayRect(Node: PVirtualNode; Column: TColumnIndex; TextOnly: Boolean; Unclipped: Boolean = False): TRect; + function GetFirst: PVirtualNode; + function GetFirstChild(Node: PVirtualNode): PVirtualNode; + function GetFirstCutCopy: PVirtualNode; + function GetFirstInitialized: PVirtualNode; + function GetFirstNoInit: PVirtualNode; + function GetFirstSelected: PVirtualNode; + function GetFirstVisible: PVirtualNode; + function GetFirstVisibleChild(Node: PVirtualNode): PVirtualNode; + function GetFirstVisibleChildNoInit(Node: PVirtualNode): PVirtualNode; + function GetFirstVisibleNoInit: PVirtualNode; + procedure GetHitTestInfoAt(X, Y: Integer; Relative: Boolean; var HitInfo: THitInfo); + function GetLast(Node: PVirtualNode = nil): PVirtualNode; + function GetLastInitialized(Node: PVirtualNode = nil): PVirtualNode; + function GetLastNoInit(Node: PVirtualNode = nil): PVirtualNode; + function GetLastChild(Node: PVirtualNode): PVirtualNode; + function GetLastChildNoInit(Node: PVirtualNode): PVirtualNode; + function GetLastVisible(Node: PVirtualNode = nil): PVirtualNode; + function GetLastVisibleChild(Node: PVirtualNode): PVirtualNode; + function GetLastVisibleChildNoInit(Node: PVirtualNode): PVirtualNode; + function GetLastVisibleNoInit(Node: PVirtualNode = nil): PVirtualNode; + function GetMaxColumnWidth(Column: TColumnIndex): Integer; + function GetNext(Node: PVirtualNode): PVirtualNode; + function GetNextCutCopy(Node: PVirtualNode): PVirtualNode; + function GetNextInitialized(Node: PVirtualNode): PVirtualNode; + function GetNextNoInit(Node: PVirtualNode): PVirtualNode; + function GetNextSelected(Node: PVirtualNode): PVirtualNode; + function GetNextSibling(Node: PVirtualNode): PVirtualNode; + function GetNextVisible(Node: PVirtualNode): PVirtualNode; + function GetNextVisibleNoInit(Node: PVirtualNode): PVirtualNode; + function GetNextVisibleSibling(Node: PVirtualNode): PVirtualNode; + function GetNextVisibleSiblingNoInit(Node: PVirtualNode): PVirtualNode; + function GetNodeAt(X, Y: Integer): PVirtualNode; overload; + function GetNodeAt(X, Y: Integer; Relative: Boolean; var NodeTop: Integer): PVirtualNode; overload; + function GetNodeData(Node: PVirtualNode): Pointer; + function GetNodeLevel(Node: PVirtualNode): Cardinal; + function GetPrevious(Node: PVirtualNode): PVirtualNode; + function GetPreviousInitialized(Node: PVirtualNode): PVirtualNode; + function GetPreviousNoInit(Node: PVirtualNode): PVirtualNode; + function GetPreviousSibling(Node: PVirtualNode): PVirtualNode; + function GetPreviousVisible(Node: PVirtualNode): PVirtualNode; + function GetPreviousVisibleNoInit(Node: PVirtualNode): PVirtualNode; + function GetPreviousVisibleSibling(Node: PVirtualNode): PVirtualNode; + function GetPreviousVisibleSiblingNoInit(Node: PVirtualNode): PVirtualNode; + function GetSortedCutCopySet(Resolve: Boolean): TNodeArray; + function GetSortedSelection(Resolve: Boolean): TNodeArray; + function GetTreeRect: TRect; + function GetVisibleParent(Node: PVirtualNode): PVirtualNode; + function HasAsParent(Node, PotentialParent: PVirtualNode): Boolean; + function InsertNode(Node: PVirtualNode; Mode: TVTNodeAttachMode; UserData: Pointer = nil): PVirtualNode; + procedure InvalidateChildren(Node: PVirtualNode; Recursive: Boolean); + procedure InvalidateColumn(Column: TColumnIndex); + function InvalidateNode(Node: PVirtualNode): TRect; virtual; + procedure InvalidateToBottom(Node: PVirtualNode); + procedure InvertSelection(VisibleOnly: Boolean); + function IsEditing: Boolean; + function IsMouseSelecting: Boolean; + function IterateSubtree(Node: PVirtualNode; Callback: TVTGetNodeProc; Data: Pointer; Filter: TVirtualNodeStates = []; + DoInit: Boolean = False; ChildNodesOnly: Boolean = False): PVirtualNode; + procedure LoadFromFile(const FileName: TFileName); virtual; + procedure LoadFromStream(Stream: TStream); virtual; + procedure MeasureItemHeight(const xCanvas: TCanvas; Node: PVirtualNode); + procedure MoveTo(Source, Target: PVirtualNode; Mode: TVTNodeAttachMode; ChildrenOnly: Boolean); overload; + procedure MoveTo(Node: PVirtualNode; Tree: TBaseVirtualTree; Mode: TVTNodeAttachMode; + ChildrenOnly: Boolean); overload; + procedure PaintTree(TargetCanvas: TCanvas; Window: TRect; Target: TPoint; PaintOptions: TVTInternalPaintOptions; + PixelFormat: TPixelFormat = pfDevice); + function PasteFromClipboard: Boolean; virtual; + procedure Print(Printer: TPrinter; PrintHeader: Boolean); + procedure RepaintNode(Node: PVirtualNode); + procedure ReinitChildren(Node: PVirtualNode; Recursive: Boolean); virtual; + procedure ReinitNode(Node: PVirtualNode; Recursive: Boolean); virtual; + procedure ResetNode(Node: PVirtualNode); virtual; + procedure SaveToFile(const FileName: TFileName); + procedure SaveToStream(Stream: TStream; Node: PVirtualNode = nil); virtual; + function ScrollIntoView(Node: PVirtualNode; Center: Boolean; Horizontally: Boolean = False): Boolean; + procedure SelectAll(VisibleOnly: Boolean); + procedure Sort(Node: PVirtualNode; Column: TColumnIndex; Direction: TSortDirection; DoInit: Boolean = True); virtual; + procedure SortTree(Column: TColumnIndex; Direction: TSortDirection; DoInit: Boolean = True); + procedure ToggleNode(Node: PVirtualNode); + function UpdateAction(xAction: TBasicAction): Boolean; override; + procedure UpdateHorizontalScrollBar(DoRepaint: Boolean); + procedure UpdateScrollBars(DoRepaint: Boolean); virtual; + procedure UpdateVerticalScrollBar(DoRepaint: Boolean); + function UseRightToLeftReading: Boolean; + procedure ValidateChildren(Node: PVirtualNode; Recursive: Boolean); + procedure ValidateNode(Node: PVirtualNode; Recursive: Boolean); + + property CheckImages: TCustomImageList read FCheckImages; + property CheckState[Node: PVirtualNode]: TCheckState read GetCheckState write SetCheckState; + property CheckType[Node: PVirtualNode]: TCheckType read GetCheckType write SetCheckType; + property ChildCount[Node: PVirtualNode]: Cardinal read GetChildCount write SetChildCount; + property ChildrenInitialized[Node: PVirtualNode]: Boolean read GetChildrenInitialized; + property EditLink: IVTEditLink read FEditLink; + property Expanded[Node: PVirtualNode]: Boolean read GetExpanded write SetExpanded; + property FocusedColumn: TColumnIndex read FFocusedColumn write SetFocusedColumn default InvalidColumn; + property FocusedNode: PVirtualNode read FFocusedNode write SetFocusedNode; + property Font; + property FullyVisible[Node: PVirtualNode]: Boolean read GetFullyVisible write SetFullyVisible; + property HasChildren[Node: PVirtualNode]: Boolean read GetHasChildren write SetHasChildren; + property HotNode: PVirtualNode read FCurrentHotNode; + property IsDisabled[Node: PVirtualNode]: Boolean read GetDisabled write SetDisabled; + property IsVisible[Node: PVirtualNode]: Boolean read GetVisible write SetVisible; + property MultiLine[Node: PVirtualNode]: Boolean read GetMultiline write SetMultiline; + property NodeHeight[Node: PVirtualNode]: Cardinal read GetNodeHeight write SetNodeHeight; + property NodeParent[Node: PVirtualNode]: PVirtualNode read GetNodeParent write SetNodeParent; + property OffsetX: Integer read FOffsetX write SetOffsetX; + property OffsetXY: TPoint read GetOffsetXY write SetOffsetXY; + property OffsetY: Integer read FOffsetY write SetOffsetY; + property RootNode: PVirtualNode read FRoot; + property SearchBuffer: WideString read FSearchBuffer; + property Selected[Node: PVirtualNode]: Boolean read GetSelected write SetSelected; + property TotalCount: Cardinal read GetTotalCount; + property TreeStates: TVirtualTreeStates read FStates write FStates; + property SelectedCount: Integer read FSelectionCount; + property TopNode: PVirtualNode read GetTopNode write SetTopNode; + property VerticalAlignment[Node: PVirtualNode]: Byte read GetVerticalAlignment write SetVerticalAlignment; + property VisibleCount: Cardinal read FVisibleCount; + property VisiblePath[Node: PVirtualNode]: Boolean read GetVisiblePath write SetVisiblePath; + end; + + +type + // Describes the mode how to blend pixels. + TBlendMode = ( + bmConstantAlpha, // apply given constant alpha + bmPerPixelAlpha, // use alpha value of the source pixel + bmMasterAlpha, // use alpha value of source pixel and multiply it with the constant alpha value + bmConstantAlphaAndColor // blend the destination color with the given constant color und the constant alpha value + ); + + TChunkHeader = record + ChunkType, + ChunkSize: Integer; // contains the size of the chunk excluding the header + end; + + TBufferedString = class + private + FStart, + FPosition, + FEnd: PChar; + function GetAsString: string; + public + destructor Destroy; override; + + procedure Add(const S: string); + procedure AddNewLine; + + property AsString: string read GetAsString; + end; + + TWideBufferedString = class + private + FStart, + FPosition, + FEnd: PWideChar; + function GetAsString: WideString; + public + destructor Destroy; override; + + procedure Add(const S: WideString); + procedure AddNewLine; + + property AsString: WideString read GetAsString; + end; + +const + { Predefined Clipboard Formats } + CF_TEXT = 1; + CF_BITMAP = 2; + CF_METAFILEPICT = 3; + CF_SYLK = 4; + CF_DIF = 5; + CF_TIFF = 6; + CF_OEMTEXT = 7; + CF_DIB = 8; + CF_PALETTE = 9; + CF_PENDATA = 10; + CF_RIFF = 11; + CF_WAVE = 12; + CF_UNICODETEXT = 13; + CF_ENHMETAFILE = 14; + CF_HDROP = 15; + CF_LOCALE = $10; + CF_MAX = 17; + CF_DIBV5 = 17; + CF_MAX_XP = 18; + +// OLE Clipboard and drag'n drop helper +procedure EnumerateVTClipboardFormats(TreeClass: TVirtualTreeClass; const List: TStrings); overload; +//x procedure EnumerateVTClipboardFormats(TreeClass: TVirtualTreeClass; var Formats: TFormatEtcArray); overload; +function GetVTClipboardFormatDescription(AFormat: Word): string; +//xprocedure RegisterVTClipboardFormat(AFormat: Word; TreeClass: TVirtualTreeClass; Priority: Cardinal); overload; +//x function RegisterVTClipboardFormat(Description: string; TreeClass: TVirtualTreeClass; Priority: Cardinal; +//x tymed: Integer = TYMED_HGLOBAL; ptd: PDVTargetDevice = nil; dwAspect: Integer = DVASPECT_CONTENT; +//x lindex: Integer = -1): Word; overload; + +// utility routines +procedure AlphaBlend(Source, Destination: HDC; R: TRect; Target: TPoint; Mode: TBlendMode; ConstantAlpha, Bias: Integer); +procedure DrawTextW(DC: HDC; lpString: PWideChar; nCount: Integer; var lpRect: TRect; uFormat: Cardinal; + AdjustRight: Boolean); overload; +procedure DrawTextW(Canvas: TCanvas; lpString: PWideChar; var lpRect: TRect; uFormat: Cardinal; + AdjustRight: Boolean); overload; +procedure PrtStretchDrawDIB(Canvas: TCanvas; DestRect: TRect; ABitmap: TBitmap); +function ShortenString(DC: HDC; const S: WideString; Width: Integer; RTL: Boolean; + EllipsisWidth: Integer = 0): WideString; +function TreeFromNode(Node: PVirtualNode): TBaseVirtualTree; +function GetTextExtentPoint32W(DC: HDC; Str: PWideChar; Count: Integer; + var Size: TSize): BOOL; + +//---------------------------------------------------------------------------------------------------------------------- + +implementation + +//todo +{.$R VirtualTrees.res} + +uses + Math, +//x AxCtrls, // TOLEStream + {$ifdef UseFlatScrollbars} + FlatSB, // wrapper for systems without flat SB support + {$endif UseFlatScrollbars} +// MMSystem, // for animation timer (does not include further resources) + TypInfo, // for migration stuff + ActnList, + StdActns; // for standard action support + +resourcestring + // Localizable strings. + SEditLinkIsNil = 'Edit link must not be nil.'; + SWrongMoveError = 'Target node cannot be a child node of the node to be moved.'; + SWrongStreamFormat = 'Unable to load tree structure, the format is wrong.'; + SWrongStreamVersion = 'Unable to load tree structure, the version is unknown.'; + SStreamTooSmall = 'Unable to load tree structure, not enough data available.'; + SCorruptStream1 = 'Stream data corrupt. A node''s anchor chunk is missing.'; + SCorruptStream2 = 'Stream data corrupt. Unexpected data after node''s end position.'; + SClipboardFailed = 'Clipboard operation failed.'; + SCannotSetUserData = 'Cannot set initial user data because there is not enough user data space allocated.'; + +const + ClipboardStates = [tsCopyPending, tsCutPending]; + DefaultScrollUpdateFlags = [suoRepaintHeader, suoRepaintScrollbars, suoScrollClientArea, suoUpdateNCArea]; + MinimumTimerInterval = 1; // minimum resolution for timeGetTime + TreeNodeSize = (SizeOf(TVirtualNode) + 3) and not 3; // used for node allocation and access to internal data + + // Lookup to quickly convert a specific check state into its pressed counterpart and vice versa. + PressedState: array[TCheckState] of TCheckState = ( + csUncheckedPressed, csUncheckedPressed, csCheckedPressed, csCheckedPressed, csMixedPressed, csMixedPressed + ); + UnpressedState: array[TCheckState] of TCheckState = ( + csUncheckedNormal, csUncheckedNormal, csCheckedNormal, csCheckedNormal, csMixedNormal, csMixedNormal + ); + MouseButtonDown = [tsLeftButtonDown, tsMiddleButtonDown, tsRightButtonDown]; + + // Do not modify the copyright in any way! Usage of this unit is prohibited without the copyright notice + // in the compiled binary file. + Copyright: string = 'Virtual Treeview © 1999, 2003 Mike Lischke'; + +type // streaming support + TMagicID = array[0..5] of WideChar; + + // base information about a node + TBaseChunkBody = packed record + ChildCount, + NodeHeight: Cardinal; + States: TVirtualNodeStates; + Align: Byte; + CheckState: TCheckState; + CheckType: TCheckType; + Reserved: Cardinal; + end; + + TBaseChunk = packed record + Header: TChunkHeader; + Body: TBaseChunkBody; + end; + + // Internally used data for animations. + TToggleAnimationData = record + Expand: Boolean; // if true then expanding is in progress + Window: HWND; // copy of the tree's window handle + DC: HDC; // the DC of the window to erase unconvered parts + Brush: HBRUSH; // the brush to be used to erase uncovered parts + R: TRect; // the scroll rectangle + end; + +const + MagicID: TMagicID = (#$2045, 'V', 'T', WideChar(VTTreeStreamVersion), ' ', #$2046); + + // chunk IDs + NodeChunk = 1; + BaseChunk = 2; // chunk containing node state, check state, child node count etc. + // this chunk is immediately followed by all child nodes + UserChunk = 4; // used for data supplied by the application + + {$ifdef UseFlatScrollbars} + ScrollBarProp: array[TScrollBarStyle] of Integer = ( + FSB_REGULAR_MODE, + FSB_FLAT_MODE, + FSB_ENCARTA_MODE + ); + {$endif} + +//x RTLFlag: array[Boolean] of Integer = (0, ETO_RTLREADING); + + WideNull = WideChar(#0); + WideCR = WideChar(#13); + WideLF = WideChar(#10); + WideLineSeparator = WideChar(#2028); + +type + // internal worker thread + TWorkerThread = class(TThread) + private + FCurrentTree: TBaseVirtualTree; + FWaiterList: TThreadList; + FRefCount: Cardinal; + FChangeLock: TCriticalSection; + procedure x; + protected + procedure ChangeTreeStates(EnterStates, LeaveStates: TChangeStates); + procedure Execute; override; + public + constructor Create(CreateSuspended: Boolean); + destructor Destroy; override; + + procedure AddTree(Tree: TBaseVirtualTree); + procedure RemoveTree(Tree: TBaseVirtualTree); + + property CurrentTree: TBaseVirtualTree read FCurrentTree; + end; + + // Helper classes to speed up rendering text formats for clipboard and drag'n drop transfers. + +var + WorkerThread: TWorkerThread; + WorkEvent: TEvent; + Watcher: TCriticalSection; + LightCheckImages, // global light check images + DarkCheckImages, // global heavy check images + LightTickImages, // global light tick images + DarkTickImages, // global heavy check images + FlatImages, // global flat check images + XPImages, // global XP style check images + UtilityImages, // some small additional images (e.g for header dragging) + SystemCheckImages, // global system check images + SystemFlatCheckImages: TImageList; // global flat system check images + Initialized: Boolean; // True if global structures have been initialized. + NeedToUnitialize: Boolean; // True if the OLE subsystem could be initialized successfully. + +//---------------------------------------------------------------------------------------------------------------------- + +{$ifndef COMPILER_6_UP} + + procedure RaiseLastOSError; + + begin + //RaiseLastWin32Error; // todo: RaiseLastOSError + end; + +{$endif COMPILER_6_UP} + +//----------------- TClipboardFormats ---------------------------------------------------------------------------------- + +type + PClipboardFormatListEntry = ^TClipboardFormatListEntry; + TClipboardFormatListEntry = record + Description: string; // The string used to register the format with Windows. + TreeClass: TVirtualTreeClass; // The tree class which supports rendering this format. + Priority: Cardinal; // Number which determines the order of formats used in IDataObject. +//x FormatEtc: TFormatEtc; // The definition of the format in the IDataObject. + end; + + TClipboardFormatList = class + private + FList: TList; + procedure Sort; + public + constructor Create; + destructor Destroy; override; + +//x procedure Add(FormatString: string; AClass: TVirtualTreeClass; Priority: Cardinal; AFormatEtc: TFormatEtc); + procedure Clear; +//x procedure EnumerateFormats(TreeClass: TVirtualTreeClass; var Formats: TFormatEtcArray; +//x const AllowedFormats: TClipboardFormats = nil); overload; + procedure EnumerateFormats(TreeClass: TVirtualTreeClass; const Formats: TStrings); overload; + function FindFormat(FormatString: string): PClipboardFormatListEntry; overload; + function FindFormat(FormatString: string; var Fmt: Word): TVirtualTreeClass; overload; + function FindFormat(Fmt: Word; var Description: string): TVirtualTreeClass; overload; + end; + +var + InternalClipboardFormats: TClipboardFormatList; + +//---------------------------------------------------------------------------------------------------------------------- + +constructor TClipboardFormatList.Create; + +begin + FList := TList.Create; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TClipboardFormatList.Destroy; + +begin + Clear; + FList.Free; + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TClipboardFormatList.Sort; + +// Sorts all entry for priority (increasing priority value). + + //--------------- local function -------------------------------------------- + + procedure QuickSort(L, R: Integer); + + var + I, J: Integer; + P, T: PClipboardFormatListEntry; + + begin + repeat + I := L; + J := R; + P := FList[(L + R) shr 1]; + repeat + while PClipboardFormatListEntry(FList[I])^.Priority < P^.Priority do + Inc(I); + while PClipboardFormatListEntry(Flist[J])^.Priority > P^.Priority do + Dec(J); + if I <= J then + begin + T := Flist[I]; + FList[I] := FList[J]; + FList[J] := T; + Inc(I); + Dec(J); + end; + until I > J; + if L < J then + QuickSort(L, J); + L := I; + until I >= R; + end; + + //--------------- end local function ---------------------------------------- + +begin + if FList.Count > 1 then + QuickSort(0, FList.Count - 1); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{xprocedure TClipboardFormatList.Add(FormatString: string; AClass: TVirtualTreeClass; Priority: Cardinal; + AFormatEtc: TFormatEtc); + +// Adds the given data to the internal list. The priority value is used to sort formats for importance. Larger priority +// values mean less priority. + +var + Entry: PClipboardFormatListEntry; + +begin + New(Entry); + Entry.Description := FormatString; + Entry.TreeClass := AClass; + Entry.Priority := Priority; + Entry.FormatEtc := AFormatEtc; + FList.Add(Entry); + + Sort; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TClipboardFormatList.Clear; + +var + I: Integer; + +begin + for I := 0 to FList.Count - 1 do + Dispose(PClipboardFormatListEntry(FList[I])); + FList.Clear; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{xprocedure TClipboardFormatList.EnumerateFormats(TreeClass: TVirtualTreeClass; var Formats: TFormatEtcArray; + const AllowedFormats: TClipboardFormats = nil); + +// Returns a list of format records for the given class. If assigned the AllowedFormats is used to limit the +// enumerated formats to those described in the list. + +var + I, Count: Integer; + Entry: PClipboardFormatListEntry; + +begin + SetLength(Formats, FList.Count); + Count := 0; + for I := 0 to FList.Count - 1 do + begin + Entry := FList[I]; + // Does the tree class support this clipboard format? + if TreeClass.InheritsFrom(Entry.TreeClass) then + begin + // Is this format allowed to be included? + if (AllowedFormats = nil) or (AllowedFormats.IndexOf(Entry.Description) > -1) then + begin + // The list could change before we use the FormatEtc so it is best not to pass a pointer to the true FormatEtc + // structure. Instead make a copy and send that. + Formats[Count] := Entry.FormatEtc; + Inc(Count); + end; + end; + end; + SetLength(Formats, Count); +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TClipboardFormatList.EnumerateFormats(TreeClass: TVirtualTreeClass; const Formats: TStrings); + +// Returns a list of format descriptions for the given class. + +var + I: Integer; + Entry: PClipboardFormatListEntry; + +begin + for I := 0 to FList.Count - 1 do + begin + Entry := FList[I]; + if TreeClass.InheritsFrom(Entry^.TreeClass) then + Formats.Add(Entry^.Description); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TClipboardFormatList.FindFormat(FormatString: string): PClipboardFormatListEntry; + +var + I: Integer; + Entry: PClipboardFormatListEntry; + +begin + Result := nil; + for I := FList.Count - 1 downto 0 do + begin + Entry := FList[I]; + if CompareText(Entry^.Description, FormatString) = 0 then + begin + Result := Entry; + Break; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TClipboardFormatList.FindFormat(FormatString: string; var Fmt: Word): TVirtualTreeClass; + +var + I: Integer; + Entry: PClipboardFormatListEntry; + +begin + Result := nil; + for I := FList.Count - 1 downto 0 do + begin + Entry := FList[I]; + if CompareText(Entry^.Description, FormatString) = 0 then + begin + Result := Entry^.TreeClass; +//x Fmt := Entry.FormatEtc.cfFormat; + Break; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TClipboardFormatList.FindFormat(Fmt: Word; var Description: string): TVirtualTreeClass; + +var + I: Integer; + Entry: PClipboardFormatListEntry; + +begin + Result := nil; +//x for I := FList.Count - 1 downto 0 do +//x begin +//x Entry := FList[I]; +//x if Entry.FormatEtc.cfFormat = Fmt then +//x begin +//x Result := Entry.TreeClass; +//x Description := Entry.Description; +//x Break; +//x end; +//x end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +type + TClipboardFormatEntry = record + ID: Word; + Description: string; + end; + +var + ClipboardDescriptions: array [1..CF_MAX - 1] of TClipboardFormatEntry = ( + (ID: CF_TEXT; Description: 'Plain text'), + (ID: CF_BITMAP; Description: 'Windows bitmap'), + (ID: CF_METAFILEPICT; Description: 'Windows metafile'), + (ID: CF_SYLK; Description: 'Symbolic link'), + (ID: CF_DIF; Description: 'Data interchange format'), + (ID: CF_TIFF; Description: 'Tiff image'), + (ID: CF_OEMTEXT; Description: 'OEM text'), + (ID: CF_DIB; Description: 'DIB image'), + (ID: CF_PALETTE; Description: 'Palette data'), + (ID: CF_PENDATA; Description: 'Pen data'), + (ID: CF_RIFF; Description: 'Riff audio data'), + (ID: CF_WAVE; Description: 'Wav audio data'), + (ID: CF_UNICODETEXT; Description: 'Unicode text'), + (ID: CF_ENHMETAFILE; Description: 'Enhanced metafile image'), + (ID: CF_HDROP; Description: 'File name(s)'), + (ID: CF_LOCALE; Description: 'Locale descriptor') + ); + +//---------------------------------------------------------------------------------------------------------------------- + +procedure EnumerateVTClipboardFormats(TreeClass: TVirtualTreeClass; const List: TStrings); + +begin + if InternalClipboardFormats = nil then + InternalClipboardFormats := TClipboardFormatList.Create; + InternalClipboardFormats.EnumerateFormats(TreeClass, List); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +//xprocedure EnumerateVTClipboardFormats(TreeClass: TVirtualTreeClass; var Formats: TFormatEtcArray); +//x +//xbegin +//x if InternalClipboardFormats = nil then +//x InternalClipboardFormats := TClipboardFormatList.Create; +//x InternalClipboardFormats.EnumerateFormats(TreeClass, Formats); +//xend; + +//---------------------------------------------------------------------------------------------------------------------- + +function GetVTClipboardFormatDescription(AFormat: Word): string; + +begin + if InternalClipboardFormats = nil then + InternalClipboardFormats := TClipboardFormatList.Create; + if InternalClipboardFormats.FindFormat(AFormat, Result) = nil then + Result := ''; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{xprocedure RegisterVTClipboardFormat(AFormat: Word; TreeClass: TVirtualTreeClass; Priority: Cardinal); + +// Registers the given clipboard format for the given TreeClass. + +var + I: Integer; + Buffer: array[0..2048] of Char; + FormatEtc: TFormatEtc; + +begin + if InternalClipboardFormats = nil then + InternalClipboardFormats := TClipboardFormatList.Create; + + // Assumes a HGlobal format. + FormatEtc.cfFormat := AFormat; + FormatEtc.ptd := nil; + FormatEtc.dwAspect := DVASPECT_CONTENT; + FormatEtc.lindex := -1; + FormatEtc.tymed := TYMED_HGLOBAL; + + // Determine description string of the given format. For predefined formats we need the lookup table because they + // don't have a description string. For registered formats the description string is the string which was used + // to register them. + if AFormat < CF_MAX then + begin + for I := 1 to High(ClipboardDescriptions) do + if ClipboardDescriptions[I].ID = AFormat then + begin + InternalClipboardFormats.Add(ClipboardDescriptions[I].Description, TreeClass, Priority, FormatEtc); + Break; + end; + end + else + begin + GetClipboardFormatName(AFormat, Buffer, Length(Buffer)); + InternalClipboardFormats.Add(Buffer, TreeClass, Priority, FormatEtc); + end; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +{xfunction RegisterVTClipboardFormat(Description: string; TreeClass: TVirtualTreeClass; Priority: Cardinal; + tymed: Integer = TYMED_HGLOBAL; ptd: PDVTargetDevice = nil; dwAspect: Integer = DVASPECT_CONTENT; + lindex: Integer = -1): Word; + +// Alternative method to register a certain clipboard format for a given tree class. Registration with the +// clipboard is done here too and the assigned ID returned by the function. +// tymed may contain or'ed TYMED constants which allows to register several storage formats for one clipboard format. + +var + FormatEtc: TFormatEtc; + +begin + if InternalClipboardFormats = nil then + InternalClipboardFormats := TClipboardFormatList.Create; + Result := RegisterClipboardFormat(PChar(Description)); + FormatEtc.cfFormat := Result; + FormatEtc.ptd := ptd; + FormatEtc.dwAspect := dwAspect; + FormatEtc.lindex := lindex; + FormatEtc.tymed := tymed; + InternalClipboardFormats.Add(Description, TreeClass, Priority, FormatEtc); +end;} + +//----------------- utility functions ---------------------------------------------------------------------------------- + +procedure ShowError(Msg: WideString; HelpContext: Integer); + +begin + raise EVirtualTreeError.CreateHelp(Msg, HelpContext); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TreeFromNode(Node: PVirtualNode): TBaseVirtualTree; + +// Returns the tree the node currently belongs to or nil if the node is not attached to a tree. + +begin + Assert(Assigned(Node), 'Node must not be nil.'); + + // The root node is marked by having its NextSibling (and PrevSibling) pointing to itself. + while Assigned(Node) and (Node^.NextSibling <> Node) do + Node := Node^.Parent; + if Assigned(Node) then + Result := TBaseVirtualTree(Node^.Parent) + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function OrderRect(const R: TRect): TRect; + +// Converts the incoming rectangle so that left and top are always less than or equal to right and bottom. + +begin + if R.Left < R.Right then + begin + Result.Left := R.Left; + Result.Right := R.Right; + end + else + begin + Result.Left := R.Right; + Result.Right := R.Left; + end; + if R.Top < R.Bottom then + begin + Result.Top := R.Top; + Result.Bottom := R.Bottom; + end + else + begin + Result.Top := R.Bottom; + Result.Bottom := R.Top; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure QuickSort(var TheArray: TNodeArray; L, R: Integer); + +var + I, J: Integer; + P, T: Pointer; + +begin + repeat + I := L; + J := R; + P := TheArray[(L + R) shr 1]; + repeat + while Cardinal(TheArray[I]) < Cardinal(P) do + Inc(I); + while Cardinal(TheArray[J]) > Cardinal(P) do + Dec(J); + if I <= J then + begin + T := TheArray[I]; + TheArray[I] := TheArray[J]; + TheArray[J] := T; + Inc(I); + Dec(J); + end; + until I > J; + if L < J then + QuickSort(TheArray, L, J); + L := I; + until I >= R; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +const + DT_RTLREADING = $20000; + ETO_RTLREADING = $80; + +// todo: dummy +function GetTextExtentPoint32W(DC: HDC; Str: PWideChar; Count: Integer; + var Size: TSize): BOOL; +begin //debugln('GetTextExtentPoint32W'); + Result := GetTextExtentPoint32(DC, PAnsiChar(WideCharToString(Str)), Count, Size); +end; + +procedure DrawTextW(DC: HDC; lpString: PWideChar; nCount: Integer; var lpRect: TRect; uFormat: Cardinal; + AdjustRight: Boolean); + +// This procedure implements a subset of Window's DrawText API for Unicode which is not available for +// Windows 9x. For a description of the parameters see DrawText in the online help. +// Supported flags are currently: +// - DT_LEFT +// - DT_TOP +// - DT_CALCRECT +// - DT_NOCLIP +// - DT_RTLREADING +// - DT_SINGLELINE +// - DT_VCENTER +// Differences to the DrawTextW Windows API: +// - The additional parameter AdjustRight determines whether to adjust the right border of the given rectangle to +// accomodate the largest line in the text. It has only a meaning if also DT_CALCRECT is specified. + +var + Head, Tail: PWideChar; + Size: TSize; + MaxWidth: Integer; + TextOutFlags: Integer; + TextAlign, + OldTextAlign: Cardinal; + TM: TTextMetric; + TextHeight: Integer; + LineRect: TRect; + TextPosY, + TextPosX: Integer; + + CalculateRect: Boolean; + +begin + // Prepare some work variables. + MaxWidth := 0; + Head := lpString; + GetTextMetrics(DC, TM); + TextHeight := TM.tmHeight; + if uFormat and DT_SINGLELINE <> 0 then + LineRect := lpRect + else + LineRect := Rect(lpRect.Left, lpRect.Top, lpRect.Right, lpRect.Top + TextHeight); + + CalculateRect := uFormat and DT_CALCRECT <> 0; + + // Prepare text output. + TextOutFlags := 0; + if uFormat and DT_NOCLIP = 0 then + TextOutFlags := TextOutFlags or ETO_CLIPPED; + if uFormat and DT_RTLREADING <> 0 then + TextOutFlags := TextOutFlags or ETO_RTLREADING; + + // Determine horizontal and vertical text alignment. + //OldTextAlign := GetTextAlign(DC); + TextAlign := TA_LEFT or TA_TOP; + TextPosX := lpRect.Left; + if uFormat and DT_RIGHT <> 0 then + begin + TextAlign := TextAlign or TA_RIGHT and not TA_LEFT; + TextPosX := lpRect.Right; + end + else + if uFormat and DT_CENTER <> 0 then + begin + TextAlign := TextAlign or TA_CENTER and not TA_LEFT; + TextPosX := (lpRect.Left + lpRect.Right) div 2; + end; + + TextPosY := lpRect.Top; + if uFormat and DT_VCENTER <> 0 then + begin + // Note: vertical alignment does only work with single line text ouput! + TextPosY := (lpRect.Top + lpRect.Bottom - TextHeight) div 2; + end; + SetTextAlign(DC, TextAlign); + if uFormat and DT_SINGLELINE <> 0 then + begin + if CalculateRect then + begin + GetTextExtentPoint32W(DC, Head, nCount, Size); + if Size.cx > MaxWidth then + MaxWidth := Size.cx; + end + else +// ExtTextOut(DC, TextPosX, TextPosY, TextOutFlags, @TextLineRect, PChar(WideCharToString(Head)), nCount, nil); + TextOut(DC, TextPosX, TextPosY, PChar(WideCharToString(Head)), nCount); + OffsetRect(LineRect, 0, TextHeight); + end + else + begin + while (nCount > 0) and (Head^ <> WideNull) do + begin + Tail := Head; + // Look for the end of the current line. A line is finished either by the string end or a line break. + while (nCount > 0) and not (Tail^ in [WideNull, WideCR, WideLF]) and (Tail^ <> WideLineSeparator) do + begin + Inc(Tail); + Dec(nCount); + end; + + if CalculateRect then + begin + GetTextExtentPoint32W(DC, Head, Tail - Head, Size); + if Size.cx > MaxWidth then + MaxWidth := Size.cx; + end + else +// ExtTextOut{W}(DC, TextPosX, LineRect.Top, TextOutFlags, @LineRect, PChar(WideCharToString(Head)), Tail - Head, nil); + TextOut(DC, TextPosX, LineRect.Top, PChar(WideCharToString(Head)), Tail - Head); + OffsetRect(LineRect, 0, TextHeight); + + // Get out of the loop if the rectangle is filled up. + if (nCount = 0) or (not CalculateRect and (LineRect.Top >= lpRect.Bottom)) then + Break; + + if (nCount > 0) and (Tail^ = WideCR) or (Tail^ = WideLineSeparator) then + begin + Inc(Tail); + Dec(nCount); + end; + + if (nCount > 0) and (Tail^ = WideLF) then + begin + Inc(Tail); + Dec(nCount); + end; + Head := Tail; + end; + end; + + //SetTextAlign(DC, OldTextAlign); + if CalculateRect then + begin + if AdjustRight then + lpRect.Right := lpRect.Left + MaxWidth; + lpRect.Bottom := LineRect.Top; + end; +end; + +procedure DrawTextW(Canvas: TCanvas; lpString: PWideChar; var lpRect: TRect; uFormat: Cardinal; + AdjustRight: Boolean); +var Style:TTextStyle; +begin + {$ifndef WINCE} + {$ifdef LINUX} + Style.Layout:=tlCenter; + Canvas.TextRect(lpRect,lpRect.Left,lpRect.Top,lpString,Style); // theo 24.2.2007 Gibt sonst Striche auf GTK1 + {$else} + DrawTextW(Canvas.Handle, lpString, Length(lpString), lpRect, uFormat, AdjustRight); + {$endif} + {$else} + Canvas.TextOut(lpRect.Left,lpRect.Top,lpString); + {$endif} +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function ShortenString(DC: HDC; const S: WideString; Width: Integer; RTL: Boolean; + EllipsisWidth: Integer = 0): WideString; + +// Adjusts the given string S so that it fits into the given width. EllipsisWidth gives the width of +// the three points to be added to the shorted string. If this value is 0 then it will be determined implicitely. +// For higher speed (and multiple entries to be shorted) specify this value explicitely. +// RTL determines if right-to-left reading is active, which is needed to put the ellipsisis on the correct side. +// Note: It is assumed that the string really needs shortage. Check this in advance. + +var + Size: TSize; + Len: Integer; + L, H, N, W: Integer; + +begin + Len := Length(S); + if (Len = 0) or (Width <= 0) then + Result := '' + else + begin + // Determine width of triple point using the current DC settings (if not already done). + if EllipsisWidth = 0 then + begin + GetTextExtentPoint32W(DC, '...', 3, Size); + EllipsisWidth := Size.cx; + end; + + if Width <= EllipsisWidth then + Result := '' + else + begin + // Do a binary search for the optimal string length which fits into the given width. + L := 0; + H := Len - 1; + if RTL then + begin + while L < H do + begin + N := (L + H) shr 1; + GetTextExtentPoint32W(DC, PWideChar(S) + N, Len - N, Size); + W := Size.cx + EllipsisWidth; + if W <= Width then + H := N + else + L := N + 1; + end; + Result := '...' + Copy(S, L + 1, Len); + end + else + begin + while L < H do + begin + N := (L + H + 1) shr 1; + GetTextExtentPoint32W(DC, PWideChar(S), N, Size); + W := Size.cx + EllipsisWidth; + if W <= Width then + L := N + else + H := N - 1; + end; + Result := Copy(S, 1, L) + '...' + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure AlphaBlendLineConstant(Source, Destination: Pointer; Count: Integer; ConstantAlpha, Bias: Integer); +begin +// Blends a line of Count pixels from Source to Destination using a constant alpha value. +// The layout of a pixel must be BGRA where A is ignored (but is calculated as the other components). +// ConstantAlpha must be in the range 0..255 where 0 means totally transparent (destination pixel only) +// and 255 totally opaque (source pixel only). +// Bias is an additional value which gets added to every component and must be in the range -128..127 +// +// EAX contains Source +// EDX contains Destination +// ECX contains Count +// ConstantAlpha and Bias are on the stack + // todo +{asm + PUSH ESI // save used registers + PUSH EDI + + MOV ESI, EAX // ESI becomes the actual source pointer + MOV EDI, EDX // EDI becomes the actual target pointer + + // Load MM6 with the constant alpha value (replicate it for every component). + // Expand it to word size. + MOV EAX, [ConstantAlpha] + DB $0F, $6E, $F0 /// MOVD MM6, EAX + DB $0F, $61, $F6 /// PUNPCKLWD MM6, MM6 + DB $0F, $62, $F6 /// PUNPCKLDQ MM6, MM6 + + // Load MM5 with the bias value. + MOV EAX, [Bias] + DB $0F, $6E, $E8 /// MOVD MM5, EAX + DB $0F, $61, $ED /// PUNPCKLWD MM5, MM5 + DB $0F, $62, $ED /// PUNPCKLDQ MM5, MM5 + + // Load MM4 with 128 to allow for saturated biasing. + MOV EAX, 128 + DB $0F, $6E, $E0 /// MOVD MM4, EAX + DB $0F, $61, $E4 /// PUNPCKLWD MM4, MM4 + DB $0F, $62, $E4 /// PUNPCKLDQ MM4, MM4 + +@1: // The pixel loop calculates an entire pixel in one run. + // Note: The pixel byte values are expanded into the higher bytes of a word due + // to the way unpacking works. We compensate for this with an extra shift. + DB $0F, $EF, $C0 /// PXOR MM0, MM0, clear source pixel register for unpacking + DB $0F, $60, $06 /// PUNPCKLBW MM0, [ESI], unpack source pixel byte values into words + DB $0F, $71, $D0, $08 /// PSRLW MM0, 8, move higher bytes to lower bytes + DB $0F, $EF, $C9 /// PXOR MM1, MM1, clear target pixel register for unpacking + DB $0F, $60, $0F /// PUNPCKLBW MM1, [EDI], unpack target pixel byte values into words + DB $0F, $6F, $D1 /// MOVQ MM2, MM1, make a copy of the shifted values, we need them again + DB $0F, $71, $D1, $08 /// PSRLW MM1, 8, move higher bytes to lower bytes + + // calculation is: target = (alpha * (source - target) + 256 * target) / 256 + DB $0F, $F9, $C1 /// PSUBW MM0, MM1, source - target + DB $0F, $D5, $C6 /// PMULLW MM0, MM6, alpha * (source - target) + DB $0F, $FD, $C2 /// PADDW MM0, MM2, add target (in shifted form) + DB $0F, $71, $D0, $08 /// PSRLW MM0, 8, divide by 256 + + // Bias is accounted for by conversion of range 0..255 to -128..127, + // doing a saturated add and convert back to 0..255. + DB $0F, $F9, $C4 /// PSUBW MM0, MM4 + DB $0F, $ED, $C5 /// PADDSW MM0, MM5 + DB $0F, $FD, $C4 /// PADDW MM0, MM4 + DB $0F, $67, $C0 /// PACKUSWB MM0, MM0, convert words to bytes with saturation + DB $0F, $7E, $07 /// MOVD [EDI], MM0, store the result +@3: + ADD ESI, 4 + ADD EDI, 4 + DEC ECX + JNZ @1 + POP EDI + POP ESI +}end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure AlphaBlendLinePerPixel(Source, Destination: Pointer; Count, Bias: Integer); +begin +// Blends a line of Count pixels from Source to Destination using the alpha value of the source pixels. +// The layout of a pixel must be BGRA. +// Bias is an additional value which gets added to every component and must be in the range -128..127 +// +// EAX contains Source +// EDX contains Destination +// ECX contains Count +// Bias is on the stack + // todo +{asm + PUSH ESI // save used registers + PUSH EDI + + MOV ESI, EAX // ESI becomes the actual source pointer + MOV EDI, EDX // EDI becomes the actual target pointer + + // Load MM5 with the bias value. + MOV EAX, [Bias] + DB $0F, $6E, $E8 /// MOVD MM5, EAX + DB $0F, $61, $ED /// PUNPCKLWD MM5, MM5 + DB $0F, $62, $ED /// PUNPCKLDQ MM5, MM5 + + // Load MM4 with 128 to allow for saturated biasing. + MOV EAX, 128 + DB $0F, $6E, $E0 /// MOVD MM4, EAX + DB $0F, $61, $E4 /// PUNPCKLWD MM4, MM4 + DB $0F, $62, $E4 /// PUNPCKLDQ MM4, MM4 + +@1: // The pixel loop calculates an entire pixel in one run. + // Note: The pixel byte values are expanded into the higher bytes of a word due + // to the way unpacking works. We compensate for this with an extra shift. + DB $0F, $EF, $C0 /// PXOR MM0, MM0, clear source pixel register for unpacking + DB $0F, $60, $06 /// PUNPCKLBW MM0, [ESI], unpack source pixel byte values into words + DB $0F, $71, $D0, $08 /// PSRLW MM0, 8, move higher bytes to lower bytes + DB $0F, $EF, $C9 /// PXOR MM1, MM1, clear target pixel register for unpacking + DB $0F, $60, $0F /// PUNPCKLBW MM1, [EDI], unpack target pixel byte values into words + DB $0F, $6F, $D1 /// MOVQ MM2, MM1, make a copy of the shifted values, we need them again + DB $0F, $71, $D1, $08 /// PSRLW MM1, 8, move higher bytes to lower bytes + + // Load MM6 with the source alpha value (replicate it for every component). + // Expand it to word size. + DB $0F, $6F, $F0 /// MOVQ MM6, MM0 + DB $0F, $69, $F6 /// PUNPCKHWD MM6, MM6 + DB $0F, $6A, $F6 /// PUNPCKHDQ MM6, MM6 + + // calculation is: target = (alpha * (source - target) + 256 * target) / 256 + DB $0F, $F9, $C1 /// PSUBW MM0, MM1, source - target + DB $0F, $D5, $C6 /// PMULLW MM0, MM6, alpha * (source - target) + DB $0F, $FD, $C2 /// PADDW MM0, MM2, add target (in shifted form) + DB $0F, $71, $D0, $08 /// PSRLW MM0, 8, divide by 256 + + // Bias is accounted for by conversion of range 0..255 to -128..127, + // doing a saturated add and convert back to 0..255. + DB $0F, $F9, $C4 /// PSUBW MM0, MM4 + DB $0F, $ED, $C5 /// PADDSW MM0, MM5 + DB $0F, $FD, $C4 /// PADDW MM0, MM4 + DB $0F, $67, $C0 /// PACKUSWB MM0, MM0, convert words to bytes with saturation + DB $0F, $7E, $07 /// MOVD [EDI], MM0, store the result +@3: + ADD ESI, 4 + ADD EDI, 4 + DEC ECX + JNZ @1 + POP EDI + POP ESI +}end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure AlphaBlendLineMaster(Source, Destination: Pointer; Count: Integer; ConstantAlpha, Bias: Integer); +begin +// Blends a line of Count pixels from Source to Destination using the source pixel and a constant alpha value. +// The layout of a pixel must be BGRA. +// ConstantAlpha must be in the range 0..255. +// Bias is an additional value which gets added to every component and must be in the range -128..127 +// +// EAX contains Source +// EDX contains Destination +// ECX contains Count +// ConstantAlpha and Bias are on the stack +{ todo +asm + PUSH ESI // save used registers + PUSH EDI + + MOV ESI, EAX // ESI becomes the actual source pointer + MOV EDI, EDX // EDI becomes the actual target pointer + + // Load MM6 with the constant alpha value (replicate it for every component). + // Expand it to word size. + MOV EAX, [ConstantAlpha] + DB $0F, $6E, $F0 /// MOVD MM6, EAX + DB $0F, $61, $F6 /// PUNPCKLWD MM6, MM6 + DB $0F, $62, $F6 /// PUNPCKLDQ MM6, MM6 + + // Load MM5 with the bias value. + MOV EAX, [Bias] + DB $0F, $6E, $E8 /// MOVD MM5, EAX + DB $0F, $61, $ED /// PUNPCKLWD MM5, MM5 + DB $0F, $62, $ED /// PUNPCKLDQ MM5, MM5 + + // Load MM4 with 128 to allow for saturated biasing. + MOV EAX, 128 + DB $0F, $6E, $E0 /// MOVD MM4, EAX + DB $0F, $61, $E4 /// PUNPCKLWD MM4, MM4 + DB $0F, $62, $E4 /// PUNPCKLDQ MM4, MM4 + +@1: // The pixel loop calculates an entire pixel in one run. + // Note: The pixel byte values are expanded into the higher bytes of a word due + // to the way unpacking works. We compensate for this with an extra shift. + DB $0F, $EF, $C0 /// PXOR MM0, MM0, clear source pixel register for unpacking + DB $0F, $60, $06 /// PUNPCKLBW MM0, [ESI], unpack source pixel byte values into words + DB $0F, $71, $D0, $08 /// PSRLW MM0, 8, move higher bytes to lower bytes + DB $0F, $EF, $C9 /// PXOR MM1, MM1, clear target pixel register for unpacking + DB $0F, $60, $0F /// PUNPCKLBW MM1, [EDI], unpack target pixel byte values into words + DB $0F, $6F, $D1 /// MOVQ MM2, MM1, make a copy of the shifted values, we need them again + DB $0F, $71, $D1, $08 /// PSRLW MM1, 8, move higher bytes to lower bytes + + // Load MM7 with the source alpha value (replicate it for every component). + // Expand it to word size. + DB $0F, $6F, $F8 /// MOVQ MM7, MM0 + DB $0F, $69, $FF /// PUNPCKHWD MM7, MM7 + DB $0F, $6A, $FF /// PUNPCKHDQ MM7, MM7 + DB $0F, $D5, $FE /// PMULLW MM7, MM6, source alpha * master alpha + DB $0F, $71, $D7, $08 /// PSRLW MM7, 8, divide by 256 + + // calculation is: target = (alpha * master alpha * (source - target) + 256 * target) / 256 + DB $0F, $F9, $C1 /// PSUBW MM0, MM1, source - target + DB $0F, $D5, $C7 /// PMULLW MM0, MM7, alpha * (source - target) + DB $0F, $FD, $C2 /// PADDW MM0, MM2, add target (in shifted form) + DB $0F, $71, $D0, $08 /// PSRLW MM0, 8, divide by 256 + + // Bias is accounted for by conversion of range 0..255 to -128..127, + // doing a saturated add and convert back to 0..255. + DB $0F, $F9, $C4 /// PSUBW MM0, MM4 + DB $0F, $ED, $C5 /// PADDSW MM0, MM5 + DB $0F, $FD, $C4 /// PADDW MM0, MM4 + DB $0F, $67, $C0 /// PACKUSWB MM0, MM0, convert words to bytes with saturation + DB $0F, $7E, $07 /// MOVD [EDI], MM0, store the result +@3: + ADD ESI, 4 + ADD EDI, 4 + DEC ECX + JNZ @1 + POP EDI + POP ESI +}end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure AlphaBlendLineMasterAndColor(Destination: Pointer; Count: Integer; ConstantAlpha, Color: Integer); +begin +// Blends a line of Count pixels in Destination against the given color using a constant alpha value. +// The layout of a pixel must be BGRA and Color must be rrggbb00 (as stored by a COLORREF). +// ConstantAlpha must be in the range 0..255. +// +// EAX contains Destination +// EDX contains Count +// ECX contains ConstantAlpha +// Color is passed on the stack +{ todo +asm + // The used formula is: target = (alpha * color + (256 - alpha) * target) / 256. + // alpha * color (factor 1) and 256 - alpha (factor 2) are constant values which can be calculated in advance. + // The remaining calculation is therefore: target = (F1 + F2 * target) / 256 + + // Load MM3 with the constant alpha value (replicate it for every component). + // Expand it to word size. (Every calculation here works on word sized operands.) + DB $0F, $6E, $D9 /// MOVD MM3, ECX + DB $0F, $61, $DB /// PUNPCKLWD MM3, MM3 + DB $0F, $62, $DB /// PUNPCKLDQ MM3, MM3 + + // Calculate factor 2. + MOV ECX, $100 + DB $0F, $6E, $D1 /// MOVD MM2, ECX + DB $0F, $61, $D2 /// PUNPCKLWD MM2, MM2 + DB $0F, $62, $D2 /// PUNPCKLDQ MM2, MM2 + DB $0F, $F9, $D3 /// PSUBW MM2, MM3 // MM2 contains now: 255 - alpha = F2 + + // Now calculate factor 1. Alpha is still in MM3, but the r and b components of Color must be swapped. + MOV ECX, [Color] + BSWAP ECX + ROR ECX, 8 + DB $0F, $6E, $C9 /// MOVD MM1, ECX // Load the color and convert to word sized values. + DB $0F, $EF, $E4 /// PXOR MM4, MM4 + DB $0F, $60, $CC /// PUNPCKLBW MM1, MM4 + DB $0F, $D5, $CB /// PMULLW MM1, MM3 // MM1 contains now: color * alpha = F1 + +@1: // The pixel loop calculates an entire pixel in one run. + DB $0F, $6E, $00 /// MOVD MM0, [EAX] + DB $0F, $60, $C4 /// PUNPCKLBW MM0, MM4 + + DB $0F, $D5, $C2 /// PMULLW MM0, MM2 // calculate F1 + F2 * target + DB $0F, $FD, $C1 /// PADDW MM0, MM1 + DB $0F, $71, $D0, $08 /// PSRLW MM0, 8 // divide by 256 + + DB $0F, $67, $C0 /// PACKUSWB MM0, MM0 // convert words to bytes with saturation + DB $0F, $7E, $00 /// MOVD [EAX], MM0 // store the result + + ADD EAX, 4 + DEC EDX + JNZ @1 +}end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure EMMS; +begin +// Reset MMX state to use the FPU for other tasks again. + +{ todo +asm + DB $0F, $77 /// EMMS +}end; + +//---------------------------------------------------------------------------------------------------------------------- + +function GetBitmapBitsFromDeviceContext(DC: HDC; var Width, Height: Integer): Pointer; + +// Helper function used to retrieve the bitmap selected into the given device context. If there is a bitmap then +// the function will return a pointer to its bits otherwise nil is returned. +// Additionally the dimensions of the bitmap are returned. + +var + Bitmap: HBITMAP; + DIB: TDIBSection; + +begin + Result := nil; + {todo Width := 0; + Height := 0; + + Bitmap := GetCurrentObject(DC, OBJ_BITMAP); + if Bitmap <> 0 then + begin + if GetObject(Bitmap, SizeOf(DIB), @DIB) = SizeOf(DIB) then + begin + Assert(DIB.dsBm.bmPlanes * DIB.dsBm.bmBitsPixel = 32, 'Alpha blending error: bitmap must use 32 bpp.'); + Result := DIB.dsBm.bmBits; + Width := DIB.dsBmih.biWidth; + Height := DIB.dsBmih.biHeight; + end; + end; } + Assert(Result <> nil, 'Alpha blending DC error: no bitmap available.'); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function CalculateScanline(Bits: Pointer; Width, Height, Row: Integer): Pointer; + +// Helper function to calculate the start address for the given row. + +begin exit; + if Height > 0 then // bottom-up DIB + Row := Height - Row - 1; + // Return DWORD aligned address of the requested scanline. + Integer(Result) := Integer(Bits) + Row * ((Width * 32 + 31) and not 31) div 8; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure AlphaBlend(Source, Destination: HDC; R: TRect; Target: TPoint; Mode: TBlendMode; ConstantAlpha, Bias: Integer); + +// Optimized alpha blend procedure using MMX instructions to perform as quick as possible. +// For this procedure to work properly it is important that both source and target bitmap use the 32 bit color format. +// R describes the source rectangle to work on. +// Target is the place (upper left corner) in the target bitmap where to blend to. Note that source width + X offset +// must be less or equal to the target width. Similar for the height. +// If Mode is bmConstantAlpha then the blend operation uses the given ConstantAlpha value for all pixels. +// If Mode is bmPerPixelAlpha then each pixel is blended using its individual alpha value (the alpha value of the source). +// If Mode is bmMasterAlpha then each pixel is blended using its individual alpha value multiplied by ConstantAlpha. +// If Mode is bmConstantAlphaAndColor then each destination pixel is blended using ConstantAlpha but also a constant +// color which will be obtained from Bias. In this case no offset value is added, otherwise Bias is used as offset. +// Blending of a color into target only (bmConstantAlphaAndColor) ignores Source (the DC) and Target (the position). +// CAUTION: This procedure does not check whether MMX instructions are actually available! Call it only if MMX is really +// usable. + +var + Y: Integer; + SourceRun, + TargetRun: PByte; + + SourceBits, + DestBits: Pointer; + SourceWidth, + SourceHeight, + DestWidth, + DestHeight: Integer; + +begin + if not IsRectEmpty(R) then + begin + // Note: it is tempting to optimize the special cases for constant alpha 0 and 255 by just ignoring soure + // (alpha = 0) or simply do a blit (alpha = 255). But this does not take the bias into account. + case Mode of + bmConstantAlpha: + begin + // Get a pointer to the bitmap bits for the source and target device contexts. + // Note: this supposes that both contexts do actually have bitmaps assigned! + SourceBits := GetBitmapBitsFromDeviceContext(Source, SourceWidth, SourceHeight); + DestBits := GetBitmapBitsFromDeviceContext(Destination, DestWidth, DestHeight); + if Assigned(SourceBits) and Assigned(DestBits) then + begin + for Y := 0 to R.Bottom - R.Top - 1 do + begin + SourceRun := CalculateScanline(SourceBits, SourceWidth, SourceHeight, Y + R.Top); + Inc(SourceRun, 4 * R.Left); + TargetRun := CalculateScanline(DestBits, DestWidth, DestHeight, Y + Target.Y); + Inc(TargetRun, 4 * Target.X); + AlphaBlendLineConstant(SourceRun, TargetRun, R.Right - R.Left, ConstantAlpha, Bias); + end; + end; + EMMS; + end; + bmPerPixelAlpha: + begin + SourceBits := GetBitmapBitsFromDeviceContext(Source, SourceWidth, SourceHeight); + DestBits := GetBitmapBitsFromDeviceContext(Destination, DestWidth, DestHeight); + if Assigned(SourceBits) and Assigned(DestBits) then + begin + for Y := 0 to R.Bottom - R.Top - 1 do + begin + SourceRun := CalculateScanline(SourceBits, SourceWidth, SourceHeight, Y + R.Top); + Inc(SourceRun, 4 * R.Left); + TargetRun := CalculateScanline(DestBits, DestWidth, DestHeight, Y + Target.Y); + Inc(TargetRun, 4 * Target.X); + AlphaBlendLinePerPixel(SourceRun, TargetRun, R.Right - R.Left, Bias); + end; + end; + EMMS; + end; + bmMasterAlpha: + begin + SourceBits := GetBitmapBitsFromDeviceContext(Source, SourceWidth, SourceHeight); + DestBits := GetBitmapBitsFromDeviceContext(Destination, DestWidth, DestHeight); + if Assigned(SourceBits) and Assigned(DestBits) then + begin + for Y := 0 to R.Bottom - R.Top - 1 do + begin + SourceRun := CalculateScanline(SourceBits, SourceWidth, SourceHeight, Y + R.Top); + Inc(SourceRun, 4 * Target.X); + TargetRun := CalculateScanline(DestBits, DestWidth, DestHeight, Y + Target.Y); + AlphaBlendLineMaster(SourceRun, TargetRun, R.Right - R.Left, ConstantAlpha, Bias); + end; + end; + EMMS; + end; + bmConstantAlphaAndColor: + begin + // Source is ignored since there is a constant color value. + DestBits := GetBitmapBitsFromDeviceContext(Destination, DestWidth, DestHeight); + if Assigned(DestBits) then + begin + for Y := 0 to R.Bottom - R.Top - 1 do + begin + TargetRun := CalculateScanline(DestBits, DestWidth, DestHeight, Y + R.Top); + Inc(TargetRun, 4 * R.Left); + AlphaBlendLineMasterAndColor(TargetRun, R.Right - R.Left, ConstantAlpha, Bias); + end; + end; + EMMS; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function GetRGBColor(Value: TColor): DWORD; + +// Little helper to convert a Delphi color to an image list color. + +begin + Result := ColorToRGB(Value); + case Result of + clNone: + Result := $FFFFFFFF {CLR_NONE}; + clDefault: + Result := $FF000000 {CLR_DEFAULT}; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +// todo: +function LoadBitmap(x: Integer; s: PChar): Integer; +begin + Result := 0; +end; + + +const + Grays: array[0..3] of TColor = (clWhite, clSilver, clGray, clBlack); + SysGrays: array[0..3] of TColor = (clWindow, clBtnFace, clBtnShadow, clBtnText); + +procedure ConvertImageList(IL: TImageList; const ImageName: string; ColorRemapping: Boolean = True); + +// Loads a bunch of images given by ImageName into IL. If ColorRemapping = True then a mapping of gray values to +// system colors is performed. + +var + Images, + OneImage, + AnotherImage: TBitmap; + I: Integer; + MaskColor: TColor; + Source, + Dest: TRect; + //Small (???) hack while a solution does not come + Stream: TMemoryStream; +begin + Watcher.Enter; + try + // Since we want the image list appearing in the correct system colors, we have to remap its colors. + Images := TBitmap.Create; + //OneImage := TBitmap.Create; + //todo: remove this ugly hack ASAP + Stream:=TMemoryStream.Create; + //todo: see what CreateMappedRes do and replace it + { + if ColorRemapping then + Images.Handle := CreateMappedRes(FindClassHInstance(TBaseVirtualTree), PChar(ImageName), Grays, SysGrays) + else + Images.Handle := LoadBitmap(FindClassHInstance(TBaseVirtualTree), PChar(ImageName)); + } + Images.LoadFromLazarusResource(ImageName); + try + Assert(Images.Height > 0, 'Internal image "' + ImageName + '" is missing or corrupt.'); + + // It is assumed that the image height determines also the width of one entry in the image list. + IL.Clear; + IL.Height := Images.Height; + IL.Width := Images.Height; + //OneImage.Width := IL.Width; + //OneImage.Height := IL.Height; + + MaskColor := clFuchsia;//Images.Canvas.Pixels[0, 0]; // this is usually clFuchsia + Dest := Rect(0, 0, IL.Width, IL.Height); + for I := 0 to (Images.Width div Images.Height) - 1 do + begin + Source := Rect(I * IL.Width, 0, (I + 1) * IL.Width, IL.Height); + OneImage:= TBitmap.Create; + OneImage.Width:=IL.Height; + OneImage.Height:=IL.Width; + OneImage.Canvas.CopyRect(Dest, Images.Canvas, Source); + //somehow SaveToStream - LoadFromStream restores the tranparency lost in CopyRect + OneImage.SaveToStream(Stream); + OneImage.Free; + AnotherImage:=TBitmap.Create; + Stream.Position:=0; + AnotherImage.LoadFromStream(Stream); + Stream.Size:=0; + IL.AddDirect(AnotherImage, nil); + end; + finally + Images.Free; + //OneImage.Free; + Stream.Free; + end; + finally + Watcher.Leave; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +// todo: +const + DFCS_HOT = $1000; + +procedure CreateSystemImageSet(var IL: TImageList; Flags: Cardinal; Flat: Boolean); + +// Creates a system check image set. +// Note: the DarkCheckImages and FlatImages image lists must already be filled, as some images from them are copied here. + +const + MaskColor: TColor = clRed; + +var + BM: TBitmap; + + //--------------- local functions ------------------------------------------- + + procedure AddNodeImages(IL: TImageList); + + var + I: Integer; + OffsetX, + OffsetY: Integer; + + begin + // The offsets are used to center the node images in case the sizes differ. + OffsetX := (IL.Width - DarkCheckImages.Width) div 2; + OffsetY := (IL.Height - DarkCheckImages.Height) div 2; + for I := 21 to 24 do + begin + BM.Canvas.Brush.Color := MaskColor; + BM.Canvas.FillRect(Rect(0, 0, BM.Width, BM.Height)); + if Flat then + FlatImages.Draw(BM.Canvas, OffsetX, OffsetY, I) + else + DarkCheckImages.Draw(BM.Canvas, OffsetX, OffsetY, I); + //IL.AddMasked(BM, MaskColor); + IL.AddCopy(BM,nil); + end; + end; + + //--------------------------------------------------------------------------- + + procedure AddSystemImage(IL: TImageList; Index: Integer); + + var + ButtonState: Cardinal; + ButtonType: Cardinal; + + begin + BM.Canvas.Brush.Color := MaskColor; + BM.Canvas.FillRect(Rect(0, 0, BM.Width, BM.Height)); + if Index < 8 then + ButtonType := DFCS_BUTTONRADIO + else + ButtonType := DFCS_BUTTONCHECK; + if Index >= 16 then + ButtonType := ButtonType or DFCS_BUTTON3STATE; + + case Index mod 4 of + 0: + ButtonState := 0; + 1: + ButtonState := DFCS_HOT; + 2: + ButtonState := DFCS_PUSHED; + else + ButtonState := DFCS_INACTIVE; + end; + if Index in [4..7, 12..19] then + ButtonState := ButtonState or DFCS_CHECKED; + if Flat then + ButtonState := ButtonState or DFCS_FLAT; + //todo: remap to LCLIntf +// DrawFrameControl(BM.Canvas.Handle, Rect(1, 2, BM.Width - 2, BM.Height - 1), DFC_BUTTON, ButtonType or ButtonState); + IL.AddCopy(BM,nil); + //IL.AddMasked(BM, MaskColor); + end; + + //--------------- end local functions --------------------------------------- + +var + I, Width, Height: Integer; + +begin + + {$IFDEF LINUX} //theo 24.2.2007 + Width:=14; + Height:=14; {$message warn'nur um die exception zu verhindern. Werte nicht getestet'} + {$ELSE} + Width := GetSystemMetrics(SM_CXMENUCHECK) + 3; + Height := GetSystemMetrics(SM_CYMENUCHECK) + 3; + {$ENDIF} + IL := TImageList.CreateSize(Width, Height); + //with IL do + // Handle := ImageList_Create(Width, Height, Flags, 0, AllocBy); + IL.Masked := True; + //todo: see why compiler complain here + //IL.BkColor := clWhite; + + // Create a temporary bitmap, which holds the intermediate images. + BM := TBitmap.Create; + try + // Make the bitmap the same size as the image list is to avoid problems when adding. + BM.Width := IL.Width; + BM.Height := IL.Height; + BM.Canvas.Brush.Color := MaskColor; + BM.Canvas.Brush.Style := bsSolid; + BM.Canvas.FillRect(Rect(0, 0, BM.Width, BM.Height)); + //IL.AddMasked(BM, MaskColor); + IL.AddCopy(BM,nil); + + // Add the 20 system checkbox and radiobutton images. + for I := 0 to 19 do + AddSystemImage(IL, I); + // Add the 4 node images from the dark check set. + AddNodeImages(IL); + + finally + //todo: change to except?? + //lcl free the bitmap in IL + //BM.Free; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function HasMMX: Boolean; +begin + Result := False; +// Helper method to determine whether the current processor supports MMX. +{ todo +asm + PUSH EBX + XOR EAX, EAX // Result := False + PUSHFD // determine if the processor supports the CPUID command + POP EDX + MOV ECX, EDX + XOR EDX, $200000 + PUSH EDX + POPFD + PUSHFD + POP EDX + XOR ECX, EDX + JZ @1 // no CPUID support so we can't even get to the feature information + PUSH EDX + POPFD + + MOV EAX, 1 + DW $A20F // CPUID, EAX contains now version info and EDX feature information + MOV EBX, EAX // free EAX to get the result value + XOR EAX, EAX // Result := False + CMP EBX, $50 + JB @1 // if processor family is < 5 then it is not a Pentium class processor + TEST EDX, $800000 + JZ @1 // if the MMX bit is not set then we don't have MMX + INC EAX // Result := True +@1: + POP EBX +}end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure PrtStretchDrawDIB(Canvas: TCanvas; DestRect: TRect; ABitmap: TBitmap); + +// Stretch draw on to the new canvas. + +var + Header, + Bits: Pointer; + HeaderSize, + BitsSize: Cardinal; + +begin + {todo GetDIBSizes(ABitmap.Handle, HeaderSize, BitsSize); + + GetMem(Header, HeaderSize); + GetMem(Bits, BitsSize); + try + GetDIB(ABitmap.Handle, ABitmap.Palette, Header^, Bits^); + StretchDIBits(Canvas.Handle, DestRect.Left, DestRect.Top, DestRect.Right - DestRect.Left, DestRect.Bottom - + DestRect.Top, 0, 0, ABitmap.Width, ABitmap.Height, Bits, TBitmapInfo(Header^), DIB_RGB_COLORS, SRCCOPY); + finally + FreeMem(Header); + FreeMem(Bits); + end;} +end; + +//---------------------------------------------------------------------------------------------------------------------- +// todo +function LoadCursor(x: integer; s:pchar): integer; +begin + result := -1; +end; + + +procedure InitializeGlobalStructures; + +// initialization of stuff global to the unit + +var + Flags: Cardinal; + +begin + Initialized := True; + + // For the drag image a fast MMX blend routine is used. We have to make sure MMX is available. + MMXAvailable := HasMMX; + + // There is a bug in Win95 and WinME (and potentially in Win98 too) regarding GetDCEx which causes sometimes + // serious trouble within GDI (see method WMNCPaint). +// IsWinNT := (Win32Platform and VER_PLATFORM_WIN32_NT) <> 0; // todo remove block +// IsWin2K := (Win32MajorVersion = 5) and (Win32MinorVersion = 0); +// IsWinXP := (Win32MajorVersion = 5) and (Win32MinorVersion = 1); + + // Load all internal image lists and convert their colors to current desktop color scheme. + // In order to use high color images we have to create the image list handle ourselves. + + LightCheckImages := TImageList.CreateSize(16, 16); + ConvertImageList(LightCheckImages, 'VT_CHECK_LIGHT'); + + DarkCheckImages := TImageList.CreateSize(16, 16); + ConvertImageList(DarkCheckImages, 'VT_CHECK_DARK'); + + LightTickImages := TImageList.CreateSize(16, 16); + ConvertImageList(LightTickImages, 'VT_TICK_LIGHT'); + + DarkTickImages := TImageList.CreateSize(16, 16); + ConvertImageList(DarkTickImages, 'VT_TICK_DARK'); + + FlatImages := TImageList.CreateSize(16, 16); + ConvertImageList(FlatImages, 'VT_FLAT'); + + XPImages := TImageList.CreateSize(16, 16); + ConvertImageList(XPImages, 'VT_XP', False); + + UtilityImages := TImageList.CreateSize(UtilityImageSize, UtilityImageSize); + ConvertImageList(UtilityImages, 'VT_UTILITIES'); + + CreateSystemImageSet(SystemCheckImages, Flags, False); + CreateSystemImageSet(SystemFlatCheckImages, Flags, True); + + +//mm // Specify an useful timer resolution for timeGetTime. +//mm timeBeginPeriod(MinimumTimerInterval); + + // Delphi (at least version 6 and lower) does not provide a standard split cursor. + // Hence we have to load our own. +//todo Screen.Cursors[crHeaderSplit] := LoadCursor(HInstance, 'VT_HEADERSPLIT'); + +//c // Clipboard format registration. +//c // Native clipboard format. Needs a new identifier and has an average priority to allow other formats to take over. +//c // This format is supposed to use the IStream storage format but unfortunately this does not work when +//c // OLEFlushClipboard is used. Hence it is disabled until somebody finds a solution. +//c CF_VIRTUALTREE := RegisterVTClipboardFormat(CFSTR_VIRTUALTREE, TBaseVirtualTree, 50, TYMED_HGLOBAL {or TYMED_ISTREAM}); +//c // Specialized string tree formats. +//c CF_HTML := RegisterVTClipboardFormat(CFSTR_HTML, TCustomVirtualStringTree, 80); +//c CF_VRTFNOOBJS := RegisterVTClipboardFormat(CFSTR_RTFNOOBJS, TCustomVirtualStringTree, 84); +//c CF_VRTF := RegisterVTClipboardFormat(CFSTR_RTF, TCustomVirtualStringTree, 85); +//c CF_CSV := RegisterVTClipboardFormat(CFSTR_CSV, TCustomVirtualStringTree, 90); +//c // Predefined clipboard formats. Just add them to the internal list. +//c RegisterVTClipboardFormat(CF_TEXT, TCustomVirtualStringTree, 100); +//c RegisterVTClipboardFormat(CF_UNICODETEXT, TCustomVirtualStringTree, 95); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure FinalizeGlobalStructures; + +var + HintWasEnabled: Boolean; + +begin +//mm timeEndPeriod(MinimumTimerInterval); + + LightCheckImages.Free; + DarkCheckImages.Free; + LightTickImages.Free; + DarkTickImages.Free; + FlatImages.Free; + XPImages.Free; + UtilityImages.Free; + SystemCheckImages.Free; + SystemFlatCheckImages.Free; + + // If VT is used in a package and its special hint window was used then the last instance of this + // window is not freed correctly (bug in the VCL). We explicitely tell the application to free it + // otherwise an AV is raised due to access to an invalid memory area. +//todo if ModuleIsPackage then +// begin +// HintWasEnabled := Application.ShowHint; +// Application.ShowHint := False; +// if HintWasEnabled then +// Application.ShowHint := True; +// end; +end; + +//----------------- TWorkerThread -------------------------------------------------------------------------------------- + +procedure AddThreadReference; + +begin exit; + if WorkerThread = nil then + begin + // Create an event used to trigger our worker thread when something is to do. + WorkEvent := TEvent.Create(nil, False, False, ''); +// if WorkEvent = 0 then +// RaiseLastOSError; later:test, how we can test if workevent is valid + + // Create worker thread, initialize it and send it to its wait loop. + WorkerThread := TWorkerThread.Create(False); + end; + Inc(WorkerThread.FRefCount); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure ReleaseThreadReference(Tree: TBaseVirtualTree); + +begin exit; + if Assigned(WorkerThread) then + begin + Dec(WorkerThread.FRefCount); + + // Make sure there is no reference remaining to the releasing tree. + Tree.InterruptValidation; + + if WorkerThread.FRefCount = 0 then + begin + with WorkerThread do + begin + Terminate; + WorkEvent.SetEvent; + +//? // The following work around is no longer necessary with Delphi 6 and up. +//? {$ifndef COMPILER_6_UP} +//? // There is a problem when the thread is freed in the exit code of a DLL. This can happen when a tree is +//? // destroyed on unload of a DLL (e.g. control panel applet). In this case only the main thread will get +//? // CPU time, other threads will never awake again. The VCL however waits for a thread when freeing it +//? // which will result in a deadlock (the WaitFor call does not return because the thread does not get CPU time). +//? // If a thread is however suspended then the VCL does not wait and all is fine. +//? if IsLibrary then +//? Suspend; +//? {$endif COMPILER_6_UP} + + WorkerThread.Free; + end; + WorkerThread := nil; + WorkEvent.Free; + WorkEvent := nil; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +constructor TWorkerThread.Create(CreateSuspended: Boolean); + +begin exit; + inherited Create(CreateSuspended); + FChangeLock := TCriticalSection.Create; + FWaiterList := TThreadList.Create; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TWorkerThread.Destroy; + +begin exit; + FWaiterList.Free; + FChangeLock.Free; + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TWorkerThread.ChangeTreeStates(EnterStates, LeaveStates: TChangeStates); + +begin exit; +//todo if Assigned(FCurrentTree) and (FCurrentTree.HandleAllocated) then +// SendMessage(FCurrentTree.Handle, WM_CHANGESTATE, Byte(EnterStates), Byte(LeaveStates)); +end; + +//---------------------------------------------------------------------------------------------------------------------- +procedure TWorkerThread.x; +begin exit; +end; + + +procedure TWorkerThread.Execute; + +// Does some background tasks, like validating tree caches. + +var + EnterStates, + LeaveStates: TChangeStates; + +begin exit; // todo: + while not Terminated do + begin //Synchronize(@x); + WorkEvent.WaitFor($FFFFFFFF {INFINITE}); //Windows.WaitForSingleObject(WorkEvent.Handle, $FFFFFFFF); + if not Terminated then + begin //Synchronize(@x); + // Get the next waiting tree. + with FWaiterList.LockList do + try + if Count > 0 then + begin + FCurrentTree := TBaseVirtualTree(Items[0]); + // Remove this tree from waiter list. + Delete(0); + // If there is yet another tree to work on then set the work event to keep looping. + if Count > 0 then + WorkEvent.SetEvent; + end + else + FCurrentTree := nil; + finally + FWaiterList.UnlockList; + end; + //Synchronize(@x); + // Something to do? + try + if Assigned(FCurrentTree) then + begin + ChangeTreeStates([csValidating], [csUseCache]); + FChangeLock.Enter; + try + EnterStates := []; + if not (tsStopValidation in FCurrentTree.FStates) and FCurrentTree.DoValidateCache then + EnterStates := [csUseCache]; + finally + FChangeLock.Leave; + end; + end; + finally + LeaveStates := [csValidating, csStopValidation]; + if csUseCache in EnterStates then + Include(LeaveStates, csValidationNeeded); + ChangeTreeStates(EnterStates, LeaveStates); + FCurrentTree := nil; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TWorkerThread.AddTree(Tree: TBaseVirtualTree); + +var + EnterStates, + LeaveStates: TVirtualTreeStates; + +begin exit; + Assert(Assigned(Tree), 'Tree must not be nil.'); + + // Remove validation stop flag, just in case it is still set. + Tree.DoStateChange([], [tsStopValidation]); +{todo with FWaiterList.LockList do + try + if IndexOf(Tree) = -1 then + Add(Tree); + finally + FWaiterList.UnlockList; + end;} + FCurrentTree := Tree; + try + if Assigned(FCurrentTree) then + begin + Tree.DoStateChange([tsValidating], [tsUseCache]); + FChangeLock.Enter; + try + EnterStates := []; + if not (tsStopValidation in FCurrentTree.FStates) and FCurrentTree.DoValidateCache then + EnterStates := [tsUseCache]; + finally + FChangeLock.Leave; + end; + end; + finally + LeaveStates := [tsValidating, tsStopValidation]; + if tsUseCache in EnterStates then + Include(LeaveStates, tsValidationNeeded); + Tree.DoStateChange(EnterStates, LeaveStates); + FCurrentTree := nil; + end; + +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TWorkerThread.RemoveTree(Tree: TBaseVirtualTree); + +begin exit; + Assert(Assigned(Tree), 'Tree must not be nil.'); + + with FWaiterList.LockList do + try + Remove(Tree); + finally + FWaiterList.UnlockList; + end; +end; + +//----------------- TBufferedString ------------------------------------------------------------------------------------ + +const + AllocIncrement = 4096; + +destructor TBufferedString.Destroy; + +begin + FreeMem(FStart); + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBufferedString.GetAsString: string; + +begin + SetString(Result, FStart, FPosition - FStart); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBufferedString.Add(const S: string); + +var + LastLen, + LastOffset, + Len: Integer; + +begin + Len := Length(S); + // Make room for the new string. + if FEnd - FPosition <= Len then + begin + // Keep last offset to restore it correctly in the case that FStart gets a new memory block assigned. + LastLen := FEnd - FStart; + LastOffset := FPosition - FStart; + ReallocMem(FStart, FEnd - FStart + AllocIncrement); + FPosition := FStart + LastOffset; + FEnd := FStart + LastLen + AllocIncrement; + end; + Move(PChar(S)^, FPosition^, Len); + Inc(FPosition, Len); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBufferedString.AddNewLine; + +var + LastLen, + LastOffset: Integer; + +begin + // Make room for the CR/LF characters. + if FEnd - FPosition <= 2 then + begin + // Keep last offset to restore it correctly in the case that FStart gets a new memory block assigned. + LastLen := FEnd - FStart; + LastOffset := FPosition - FStart; + ReallocMem(FStart, FEnd - FStart + AllocIncrement); + FPosition := FStart + LastOffset; + FEnd := FStart + LastLen + AllocIncrement; + end; + FPosition^ := #13; + Inc(FPosition); + FPosition^ := #10; + Inc(FPosition); +end; + +//----------------- TWideBufferedString -------------------------------------------------------------------------------- + +destructor TWideBufferedString.Destroy; + +begin + FreeMem(FStart); + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TWideBufferedString.GetAsString: WideString; + +begin + SetString(Result, FStart, FPosition - FStart); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TWideBufferedString.Add(const S: WideString); + +var + LastLen, + LastOffset, + Len: Integer; + +begin + Len := Length(S); + // Make room for the new string. + if FEnd - FPosition <= Len then + begin + // Keep last offset to restore it correctly in the case that FStart gets a new memory block assigned. + LastLen := FEnd - FStart; + LastOffset := FPosition - FStart; + ReallocMem(FStart, 2 * (FEnd - FStart + AllocIncrement)); + FPosition := FStart + LastOffset; + FEnd := FStart + LastLen + AllocIncrement; + end; + Move(PWideChar(S)^, FPosition^, 2 * Len); + Inc(FPosition, Len); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TWideBufferedString.AddNewLine; + +var + LastLen, + LastOffset: Integer; + +begin + // Make room for the CR/LF characters. + if FEnd - FPosition <= 4 then + begin + // Keep last offset to restore it correctly in the case that FStart gets a new memory block assigned. + LastLen := FEnd - FStart; + LastOffset := FPosition - FStart; + ReallocMem(FStart, 2 * (FEnd - FStart + AllocIncrement)); + FPosition := FStart + LastOffset; + FEnd := FStart + LastLen + AllocIncrement; + end; + FPosition^ := #13; + Inc(FPosition); + FPosition^ := #10; + Inc(FPosition); +end; + +//----------------- TCustomVirtualTreeOptions -------------------------------------------------------------------------- + +constructor TCustomVirtualTreeOptions.Create(AOwner: TBaseVirtualTree); + +begin + FOwner := AOwner; + + FPaintOptions := DefaultPaintOptions; + FAnimationOptions := DefaultAnimationOptions; + FAutoOptions := DefaultAutoOptions; + FSelectionOptions := DefaultSelectionOptions; + FMiscOptions := DefaultMiscOptions; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TCustomVirtualTreeOptions.SetAnimationOptions(const Value: TVTAnimationOptions); + +begin + FAnimationOptions := Value; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TCustomVirtualTreeOptions.SetAutoOptions(const Value: TVTAutoOptions); + +var + ChangedOptions: TVTAutoOptions; + +begin + if FAutoOptions <> Value then + begin + // Exclusive ORing to get all entries wich are in either set but not in both. + ChangedOptions := FAutoOptions + Value - (FAutoOptions * Value); + FAutoOptions := Value; + with FOwner do + if (toAutoSpanColumns in ChangedOptions) and not (csLoading in ComponentState) and HandleAllocated then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TCustomVirtualTreeOptions.SetMiscOptions(const Value: TVTMiscOptions); + +var + ToBeSet, + ToBeCleared: TVTMiscOptions; + +begin + if FMiscOptions <> Value then + begin + ToBeSet := Value - FMiscOptions; + ToBeCleared := FMiscOptions - Value; + FMiscOptions := Value; + + with FOwner do + if not (csLoading in ComponentState) and HandleAllocated then + begin + if toCheckSupport in ToBeSet + ToBeCleared then + Invalidate; + if not (csDesigning in ComponentState) then + begin + if toFullRepaintOnResize in TobeSet + ToBeCleared then + RecreateWnd(FOwner); +//x if toAcceptOLEDrop in ToBeSet then +//x RegisterDragDrop(Handle, DragManager as IDropTarget); +//x if toAcceptOLEDrop in ToBeCleared then +//x RevokeDragDrop(Handle); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TCustomVirtualTreeOptions.SetPaintOptions(const Value: TVTPaintOptions); + +var + ToBeSet, + ToBeCleared: TVTPaintOptions; + +begin + if FPaintOptions <> Value then + begin + ToBeSet := Value - FPaintOptions; + ToBeCleared := FPaintOptions - Value; + FPaintOptions := Value; + with FOwner do + if not (csLoading in ComponentState) and HandleAllocated then + begin + {$ifdef ThemeSupport} + if toThemeAware in ToBeSet + ToBeCleared then + begin + if (toThemeAware in ToBeSet) and ThemeServices.ThemesEnabled then + DoStateChange([tsUseThemes]) + else + DoStateChange([], [tsUseThemes]); + PrepareBitmaps(True, False); + RedrawWindow(Handle, nil, 0, RDW_INVALIDATE or RDW_VALIDATE or RDW_FRAME); + end + else + {$endif ThemeSupport} + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TCustomVirtualTreeOptions.SetSelectionOptions(const Value: TVTSelectionOptions); + +var + ToBeSet, + ToBeCleared: TVTSelectionOptions; + +begin + if FSelectionOptions <> Value then + begin + ToBeSet := Value - FSelectionOptions; + ToBeCleared := FSelectionOptions - Value; + FSelectionOptions := Value; + + with FOwner do + begin + if (toMultiSelect in (ToBeCleared + ToBeSet)) or + ([toLevelSelectConstraint, toSiblingSelectConstraint] * ToBeSet <> []) then + ClearSelection; + + if (toExtendedFocus in ToBeCleared) and (FFocusedColumn > 0) and HandleAllocated then + begin + FFocusedColumn := FHeader.MainColumn; + Invalidate; + end; + + if not (toExtendedFocus in FSelectionOptions) then + FFocusedColumn := FHeader.MainColumn; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TCustomVirtualTreeOptions.AssignTo(Dest: TPersistent); + +begin + if Dest is TCustomVirtualTreeOptions then + begin + with Dest as TCustomVirtualTreeOptions do + begin + PaintOptions := Self.PaintOptions; + AnimationOptions := Self.AnimationOptions; + AutoOptions := Self.AutoOptions; + SelectionOptions := Self.SelectionOptions; + MiscOptions := Self.MiscOptions; + end; + end + else + inherited; +end; + +//----------------- TVTNodeMemoryManager ------------------------------------------------------------------------------- + +{$ifdef UseLocalMemoryManager} + + const + NodeMemoryGuard: PVirtualNode = PVirtualNode($FEEFEFFE); + + constructor TVTNodeMemoryManager.Create; + + begin + FBlockList := TList.Create; + end; + + //---------------------------------------------------------------------------------------------------------------------- + + destructor TVTNodeMemoryManager.Destroy; + + begin + Clear; + FBlockList.Free; + end; + + //---------------------------------------------------------------------------------------------------------------------- + + function TVTNodeMemoryManager.AllocNode(const Size: Cardinal): PVirtualNode; + + // Allocates memory for a node using the local memory manager. + + const + BlockSize = (16 * 1024); // Blocks larger than 16K offer no significant performance improvement. + + begin + if FAllocSize = 0 then + // Recalculate allocation size first time after a clear. + FAllocSize := (Size + 3) and not 3 // Force alignment on 32-bit boundaries. + else + // Allocation size cannot be increased unless Memory Manager is explicitly cleared. + Assert(Size <= FAllocSize, 'Node memory manager allocation size cannot be increased.'); + + if Assigned(FFreeSpace) then + begin + // Assign node from free-space chain. + Assert(FFreeSpace.NextSibling = NodeMemoryGuard, 'Memory overwrite in node memory manager free space chain.'); + Result := FFreeSpace; // Assign node + FFreeSpace := Result.PrevSibling; // Point to prev node in free-space chain + end + else + begin + if FBytesAvailable < FAllocSize then + begin + // Get another block from the Delphi memory manager. + GetMem(FNext, BlockSize); + FBytesAvailable := BlockSize; + FBlockList.Add(FNext); + end; + // Assign node from current block. + Result := FNext; + Inc(PChar(FNext), FAllocSize); + Dec(FBytesAvailable, FAllocSize); + end; + + // Clear the memory. + FillChar(Result^, FAllocSize, 0); + end; + + //---------------------------------------------------------------------------------------------------------------------- + + procedure TVTNodeMemoryManager.Clear; + + // Releases all memory held by the local memory manager. + + var + I: Integer; + + begin + for I := 0 to FBlockList.Count - 1 do + FreeMem(FBlockList[I]); + FBlockList.Clear; + FFreeSpace := nil; + FBytesAvailable := 0; + FAllocSize := 0; + end; + + //---------------------------------------------------------------------------------------------------------------------- + + procedure TVTNodeMemoryManager.FreeNode(const Node: PVirtualNode); + + // Frees node memory that was allocated using the local memory manager. + + begin + Node.PrevSibling := FFreeSpace; // Point to previous free node. + Node.NextSibling := NodeMemoryGuard; // Memory guard to detect overwrites. + FFreeSpace := Node; // Point Free chain pointer to me. + end; + +{$endif UseLocalMemoryManager} + +//---------------------------------------------------------------------------------------------------------------------- + +// OLE drag and drop support classes +// This is quite heavy stuff (compared with the VCL implementation) but is much better suited to fit the needs +// of DD'ing various kinds of virtual data and works also between applications. + +//----------------- TEnumFormatEtc ------------------------------------------------------------------------------------- +(* +constructor TEnumFormatEtc.Create(Tree: TBaseVirtualTree; AFormatEtcArray: TFormatEtcArray); + +var + I: Integer; + +begin + inherited Create; + + FTree := Tree; + // Make a local copy of the format data. + SetLength(FFormatEtcArray, Length(AFormatEtcArray)); + for I := 0 to High(AFormatEtcArray) do + FFormatEtcArray[I] := AFormatEtcArray[I]; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TEnumFormatEtc.Clone(out Enum: IEnumFormatEtc): HResult; + +var + AClone: TEnumFormatEtc; + +begin + Result := S_OK; + try + AClone := TEnumFormatEtc.Create(nil, FFormatEtcArray); + AClone.FCurrentIndex := FCurrentIndex; + Enum := AClone as IEnumFormatEtc; + except + Result := E_FAIL; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TEnumFormatEtc.Next(celt: Integer; out elt; pceltFetched: PLongint): HResult; + +var + CopyCount: Integer; + +begin + Result := S_FALSE; + CopyCount := Length(FFormatEtcArray) - FCurrentIndex; + if celt < CopyCount then + CopyCount := celt; + if CopyCount > 0 then + begin + Move(FFormatEtcArray[FCurrentIndex], elt, CopyCount * SizeOf(TFormatEtc)); + Inc(FCurrentIndex, CopyCount); + Result := S_OK; + end; + if Assigned(pceltFetched) then + pceltFetched^ := CopyCount; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TEnumFormatEtc.Reset: HResult; + +begin + FCurrentIndex := 0; + Result := S_OK; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TEnumFormatEtc.Skip(celt: Integer): HResult; + +begin + if FCurrentIndex + celt < High(FFormatEtcArray) then + begin + Inc(FCurrentIndex, celt); + Result := S_Ok; + end + else + Result := S_FALSE; +end; +*) + +//----------------- TVirtualTreeHintWindow ----------------------------------------------------------------------------- + +var + // This variable is necessary to coordinate the complex interaction between different hints in the application + // and animated hints in our own class. Under certain conditions it can happen that our hint window is destroyed + // while it is still in the animation loop. + HintWindowDestroyed: Boolean = True; + +constructor TVirtualTreeHintWindow.Create(AOwner: TComponent); + +begin + inherited; + + FBackground := TBitmap.Create; +// FBackground.PixelFormat := pf32Bit; + FDrawBuffer := TBitmap.Create; +// FDrawBuffer.PixelFormat := pf32Bit; + FTarget := TBitmap.Create; +// FTarget.PixelFormat := pf32Bit; + + DoubleBuffered := False; // we do our own buffering + HintWindowDestroyed := False; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TVirtualTreeHintWindow.Destroy; + +begin + HintWindowDestroyed := True; + + FTarget.Free; + FDrawBuffer.Free; + FBackground.Free; + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeHintWindow.AnimationCallback(Step, StepSize: Integer; Data: Pointer): Boolean; + +begin + Result := not HintWindowDestroyed and IsWindowVisible(Handle) and + not (tsCancelHintAnimation in FHintData.Tree.FStates); + if Result then + begin + InternalPaint(Step, StepSize); + // We have to allow certain messages to be processed normally for various reasons. + // This introduces another problem however if this hint window is destroyed + // while it is still in the animation loop. A global variable keeps track of + // that case. This is reliable because we can only have one (internal) hint window. + Application.ProcessMessages; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.InternalPaint(Step, StepSize: Integer); + + //--------------- local functions ------------------------------------------- + + procedure DoShadowBlend(DC: HDC; R: TRect; Alpha: Integer); + + // Helper routine for shadow blending to shorten the parameter list in frequent calls. + + begin + AlphaBlend(0, DC, R, Point(0, 0), bmConstantAlphaAndColor, Alpha, clBlack); + end; + + //--------------------------------------------------------------------------- + + procedure DrawHintShadow(Canvas: TCanvas; ShadowSize: Integer); + + var + R: TRect; + + begin + // Bottom shadow. + R := Rect(ShadowSize, Height - ShadowSize, Width, Height); + DoShadowBlend(Canvas.Handle, R, 5); + Inc(R.Left); + Dec(R.Right); + Dec(R.Bottom); + DoShadowBlend(Canvas.Handle, R, 10); + Inc(R.Left); + Dec(R.Right); + Dec(R.Bottom); + DoShadowBlend(Canvas.Handle, R, 20); + Inc(R.Left); + Dec(R.Right); + Dec(R.Bottom); + DoShadowBlend(Canvas.Handle, R, 35); + Inc(R.Left); + Dec(R.Right); + Dec(R.Bottom); + DoShadowBlend(Canvas.Handle, R, 50); + // Right shadow. + R := Rect(Width - ShadowSize, ShadowSize, Width, Height - ShadowSize); + DoShadowBlend(Canvas.Handle, R, 5); + Inc(R.Top); + Dec(R.Right); + DoShadowBlend(Canvas.Handle, R, 10); + Inc(R.Top); + Dec(R.Right); + DoShadowBlend(Canvas.Handle, R, 20); + Inc(R.Top); + Dec(R.Right); + DoShadowBlend(Canvas.Handle, R, 35); + Inc(R.Top); + Dec(R.Right); + DoShadowBlend(Canvas.Handle, R, 50); + end; + + //--------------- end local functions --------------------------------------- + +var + R: TRect; + Y: Integer; + S: WideString; + DrawFormat: Cardinal; + Shadow: Integer; + +begin + {$ifndef COMPILER_7_UP} + if MMXAvailable then + Shadow := ShadowSize + else + {$endif COMPILER_7_UP} + Shadow := 0; + + with FHintData, FDrawBuffer do + begin + // Do actual painting only in the very first run. + if Step = 0 then + begin + // If the given node is nil then we have to display a header hint. + if (Node = nil) or (Tree.FHintMode <> hmToolTip) then + begin + Canvas.Font := Screen.HintFont; + Y := 2; + end + else + begin + Tree.GetTextInfo(Node, Column, Canvas.Font, R, S); + if vsMultiline in Node^.States then + Y := 1 + else + Y := (R.Top - R.Bottom - Shadow + Self.Height) div 2; + end; + + with ClientRect do + R := Rect(0, 0, Width - Shadow, Height - Shadow); + +{ if (Tree is TCustomVirtualDrawTree) and Assigned(Node) then + begin + // The draw tree has by default no hint text so let it draw the hint itself. + (Tree as TCustomVirtualDrawTree).DoDrawHint(Canvas, Node, R, Column); + end + else} + with Canvas do + begin + // Still force tooltip back and text color. + Font.Color := clInfoText; + Pen.Color := clBlack; + Brush.Color := clInfoBk; + {$ifdef COMPILER_5_UP} + Rectangle(R); + {$else} + with R do + Rectangle(Left, Top, Right, Bottom); + {$endif COMPILER_5_UP} + + // Determine text position and don't forget the border. + InflateRect(R, -Tree.FTextMargin - 1, -1); + DrawFormat := DT_TOP or DT_NOPREFIX; +//b if BidiMode <> bdLeftToRight then +//b begin +//b DrawFormat := DrawFormat or DT_RIGHT or DT_RTLREADING; +//b Inc(R.Right); +//b end +//b else + DrawFormat := DrawFormat or DT_LEFT; + SetBkMode(Handle, LCLType.TRANSPARENT); + R.Top := Y; + if Assigned(Node) and (vsMultiline in Node^.States) then + DrawFormat := DrawFormat or DT_WORDBREAK; + DrawTextW(Canvas, PWideChar(HintText), R, DrawFormat, False); + end; + end; + end; + + if StepSize > 0 then + begin + if FHintData.Tree.DoGetAnimationType = hatFade then + begin + with FTarget do + BitBlt(Canvas.Handle, 0, 0, Width, Height, FBackground.Canvas.Handle, 0, 0, SRCCOPY); + // Main image. + AlphaBlend(FDrawBuffer.Canvas.Handle, FTarget.Canvas.Handle, Rect(0, 0, Width - Shadow, Height - Shadow), + Point(0, 0), bmConstantAlpha, MulDiv(Step, 256, FadeAnimationStepCount), 0); + + if Shadow > 0 then + DrawHintShadow(FTarget.Canvas, Shadow); + BitBlt(Canvas.Handle, 0, 0, Width, Height, FTarget.Canvas.Handle, 0, 0, SRCCOPY); + end + else + begin + // Slide is done by blitting "step" lines of the lower part of the hint window + // and fill the rest with the screen background. + + // 1) blit hint bitmap to the hint canvas + BitBlt(Canvas.Handle, 0, 0, Width - Shadow, Step, FDrawBuffer.Canvas.Handle, 0, Height - Step, SRCCOPY); + // 2) blit background rest to hint canvas + if Step <= Shadow then + Step := 0 + else + Dec(Step, Shadow); + BitBlt(Canvas.Handle, 0, Step, Width, Height - Step, FBackground.Canvas.Handle, 0, Step, SRCCOPY); + end; + end + else + // Last step during slide or the only step without animation. + if FHintData.Tree.DoGetAnimationType <> hatFade then + begin + if Shadow > 0 then + begin + with FBackground do + BitBlt(Canvas.Handle, 0, 0, Width - Shadow, Height - Shadow, FDrawBuffer.Canvas.Handle, 0, 0, SRCCOPY); + + DrawHintShadow(FBackground.Canvas, Shadow); + BitBlt(Canvas.Handle, 0, 0, Width, Height, FBackground.Canvas.Handle, 0, 0, SRCCOPY); + end + else + BitBlt(Canvas.Handle, 0, 0, Width, Height, FDrawBuffer.Canvas.Handle, 0, 0, SRCCOPY); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.CMTextChanged(var Message: TLMessage); + +begin + // swallow this message to prevent the ancestor from resizing the window (we don't use the caption anyway) +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.WMEraseBkgnd(var Message: TLMEraseBkgnd); + +// The control is fully painted by own code so don't erase its background as this causes flickering. + +begin + Message.Result := 1; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.WMNCPaint(var Message: TLMessage); + +// The control is fully painted by own code so don't paint any borders. + +begin + Message.Result := 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.WMShowWindow(var Message: TLMShowWindow); + +// Clear hint data when the window becomes hidden. + +begin + if not Message.Show then + begin + if Assigned(FHintData.Tree) then + FHintData.Tree.FLastHintRect := Rect(0, 0, 0, 0); + Finalize(FHintData); + FillChar(FHintData, SizeOf(FHintData), 0); + + // If the hint window destruction flag to stop any hint window animation was set by a tree + // during its destruction then reset it here to allow other tree instances to still use + // this hint window. + HintWindowDestroyed := False; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.CreateParams(var Params: TCreateParams); + +begin + inherited CreateParams(Params); + + with Params do + begin + Style := WS_POPUP; + ExStyle := ExStyle and not WS_EX_CLIENTEDGE; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.Paint; + +begin + InternalPaint(0, 0); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeHintWindow.ActivateHint(Rect: TRect; const AHint: string); + +var + DC: HDC; + StopLastAnimation: Boolean; + +begin + if IsRectEmpty(Rect) then + Application.CancelHint + else + begin + // There is already an animation. Start a new one but do not continue the old one once we are finished here. + StopLastAnimation := (tsInAnimation in FHintData.Tree.FStates); + if StopLastAnimation then + FHintData.Tree.DoStateChange([], [tsInAnimation]); + + SetWindowPos(Handle, 0, Rect.Left, Rect.Top, Width, Height, {todoSWP_HIDEWINDOW or} SWP_NOACTIVATE or SWP_NOZORDER); +//todo:win UpdateBoundsRect(Rect); + +{org code if Rect.Top + Height > Screen.DesktopHeight then + Rect.Top := Screen.DesktopHeight - Height; + if Rect.Top < Screen.DesktopTop then + Rect.Top := Screen.DesktopTop; + if Rect.Left + Width > Screen.DesktopWidth then + Rect.Left := Screen.DesktopWidth - Width; + if Rect.Left < Screen.DesktopLeft then + Rect.Left := Screen.DesktopLeft;} + + if Rect.Top + Height > Screen.Height then + Rect.Top := Screen.Height - Height; + if Rect.Top < 0 then + Rect.Top := 0; + if Rect.Left + Width > Screen.Width then + Rect.Left := Screen.Width - Width; + if Rect.Left < 0 then + Rect.Left := 0; + + // adjust sizes of bitmaps + FDrawBuffer.Width := Width; + FDrawBuffer.Height := Height; + FBackground.Width := Width; + FBackground.Height := Height; + FTarget.Width := Width; + FTarget.Height := Height; + + FHintData.Tree.Update; + + // capture screen + DC := GetDC(0); + try + with Rect do + BitBlt(FBackground.Canvas.Handle, 0, 0, Width, Height, DC, Left, Top, SRCCOPY); + finally + ReleaseDC(0, DC); + end; + + SetWindowPos(Handle, HWND_TOPMOST, Rect.Left, Rect.Top, Width, Height, {todoSWP_SHOWWINDOW or} SWP_NOACTIVATE); + with FHintData.Tree do + case DoGetAnimationType of + hatNone: + InvalidateRect(Self.Handle, nil, False); + hatFade: + begin + // Make sure the window is not drawn unanimated. +//todowin ValidateRect(Self.Handle, nil); + // Empirically determined animation duration shows that fading needs about twice as much time as + // sliding to show a comparable visual effect. +//todo Animate(FadeAnimationStepCount, 2 * FAnimationDuration, @AnimationCallback, nil); + end; + hatSlide: + begin + // Make sure the window is not drawn unanimated. +//todowin ValidateRect(Self.Handle, nil); +//todo Animate(Self.Height, FAnimationDuration, @AnimationCallback, nil); + end; + end; + if StopLastAnimation and Assigned(FHintData.Tree) then + FHintData.Tree.DoStateChange([tsCancelHintAnimation]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeHintWindow.CalcHintRect(MaxWidth: Integer; const AHint: string; AData: Pointer): TRect; + +var + TM: TTextMetric; + R: TRect; + +begin + if AData = nil then + // Defensive approach, it *can* happen that AData is nil. Maybe when several user defined hint classes are used. + Result := Rect(0, 0, 0, 0) + else + begin + // The hint window does not need any bidi mode setting but the caller of this method (TApplication.ActivateHint) + // does some unneccessary actions if the hint window is not left-to-right. + // The text alignment is based on the bidi mode passed in the hint data, hence we can + // simply set the window's mode to left-to-right (it might have been modified by the caller, if the + // tree window is right-to-left aligned). +//b BidiMode := bdLeftToRight; + + FHintData := PVTHintData(AData)^; + + with FHintData do + begin + // The draw tree gets its hint size by the application (but only if not a header hint is about to show). + // This size has already been determined in CMHintShow. +{ if (Tree is TCustomVirtualDrawTree) and Assigned(Node) then + Result := HintRect + else} + begin + if Column <= NoColumn then + begin +//b BidiMode := Tree.BidiMode; + Alignment := Tree.Alignment; + end + else + begin +//b BidiMode := Tree.Header.Columns[Column].BidiMode; + Alignment := Tree.Header.Columns[Column].Alignment; + end; + +//b if BidiMode <> bdLeftToRight then +//b ChangeBidiModeAlignment(Alignment); + + if (Node = nil) or (Tree.FHintMode <> hmToolTip) then + begin + Canvas.Font := Screen.HintFont + end + else + begin + Canvas.Font := Tree.Font; +{ if Tree is TCustomVirtualStringTree then + with TCustomVirtualStringTree(Tree) do + DoPaintText(Node, Self.Canvas, Column, ttNormal);} + end; + + GetTextMetrics(Canvas.Handle, TM); + FTextHeight := TM.tmHeight; + + if Length(DefaultHint) > 0 then + HintText := DefaultHint + else + if Tree.HintMode = hmToolTip then + HintText := Tree.DoGetNodeToolTip(Node, Column) + else + HintText := Tree.DoGetNodeHint(Node, Column); + + if Length(HintText) = 0 then + Result := Rect(0, 0, 0, 0) + else + begin + if Assigned(Node) and (Tree.FHintMode = hmToolTip) then + begin + // Hint for a node. + if vsMultiline in Node^.States then + begin + // Multiline tooltips use the columns width but extend the bottom border to fit the whole caption. + Result := Tree.GetDisplayRect(Node, Column, True, False); + // On Windows NT the behavior of the tooltip is slightly different to that on Windows 9x/Me. + // We don't have Unicode word wrap on the latter so the tooltip gets as wide as the largest line + // in the caption (limited by carriage return), which results in unoptimal overlay of the tooltip. + // On Windows NT the tooltip exactly overlays the node text. +//? if IsWinNT then +//? begin +//? // DT_CALCRECT sometimes also modifies the right border. But we are only interested in the bottom border. +//? R := Result; +//? Windows.DrawTextW(Canvas.Handle, PWideChar(HintText), Length(HintText), R, DT_CALCRECT or DT_WORDBREAK); +//? Result.Bottom := R.Bottom; +//? end +//? else +//? DrawTextW(Canvas.Handle, PWideChar(HintText), Length(HintText), Result, DT_CALCRECT, True); + DrawTextW(Canvas, PWideChar(HintText), Result, DT_CALCRECT, True); + + Inc(Result.Right); + // If the node height is already large enough to cover the entire text, then we don't need the hint, though. + // However if the text is partially scrolled out of the client area then a hint is useful as well. + if ((Integer(Tree.NodeHeight[Node]) + 2) >= (Result.Bottom - Result.Top)) and not + ((Result.Left < 0) or (Result.Right > Tree.ClientWidth) or + (Result.Top < 0) or (Result.Bottom > Tree.ClientHeight)) then + begin + Result := Rect(0, 0, 0, 0); + Exit; + end; + end + else + begin + Result := Tree.GetDisplayRect(Node, Column, True, True); + if toShowHorzGridLines in Tree.TreeOptions.PaintOptions then + Dec(Result.Bottom); + end; + // Include a one pixel border. + InflateRect(Result, 1, 1); + // Make the coordinates relative. They will again be offset by the caller code. + OffsetRect(Result, -Result.Left - 1, -Result.Top - 1); + end + else + begin + // Hint for a header or non-tooltip hint. + + // Start with the base size of the hint in client coordinates. + Result := Rect(0, 0, MaxWidth, FTextHeight); + // Calculate the true size of the text rectangle. + DrawTextW(Canvas, PWideChar(HintText), Result, DT_CALCRECT, True); + // The height of the text plus 2 pixels vertical margin plus the border determine the hint window height. + Inc(Result.Bottom, 6); + // The text is centered horizontally with usual text margin for left and right borders (plus border). + Inc(Result.Right, 2 * Tree.FTextMargin + 2); + end; + + {$ifndef COMPILER_7_UP} + // Add some pixels for the shadow if MMX is available for blending. + if MMXAvailable then + begin + Inc(Result.Right, ShadowSize); + Inc(Result.Bottom, ShadowSize); + end; + {$endif COMPILER_7_UP} + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeHintWindow.IsHintMsg(var Msg: TMsg): Boolean; + +// The VCL is a bit too generous when telling that an existing hint can be cancelled. Need to specify further here. + +begin + Result := {?inherited IsHintMsg(Msg) and} HandleAllocated and IsWindowVisible(Handle); + // Avoid that mouse moves over the non-client area or key presses cancel the current hint. + if Result and ((Msg.Message = LM_NCMOUSEMOVE) or ((Msg.Message >= LM_KEYFIRST) and (Msg.Message <= LM_KEYLAST))) then + Result := False + ;{todoelse + // Work around problems with keypresses while doing hint animation. + if HandleAllocated and IsWindowVisible(Handle) and (Msg.Message >= LM_KEYFIRST) and (Msg.Message <= LM_KEYLAST) and + (tsInAnimation in FHintData.Tree.FStates) and TranslateMessage(Msg) then + DispatchMessage(Msg);} +end; + +//----------------- TVTDragImage --------------------------------------------------------------------------------------- + +constructor TVTDragImage.Create(AOwner: TBaseVirtualTree); + +begin exit; + FOwner := AOwner; + FTransparency := 128; + FPreBlendBias := 0; + FPostBlendBias := 0; + FFade := False; + FRestriction := dmrNone; + FColorKey := clNone; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TVTDragImage.Destroy; + +begin exit; + EndDrag; + + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTDragImage.GetVisible: Boolean; + +// Returns True if the internal drag image is used (i.e. the system does not natively support drag images) and +// the internal image is currently visible on screen. + +begin exit; + Result := FStates * [disHidden, disInDrag, disPrepared, disSystemSupport] = [disInDrag, disPrepared]; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTDragImage.InternalShowDragImage(ScreenDC: HDC); + +// Frequently called helper routine to actually do the blend and put it onto the screen. +// Only used if the system does not support drag images. + +var + BlendMode: TBlendMode; + +begin exit; + with FAlphaImage do + BitBlt(Canvas.Handle, 0, 0, Width, Height, FBackImage.Canvas.Handle, 0, 0, SRCCOPY); + if not FFade and (FColorKey = clNone) then + BlendMode := bmConstantAlpha + else + BlendMode := bmMasterAlpha; + with FDragImage do + AlphaBlend(Canvas.Handle, FAlphaImage.Canvas.Handle, Rect(0, 0, Width, Height), Point(0, 0), BlendMode, + FTransparency, FPostBlendBias); + + with FAlphaImage do + BitBlt(ScreenDC, FImagePosition.X, FImagePosition.Y, Width, Height, Canvas.Handle, 0, 0, SRCCOPY); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTDragImage.MakeAlphaChannel(Source, Target: TBitmap); + +// Helper method to create a proper alpha channel in Target (which must be in 32 bit pixel format), depending +// on the settings for the drag image and the color values in Source. +// Only used if the system does not support drag images. + +type + PBGRA = ^TBGRA; + TBGRA = packed record + case Boolean of + False: + (Color: Cardinal); + True: + (BGR: array[0..2] of Byte; + Alpha: Byte); + end; + +var + Color, + ColorKeyRef: COLORREF; + UseColorKey: Boolean; + SourceRun, + TargetRun: PBGRA; + X, Y, + MaxDimension, + HalfWidth, + HalfHeight: Integer; + T: Extended; + +begin exit; + {todoUseColorKey := ColorKey <> clNone; + ColorKeyRef := ColorToRGB(ColorKey) and $FFFFFF; + // Color values are in the form BGR (red on LSB) while bitmap colors are in the form ARGB (blue on LSB) + // hence we have to swap red and blue in the color key. + with TBGRA(ColorKeyRef) do + begin + X := BGR[0]; + BGR[0] := BGR[2]; + BGR[2] := X; + end; + + with Target do + begin + MaxDimension := Max(Width, Height); + + HalfWidth := Width div 2; + HalfHeight := Height div 2; + for Y := 0 to Height - 1 do + begin + TargetRun := Scanline[Y]; + SourceRun := Source.Scanline[Y]; + for X := 0 to Width - 1 do + begin + Color := SourceRun.Color and $FFFFFF; + if UseColorKey and (Color = ColorKeyRef) then + TargetRun.Alpha := 0 + else + begin + // If the color is not the given color key (or none is used) then do full calculation of a bell curve. + T := exp(-8 * Sqrt(Sqr((X - HalfWidth) / MaxDimension) + Sqr((Y - HalfHeight) / MaxDimension))); + TargetRun.Alpha := Round(255 * T); + end; + Inc(SourceRun); + Inc(TargetRun); + end; + end; + end;} +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTDragImage.DragTo(P: TPoint; ForceRepaint: Boolean): Boolean; + +// Moves the drag image to a new position, which is determined from the passed point P and the previous +// mouse position. +// ForceRepaint is True if something on the screen changed and the back image must be refreshed. + +var + ScreenDC: HDC; + DeltaX, + DeltaY: Integer; + + // optimized drag image move support + RSamp1, + RSamp2, // newly added parts from screen which will be overwritten + RDraw1, + RDraw2, // parts to be restored to screen + RScroll, + RClip: TRect; // ScrollDC of the existent background + +begin + RDraw2 := Rect(0,0,0,0); + RDraw1 := Rect(0,0,0,0); + RSamp2 := Rect(0,0,0,0); + RSamp1 := Rect(0,0,0,0); + // Determine distances to move the drag image. Take care for restrictions. + case FRestriction of + dmrHorizontalOnly: + begin + DeltaX := FLastPosition.X - P.X; + DeltaY := 0; + end; + dmrVerticalOnly: + begin + DeltaX := 0; + DeltaY := FLastPosition.Y - P.Y; + end; + else // dmrNone + DeltaX := FLastPosition.X - P.X; + DeltaY := FLastPosition.Y - P.Y; + end; + + Result := (DeltaX <> 0) or (DeltaY <> 0) or ForceRepaint; + if Result then + begin + if Visible then + begin + // All this stuff is only called if we have to handle the drag image ourselves. If the system supports + // drag image then this is all never executed. + ScreenDC := GetDC(0); + try + if (Abs(DeltaX) >= FDragImage.Width) or (Abs(DeltaY) >= FDragImage.Height) or ForceRepaint then + begin + // If moved more than image size then just restore old screen and blit image to new position. + BitBlt(ScreenDC, FImagePosition.X, FImagePosition.Y, FBackImage.Width, FBackImage.Height, + FBackImage.Canvas.Handle, 0, 0, SRCCOPY); + + if ForceRepaint then + UpdateWindow(FOwner.Handle); + + Inc(FImagePosition.X, -DeltaX); + Inc(FImagePosition.Y, -DeltaY); + + BitBlt(FBackImage.Canvas.Handle, 0, 0, FBackImage.Width, FBackImage.Height, ScreenDC, FImagePosition.X, + FImagePosition.Y, SRCCOPY); + end + else + begin + // overlapping copy + + with FBackImage.Canvas do + begin + // restore uncovered areas of the screen + if DeltaX = 0 then + begin + with RDraw2 do + BitBlt(ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, Right, Bottom, Handle, Left, Top, + SRCCOPY); + end + else + begin + if DeltaY = 0 then + begin + with RDraw1 do + BitBlt(ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, Right, Bottom, Handle, Left, Top, + SRCCOPY); + end + else + begin + with RDraw1 do + BitBlt(ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, Right, Bottom, Handle, Left, Top, + SRCCOPY); + with RDraw2 do + BitBlt(ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, Right, Bottom, Handle, Left, Top, + SRCCOPY); + end; + end; + + // move existent background + //todo:ScrollDC(Handle, DeltaX, DeltaY, RScroll, RClip, 0, nil); + + Inc(FImagePosition.X, -DeltaX); + Inc(FImagePosition.Y, -DeltaY); + + // Get first and second additional rectangle from screen. + if DeltaX = 0 then + begin + with RSamp2 do + BitBlt(Handle, Left, Top, Right, Bottom, ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, + SRCCOPY); + end + else + if DeltaY = 0 then + begin + with RSamp1 do + BitBlt(Handle, Left, Top, Right, Bottom, ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, + SRCCOPY); + end + else + begin + with RSamp1 do + BitBlt(Handle, Left, Top, Right, Bottom, ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, + SRCCOPY); + with RSamp2 do + BitBlt(Handle, Left, Top, Right, Bottom, ScreenDC, FImagePosition.X + Left, FImagePosition.Y + Top, + SRCCOPY); + end; + end; + end; + InternalShowDragImage(ScreenDC); + finally + ReleaseDC(0, ScreenDC); + end; + end; + FLastPosition.X := P.X; + FLastPosition.Y := P.Y; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTDragImage.EndDrag; + +begin exit; + HideDragImage; + FStates := FStates - [disInDrag, disPrepared]; + + FBackImage.Free; + FBackImage := nil; + FDragImage.Free; + FDragImage := nil; + FAlphaImage.Free; + FAlphaImage := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTDragImage.GetDragImageRect: TRect; + +// Returns the current size and position of the drag image (screen coordinates). + +begin exit; + if Visible then + begin + with FBackImage do + Result := Rect(FImagePosition.X, FImagePosition.Y, FImagePosition.X + Width, FImagePosition.Y + Height); + end + else + Result := Rect(0, 0, 0, 0); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTDragImage.HideDragImage; + +var + ScreenDC: HDC; + +begin exit; + if Visible then + begin + Include(FStates, disHidden); + ScreenDC := GetDC(0); + try + // restore screen + with FBackImage do + BitBlt(ScreenDC, FImagePosition.X, FImagePosition.Y, Width, Height, Canvas.Handle, 0, 0, SRCCOPY); + finally + ReleaseDC(0, ScreenDC); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTDragImage.PrepareDrag(DragImage: TBitmap; ImagePosition, HotSpot: TPoint); + +// Creates all necessary structures to do alpha blended dragging using the given image. +// ImagePostion and Hotspot are given in screen coordinates. The first determines where to place the drag image while +// the second is the initial mouse position. +// This method also determines whether the system supports drag images natively. If so then only minimal structures +// are created. + +var + Width, + Height: Integer; + +begin + Width := DragImage.Width; + Height := DragImage.Height; + + Include(FStates, disSystemSupport); + + if MMXAvailable and not (disSystemSupport in FStates) then + begin + FLastPosition := HotSpot; + + FDragImage := TBitmap.Create; +// FDragImage.PixelFormat := pf32Bit; + FDragImage.Width := Width; + FDragImage.Height := Height; + + FAlphaImage := TBitmap.Create; +// FAlphaImage.PixelFormat := pf32Bit; + FAlphaImage.Width := Width; + FAlphaImage.Height := Height; + + FBackImage := TBitmap.Create; +// FBackImage.PixelFormat := pf32Bit; + FBackImage.Width := Width; + FBackImage.Height := Height; + + // Copy the given drag image and apply pre blend bias if required. + if FPreBlendBias = 0 then +{ with FDragImage do + BitBlt(Canvas.Handle, 0, 0, Width, Height, DragImage.Canvas.Handle, 0, 0, SRCCOPY) + else + AlphaBlend(DragImage.Canvas.Handle, FDragImage.Canvas.Handle, Rect(0, 0, Width, Height), Point(0, 0), + bmConstantAlpha, 255, FPreBlendBias); + } + // Create a proper alpha channel also if no fading is required (transparent parts). +// MakeAlphaChannel(DragImage, FDragImage); + + FImagePosition := ImagePosition; + + // Initially the drag image is hidden and will be shown during the immediately following DragEnter event. + FStates := FStates + [disInDrag, disHidden, disPrepared]; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- +// todo: dummy +function MapWindowPoints(hWndFrom: HWND; hWndTo: HWND; lpPoints: TPOINT; cPoints: UINT): Integer; overload; +begin + debugln('---------------------------------------MapWindowPoints point'); + Result := 0; +end; + +function MapWindowPoints(hWndFrom: HWND; hWndTo: HWND; lpPoints: TRect; cPoints: UINT): Integer; overload; +begin + debugln('----------------------------------------MapWindowPoints rect'); + Result := 0; +end; + + + +procedure TVTDragImage.RecaptureBackground(Tree: TBaseVirtualTree; R: TRect; VisibleRegion: HRGN; + CaptureNCArea, ReshowDragImage: Boolean); + +// Notification by the drop target tree to update the background image because something in the tree has changed. +// Note: The passed rectangle is given in client coordinates of the current drop target tree (given in Tree). +// The caller does not check if the given rectangle is actually within the drag image. Hence this method must do +// all the checks. +// This method does nothing if the system manages the drag image. + +var + DragRect, + ClipRect: TRect; + PaintTarget: TPoint; + PaintOptions: TVTInternalPaintOptions; + ScreenDC: HDC; + +begin exit; + // Recapturing means we want the tree to paint the new part into our back bitmap instead to the screen. + if Visible then + begin + // Create the minimum rectangle to be recaptured. + MapWindowPoints(Tree.Handle, 0, R, 2); + DragRect := GetDragImageRect; + IntersectRect(R, R, DragRect); + + //todoOffsetRgn(VisibleRegion, -DragRect.Left, -DragRect.Top); + + // The target position for painting in the drag image is relative and can be determined from screen coordinates too. + PaintTarget.X := R.Left - DragRect.Left; + PaintTarget.Y := R.Top - DragRect.Top; + + // The source rectangle is determined by the offsets in the tree. + MapWindowPoints(0, Tree.Handle, R, 2); + OffsetRect(R, -Tree.FOffsetX, -Tree.FOffsetY); + + // Finally let the tree paint the relevant part and upate the drag image on screen. + PaintOptions := [poBackground, poColumnColor, poDrawFocusRect, poDrawDropMark, poDrawSelection, poGridLines]; + with FBackImage do + begin + ClipRect.TopLeft := PaintTarget; + ClipRect.Right := ClipRect.Left + R.Right - R.Left; + ClipRect.Bottom := ClipRect.Top + R.Bottom - R.Top; + Tree.LimitPaintingToArea(Canvas, ClipRect, VisibleRegion); + Tree.PaintTree(Canvas, R, PaintTarget, PaintOptions); + + if CaptureNCArea then + begin + // For the non-client area we only need the visible region of the window as limit for painting. + SelectClipRgn(Canvas.Handle, VisibleRegion); + // Since WM_PRINT cannot be given a position where to draw we simply move the window origin and + // get the same effect. + GetWindowRect(Tree.Handle, ClipRect); + SetWindowOrgEx(Canvas.Handle, DragRect.Left - ClipRect.Left, DragRect.Top - ClipRect.Top, nil); + //todoTree.Perform(WM_PRINT, Integer(Canvas.Handle), PRF_NONCLIENT); + SetWindowOrgEx(Canvas.Handle, 0, 0, nil); + end; + SelectClipRgn(Canvas.Handle, 0); + + if ReshowDragImage then + begin + //todoGDIFlush; + ScreenDC := GetDC(0); + try + InternalShowDragImage(ScreenDC); + finally + ReleaseDC(0, ScreenDC); + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTDragImage.ShowDragImage; + +// Shows the drag image after it has been hidden by HideDragImage. +// Note: there might be a new background now. +// Also this method does nothing if the system manages the drag image. + +var + ScreenDC: HDC; + +begin exit; + if FStates * [disInDrag, disHidden, disPrepared, disSystemSupport] = [disInDrag, disHidden, disPrepared] then + begin + Exclude(FStates, disHidden); + + //todoGDIFlush; + ScreenDC := GetDC(0); + try + BitBlt(FBackImage.Canvas.Handle, 0, 0, FBackImage.Width, FBackImage.Height, ScreenDC, FImagePosition.X, + FImagePosition.Y, SRCCOPY); + + InternalShowDragImage(ScreenDC); + finally + ReleaseDC(0, ScreenDC); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTDragImage.WillMove(P: TPoint): Boolean; + +// This method determines whether the drag image would "physically" move when DragTo would be called with the same +// target point. +// Always returns False if the system drag image support is available. + +var + DeltaX, + DeltaY: Integer; + +begin exit; + Result := Visible; + if Result then + begin + // Determine distances to move the drag image. Take care for restrictions. + case FRestriction of + dmrHorizontalOnly: + begin + DeltaX := FLastPosition.X - P.X; + DeltaY := 0; + end; + dmrVerticalOnly: + begin + DeltaX := 0; + DeltaY := FLastPosition.Y - P.Y; + end; + else // dmrNone + DeltaX := FLastPosition.X - P.X; + DeltaY := FLastPosition.Y - P.Y; + end; + + Result := (DeltaX <> 0) or (DeltaY <> 0); + end; +end; + +//----------------- TVirtualTreeColumn --------------------------------------------------------------------------------- + +constructor TVirtualTreeColumn.Create(xCollection: TCollection); + +begin + FWidth := 50; + FLastWidth := 50; + FMinWidth := 10; + FMaxWidth := 10000; + FImageIndex := -1; + FMargin := 4; + FSpacing := 4; + FText := ''; + FOptions := DefaultColumnOptions; + FAlignment := taLeftJustify; +//b FBidiMode := bdLeftToRight; + FColor := clWindow; + FLayout := blGlyphLeft; + + inherited Create(xCollection); + + FPosition := Owner.Count - 1; + // Read parent bidi mode and color values as default values. + ParentBiDiModeChanged; + ParentColorChanged; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TVirtualTreeColumn.Destroy; + +var + I: Integer; + + //--------------- local function --------------------------------------------- + + procedure AdjustColumnIndex(var ColumnIndex: TColumnIndex); + + begin + if Index = ColumnIndex then + ColumnIndex := NoColumn + else + if Index < ColumnIndex then + Dec(ColumnIndex); + end; + + //--------------- end local function ----------------------------------------- + +begin + // Check if this column is somehow referenced by its collection parent or the header. + with Owner do + begin + // If the columns collection object is currently deleting all columns + // then we don't need to check the various cached indices individually. + if not FClearing then + begin + IndexChanged(Index, -1); + + AdjustColumnIndex(FHoverIndex); + AdjustColumnIndex(FDownIndex); + AdjustColumnIndex(FTrackIndex); + AdjustColumnIndex(FClickIndex); + + with Header do + begin + AdjustColumnIndex(FAutoSizeIndex); + if Index = FMainColumn then + begin + // If the current main column is about to be destroyed then we have to find a new main column. + FMainColumn := NoColumn; + for I := 0 to Count - 1 do + if I <> Index then + begin + FMainColumn := I; + Break; + end; + end; + AdjustColumnIndex(FSortColumn); + end; + end; + end; + + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumn.GetLeft: Integer; + +begin + Result := FLeft + Owner.Header.Treeview.FOffsetX; + if [coVisible, coFixed] * FOptions <> [coVisible, coFixed] then + Dec(Result, Owner.Header.Treeview.FEffectiveOffsetX); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumn.IsBiDiModeStored: Boolean; + +begin + Result := not (coParentBiDiMode in FOptions); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumn.IsColorStored: Boolean; + +begin + Result := not (coParentColor in FOptions); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetAlignment(const Value: TAlignment); + +begin + if FAlignment <> Value then + begin + FAlignment := Value; + Changed(False); + // Setting the alignment affects also the tree, hence invalidate it too. + Owner.Header.TreeView.Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{bprocedure TVirtualTreeColumn.SetBiDiMode(Value: TBiDiMode); + +begin + if Value <> FBiDiMode then + begin + FBiDiMode := Value; + Exclude(FOptions, coParentBiDiMode); + Changed(False); + // Setting the alignment affects also the tree, hence invalidate it too. + Owner.Header.TreeView.Invalidate; + end; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetColor(const Value: TColor); + +begin + if FColor <> Value then + begin + FColor := Value; + Exclude(FOptions, coParentColor); + Changed(False); + Owner.Header.TreeView.Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetImageIndex(Value: TImageIndex); + +begin + if Value <> FImageIndex then + begin + FImageIndex := Value; + Changed(False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetLayout(Value: TVTHeaderColumnLayout); + +begin + if FLayout <> Value then + begin + FLayout := Value; + Changed(False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetMargin(Value: Integer); + +begin + // Compatibility setting for -1. + if Value < 0 then + Value := 4; + if FMargin <> Value then + begin + FMargin := Value; + Changed(False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetMaxWidth(Value: Integer); + +begin + if Value < FMinWidth then + Value := FMinWidth; +//? if not IsWinNT and (Value > 10000) then +//? Value := 10000; + FMaxWidth := Value; + SetWidth(FWidth); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetMinWidth(Value: Integer); + +begin + if Value < 0 then + Value := 0; + if Value > FMaxWidth then + Value := FMaxWidth; + FMinWidth := Value; + SetWidth(FWidth); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetOptions(Value: TVTColumnOptions); + +var + ToBeSet, + ToBeCleared: TVTColumnOptions; + VisibleChange, + ColorChanged: Boolean; + +begin + if FOptions <> Value then + begin + ToBeCleared := FOptions - Value; + ToBeSet := Value - FOptions; + + FOptions := Value; + + VisibleChange := coVisible in (ToBeSet + ToBeCleared); + ColorChanged := coParentColor in ToBeSet; + + if coParentBidiMode in ToBeSet then + ParentBiDiModeChanged; + if ColorChanged then + ParentColorChanged; + + if coAutoSpring in ToBeSet then + FSpringRest := 0; + + Changed(False); + // Need to repaint and adjust the owner tree too. + with Owner,Header.Treeview do + if not (csLoading in ComponentState) and (VisibleChange or ColorChanged) and (FUpdateCount = 0) then + begin + Invalidate; + if VisibleChange then + UpdateHorizontalScrollBar(False); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetPosition(Value: TColumnPosition); + +begin + if csLoading in Owner.Header.Treeview.ComponentState then + // Only cache the position for final fixup when loading from DFM. + FPosition := Value + else + begin + if Value >= TColumnPosition(Collection.Count) then + Value := Collection.Count - 1; + if FPosition <> Value then + with Owner do + begin + InitializePositionArray; + // Need to repaint and adjust the owner tree too. + with Header do + begin + if not (csLoading in Treeview.ComponentState) {todoand (UpdateCount = 0)} then + begin + Treeview.CancelEditNode; + AdjustPosition(Self, Value); + Invalidate(Self); + Treeview.Invalidate; + Self.Changed(False); + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetSpacing(Value: Integer); + +begin + if FSpacing <> Value then + begin + FSpacing := Value; + Changed(False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetStyle(Value: TVirtualTreeColumnStyle); + +begin + if FStyle <> Value then + begin + FStyle := Value; + Changed(False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetText(const Value: WideString); + +begin + if FText <> Value then + begin + FText := Value; + Changed(False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetWidth(Value: Integer); + +begin + if Value < FMinWidth then + Value := FMinWidth; + if Value > FMaxWidth then + Value := FMaxWidth; + + if FWidth <> Value then + begin + FLastWidth := FWidth; + with Owner, Header do + begin + if not (hoAutoResize in FOptions) or (Index <> FAutoSizeIndex) then + begin + FWidth := Value; + UpdatePositions; + end; + if not (csLoading in Treeview.ComponentState) {todoand (UpdateCount = 0)} then + begin + if hoAutoResize in FOptions then + AdjustAutoSize(Index); + Treeview.DoColumnResize(Index); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.ComputeHeaderLayout(DC: HDC; const Client: TRect; UseHeaderGlyph, UseSortGlyph: Boolean; + var HeaderGlyphPos, SortGlyphPos: TPoint; var TextBounds: TRect); + +// The layout of a column header is determined by a lot of factors. This method takes them all into account and +// determines all necessary positions and bounds: +// - for the header text +// - the header glyph +// - the sort glyph + +var + TextSize: TSize; + TextPos, + ClientSize, + HeaderGlyphSize, + SortGlyphSize: TPoint; + CurrentAlignment: TAlignment; + MinLeft, + MaxRight, + TextSpacing: Integer; + UseText: Boolean; + +begin + UseText := Length(FText) > 0; + // If nothing is to show then don't waste time with useless preparation. + if not (UseText or UseHeaderGlyph or UseSortGlyph) then + Exit; + + CurrentAlignment := FAlignment; +//b if FBidiMode <> bdLeftToRight then +//b ChangeBiDiModeAlignment(CurrentAlignment); + + // Calculate sizes of the involved items. + ClientSize := Point(Client.Right - Client.Left, Client.Bottom - Client.Top); + with Owner, Header do + begin + if UseHeaderGlyph then + HeaderGlyphSize := Point(FImages.Width, FImages.Height) + else + HeaderGlyphSize := Point(0, 0); + if UseSortGlyph then + begin + SortGlyphSize := Point(UtilityImages.Width, UtilityImages.Height); + // In any case, the sort glyph is vertically centered. + SortGlyphPos.Y := (ClientSize.Y - SortGlyphSize.Y) div 2; + end + else + SortGlyphSize := Point(0, 0); + end; + + if UseText then + begin + GetTextExtentPoint32W(DC, PWideChar(FText), Length(FText), TextSize); + Inc(TextSize.cx, 2); + TextBounds := Rect(0, 0, TextSize.cx, TextSize.cy); + TextSpacing := FSpacing; + end + else + begin + TextSpacing := 0; + TextSize.cx := 0; + TextSize.cy := 0; + end; + + // Check first for the special case where nothing is shown except the sort glyph. + if UseSortGlyph and not (UseText or UseHeaderGlyph) then + begin + // Center the sort glyph in the available area if nothing else is there. + SortGlyphPos := Point((ClientSize.X - SortGlyphSize.X) div 2, (ClientSize.Y - SortGlyphSize.Y) div 2); + end + else + begin + // Determine extents of text and glyph and calculate positions which are clear from the layout. + if (Layout in [blGlyphLeft, blGlyphRight]) or not UseHeaderGlyph then + begin + HeaderGlyphPos.Y := (ClientSize.Y - HeaderGlyphSize.Y) div 2; + TextPos.Y := (ClientSize.Y - TextSize.cy) div 2; + end + else + begin + if Layout = blGlyphTop then + begin + HeaderGlyphPos.Y := (ClientSize.Y - HeaderGlyphSize.Y - TextSize.cy - TextSpacing) div 2; + TextPos.Y := HeaderGlyphPos.Y + HeaderGlyphSize.Y + TextSpacing; + end + else + begin + TextPos.Y := (ClientSize.Y - HeaderGlyphSize.Y - TextSize.cy - TextSpacing) div 2; + HeaderGlyphPos.Y := TextPos.Y + TextSize.cy + TextSpacing; + end; + end; + + // Each alignment needs special consideration. + case CurrentAlignment of + taLeftJustify: + begin + MinLeft := FMargin; +//b if UseSortGlyph and (FBidiMode <> bdLeftToRight) then +//b begin +//b // In RTL context is the sort glyph placed on the left hand side. +//b SortGlyphPos.X := MinLeft; +//b Inc(MinLeft, SortGlyphSize.X + FSpacing); +//b end; + if Layout in [blGlyphTop, blGlyphBottom] then + begin + // Header glyph is above or below text, so both must be considered when calculating + // the left positition of the sort glyph (if it is on the right hand side). + TextPos.X := MinLeft; + if UseHeaderGlyph then + begin + HeaderGlyphPos.X := (ClientSize.X - HeaderGlyphSize.X) div 2; + if HeaderGlyphPos.X < MinLeft then + HeaderGlyphPos.X := MinLeft; + MinLeft := Max(TextPos.X + TextSize.cx + TextSpacing, HeaderGlyphPos.X + HeaderGlyphSize.X + FSpacing); + end + else + MinLeft := TextPos.X + TextSize.cx + TextSpacing; + end + else + begin + // Everything is lined up. TextSpacing might be 0 if there is no text. + // This simplifies the calculation because no extra tests are necessary. + if UseHeaderGlyph and (Layout = blGlyphLeft) then + begin + HeaderGlyphPos.X := MinLeft; + Inc(MinLeft, HeaderGlyphSize.X + FSpacing); + end; + TextPos.X := MinLeft; + Inc(MinLeft, TextSize.cx + TextSpacing); + if UseHeaderGlyph and (Layout = blGlyphRight) then + begin + HeaderGlyphPos.X := MinLeft; + Inc(MinLeft, HeaderGlyphSize.X + FSpacing); + end; + end; +//b if UseSortGlyph and (FBidiMode = bdLeftToRight) then +//b SortGlyphPos.X := MinLeft; + end; + taCenter: + begin + if Layout in [blGlyphTop, blGlyphBottom] then + begin + HeaderGlyphPos.X := (ClientSize.X - HeaderGlyphSize.X) div 2; + TextPos.X := (ClientSize.X - TextSize.cx) div 2; + if UseSortGlyph then + Dec(TextPos.X, SortGlyphSize.X div 2); + end + else + begin + MinLeft := (ClientSize.X - HeaderGlyphSize.X - TextSpacing - TextSize.cx) div 2; + if UseHeaderGlyph and (Layout = blGlyphLeft) then + begin + HeaderGlyphPos.X := MinLeft; + Inc(MinLeft, HeaderGlyphSize.X + TextSpacing); + end; + TextPos.X := MinLeft; + Inc(MinLeft, TextSize.cx + TextSpacing); + if UseHeaderGlyph and (Layout = blGlyphRight) then + HeaderGlyphPos.X := MinLeft; + end; + if UseHeaderGlyph then + begin + MinLeft := Min(HeaderGlyphPos.X, TextPos.X); + MaxRight := Max(HeaderGlyphPos.X + HeaderGlyphSize.X, TextPos.X + TextSize.cx); + end + else + begin + MinLeft := TextPos.X; + MaxRight := TextPos.X + TextSize.cx; + end; + // Place the sort glyph directly to the left or right of the larger item. + if UseSortGlyph then +//b if FBidiMode = bdLeftToRight then +//b begin +//b // Sort glyph on the right hand side. +//b SortGlyphPos.X := MaxRight + FSpacing; +//b end +//b else +//b begin + // Sort glyph on the left hand side. + SortGlyphPos.X := MinLeft - FSpacing - SortGlyphSize.X; +//b end; + end; + else + // taRightJustify + MaxRight := ClientSize.X - FMargin; +//b if UseSortGlyph and (FBidiMode = bdLeftToRight) then +//b begin +//b // In LTR context is the sort glyph placed on the right hand side. +//b Dec(MaxRight, SortGlyphSize.X); +//b SortGlyphPos.X := MaxRight; +//b Dec(MaxRight, FSpacing); +//b end; + if Layout in [blGlyphTop, blGlyphBottom] then + begin + TextPos.X := MaxRight - TextSize.cx; + if UseHeaderGlyph then + begin + HeaderGlyphPos.X := (ClientSize.X - HeaderGlyphSize.X) div 2; + if HeaderGlyphPos.X + HeaderGlyphSize.X + FSpacing > MaxRight then + HeaderGlyphPos.X := MaxRight - HeaderGlyphSize.X - FSpacing; + MaxRight := Min(TextPos.X - TextSpacing, HeaderGlyphPos.X - FSpacing); + end + else + MaxRight := TextPos.X - TextSpacing; + end + else + begin + // Everything is lined up. TextSpacing might be 0 if there is no text. + // This simplifies the calculation because no extra tests are necessary. + if UseHeaderGlyph and (Layout = blGlyphRight) then + begin + HeaderGlyphPos.X := MaxRight - HeaderGlyphSize.X; + MaxRight := HeaderGlyphPos.X - FSpacing; + end; + TextPos.X := MaxRight - TextSize.cx; + MaxRight := TextPos.X - TextSpacing; + if UseHeaderGlyph and (Layout = blGlyphLeft) then + begin + HeaderGlyphPos.X := MaxRight - HeaderGlyphSize.X; + MaxRight := HeaderGlyphPos.X - FSpacing; + end; + end; +//b if UseSortGlyph and (FBidiMode <> bdLeftToRight) then +//b SortGlyphPos.X := MaxRight - SortGlyphSize.X; + end; + end; + + // Once the position of each element is determined there remains only one but important step. + // The horizontal positions of every element must be adjusted so that it always fits into the + // given header area. This is accomplished by shorten the text appropriately. + + // These are the maximum bounds. Nothing goes beyond them. + MinLeft := FMargin; + MaxRight := ClientSize.X - FMargin; + if UseSortGlyph then + begin +//b if FBidiMode = bdLeftToRight then +//b begin +//b // Sort glyph on the right hand side. +//b if SortGlyphPos.X + SortGlyphSize.X > MaxRight then +//b SortGlyphPos.X := MaxRight - SortGlyphSize.X; +//b MaxRight := SortGlyphPos.X - FSpacing; +//b end; + + // Consider also the left side of the sort glyph regardless of the bidi mode. + if SortGlyphPos.X < MinLeft then + SortGlyphPos.X := MinLeft; + // Left border needs only adjustment if the sort glyph marks the left border. +//b if FBidiMode <> bdLeftToRight then +//b MinLeft := SortGlyphPos.X + SortGlyphSize.X + FSpacing; + + // Finally transform sort glyph to its actual position. + with SortGlyphPos do + begin + Inc(X, Client.Left); + Inc(Y, Client.Top); + end; + end; + if UseHeaderGlyph then + begin + if HeaderGlyphPos.X + HeaderGlyphSize.X > MaxRight then + HeaderGlyphPos.X := MaxRight - HeaderGlyphSize.X; + if Layout = blGlyphRight then + MaxRight := HeaderGlyphPos.X - FSpacing; + if HeaderGlyphPos.X < MinLeft then + HeaderGlyphPos.X := MinLeft; + if Layout = blGlyphLeft then + MinLeft := HeaderGlyphPos.X + HeaderGlyphSize.X + FSpacing; + // Finally transform header glyph to its actual position. + with HeaderGlyphPos do + begin + Inc(X, Client.Left); + Inc(Y, Client.Top); + end; + end; + if UseText then + begin + if TextPos.X < MinLeft then + TextPos.X := MinLeft; + OffsetRect(TextBounds, TextPos.X, TextPos.Y); + if TextBounds.Right > MaxRight then + TextBounds.Right := MaxRight; + OffsetRect(TextBounds, Client.Left, Client.Top); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.DefineProperties(Filer: TFiler); + +begin + inherited; + + // Must define a new name for the properties otherwise the VCL will try to load the wide string + // without asking us and screws it completely up. + + Filer.DefineProperty('WideText', @ReadText, @WriteText, FText <> ''); + Filer.DefineProperty('WideHint', @ReadHint, @WriteHint, FHint <> ''); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.GetAbsoluteBounds(var Left, Right: Integer); + +// Returns the column's left and right bounds in header coordinates, that is, independant of the scrolling position. + +begin + Left := FLeft; + Right := FLeft + FWidth; +end; + +//---------------------------------------------------------------------------------------------------------------------- +{ +function TVirtualTreeColumn.GetDisplayName: string; + +// Returns the column text if it only contains ANSI characters, otherwise the column id is returned because the IDE +// still cannot handle Unicode strings. + +var + I: Integer; + +begin + // Check if the text of the column contains characters > 255 + I := 1; + while I <= Length(FText) do + begin + if Ord(FText[I]) > 255 then + Break; + Inc(I); + end; + + if I > Length(FText) then + Result := FText // implicit conversion + else + Result := Format('Column %d', [Index]); +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumn.GetOwner: TVirtualTreeColumns; + +begin + Result := Collection as TVirtualTreeColumns; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.ReadText(Reader: TReader); + +begin + case Reader.NextValue of + vaLString, vaString: + SetText(Reader.ReadString); + else + SetText(Reader.ReadWideString); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SetIndex(Value: Integer); + +begin + if Index <> Value then + begin + // Tell the columns collection about the index change. Its position array must be updated. + Owner.IndexChanged(Index, Value); + + inherited; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.ReadHint(Reader: TReader); + +begin + case Reader.NextValue of + vaLString, vaString: + FHint := Reader.ReadString; + else + FHint := Reader.ReadWideString; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.WriteHint(Writer: TWriter); + +begin + Writer.WriteWideString(FHint); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.WriteText(Writer: TWriter); + +begin + Writer.WriteWideString(FText); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.Assign(Source: TPersistent); + +var + OldOptions: TVTColumnOptions; + +begin + if Source is TVirtualTreeColumn then + begin + OldOptions := FOptions; + FOptions := []; + +//b BiDiMode := TVirtualTreeColumn(Source).BiDiMode; + ImageIndex := TVirtualTreeColumn(Source).ImageIndex; + Layout := TVirtualTreeColumn(Source).Layout; + Margin := TVirtualTreeColumn(Source).Margin; + MaxWidth := TVirtualTreeColumn(Source).MaxWidth; + MinWidth := TVirtualTreeColumn(Source).MinWidth; + Position := TVirtualTreeColumn(Source).Position; + Spacing := TVirtualTreeColumn(Source).Spacing; + Style := TVirtualTreeColumn(Source).Style; + Text := TVirtualTreeColumn(Source).Text; + Hint := TVirtualTreeColumn(Source).Hint; + Width := TVirtualTreeColumn(Source).Width; + Alignment := TVirtualTreeColumn(Source).Alignment; + Color := TVirtualTreeColumn(Source).Color; + Tag := TVirtualTreeColumn(Source).Tag; + + // Order is important. Assign options last. + FOptions := OldOptions; + Options := TVirtualTreeColumn(Source).Options; + + Changed(False); + end + else + inherited Assign(Source); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumn.Equals(OtherColumn: TVirtualTreeColumn): Boolean; + +begin + Result := {b(BiDiMode = OtherColumn.BiDiMode) and} + (ImageIndex = OtherColumn.ImageIndex) and + (Layout = OtherColumn.Layout) and + (Margin = OtherColumn.Margin) and + (MaxWidth = OtherColumn.MaxWidth) and + (MinWidth = OtherColumn.MinWidth) and + (Position = OtherColumn.Position) and + (Spacing = OtherColumn.Spacing) and + (Style = OtherColumn.Style) and + (Text = OtherColumn.Text) and + (Hint = OtherColumn.Hint) and + (Width = OtherColumn.Width) and + (Alignment = OtherColumn.Alignment) and + (Color = OtherColumn.Color) and + (Tag = OtherColumn.Tag) and + (Options = OtherColumn.Options); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumn.GetRect: TRect; + +// Returns the rectangle this column occupies in the header (relative to (0, 0) of the non-client area). + +begin + with TVirtualTreeColumns(GetOwner).FHeader do + Result := Treeview.FHeaderRect; + Inc(Result.Left, FLeft); + Result.Right := Result.Left + FWidth; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.LoadFromStream(const Stream: TStream; Version: Integer); + + //--------------- local function -------------------------------------------- + + function ConvertOptions(Value: Cardinal): TVTColumnOptions; + + // Converts the given raw value which represents column options for possibly older + // formats to the current format. + + begin + if Version >= 3 then + Result := TVTColumnOptions(Value and $FFFF) + else + if Version = 2 then + Result := TVTColumnOptions(Value and $FF) + else + begin + // In version 2 coParentColor has been added. This needs an option shift for older stream formats. + // The first (lower) 4 options remain as they are. + Result := TVTColumnOptions(Value and $F); + Value := (Value and not $F) shl 1; + Result := Result + TVTColumnOptions(Value and $FF); + end; + end; + + //--------------- end local function ---------------------------------------- + +var + Dummy: Integer; + S: WideString; + +begin + with Stream do + begin + ReadBuffer(Dummy, SizeOf(Dummy)); + SetLength(S, Dummy); + ReadBuffer(PWideChar(S)^, 2 * Dummy); + Text := S; + ReadBuffer(Dummy, SizeOf(Dummy)); + SetLength(FHint, Dummy); + ReadBuffer(PWideChar(FHint)^, 2 * Dummy); + ReadBuffer(Dummy, SizeOf(Dummy)); + Width := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + MinWidth := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + MaxWidth := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + Style := TVirtualTreeColumnStyle(Dummy); + ReadBuffer(Dummy, SizeOf(Dummy)); + ImageIndex := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + Layout := TVTHeaderColumnLayout(Dummy); + ReadBuffer(Dummy, SizeOf(Dummy)); + Margin := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + Spacing := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); +//b BiDiMode := TBiDiMode(Dummy); + + ReadBuffer(Dummy, SizeOf(Dummy)); + Options := ConvertOptions(Dummy); + + if Version > 0 then + begin + // Parts which have been introduced/changed with header stream version 1+. + ReadBuffer(Dummy, SizeOf(Dummy)); + Tag := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + Alignment := TAlignment(Dummy); + + if Version > 1 then + begin + ReadBuffer(Dummy, SizeOf(Dummy)); + Color := TColor(Dummy); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.ParentBiDiModeChanged; + +var + Columns: TVirtualTreeColumns; + +begin + if coParentBiDiMode in FOptions then + begin + Columns := GetOwner as TVirtualTreeColumns; + if Assigned(Columns) {band (FBidiMode <> Columns.FHeader.Treeview.BiDiMode)} then + begin +//b FBiDiMode := Columns.FHeader.Treeview.BiDiMode; + Changed(False); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.ParentColorChanged; + +var + Columns: TVirtualTreeColumns; + +begin + if coParentColor in FOptions then + begin + Columns := GetOwner as TVirtualTreeColumns; + if Assigned(Columns) and (FColor <> Columns.FHeader.Treeview.Color) then + begin + FColor := Columns.FHeader.Treeview.Color; + Changed(False); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.RestoreLastWidth; + +begin + TVirtualTreeColumns(GetOwner).AnimatedResize(Index, FLastWidth); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumn.SaveToStream(const Stream: TStream); + +var + Dummy: Integer; + +begin + with Stream do + begin + Dummy := Length(FText); + WriteBuffer(Dummy, SizeOf(Dummy)); + WriteBuffer(PWideChar(FText)^, 2 * Dummy); + Dummy := Length(FHint); + WriteBuffer(Dummy, SizeOf(Dummy)); + WriteBuffer(PWideChar(FHint)^, 2 * Dummy); + WriteBuffer(FWidth, SizeOf(FWidth)); + WriteBuffer(FMinWidth, SizeOf(FMinWidth)); + WriteBuffer(FMaxWidth, SizeOf(FMaxWidth)); + Dummy := Ord(FStyle); + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := FImageIndex; + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := Ord(FLayout); + WriteBuffer(Dummy, SizeOf(Dummy)); + WriteBuffer(FMargin, SizeOf(FMargin)); + WriteBuffer(FSpacing, SizeOf(FSpacing)); +//b Dummy := Ord(FBiDiMode); +//b WriteBuffer(Dummy, SizeOf(Dummy)); +//todo Dummy := Word(FOptions); +// WriteBuffer(Dummy, SizeOf(Dummy)); + + // parts introduce with stream version 1 + WriteBuffer(FTag, SizeOf(Dummy)); + Dummy := Cardinal(FAlignment); + WriteBuffer(Dummy, SizeOf(Dummy)); + + // parts introduce with stream version 2 + Dummy := Integer(FColor); + WriteBuffer(Dummy, SizeOf(Dummy)); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumn.UseRightToLeftReading: Boolean; + +begin +//b Result := FBiDiMode <> bdLeftToRight; + Result := False; +end; + +//----------------- TVirtualTreeColumns -------------------------------------------------------------------------------- + +constructor TVirtualTreeColumns.Create(AOwner: TVTHeader); + +var + ColumnClass: TVirtualTreeColumnClass; + +begin + FHeader := AOwner; + + // Determine column class to be used in the header. + ColumnClass := AOwner.FOwner.GetColumnClass; + // The owner tree always returns the default tree column class if not changed by application/descentants. + inherited Create(ColumnClass); + + FHeaderBitmap := TBitmap.Create; + + FHoverIndex := NoColumn; + FDownIndex := NoColumn; + FClickIndex := NoColumn; + FDropTarget := NoColumn; + FTrackIndex := NoColumn; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TVirtualTreeColumns.Destroy; + +begin + FHeaderBitmap.Free; + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetItem(Index: TColumnIndex): TVirtualTreeColumn; + +begin + Result := TVirtualTreeColumn(inherited GetItem(Index)); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetNewIndex(P: TPoint; var OldIndex: TColumnIndex): Boolean; + +var + NewIndex: Integer; + +begin + Result := False; + // convert to local coordinates + Inc(P.Y, FHeader.FHeight); + NewIndex := ColumnFromPosition(P); + if NewIndex <> OldIndex then + begin + if OldIndex > NoColumn then + FHeader.Invalidate(Items[OldIndex]); + OldIndex := NewIndex; + if OldIndex > NoColumn then + FHeader.Invalidate(Items[OldIndex]); + Result := True; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.SetItem(Index: TColumnIndex; Value: TVirtualTreeColumn); + +begin + inherited SetItem(Index, Value); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.AdjustAutoSize(CurrentIndex: TColumnIndex; Force: Boolean = False); + +// Called only if the header is in auto-size mode which means a column needs to be so large +// that it fills all the horizontal space not occupied by the other columns. +// CurrentIndex (if not InvalidColumn) describes which column has just been resized. + +var + NewValue, + AutoIndex, + Index, + RestWidth: Integer; + +begin + if Count > 0 then + begin + // Determine index to be used for auto resizing. This is usually given by the owner's AutoSizeIndex, but + // could be different if the column whose resize caused the invokation here is either the auto column itself + // or visually to the right of the auto size column. + AutoIndex := FHeader.FAutoSizeIndex; + if (AutoIndex < 0) or (AutoIndex >= Count) then + AutoIndex := Count - 1; + if (CurrentIndex > NoColumn) and + (Items[CurrentIndex].Position >= Items[AutoIndex].Position) then + begin + // The given index is the either the auto size column itself or visually to its right. + // Use the next column instead if there is one. + AutoIndex := GetNextVisibleColumn(CurrentIndex); + end; + + if AutoIndex >= 0 then + begin + with FHeader.Treeview do + begin + if HandleAllocated then + RestWidth := ClientWidth + else + RestWidth := Width; + end; + + // go through all columns and calculate the rest space remaining + for Index := 0 to Count - 1 do + if (Index <> AutoIndex) and (coVisible in Items[Index].FOptions) then + Dec(RestWidth, Items[Index].Width); + + with Items[AutoIndex] do + begin + NewValue := Max(MinWidth, Min(MaxWidth, RestWidth)); + if Force or (FWidth <> NewValue) then + begin + FWidth := NewValue; + UpdatePositions; + FHeader.Treeview.DoColumnResize(AutoIndex); + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.AdjustDownColumn(P: TPoint): TColumnIndex; + +// Determines the column from the given position and returns it. If this column is allowed to be clicked then +// it is also kept for later use. + +begin + // Convert to local coordinates. + Inc(P.Y, FHeader.FHeight); + Result := ColumnFromPosition(P); + if (Result > NoColumn) and (Result <> FDownIndex) and (coAllowClick in Items[Result].FOptions) and + (coEnabled in Items[Result].FOptions) then + begin + if FDownIndex > NoColumn then + FHeader.Invalidate(Items[FDownIndex]); + FDownIndex := Result; + FHeader.Invalidate(Items[FDownIndex]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.AdjustHoverColumn(P: TPoint): Boolean; + +// Determines the new hover column index and returns True if the index actually changed else False. + +begin + Result := GetNewIndex(P, FHoverIndex); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.AdjustPosition(Column: TVirtualTreeColumn; Position: Cardinal); + +// Reorders the column position array so that the given column gets the given position. + +var + OldPosition: Cardinal; + +begin + OldPosition := Column.Position; + if OldPosition <> Position then + begin + if OldPosition < Position then + begin + // column will be moved up so move down other entries + Move(FPositionToIndex[OldPosition + 1], FPositionToIndex[OldPosition], (Position - OldPosition) * SizeOf(Cardinal)); + end + else + begin + // column will be moved down so move up other entries + Move(FPositionToIndex[Position], FPositionToIndex[Position + 1], (OldPosition - Position) * SizeOf(Cardinal)); + end; + FPositionToIndex[Position] := Column.Index; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.DrawButtonText(DC: HDC; Caption: WideString; Bounds: TRect; Enabled, Hot: Boolean; + DrawFormat: Cardinal); + +var + TextSpace: Integer; + Size: TSize; + +begin + // Do we need to shorten the caption due to limited space? + GetTextExtentPoint32W(DC, PWideChar(Caption), Length(Caption), Size); + TextSpace := Bounds.Right - Bounds.Left; + if TextSpace < Size.cx then + Caption := ShortenString(DC, Caption, TextSpace, DT_RTLREADING and DrawFormat <> 0); + + SetBkMode(DC, TRANSPARENT); + if not Enabled then + begin + OffsetRect(Bounds, 1, 1); + SetTextColor(DC, ColorToRGB(clBtnHighlight)); + DrawTextW(DC, PWideChar(Caption), Length(Caption), Bounds, DrawFormat, False); + OffsetRect(Bounds, -1, -1); + SetTextColor(DC, ColorToRGB(clBtnShadow)); + DrawTextW(DC, PWideChar(Caption), Length(Caption), Bounds, DrawFormat, False); + end + else + begin + if Hot then + SetTextColor(DC, ColorToRGB(FHeader.Treeview.FColors.HeaderHotColor)) + else + SetTextColor(DC, ColorToRGB(FHeader.FFont.Color)); + DrawTextW(DC, PWideChar(Caption), Length(Caption), Bounds, DrawFormat, False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +// XP style header button legacy code. This procedure is only used on non-XP systems to simulate the themed +// header style. +// Note: the theme elements displayed here only correspond to the standard themes of Windows XP + +const + XPMainHeaderColorUp = $DBEAEB; // Main background color of the header if drawn as being not pressed. + XPMainHeaderColorDown = $D8DFDE; // Main background color of the header if drawn as being pressed. + XPMainHeaderColorHover = $F3F8FA; // Main background color of the header if drawn as being under the mouse pointer. + XPDarkSplitBarColor = $B2C5C7; // Dark color of the splitter bar. + XPLightSplitBarColor = $FFFFFF; // Light color of the splitter bar. + XPDarkGradientColor = $B8C7CB; // Darkest color in the bottom gradient. Other colors will be interpolated. + XPDownOuterLineColor = $97A5A5; // Down state border color. + XPDownMiddleLineColor = $B8C2C1; // Down state border color. + XPDownInnerLineColor = $C9D1D0; // Down state border color. + +procedure TVirtualTreeColumns.DrawXPButton(DC: HDC; ButtonR: TRect; DrawSplitter, Down, Hover: Boolean); + +// Helper procedure to draw an Windows XP like header button. + +var + PaintBrush: HBRUSH; + Pen, + OldPen: HPEN; + PenColor, + FillColor: COLORREF; + dRed, dGreen, dBlue: Single; + Width, + XPos: Integer; + +begin +{ if Down then + FillColor := XPMainHeaderColorDown + else + if Hover then + FillColor := XPMainHeaderColorHover + else + FillColor := XPMainHeaderColorUp; + PaintBrush := CreateSolidBrush(FillColor); + FillRect(DC, ButtonR, PaintBrush); + DeleteObject(PaintBrush); + + if DrawSplitter and not (Down or Hover) then + begin + // One solid pen for the dark line... + Pen := CreatePen(PS_SOLID, 1, XPDarkSplitBarColor); + OldPen := SelectObject(DC, Pen); + MoveToEx(DC, ButtonR.Right - 2, ButtonR.Top + 3, nil); + LineTo(DC, ButtonR.Right - 2, ButtonR.Bottom - 5); + // ... and one solid pen for the light line. + Pen := CreatePen(PS_SOLID, 1, XPLightSplitBarColor); + DeleteObject(SelectObject(DC, Pen)); + MoveToEx(DC, ButtonR.Right - 1, ButtonR.Top + 3, nil); + LineTo(DC, ButtonR.Right - 1, ButtonR.Bottom - 5); + SelectObject(DC, OldPen); + DeleteObject(Pen); + end; + + if Down then + begin + // Down state. Three lines to draw. + // First one is the outer line, drawn at left, bottom and right. + Pen := CreatePen(PS_SOLID, 1, XPDownOuterLineColor); + OldPen := SelectObject(DC, Pen); + MoveToEx(DC, ButtonR.Left, ButtonR.Top, nil); + LineTo(DC, ButtonR.Left, ButtonR.Bottom - 1); + LineTo(DC, ButtonR.Right - 1, ButtonR.Bottom - 1); + LineTo(DC, ButtonR.Right - 1, ButtonR.Top - 1); + + // Second one is the middle line, which is a bit lighter. + Pen := CreatePen(PS_SOLID, 1, XPDownMiddleLineColor); + DeleteObject(SelectObject(DC, Pen)); + MoveToEx(DC, ButtonR.Left + 1, ButtonR.Bottom - 2, nil); + LineTo(DC, ButtonR.Left + 1, ButtonR.Top); + LineTo(DC, ButtonR.Right - 1, ButtonR.Top); + + // Third line is the inner line, which is even lighter than the middle line. + Pen := CreatePen(PS_SOLID, 1, XPDownInnerLineColor); + DeleteObject(SelectObject(DC, Pen)); + MoveToEx(DC, ButtonR.Left + 2, ButtonR.Bottom - 2, nil); + LineTo(DC, ButtonR.Left + 2, ButtonR.Top + 1); + LineTo(DC, ButtonR.Right - 1, ButtonR.Top + 1); + + // Housekeeping: + SelectObject(DC, OldPen); + DeleteObject(Pen); + end + else + if Hover then + begin + // Hover state. There are three lines at the bottom border, but they are rendered in a way which + // requires expensive construction. + Width := ButtonR.Right - ButtonR.Left; + if Width <= 32 then + begin + ImageList_DrawEx(UtilityImages.Handle, 8, DC, ButtonR.Right - 16, ButtonR.Bottom - 3, 16, 3, CLR_NONE, CLR_NONE, + ILD_NORMAL); + ImageList_DrawEx(UtilityImages.Handle, 6, DC, ButtonR.Left, ButtonR.Bottom - 3, Width div 2, 3, CLR_NONE, + CLR_NONE, ILD_NORMAL); + end + else + begin + ImageList_DrawEx(UtilityImages.Handle, 6, DC, ButtonR.Left, ButtonR.Bottom - 3, 16, 3, CLR_NONE, CLR_NONE, + ILD_NORMAL); + // Replicate inner part as many times as need to fill up the button rectangle. + XPos := ButtonR.Left + 16; + repeat + ImageList_DrawEx(UtilityImages.Handle, 7, DC, XPos, ButtonR.Bottom - 3, 16, 3, CLR_NONE, CLR_NONE, ILD_NORMAL); + Inc(XPos, 16); + until XPos + 16 >= ButtonR.Right; + ImageList_DrawEx(UtilityImages.Handle, 8, DC, ButtonR.Right - 16, ButtonR.Bottom - 3, 16, 3, CLR_NONE, CLR_NONE, + ILD_NORMAL); + end; + end + else + begin + // There is a three line gradient near the bottom border which transforms from the button color to a dark, + // clBtnFace like color (here XPDarkGradientColor). + PenColor := XPMainHeaderColorUp; + dRed := ((PenColor and $FF) - (XPDarkGradientColor and $FF)) / 3; + dGreen := (((PenColor shr 8) and $FF) - ((XPDarkGradientColor shr 8) and $FF)) / 3; + dBlue := (((PenColor shr 16) and $FF) - ((XPDarkGradientColor shr 16) and $FF)) / 3; + + // First line: + PenColor := PenColor - Round(dRed) - Round(dGreen) shl 8 - Round(dBlue) shl 16; + Pen := CreatePen(PS_SOLID, 1, PenColor); + OldPen := SelectObject(DC, Pen); + MoveToEx(DC, ButtonR.Left, ButtonR.Bottom - 3, nil); + LineTo(DC, ButtonR.Right, ButtonR.Bottom - 3); + + // Second line: + PenColor := PenColor - Round(dRed) - Round(dGreen) shl 8 - Round(dBlue) shl 16; + Pen := CreatePen(PS_SOLID, 1, PenColor); + DeleteObject(SelectObject(DC, Pen)); + MoveToEx(DC, ButtonR.Left, ButtonR.Bottom - 2, nil); + LineTo(DC, ButtonR.Right, ButtonR.Bottom - 2); + + // Third line: + Pen := CreatePen(PS_SOLID, 1, XPDarkGradientColor); + DeleteObject(SelectObject(DC, Pen)); + MoveToEx(DC, ButtonR.Left, ButtonR.Bottom - 1, nil); + LineTo(DC, ButtonR.Right, ButtonR.Bottom - 1); + + // Housekeeping: + DeleteObject(SelectObject(DC, OldPen)); + end; } +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.FixPositions; + +// Fixes column positions after loading from DFM. + +var + I: Integer; + +begin + for I := 0 to Count - 1 do + FPositionToIndex[Items[I].Position] := I; + FNeedPositionsFix := False; + UpdatePositions(True); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetColumnAndBounds(P: TPoint; var ColumnLeft, ColumnRight: Integer; + Relative: Boolean = True): Integer; + +// Returns the column where the mouse is currently in as well as the left and right bound of +// this column (Left and Right are undetermined if no column is involved). + +var + I: Integer; + +begin + Result := InvalidColumn; + if Relative and (P.X > Header.Columns.GetVisibleFixedWidth) then + ColumnLeft := -FHeader.Treeview.FEffectiveOffsetX + else + ColumnLeft := 0; + +// if FHeader.Treeview.UseRightToLeftAlignment then +// Inc(ColumnLeft, FHeader.Treeview.ComputeRTLOffset(True)); + + for I := 0 to Count - 1 do + with Items[FPositionToIndex[I]] do + if coVisible in FOptions then + begin + ColumnRight := ColumnLeft + FWidth; + if P.X < ColumnRight then + begin + Result := FPositionToIndex[I]; + Exit; + end; + ColumnLeft := ColumnRight; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetOwner: TPersistent; + +begin + Result := FHeader; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.HandleClick(P: TPoint; Button: TMouseButton; Force, DblClick: Boolean); + +// Generates a click event if the mouse button has been released over the same column it was pressed first. +// Alternatively, Force might be set to True to indicate that the down index does not matter (right, middle and +// double click). + +var + NewClickIndex: Integer; + Shift: TShiftState; + +begin + // Convert vertical position to local coordinates. + Inc(P.Y, FHeader.FHeight); + NewClickIndex := ColumnFromPosition(P); + if (NewClickIndex > NoColumn) and (coAllowClick in Items[NewClickIndex].FOptions) and + ((NewClickIndex = FDownIndex) or Force) then + begin + FClickIndex := NewClickIndex; + Shift := FHeader.GetShiftState; + if DblClick then + Shift := Shift + [ssDouble]; + FHeader.Treeview.DoHeaderClick(NewClickIndex, Button, Shift, P.X, P.Y); + FHeader.Invalidate(Items[NewClickIndex]); + end + else + FClickIndex := NoColumn; + + if (FClickIndex > NoColumn) and (FClickIndex <> NewClickIndex) then + FHeader.Invalidate(Items[FClickIndex]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.IndexChanged(OldIndex, NewIndex: Integer); + +// Called by a column when its index in the collection changes. If NewIndex is -1 then the column is +// about to be removed, otherwise it is moved to a new index. +// The method will then update the position array to reflect the change. + +var + I: Integer; + Increment: Integer; + Lower, + Upper: Integer; + +begin + if NewIndex = -1 then + begin + // Find position in the array with the old index. + Upper := High(FPositionToIndex); + for I := 0 to Upper do + begin + if FPositionToIndex[I] = OldIndex then + begin + // Index found. Move all higher entries one step down and remove the last entry. + if I < Upper then + Move(FPositionToIndex[I + 1], FPositionToIndex[I], (Upper - I) * SizeOf(Integer)); + end; + // Decrease all indices, which are greater than the index to be deleted. + if FPositionToIndex[I] > OldIndex then + Dec(FPositionToIndex[I]); + end; + SetLength(FPositionToIndex, High(FPositionToIndex)); + end + else + begin + if OldIndex < NewIndex then + Increment := -1 + else + Increment := 1; + + Lower := Min(OldIndex, NewIndex); + Upper := Max(OldIndex, NewIndex); + for I := 0 to High(FPositionToIndex) do + begin + if (FPositionToIndex[I] >= Lower) and (FPositionToIndex[I] < Upper) then + Inc(FPositionToIndex[I], Increment) + else + if FPositionToIndex[I] = OldIndex then + FPositionToIndex[I] := NewIndex; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.InitializePositionArray; + +// Ensures that the column position array contains as much entries as columns are defined. +// The array is resized and initialized with default values if needed. + +var + I, OldSize: Integer; + xChanged: Boolean; + +begin + if Count <> Length(FPositionToIndex) then + begin + OldSize := Length(FPositionToIndex); + SetLength(FPositionToIndex, Count); + if Count > OldSize then + begin + // New items have been added, just set their position to the same as their index. + for I := OldSize to Count - 1 do + FPositionToIndex[I] := I; + end + else + begin + // Items have been deleted, so reindex remaining entries by decrementing values larger than the highest + // possible index until no entry is higher than this limit. + repeat + xChanged := False; + for I := 0 to Count - 1 do + if FPositionToIndex[I] >= Count then + begin + Dec(FPositionToIndex[I]); + xChanged := True; + end; + until not xChanged; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.Update(Item: TCollectionItem); + +begin + // This is the only place which gets notified when a new column has been added or removed + // and we need this event to adjust the column position array. + InitializePositionArray; + if csLoading in Header.Treeview.ComponentState then + FNeedPositionsFix := True + else + UpdatePositions; + + // The first column which is created is by definition also the main column. + if (Count > 0) and (Header.FMainColumn < 0) then + FHeader.FMainColumn := 0; + + if not (csLoading in Header.Treeview.ComponentState) and not (hsLoading in FHeader.FStates) then + begin + with FHeader do + begin + if hoAutoResize in FOptions then + AdjustAutoSize(InvalidColumn); + if Assigned(Item) then + Invalidate(Item as TVirtualTreeColumn) + else + if Treeview.HandleAllocated then + begin + Treeview.UpdateHorizontalScrollBar(False); + Invalidate(nil); + Treeview.Invalidate; + end; + // This is mainly to let the designer know when a change occurs at design time which + // doesn't involve the object inspector (like column resizing with the mouse). + // This does NOT include design time code as the communication is done via an interface. + Treeview.UpdateDesigner; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.UpdatePositions(Force: Boolean = False); + +// Recalculates the left border of every column and updates their position property according to the +// PostionToIndex array which primarily determines where each column is placed visually. + +var + I, LeftPos: Integer; + +begin + if not FNeedPositionsFix and (Force or True{todo(UpdateCount = 0)}) then + begin + LeftPos := 0; + for I := 0 to High(FPositionToIndex) do + with Items[FPositionToIndex[I]] do + begin + FPosition := I; + FLeft := LeftPos; + if coVisible in FOptions then + Inc(LeftPos, FWidth); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.Add: TVirtualTreeColumn; + +begin + Result := TVirtualTreeColumn(inherited Add); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.AnimatedResize(Column: TColumnIndex; NewWidth: Integer); + +// Resizes the given column animated by scrolling the window DC. + +var + OldWidth: Integer; + DC: HDC; + I, + Steps, + DX: Integer; + HeaderScrollRect, + ScrollRect, + R: TRect; + + NewBrush, + LastBrush: HBRUSH; + +begin + // Make sure the width constrains are considered. + if NewWidth < Items[Column].FMinWidth then + NewWidth := Items[Column].FMinWidth; + if NewWidth > Items[Column].FMaxWidth then + NewWidth := Items[Column].FMaxWidth; + + OldWidth := Items[Column].Width; + // Nothing to do if the width is the same. + if OldWidth <> NewWidth then + begin + {todoDC := GetWindowDC(FHeader.Treeview.Handle); + with FHeader.Treeview do + try + Steps := 32; + DX := (NewWidth - OldWidth) div Steps; + + // Determination of the scroll rectangle is a bit complicated since we neither want + // to scroll the scrollbars nor the border of the treeview window. + HeaderScrollRect := FHeaderRect; + ScrollRect := HeaderScrollRect; + // Exclude the header itself from scrolling. + ScrollRect.Top := ScrollRect.Bottom; + ScrollRect.Bottom := ScrollRect.Top + ClientHeight; + ScrollRect.Right := ScrollRect.Left + ClientWidth; + with Items[Column] do + Inc(ScrollRect.Left, FLeft + FWidth); + HeaderScrollRect.Left := ScrollRect.Left; + HeaderScrollRect.Right := ScrollRect.Right; + + // When the new width is larger then avoid artefacts on the left hand side + // by deleting a small stripe + if NewWidth > OldWidth then + begin + R := ScrollRect; + NewBrush := CreateSolidBrush(ColorToRGB(Color)); + LastBrush := SelectObject(DC, NewBrush); + R.Right := R.Left + DX; + FillRect(DC, R, NewBrush); + SelectObject(DC, LastBrush); + DeleteObject(NewBrush); + end + else + begin + Inc(HeaderScrollRect.Left, DX); + Inc(ScrollRect.Left, DX); + end; + + for I := 0 to Steps - 1 do + begin + ScrollDC(DC, DX, 0, HeaderScrollRect, HeaderScrollRect, 0, nil); + Inc(HeaderScrollRect.Left, DX); + ScrollDC(DC, DX, 0, ScrollRect, ScrollRect, 0, nil); + Inc(ScrollRect.Left, DX); + Sleep(1); + end; + finally + ReleaseDC(Handle, DC); + end;} + Items[Column].Width := NewWidth; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.Assign(Source: TPersistent); + +begin + // Let the collection class assign the items. + inherited; + + if Source is TVirtualTreeColumns then + begin + // Copying the position array is the only needed task here. + FPositionToIndex := Copy(TVirtualTreeColumns(Source).FPositionToIndex, 0, MaxInt); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.Clear; + +begin + FClearing := True; + try + // Since we're freeing all columns, the following have to be true when we're done. + FHoverIndex := NoColumn; + FDownIndex := NoColumn; + FTrackIndex := NoColumn; + FClickIndex := NoColumn; + + with Header do + if not (hsLoading in FStates) then + begin + FAutoSizeIndex := NoColumn; + FMainColumn := NoColumn; + FSortColumn := NoColumn; + end; + + inherited Clear; + finally + FClearing := False; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.ColumnFromPosition(P: TPoint; Relative: Boolean = True): TColumnIndex; + +// Determines the current column based on the position passed in P. + +var + I, Sum: Integer; + +begin + Result := InvalidColumn; + + // The position must be within the header area, but we extend the vertical bounds to the entire treeview area. + if (P.X >= 0) and (P.Y >= 0) and (P.Y <= FHeader.TreeView.Height) then + with FHeader, Treeview do + begin + if Relative and (P.X > GetVisibleFixedWidth) then + Sum := -FEffectiveOffsetX + else + Sum := 0; + +// if UseRightToLeftAlignment then +// Inc(Sum, ComputeRTLOffset(True)); + + for I := 0 to Count - 1 do + if coVisible in Items[FPositionToIndex[I]].FOptions then + begin + Inc(Sum, Items[FPositionToIndex[I]].Width); + if P.X < Sum then + begin + Result := FPositionToIndex[I]; + Break; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.ColumnFromPosition(PositionIndex: TColumnPosition): TColumnIndex; + +// Returns the index of the column at the given position. + +begin + if Integer(PositionIndex) < Length(FPositionToIndex) then + Result := FPositionToIndex[PositionIndex] + else + Result := NoColumn; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.Equals(OtherColumns: TVirtualTreeColumns): Boolean; + +// Compares itself with the given set of columns and returns True if all published properties are the same +// (including column order), otherwise False is returned. + +var + I: Integer; + +begin + // Same number of columns? + Result := OtherColumns.Count = Count; + if Result then + begin + // Same order of columns? + Result := CompareMem(Pointer(FPositionToIndex), Pointer(OtherColumns.FPositionToIndex), + Length(FPositionToIndex) * SizeOf(TColumnIndex)); + if Result then + begin + for I := 0 to Count - 1 do + if not Items[I].Equals(OtherColumns[I]) then + begin + Result := False; + Break; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.GetColumnBounds(Column: TColumnIndex; var Left, Right: Integer); + +// Returns the left and right bound of the given column. If Column is NoColumn then the entire client width is returned. + +begin + if Column = NoColumn then + begin + Left := 0; + Right := FHeader.Treeview.ClientWidth; + end + else + begin + Left := Items[Column].Left; + Right := Left + Items[Column].Width; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetFirstVisibleColumn: TColumnIndex; + +// Returns the index of the first visible column or "InvalidColumn" if either no columns are defined or +// all columns are hidden. + +var + I: Integer; + +begin + Result := InvalidColumn; + for I := 0 to Count - 1 do + if coVisible in Items[FPositionToIndex[I]].FOptions then + begin + Result := FPositionToIndex[I]; + Break; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetLastVisibleColumn: TColumnIndex; + +// Returns the index of the last visible column or "InvalidColumn" if either no columns are defined or +// all columns are hidden. + +var + I: Integer; + +begin + Result := InvalidColumn; + for I := Count - 1 downto 0 do + if coVisible in Items[FPositionToIndex[I]].FOptions then + begin + Result := FPositionToIndex[I]; + Break; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetNextColumn(Column: TColumnIndex): TColumnIndex; + +// Returns the next column in display order. Column is the index of an item in the collection (a column). + +var + Position: Integer; + +begin + if Column < 0 then + Result := InvalidColumn + else + begin + Position := Items[Column].Position; + if Position < Count - 1 then + Result := FPositionToIndex[Position + 1] + else + Result := InvalidColumn; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetNextVisibleColumn(Column: TColumnIndex): TColumnIndex; + +// Returns the next visible column in display order, Column is an index into the columns list. + +begin + Result := Column; + repeat + Result := GetNextColumn(Result); + until (Result = InvalidColumn) or (coVisible in Items[Result].FOptions); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetPreviousColumn(Column: TColumnIndex): TColumnIndex; + +// Returns the previous column in display order, Column is an index into the columns list. + +var + Position: Integer; + +begin + if Column < 0 then + Result := InvalidColumn + else + begin + Position := Items[Column].Position; + if Position > 0 then + Result := FPositionToIndex[Position - 1] + else + Result := InvalidColumn; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetPreviousVisibleColumn(Column: TColumnIndex): TColumnIndex; + +// Returns the previous column in display order, Column is an index into the columns list. + +begin + Result := Column; + repeat + Result := GetPreviousColumn(Result); + until (Result = InvalidColumn) or (coVisible in Items[Result].FOptions); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetVisibleColumns: TColumnsArray; + +// Returns a list of all currently visible columns in actual order. + +var + I, Counter: Integer; + +begin + SetLength(Result, Count); + Counter := 0; + + for I := 0 to Count - 1 do + if coVisible in Items[FPositionToIndex[I]].FOptions then + begin + Result[Counter] := Items[FPositionToIndex[I]]; + Inc(Counter); + end; + // Set result length to actual visible count. + SetLength(Result, Counter); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.GetVisibleFixedWidth: Integer; + +// Determines the horizontal space all visible and fixed columns occupy. + +var + I: Integer; + +begin + Result := 0; + for I := 0 to Count - 1 do + begin + if Items[I].Options * [coVisible, coFixed] = [coVisible, coFixed] then + Inc(Result, Items[I].Width); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.IsValidColumn(Column: TColumnIndex): Boolean; + +// Determines whether the given column is valid or not, that is, whether it is one of the current columns. + +begin ; + Result := (Column > NoColumn) and (Column < Count); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.LoadFromStream(const Stream: TStream; Version: Integer); + +var + I, + ItemCount: Integer; + +begin + Clear; + Stream.ReadBuffer(ItemCount, SizeOf(ItemCount)); + // number of columns + if ItemCount > 0 then + begin + BeginUpdate; + try + for I := 0 to ItemCount - 1 do + Add.LoadFromStream(Stream, Version); + SetLength(FPositionToIndex, ItemCount); + Stream.ReadBuffer(FPositionToIndex[0], ItemCount * SizeOf(Cardinal)); + UpdatePositions(True); + finally + EndUpdate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- +// todo: dummy +procedure ZeroMemory(Destination: Pointer; Length: DWORD); +begin + FillChar(Destination^, Length, 0); +end; + +procedure TVirtualTreeColumns.PaintHeader(DC: HDC; R: TRect; HOffset: Integer; VOffset: Integer = 0;PixelFormat : TPixelFormat = pfDevice); + +// Main paint method to draw the header. + +const + SortGlyphs: array[TSortDirection, Boolean] of Integer = ( // ascending/descending, normal/XP style + (3, 5) {ascending}, (2, 4) {descending} + ); + +var + I, Y, + SortIndex: Integer; + Run: TRect; + RightBorderFlag, + NormalButtonStyle, + NormalButtonFlags, + PressedButtonStyle, + PressedButtonFlags, + RaisedButtonStyle, + RaisedButtonFlags: Cardinal; + DrawFormat: Cardinal; + Images: TCustomImageList; + ButtonRgn: HRGN; + OwnerDraw, + AdvancedOwnerDraw: Boolean; + {$ifdef ThemeSupport} + Details: TThemedElementDetails; + {$endif ThemeSupport} + + PaintInfo: THeaderPaintInfo; + RequestedElements, + ActualElements: THeaderPaintElements; + + SavedDC: Integer; + +begin + Run := FHeader.Treeview.FHeaderRect; + FHeaderBitmap.Width := Max(Run.Right, R.Right - R.Left); + FHeaderBitmap.Height := Run.Bottom; + FHeaderBitmap.PixelFormat := PixelFormat; + OwnerDraw := (hoOwnerDraw in FHeader.FOptions) and Assigned(FHeader.Treeview.FOnHeaderDraw) and + not (csDesigning in FHeader.Treeview.ComponentState); + AdvancedOwnerDraw := (hoOwnerDraw in FHeader.FOptions) and Assigned(FHeader.Treeview.FOnAdvancedHeaderDraw) and + Assigned(FHeader.Treeview.FOnHeaderDrawQueryElements) and not (csDesigning in FHeader.Treeview.ComponentState); + // If both draw posibillities are specified then prefer the advanced way. + if AdvancedOwnerDraw then + OwnerDraw := False; + + ZeroMemory(@PaintInfo, SizeOf(PaintInfo)); + PaintInfo.TargetCanvas := FHeaderBitmap.Canvas; + with PaintInfo, PaintInfo.TargetCanvas do + begin + Font := FHeader.FFont; + + RaisedButtonStyle := 0; + RaisedButtonFlags := 0; + case FHeader.Style of + hsThickButtons: + begin + NormalButtonStyle := BDR_RAISEDINNER or BDR_RAISEDOUTER; + NormalButtonFlags := BF_LEFT or BF_TOP or BF_BOTTOM or BF_MIDDLE or BF_SOFT or BF_ADJUST; + PressedButtonStyle := BDR_RAISEDINNER or BDR_RAISEDOUTER; + PressedButtonFlags := NormalButtonFlags or BF_RIGHT or BF_FLAT or BF_ADJUST; + end; + hsFlatButtons: + begin + NormalButtonStyle := BDR_RAISEDINNER; + NormalButtonFlags := BF_LEFT or BF_TOP or BF_BOTTOM or BF_MIDDLE or BF_ADJUST; + PressedButtonStyle := BDR_SUNKENOUTER; + PressedButtonFlags := BF_RECT or BF_MIDDLE or BF_ADJUST; + end; + else + // hsPlates or hsXPStyle, values are not used in the latter case + begin + NormalButtonStyle := BDR_RAISEDINNER; + NormalButtonFlags := BF_RECT or BF_MIDDLE or BF_SOFT or BF_ADJUST; + PressedButtonStyle := BDR_SUNKENOUTER; + PressedButtonFlags := BF_RECT or BF_MIDDLE or BF_ADJUST; + RaisedButtonStyle := BDR_RAISEDINNER; + RaisedButtonFlags := BF_LEFT or BF_TOP or BF_BOTTOM or BF_MIDDLE or BF_ADJUST; + end; + end; + + // Use shortcut for the images. + Images := FHeader.FImages; + + // Consider right-to-left directionality. + with FHeader.Treeview do +//b if (BidiMode <> bdLeftToRight) and (Integer(FRangeY) > ClientHeight) then +//b Inc(HOffset, GetSystemMetrics(SM_CXVSCROLL)); + + // Erase background of the header. + // See if the application wants to do that on its own. + RequestedElements := []; + if AdvancedOwnerDraw then + begin + PaintInfo.PaintRectangle := R; + PaintInfo.Column := nil; + FHeader.Treeview.DoHeaderDrawQueryElements(PaintInfo, RequestedElements); + end; + + if hpeBackground in RequestedElements then + begin + FHeader.Treeview.DoAdvancedHeaderDraw(PaintInfo, [hpeBackground]); + end + else + begin + {$ifdef ThemeSupport} + if tsUseThemes in FHeader.Treeview.FStates then + begin + Details := ThemeServices.GetElementDetails(thHeaderItemRightNormal); + ThemeServices.DrawElement(Handle, Details, R, @R); + end + else + {$endif ThemeSupport} + if FHeader.Style = hsXPStyle then + DrawXPButton(Handle, Run, False, False, False) + else + begin + Brush.Color := FHeader.FBackground; + FillRect(R); + end; + end; + + Run.Top := R.Top; + Run.Right := R.Left + HOffset; + Run.Bottom := R.Bottom; + // Run.Left is set in the loop + + ShowRightBorder := (FHeader.Style = hsThickButtons) or not (hoAutoResize in FHeader.FOptions) {or + (FHeader.Treeview.BevelKind = bkNone)}; + + // now go for each button + for I := 0 to Count - 1 do + with Items[FPositionToIndex[I]] do + if coVisible in FOptions then + begin + Run.Left := Run.Right; + Inc(Run.Right, Width); + // Skip columns which are not visible at all. + if Run.Right > R.Left then + begin + // Stop painting if the rectangle is filled. + if Run.Left > R.Right then + Break; + + IsHoverIndex := (Integer(FPositionToIndex[I]) = FHoverIndex) and (hoHotTrack in FHeader.FOptions) and + (coEnabled in FOptions); + IsDownIndex := Integer(FPositionToIndex[I]) = FDownIndex; + if (coShowDropMark in FOptions) and (Integer(FPositionToIndex[I]) = FDropTarget) and + (Integer(FPositionToIndex[I]) <> FDragIndex) then + begin + if FDropBefore then + DropMark := dmmLeft + else + DropMark := dmmRight; + end + else + DropMark := dmmNone; + IsEnabled := (coEnabled in FOptions) and (FHeader.Treeview.Enabled); + ShowHeaderGlyph := (hoShowImages in FHeader.FOptions) and Assigned(Images) and (FImageIndex > -1); + ShowSortGlyph := (Integer(FPositionToIndex[I]) = FHeader.FSortColumn) and (hoShowSortGlyphs in FHeader.FOptions); + + PaintRectangle := Run; + + // This path for text columns or advanced owner draw. + if (Style = vsText) or not OwnerDraw or AdvancedOwnerDraw then + begin + // See if the application wants to draw part of the header itself. + RequestedElements := []; + if AdvancedOwnerDraw then + begin + PaintInfo.Column := Items[FPositionToIndex[I]]; + FHeader.Treeview.DoHeaderDrawQueryElements(PaintInfo, RequestedElements); + end; + + if ShowRightBorder or (I < Count - 1) then + RightBorderFlag := BF_RIGHT + else + RightBorderFlag := 0; + + if hpeBackground in RequestedElements then + FHeader.Treeview.DoAdvancedHeaderDraw(PaintInfo, [hpeBackground]) + else + begin + // Draw button first before setting the clip region. + {$ifdef ThemeSupport} + if tsUseThemes in FHeader.Treeview.FStates then + begin + if IsDownIndex then + Details := ThemeServices.GetElementDetails(thHeaderItemPressed) + else + if IsHoverIndex then + Details := ThemeServices.GetElementDetails(thHeaderItemHot) + else + Details := ThemeServices.GetElementDetails(thHeaderItemNormal); + ThemeServices.DrawElement(Handle, Details, PaintRectangle, @PaintRectangle); + end + else + {$endif ThemeSupport} + begin + if FHeader.Style = hsXPStyle then + DrawXPButton(Handle, PaintRectangle, RightBorderFlag <> 0, IsDownIndex, IsHoverIndex) + else + if IsDownIndex then + DrawEdge(Handle, PaintRectangle, PressedButtonStyle, PressedButtonFlags) + else + // Plates have the special case of raising on mouse over. + if (FHeader.Style = hsPlates) and IsHoverIndex and + (coAllowClick in FOptions) and (coEnabled in FOptions) then + DrawEdge(Handle, PaintRectangle, RaisedButtonStyle, RaisedButtonFlags or RightBorderFlag) + else + DrawEdge(Handle, PaintRectangle, NormalButtonStyle, NormalButtonFlags or RightBorderFlag); + end; + end; + end; + + // Create a clip region to avoid overpainting any other area which does not belong to this column. + if PaintRectangle.Right > R.Right then + PaintRectangle.Right := R.Right; + if PaintRectangle.Left < R.Left then + PaintRectangle.Left := R.Left; + ButtonRgn := CreateRectRgnIndirect(PaintRectangle); + SelectClipRgn(Handle, ButtonRgn); + DeleteObject(ButtonRgn); + + PaintRectangle := Run; + if (Style = vsText) or not OwnerDraw or AdvancedOwnerDraw then + begin + // calculate text and glyph position + InflateRect(PaintRectangle, -2, -2); + DrawFormat := DT_LEFT or DT_TOP or DT_NOPREFIX; + if UseRightToLeftReading then + DrawFormat := DrawFormat + DT_RTLREADING; + ComputeHeaderLayout(Handle, PaintRectangle, ShowHeaderGlyph, ShowSortGlyph, GlyphPos, SortGlyphPos, + TextRectangle); + + // Move glyph and text one pixel to the right and down to simulate a pressed button. + if IsDownIndex then + begin + OffsetRect(TextRectangle, 1, 1); + Inc(GlyphPos.X); + Inc(GlyphPos.Y); + Inc(SortGlyphPos.X); + Inc(SortGlyphPos.Y); + end; + + // Advanced owner draw allows to paint elements, which would normally not be painted (because of space + // limitations, empty captions etc.). + ActualElements := RequestedElements * [hpeHeaderGlyph, hpeSortGlyph, hpeDropMark, hpeText]; + + // main glyph + if not (hpeHeaderGlyph in ActualElements) and ShowHeaderGlyph and + (not ShowSortGlyph {bor (FBidiMode <> bdLeftToRight)} or (GlyphPos.X + Images.Width <= SortGlyphPos.X)) then + Images.Draw(FHeaderBitmap.Canvas, GlyphPos.X, GlyphPos.Y, FImageIndex, IsEnabled); + + // caption + if not (hpeText in ActualElements) and (Length(Text) > 0) then + DrawButtonText(Handle, Text, TextRectangle, IsEnabled, IsHoverIndex and (hoHotTrack in FHeader.FOptions) and + not (tsUseThemes in FHeader.Treeview.FStates), DrawFormat); + + // sort glyph + if not (hpeSortGlyph in ActualElements) and ShowSortGlyph then + begin + SortIndex := SortGlyphs[FHeader.FSortDirection, tsUseThemes in FHeader.Treeview.FStates]; + UtilityImages.Draw(FHeaderBitmap.Canvas, SortGlyphPos.X, SortGlyphPos.Y, SortIndex); + end; + + // Show an indication if this column is the current drop target in a header drag operation. + if not (hpeDropMark in ActualElements) and (DropMark <> dmmNone) then + begin + Y := (PaintRectangle.Top + PaintRectangle.Bottom - UtilityImages.Height) div 2; + if DropMark = dmmLeft then + UtilityImages.Draw(FHeaderBitmap.Canvas, PaintRectangle.Left, Y, 0) + else + UtilityImages.Draw(FHeaderBitmap.Canvas, PaintRectangle.Right - 16 , Y, 1); + end; + + if ActualElements <> [] then + begin + SavedDC := SaveDC(Handle); + FHeader.Treeview.DoAdvancedHeaderDraw(PaintInfo, ActualElements); + RestoreDC(Handle, SavedDC); + end; + end + else // Let application draw the header. + FHeader.Treeview.DoHeaderDraw(FHeaderBitmap.Canvas, Items[FPositionToIndex[I]], PaintRectangle, IsHoverIndex, + IsDownIndex, DropMark); + SelectClipRgn(Handle, 0); + end; + end; + + // Blit the result to target. + with R do + BitBlt(DC, Left, Top, Right - Left, Bottom - Top, PaintInfo.TargetCanvas.Handle, Left, Top, SRCCOPY); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVirtualTreeColumns.SaveToStream(const Stream: TStream); + +var + I: Integer; + +begin + I := Count; + Stream.WriteBuffer(I, SizeOf(I)); + if I > 0 then + begin + for I := 0 to Count - 1 do + TVirtualTreeColumn(Items[I]).SaveToStream(Stream); + + Stream.WriteBuffer(FPositionToIndex[0], Count * SizeOf(Cardinal)); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVirtualTreeColumns.TotalWidth: Integer; + +var + LastColumn: TColumnIndex; + +begin + if Count = 0 then + Result := 0 + else + begin + LastColumn := FPositionToIndex[Count - 1]; + if not (coVisible in Items[LastColumn].FOptions) then + LastColumn := GetPreviousVisibleColumn(LastColumn); + if LastColumn > NoColumn then + with Items[LastColumn] do + Result := FLeft + FWidth + else + Result := 0; + end; +end; + +//----------------- TVTHeader ----------------------------------------------------------------------------------------- + +constructor TVTHeader.Create(AOwner: TBaseVirtualTree); + +begin + inherited Create; + FOwner := AOwner; + FColumns := GetColumnsClass.Create(Self); + FHeight := 17; + FFont := TFont.Create; + FFont.OnChange := @FontChanged; + FParentFont := False; + FBackground := clBtnFace; + FOptions := [hoColumnResize, hoDrag]; + + FImageChangeLink := TChangeLink.Create; + FImageChangeLink.OnChange := @ImageListChange; + + FSortColumn := NoColumn; + FSortDirection := sdAscending; + FMainColumn := NoColumn; + + FDragImage := TVTDragImage.Create(AOwner); + with FDragImage do + begin + Fade := False; + PostBlendBias := 0; + PreBlendBias := -50; + Transparency := 140; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TVTHeader.Destroy; + +begin + FDragImage.Free; + FImageChangeLink.Free; + FFont.Free; + FColumns.Clear; // TCollection's Clear method is not virtual, so we have to call our own Clear method manually. + FColumns.Free; + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.FontChanged(Sender: TObject); + +begin + Invalidate(nil); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.GetMainColumn: TColumnIndex; + +begin + if FColumns.Count > 0 then + Result := FMainColumn + else + Result := NoColumn; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.GetUseColumns: Boolean; + +begin + Result := FColumns.Count > 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetAutoSizeIndex(Value: TColumnIndex); + +begin + if FAutoSizeIndex <> Value then + begin + FAutoSizeIndex := Value; + if hoAutoResize in FOptions then + Columns.AdjustAutoSize(InvalidColumn); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetBackground(Value: TColor); + +begin + if FBackground <> Value then + begin + FBackground := Value; + Invalidate(nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetColumns(Value: TVirtualTreeColumns); + +begin + FColumns.Assign(Value); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetFont(const Value: TFont); + +begin + FFont.Assign(Value); + FParentFont := False; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetHeight(Value: Cardinal); + +begin + if FHeight <> Value then + begin + FHeight := Value; + if not (csLoading in Treeview.ComponentState) then + RecalculateHeader; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetImages(const Value: TCustomImageList); + +begin + if FImages <> Value then + begin + if Assigned(FImages) then + begin + FImages.UnRegisterChanges(FImageChangeLink); + FImages.RemoveFreeNotification(FOwner); + end; + FImages := Value; + if Assigned(FImages) then + begin + FImages.RegisterChanges(FImageChangeLink); + FImages.FreeNotification(FOwner); + end; + if not (csLoading in Treeview.ComponentState) then + Invalidate(nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetMainColumn(Value: TColumnIndex); + +begin + if csLoading in Treeview.ComponentState then + FMainColumn := Value + else + begin + if Value < 0 then + Value := 0; + if Value > FColumns.Count - 1 then + Value := FColumns.Count - 1; + if Value <> FMainColumn then + begin + FMainColumn := Value; + if not (csLoading in Treeview.ComponentState) then + begin + Treeview.MainColumnChanged; + if not (toExtendedFocus in Treeview.FOptions.FSelectionOptions) then + Treeview.FocusedColumn := FMainColumn; + Treeview.Invalidate; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetOptions(Value: TVTHeaderOptions); + +var + ToBeSet, + ToBeCleared: TVTHeaderOptions; + +begin + ToBeSet := Value - FOptions; + ToBeCleared := FOptions - Value; + FOptions := Value; + + if (hoAutoResize in (ToBeSet + ToBeCleared)) and (FColumns.Count > 0) then + begin + FColumns.AdjustAutoSize(InvalidColumn); + if Treeview.HandleAllocated then + begin + Treeview.UpdateHorizontalScrollBar(False); + if hoAutoResize in ToBeSet then + Treeview.Invalidate; + end; + end; + + if not (csLoading in Treeview.ComponentState) and Treeview.HandleAllocated then + begin + if hoVisible in (ToBeSet + ToBeCleared) then + RecalculateHeader; + Invalidate(nil); + Treeview.Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetParentFont(Value: Boolean); + +begin + if FParentFont <> Value then + begin + FParentFont := Value; + if FParentFont then + FFont.Assign(FOwner.Font); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetSortColumn(Value: TColumnIndex); + +begin + if csLoading in Treeview.ComponentState then + FSortColumn := Value + else + begin + if Value < NoColumn then + Value := NoColumn; + if Value > Columns.Count - 1 then + Value := Columns.Count - 1; + if FSortColumn <> Value then + begin + if FSortColumn > NoColumn then + Invalidate(Columns[FSortColumn]); + FSortColumn := Value; + if FSortColumn > NoColumn then + Invalidate(Columns[FSortColumn]); + if (toAutoSort in Treeview.FOptions.FAutoOptions) and (Treeview.FUpdateCount = 0) then + Treeview.SortTree(FSortColumn, FSortDirection, True); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetSortDirection(const Value: TSortDirection); + +begin + if Value <> FSortDirection then + begin + FSortDirection := Value; + Invalidate(nil); + if (toAutoSort in Treeview.FOptions.FAutoOptions) and (Treeview.FUpdateCount = 0) then + Treeview.SortTree(FSortColumn, FSortDirection, True); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SetStyle(Value: TVTHeaderStyle); + +begin + if FStyle <> Value then + begin + FStyle := Value; + if not (csLoading in Treeview.ComponentState) then + Invalidate(nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.CanWriteColumns: Boolean; + +// Descentants may override this to optionally prevent column writing (e.g. if they are build dynamically). + +begin + Result := True; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.ChangeScale(M, D: Integer); + +begin + FFont.Size := MulDiv(FFont.Size, M, D); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.DetermineSplitterIndex(P: TPoint): Boolean; + +// Tries to find the index of that column whose right border corresponds to P. +// Result is True if column border was hit (with -3..+5 pixels tolerance). +// For continuous resizing the current track index and the column's left/right border are set. +// Note: The hit test is checking from right to left (or left to right in RTL mode) to make enlarging of zero-sized +// columns possible. + +var + I, + SplitPoint: Integer; + +begin + Result := False; + FColumns.FTrackIndex := NoColumn; + + if FColumns.Count > 0 then + begin +{ if Treeview.UseRightToLeftAlignment then + begin + SplitPoint := -Treeview.FEffectiveOffsetX; + if Integer(Treeview.FRangeX) < Treeview.ClientWidth then + Inc(SplitPoint, Treeview.ClientWidth - Integer(Treeview.FRangeX)); + + for I := 0 to FColumns.Count - 1 do + with FColumns, Items[FPositionToIndex[I]] do + if coVisible in FOptions then + begin + if (P.X < SplitPoint + 3) and (P.X > SplitPoint - 5) then + begin + if coResizable in FOptions then + begin + Result := True; + FTrackIndex := FPositionToIndex[I]; + + // Keep the right border of this column. This and the current mouse position + // directly determine the current column width. + FTrackPos := SplitPoint + FWidth; + end; + Break; + end; + Inc(SplitPoint, FWidth); + end; + end + else} + begin + SplitPoint := -Treeview.FEffectiveOffsetX + Integer(Treeview.FRangeX); + + for I := FColumns.Count - 1 downto 0 do + with FColumns, Items[FPositionToIndex[I]] do + if coVisible in FOptions then + begin + if (P.X < SplitPoint + 5) and (P.X > SplitPoint - 3) then + begin + if coResizable in FOptions then + begin + Result := True; + FTrackIndex := FPositionToIndex[I]; + + // Keep the left border of this column. This and the current mouse position + // directly determine the current column width. + FTrackPos := SplitPoint - FWidth; + end; + Break; + end; + Dec(SplitPoint, FWidth); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.DragTo(P: TPoint); + +// Moves the drag image to a new position, which is determined from the passed point P and the previous +// mouse position. + +var + I, + NewTarget: Integer; + // optimized drag image move support + ClientP: TPoint; + Left, + Right: Integer; + NeedRepaint: Boolean; // True if the screen needs an update (changed drop target or drop side) + +begin + // Determine new drop target and which side of it is prefered. + ClientP := Treeview.ScreenToClient(P); + // Make coordinates relative to (0, 0) of the non-client area. + Inc(ClientP.Y, FHeight); + NewTarget := FColumns.ColumnFromPosition(ClientP); + NeedRepaint := (NewTarget <> InvalidColumn) and (NewTarget <> FColumns.FDropTarget); + if NewTarget >= 0 then + begin + FColumns.GetColumnBounds(NewTarget, Left, Right); + if (ClientP.X < ((Left + Right) div 2)) <> FColumns.FDropBefore then + begin + NeedRepaint := True; + FColumns.FDropBefore := not FColumns.FDropBefore; + end; + end; + + if NeedRepaint then + begin + // Invalidate columns which need a repaint. + if FColumns.FDropTarget > NoColumn then + begin + I := FColumns.FDropTarget; + FColumns.FDropTarget := NoColumn; + Invalidate(FColumns.Items[I]); + end; + if (NewTarget > NoColumn) and (NewTarget <> FColumns.FDropTarget) then + begin + Invalidate(FColumns.Items[NewTarget]); + FColumns.FDropTarget := NewTarget; + end; + end; + + FDragImage.DragTo(P, NeedRepaint); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.GetColumnsClass: TVirtualTreeColumnsClass; + +// Returns the class to be used for the actual column implementation. Descentants may optionally override this and +// return their own class. + +begin + Result := TVirtualTreeColumns; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.GetOwner: TPersistent; + +begin + Result := FOwner; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.GetShiftState: TShiftState; + +begin + Result := []; + if GetKeyState(VK_SHIFT) < 0 then + Include(Result, ssShift); + if GetKeyState(VK_CONTROL) < 0 then + Include(Result, ssCtrl); + if GetKeyState(VK_MENU) < 0 then + Include(Result, ssAlt); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.HandleHeaderMouseMove(var Message: TLMMouseMove): Boolean; + +var + P: TPoint; + I: Integer; + +begin + Result := False; + with Message do + begin + P := Point(XPos, YPos); + if hsTrackPending in FStates then + begin + Treeview.StopTimer(HeaderTimer); + FStates := FStates - [hsTrackPending] + [hsTracking]; + HandleHeaderMouseMove := True; + Result := 0; + end + else + if hsTracking in FStates then + begin + FColumns[FColumns.FTrackIndex].Width := XPos - FLeftTrackPos; + HandleHeaderMouseMove := True; + Result := 0; + end + else + begin + if hsDragPending in FStates then + begin + P := Treeview.ClientToScreen(P); + // start actual dragging if allowed + end + else + if hsDragging in FStates then + begin + DragTo(Treeview.ClientToScreen(Point(XPos, YPos))); + HandleHeaderMouseMove := True; + Result := 0; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.HandleMessage(var Message: TLMessage): Boolean; + +// The header gets here the opportunity to handle certain messages before they reach the tree. This is important +// because the tree needs to handle various non-client area messages for the header as well as some dragging/tracking +// events. +// By returning True the message will not be handled further, otherwise the message is then dispatched +// to the proper message handlers. + +var + P: TPoint; + R: TRect; + I: Integer; + OldPosition: Integer; + HitIndex: TColumnIndex; + NewCursor: HCURSOR; + Button: TMouseButton; + +begin + Result := False; + case Message.Msg of + LM_SIZE: + begin + if (hoAutoResize in FOptions) and not (hsAutoSizing in FStates) and + not (tsWindowCreating in FOwner.FStates) then + begin + FColumns.AdjustAutoSize(InvalidColumn); + Invalidate(nil); + end; + end; +{ CM_PARENTFONTCHANGED: + if FParentFont then + FFont.Assign(Font);} //Dont supported by the LCL + CM_BIDIMODECHANGED: + for I := 0 to FColumns.Count - 1 do + if coParentBiDiMode in FColumns[I].FOptions then + FColumns[I].ParentBiDiModeChanged; +{todo WM_NCMBUTTONDOWN: + begin + with TWMNCMButtonDown(Message) do + P := Treeview.ScreenToClient(Point(XCursor, YCursor)); + if InHeader(P) then + FOwner.DoHeaderMouseDown(mbMiddle, GetShiftState, P.X, P.Y + Integer(FHeight)); + end;} +{ LM_NCMBUTTONUP: + begin + with TWMNCMButtonUp(Message) do + P := FOwner.ScreenToClient(Point(XCursor, YCursor)); + if InHeader(P) then + begin + FColumns.HandleClick(P, mbMiddle, True, False); + FOwner.DoHeaderMouseUp(mbMiddle, GetShiftState, P.X, P.Y + Integer(FHeight)); + FColumns.FDownIndex := NoColumn; + end; + end;} +{ LM_NCLBUTTONDBLCLK, + LM_NCMBUTTONDBLCLK, + LM_NCRBUTTONDBLCLK: + begin + with TWMNCLButtonDblClk(Message) do + P := FOwner.ScreenToClient(Point(XCursor, YCursor)); + // If the click was on a splitter then resize column do smallest width. + if InHeader(P) then + begin + case Message.Msg of + WM_NCMBUTTONDBLCLK: + Button := mbMiddle; + WM_NCRBUTTONDBLCLK: + Button := mbRight; + else + // WM_NCLBUTTONDBLCLK + Button := mbLeft; + end; + if (hoDblClickResize in FOptions) and (FColumns.FTrackIndex > NoColumn) then + begin + with FColumns do + AnimatedResize(FTrackIndex, Max(FColumns[FTrackIndex].MinWidth, Treeview.GetMaxColumnWidth(FTrackIndex))); + end + else + FColumns.HandleClick(P, Button, True, True); + if FColumns.FClickIndex > NoColumn then + FOwner.DoHeaderDblClick(FColumns.FClickIndex, Button, GetShiftState + [ssDouble], P.X, P.Y + + Integer(FHeight)); + end; + end;} +{ LM_NCLBUTTONDOWN: + begin + Application.CancelHint; + + // make sure no auto scrolling is active... + Treeview.StopTimer(ScrollTimer); + Treeview.DoStateChange([], [tsScrollPending, tsScrolling]); + // ... pending editing is cancelled (actual editing remains active) + Treeview.StopTimer(EditTimer); + Treeview.DoStateChange([], [tsEditPending]); + + with TWMNCLButtonDown(Message) do + begin + // want the drag start point in screen coordinates + FDragStart := Point(XCursor, YCursor); + P := Treeview.ScreenToClient(FDragStart); + end; + + if InHeader(P) then + begin + // This is a good opportunity to notify the application. + FOwner.DoHeaderMouseDown(mbLeft, GetShiftState, P.X, P.Y + Integer(FHeight)); + + if DetermineSplitterIndex(P) and (hoColumnResize in FOptions) then + begin + FColumns.FHoverIndex := NoColumn; + FTrackStart := P; + Include(FStates, hsTrackPending); + SetCapture(Treeview.Handle); + Result := True; + Message.Result := 0; + end + else + begin + HitIndex := Columns.AdjustDownColumn(P); + if (hoDrag in FOptions) and (HitIndex > NoColumn) and (coDraggable in FColumns[HitIndex].FOptions) then + begin + // Show potential drag operation. + // Disabled columns do not start a drag operation because they can't be clicked. + Include(FStates, hsDragPending); + SetCapture(Treeview.Handle); + Result := True; + Message.Result := 0; + end; + end; + end; + end; + LM_NCRBUTTONDOWN: + begin + with TWMNCRButtonDown(Message) do + P := FOwner.ScreenToClient(Point(XCursor, YCursor)); + if InHeader(P) then + FOwner.DoHeaderMouseDown(mbRight, GetShiftState, P.X, P.Y + Integer(FHeight)); + end; + LM_NCRBUTTONUP: + if not (csDesigning in FOwner.ComponentState) then + with TWMNCRButtonUp(Message) do + begin + Application.CancelHint; + + P := FOwner.ScreenToClient(Point(XCursor, YCursor)); + if InHeader(P) then + begin + FColumns.HandleClick(P, mbRight, True, False); + FOwner.DoHeaderMouseUp(mbRight, GetShiftState, P.X, P.Y + Integer(FHeight)); + FColumns.FDownIndex := NoColumn; + FColumns.FTrackIndex := NoColumn; + + // Trigger header popup if there's one. + if Assigned(FPopupMenu) then + begin + Treeview.StopTimer(ScrollTimer); + Treeview.StopTimer(HeaderTimer); + FColumns.FHoverIndex := NoColumn; + Treeview.DoStateChange([], [tsScrollPending, tsScrolling]); + FPopupMenu.PopupComponent := Treeview; + FPopupMenu.Popup(XCursor, YCursor); + HandleMessage := True; + end; + end; + end; + // When the tree window has an active mouse capture then we only get "client-area" messages. + LM_LBUTTONUP, + LM_NCLBUTTONUP: + begin + Application.CancelHint; + + if FStates <> [] then + begin + ReleaseCapture; + if hsDragging in FStates then + begin + // successfull dragging moves columns + with TWMLButtonUp(Message) do + P := Treeview.ClientToScreen(Point(XPos, YPos)); + GetWindowRect(Treeview.Handle, R); + with FColumns do + begin + FDragImage.EndDrag; + if (FDropTarget > -1) and (FDropTarget <> FDragIndex) and PtInRect(R, P) then + begin + OldPosition := FColumns[FDragIndex].Position; + if FColumns.FDropBefore then + begin + if FColumns[FDragIndex].Position < FColumns[FDropTarget].Position then + FColumns[FDragIndex].Position := Max(0, FColumns[FDropTarget].Position - 1) + else + FColumns[FDragIndex].Position := FColumns[FDropTarget].Position; + end + else + begin + if FColumns[FDragIndex].Position < FColumns[FDropTarget].Position then + FColumns[FDragIndex].Position := FColumns[FDropTarget].Position + else + FColumns[FDragIndex].Position := FColumns[FDropTarget].Position + 1; + end; + Treeview.DoHeaderDragged(FDragIndex, OldPosition); + end + else + Treeview.DoHeaderDraggedOut(FDragIndex, P); + FDropTarget := NoColumn; + end; + Invalidate(nil); + end; + Result := True; + Message.Result := 0; + end; + + case Message.Msg of + WM_LBUTTONUP: + with TWMLButtonUp(Message) do + begin + if FColumns.FDownIndex > NoColumn then + FColumns.HandleClick(Point(XPos, YPos), mbLeft, False, False); + if FStates <> [] then + FOwner.DoHeaderMouseUp(mbLeft, KeysToShiftState(Keys), XPos, YPos); + end; + WM_NCLBUTTONUP: + with TWMNCLButtonUp(Message) do + begin + P := FOwner.ScreenToClient(Point(XCursor, YCursor)); + FColumns.HandleClick(P, mbLeft, False, False); + FOwner.DoHeaderMouseUp(mbLeft, GetShiftState, P.X, P.Y + Integer(FHeight)); + end; + end; + + if FColumns.FTrackIndex > NoColumn then + begin + Invalidate(Columns[FColumns.FTrackIndex]); + FColumns.FTrackIndex := NoColumn; + end; + if FColumns.FDownIndex > NoColumn then + begin + Invalidate(Columns[FColumns.FDownIndex]); + FColumns.FDownIndex := NoColumn; + end; + FStates := FStates - [hsDragging, hsDragPending, hsTracking, hsTrackPending]; + end; + // hovering, mouse leave detection + LM_NCMOUSEMOVE: + with TWMNCMouseMove(Message), FColumns do + begin + P := Treeview.ScreenToClient(Point(XCursor, YCursor)); + Treeview.DoHeaderMouseMove(GetShiftState, P.X, P.Y + Integer(FHeight)); + if InHeader(P) and ((AdjustHoverColumn(P)) or ((FDownIndex >= 0) and (FHoverIndex <> FDownIndex))) then + begin + // We need a mouse leave detection from here for the non client area. The best solution available would be the + // TrackMouseEvent API. Unfortunately, it leaves Win95 totally and WinNT4 for non-client stuff out and + // currently I cannot ignore these systems. Hence I go the only other reliable way and use a timer + // (although, I don't like it...). + Treeview.StopTimer(HeaderTimer); + SetTimer(Treeview.Handle, HeaderTimer, 50, nil); + // use Delphi's internal hint handling for header hints too + if hoShowHint in FOptions then + begin + // client coordinates! + XCursor := P.x; + YCursor := P.y + Integer(FHeight); + Application.HintMouseMessage(Treeview, Message); + end; + end + end; + LM_TIMER: + if TWMTimer(Message).TimerID = HeaderTimer then + begin + // determine current mouse position to check if it left the window + GetCursorPos(P); + P := Treeview.ScreenToClient(P); + with FColumns do + begin + if not InHeader(P) or ((FDownIndex > NoColumn) and (FHoverIndex <> FDownIndex)) then + begin + Treeview.StopTimer(HeaderTimer); + FHoverIndex := NoColumn; + FClickIndex := NoColumn; + FDownIndex := NoColumn; + Result := True; + Message.Result := 0; + Invalidate(nil); + end; + end; + end; + LM_MOUSEMOVE: // mouse capture and general message redirection + Result := HandleHeaderMouseMove(TWMMouseMove(Message)); + LM_SETCURSOR: + if FStates = [] then + begin + // Retrieve last cursor position (GetMessagePos does not work here, I don't know why). + GetCursorPos(P); + // Is the mouse in the header rectangle? + P := Treeview.ScreenToClient(P); + if InHeader(P) then + begin + NewCursor := Screen.Cursors[crDefault]; + if hoColumnResize in FOptions then + begin + if DetermineSplitterIndex(P) then + NewCursor := Screen.Cursors[crHeaderSplit]; + + Treeview.DoGetHeaderCursor(NewCursor); + Result := NewCursor <> Screen.Cursors[crDefault]; + if Result then + begin + Windows.SetCursor(NewCursor); + Message.Result := 1; + end + end; + end; + end + else + begin + Message.Result := 1; + Result := True; + end;} + LM_KEYDOWN, + LM_KILLFOCUS: + if (Message.Msg = LM_KILLFOCUS) or + (TLMKeyDown(Message).CharCode = VK_ESCAPE) then + begin + if hsDragging in FStates then + begin + ReleaseCapture; + FDragImage.EndDrag; + Exclude(FStates, hsDragging); + FColumns.FDropTarget := NoColumn; + Invalidate(nil); + Result := True; + Message.Result := 0; + end + else + if hsTracking in FStates then + begin + ReleaseCapture; + Exclude(FStates, hsTracking); + Result := True; + Message.Result := 0; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.ImageListChange(Sender: TObject); + +begin + if not (csDestroying in Treeview.ComponentState) then + Invalidate(nil); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.PrepareDrag(P, Start: TPoint); + +// Initializes dragging of the header, P is the current mouse postion and Start the initial mouse position. + +var + ColumnR, + HeaderR: TRect; + Image: TBitmap; + ImagePos: TPoint; + +begin + // Determine initial position of drag image (screen coordinates). + FColumns.FDropTarget := NoColumn; + Start := Treeview.ScreenToClient(Start); + Inc(Start.Y, FHeight); + FColumns.FDragIndex := FColumns.ColumnFromPosition(Start); + ColumnR := FColumns[FColumns.FDragIndex].GetRect; + + HeaderR := Treeview.FHeaderRect; + // Set right border of the header rectangle to the maximum extent. + HeaderR.Right := FColumns.TotalWidth; + + // Take out influence of border since we need a seamless drag image. + OffsetRect(ColumnR, -HeaderR.Left + Treeview.FOffsetX, -HeaderR.Top); + + Image := TBitmap.Create; + with Image do + try + PixelFormat := pf32Bit; + Width := ColumnR.Right - ColumnR.Left + HeaderR.Left; + Height := ColumnR.Bottom - ColumnR.Top + HeaderR.Top; + + HeaderR.Left := 0; + HeaderR.Top := 0; + + // Erase the entire image with the color key value, for the case not everything + // in the image is covered by the header image. + Canvas.Brush.Color := clBtnFace; + Canvas.FillRect(Rect(0, 0, Width, Height)); + + FColumns.PaintHeader(Canvas.Handle, HeaderR, -ColumnR.Left + Treeview.FOffsetX, -ColumnR.Top); + + ImagePos := Treeview.ClientToScreen(ColumnR.TopLeft); + // Column rectangles are given in local window coordinates not client coordinates. + Dec(ImagePos.Y, FHeight); + + if hoRestrictDrag in FOptions then + FDragImage.MoveRestriction := dmrHorizontalOnly + else + FDragImage.MoveRestriction := dmrNone; +//x FDragImage.PrepareDrag(Image, ImagePos, P, nil); + FDragImage.ShowDragImage; + finally + Image.Free; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.ReadColumns(Reader: TReader); + +begin + Include(FStates, hsLoading); + Columns.Clear; + Reader.ReadValue; + Reader.ReadCollection(Columns); + Exclude(FStates, hsLoading); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.RecalculateHeader; + +// Initiate a recalculation of the non-client area of the owner tree. + +begin + if Treeview.HandleAllocated then + begin + Treeview.UpdateHeaderRect; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.UpdateMainColumn; + +// Called once the load process of the owner tree is done. + +begin + if FMainColumn < 0 then + FMainColumn := 0; + if FMainColumn > FColumns.Count - 1 then + FMainColumn := FColumns.Count - 1; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.UpdateSpringColumns; + +var + I: Integer; + SpringCount: Integer; + Sign: Integer; + ChangeBy: Single; + Difference: Single; + NewAccumulator: Single; + +begin + with TreeView do + ChangeBy := FHeaderRect.Right - FHeaderRect.Left - FLastWidth; + if (hoAutoSpring in FOptions) and (FLastWidth <> 0) and (ChangeBy <> 0) then + begin + // Stay positive if downsizing the control. + if ChangeBy < 0 then + Sign := -1 + else + Sign := 1; + ChangeBy := Abs(ChangeBy); + // Count how many columns have Spring enabled. + SpringCount := 0; + for I := 0 to FColumns.Count-1 do + if coAutoSpring in FColumns[I].FOptions then + Inc(SpringCount); + if SpringCount > 0 then + begin + // Calculate the size to add/sub to each columns. + Difference := ChangeBy / SpringCount; + // Adjust the column's size accumulators and resize if the result is >= 1. + for I := 0 to FColumns.Count - 1 do + if coAutoSpring in FColumns[I].FOptions then + begin + // Sum up rest changes from previous runs and the amount from this one and store it in the + // column. If there is at least one pixel difference then do a resize and reset the accumulator. + NewAccumulator := FColumns[I].FSpringRest + Difference; + // Set new width if at least one pixel size difference is reached. + if NewAccumulator >= 1 then + FColumns[I].SetWidth(FColumns[I].FWidth + (Trunc(NewAccumulator) * Sign)); + FColumns[I].FSpringRest := Frac(NewAccumulator); + + // Keep track of the size count. + ChangeBy := ChangeBy - Difference; + // Exit loop if resize count drops below freezing point. + if ChangeBy < 0 then + Break; + end; + end; + end; + with TreeView do + FLastWidth := FHeaderRect.Right - FHeaderRect.Left; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.WriteColumns(Writer: TWriter); + +begin + Writer.WriteCollection(Columns); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.Assign(Source: TPersistent); + +begin + if Source is TVTHeader then + begin + AutoSizeIndex := TVTHeader(Source).AutoSizeIndex; + Background := TVTHeader(Source).Background; + Columns := TVTHeader(Source).Columns; + Font := TVTHeader(Source).Font; + Height := TVTHeader(Source).Height; + Images := TVTHeader(Source).Images; + MainColumn := TVTHeader(Source).MainColumn; + Options := TVTHeader(Source).Options; + ParentFont := TVTHeader(Source).ParentFont; + PopupMenu := TVTHeader(Source).PopupMenu; + SortColumn := TVTHeader(Source).SortColumn; + SortDirection := TVTHeader(Source).SortDirection; + Style := TVTHeader(Source).Style; + end + else + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.AutoFitColumns(Animated: Boolean = True); + +var + I: Integer; + +begin + if Animated then + begin + with FColumns do + for I := 0 to Count - 1 do + if [coResizable, coVisible] * Items[FPositionToIndex[I]].FOptions = [coResizable, coVisible] then + AnimatedResize(FPositionToIndex[I], Treeview.GetMaxColumnWidth(FPositionToIndex[I])) + end + else + begin + with FColumns do + for I := 0 to Count - 1 do + if [coResizable, coVisible] * Items[FPositionToIndex[I]].FOptions = [coResizable, coVisible] then + FColumns[FPositionToIndex[I]].Width := Treeview.GetMaxColumnWidth(FPositionToIndex[I]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTHeader.InHeader(P: TPoint): Boolean; + +// Determines whether the given point (client coordinates!) is within the header rectangle (non-client coordinates). + +var + R, RW: TRect; + +begin + R := Treeview.FHeaderRect; + // current position of the owner in screen coordinates + GetWindowRect(Treeview.Handle, RW); + // convert to client coordinates + MapWindowPoints(0, Treeview.Handle, RW, 2); + // consider the header within this rectangle + OffsetRect(R, RW.Left, RW.Top); + Result := PtInRect(R, P); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.Invalidate(Column: TVirtualTreeColumn; ExpandToBorder: Boolean = False); + +// Because the header is in the non-client area of the tree it needs some special handling in order to initiate its +// repainting. +// If ExpandToBorder is True then not only the given column but everything to its right (or left, in RTL mode) will be +// invalidated (useful for resizing). This makes only sense when a column is given. + +var + R, RW: TRect; + +begin + if (hoVisible in FOptions) and Treeview.HandleAllocated then + with Treeview do + begin + if Column = nil then + R := FHeaderRect + else + begin + R := Column.GetRect; + if not (coFixed in Column.Options) then + OffsetRect(R, -FEffectiveOffsetX, 0); +// if UseRightToLeftAlignment then +// OffsetRect(R, ComputeRTLOffset, 0); + if ExpandToBorder then +{ if UseRightToLeftAlignment then + R.Left := FHeaderRect.Left + else} + R.Right := FHeaderRect.Right; + end; + + // Current position of the owner in screen coordinates. + GetWindowRect(Handle, RW); + + // Consider the header within this rectangle. + OffsetRect(R, RW.Left, RW.Top); + + // Expressed in client coordinates (because RedrawWindow wants them so, they will actually become negative). + MapWindowPoints(0, Handle, R, 2); +// RedrawWindow(Handle, @R, 0, RDW_FRAME or RDW_INVALIDATE or RDW_VALIDATE or RDW_NOINTERNALPAINT or +// RDW_NOERASE or RDW_NOCHILDREN); + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.LoadFromStream(const Stream: TStream); + +// restore the state of the header from the given stream + +var + Dummy, + Version: Integer; + S: string; + OldOptions: TVTHeaderOptions; + +begin + Include(FStates, hsLoading); + with Stream do + try + // switch off all options which could influence loading the columns (they will be later set again) + OldOptions := FOptions; + FOptions := []; + + // determine whether the stream contains data without a version number + ReadBuffer(Dummy, SizeOf(Dummy)); + if Dummy > -1 then + begin + // seek back to undo read operation if this is an old stream format + Seek(-SizeOf(Dummy), soFromCurrent); + Version := -1; + end + else // read version number if this is a "versionized" format + ReadBuffer(Version, SizeOf(Version)); + Columns.LoadFromStream(Stream, Version); + + ReadBuffer(Dummy, SizeOf(Dummy)); + AutoSizeIndex := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + Background := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + Height := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + FOptions := OldOptions; +//set Options := TVTHeaderOptions(Word(Dummy)); + // PopupMenu is neither saved nor restored + ReadBuffer(Dummy, SizeOf(Dummy)); + Style := TVTHeaderStyle(Dummy); + // TFont has no own save routine so we do it manually + with Font do + begin + ReadBuffer(Dummy, SizeOf(Dummy)); + Color := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + Height := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + SetLength(S, Dummy); + ReadBuffer(PChar(S)^, Dummy); + Name := S; + ReadBuffer(Dummy, SizeOf(Dummy)); + Pitch := TFontPitch(Dummy); + ReadBuffer(Dummy, SizeOf(Dummy)); +//set Style := TFontStyles(Byte(Dummy)); + end; + + // read data introduced by stream version 1+ + if Version > 0 then + begin + ReadBuffer(Dummy, SizeOf(Dummy)); + MainColumn := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + SortColumn := Dummy; + ReadBuffer(Dummy, SizeOf(Dummy)); + SortDirection := TSortDirection(Byte(Dummy)); + end; + finally + Exclude(FStates, hsLoading); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.RestoreColumns; + +// Restores all columns to their width which they had before they have been auto fitted. + +var + I: Integer; + +begin + with FColumns do + for I := Count - 1 downto 0 do + if [coResizable, coVisible] * Items[FPositionToIndex[I]].FOptions = [coResizable, coVisible] then + Items[I].RestoreLastWidth; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTHeader.SaveToStream(const Stream: TStream); + +// Saves the complete state of the header into the provided stream. + +var + Dummy: Integer; + +begin + with Stream do + begin + // In previous version of VT was no header stream version defined. + // For feature enhancements it is necessary, however, to know which stream + // format we are trying to load. + // In order to distict from non-version streams an indicator is inserted. + Dummy := -1; + WriteBuffer(Dummy, SizeOf(Dummy)); + // Write current stream version number, nothing more is required at the time being. + Dummy := VTHeaderStreamVersion; + WriteBuffer(Dummy, SizeOf(Dummy)); + + // Save columns in case they depend on certain options (like auto size). + Columns.SaveToStream(Stream); + + Dummy := FAutoSizeIndex; + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := FBackground; + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := FHeight; + WriteBuffer(Dummy, SizeOf(Dummy)); +//set Dummy := Word(FOptions); +//set WriteBuffer(Dummy, SizeOf(Dummy)); + // PopupMenu is neither saved nor restored + Dummy := Ord(FStyle); + WriteBuffer(Dummy, SizeOf(Dummy)); + // TFont has no own save routine so we do it manually + with Font do + begin + Dummy := Color; + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := Height; + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := Length(Name); + WriteBuffer(Dummy, SizeOf(Dummy)); + WriteBuffer(PChar(Name)^, Dummy); + Dummy := Ord(Pitch); + WriteBuffer(Dummy, SizeOf(Dummy)); + // need only to write one: size or height, I decided to write height +//set Dummy := Byte(Style); +//set WriteBuffer(Dummy, SizeOf(Dummy)); + end; + + // data introduced by stream version 1 + Dummy := FMainColumn; + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := FSortColumn; + WriteBuffer(Dummy, SizeOf(Dummy)); + Dummy := Byte(FSortDirection); + WriteBuffer(Dummy, SizeOf(Dummy)); + end; +end; + +//----------------- TScrollBarOptions ---------------------------------------------------------------------------------- + +constructor TScrollBarOptions.Create(AOwner: TBaseVirtualTree); + +begin + inherited Create; + + FOwner := AOwner; + FAlwaysVisible := False; + FScrollBarStyle := sbmRegular; + FScrollBars := ssBoth; + FIncrementX := 20; + FIncrementY := 20; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TScrollBarOptions.SetAlwaysVisible(Value: Boolean); + +begin + if FAlwaysVisible <> Value then + begin + FAlwaysVisible := Value; + if not (csLoading in FOwner.ComponentState) and FOwner.HandleAllocated then + Controls.RecreateWnd(FOwner); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TScrollBarOptions.SetScrollBars(Value: TScrollStyle); + +begin + if FScrollbars <> Value then + begin + FScrollBars := Value; + if not (csLoading in FOwner.ComponentState) and FOwner.HandleAllocated then + RecreateWnd(FOwner); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TScrollBarOptions.SetScrollBarStyle(Value: TScrollBarStyle); + +begin + {$ifndef UseFlatScrollbars} + Assert(Value = sbmRegular, 'Flat scrollbars styles are disabled. Enable UseFlatScrollbars in VirtualTrees.pas for' + + 'flat scrollbar support.'); + {$endif UseFlatScrollbars} + + if FScrollBarStyle <> Value then + begin + FScrollBarStyle := Value; + {$ifdef UseFlatScrollbars} + if FOwner.HandleAllocated then + begin + // If set to regular style then don't use the emulation mode of the FlatSB APIs but the original APIs. + // This is necessary because the FlatSB APIs don't respect NC paint request with limited update region + // (which is necessary for the transparent drag image). + Controls.RecreateWnd(FOwner); + end; + {$endif UseFlatScrollbars} + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TScrollBarOptions.GetOwner: TPersistent; + +begin + Result := FOwner; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TScrollBarOptions.Assign(Source: TPersistent); + +begin + if Source is TScrollBarOptions then + begin + AlwaysVisible := TScrollBarOptions(Source).AlwaysVisible; + HorizontalIncrement := TScrollBarOptions(Source).HorizontalIncrement; + ScrollBars := TScrollBarOptions(Source).ScrollBars; + ScrollBarStyle := TScrollBarOptions(Source).ScrollBarStyle; + VerticalIncrement := TScrollBarOptions(Source).VerticalIncrement; + end + else + inherited; +end; + +//----------------- TVTColors ------------------------------------------------------------------------------------------ + +constructor TVTColors.Create(AOwner: TBaseVirtualTree); + +begin + FOwner := AOwner; + FColors[0] := clBtnShadow; // DisabledColor + FColors[1] := clHighlight; // DropMarkColor + FColors[2] := clHighLight; // DropTargetColor + FColors[3] := clHighLight; // FocusedSelectionColor + FColors[4] := clBtnFace; // GridLineColor + FColors[5] := clBtnShadow; // TreeLineColor + FColors[6] := clBtnFace; // UnfocusedSelectionColor + FColors[7] := clBtnFace; // BorderColor + FColors[8] := clWindowText; // HotColor + FColors[9] := clHighLight; // FocusedSelectionBorderColor + FColors[10] := clBtnFace; // UnfocusedSelectionBorderColor + FColors[11] := clHighlight; // DropTargetBorderColor + FColors[12] := clHighlight; // SelectionRectangleBlendColor + FColors[13] := clHighlight; // SelectionRectangleBorderColor + FColors[14] := clBtnShadow; // HeaderHotColor +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TVTColors.GetColor(const Index: Integer): TColor; + +begin + Result := FColors[Index]; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTColors.SetColor(const Index: Integer; const Value: TColor); + +begin + if FColors[Index] <> Value then + begin + FColors[Index] := Value; + if not (csLoading in FOwner.ComponentState) and FOwner.HandleAllocated then + begin + // Cause helper bitmap rebuild if the button color changed. + case Index of + 5: + begin + FOwner.PrepareBitmaps(True, False); + FOwner.Invalidate; + end; +// 7: +//todo RedrawWindow(FOwner.Handle, nil, 0, RDW_FRAME or RDW_INVALIDATE or RDW_NOERASE or RDW_NOCHILDREN) + else + FOwner.Invalidate; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TVTColors.Assign(Source: TPersistent); + +begin + if Source is TVTColors then + begin + FColors := TVTColors(Source).FColors; + if FOwner.FUpdateCount = 0 then + FOwner.Invalidate; + end + else + inherited; +end; + +//----------------- TClipboardFormats ---------------------------------------------------------------------------------- + +constructor TClipboardFormats.Create(AOwner: TBaseVirtualTree); + +begin + FOwner := AOwner; + Sorted := True; + Duplicates := dupIgnore; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TClipboardFormats.Add(const S: string): Integer; + +// Restrict additions to the clipbard formats to only those which are registered with the owner tree or one of its +// ancestors. + +var + Format: Word; + RegisteredClass: TVirtualTreeClass; + +begin exit; // todo + RegisteredClass := InternalClipboardFormats.FindFormat(S, Format); + if Assigned(RegisteredClass) and FOwner.ClassType.InheritsFrom(RegisteredClass) then + Result := inherited Add(S) + else + Result := -1; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TClipboardFormats.Insert(Index: Integer; const S: string); + +// Restrict additions to the clipbard formats to only those which are registered with the owner tree or one of its +// ancestors. + +var + Format: Word; + RegisteredClass: TVirtualTreeClass; + +begin // todo + RegisteredClass := InternalClipboardFormats.FindFormat(S, Format); + if Assigned(RegisteredClass) and FOwner.ClassType.InheritsFrom(RegisteredClass) then + inherited Insert(Index, S); +end; + +//----------------- TBaseVirtualTree ----------------------------------------------------------------------------------- + +constructor TBaseVirtualTree.Create(AOwner: TComponent); + +begin + if not Initialized then + InitializeGlobalStructures; + + inherited; + + ControlStyle := ControlStyle - [csSetCaption] + [csCaptureMouse, csOpaque, csReplicatable, csDisplayDragImage, + csReflector]; + FTotalInternalDataSize := 0; + FNodeDataSize := -1; + Width := 200; + Height := 100; + TabStop := True; + ParentColor := False; + FDefaultNodeHeight := 18; + FHotCursor := crDefault; + FScrollBarOptions := TScrollBarOptions.Create(Self); + FFocusedColumn := NoColumn; + FLastSelectionLevel := -1; + FAnimationType := hatSystemDefault; + FSelectionBlendFactor := 128; + + FIndent := 18; + + FPlusBM := TBitmap.Create; + FMinusBM := TBitmap.Create; + + FBorderStyle := bsSingle; + FButtonStyle := bsRectangle; + FButtonFillMode := fmTreeColor; + + FHeader := GetHeaderClass.Create(Self); + + // we have an own double buffer handling + DoubleBuffered := False; + + FCheckImageKind := ckLightCheck; + FCheckImages := LightCheckImages; + + FImageChangeLink := TChangeLink.Create; + FImageChangeLink.OnChange := @ImageListChange; + FStateChangeLink := TChangeLink.Create; + FStateChangeLink.OnChange := @ImageListChange; + FCustomCheckChangeLink := TChangeLink.Create; + FCustomCheckChangeLink.OnChange := @ImageListChange; + + FAutoExpandDelay := 1000; + FAutoScrollDelay := 1000; + FAutoScrollInterval := 1; + + FBackground := TPicture.Create; + + FDefaultPasteMode := amAddChildLast; + FMargin := 4; + FTextMargin := 4; + + FColors := TVTColors.Create(Self); + FEditDelay := 1000; + + SetLength(FSingletonNodeArray, 1); + FAnimationDuration := 200; + FSearchTimeout := 1000; + FSearchStart := ssFocusedNode; + FNodeAlignment := naProportional; + FLineStyle := lsDotted; + FIncrementalSearch := isNone; + FClipboardFormats := TClipboardFormats.Create(Self); + FOptions := GetOptionsClass.Create(Self); + + {$ifdef UseLocalMemoryManager} + FNodeMemoryManager := TVTNodeMemoryManager.Create; + {$endif UseLocalMemoryManager} + + AddThreadReference; + +end; + +//---------------------------------------------------------------------------------------------------------------------- + +destructor TBaseVirtualTree.Destroy; + +var + i: Integer; + +begin + Exclude(FOptions.FMiscOptions, toReadOnly); + InterruptValidation; + StopWheelPanning; + CancelEditNode; + + // Just in case it didn't happen already release the edit link. + FEditLink := nil; + FClipboardFormats.Free; + // Clear will also free the drag manager if it is still alive. + Clear; + FColors.Free; + FBackground.Free; + FImageChangeLink.Free; + FStateChangeLink.Free; + FCustomCheckChangeLink.Free; + FScrollBarOptions.Free; + FOptions.Free; + + for i := Low(FTimers) to High(FTimers) do + if Assigned(FTimers[i]) then + FTimers[i].Free; + + // The window handle must be destroyed before the header is freed because it is needed in WM_NCDESTROY. +//todo test if HandleAllocated then +// DestroyWindowHandle; + FHeader.Free; + FHeader := nil; + + FreeMem(FRoot); + + {$ifdef UseLocalMemoryManager} + FNodeMemoryManager.Free; + {$endif UseLocalMemoryManager} + FPlusBM.Free; + FMinusBM.Free; + ReleaseThreadReference(Self); + + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AdjustCoordinatesByIndent(var PaintInfo: TVTPaintInfo; Indent: Integer); + +// During painting of the main column some coordinates must be adjusted due to the tree lines. +// The offset resulting from the tree lines and indentation level is given in Indent. + +var + Offset: Integer; + +begin + with PaintInfo do + begin + Offset := Indent * Integer(FIndent); +//b if BidiMode = bdLeftToRight then +//b begin + Inc(ContentRect.Left, Offset); + Inc(ImageInfo[iiNormal].XPos, Offset); + Inc(ImageInfo[iiState].XPos, Offset); + Inc(ImageInfo[iiCheck].XPos, Offset); +//b end +//b else +//b begin +//b Dec(ContentRect.Right, Offset); +//b Dec(ImageInfo[iiNormal].XPos, Offset); +//b Dec(ImageInfo[iiState].XPos, Offset); +//b Dec(ImageInfo[iiCheck].XPos, Offset); +//b end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AdjustImageBorder(Images: TCustomImageList; BidiMode: TBidiMode; VAlign: Integer; var R: TRect; + var ImageInfo: TVTImageInfo); + +// Depending on the width of the image list as well as the given bidi mode R must be adjusted. + +begin +//b if BidiMode = bdLeftToRight then +//b begin + ImageInfo.XPos := R.Left; + Inc(R.Left, Images.Width + 2); +//b end +//b else +//b begin +//b ImageInfo.XPos := R.Right - Images.Width; +//b Dec(R.Right, Images.Width + 2); +//b end; + ImageInfo.YPos := R.Top + VAlign - Images.Height div 2; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AdjustTotalCount(Node: PVirtualNode; Value: Integer; relative: Boolean = False); + +// Sets a node's total count to the given value and recursively adjusts the parent's total count +// (actually, the adjustment is done iteratively to avoid function call overheads). + +var + Difference: Integer; + Run: PVirtualNode; + +begin exit; + if relative then + Difference := Value + else + Difference := Integer(Value) - Integer(Node^.TotalCount); + if Difference <> 0 then + begin + Run := Node; + // root node has as parent the tree view + while Assigned(Run) and (Run <> Pointer(Self)) do + begin + Inc(Integer(Run^.TotalCount), Difference); + Run := Run^.Parent; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AdjustTotalHeight(Node: PVirtualNode; Value: Integer; relative: Boolean = False); + +// Sets a node's total height to the given value and recursively adjusts the parent's total height. + +var + Difference: Integer; + Run: PVirtualNode; + +begin + if relative then + Difference := Value + else + Difference := Integer(Value) - Integer(Node^.TotalHeight); + if Difference <> 0 then + begin + Run := Node; + repeat + Inc(Integer(Run^.TotalHeight), Difference); + // If the node is not visible or the parent node is not expanded or we are already at the top + // then nothing more remains to do. + if not (vsVisible in Run^.States) or (Run = FRoot) or + (Run^.Parent = nil) or not (vsExpanded in Run^.Parent^.States) then + Break; + + Run := Run^.Parent; + until False; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CalculateCacheEntryCount: Integer; + +// Calculates the size of the position cache. + +begin exit; + if FVisibleCount > 1 then + Result := Ceil(FVisibleCount / CacheThreshold) + else + Result := 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CalculateVerticalAlignments(ShowImages, ShowStateImages: Boolean; Node: PVirtualNode; + var VAlign, VButtonAlign: Integer); + +// Calculates the vertical alignment of the given node and its associated expand/collapse button during +// a node paint cycle depending on the required node alignment style. + +begin + // For absolute alignment the calculation is trivial. + case FNodeAlignment of + naFromTop: + VAlign := Node^.Align; + naFromBottom: + VAlign := NodeHeight[Node] - Node^.Align; + else // naProportional + // Consider button and line alignment, but make sure neither the image nor the button (whichever is taller) + // go out of the entire node height (100% means bottom alignment to the node's bounds). + if ShowImages or ShowStateImages then + begin + if ShowImages then + VAlign := FImages.Height + else + VAlign := FStateImages.Height; + VAlign := MulDiv((Integer(NodeHeight[Node]) - VAlign), Node^.Align, 100) + VAlign div 2; + end + else + if toShowButtons in FOptions.FPaintOptions then + VAlign := MulDiv((Integer(NodeHeight[Node]) - FPlusBM.Height), Node^.Align, 100) + FPlusBM.Height div 2 + else + VAlign := MulDiv(Node^.NodeHeight, Node^.Align, 100); + end; + + VButtonAlign := VAlign - FPlusBM.Height div 2; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.ChangeCheckState(Node: PVirtualNode; Value: TCheckState): Boolean; + +// Sets the check state of the node according to the given value and the node's check type. +// If the check state must be propagated to the parent nodes and one of them refuses to change then +// nothing happens and False is returned, otherwise True. + +var + Run: PVirtualNode; + UncheckedCount, + MixedCheckCount, + CheckedCount: Cardinal; + +begin + Result := not (vsChecking in Node^.States); + with Node^ do + if Result then + begin + Include(States, vsChecking); + if not (vsInitialized in States) then + InitNode(Node); + + // Indicate that we are going to propagate check states up and down the hierarchy. + DoStateChange([tsCheckPropagation]); + // Do actions which are associated with the given check state. + case CheckType of + // Check state change with additional consequences for check states of the children. + ctTriStateCheckBox: + begin + // Propagate state down to the children. + if toAutoTristateTracking in FOptions.FAutoOptions then + case Value of + csUncheckedNormal: + if Node^.ChildCount > 0 then + begin + Run := FirstChild; + CheckedCount := 0; + MixedCheckCount := 0; + UncheckedCount := 0; + while Assigned(Run) do + begin + if Run^.CheckType in [ctCheckBox, ctTriStateCheckBox] then + begin + SetCheckState(Run, csUncheckedNormal); + // Check if the new child state was set successfully, otherwise we have to adjust the + // node's new check state accordingly. + case Run^.CheckState of + csCheckedNormal: + Inc(CheckedCount); + csMixedNormal: + Inc(MixedCheckCount); + csUncheckedNormal: + Inc(UncheckedCount); + end; + end; + Run := Run^.NextSibling; + end; + + // If there is still a mixed state child node checkbox then this node must be mixed checked too. + if MixedCheckCount > 0 then + Value := csMixedNormal + else + // If nodes are normally checked child nodes then the unchecked count determines what + // to set for the node itself. + if CheckedCount > 0 then + if UncheckedCount > 0 then + Value := csMixedNormal + else + Value := csCheckedNormal; + end; + csCheckedNormal: + if Node^.ChildCount > 0 then + begin + Run := FirstChild; + CheckedCount := 0; + MixedCheckCount := 0; + UncheckedCount := 0; + while Assigned(Run) do + begin + if Run^.CheckType in [ctCheckBox, ctTriStateCheckBox] then + begin + SetCheckState(Run, csCheckedNormal); + // Check if the new child state was set successfully, otherwise we have to adjust the + // node's new check state accordingly. + case Run^.CheckState of + csCheckedNormal: + Inc(CheckedCount); + csMixedNormal: + Inc(MixedCheckCount); + csUncheckedNormal: + Inc(UncheckedCount); + end; + end; + Run := Run^.NextSibling; + end; + + // If there is still a mixed state child node checkbox then this node must be mixed checked too. + if MixedCheckCount > 0 then + Value := csMixedNormal + else + // If nodes are normally checked child nodes then the unchecked count determines what + // to set for the node itself. + if CheckedCount > 0 then + if UncheckedCount > 0 then + Value := csMixedNormal + else + Value := csCheckedNormal; + end; + end; + end; + // radio button check state change + ctRadioButton: + if Value = csCheckedNormal then + begin + Value := csCheckedNormal; + // Make sure only this node is checked. + Run := Parent^.FirstChild; + while Assigned(Run) do + begin + if Run^.CheckType = ctRadioButton then + Run^.CheckState := csUncheckedNormal; + Run := Run^.NextSibling; + end; + Invalidate; + end; + end; + + if Result then + CheckState := Value // Set new check state + else + CheckState := UnpressedState[CheckState]; // Reset dynamic check state. + + // Propagate state up to the parent. + if not (vsInitialized in Parent^.States) then + InitNode(Parent); + if (toAutoTristateTracking in FOptions.FAutoOptions) and ([vsChecking, vsDisabled] * Parent^.States = []) and + (CheckType in [ctCheckBox, ctTriStateCheckBox]) and (Parent <> FRoot) and + (Parent^.CheckType = ctTriStateCheckBox) then + Result := CheckParentCheckState(Node, Value) + else + Result := True; + + InvalidateNode(Node); + Exclude(States, vsChecking); + + DoStateChange([], [tsCheckPropagation]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CollectSelectedNodesLTR(MainColumn, NodeLeft, NodeRight: Integer; Alignment: TAlignment; + OldRect, NewRect: TRect): Boolean; + +// Helper routine used when a draw selection takes place. This version handles left-to-right directionality. +// In the process of adding or removing nodes the current selection is modified which requires to pack it after +// the function returns. Another side effect of this method is that a temporary list of nodes will be created +// (see also InternalCacheNode) which must be inserted into the current selection by the caller. + +var + Run, + NextNode: PVirtualNode; + TextRight, + TextLeft, + CheckOffset, + CurrentTop, + CurrentRight, + NextTop, + NextColumn, + NodeWidth, + Dummy: Integer; + MinY, MaxY: Integer; + ImageOffset, + StateImageOffset: Integer; + IsInOldRect, + IsInNewRect: Boolean; + + // quick check variables for various parameters + WithCheck, + WithImages, + WithStateImages, + DoSwitch, + AutoSpan, + Ghosted: Boolean; + SimpleSelection: Boolean; + +begin exit; + // A priori nothing changes. + Result := False; + + // If the old rectangle is empty then we just started the drag selection. + // So we just copy the new rectangle to the old and get out of here. + if IsRectEmpty(OldRect) then + OldRect := NewRect + else + begin + // Determine minimum and maximum vertical coordinates to limit iteration to. + MinY := Min(OldRect.Top, NewRect.Top); + MaxY := Max(OldRect.Bottom, NewRect.Bottom); + + // Initialize short hand variables to speed up tests below. + DoSwitch := ssCtrl in FDrawSelShiftState; + WithCheck := (toCheckSupport in FOptions.FMiscOptions) and Assigned(FCheckImages); + // Don't check the events here as descendant trees might have overriden the DoGetImageIndex method. + WithImages := Assigned(FImages); + if WithImages then + ImageOffset := FImages.Width + 2 + else + ImageOffset := 0; + WithStateImages := Assigned(FStateImages); + if WithStateImages then + StateImageOffset := FStateImages.Width + 2 + else + StateImageOffset := 0; + if WithCheck then + CheckOffset := FCheckImages.Width + 2 + else + CheckOffset := 0; + AutoSpan := FHeader.UseColumns and (toAutoSpanColumns in FOptions.FAutoOptions); + SimpleSelection := toSimpleDrawSelection in FOptions.FSelectionOptions; + + // This is the node to start with. + Run := GetNodeAt(0, MinY, False, CurrentTop); + + if Assigned(Run) then + begin + // The initial minimal left border is determined by the identation level of the node and is dynamically adjusted. + if toShowRoot in FOptions.FPaintOptions then + Inc(NodeLeft, Integer((GetNodeLevel(Run) + 1) * FIndent) + FMargin) + else + Inc(NodeLeft, Integer(GetNodeLevel(Run) * FIndent) + FMargin); + + // ----- main loop + // Change selection depending on the node's rectangle being in the selection rectangle or not, but + // touch only those nodes which overlap either the old selection rectangle or the new one but not both. + repeat + // Collect offsets for check, normal and state images. + TextLeft := NodeLeft; + if WithCheck and (Run^.CheckType <> ctNone) then + Inc(TextLeft, CheckOffset); + if WithImages and (GetImageIndex(Run, ikNormal, MainColumn, Ghosted) > -1) then + Inc(TextLeft, ImageOffset); + if WithStateImages and (GetImageIndex(Run, ikState, MainColumn, Ghosted) > -1) then + Inc(TextLeft, StateImageOffset); + + // Ensure the node's height is determined. + MeasureItemHeight(Canvas, Run); + + NextTop := CurrentTop + Integer(NodeHeight[Run]); + + // Simple selection allows to draw the selection rectangle anywhere. No intersection with node captions is + // required. Only top and bottom bounds of the rectangle matter. + if SimpleSelection then + begin + IsInOldRect := (NextTop > OldRect.Top) and (CurrentTop < OldRect.Bottom); + IsInNewRect := (NextTop > NewRect.Top) and (CurrentTop < NewRect.Bottom); + end + else + begin + // The right column border might be extended if column spanning is enabled. + if AutoSpan then + begin + with FHeader.FColumns do + begin + NextColumn := MainColumn; + repeat + Dummy := GetNextVisibleColumn(NextColumn); + if (Dummy = InvalidColumn) or not ColumnIsEmpty(Run, Dummy) {bor + (Items[Dummy].BidiMode <> bdLeftToRight)} then + Break; + NextColumn := Dummy; + until False; + if NextColumn = MainColumn then + CurrentRight := NodeRight + else + GetColumnBounds(NextColumn, Dummy, CurrentRight); + end; + end + else + CurrentRight := NodeRight; + + // Check if we need the node's width. This is the case when the node is not left aligned or the + // left border of the selection rectangle is to the right of the left node border. + if (TextLeft < OldRect.Left) or (TextLeft < NewRect.Left) or (Alignment <> taLeftJustify) then + begin + NodeWidth := DoGetNodeWidth(Run, MainColumn); + if NodeWidth >= (CurrentRight - TextLeft) then + TextRight := CurrentRight + else + case Alignment of + taLeftJustify: + TextRight := TextLeft + NodeWidth; + taCenter: + begin + TextLeft := (TextLeft + CurrentRight - NodeWidth) div 2; + TextRight := TextLeft + NodeWidth; + end; + else + // taRightJustify + TextRight := CurrentRight; + TextLeft := TextRight - NodeWidth; + end; + end + else + TextRight := CurrentRight; + + // Now determine whether we need to change the state. + IsInOldRect := (OldRect.Left <= TextRight) and (OldRect.Right >= TextLeft) and + (NextTop > OldRect.Top) and (CurrentTop < OldRect.Bottom); + IsInNewRect := (NewRect.Left <= TextRight) and (NewRect.Right >= TextLeft) and + (NextTop > NewRect.Top) and (CurrentTop < NewRect.Bottom); + end; + + if IsInOldRect xor IsInNewRect then + begin + Result := True; + if DoSwitch then + begin + if vsSelected in Run^.States then + InternalRemoveFromSelection(Run) + else + InternalCacheNode(Run); + end + else + begin + if IsInNewRect then + InternalCacheNode(Run) + else + InternalRemoveFromSelection(Run); + end; + end; + + CurrentTop := NextTop; + // Get next visible node and update left node position. + NextNode := GetNextVisibleNoInit(Run); + if NextNode = nil then + Break; + Inc(NodeLeft, CountLevelDifference(Run, NextNode) * Integer(FIndent)); + Run := NextNode; + until CurrentTop > MaxY; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CollectSelectedNodesRTL(MainColumn, NodeLeft, NodeRight: Integer; Alignment: TAlignment; + OldRect, NewRect: TRect): Boolean; + +// Helper routine used when a draw selection takes place. This version handles right-to-left directionality. +// See also comments in CollectSelectedNodesLTR. + +var + Run, + NextNode: PVirtualNode; + TextRight, + TextLeft, + CheckOffset, + CurrentTop, + CurrentLeft, + NextTop, + NextColumn, + NodeWidth, + Dummy: Integer; + MinY, MaxY: Integer; + ImageOffset, + StateImageOffset: Integer; + IsInOldRect, + IsInNewRect: Boolean; + + // quick check variables for various parameters + WithCheck, + WithImages, + WithStateImages, + DoSwitch, + AutoSpan, + Ghosted: Boolean; + SimpleSelection: Boolean; + +begin exit; + // A priori nothing changes. + Result := False; + // Switch the alignment to the opposite value in RTL context. +//b ChangeBiDiModeAlignment(Alignment); + + // Determine minimum and maximum vertical coordinates to limit iteration to. + MinY := Min(OldRect.Top, NewRect.Top); + MaxY := Max(OldRect.Bottom, NewRect.Bottom); + + // Initialize short hand variables to speed up tests below. + DoSwitch := ssCtrl in FDrawSelShiftState; + WithCheck := (toCheckSupport in FOptions.FMiscOptions) and Assigned(FCheckImages); + // Don't check the events here as descendant trees might have overriden the DoGetImageIndex method. + WithImages := Assigned(FImages); + if WithImages then + ImageOffset := FImages.Width + 2 + else + ImageOffset := 0; + WithStateImages := Assigned(FStateImages); + if WithStateImages then + StateImageOffset := FStateImages.Width + 2 + else + StateImageOffset := 0; + if WithCheck then + CheckOffset := FCheckImages.Width + 2 + else + CheckOffset := 0; + AutoSpan := FHeader.UseColumns and (toAutoSpanColumns in FOptions.FAutoOptions); + SimpleSelection := toSimpleDrawSelection in FOptions.FSelectionOptions; + + // This is the node to start with. + Run := GetNodeAt(0, MinY, False, CurrentTop); + + if Assigned(Run) then + begin + // The initial minimal left border is determined by the identation level of the node and is dynamically adjusted. + if toShowRoot in FOptions.FPaintOptions then + Dec(NodeRight, Integer((GetNodeLevel(Run) + 1) * FIndent) + FMargin) + else + Dec(NodeRight, Integer(GetNodeLevel(Run) * FIndent) + FMargin); + + // ----- main loop + // Change selection depending on the node's rectangle being in the selection rectangle or not, but + // touch only those nodes which overlap either the old selection rectangle or the new one but not both. + repeat + // Collect offsets for check, normal and state images. + TextRight := NodeRight; + if WithCheck and (Run^.CheckType <> ctNone) then + Dec(TextRight, CheckOffset); + if WithImages and (GetImageIndex(Run, ikNormal, MainColumn, Ghosted) > -1) then + Dec(TextRight, ImageOffset); + if WithStateImages and (GetImageIndex(Run, ikState, MainColumn, Ghosted) > -1) then + Dec(TextRight, StateImageOffset); + + // Ensure the node's height is determined. + MeasureItemHeight(Canvas, Run); + + NextTop := CurrentTop + Integer(NodeHeight[Run]); + + // Simple selection allows to draw the selection rectangle anywhere. No intersection with node captions is + // required. Only top and bottom bounds of the rectangle matter. + if SimpleSelection then + begin + IsInOldRect := (NextTop > OldRect.Top) and (CurrentTop < OldRect.Bottom); + IsInNewRect := (NextTop > NewRect.Top) and (CurrentTop < NewRect.Bottom); + end + else + begin + // The left column border might be extended if column spanning is enabled. + if AutoSpan then + begin + NextColumn := MainColumn; + repeat + Dummy := FHeader.FColumns.GetPreviousVisibleColumn(NextColumn); + if (Dummy = InvalidColumn) or not ColumnIsEmpty(Run, Dummy) {bor + (FHeader.FColumns[Dummy].BiDiMode = bdLeftToRight)} then + Break; + NextColumn := Dummy; + until False; + if NextColumn = MainColumn then + CurrentLeft := NodeLeft + else + FHeader.FColumns.GetColumnBounds(NextColumn, CurrentLeft, Dummy); + end + else + CurrentLeft := NodeLeft; + + // Check if we need the node's width. This is the case when the node is not left aligned (in RTL context this + // means actually right aligned) or the right border of the selection rectangle is to the left + // of the right node border. + if (TextRight > OldRect.Right) or (TextRight > NewRect.Right) or (Alignment <> taRightJustify) then + begin + NodeWidth := DoGetNodeWidth(Run, MainColumn); + if NodeWidth >= (TextRight - CurrentLeft) then + TextLeft := CurrentLeft + else + case Alignment of + taLeftJustify: + begin + TextLeft := CurrentLeft; + TextRight := TextLeft + NodeWidth; + end; + taCenter: + begin + TextLeft := (TextRight + CurrentLeft - NodeWidth) div 2; + TextRight := TextLeft + NodeWidth; + end; + else + // taRightJustify + TextLeft := TextRight - NodeWidth; + end; + end + else + TextLeft := CurrentLeft; + + // Now determine whether we need to change the state. + IsInOldRect := (OldRect.Right >= TextLeft) and (OldRect.Left <= TextRight) and + (NextTop > OldRect.Top) and (CurrentTop < OldRect.Bottom); + IsInNewRect := (NewRect.Right >= TextLeft) and (NewRect.Left <= TextRight) and + (NextTop > NewRect.Top) and (CurrentTop < NewRect.Bottom); + end; + + if IsInOldRect xor IsInNewRect then + begin + Result := True; + if DoSwitch then + begin + if vsSelected in Run^.States then + InternalRemoveFromSelection(Run) + else + InternalCacheNode(Run); + end + else + begin + if IsInNewRect then + InternalCacheNode(Run) + else + InternalRemoveFromSelection(Run); + end; + end; + + CurrentTop := NextTop; + // Get next visible node and update left node position. + NextNode := GetNextVisibleNoInit(Run); + if NextNode = nil then + Break; + Dec(NodeRight, CountLevelDifference(Run, NextNode) * Integer(FIndent)); + Run := NextNode; + until CurrentTop > MaxY; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ClearNodeBackground(const PaintInfo: TVTPaintInfo; UseBackground, xFloating: Boolean; + R: TRect); + +// Erases a node's background depending on what the application decides to do. +// UseBackground determines whether or not to use the background picture, while Floating indicates +// that R is given in coordinates of the small node bitmap or the superordinated target bitmap used in PaintTree. + +var + BackColor: TColor; + EraseAction: TItemEraseAction; + Offset: TPoint; + +begin + with PaintInfo do + begin + EraseAction := eaDefault; + BackColor := Color; + if xFloating then + begin + Offset := Point(-FEffectiveOffsetX, R.Top); + OffsetRect(R, 0, -Offset.Y); + end + else + Offset := Point(0, 0); + + DoBeforeItemErase(Canvas, Node, R, Backcolor, EraseAction); + + with Canvas do + begin + case EraseAction of + eaNone: + ; + eaColor: + begin + // User has given a new background color. + Brush.Color := BackColor; + FillRect(R); + end; + else // eaDefault + if UseBackground then + begin + TileBackground(FBackground.Bitmap, Canvas, Offset, R); + end + else + begin + if (poDrawSelection in PaintOptions) and (toFullRowSelect in FOptions.FSelectionOptions) and + (vsSelected in Node^.States) and not (toUseBlendedSelection in FOptions.PaintOptions) then + begin + if toShowHorzGridLines in FOptions.PaintOptions then + Dec(R.Bottom); + if Focused or (toPopupMode in FOptions.FPaintOptions) then + begin + Brush.Color := FColors.FocusedSelectionColor; + Pen.Color := FColors.FocusedSelectionBorderColor; + end + else + begin + Brush.Color := FColors.UnfocusedSelectionColor; + Pen.Color := FColors.UnfocusedSelectionBorderColor; + end; + + with R do + RoundRect(Left, Top, Right, Bottom, FSelectionCurveRadius, FSelectionCurveRadius); + end + else + begin + Brush.Color := Self.Color; + FillRect(R); + end; + end; + end; + DoAfterItemErase(Canvas, Node, R); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CompareNodePositions(Node1, Node2: PVirtualNode): Integer; + +// Tries hard and smart to quickly determine whether Node1's structural position is before Node2's position +// Returns 0 if Node1 = Node2, < 0 if Node1 is located before Node2 else > 0. + +var + Run1, + Run2: PVirtualNode; + Level1, + Level2: Cardinal; + +begin + Assert(Assigned(Node1) and Assigned(Node2), 'Nodes must never be nil.'); + + if Node1 = Node2 then + Result := 0 + else + begin + if HasAsParent(Node1, Node2) then + Result := 1 + else + if HasAsParent(Node2, Node1) then + Result := -1 + else + begin + // the given nodes are neither equal nor are they parents of each other, so go up to FRoot + // for each node and compare the child indices of the top level parents + // Note: neither Node1 nor Node2 can be FRoot at this point as this (a bit strange) circumstance would + // be caught by the previous code. + + // start lookup at the same level + Level1 := GetNodeLevel(Node1); + Level2 := GetNodeLevel(Node2); + Run1 := Node1; + while Level1 > Level2 do + begin + Run1 := Run1^.Parent; + Dec(Level1); + end; + Run2 := Node2; + while Level2 > Level1 do + begin + Run2 := Run2^.Parent; + Dec(Level2); + end; + + // now go up until we find a common parent node (loop will safely stop at FRoot if the nodes + // don't share a common parent) + while Run1^.Parent <> Run2^.Parent do + begin + Run1 := Run1^.Parent; + Run2 := Run2^.Parent; + end; + Result := Integer(Run1^.Index) - Integer(Run2^.Index); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DrawLineImage(const PaintInfo: TVTPaintInfo; X, Y, H, VAlign: Integer; Style: TVTLineType; + Reverse: Boolean); + +// Draws (depending on Style) one of the 5 line types of the tree. +// If Reverse is True then a right-to-left column is being drawn, hence horizontal lines must be mirrored. +// X and Y describe the left upper corner of the line image rectangle, while H denotes its height (and width). + +var + HalfWidth, + TargetX: Integer; + +begin + HalfWidth := Integer(FIndent) div 2; + if Reverse then + TargetX := 0 + else + TargetX := FIndent; + + with PaintInfo.Canvas do + begin + case Style of + ltBottomRight: + begin + DrawDottedVLine(PaintInfo, Y + VAlign, Y + H, X + HalfWidth); + DrawDottedHLine(PaintInfo, X + HalfWidth, X + TargetX, Y + VAlign); + end; + ltTopDown: + DrawDottedVLine(PaintInfo, Y, Y + H, X + HalfWidth); + ltTopDownRight: + begin + DrawDottedVLine(PaintInfo, Y, Y + H, X + HalfWidth); + DrawDottedHLine(PaintInfo, X + HalfWidth, X + TargetX, Y + VAlign); + end; + ltRight: + DrawDottedHLine(PaintInfo, X + HalfWidth, X + TargetX, Y + VAlign); + ltTopRight: + begin + DrawDottedVLine(PaintInfo, Y, Y + VAlign, X + HalfWidth); + DrawDottedHLine(PaintInfo, X + HalfWidth, X + TargetX, Y + VAlign); + end; + ltLeft: // left can also mean right for RTL context + if Reverse then + DrawDottedVLine(PaintInfo, Y, Y + H, X + Integer(FIndent)) + else + DrawDottedVLine(PaintInfo, Y, Y + H, X); + ltLeftBottom: + if Reverse then + begin + DrawDottedVLine(PaintInfo, Y, Y + H, X + Integer(FIndent)); + DrawDottedHLine(PaintInfo, X, X + Integer(FIndent), Y + H); + end + else + begin + DrawDottedVLine(PaintInfo, Y, Y + H, X); + DrawDottedHLine(PaintInfo, X, X + Integer(FIndent), Y + H); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.FindInPositionCache(Node: PVirtualNode; var CurrentPos: Cardinal): PVirtualNode; + +// Looks through the position cache and returns the node whose top position is the largest one which is smaller or equal +// to the position of the given node. + +var + L, H, I: Integer; + +begin + L := 0; + H := High(FPositionCache); + while L <= H do + begin + I := (L + H) shr 1; + if CompareNodePositions(FPositionCache[I].Node, Node) <= 0 then + L := I + 1 + else + H := I - 1; + end; + Result := FPositionCache[L - 1].Node; + CurrentPos := FPositionCache[L - 1].AbsoluteTop; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.FindInPositionCache(Position: Cardinal; var CurrentPos: Cardinal): PVirtualNode; + +// Looks through the position cache and returns the node whose top position is the largest one which is smaller or equal +// to the given vertical position. +// The returned node does not necessarily occupy the given position but is the nearest one to start +// iterating from to approach the real node for a given position. CurrentPos receives the actual position of the found +// node which is needed for further iteration. + +var + L, H, I: Integer; + +begin + L := 0; + H := High(FPositionCache); + while L <= H do + begin + I := (L + H) shr 1; + if FPositionCache[I].AbsoluteTop <= Position then + L := I + 1 + else + H := I - 1; + end; + Result := FPositionCache[L - 1].Node; + CurrentPos := FPositionCache[L - 1].AbsoluteTop; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetCheckState(Node: PVirtualNode): TCheckState; + +begin + Result := Node^.CheckState; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetCheckType(Node: PVirtualNode): TCheckType; + +begin + Result := Node^.CheckType; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetChildCount(Node: PVirtualNode): Cardinal; + +begin + if (Node = nil) or (Node = FRoot) then + Result := FRoot^.ChildCount + else + Result := Node^.ChildCount; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetChildrenInitialized(Node: PVirtualNode): Boolean; + +begin + Result := not (vsHasChildren in Node^.States) or (Node^.ChildCount > 0); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetDisabled(Node: PVirtualNode): Boolean; + +begin + Result := Assigned(Node) and (vsDisabled in Node^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{xfunction TBaseVirtualTree.GetDragManager: IVTDragManager; + +// Returns the internal drag manager interface. If this does not yet exist then it is created here. + +begin + if FDragManager = nil then + begin + FDragManager := DoCreateDragManager; + if FDragManager = nil then + FDragManager := TVTDragManager.Create(Self); + end; + + Result := FDragManager; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetExpanded(Node: PVirtualNode): Boolean; + +begin + if Assigned(Node) then + Result := vsExpanded in Node^.States + else + Result := False; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFullyVisible(Node: PVirtualNode): Boolean; + +// Determines whether the given node has the visibility flag set as well as all its parents are expanded. + +begin + Assert(Assigned(Node), 'Invalid parameter.'); + Result := vsVisible in Node^.States; + if Result and (Node <> FRoot) then + Result := VisiblePath[Node]; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetHasChildren(Node: PVirtualNode): Boolean; + +begin + if Assigned(Node) then + Result := vsHasChildren in Node^.States + else + Result := vsHasChildren in FRoot^.States; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetMultiline(Node: PVirtualNode): Boolean; + +begin + Result := Assigned(Node) and (Node <> FRoot) and (vsMultiline in Node^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNodeHeight(Node: PVirtualNode): Cardinal; + +begin + if Assigned(Node) and (Node <> FRoot) then + begin + if toVariableNodeHeight in FOptions.FMiscOptions then + // Ensure the node's height is determined. + MeasureItemHeight(Canvas, Node); + Result := Node^.NodeHeight + end + else + Result := 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNodeParent(Node: PVirtualNode): PVirtualNode; + +begin + if Assigned(Node) and (Node^.Parent <> FRoot) then + Result := Node^.Parent + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetOffsetXY: TPoint; + +begin + Result := Point(FOffsetX, FOffsetY); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetRootNodeCount: Cardinal; + +begin + Result := FRoot^.ChildCount; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetSelected(Node: PVirtualNode): Boolean; + +begin + Result := Assigned(Node) and (vsSelected in Node^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetTopNode: PVirtualNode; + +var + Dummy: Integer; + +begin + Result := GetNodeAt(0, 0, True, Dummy); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetTotalCount: Cardinal; + +begin + Inc(FUpdateCount); + try + ValidateNode(FRoot, True); + finally + Dec(FUpdateCount); + end; + // The root node itself doesn't count as node. + Result := FRoot^.TotalCount - 1; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetVerticalAlignment(Node: PVirtualNode): Byte; + +begin + Result := Node^.Align; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetVisible(Node: PVirtualNode): Boolean; + +// Determines if the given node is marked as being visible. + +begin + if Node = nil then + Node := FRoot; + + if not (vsInitialized in Node^.States) then + InitNode(Node); + + Result := vsVisible in Node^.States; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetVisiblePath(Node: PVirtualNode): Boolean; + +// Determines if all parents of the given node are expanded and have the visibility flag set. + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameters.'); + + // FRoot is always expanded + repeat + Node := Node^.Parent; + until (Node = FRoot) or not (vsExpanded in Node^.States) or not (vsVisible in Node^.States); + + Result := Node = FRoot; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.HandleClickSelection(LastFocused, NewNode: PVirtualNode; Shift: TShiftState; + DragPending: Boolean); + +// Handles multi-selection with mouse click. + +begin + // Ctrl key down + if ssCtrl in Shift then + begin + if ssShift in Shift then + begin + SelectNodes(FRangeAnchor, NewNode, True); + Invalidate; + end + else + begin + if not (toSiblingSelectConstraint in FOptions.SelectionOptions) then + FRangeAnchor := NewNode; + // Delay selection change if a drag operation is pending. + // Otherwise switch selection state here. + if DragPending then + DoStateChange([tsToggleFocusedSelection]) + else + if vsSelected in NewNode^.States then + RemoveFromSelection(NewNode) + else + AddToSelection(NewNode); + end; + end + else + // Shift key down + if ssShift in Shift then + begin + if FRangeAnchor = nil then + FRangeAnchor := FRoot^.FirstChild; + + // select node range + if Assigned(FRangeAnchor) then + begin + SelectNodes(FRangeAnchor, NewNode, False); + Invalidate; + end; + end + else + begin + // any other case + if not (vsSelected in NewNode^.States) then + begin + AddToSelection(NewNode); + InvalidateNode(NewNode); + end; + // assign new reference item + FRangeAnchor := NewNode; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.HandleDrawSelection(X, Y: Integer): Boolean; + +// Handles multi-selection with a focus rectangle. +// Result is True if something changed in selection. + +var + OldRect, + NewRect: TRect; + MainColumn: TColumnIndex; + MaxValue: Integer; + + // limits of a node and its text + NodeLeft, + NodeRight: Integer; + + // alignment and directionality + CurrentBidiMode: TBidiMode; + CurrentAlignment: TAlignment; + +begin + Result := False; + + // Selection changes are only done if the user drew a selection rectangle large + // enough to exceed the threshold. + if (FRoot^.TotalCount > 1) and (tsDrawSelecting in FStates) then + begin + // Effective handling of node selection is done by using two rectangles stored in FSelectRec. + OldRect := OrderRect(FLastSelRect); + NewRect := OrderRect(FNewSelRect); + ClearTempCache; + + MainColumn := FHeader.MainColumn; + + // Alignment and bidi mode determine where the node text is located within a node. + if MainColumn = NoColumn then + begin +//b CurrentBidiMode := BidiMode; + CurrentAlignment := Alignment; + end + else + begin +//b CurrentBidiMode := FHeader.FColumns[MainColumn].BidiMode; + CurrentAlignment := FHeader.FColumns[MainColumn].Alignment; + end; + + // Determine initial left border of first node (take column reordering into account). + if FHeader.UseColumns then + begin + // The mouse coordinates don't include any horizontal scrolling hence take this also + // out from the returned column position. + NodeLeft := FHeader.FColumns[MainColumn].Left - FEffectiveOffsetX; + NodeRight := NodeLeft + FHeader.FColumns[MainColumn].Width; + end + else + begin + NodeLeft := 0; + NodeRight := ClientWidth; + end; +//b if CurrentBidiMode = bdLeftToRight then + Result := CollectSelectedNodesLTR(MainColumn, NodeLeft, NodeRight, CurrentAlignment, OldRect, NewRect) +//b else +//b Result := CollectSelectedNodesRTL(MainColumn, NodeLeft, NodeRight, CurrentAlignment, OldRect, NewRect); + end; + + if Result then + begin + // Do some housekeeping if there was a change. + MaxValue := PackArray(FSelection, FSelectionCount); + if MaxValue > -1 then + begin + FSelectionCount := MaxValue; + SetLength(FSelection, FSelectionCount); + end; + if FTempNodeCount > 0 then + begin + AddToSelection(FTempNodeCache, FTempNodeCount); + ClearTempCache; + end; + + Change(nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.HasVisibleNextSibling(Node: PVirtualNode): Boolean; + +// Helper method to determine if the given node has a visible sibling. This is needed to +// draw correct tree lines. + +begin + // Check if there is a sibling at all. + Result := Assigned(Node^.NextSibling); + + if Result then + begin + repeat + Node := Node^.NextSibling; + Result := vsVisible in Node^.States; + until Result or (Node^.NextSibling = nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ImageListChange(Sender: TObject); + +begin + if not (csDestroying in ComponentState) then + Invalidate; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InitializeFirstColumnValues(var PaintInfo: TVTPaintInfo); + +// Determines initial index, position and cell size of the first visible column. + +begin + PaintInfo.Column := FHeader.FColumns.GetFirstVisibleColumn; + with FHeader.FColumns, PaintInfo do + begin + if Column > NoColumn then + begin + CellRect.Right := CellRect.Left + Items[Column].Width; + Position := Items[Column].Position; + end + else + Position := 0; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.InitializeLineImageAndSelectLevel(Node: PVirtualNode; var LineImage: TLineImage): Integer; + +// This method is used during paint cycles and initializes an array of line type IDs. These IDs are used to paint +// the tree lines in front of the given node. +// Additionally an initial count of selected parents is determined and returned which is used for specific painting. + +var + X: Integer; + Run: PVirtualNode; + +begin + Result := 0; + if toShowRoot in FOptions.FPaintOptions then + X := 1 + else + X := 0; + Run := Node; + // Determine indentation level of top node. + while Run^.Parent <> FRoot do + begin + Inc(X); + Run := Run^.Parent; + // Count selected nodes (FRoot is never selected). + if vsSelected in Run^.States then + Inc(Result); + end; + + // Set initial size of line index array, this will automatically initialized all entries to ltNone. + SetLength(LineImage, X); + + // Only use lines if requested. + if toShowTreeLines in FOptions.FPaintOptions then + begin + // Start over parent traversal if necessary. + Run := Node; + if Run^.Parent <> FRoot then + begin + // The very last image (the one immediately before the item label) is different. + if HasVisibleNextSibling(Run) then + LineImage[X - 1] := ltTopDownRight + else + LineImage[X - 1] := ltTopRight; + Run := Run^.Parent; + + // Now go up all parents. + repeat + if Run^.Parent = FRoot then + Break; + Dec(X); + if HasVisibleNextSibling(Run) then + LineImage[X - 1] := ltTopDown + else + LineImage[X - 1] := ltNone; + Run := Run^.Parent; + until False; + end; + + // Prepare root level. Run points at this stage to a top level node. + if (toShowRoot in FOptions.FPaintOptions) and (toShowTreeLines in FOptions.FPaintOptions) then + begin + // Is the top node a root node? + if Run = Node then + begin + // First child gets the bottom-right bitmap if it isn't also the only child. + if IsFirstVisibleChild(FRoot, Run) then + // Is it the only child? + if IsLastVisibleChild(FRoot, Run) then + LineImage[0] := ltRight + else + LineImage[0] := ltBottomRight + else + // real last child + if IsLastVisibleChild(FRoot, Run) then + LineImage[0] := ltTopRight + else + LineImage[0] := ltTopDownRight; + end + else + begin + // No, top node is not a top level node. So we need different painting. + if HasVisibleNextSibling(Run) then + LineImage[0] := ltTopDown + else + LineImage[0] := ltNone; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InitRootNode(OldSize: Cardinal = 0); + +// Reinitializes the root node. + +var + NewSize: Cardinal; + +begin + NewSize := TreeNodeSize + FTotalInternalDataSize; + if FRoot = nil then + FRoot := AllocMem(NewSize) + else + begin + ReallocMem(FRoot, NewSize); + ZeroMemory(PChar(FRoot) + OldSize, NewSize - OldSize); + end; + + with FRoot^ do + begin + // Indication that this node is the root node. + PrevSibling := FRoot; + NextSibling := FRoot; + Parent := Pointer(Self); + States := [vsInitialized, vsExpanded, vsHasChildren, vsVisible]; + TotalHeight := FDefaultNodeHeight; + TotalCount := 1; + TotalHeight := FDefaultNodeHeight; + NodeHeight := FDefaultNodeHeight; + Align := 50; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InterruptValidation; + +// Waits until the worker thread has stopped validating the caches of this tree. + +var + Msg: TMsg; + +begin + DoStateChange([tsStopValidation], [tsUseCache]); + if tsValidating in FStates then + begin + // Do a hard break until the worker thread has stopped validation. + while (tsValidating in FStates) and (WorkerThread.CurrentTree = Self) and not Application.Terminated do + begin + // Pump our own messages to avoid a deadlock. +//? if PeekMessage(Msg, Handle, 0, 0, PM_REMOVE) then +//? begin +//? if Msg.message = LM_QUIT then +//? Break; +//todo TranslateMessage(Msg); +//todo DispatchMessage(Msg); +//? end; + end; + DoStateChange([tsValidationNeeded]); + end + else // Remove any pending validation. + WorkerThread.RemoveTree(Self); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.IsFirstVisibleChild(xParent, Node: PVirtualNode): Boolean; + +// Helper method to check if Node is the same as the first visible child of Parent. + +var + Run: PVirtualNode; + +begin + // Find first visible child. + Run := xParent^.FirstChild; + while Assigned(Run) and not (vsVisible in Run^.States) do + Run := Run^.NextSibling; + + Result := Assigned(Run) and (Run = Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.IsLastVisibleChild(xParent, Node: PVirtualNode): Boolean; + +// Helper method to check if Node is the same as the last visible child of Parent. + +var + Run: PVirtualNode; + +begin + // Find last visible child. + Run := xParent^.LastChild; + while Assigned(Run) and not (vsVisible in Run^.States) do + Run := Run^.PrevSibling; + + Result := Assigned(Run) and (Run = Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.LimitPaintingToArea(xCanvas: TCanvas; ClipRect: TRect; VisibleRegion: HRGN = 0); + +// Limits further painting onto the given canvas to the given rectangle. +// VisibleRegion is an optional region which can be used to limit drawing further. + +var + ClipRegion: HRGN; + +begin + // Regions expect their coordinates in device coordinates, hence we have to transform the region rectangle. +//todo LPtoDP(xCanvas.Handle, ClipRect, 2); + ClipRegion := CreateRectRgnIndirect(ClipRect); + if VisibleRegion <> 0 then + CombineRgn(ClipRegion, ClipRegion, VisibleRegion, RGN_AND); + SelectClipRgn(xCanvas.Handle, ClipRegion); + DeleteObject(ClipRegion); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.MakeNewNode: PVirtualNode; + +var + Size: Cardinal; + +begin + Size := TreeNodeSize; + if not (csDesigning in ComponentState) then + begin + // Make sure FNodeDataSize is valid. + if FNodeDataSize = -1 then + ValidateNodeDataSize(FNodeDataSize); + + // Take record alignment into account. + Inc(Size, FNodeDataSize); + end; + + {$ifdef UseLocalMemoryManager} + Result := FNodeMemoryManager.AllocNode(Size + FTotalInternalDataSize); + {$else} + Result := AllocMem(Size + FTotalInternalDataSize); + {$endif UseLocalMemoryManager} + + // Fill in some default values. + with Result^ do + begin + TotalCount := 1; + TotalHeight := FDefaultNodeHeight; + NodeHeight := FDefaultNodeHeight; + States := [vsVisible]; + Align := 50; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{function TBaseVirtualTree.PackArray(TheArray: TNodeArray; Count: Integer): Integer; assembler; + +// Removes all entries from the selection array which are no longer in use. The selection array must be sorted for this +// algo to work. Values which must be removed are marked with bit 0 (LSB) set. This little trick works because memory +// is always allocated DWORD aligned. Since the selection array must be sorted while determining the entries to be +// removed it is much more efficient to increment the entry in question instead of setting it to nil (which would break +// the ordered appearance of the list). +// +// On enter EAX contains self reference, EDX the address to TheArray and ECX Count +// The returned value is the number of remaining entries in the array, so the caller can reallocate (shorten) +// the selection array if needed or -1 if nothing needs to be changed. + +asm + PUSH EBX + PUSH EDI + PUSH ESI + MOV ESI, EDX + MOV EDX, -1 + JCXZ @@Finish // Empty list? + INC EDX // init remaining entries counter + MOV EDI, ESI // source and destination point to the list memory + MOV EBX, 1 // use a register instead of immediate operant to check against +@@PreScan: + TEST [ESI], EBX // do the fastest scan possible to find the first entry + // which must be removed + JNZ @@DoMainLoop + INC EDX + ADD ESI, 4 + DEC ECX + JNZ @@PreScan + JMP @@Finish + +@@DoMainLoop: + MOV EDI, ESI +@@MainLoop: + TEST [ESI], EBX // odd entry? + JNE @@Skip // yes, so skip this one + MOVSD // else move the entry to new location + INC EDX // count the moved entries + DEC ECX + JNZ @@MainLoop // do it until all entries are processed + JMP @@Finish + +@@Skip: + ADD ESI, 4 // point to the next entry + DEC ECX + JNZ @@MainLoop // do it until all entries are processed +@@Finish: + MOV EAX, EDX // prepare return value + POP ESI + POP EDI + POP EBX +end;} + +function TBaseVirtualTree.PackArray(TheArray: TNodeArray; Count: Integer): Integer; + +// Removes all entries from the selection array which are no longer in use. The selection array must be sorted for this +// algo to work. Values which must be removed are marked with bit 0 (LSB) set. This little trick works because memory +// is always allocated DWORD aligned. Since the selection array must be sorted while determining the entries to be +// removed it is much more efficient to increment the entry in question instead of setting it to nil (which would break +// the ordered appearance of the list). +// +// On enter EAX contains self reference, EDX the address to TheArray and ECX Count +// The returned value is the number of remaining entries in the array, so the caller can reallocate (shorten) +// the selection array if needed or -1 if nothing needs to be changed. + +// sorry, i'm not an assembler guru and the asm won't work + +var + i, l: Integer; + +begin + Result := -1; + + if Count = 0 then + Exit; + + l := 0; + for i := 0 to Count - 1 do begin + if vsSelected in TheArray[i]^.States then begin + TheArray[l] := TheArray[i]; + Inc(l); + end; + end; + + Result := l; // return length +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PrepareBitmaps(NeedButtons, NeedLines: Boolean); + +var + PatternBitmap: TBITMAP; + logbrush: TLogBrush; + {$ifdef ThemeSupport} + Details: TThemedElementDetails; + {$endif ThemeSupport} + x,y : integer; + +begin + if NeedButtons then + begin + with FMinusBM do + begin + // box is always of odd size +// PixelFormat := pfdevice; + Width := 9; + Height := Width; + //Lazarus hasnt Trancparency yet + Transparent := True; + case FButtonFillMode of + fmTreeColor: + Canvas.Brush.Color := Self.Color; + fmWindowColor: + Canvas.Brush.Color := clWindow; + end; + Canvas.FillRect(Rect(0, 0, Width, Height)); + if FButtonStyle = bsTriangle then + begin + Canvas.Brush.Color := clBlack; + Canvas.Pen.Color := clBlack; + Canvas.Polygon([Point(0, 2), Point(8, 2), Point(4, 6)]); + end + else + begin + // Button style is rectangular. Now ButtonFillMode determines how to fill the interior. + if FButtonFillMode in [fmTreeColor, fmWindowColor, fmTransparent] then + begin + case FButtonFillMode of + fmTreeColor: + Canvas.Brush.Color := Self.Color; + fmWindowColor: + Canvas.Brush.Color := clWindow; + end; + Canvas.Pen.Color := FColors.TreeLineColor; + Canvas.Rectangle(0, 0, Width-1, Height-1); + Canvas.Pen.Color := Self.Font.Color; + Canvas.MoveTo(2, Width div 2); + Canvas.LineTo(Width - 2 , Width div 2); + end + else + FMinusBM.Handle := LoadBitmap(HInstance, 'VT_XPBUTTONMINUS'); + end; + end; + + with FPlusBM do + begin +// PixelFormat := pfdevice; + + Width := 9; + Height := Width; + Transparent := True; + case FButtonFillMode of + fmTreeColor: + Canvas.Brush.Color := Self.Color; + fmWindowColor: + Canvas.Brush.Color := clWindow; + end; + Canvas.FillRect(Rect(0, 0, Width, Height)); + if FButtonStyle = bsTriangle then + begin + Canvas.Brush.Color := clBlack; + Canvas.Pen.Color := clBlack; + Canvas.Polygon([Point(2, 0), Point(6, 4), Point(2, 8)]); + end + else + begin + // Button style is rectangular. Now ButtonFillMode determines how to fill the interior. + if FButtonFillMode in [fmTreeColor, fmWindowColor, fmTransparent] then + begin + case FButtonFillMode of + fmTreeColor: + Canvas.Brush.Color := Self.Color; + fmWindowColor: + Canvas.Brush.Color := clWindow; + end; + + Canvas.Pen.Color := FColors.TreeLineColor; + Canvas.Rectangle(0, 0, Width-1, Height-1); + Canvas.Pen.Color := Self.Font.Color; + Canvas.MoveTo(2, Width div 2); + Canvas.LineTo(Width - 2 , Width div 2); + Canvas.MoveTo(Width div 2, 2); + Canvas.LineTo(Width div 2, Width - 2); + end + else + FPlusBM.Handle := LoadBitmap(HInstance, 'VT_XPBUTTONPLUS'); + end; + end; + + {$ifdef ThemeSupport} + // Overwrite glyph images if theme is active. + if tsUseThemes in FStates then + begin + Details := ThemeServices.GetElementDetails(ttGlyphClosed); + ThemeServices.DrawElement(FPlusBM.Canvas.Handle, Details, Rect(0, 0, 9, 9)); + Details := ThemeServices.GetElementDetails(ttGlyphOpened); + ThemeServices.DrawElement(FMinusBM.Canvas.Handle, Details, Rect(0, 0, 9, 9)); + end; + {$endif ThemeSupport} + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- +// todo: dummy +procedure DrawFocusRect(xCanvas: TCanvas; aRect: TRect); + +const + Color = clBlack; + + procedure DrawVertLine(X1,Y1,Y2: integer); + begin + if Y2 MaxWidth then + R.Right := MaxWidth; + AlphaBlend(0, PaintInfo.Canvas.Handle, R, Point(0, 0), bmConstantAlphaAndColor, + FSelectionBlendFactor, ColorToRGB(Color)); + end; + + //---------------------------------------------------------------------------- + +begin + with PaintInfo, Canvas do + begin + InnerRect := ContentRect; + + // Fill cell background if its color differs from tree background. + with FHeader.FColumns do + if poColumnColor in PaintOptions then + begin + Brush.Color := Items[Column].Color; + FillRect(CellRect); + end; + + // Let the application customize the cell background. + DoBeforeCellPaint(Canvas, Node, Column, CellRect); + + if (Column = FFocusedColumn) or (toFullRowSelect in FOptions.FSelectionOptions) then + begin + // The selection rectangle depends on alignment. + if not (toGridExtensions in FOptions.FMiscOptions) then + begin + case Alignment of + taLeftJustify: + with InnerRect do + if Left + NodeWidth < Right then + Right := Left + NodeWidth; + taCenter: + with InnerRect do + if (Right - Left) > NodeWidth then + begin + Left := (Left + Right - NodeWidth) div 2; + Right := Left + NodeWidth; + end; + taRightJustify: + with InnerRect do + if (Right - Left) > NodeWidth then + Left := Right - NodeWidth; + end; + end; + + // Fill the selection rectangle. + if poDrawSelection in PaintOptions then + begin + if vsSelected in Node^.States then + begin + if Focused or (toPopupMode in FOptions.FPaintOptions) then + begin + Brush.Color := FColors.FocusedSelectionColor; + Pen.Color := FColors.FocusedSelectionBorderColor; + end + else + begin + Brush.Color := FColors.UnfocusedSelectionColor; + Pen.Color := FColors.UnfocusedSelectionBorderColor; + end; + + if (toGridExtensions in FOptions.FMiscOptions) or (toFullRowSelect in FOptions.FSelectionOptions) then + InnerRect := CellRect; + if not IsRectEmpty(InnerRect) then + if toUseBlendedSelection in FOptions.PaintOptions then + AlphaBlendSelection(Brush.Color) + else + with InnerRect do + RoundRect(Left, Top, Right, Bottom, FSelectionCurveRadius, FSelectionCurveRadius); + end; + end; + + // draw focus rect + if (poDrawFocusRect in PaintOptions) and (Column = FFocusedColumn) and + (Focused or (toPopupMode in FOptions.FPaintOptions)) and (FFocusedNode = Node) then + begin +// TextColorBackup := GetTextColor(Handle); +// SetTextColor(Handle, $FFFFFF); +// todo BackColorBackup := GetBkColor(Handle); +// SetBkColor(Handle, 0); + + if toGridExtensions in FOptions.FMiscOptions then + VirtualTrees.DrawFocusRect(Canvas, PaintInfo.CellRect) + else + VirtualTrees.DrawFocusRect(Canvas, InnerRect); + +// SetTextColor(Handle, TextColorBackup); +//todo SetBkColor(Handle, BackColorBackup); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetAlignment(const Value: TAlignment); + +begin + if FAlignment <> Value then + begin + FAlignment := Value; + if not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetAnimationDuration(const Value: Cardinal); + +begin + FAnimationDuration := Value; + if FAnimationDuration = 0 then + Exclude(FOptions.FAnimationOptions, toAnimatedToggle) + else + Include(FOptions.FAnimationOptions, toAnimatedToggle); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetBackground(const Value: TPicture); + +begin + FBackground.Assign(Value); + Invalidate; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetBackgroundOffset(const Index, Value: Integer); + +begin + case Index of + 0: + if FBackgroundOffsetX <> Value then + begin + FBackgroundOffsetX := Value; + Invalidate; + end; + 1: + if FBackgroundOffsetY <> Value then + begin + FBackgroundOffsetY := Value; + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetBorderStyle(Value: TBorderStyle); + +begin + if FBorderStyle <> Value then + begin + FBorderStyle := Value; + RecreateWnd(Self); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetButtonFillMode(const Value: TVTButtonFillMode); + +begin + if FButtonFillMode <> Value then + begin + FButtonFillMode := Value; + if not (csLoading in ComponentState) then + begin + PrepareBitmaps(True, False); + if HandleAllocated then + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetButtonStyle(const Value: TVTButtonStyle); + +begin + if FButtonStyle <> Value then + begin + FButtonStyle := Value; + if not (csLoading in ComponentState) then + begin + PrepareBitmaps(True, False); + if HandleAllocated then + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetCheckImageKind(Value: TCheckImageKind); + +begin + if FCheckImageKind <> Value then + begin + FCheckImageKind := Value; + case Value of + ckDarkCheck: + FCheckImages := DarkCheckImages; + ckLightTick: + FCheckImages := LightTickImages; + ckDarkTick: + FCheckImages := DarkTickImages; + ckLightCheck: + FCheckImages := LightCheckImages; + ckFlat: + FCheckImages := FlatImages; + ckXP: + FCheckImages := XPImages; + ckSystem: + FCheckImages := SystemCheckImages; + ckSystemFlat: + FCheckImages := SystemFlatCheckImages; + else + FCheckImages := FCustomCheckImages; + end; + if HandleAllocated and (FUpdateCount = 0) and not (csLoading in ComponentState) then + InvalidateRect(Handle, nil, False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetCheckState(Node: PVirtualNode; Value: TCheckState); + +begin + if (Node^.CheckState <> Value) and not (vsDisabled in Node^.States) and DoChecking(Node, Value) then + DoCheckClick(Node, Value); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetCheckType(Node: PVirtualNode; Value: TCheckType); + +begin + if (Node^.CheckType <> Value) and not (toReadOnly in FOptions.FMiscOptions) then + begin + Node^.CheckType := Value; + Node^.CheckState := csUncheckedNormal; + // For check boxes with tri-state check box parents we have to initialize differently. + if (toAutoTriStateTracking in FOptions.FAutoOptions) and (Value in [ctCheckBox, ctTriStateCheckBox]) and + (Node^.Parent <> FRoot) then + begin + if not (vsInitialized in Node^.Parent^.States) then + InitNode(Node^.Parent); + if (Node^.Parent^.CheckType = ctTriStateCheckBox) and + (Node^.Parent^.CheckState in [csUncheckedNormal, csCheckedNormal]) then + CheckState[Node] := Node^.Parent^.CheckState; + end; + InvalidateNode(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetChildCount(Node: PVirtualNode; NewChildCount: Cardinal); + +// Changes a node's child structure to accomodate the new child count. This is used to add or delete +// child nodes to/from the end of the node's child list. To insert or delete a specific node a separate +// routine is used. + +var + Count: Integer; + Index: Cardinal; + Child: PVirtualNode; + C: Integer; + NewHeight: Integer; + +begin + if not (toReadOnly in FOptions.FMiscOptions) then + begin + if Node = nil then + Node := FRoot; + + if NewChildCount = 0 then + DeleteChildren(Node) + else + begin + Count := Integer(NewChildCount) - Integer(Node^.ChildCount); + + // If nothing changed then do nothing. + if Count <> 0 then + begin + InterruptValidation; + + C := Count; + NewHeight := 0; + + if Count > 0 then + begin + // New nodes to add. + if Assigned(Node^.LastChild) then + Index := Node^.LastChild^.Index + 1 + else + begin + Index := 0; + Include(Node^.States, vsHasChildren); + end; + // New nodes are by default always visible, so we don't need to check the visibility. + while Count > 0 do + begin + Child := MakeNewNode; + Child^.Index := Index; + Child^.PrevSibling := Node^.LastChild; + if Assigned(Node^.LastChild) then + Node^.LastChild^.NextSibling := Child; + Child^.Parent := Node; + Node^.LastChild := Child; + if Node^.FirstChild = nil then + Node^.FirstChild := Child; + Dec(Count); + Inc(Index); + Inc(NewHeight, NodeHeight[Child]); + end; + + if vsExpanded in Node^.States then + begin + AdjustTotalHeight(Node, NewHeight, True); + if FullyVisible[Node] then + Inc(Integer(FVisibleCount), C); + end; + + AdjustTotalCount(Node, C, True); + Node^.ChildCount := NewChildCount; + if (FUpdateCount = 0) and (toAutoSort in FOptions.FAutoOptions) and (FHeader.FSortColumn > InvalidColumn) then + Sort(Node, FHeader.FSortColumn, FHeader.FSortDirection, True); + + InvalidateCache; + end + else + begin + // Nodes have to be deleted. + while Count < 0 do + begin + DeleteNode(Node^.LastChild); + Inc(Count); + end; + end; + + if FUpdateCount = 0 then + begin + ValidateCache; + UpdateScrollBars(True); + Invalidate; + end; + + if Node = FRoot then + StructureChange(nil, crChildAdded) + else + StructureChange(Node, crChildAdded); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetClipboardFormats(const Value: TClipboardFormats); + +var + I: Integer; + +begin + // Add string by string instead doing an Assign or AddStrings because the list may return -1 for + // invalid entries which cause trouble for the standard implementation. + FClipboardFormats.Clear; + for I := 0 to Value.Count - 1 do + FClipboardFormats.Add(Value[I]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetColors(const Value: TVTColors); + +begin + FColors.Assign(Value); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetCustomCheckImages(const Value: TCustomImageList); + +begin + if FCustomCheckImages <> Value then + begin + if Assigned(FCustomCheckImages) then + begin + FCustomCheckImages.UnRegisterChanges(FCustomCheckChangeLink); + {$ifdef COMPILER_5_UP} + FCustomCheckImages.RemoveFreeNotification(Self); + {$endif COMPILER_5_UP} + // Reset the internal check image list reference too, if necessary. + if FCheckImages = FCustomCheckImages then + FCheckImages := nil; + end; + FCustomCheckImages := Value; + if Assigned(FCustomCheckImages) then + begin + FCustomCheckImages.RegisterChanges(FCustomCheckChangeLink); + FCustomCheckImages.FreeNotification(Self); + end; + // Check if currently custom check images are active. + if FCheckImageKind = ckCustom then + FCheckImages := Value; + if not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetDefaultNodeHeight(Value: Cardinal); + +begin + if Value = 0 then + Value := 18; + if FDefaultNodeHeight <> Value then + begin + DoStateChange([tsNeedScale]); + Inc(Integer(FRoot^.TotalHeight), Integer(Value) - Integer(FDefaultNodeHeight)); + Inc(SmallInt(FRoot^.NodeHeight), Integer(Value) - Integer(FDefaultNodeHeight)); + FDefaultNodeHeight := Value; + InvalidateCache; + if (FUpdateCount = 0) and HandleAllocated and not (csLoading in ComponentState) then + begin + ValidateCache; + UpdateScrollBars(True); + ScrollIntoView(FFocusedNode, toCenterScrollIntoView in FOptions.SelectionOptions, True); + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetDisabled(Node: PVirtualNode; Value: Boolean); + +begin + if Assigned(Node) and (Value xor (vsDisabled in Node^.States)) then + begin + if Value then + Include(Node^.States, vsDisabled) + else + Exclude(Node^.States, vsDisabled); + + if FUpdateCount = 0 then + InvalidateNode(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetExpanded(Node: PVirtualNode; Value: Boolean); + +begin + if Assigned(Node) and (Node <> FRoot) and (Value xor (vsExpanded in Node^.States)) then + ToggleNode(Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetFocusedColumn(Value: TColumnIndex); + +begin + if (FFocusedColumn <> Value) and + DoFocusChanging(FFocusedNode, FFocusedNode, FFocusedColumn, Value) then + begin + CancelEditNode; + FFocusedColumn := Value; + if Assigned(FFocusedNode) then + begin + ScrollIntoView(FFocusedNode, toCenterScrollIntoView in FOptions.SelectionOptions, + not (toDisableAutoscrollOnFocus in FOptions.FAutoOptions)); + InvalidateNode(FFocusedNode); + end; + + DoFocusChange(FFocusedNode, FFocusedColumn); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetFocusedNode(Value: PVirtualNode); + +var + WasDifferent: Boolean; + +begin + WasDifferent := Value <> FFocusedNode; + DoFocusNode(Value, True); + // Do change event only if there was actually a change. + if WasDifferent and (FFocusedNode = Value) then + DoFocusChange(FFocusedNode, FFocusedColumn); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetFullyVisible(Node: PVirtualNode; Value: Boolean); + +// This method ensures that a node is visible and all its parent nodes are expanded and also visible +// if Value is True. Otherwise the visibility flag of the node is reset but the expand state +// of the parent nodes stays untouched. + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameter'); + + IsVisible[Node] := Value; + if Value then + begin + repeat + Node := Node^.Parent; + if Node = FRoot then + Break; + if not (vsExpanded in Node^.States) then + ToggleNode(Node); + if not (vsVisible in Node^.States) then + IsVisible[Node] := True; + until False; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetHasChildren(Node: PVirtualNode; Value: Boolean); + +begin + if Assigned(Node) and not (toReadOnly in FOptions.FMiscOptions) then + begin + if Value then + Include(Node^.States, vsHasChildren) + else + begin + Exclude(Node^.States, vsHasChildren); + DeleteChildren(Node); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetHeader(const Value: TVTHeader); + +begin + FHeader.Assign(Value); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetImages(const Value: TCustomImageList); + +begin + if FImages <> Value then + begin + if Assigned(FImages) then + begin + FImages.UnRegisterChanges(FImageChangeLink); + {$ifdef COMPILER_5_UP} + FImages.RemoveFreeNotification(Self); + {$endif COMPILER_5_UP} + end; + FImages := Value; + if Assigned(FImages) then + begin + FImages.RegisterChanges(FImageChangeLink); + FImages.FreeNotification(Self); + end; + if not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetIndent(Value: Cardinal); + +begin + if FIndent <> Value then + begin + FIndent := Value; + if not (csLoading in ComponentState) and (FUpdateCount = 0) and HandleAllocated then + begin + UpdateScrollBars(True); + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetLineMode(const Value: TVTLineMode); + +begin + if FLineMode <> Value then + begin + FLineMode := Value; + if HandleAllocated and not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetLineStyle(const Value: TVTLineStyle); + +begin + if FLineStyle <> Value then + begin + FLineStyle := Value; + if not (csLoading in ComponentState) then + begin + PrepareBitmaps(False, True); + if HandleAllocated then + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetMargin(Value: Integer); + +begin + if FMargin <> Value then + begin + FMargin := Value; + if HandleAllocated and not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetMultiline(Node: PVirtualNode; const Value: Boolean); + +begin + if Assigned(Node) and (Node <> FRoot) then + if Value <> (vsMultiline in Node^.States) then + begin + if Value then + Include(Node^.States, vsMultiline) + else + Exclude(Node^.States, vsMultiline); + + if FUpdateCount = 0 then + InvalidateNode(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetNodeAlignment(const Value: TVTNodeAlignment); + +begin + if FNodeAlignment <> Value then + begin + FNodeAlignment := Value; + if HandleAllocated and not (csReading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetNodeDataSize(Value: Integer); + +var + LastRootCount: Cardinal; + +begin + if Value < -1 then + Value := -1; + if FNodeDataSize <> Value then + begin + FNodeDataSize := Value; + if not (csLoading in ComponentState) and not (csDesigning in ComponentState) then + begin + LastRootCount := FRoot^.ChildCount; + Clear; + SetRootNodeCount(LastRootCount); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetNodeHeight(Node: PVirtualNode; Value: Cardinal); + +var + Difference: Integer; + +begin + if Assigned(Node) and (Node <> FRoot) and (Node^.NodeHeight <> Value) and not (toReadOnly in FOptions.FMiscOptions) then + begin + Difference := Integer(Value) - Integer(Node^.NodeHeight); + Node^.NodeHeight := Value; + AdjustTotalHeight(Node, Difference, True); + if FullyVisible[Node] then + begin + InvalidateCache; + if FUpdateCount = 0 then + begin + ValidateCache; + InvalidateToBottom(Node); + UpdateScrollBars(True); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetNodeParent(Node: PVirtualNode; const Value: PVirtualNode); + +begin + if Assigned(Node) and Assigned(Value) and (Node^.Parent <> Value) then + MoveTo(Node, Value, amAddChildLast, False); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetOffsetX(const Value: Integer); + +begin + DoSetOffsetXY(Point(Value, FOffsetY), DefaultScrollUpdateFlags); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetOffsetXY(const Value: TPoint); + +begin + DoSetOffsetXY(Value, DefaultScrollUpdateFlags); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetOffsetY(const Value: Integer); + +begin + DoSetOffsetXY(Point(FOffsetX, Value), DefaultScrollUpdateFlags); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetOptions(const Value: TVirtualTreeOptions); + +begin + FOptions.Assign(Value); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetRootNodeCount(Value: Cardinal); + +begin + // Don't set the root node count until all other properties (in particular the OnInitNode event) have been set. + if csLoading in ComponentState then + begin + FRoot^.ChildCount := Value; + DoStateChange([tsNeedRootCountUpdate]); + end + else + if FRoot^.ChildCount <> Value then + begin + BeginUpdate; + InterruptValidation; + SetChildCount(FRoot, Value); + EndUpdate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetScrollBarOptions(Value: TScrollBarOptions); + +begin + FScrollBarOptions.Assign(Value); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetSearchOption(const Value: TVTIncrementalSearch); + +begin + if FIncrementalSearch <> Value then + begin + FIncrementalSearch := Value; + if FIncrementalSearch = isNone then + begin + StopTimer(SearchTimer); + FSearchBuffer := ''; + FLastSearchNode := nil; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetSelected(Node: PVirtualNode; Value: Boolean); + +begin + if Assigned(Node) and (Node <> FRoot) and (Value xor (vsSelected in Node^.States)) then + begin + if Value then + begin + if FSelectionCount = 0 then + FRangeAnchor := Node + else + if not (toMultiSelect in FOptions.FSelectionOptions) then + ClearSelection; + + AddToSelection(Node); + + // Make sure there is a valid column selected (if there are columns at all). + if ((FFocusedColumn < 0) or not (coVisible in FHeader.Columns[FFocusedColumn].Options)) and + (FHeader.MainColumn > NoColumn) then + if coVisible in FHeader.Columns[FHeader.MainColumn].Options then + FFocusedColumn := FHeader.MainColumn + else + FFocusedColumn := FHeader.Columns.GetFirstVisibleColumn; + if FRangeAnchor = nil then + FRangeAnchor := Node; + end + else + begin + RemoveFromSelection(Node); + if FSelectionCount = 0 then + ResetRangeAnchor; + end; + if FullyVisible[Node] then + InvalidateNode(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetSelectionCurveRadius(const Value: Cardinal); + +begin + if FSelectionCurveRadius <> Value then + begin + FSelectionCurveRadius := Value; + if HandleAllocated and not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetStateImages(const Value: TCustomImageList); + +begin + if FStateImages <> Value then + begin + if Assigned(FStateImages) then + begin + FStateImages.UnRegisterChanges(FStateChangeLink); + {$ifdef COMPILER_5_UP} // todo: test if we need this + FStateImages.RemoveFreeNotification(Self); + {$endif COMPILER_5_UP} + end; + FStateImages := Value; + if Assigned(FStateImages) then + begin + FStateImages.RegisterChanges(FStateChangeLink); + FStateImages.FreeNotification(Self); + end; + if HandleAllocated and not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetTextMargin(Value: Integer); + +begin + if FTextMargin <> Value then + begin + FTextMargin := Value; + if not (csLoading in ComponentState) then + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetTopNode(Node: PVirtualNode); + +var + R: TRect; + Run: PVirtualNode; + +begin + if Assigned(Node) then + begin + // make sure all parents of the node are expanded + Run := Node^.Parent; + while Run <> FRoot do + begin + if not (vsExpanded in Run^.States) then + ToggleNode(Run); + Run := Run^.Parent; + end; + R := GetDisplayRect(Node, FHeader.MainColumn, True); + SetOffsetY(FOffsetY - R.Top); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetUpdateState(xUpdating: Boolean); + +begin + // The check for visibility is necessary otherwise the tree is automatically shown when + // updating is allowed. As this happens internally the VCL does not get notified and + // still assumes the control is hidden. This results in weird "cannot focus invisble control" errors. +//todo if Visible and HandleAllocated then +// SendMessage(Handle, WM_SETREDRAW, Ord(not xUpdating), 0); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetVerticalAlignment(Node: PVirtualNode; Value: Byte); + +begin + if Value > 100 then + Value := 100; + if Node^.Align <> Value then + begin + Node^.Align := Value; + if FullyVisible[Node] and (FUpdateCount = 0) then + InvalidateNode(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetVisible(Node: PVirtualNode; Value: Boolean); + +// Sets the visibility style of the given node according to Value. + +var + NeedUpdate: Boolean; + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameter.'); + + if Value <> (vsVisible in Node^.States) then + begin + InterruptValidation; + NeedUpdate := False; + if Value then + begin + Include(Node^.States, vsVisible); + if vsExpanded in Node^.Parent^.States then + AdjustTotalHeight(Node^.Parent, Node^.TotalHeight, True); + if VisiblePath[Node] then + begin + Inc(FVisibleCount, 1 + CountVisibleChildren(Node)); + NeedUpdate := True; + end; + + // Update the hidden children flag of the parent. + // Since this node is now visible we simply have to remove the flag. + Exclude(Node^.Parent^.States, vsAllChildrenHidden); + end + else + begin + Exclude(Node^.States, vsVisible); + if vsExpanded in Node^.Parent^.States then + AdjustTotalHeight(Node^.Parent, -Integer(Node^.TotalHeight), True); + if VisiblePath[Node] then + begin + Dec(FVisibleCount, 1 + CountVisibleChildren(Node)); + NeedUpdate := True; + end; + + if FUpdateCount = 0 then + DetermineHiddenChildrenFlag(Node^.Parent) + else + Include(FStates, tsUpdateHiddenChildrenNeeded) + end; + + InvalidateCache; + if NeedUpdate and (FUpdateCount = 0) then + begin + ValidateCache; + UpdateScrollBars(True); + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetVisiblePath(Node: PVirtualNode; Value: Boolean); + +// If Value is True then all parent nodes of Node are expanded. + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameter.'); + + if Value then + begin + repeat + Node := Node^.Parent; + if Node = FRoot then + Break; + if not (vsExpanded in Node^.States) then + ToggleNode(Node); + until False; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.StartTimer(ID: Integer; Interval: Integer); + +begin + if not Assigned(FTimers[ID]) then begin + FTimers[ID] := TCustomTimer.Create(Self); + FTimers[ID].OnTimer := @OnTimer; + FTimers[ID].Tag := ID; + end; + + FTimers[ID].Interval := Interval; + FTimers[ID].Enabled := True; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.OnTimer(Sender: TObject); + +var + ID: Integer; + LMessage: TLMessage; + +begin + ID := TCustomTimer(Sender).Tag; + LMessage.WParam := ID; + + WMTimer(LMessage); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.StopTimer(ID: Integer); + +begin + if Assigned(FTimers[ID]) then + FTimers[ID].Enabled := False; + +// org code: +// if HandleAllocated then +// KillTimer(Handle, ID); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.TileBackground(Source: TBitmap; Target: TCanvas; Offset: TPoint; R: TRect); + +// Draws the given source graphic so that it tiles into the given rectangle which is relative to the target bitmap. +// The graphic is aligned so that it always starts at the upper left corner of the target canvas. +// Offset gives the position of the target window in an possible superordinated surface. + +var + SourceX, + SourceY, + TargetX, + + DeltaY: Integer; + +begin + with Target do + begin + SourceY := (R.Top + Offset.Y + FBackgroundOffsetY) mod Source.Height; + // Always wrap the source coordinates into positive range. + if SourceY < 0 then + SourceY := Source.Height + SourceY; + + // Tile image vertically until target rect is filled. + while R.Top < R.Bottom do + begin + SourceX := (R.Left + Offset.X + FBackgroundOffsetX) mod Source.Width; + // always wrap the source coordinates into positive range + if SourceX < 0 then + SourceX := Source.Width + SourceX; + + TargetX := R.Left; + // height of strip to draw + DeltaY := Min(R.Bottom - R.Top, Source.Height - SourceY); + + // tile the image horizontally + while TargetX < R.Right do + begin + BitBlt(Handle, TargetX, R.Top, Min(R.Right - TargetX, Source.Width - SourceX), DeltaY, + Source.Canvas.Handle, SourceX, SourceY, SRCCOPY); + Inc(TargetX, Source.Width - SourceX); + SourceX := 0; + end; + Inc(R.Top, Source.Height - SourceY); + SourceY := 0; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.ToggleCallback(Step, StepSize: Integer; Data: Pointer): Boolean; + +var + ScrollRect: TRect; + Column: TColumnIndex; + Run: TRect; + + //--------------- local function -------------------------------------------- + + procedure EraseLine; + + var + LocalBrush: HBRUSH; + + begin + with TToggleAnimationData(Data^), FHeader.FColumns do + begin + // Iterate through all columns and erase background in their local color. + // LocalBrush is a brush in the color of the particular column. + Column := ColumnFromPosition(Run.TopLeft); + while (Column > InvalidColumn) and (Run.Left < ClientWidth) do + begin + GetColumnBounds(Column, Run.Left, Run.Right); + if coParentColor in Items[Column].FOptions then + FillRect(DC, Run, Brush) + else + begin + //Error ?? + LocalBrush := CreateSolidBrush(ColorToRGB(Items[Column].Color)); + FillRect(DC, Run, LocalBrush); + DeleteObject(LocalBrush); + end; + Column := GetNextVisibleColumn(Column); + end; + end; + end; + + //--------------- end local function ---------------------------------------- + +begin + Result := True; + if StepSize > 0 then + begin + with TToggleAnimationData(Data^) do + begin + ScrollRect := R; + if Expand then + begin +//todo ScrollDC(DC, 0, StepSize, ScrollRect, ScrollRect, 0, nil); + + // In the first step the background must be cleared (only a small stripe) to avoid artefacts. + if Step = 0 then + if not FHeader.UseColumns then + FillRect(DC, Rect(R.Left, R.Top, R.Right, R.Top + StepSize + 1), Brush) + else + begin + Run := Rect(R.Left, R.Top, R.Right, R.Top + StepSize + 1); + EraseLine; + end; + end + else + begin + // Collapse branch. +//todo ScrollDC(DC, 0, -StepSize, ScrollRect, ScrollRect, 0, nil); + + if Step = 0 then + if not FHeader.UseColumns then + FillRect(DC, Rect(R.Left, R.Bottom - StepSize - 1, R.Right, R.Bottom), Brush) + else + begin + Run := Rect(R.Left, R.Bottom - StepSize - 1, R.Right, R.Bottom); + EraseLine; + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- +(* +procedure TBaseVirtualTree.CMDrag(var Message: TCMDrag); + +var + S: TObject; + ShiftState: Integer; + P: TPoint; +//x Formats: TFormatArray; + +begin + with Message, DragRec^ do + begin + S := Source; +//x Formats := nil; + + // Let the ancestor handle dock operations. + if S is TDragDockObject then + inherited + else + begin + // We need an extra check for the control drag object as there might be other objects not derived from + // this class (e.g. TActionDragObject). + if not (tsUserDragObject in FStates) and (S is TBaseDragControlObject) then + S := (S as TBaseDragControlObject).Control; + case DragMessage of + dmDragEnter, dmDragLeave, dmDragMove: + begin + if DragMessage = dmDragEnter then + DoStateChange([tsVCLDragging]); + if DragMessage = dmDragLeave then + DoStateChange([], [tsVCLDragging]); + + if DragMessage = dmDragMove then + with ScreenToClient(Pos) do + DoAutoScroll(X, Y); + + ShiftState := 0; + // Alt key will be queried by the KeysToShiftState function in DragOver. + if GetKeyState(VK_SHIFT) < 0 then + ShiftState := ShiftState or MK_SHIFT; + if GetKeyState(VK_CONTROL) < 0 then + ShiftState := ShiftState or MK_CONTROL; + + // Allowed drop effects are simulated for VCL dd. +//x Result := DROPEFFECT_MOVE or DROPEFFECT_COPY; + DragOver(S, ShiftState, TDragState(DragMessage), Pos, Result); + FLastVCLDragTarget := FDropTargetNode; + FVCLDragEffect := Result; + if (DragMessage = dmDragLeave) and Assigned(FDropTargetNode) then + begin + InvalidateNode(FDropTargetNode); + FDropTargetNode := nil; + end; + end; + dmDragDrop: + begin + ShiftState := 0; + // Alt key will be queried by the KeysToShiftState function in DragOver + if GetKeyState(VK_SHIFT) < 0 then + ShiftState := ShiftState or MK_SHIFT; + if GetKeyState(VK_CONTROL) < 0 then + ShiftState := ShiftState or MK_CONTROL; + + // allowed drop effects are simulated for VCL dd, + // replace target node with cached node from other VCL dd messages + if Assigned(FDropTargetNode) then + InvalidateNode(FDropTargetNode); + FDropTargetNode := FLastVCLDragTarget; + P := Point(Pos.X, Pos.Y); + P := ScreenToClient(P); +//x DoDragDrop(S, nil, Formats, KeysToShiftState(ShiftState), P, FVCLDragEffect, FLastDropMode); + if Assigned(FDropTargetNode) then + begin + InvalidateNode(FDropTargetNode); + FDropTargetNode := nil; + end; + end; + dmFindTarget: + begin + Result := Integer(ControlAtPos(ScreenToClient(Pos), False)); + if Result = 0 then + Result := Integer(Self); + + // This is a reliable place to check whether VCL drag has + // really begun. + if tsVCLDragPending in FStates then + DoStateChange([tsVCLDragging], [tsVCLDragPending, tsEditPending, tsClearPending]); + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CMEnabledChanged(var Message: TLMessage); + +begin + inherited; + + // Need to invalidate the non-client area as well, since the header must be redrawn too. +// if csDesigning in ComponentState then +//todo RedrawWindow(Handle, nil, 0, RDW_FRAME or RDW_INVALIDATE or RDW_NOERASE or RDW_NOCHILDREN); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CMFontChanged(var Message: TLMessage); + +begin + inherited; + + if not (csLoading in ComponentState) then + begin + PrepareBitmaps(True, False); + if HandleAllocated then + Invalidate; + end; +end; *) + +//---------------------------------------------------------------------------------------------------------------------- +(* +procedure TBaseVirtualTree.CMHintShow(var Message: TCMHintShow); + +// Determines hint message (tooltip) and out-of-hint rect. +// Note: A special handling is needed here because we cannot pass wide strings back to the caller. +// I had to introduce the hint data record anyway so we can use this to pass the hint string. +// We still need to set a dummy hint string in the message to make the VCL showing the hint window. + +var + NodeRect: TRect; + SpanColumn, + Dummy, + ColLeft, + ColRight: Integer; + HitInfo: THitInfo; + ShowOwnHint: Boolean; + IsFocusedOrEditing: Boolean; + ParentForm: TCustomForm; + +begin + with Message do + begin + Result := 1; + + if PtInRect(FLastHintRect, HintInfo^.CursorPos) then + Exit; + // Determine node for which to show hint/tooltip. + with HintInfo^ do + GetHitTestInfoAt(CursorPos.X, CursorPos.Y, True, HitInfo); + + // Make sure a hint is only shown if the tree or at least its parent form is active. + // Active editing is ok too as long as we don't want the hint for the current edit node. + if IsEditing then + IsFocusedOrEditing := HitInfo.HitNode <> FFocusedNode + else + begin + IsFocusedOrEditing := Focused; + ParentForm := GetParentForm(Self); + if Assigned(ParentForm) then + IsFocusedOrEditing := ParentForm.Focused {todoor Application.Active}; + end; + + if (GetCapture = 0) and ShowHint and not (Dragging or IsMouseSelecting) and ([tsScrolling] * FStates = []) and + (FHeader.States = []) and IsFocusedOrEditing then + begin + with HintInfo^ do + begin + Result := 0; + ShowOwnHint := False; + // Assign a dummy string otherwise the VCL will not show the hint window. + HintStr := ' '; + + // First check whether there is a header hint to show. + if FHeader.UseColumns and (hoShowHint in FHeader.FOptions) and FHeader.InHeader(CursorPos) then + begin + CursorRect := FHeaderRect; + // Convert the cursor rectangle into real client coordinates. + OffsetRect(CursorRect, 0, -Integer(FHeader.FHeight)); + HitInfo.HitColumn := FHeader.FColumns.GetColumnAndBounds(CursorPos, CursorRect.Left, CursorRect.Right); + // align the vertical hint position on the bottom bound of the header, but + // avoid overlapping of mouse cursor and hint + HintPos.Y := Max(HintPos.Y, ClientToScreen(Point(0, CursorRect.Bottom)).Y); + // Note: the test for the left mouse button in ControlState might cause problems whenever the VCL does not + // realize when the button is released. This, for instance, happens when doing OLE drag'n drop and + // cancel this with ESC. + if (HitInfo.HitColumn > -1) and not (csLButtonDown in ControlState) then + begin + FHintData.DefaultHint := FHeader.FColumns[HitInfo.HitColumn].FHint; + if FHintData.DefaultHint <> '' then + ShowOwnHint := True + else + Result := 1; + end + else + Result := 1; + end + else + begin + // Default mode is handled as would the tree be a usual VCL control (no own hint window necessary). + if FHintMode = hmDefault then + HintStr := GetShortHint(Hint) + else + begin + if Assigned(HitInfo.HitNode) and (HitInfo.HitColumn > InvalidColumn) then + begin + // A draw tree should only display a hint when at least its OnGetHintSize + // event handler is assigned. + if Self is TCustomVirtualDrawTree then + begin + FHintData.HintRect := Rect(0, 0, 0, 0); + with Self as TCustomVirtualDrawTree do + DoGetHintSize(HitInfo.HitNode, HitInfo.HitColumn, FHintData.HintRect); + ShowOwnHint := not IsRectEmpty(FHintData.HintRect); + end + else + // For string trees a decision about showing the hint or not is based + // on the hint string (if it is empty then no hint is shown). + ShowOwnHint := True; + + if ShowOwnHint then + begin + if HitInfo.HitColumn > NoColumn then + begin + FHeader.FColumns.GetColumnBounds(HitInfo.HitColumn, ColLeft, ColRight); + // The right column border might be extended if column spanning is enabled. + if toAutoSpanColumns in FOptions.FAutoOptions then + begin + SpanColumn := HitInfo.HitColumn; + repeat + Dummy := FHeader.FColumns.GetNextVisibleColumn(SpanColumn); + if (Dummy = InvalidColumn) or not ColumnIsEmpty(HitInfo.HitNode, Dummy) then + Break; + SpanColumn := Dummy; + until False; + if SpanColumn <> HitInfo.HitColumn then + FHeader.FColumns.GetColumnBounds(SpanColumn, Dummy, ColRight); + end; + end + else + begin + ColLeft := 0; + ColRight := ClientWidth; + end; + + FHintData.DefaultHint := ''; + if FHintMode <> hmTooltip then + begin + // Node specific hint text. + CursorRect := GetDisplayRect(HitInfo.HitNode, HitInfo.HitColumn, False); + CursorRect.Left := ColLeft; + CursorRect.Right := ColRight; + // Align the vertical hint position on the bottom bound of the node, but + // avoid overlapping of mouse cursor and hint. + HintPos.Y := Max(HintPos.Y, ClientToScreen(CursorRect.BottomRight).Y) + 2; + end + else + begin + // Tool tip to show. This means the full caption of the node must be displayed. + if vsMultiline in HitInfo.HitNode^.States then + begin + ShowOwnHint := True; + NodeRect := GetDisplayRect(HitInfo.HitNode, HitInfo.HitColumn, True, False); + end + else + begin + NodeRect := GetDisplayRect(HitInfo.HitNode, HitInfo.HitColumn, True, True); + ShowOwnHint := (HitInfo.HitColumn > InvalidColumn) and PtInRect(NodeRect, CursorPos) and + (CursorPos.X <= ColRight) and (CursorPos.X >= ColLeft) and + ((NodeRect.Right > Min(ColRight, ClientWidth)) or (NodeRect.Left < Max(ColLeft, 0))); + end; + + if ShowOwnHint then + begin + // Node specific hint text given will be retrieved when needed. + FHintData.DefaultHint := ''; + HintPos := ClientToScreen(Point(NodeRect.Left, NodeRect.Top)); + CursorRect := NodeRect; + end + else + // nothing to show + Result := 1; + end; + end + else + Result := 1; // Avoid hint if this is a draw tree returning an empty hint rectangle. + end + else + begin + // No node so fall back to control's hint (if indicated) or show nothing. + if FHintMode = hmHintAndDefault then + begin + FHintData.DefaultHint := GetShortHint(Hint); + if Length(FHintData.DefaultHint) = 0 then + Result := 1 + else + ShowOwnHint := True; + end + else + Result := 1; + end; + end; + end; + + // Set our own hint window class and prepare structure to be passed to the hint window. + if ShowOwnHint and (Result = 0) then + begin + HintWindowClass := TVirtualTreeHintWindow; + + FHintData.Tree := Self; + FHintData.Column := HitInfo.HitColumn; + FHintData.Node := HitInfo.HitNode; + FLastHintRect := CursorRect; + HintData := @FHintData; + end + else + FLastHintRect := Rect(0, 0, 0, 0); + end; + + // Remind that a hint is about to show. + if Result = 0 then + DoStateChange([tsHint]) + else + DoStateChange([], [tsHint]); + end; + end; +end; *) + (* +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CMHintShowPause(var Message: TCMHintShowPause); + +// Tells the application that the tree (and only the tree) does not want a delayed tool tip. +// Normal hints / header hints use the default delay (except for the first time). + +var + P: TPoint; + +begin + // A little workaround is needed here to make the application class using the correct hint window class. + // Once the application gets ShowHint set to true (which is the case when we want to show hints in the tree) then + // an internal hint window will be created which is not our own class (because we don't set an application wide + // hint window class but only one for the tree). Unfortunately, this default hint window class will prevent + // hints for the non-client area to show up (e.g. for the header) by calling CancelHint whenever certain messages + // arrive. By setting the hint show pause to 0 if our hint class was not used recently we make sure + // that the hint timer (in Forms.pas) is not used and our class is created immediately. + if HintWindowDestroyed then + begin + GetCursorPos(P); + // Check if the mouse is in the header or tool tips are enabled, which must be shown without delay anyway. + if FHeader.UseColumns and (hoShowHint in FHeader.FOptions) and FHeader.InHeader(ScreenToClient(P)) or + (FHintMode = hmToolTip) then + Message.Pause^ := 0 + end + else + if (FHintMode = hmToolTip) then + Message.Pause^ := 0; +end; + *) +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CMMouseLeave(var Message: TLMessage); + +var + LeaveStates: TVirtualTreeStates; + +begin + LeaveStates := [tsHint]; + if [tsWheelPanning, tsWheelScrolling] * FStates = [] then + begin + StopTimer(ScrollTimer); + LeaveStates := LeaveStates + [tsScrollPending, tsScrolling]; + end; + DoStateChange([], LeaveStates); + if Assigned(FCurrentHotNode) then + begin + DoHotChange(FCurrentHotNode, nil); + InvalidateNode(FCurrentHotNode); + FCurrentHotNode := nil; + end; + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CMMouseWheel(var Message: TLMMouseEvent); + +const + WHEEL_DELTA = 120; + +var + ScrollCount: Integer; + ScrollLines: Integer; + +begin + StopWheelPanning; + + //inherited; + +// if Message.Result = 0 then + begin + with Message do + begin +// Result := 1; + if FRangeY > Cardinal(ClientHeight) then + begin + // Scroll vertically if there's something to scroll... + if ssCtrl in State then + ScrollCount := WheelDelta div WHEEL_DELTA * (ClientHeight div Integer(FDefaultNodeHeight)) + else + begin + //SystemParametersInfo(SPI_GETWHEELSCROLLLINES, 0, @ScrollLines, 0); + ScrollLines := 3; + ScrollCount := ScrollLines * WheelDelta div WHEEL_DELTA; + end; + SetOffsetY(FOffsetY + ScrollCount * Integer(FDefaultNodeHeight)); + end + else + begin + // ...else scroll horizontally. + if ssCtrl in State then + ScrollCount := WheelDelta div WHEEL_DELTA * ClientWidth + else + ScrollCount := WheelDelta div WHEEL_DELTA; + SetOffsetX(FOffsetX + ScrollCount * Integer(FIndent)); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- +(* +procedure TBaseVirtualTree.CMSysColorChange(var Message: TLMessage); + +begin + inherited; + + ConvertImageList(LightCheckImages, 'VT_CHECK_LIGHT'); + ConvertImageList(DarkCheckImages, 'VT_CHECK_DARK'); + ConvertImageList(LightTickImages, 'VT_TICK_LIGHT'); + ConvertImageList(DarkTickImages, 'VT_TICK_DARK'); + ConvertImageList(FlatImages, 'VT_FLAT'); + ConvertImageList(UtilityImages, 'VT_UTILITIES'); + // XP images do not need to be converted. + // System check images do not need to be converted. +//todowin Message.Msg := WM_SYSCOLORCHANGE; +//win DefaultHandler(Message); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.TVMGetItem(var Message: TMessage); + +// Screen reader support function. The method returns information about a particular node. + +const + StateMask = TVIS_STATEIMAGEMASK or TVIS_OVERLAYMASK or TVIS_EXPANDED or TVIS_DROPHILITED or TVIS_CUT or + TVIS_SELECTED or TVIS_FOCUSED; + +var + Item: PTVItemEx; + Node: PVirtualNode; + Ghosted: Boolean; + ImageIndex: Integer; + R: TRect; + Text: WideString; + ANSIText: ANSIString; + +begin + // We can only return valid data if a nodes reference is given. + Item := Pointer(Message.LParam); + Message.Result := Ord(((Item.mask and TVIF_HANDLE) <> 0) and Assigned(Item.hItem)); + if Message.Result = 1 then + begin + Node := Pointer(Item.hItem); + // Child count requested? + if (Item.mask and TVIF_CHILDREN) <> 0 then + Item.cChildren := Node^.ChildCount; + // Index for normal image requested? + if (Item.mask and TVIF_IMAGE) <> 0 then + begin + Item.iImage := -1; + DoGetImageIndex(Node, ikNormal, -1, Ghosted, Item.iImage); + end; + // Index for selected image requested? + if (Item.mask and TVIF_SELECTEDIMAGE) <> 0 then + begin + Item.iSelectedImage := -1; + DoGetImageIndex(Node, ikSelected, -1, Ghosted, Item.iSelectedImage); + end; + // State info requested? + if (Item.mask and TVIF_STATE) <> 0 then + begin + // Everything, which is possible is returned. + Item.stateMask := StateMask; + Item.state := 0; + if Node = FFocusedNode then + Item.state := Item.state or TVIS_FOCUSED; + if vsSelected in Node.States then + Item.state := Item.state or TVIS_SELECTED; + if vsCutOrCopy in Node.States then + Item.state := Item.state or TVIS_CUT; + if Node = FDropTargetNode then + Item.state := Item.state or TVIS_DROPHILITED; + if vsExpanded in Node.States then + Item.state := Item.state or TVIS_EXPANDED; + + // Construct state image and overlay image indices. They are one based, btw. + // and zero means there is no image. + ImageIndex := -1; + DoGetImageIndex(Node, ikState, -1, Ghosted, ImageIndex); + Item.state := Item.state or Byte(IndexToStateImageMask(ImageIndex + 1)); + ImageIndex := -1; + DoGetImageIndex(Node, ikOverlay, -1, Ghosted, ImageIndex); + Item.state := Item.state or Byte(IndexToOverlayMask(ImageIndex + 1)); + end; + // Node caption requested? + if (Item.mask and TVIF_TEXT) <> 0 then + begin + GetTextInfo(Node, -1, Font, R, Text); + // Convert the Unicode implicitely to ANSI using the current locale. + ANSIText := Text; + StrLCopy(Item.pszText, PChar(ANSIText), Item.cchTextMax - 1); + Item.pszText[Length(ANSIText)] := #0; + end; + end; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.TVMGetItemRect(var Message: TMessage); + +// Screen read support function. This method returns a node's display rectangle. + +var + TextOnly: Boolean; + Node: PVirtualNode; + +begin + // The lparam member is used two-way. On enter it contains a pointer to the item (node). + // On exit it is to be considered as pointer to a rectangle structure. + Node := Pointer(Pointer(Message.LParam)^); + Message.Result := Ord(IsVisible[Node]); + if Message.Result <> 0 then + begin + TextOnly := Message.WParam <> 0; + PRect(Message.LParam)^ := GetDisplayRect(Node, -1, TextOnly); + end; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.TVMGetNextItem(var Message: TMessage); + +// Screen read support function. This method returns a node depending on the requested case. + +var + Node: PVirtualNode; + +begin + // Start with a nil result. + Message.Result := 0; + Node := Pointer(Message.LParam); + case Message.WParam of + TVGN_CARET: + Message.Result := Integer(FFocusedNode); + TVGN_CHILD: + if Assigned(Node) then + Message.Result := Integer(GetFirstChild(Node)); + TVGN_DROPHILITE: + Message.Result := Integer(FDropTargetNode); + TVGN_FIRSTVISIBLE: + Message.Result := Integer(GetFirstVisible); + TVGN_LASTVISIBLE: + Message.Result := Integer(GetLastVisible); + TVGN_NEXT: + if Assigned(Node) then + Message.Result := Integer(GetNextSibling(Node)); + TVGN_NEXTVISIBLE: + if Assigned(Node) then + Message.Result := Integer(GetNextVisible(Node)); + TVGN_PARENT: + if Assigned(Node) and (Node <> FRoot) and (Node.Parent <> FRoot) then + Message.Result := Integer(Node.Parent); + TVGN_PREVIOUS: + if Assigned(Node) then + Message.Result := Integer(GetPreviousSibling(Node)); + TVGN_PREVIOUSVISIBLE: + if Assigned(Node) then + Message.Result := Integer(GetPreviousVisible(Node)); + TVGN_ROOT: + Message.Result := Integer(GetFirst); + end; +end;} *) + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMCancelMode(var Message: TLMNoParams {TWMCancelMode}); + +begin + // Clear any transient state. + StopTimer(ExpandTimer); + StopTimer(EditTimer); + StopTimer(HeaderTimer); + StopTimer(ScrollTimer); + StopTimer(SearchTimer); + FSearchBuffer := ''; + FLastSearchNode := nil; + + DoStateChange([], [tsClearPending, tsEditPending, tsOLEDragPending, tsVCLDragPending, tsDrawSelecting, + tsDrawSelPending, tsIncrementalSearching]); + + inherited; +end; + (* +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMChangeState(var Message: TLMessage); + +var + EnterStates, + LeaveStates: TVirtualTreeStates; + +begin + EnterStates := []; + {todosetif csStopValidation in TChangeStates(Byte(Message.WParam)) then + Include(EnterStates, tsStopValidation); + if csUseCache in TChangeStates(Byte(Message.WParam)) then + Include(EnterStates, tsUseCache); + if csValidating in TChangeStates(Byte(Message.WParam)) then + Include(EnterStates, tsValidating); + if csValidationNeeded in TChangeStates(Byte(Message.WParam)) then + Include(EnterStates, tsValidationNeeded);} + + LeaveStates := []; + {if csStopValidation in TChangeStates(Byte(Message.LParam)) then + Include(LeaveStates, tsStopValidation); + if csUseCache in TChangeStates(Byte(Message.LParam)) then + Include(LeaveStates, tsUseCache); + if csValidating in TChangeStates(Byte(Message.LParam)) then + Include(LeaveStates, tsValidating); + if csValidationNeeded in TChangeStates(Byte(Message.LParam)) then + Include(LeaveStates, tsValidationNeeded);} + + DoStateChange(EnterStates, LeaveStates); +end; + *) +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMChar(var Message: TLMChar); + +begin + if tsIncrementalSearchPending in FStates then + begin + HandleIncrementalSearch(Message.CharCode); + DoStateChange([], [tsIncrementalSearchPending]); + end; + + inherited; +end; +(* +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.WMContextMenu(var Message: TWMContextMenu); + +// This method is called when a popup menu is about to be displayed. +// We have to cancel some pending states here to avoid interferences. + +begin + DoStateChange([], [tsClearPending, tsEditPending, tsOLEDragPending, tsVCLDragPending]); + + if not (tsPopupMenuShown in FStates) then + inherited; +end;} +*) +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMCopy(var Message: TLMNoParams {TWMCopy}); + +begin + CopyToClipboard; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMCut(var Message: TLMNoParams {TWMCut}); + +begin + CutToClipboard; +end; + (* +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.WMEnable(var Message: TWMEnable); + +begin + inherited; + RedrawWindow(Handle, nil, 0, RDW_FRAME or RDW_INVALIDATE or RDW_NOERASE or RDW_NOCHILDREN); +end;} + +//---------------------------------------------------------------------------------------------------------------------- +*) +procedure TBaseVirtualTree.WMEraseBkgnd(var Message: TLMEraseBkgnd); + +begin + Message.Result := 1; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMGetDlgCode(var Message: TLMNoParams {TWMGetDlgCode}); + +begin + Message.Result := DLGC_WANTCHARS or DLGC_WANTARROWS; + if FWantTabs then + Message.Result := Message.Result or DLGC_WANTTAB; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMHScroll(var Message: TLMHScroll); + + //--------------- local functions ------------------------------------------- + + function GetRealScrollPosition: Integer; + + var + SI: TScrollInfo; + Code: Integer; + + begin + SI.cbSize := SizeOf(TScrollInfo); + SI.fMask := SIF_TRACKPOS; + Code := SB_HORZ; + {$ifdef UseFlatScrollbars} + FlatSB_GetScrollInfo(Handle, Code, SI); + {$else} + GetScrollInfo(Handle, Code, SI); + {$endif UseFlatScrollbars} + Result := SI.nTrackPos; + end; + + //--------------- end local functions --------------------------------------- + +begin + case Message.ScrollCode of + SB_BOTTOM: + SetOffsetX(-Integer(FRangeX)); + SB_ENDSCROLL: + begin + DoStateChange([], [tsThumbTracking]); + // avoiding to adjust the vertical scroll position while tracking makes it much smoother + // but we need to adjust the final position here then + UpdateHorizontalScrollBar(False); + end; + SB_LINELEFT: + SetOffsetX(FOffsetX + FScrollBarOptions.FIncrementX); + SB_LINERIGHT: + SetOffsetX(FOffsetX - FScrollBarOptions.FIncrementX); + SB_PAGELEFT: + SetOffsetX(FOffsetX + ClientWidth); + SB_PAGERIGHT: + SetOffsetX(FOffsetX - ClientWidth); + SB_THUMBPOSITION, + SB_THUMBTRACK: + begin + DoStateChange([tsThumbTracking]); + SetOffsetX(-GetRealScrollPosition); + end; + SB_TOP: + SetOffsetX(0); + end; + + Message.Result := 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMKeyDown(var Message: TLMKey); + +// Keyboard event handling for node focus, selection, node specific popup menus and help invokation. +// For a detailed description of every action done here read the help. + +var + Shift: TShiftState; + Node, Temp, + LastFocused: PVirtualNode; + Offset: Integer; + ClearPending, + NeedInvalidate, + DoRangeSelect, + HandleMultiSelect: Boolean; + Context: Integer; + ParentControl: TWinControl; + R: TRect; + NewCheckState: TCheckState; + NewColumn: TColumnIndex; + ActAsGrid: Boolean; + ForceSelection: Boolean; + + // for tabulator handling + GetStartColumn: function: TColumnIndex of object; + GetNextColumn: function(Column: TColumnIndex): TColumnIndex of object; + GetNextNode: TGetNextNodeProc; + + KeyState: TKeyboardState; + Buffer: array[0..1] of Char; + FOldFocusChanged : TVTFocusChangeEvent; + +begin + with Message do + begin + Shift := KeyDataToShiftState(KeyData); + // Ask the application if the default key handling is desired. + if DoKeyAction(CharCode, Shift) then + begin + if (tsKeyCheckPending in FStates) and (CharCode <> VK_SPACE) then + begin + DoStateChange([], [tskeyCheckPending]); + FCheckNode^.CheckState := UnpressedState[FCheckNode^.CheckState]; + RepaintNode(FCheckNode); + FCheckNode := nil; + end; + + FOldFocusChanged := FOnFocusChanged; + FOnFocusChanged := nil; + + if CharCode in [VK_HOME, VK_END, VK_PRIOR, VK_NEXT, VK_UP, VK_DOWN, VK_LEFT, VK_RIGHT, VK_BACK, VK_TAB] then + begin + HandleMultiSelect := (ssShift in Shift) and (toMultiSelect in FOptions.FSelectionOptions) and not IsEditing; + + // Flag to avoid range selection in case of single node advance. + DoRangeSelect := (CharCode in [VK_HOME, VK_END, VK_PRIOR, VK_NEXT]) and HandleMultiSelect and not IsEditing; + + NeedInvalidate := DoRangeSelect or (FSelectionCount > 1); + ActAsGrid := toGridExtensions in FOptions.FMiscOptions; + ClearPending := (Shift = []) or (ActAsGrid and not (ssShift in Shift)) or + not (toMultiSelect in FOptions.FSelectionOptions) or (CharCode in [VK_TAB, VK_BACK]); + + // Keep old focused node for range selection. Use a default node if none was focused until now. + LastFocused := FFocusedNode; + if (LastFocused = nil) and (Shift <> []) then + LastFocused := GetFirstVisible; + + // Set an initial range anchor if there is not yet one. + if FRangeAnchor = nil then + FRangeAnchor := GetFirstSelected; + if FRangeAnchor = nil then + FRangeAnchor := GetFirst; + + // Determine new focused node. + case CharCode of + VK_HOME, VK_END: + begin + if CharCode = VK_END then + begin + GetStartColumn := @FHeader.FColumns.GetLastVisibleColumn; + GetNextColumn := @FHeader.FColumns.GetPreviousVisibleColumn; + GetNextNode := @GetPreviousVisible; + Node := GetLastVisible; + end + else + begin + GetStartColumn := @FHeader.FColumns.GetFirstVisibleColumn; + GetNextColumn := @FHeader.FColumns.GetNextVisibleColumn; + GetNextNode := @GetNextVisible; + Node := GetFirstVisible; + end; + + // Advance to next/previous visible column. + if FHeader.UseColumns then + NewColumn := GetStartColumn() + else + NewColumn := NoColumn; + // Find a column for the new/current node which can be focused. + while (NewColumn > NoColumn) and not DoFocusChanging(FFocusedNode, Node, FFocusedColumn, NewColumn) do + NewColumn := GetNextColumn(NewColumn); + if NewColumn > InvalidColumn then + begin + if (Shift = [ssCtrl]) and not ActAsGrid then + begin + ScrollIntoView(Node, toCenterScrollIntoView in FOptions.SelectionOptions, + not (toDisableAutoscrollOnFocus in FOptions.FAutoOptions)); + if CharCode = VK_HOME then + SetOffsetX(0) + else + SetOffsetX(-MaxInt); + end + else + begin + if not ActAsGrid or (ssCtrl in Shift) then + FocusedNode := Node; + if ActAsGrid and not (toFullRowSelect in FOptions.FSelectionOptions) then + FocusedColumn := NewColumn; + end; + end; + end; + VK_PRIOR: + if ssCtrl in Shift then + SetOffsetY(FOffsetY + ClientHeight) + else + begin + Offset := 0; + // If there's no focused node then just take the very first visible one. + if FFocusedNode = nil then + Node := GetFirstVisible + else + begin + // Go up as many nodes as comprise together a size of ClientHeight. + Node := FFocusedNode; + while Offset < ClientHeight do + begin + Temp := GetPreviousVisible(Node); + if Temp = nil then + Break; + Node := Temp; + Inc(Offset, NodeHeight[Node]); + end; + end; + FocusedNode := Node; + end; + VK_NEXT: + if ssCtrl in Shift then + SetOffsetY(FOffsetY - ClientHeight) + else + begin + Offset := 0; + // If there's no focused node then just take the very last one. + if FFocusedNode = nil then + Node := GetLastVisible + else + begin + // Go up as many nodes as comprise together a size of ClientHeight. + Node := FFocusedNode; + while Offset < ClientHeight do + begin + Temp := GetNextVisible(Node); + if Temp = nil then + Break; + Node := Temp; + Inc(Offset, NodeHeight[Node]); + end; + end; + FocusedNode := Node; + end; + VK_UP: + begin + // scrolling without selection change + if ssCtrl in Shift then + SetOffsetY(FOffsetY + Integer(FDefaultNodeHeight)) + else + begin + if FFocusedNode = nil then + Node := GetLastVisible + else + Node := GetPreviousVisible(FFocusedNode); + + if Assigned(Node) then + begin + EndEditNode; + if HandleMultiSelect and (CompareNodePositions(LastFocused, FRangeAnchor) > 0) and + Assigned(FFocusedNode) then + RemoveFromSelection(FFocusedNode); + if FFocusedColumn = NoColumn then + FFocusedColumn := FHeader.MainColumn; + FocusedNode := Node; + end + else + if Assigned(FFocusedNode) then + InvalidateNode(FFocusedNode); + end; + end; + VK_DOWN: + begin + // scrolling without selection change + if ssCtrl in Shift then + SetOffsetY(FOffsetY - Integer(FDefaultNodeHeight)) + else + begin + if FFocusedNode = nil then + Node := GetFirstVisible + else + Node := GetNextVisible(FFocusedNode); + + if Assigned(Node) then + begin + EndEditNode; + if HandleMultiSelect and (CompareNodePositions(LastFocused, FRangeAnchor) < 0) and + Assigned(FFocusedNode) then + RemoveFromSelection(FFocusedNode); + if FFocusedColumn = NoColumn then + FFocusedColumn := FHeader.MainColumn; + FocusedNode := Node; + end + else + if Assigned(FFocusedNode) then + InvalidateNode(FFocusedNode); + end; + end; + VK_LEFT: + begin + // special handling + if ssCtrl in Shift then + SetOffsetX(FOffsetX + Integer(FIndent)) + else + begin + // other special cases + Context := NoColumn; + if (toExtendedFocus in FOptions.FSelectionOptions) and (toGridExtensions in FOptions.FMiscOptions) then + begin + Context := FHeader.Columns.GetPreviousVisibleColumn(FFocusedColumn); + if Context > -1 then + FocusedColumn := Context + end + else + if Assigned(FFocusedNode) and (vsExpanded in FFocusedNode^.States) and + (Shift = []) and (vsHasChildren in FFocusedNode^.States) then + ToggleNode(FFocusedNode) + else + begin + if FFocusedNode = nil then + FocusedNode := GetFirstVisible + else + begin + if FFocusedNode^.Parent <> FRoot then + Node := FFocusedNode^.Parent + else + Node := nil; + if Assigned(Node) then + begin + if HandleMultiSelect then + begin + // and a third special case + if FFocusedNode^.Index > 0 then + DoRangeSelect := True + else + if CompareNodePositions(Node, FRangeAnchor) > 0 then + RemoveFromSelection(FFocusedNode); + end; + FocusedNode := Node; + end; + end; + end; + end; + end; + VK_RIGHT: + begin + // special handling + if ssCtrl in Shift then + SetOffsetX(FOffsetX - Integer(FIndent)) + else + begin + // other special cases + Context := NoColumn; + if (toExtendedFocus in FOptions.FSelectionOptions) and (toGridExtensions in FOptions.FMiscOptions) then + begin + Context := FHeader.Columns.GetNextVisibleColumn(FFocusedColumn); + if Context > -1 then + FocusedColumn := Context; + end + else + if Assigned(FFocusedNode) and not (vsExpanded in FFocusedNode^.States) and + (Shift = []) and (vsHasChildren in FFocusedNode^.States) then + ToggleNode(FFocusedNode) + else + begin + if FFocusedNode = nil then + FocusedNode := GetFirstVisible + else + begin + Node := GetFirstVisibleChild(FFocusedNode); + if Assigned(Node) then + begin + if HandleMultiSelect and (CompareNodePositions(Node, FRangeAnchor) < 0) then + RemoveFromSelection(FFocusedNode); + FocusedNode := Node; + end; + end; + end; + end; + end; + VK_BACK: + if tsIncrementalSearching in FStates then + DoStateChange([tsIncrementalSearchPending]) + else + if Assigned(FFocusedNode) and (FFocusedNode^.Parent <> FRoot) then + FocusedNode := FocusedNode^.Parent; + VK_TAB: + if (toExtendedFocus in FOptions.FSelectionOptions) and FHeader.UseColumns then + begin + // In order to avoid duplicating source code just to change the direction + // we use function variables. + if ssShift in Shift then + begin + GetStartColumn := @FHeader.FColumns.GetLastVisibleColumn; + GetNextColumn := @FHeader.FColumns.GetPreviousVisibleColumn; + GetNextNode := @GetPreviousVisible; + end + else + begin + GetStartColumn := @FHeader.FColumns.GetFirstVisibleColumn; + GetNextColumn := @FHeader.FColumns.GetNextVisibleColumn; + GetNextNode := @GetNextVisible; + end; + + // Advance to next/previous visible column/node. + Node := FFocusedNode; + NewColumn := GetNextColumn(FFocusedColumn); + repeat + // Find a column for the current node which can be focused. + while (NewColumn > NoColumn) and not DoFocusChanging(FFocusedNode, Node, FFocusedColumn, NewColumn) do + NewColumn := GetNextColumn(NewColumn); + + if NewColumn > NoColumn then + begin + // Set new node and column in one go. + SetFocusedNodeAndColumn(Node, NewColumn); + Break; + end; + + // No next column was accepted for the current node. So advance to next node and try again. + Node := GetNextNode(Node); + NewColumn := GetStartColumn(); + until Node = nil; + end; + end; + + // Clear old selection if required but take care to select the new focused node if it was not selected before. + ForceSelection := False; + if ClearPending and ((LastFocused <> FFocusedNode) or (FSelectionCount <> 1)) then + begin + ClearSelection; + ForceSelection := True; + end; + + // Determine new selection anchor. + if Shift = [] then + begin + FRangeAnchor := FFocusedNode; + FLastSelectionLevel := GetNodeLevel(FFocusedNode); + end; + // Finally change the selection for a specific range of nodes. + if DoRangeSelect then + ToggleSelection(LastFocused, FFocusedNode); + + // Make sure the new focused node is also selected. + if Assigned(FFocusedNode) and ((LastFocused <> FFocusedNode) or ForceSelection) then + AddToSelection(FFocusedNode); + + // If a repaint is needed then paint the entire tree because of the ClearSelection call, + if NeedInvalidate then + Invalidate; + end + else + begin + // Second chance for keys not directly concerned with selection changes. + + // For +, -, /, * keys on the main keyboard (not numpad) there is no virtual key code defined. + // We have to do special processing to get them working too. +//todowin GetKeyboardState(KeyState); + // Avoid conversion to control characters. We have captured the control key state already in Shift. + KeyState[VK_CONTROL] := 0; +{todowin if ToASCII(Message.CharCode, (Message.KeyData shr 16) and 7, KeyState, Buffer, 0) > 0 then + begin + case Buffer[0] of + '*': + CharCode := VK_MULTIPLY; + '+': + CharCode := VK_ADD; + '/': + CharCode := VK_DIVIDE; + '-': + CharCode := VK_SUBTRACT; + end; + end;} + + case CharCode of + VK_F2: + if (Shift = []) and Assigned(FFocusedNode) and CanEdit(FFocusedNode, FFocusedColumn) then + begin + FEditColumn := FFocusedColumn; + DoEdit; + end; + VK_ADD: + if not (tsIncrementalSearching in FStates) then + begin + if ssCtrl in Shift then + if {$ifdef ReverseFullExpandHotKey} not {$endif ReverseFullExpandHotKey} (ssShift in Shift) then + FullExpand + else + FHeader.AutoFitColumns + else + if Assigned(FFocusedNode) and not (vsExpanded in FFocusedNode^.States) then + ToggleNode(FFocusedNode); + end + else + DoStateChange([tsIncrementalSearchPending]); + VK_SUBTRACT: + if not (tsIncrementalSearching in FStates) then + begin + if ssCtrl in Shift then + if {$ifdef ReverseFullExpandHotKey} not {$endif ReverseFullExpandHotKey} (ssShift in Shift) then + FullCollapse + else + FHeader.RestoreColumns + else + if Assigned(FFocusedNode) and (vsExpanded in FFocusedNode^.States) then + ToggleNode(FFocusedNode); + end + else + DoStateChange([tsIncrementalSearchPending]); + VK_MULTIPLY: + if not (tsIncrementalSearching in FStates) then + begin + if Assigned(FFocusedNode) then + FullExpand(FFocusedNode); + end + else + DoStateChange([tsIncrementalSearchPending]); + VK_DIVIDE: + if not (tsIncrementalSearching in FStates) then + begin + if Assigned(FFocusedNode) then + FullCollapse(FFocusedNode); + end + else + DoStateChange([tsIncrementalSearchPending]); + VK_ESCAPE: // cancel actions currently in progress + begin + if IsMouseSelecting then + begin + DoStateChange([], [tsDrawSelecting, tsDrawSelPending]); + Invalidate; + end + else + if IsEditing then + CancelEditNode; + end; + VK_SPACE: + if (toCheckSupport in FOptions.FMiscOptions) and Assigned(FFocusedNode) and + (FFocusedNode^.CheckType <> ctNone) then + begin + if (FStates * [tsKeyCheckPending, tsMouseCheckPending] = []) and Assigned(FFocusedNode) and + not (vsDisabled in FFocusedNode^.States) then + begin + with FFocusedNode^ do + NewCheckState := DetermineNextCheckState(CheckType, CheckState); + if DoChecking(FFocusedNode, NewCheckState) then + begin + DoStateChange([tsKeyCheckPending]); + FCheckNode := FFocusedNode; + FPendingCheckState := NewCheckState; + FCheckNode^.CheckState := PressedState[FCheckNode^.CheckState]; + RepaintNode(FCheckNode); + end; + end; + end + else + DoStateChange([tsIncrementalSearchPending]); + VK_F1: + if Assigned(FOnGetHelpContext) then + begin + Context := 0; + if Assigned(FFocusedNode) then + begin + Node := FFocusedNode; + // Traverse the tree structure up to the root. + repeat + FOnGetHelpContext(Self, Node, 0, Context); + Node := Node^.Parent; + until (Node = FRoot) or (Context <> 0); + end; + + // If no help context could be found try the tree's one or its parent's contexts. + ParentControl := Self; + while Assigned(ParentControl) and (Context = 0) do + begin + Context := ParentControl.HelpContext; + ParentControl := ParentControl.Parent; + end; + if Context <> 0 then + Application.HelpContext(Context); + end; + VK_APPS: + if Assigned(FFocusedNode) then + begin + R := GetDisplayRect(FFocusedNode, FFocusedColumn, True); + Offset := DoGetNodeWidth(FFocusedNode, FFocusedColumn); + if FFocusedColumn >= 0 then + begin + if Offset > FHeader.Columns[FFocusedColumn].Width then + Offset := FHeader.Columns[FFocusedColumn].Width; + end + else + begin + if Offset > ClientWidth then + Offset := ClientWidth; + end; + DoPopupMenu(FFocusedNode, FFocusedColumn, Point(R.Left + Offset div 2, (R.Top + R.Bottom) div 2)); + end; + Ord('a'), Ord('A'): + if ssCtrl in Shift then + SelectAll(True) + else + DoStateChange([tsIncrementalSearchPending]); + else + begin + // Use the key for incremental search. + // Since we are dealing with Unicode all the time there should be a more sophisticated way + // of checking for valid characters for incremental search. + // This is available but would require to include a significant amount of Unicode character + // properties, so we stick with the simple space check. + if (Shift * [ssCtrl, ssAlt] = []) and (CharCode >= 32) then + DoStateChange([tsIncrementalSearchPending]); + end; + end; + end; + + FOnFocusChanged := FOldFocusChanged; + DoFocusChange(FocusedNode,0); + end; + end; + // Make form key preview work and let application modify the key if it wants this. + inherited WMKeyDown(Message); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMKeyUp(var Message: TLMKey); + +begin + inherited WMKeyUp(Message); + + case Message.CharCode of + VK_SPACE: + if tsKeyCheckPending in FStates then + begin + DoStateChange([], [tskeyCheckPending]); + if FCheckNode = FFocusedNode then + DoCheckClick(FCheckNode, FPendingCheckState); + InvalidateNode(FCheckNode); + FCheckNode := nil; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMKillFocus(var Msg: TLMKillFocus); + +var + Form: TCustomForm; + Control: TWinControl; + Pos: TSmallPoint; + Unknown: IUnknown; + +begin + inherited; + + // Stop wheel panning if active. + StopWheelPanning; + + // Don't let any timer continue if the tree is no longer the active control (except change timers). + StopTimer(ExpandTimer); + StopTimer(EditTimer); + StopTimer(HeaderTimer); + StopTimer(ScrollTimer); + StopTimer(SearchTimer); + FSearchBuffer := ''; + FLastSearchNode := nil; + + DoStateChange([], [tsScrollPending, tsScrolling, tsEditPending, tsLeftButtonDown, tsRightButtonDown, + tsMiddleButtonDown, tsOLEDragPending, tsVCLDragPending, tsIncrementalSearching]); + + if (FSelectionCount > 0) or not (toGhostedIfUnfocused in FOptions.FPaintOptions) then + Invalidate + else + if Assigned(FFocusedNode) then + InvalidateNode(FFocusedNode); + + // Workaround for wrapped non-VCL controls (like TWebBrowser), which do not use VCL mechanisms and + // leave the ActiveControl property in the wrong state, which causes trouble when the control is refocused. + Form := GetParentForm(Self); + if Assigned(Form) and (Form.ActiveControl = Self) then + begin +//x Cardinal(Pos) := GetMessagePos; +//x Control := FindVCLWindow(SmallPointToPoint(Pos)); +//x // Every control derived from TOleControl has potentially the focus problem. In order to avoid including +//x // the OleCtrls unit (which will, among others, include Variants), which would allow to test for the TOleControl +//x // class, the IOleClientSite interface is used for the test, which is supported by TOleControl and a good indicator. +//x if Assigned(Control) and Control.GetInterface(IOleClientSite, Unknown) then +//x Form.ActiveControl := nil; + + // For other classes the active control should not be modified. Otherwise you need two clicks to select it. + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMLButtonDblClk(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + inherited WMLButtonDblClk(Message); + + // get information about the hit + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseDblClick(Message, HitInfo); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMLButtonDown(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + DoStateChange([tsLeftButtonDown]); + inherited WMLButtonDown(Message); + + // get information about the hit + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseDown(Message, HitInfo); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMLButtonUp(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + DoStateChange([], [tsLeftButtonDown]); + + // get information about the hit + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseUp(Message, HitInfo); + + inherited WMLButtonUp(Message); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMMButtonDblClk(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + inherited WMMButtonDblClk(Message); + + // get information about the hit + if toMiddleClickSelect in FOptions.FSelectionOptions then + begin + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseDblClick(Message, HitInfo); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMMButtonDown(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + DoStateChange([tsMiddleButtonDown]); + inherited WMMButtonDown(Message); + + if FHeader.FStates = [] then + begin + + // Start wheel panning or scrolling if not already active, allowed and scrolling is useful at all. + if (toWheelPanning in FOptions.FMiscOptions) and ([tsWheelScrolling, tsWheelPanning] * FStates = []) and + ((Integer(FRangeX) > ClientWidth) or (Integer(FRangeY) > ClientHeight)) then + begin + FLastClickPos := SmallPointToPoint(Message.Pos); + StartWheelPanning(FLastClickPos); + end + else + begin + StopWheelPanning; + + // Get information about the hit. + if toMiddleClickSelect in FOptions.FSelectionOptions then + begin + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseDown(Message, HitInfo); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMMButtonUp(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + DoStateChange([], [tsMiddleButtonDown]); + + // If wheel panning/scrolling is active and the mouse has not yet been moved then the user starts wheel auto scrolling. + // Indicate this by removing the panning flag. Otherwise (the mouse has moved meanwhile) stop panning. + if [tsWheelPanning, tsWheelScrolling] * FStates <> [] then + begin + if tsWheelScrolling in FStates then + DoStateChange([], [tsWheelPanning]) + else + StopWheelPanning; + end + else + if FHeader.FStates = [] then + begin + inherited; + + // get information about the hit + if toMiddleClickSelect in FOptions.FSelectionOptions then + begin + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseUp(Message, HitInfo); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- +(* +procedure TBaseVirtualTree.WMNCCalcSize(var Message: TLMNCCalcSize); + +begin + inherited; + + with FHeader do + if hoVisible in FHeader.FOptions then + with Message.CalcSize_Params^ do + Inc(rgrc[0].Top, FHeight); +end; + +//---------------------------------------------------------------------------------------------------------------------- + *) (* +procedure TBaseVirtualTree.WMNCDestroy(var Message: TWMNCDestroy); + +// Used to release a reference of the drag manager. This is the only reliable way we get notified about +// window destruction, because of the automatic release of a window if its parent window is freed. + +begin + InterruptValidation; + + StopTimer(ChangeTimer); + StopTimer(StructureChangeTimer); + + if not (csDesigning in ComponentState) and (toAcceptOLEDrop in FOptions.FMiscOptions) then + RevokeDragDrop(Handle); + + // Clean up other stuff. + DeleteObject(FDottedBrush); + FDottedBrush := 0; + if tsInAnimation in FStates then + HintWindowDestroyed := True; // Stop any pending animation. + + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + *) (* +procedure TBaseVirtualTree.WMNCHitTest(var Message: TLMNCHitTest); + +begin + inherited; +//? if not (csDesigning in ComponentState) and (hoVisible in FHeader.FOptions) and +//? FHeader.InHeader(ScreenToClient(SmallPointToPoint(Message.Pos))) then +//? Message.Result := HTBORDER; +end; + +//---------------------------------------------------------------------------------------------------------------------- + *) +(*procedure TBaseVirtualTree.WMNCPaint(var Message: TRealWMNCPaint); + +var + DC: HDC; + R: TRect; + Flags: DWORD; + {$ifdef ThemeSupport} + ExStyle: Integer; + TempRgn: HRGN; + BorderWidth, + BorderHeight: Integer; + {$endif ThemeSupport} + +begin debugln('TBaseVirtualTree.WMNCPaint begin'); + {$ifdef ThemeSupport} + if tsUseThemes in FStates then + begin + // If theming is enabled and the client edge border is set for the window then prevent the default window proc + // from painting the old border to avoid flickering. + ExStyle := GetWindowLong(Handle, GWL_EXSTYLE); + if (ExStyle and WS_EX_CLIENTEDGE) <> 0 then + begin + GetWindowRect(Handle, R); + // Determine width of the client edge. + BorderWidth := GetSystemMetrics(SM_CXEDGE); + BorderHeight := GetSystemMetrics(SM_CYEDGE); + InflateRect(R, -BorderWidth, -BorderHeight); + TempRgn := CreateRectRgnIndirect(R); + // Exclude the border from the message region if there is one. Otherwise just use the inflated + // window area region. + if Message.Rgn <> 1 then + CombineRgn(TempRgn, Message.Rgn, TempRgn, RGN_AND); + DefWindowProc(Handle, Message.Msg, Integer(TempRgn), 0); + DeleteObject(TempRgn); + end + else + DefaultHandler(Message); + end + else + {$endif ThemeSupport} + DefaultHandler(Message); + +//todowin Flags := DCX_CACHE or DCX_CLIPSIBLINGS or DCX_WINDOW or DCX_VALIDATE; + +//todowin if (Message.Rgn = 1) or not IsWinNT then +//todowin DC := GetDCEx(Handle, 0, Flags); +//todowin else +//todowin DC := GetDCEx(Handle, Message.Rgn, Flags or DCX_INTERSECTRGN); +DC := Canvas.Handle; + + if DC <> 0 then + begin + if hoVisible in FHeader.FOptions then + begin + R := FHeaderRect; + FHeader.FColumns.PaintHeader(DC, R, -FEffectiveOffsetX); + end; + OriginalWMNCPaint(DC); + ReleaseDC(Handle, DC); + end; + {$ifdef ThemeSupport} + if tsUseThemes in FStates then + ThemeServices.PaintBorder(Self, False); + {$endif ThemeSupport} +end;*) + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMPaint(var Message: TLMPaint); + +begin +//todowin if tsVCLDragging in FStates then +//todowin ImageList_DragShowNolock(False); + + if csPaintCopy in ControlState then + FUpdateRect := ClientRect + else +//todo:win GetUpdateRect(Handle, FUpdateRect, True); + FUpdateRect := ClientRect; + + OffsetRect(fUpdateRect,OffsetX,0); //theo 24.2.2007 + fUpdateRect.Right:=fUpdateRect.Right-fOffsetX*2; //theo 24.2.2007 + + inherited WMPaint(Message); + +//todowin if tsVCLDragging in FStates then +//todowin ImageList_DragShowNolock(True); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMPaste(var Message: TLMNoParams {TWMPaste}); + +begin + PasteFromClipboard; +end; + +//---------------------------------------------------------------------------------------------------------------------- + (* +procedure TBaseVirtualTree.WMPrint(var Message: TWMPrint); + +// This message is sent to request that the tree draws itself to a given device context. This includes not only +// the client area but also the non-client area (header!). + +begin + // Draw only if the window is visible or visibility is not required. + if ((Message.Flags and PRF_CHECKVISIBLE) = 0) or IsWindowVisible(Handle) then + Header.Columns.PaintHeader(Message.DC, FHeaderRect, FEffectiveOffsetX); + + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMPrintClient(var Message: TWMPrintClient); + +var + Window: TRect; + Target: TPoint; + Canvas: TCanvas; + +begin + // Draw only if the window is visible or visibility is not required. + if ((Message.Flags and PRF_CHECKVISIBLE) = 0) or IsWindowVisible(Handle) then + begin + // Determine area of the entire tree to be displayed in the control. + Window := ClientRect; + Target := Window.TopLeft; + + // The Window rectangle is given in client coordinates. We have to convert it into + // a sliding window of the tree image. + OffsetRect(Window, -FEffectiveOffsetX, -FOffsetY); + + Canvas := TCanvas.Create; + try + Canvas.Handle := Message.DC; + PaintTree(Canvas, Window, Target, [poBackground, poDrawFocusRect, poDrawDropMark, poDrawSelection, poGridLines]); + finally + Canvas.Handle := 0; + Canvas.Free; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + *) +procedure TBaseVirtualTree.WMRButtonDblClk(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + inherited; + + // get information about the hit + if toMiddleClickSelect in FOptions.FSelectionOptions then + begin + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseDblClick(Message, HitInfo); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMRButtonDown(var Message: TLMMouse); + +var + HitInfo: THitInfo; + +begin + DoStateChange([tsRightButtonDown]); + + if FHeader.FStates = [] then + begin + inherited; + + // get information about the hit + if toRightClickSelect in FOptions.FSelectionOptions then + begin + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + HandleMouseDown(Message, HitInfo); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMRButtonUp(var Message: TLMMouse); + +// handle right click selection and node specific popup menu + +var + HitInfo: THitInfo; + +begin + DoStateChange([], [tsPopupMenuShown, tsRightButtonDown]); + + if FHeader.FStates = [] then + begin + Application.CancelHint; + + if IsMouseSelecting and Assigned(PopupMenu) then + begin + // Reset selection state already here, before the inherited handler opens the default menu. + DoStateChange([], [tsDrawSelecting, tsDrawSelPending]); + Invalidate; + end; + + inherited; + + // get information about the hit + GetHitTestInfoAt(Message.XPos, Message.YPos, True, HitInfo); + + if toRightClickSelect in FOptions.FSelectionOptions then + HandleMouseUp(Message, HitInfo); + + if not Assigned(PopupMenu) then + DoPopupMenu(HitInfo.HitNode, HitInfo.HitColumn, Point(Message.XPos, Message.YPos)) + else + PopupMenu.PopUp(Parent.ClientOrigin.X+Message.XPos,Parent.ClientOrigin.Y+Message.YPos); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.WMSetCursor(var Message: TWMSetCursor); + +// Sets the hot node mouse cursor for the tree. Cursor changes for the header are handled in Header.HandleMessage. + +var + NewCursor: TCursor; + +begin + with Message do + begin + if (CursorWnd = Handle) and not (csDesigning in ComponentState) then + begin + if [tsWheelPanning, tsWheelScrolling] * FStates <> [] then + begin + Beep; + end + else + if not FHeader.HandleMessage(TMessage(Message)) then + begin + // Apply own cursors only if there is no global cursor set. + if Screen.Cursor = crDefault then + begin + if (toHotTrack in FOptions.PaintOptions) and Assigned(FCurrentHotNode) then + NewCursor := FHotCursor + else + NewCursor := Cursor; + + DoGetCursor(NewCursor); + Windows.SetCursor(Screen.Cursors[NewCursor]); + Message.Result := 1; + end + else + inherited; + end; + end + else + inherited; + end; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMSetFocus(var Msg: TLMSetFocus); + +begin + inherited; + if (FSelectionCount > 0) or not (toGhostedIfUnfocused in FOptions.FPaintOptions) then + Invalidate; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Resize; // was WMSize(var Message: TLMSize); + +begin + inherited; + + // Need to update scroll bars here. This will cause a recursion because of the change of the client area + // when changing a scrollbar. Usually this is no problem since with the second level recursion no change of the + // window size happens (the same values for the scrollbars are set, which shouldn't cause a window size change). + // Appearently, this applies not to all systems, however. + if HandleAllocated and ([tsSizing, tsWindowCreating] * FStates = []) and (ClientHeight > 0) then + try + DoStateChange([tsSizing]); + // This call will invalidate the entire non-client area which needs recalculation on resize. + FHeader.RecalculateHeader; + FHeader.UpdateSpringColumns; + UpdateScrollBars(True); + + if (tsEditing in FStates) and not FHeader.UseColumns then + UpdateEditBounds; + finally + DoStateChange([], [tsSizing]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{$ifdef ThemeSupport} + + procedure TBaseVirtualTree.WMThemeChanged(var Message: TMessage); + + begin + inherited; + + ThemeServices.UpdateThemes; + if ThemeServices.ThemesEnabled and (toThemeAware in TreeOptions.PaintOptions) then + DoStateChange([tsUseThemes]) + else + DoStateChange([], [tsUseThemes]); + RedrawWindow(Handle, nil, 0, RDW_INVALIDATE or RDW_VALIDATE or RDW_FRAME); + end; + +{$endif ThemeSupport} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMTimer(var Message: TLMessage); + +// centralized timer handling happens here + +begin + with Message do + begin + case WParam {TimerID} of + EditTimer: + DoEdit; + ScrollTimer: + begin + if tsScrollPending in FStates then + begin + Application.CancelHint; + // Scroll delay has elapsed, set to normal scroll interval now. + StartTimer(ScrollTimer, FAutoScrollInterval); + //SetTimer(Handle, ScrollTimer, FAutoScrollInterval, nil); + DoStateChange([tsScrolling], [tsScrollPending]); + end; + DoTimerScroll; + end; + ChangeTimer: + DoChange(FLastChangedNode); + StructureChangeTimer: + DoStructureChange(FLastStructureChangeNode, FLastStructureChangeReason); + SearchTimer: + begin + // When this event triggers then the user did not pressed any key for the specified timeout period. + // Hence incremental searching is stopped. + DoStateChange([], [tsIncrementalSearching]); + StopTimer(SearchTimer); + FSearchBuffer := ''; + FLastSearchNode := nil; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WMVScroll(var Message: TLMVScroll); + + //--------------- local functions ------------------------------------------- + + function GetRealScrollPosition: Integer; + + var + SI: TScrollInfo; + Code: Integer; + + begin + SI.cbSize := SizeOf(TScrollInfo); + SI.fMask := SIF_TRACKPOS; + Code := SB_VERT; + {$ifdef UseFlatScrollbars} + FlatSB_GetScrollInfo(Handle, Code, SI); + {$else} + GetScrollInfo(Handle, Code, SI); + {$endif UseFlatScrollbars} + Result := SI.nTrackPos; + end; + + //--------------- end local functions --------------------------------------- + +begin + case Message.ScrollCode of + SB_BOTTOM: + SetOffsetY(-Integer(FRoot^.TotalHeight)); + SB_ENDSCROLL: + begin + DoStateChange([], [tsThumbTracking]); + // Avoiding to adjust the horizontal scroll position while tracking makes scrolling much smoother + // but we need to adjust the final position here then. + UpdateScrollBars(True); + // Really weird invalidation needed here (and I do it only because it happens so rarely), because + // when showing the horizontal scrollbar while scrolling down using the down arrow button, + // the button will be repainted on mouse up (at the wrong place in the far right lower corner)... +//todowin RedrawWindow(Handle, nil, 0, RDW_FRAME or RDW_INVALIDATE or RDW_NOERASE or RDW_NOCHILDREN); + end; + SB_LINEUP: + SetOffsetY(FOffsetY + FScrollBarOptions.FIncrementY); + SB_LINEDOWN: + SetOffsetY(FOffsetY - FScrollBarOptions.FIncrementY); + SB_PAGEUP: + SetOffsetY(FOffsetY + ClientHeight); + SB_PAGEDOWN: + SetOffsetY(FOffsetY - ClientHeight); + + SB_THUMBPOSITION, + SB_THUMBTRACK: + begin + DoStateChange([tsThumbTracking]); + SetOffsetY(-GetRealScrollPosition); + end; + SB_TOP: + SetOffsetY(0); + end; + Message.Result := 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AddToSelection(Node: PVirtualNode); + +var + xChanged: Boolean; + +begin + Assert(Assigned(Node), 'Node must not be nil!'); + FSingletonNodeArray[0] := Node; + xChanged := InternalAddToSelection(FSingletonNodeArray, 1, False); + if xChanged then + Change(Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AddToSelection(const NewItems: TNodeArray; NewLength: Integer; ForceInsert: Boolean = False); + +// Adds the given items all at once into the current selection array. NewLength is the amount of +// nodes to add (necessary to allow NewItems to be larger than the actual used entries). +// ForceInsert is True if nodes must be inserted without consideration of level select constraint or +// already set selected flags (e.g. when loading from stream). +// Note: In the case ForceInsert is True the caller is responsible for making sure the new nodes aren't already in the +// selection array! + +var + xChanged: Boolean; + +begin + xChanged := InternalAddToSelection(NewItems, NewLength, ForceInsert); + if xChanged then + begin + if NewLength = 1 then + Change(NewItems[0]) + else + Change(nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AdjustPaintCellRect(var PaintInfo: TVTPaintInfo; var NextNonEmpty: TColumnIndex); + +// Used in descentants to modify the paint rectangle of the current column while painting a certain node. + +begin + // Since cells are always drawn from left to right the next column index is independent of the + // bidi mode, but not the column borders, which might change depending on the cell's content. + NextNonEmpty := FHeader.FColumns.GetNextVisibleColumn(PaintInfo.Column); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AdjustPanningCursor(X, Y: Integer); + +// Triggered by a mouse move when wheel panning/scrolling is active. +// Loads the proper cursor which indicates into which direction scrolling is done. + +var + xName: string; + NewCursor: HCURSOR; + ScrollHorizontal, + ScrollVertical: Boolean; + +begin + ScrollHorizontal := Integer(FRangeX) > ClientWidth; + ScrollVertical := Integer(FRangeY) > ClientHeight; + + if (Abs(X - FLastClickPos.X) < 8) and (Abs(Y - FLastClickPos.Y) < 8) then + begin + // Mouse is in the neutral zone. + if ScrollHorizontal then + begin + if ScrollVertical then + xName := 'VT_MOVEALL' + else + xName := 'VT_MOVEEW' + end + else + xName := 'VT_MOVENS'; + end + else + begin + // One of 8 directions applies: north, north-east, east, south-east, south, south-west, west and north-west. + // Check also if scrolling in the particular direction is possible. + if ScrollVertical and ScrollHorizontal then + begin + // All directions allowed. + if X - FlastClickPos.X < -8 then + begin + // Left hand side. + if Y - FLastClickPos.Y < -8 then + xName := 'VT_MOVENW' + else + if Y - FLastClickPos.Y > 8 then + xName := 'VT_MOVESW' + else + xName := 'VT_MOVEW'; + end + else + if X - FLastClickPos.X > 8 then + begin + // Right hand side. + if Y - FLastClickPos.Y < -8 then + xName := 'VT_MOVENE' + else + if Y - FLastClickPos.Y > 8 then + xName := 'VT_MOVESE' + else + xName := 'VT_MOVEE'; + end + else + begin + // Up or down. + if Y < FLastClickPos.Y then + xName := 'VT_MOVEN' + else + xName := 'VT_MOVES'; + end; + end + else + if ScrollHorizontal then + begin + // Only horizontal movement allowed. + if X < FlastClickPos.X then + xName := 'VT_MOVEW' + else + xName := 'VT_MOVEE'; + end + else + begin + // Only vertical movement allowed. + if Y < FlastClickPos.Y then + xName := 'VT_MOVEN' + else + xName := 'VT_MOVES'; + end; + end; + + // Now load the cursor and apply it. + NewCursor := LoadCursor(HInstance, PChar(xName)); + if FPanningCursor <> NewCursor then + begin + DeleteObject(FPanningCursor); + FPanningCursor := NewCursor; + SetCursor(FPanningCursor); + end + else + DeleteObject(NewCursor); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AdviseChangeEvent(StructureChange: Boolean; Node: PVirtualNode; Reason: TChangeReason); + +// Used to register a delayed change event. If StructureChange is False then we have a selection change event (without +// a specific reason) otherwise it is a structure change. + +begin + if StructureChange then + begin + if tsStructureChangePending in FStates then + StopTimer(StructureChangeTimer) + else + DoStateChange([tsStructureChangePending]); + + FLastStructureChangeNode := Node; + if FLastStructureChangeReason = crIgnore then + FLastStructureChangeReason := Reason + else + if Reason <> crIgnore then + FLastStructureChangeReason := crAccumulated; + end + else + begin + if tsChangePending in FStates then + StopTimer(ChangeTimer) + else + DoStateChange([tsChangePending]); + + FLastChangedNode := Node; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.AllocateInternalDataArea(Size: Cardinal): Cardinal; + +// Simple registration method to be called by each descendant to claim their internal data area. +// Result is the offset from the begin of the node to the internal data area of the calling tree class. + +begin + Assert((FRoot = nil) or (FRoot^.ChildCount = 0), 'Internal data allocation must be done before any node is created.'); + + Result := TreeNodeSize + FTotalInternalDataSize; + Inc(FTotalInternalDataSize, (Size + 3) and not 3); + InitRootNode(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Animate(Steps, Duration: Cardinal; Callback: TVTAnimationCallback; Data: Pointer); + +// This method does the calculation part of an animation as used for node toggling and hint animations. +// Steps is the maximum amount of animation steps to do and Duration determines the milliseconds the animation +// has to run. Callback is a task specific method which is called in the loop for every step and Data is simply +// something to pass on to the callback. +// The callback is called with the current step, the current step size and the Data parameter. Since the step amount +// as well as the step size are possibly adjusted during the animation, it is impossible to determine if the current +// step is the last step, even if the original step amount is known. To solve this problem the callback will be +// called after the loop has finished with a step size of 0 indicating so to execute any post processing. + +var + StepSize, + RemainingTime, + RemainingSteps, + NextTimeStep, + CurrentStep, + StartTime, + CurrentTime: Cardinal; + +begin + if not (tsInAnimation in FStates) and (Duration > 0) then + begin + DoStateChange([tsInAnimation]); + try + RemainingTime := Duration; + RemainingSteps := Steps; + + // Determine the initial step size which is either 1 if the needed steps are less than the number of + // steps possible given by the duration or > 1 otherwise. + StepSize := Round(Max(1, RemainingSteps / Duration)); + RemainingSteps := RemainingSteps div StepSize; + CurrentStep := 0; + + while (RemainingSteps > 0) and (RemainingTime > 0) and not Application.Terminated do + begin + StartTime := GetTickCount; + NextTimeStep := StartTime + RemainingTime div RemainingSteps; + if not Callback(CurrentStep, StepSize, Data) then + Break; + + // Keep duration for this step for rest calculation. + CurrentTime := GetTickCount; + // Wait until the calculated time has been reached. + while CurrentTime < NextTimeStep do + CurrentTime := GetTickCount; + + // Subtract the time this step really needed. + if RemainingTime >= CurrentTime - StartTime then + begin + Dec(RemainingTime, CurrentTime - StartTime); + Dec(RemainingSteps); + end + else + begin + RemainingTime := 0; + RemainingSteps := 0; + end; + // If the remaining time per step is less than one time step then we have to decrease the + // step count and increase the step size. + if (RemainingSteps > 0) and ((RemainingTime div RemainingSteps) < 1) then + begin + repeat + Inc(StepSize); + RemainingSteps := RemainingTime div StepSize; + until (RemainingSteps <= 0) or ((RemainingTime div RemainingSteps) >= 1); + end; + CurrentStep := Cardinal(Steps) - RemainingSteps; + end; + if not Application.Terminated then + Callback(0, 0, Data); + finally + DoStateChange([], [tsCancelHintAnimation, tsInAnimation]); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CalculateSelectionRect(X, Y: Integer): Boolean; + +// Recalculates old and new selection rectangle given that X, Y are new mouse coordinates. +// Returns True if there was a change since the last call. + +var + MaxValue: Integer; + +begin + if tsDrawSelecting in FStates then + FLastSelRect := FNewSelRect; + FNewSelRect.BottomRight := Point(X - FEffectiveOffsetX, Y - FOffsetY); + if FNewSelRect.Right < 0 then + FNewSelRect.Right := 0; + if FNewSelRect.Bottom < 0 then + FNewSelRect.Bottom := 0; + MaxValue := ClientWidth; + if FRangeX > Cardinal(MaxValue) then + MaxValue := FRangeX; + if FNewSelRect.Right > MaxValue then + FNewSelRect.Right := MaxValue; + MaxValue := ClientHeight; + if FRangeY > Cardinal(MaxValue) then + MaxValue := FRangeY; + if FNewSelRect.Bottom > MaxValue then + FNewSelRect.Bottom := MaxValue; + + Result := not CompareMem(@FLastSelRect, @FNewSelRect, SizeOf(FNewSelRect)); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CanAutoScroll: Boolean; + +// Determines if auto scrolling is currently allowed. + +var + IsDropTarget: Boolean; + IsDrawSelecting: Boolean; + IsWheelPanning: Boolean; + +begin + // Don't scroll the client area if the header is currently doing tracking or dragging. + // Do auto scroll only if there is a draw selection in progress or the tree is the current drop target or + // wheel panning/scrolling is active. +//x IsDropTarget := Assigned(FDragManager) and DragManager.IsDropTarget; + IsDrawSelecting := [tsDrawSelPending, tsDrawSelecting] * FStates <> []; + IsWheelPanning := [tsWheelPanning, tsWheelScrolling] * FStates <> []; + Result := ((toAutoScroll in FOptions.FAutoOptions) or IsWheelPanning) and + (FHeader.FStates = []) and (IsDrawSelecting or IsDropTarget or (tsVCLDragging in FStates) or IsWheelPanning); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CanEdit(Node: PVirtualNode; Column: TColumnIndex): Boolean; + +// Returns True if the given node can be edited. + +begin + Result := (toEditable in FOptions.FMiscOptions) and Enabled and not (toReadOnly in FOptions.FMiscOptions); + DoCanEdit(Node, Column, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Change(Node: PVirtualNode); + +begin + AdviseChangeEvent(False, Node, crIgnore); + + if FUpdateCount = 0 then + begin + if (FChangeDelay > 0) and not (tsSynchMode in FStates) then + StartTimer(ChangeTimer, FChangeDelay) +// SetTimer(Handle, ChangeTimer, FChangeDelay, nil) + else + DoChange(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ChangeScale(M, D: Integer); + +var + DoScale: Boolean; + +begin + inherited; + + if (M <> D) and (toAutoChangeScale in FOptions.FAutoOptions) then + begin + if (csLoading in ComponentState) then + DoScale := tsNeedScale in FStates + else + DoScale := True; + if DoScale then + begin + FDefaultNodeHeight := MulDiv(FDefaultNodeHeight, M, D); + FHeader.ChangeScale(M, D); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CheckParentCheckState(Node: PVirtualNode; NewCheckState: TCheckState): Boolean; + +// Checks all siblings of node to determine which check state Node's parent must get. + +var + CheckCount, + BoxCount: Cardinal; + PartialCheck: Boolean; + Run: PVirtualNode; + +begin + CheckCount := 0; + BoxCount := 0; + PartialCheck := False; + Run := Node^.Parent^.FirstChild; + while Assigned(Run) do + begin + if Run = Node then + begin + // The given node cannot be checked because it does not yet have its new check state (as this depends + // on the outcome of this method). Instead NewCheckState is used as this contains the new state the node + // will get if this method returns True. + if Run^.CheckType in [ctCheckBox, ctTriStateCheckBox] then + begin + Inc(BoxCount); + if NewCheckState in [csCheckedNormal, csCheckedPressed] then + Inc(CheckCount); + PartialCheck := PartialCheck or (NewCheckState = csMixedNormal); + end; + end + else + if Run^.CheckType in [ctCheckBox, ctTriStateCheckBox] then + begin + Inc(BoxCount); + if Run^.CheckState in [csCheckedNormal, csCheckedPressed] then + Inc(CheckCount); + PartialCheck := PartialCheck or (Run^.CheckState = csMixedNormal); + end; + Run := Run^.NextSibling; + end; + + if (CheckCount = 0) and not PartialCheck then + NewCheckState := csUncheckedNormal + else + if CheckCount < BoxCount then + NewCheckState := csMixedNormal + else + NewCheckState := csCheckedNormal; + + Node := Node^.Parent; + Result := DoChecking(Node, NewCheckState); + if Result then + begin + DoCheckClick(Node, NewCheckState); + // Recursively adjust parent of parent. + with Node^ do + begin + if not (vsInitialized in Parent^.States) then + InitNode(Parent); + if ([vsChecking, vsDisabled] * Parent^.States = []) and (Parent <> FRoot) and + (Parent^.CheckType = ctTriStateCheckBox) then + Result := CheckParentCheckState(Node, NewCheckState); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ClearTempCache; + +// make sure the temporary node cache is in a reliable state + +begin + FTempNodeCache := nil; + FTempNodeCount := 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.ColumnIsEmpty(Node: PVirtualNode; Column: TColumnIndex): Boolean; + +// Returns True if the given column is to be considered as being empty. This will usually be determined by +// descentants as the base tree implementation has not enough information to decide. + +begin + Result := True; + if Assigned(FOnGetCellIsEmpty) then + FOnGetCellIsEmpty(Self, Node, Column, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CountLevelDifference(Node1, Node2: PVirtualNode): Integer; + +// This method counts how many indentation levels the given nodes are apart. If both nodes have the same parent then the +// difference is 0 otherwise the result is basically GetNodeLevel(Node2) - GetNodeLevel(Node1), but with sign. +// If the result is negative then Node2 is less intended than Node1. + +var + Level1, Level2: Integer; + +begin + Assert(Assigned(Node1) and Assigned(Node2), 'Both nodes must be Assigned.'); + + Level1 := 0; + while Node1^.Parent <> FRoot do + begin + Inc(Level1); + Node1 := Node1^.Parent; + end; + + Level2 := 0; + while Node2^.Parent <> FRoot do + begin + Inc(Level2); + Node2 := Node2^.Parent; + end; + + Result := Level2 - Level1; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CountVisibleChildren(Node: PVirtualNode): Cardinal; + +// Returns the number of visible child nodes of the given node. + +begin + Result := 0; + // its direct children + if vsExpanded in Node^.States then + begin + // and their children + Node := Node^.FirstChild; + while Assigned(Node) do + begin + if vsVisible in Node^.States then + Inc(Result, CountVisibleChildren(Node) + 1); + Node := Node^.NextSibling; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CreateParams(var Params: TCreateParams); + +const + ScrollBar: array[TScrollStyle] of Cardinal = (0, WS_HSCROLL, WS_VSCROLL, WS_HSCROLL or WS_VSCROLL, + WS_HSCROLL, WS_VSCROLL, WS_HSCROLL or WS_VSCROLL); + +begin + inherited CreateParams(Params); + + with Params do + begin + Style := Style or WS_CLIPCHILDREN or WS_CLIPSIBLINGS or ScrollBar[ScrollBarOptions.FScrollBars]; + if toFullRepaintOnResize in FOptions.FMiscOptions then + WindowClass.style := WindowClass.style or CS_HREDRAW or CS_VREDRAW + else + WindowClass.style := WindowClass.style and not (CS_HREDRAW or CS_VREDRAW); + if FBorderStyle = bsSingle then + begin + if Ctl3D then + begin + ExStyle := ExStyle or WS_EX_CLIENTEDGE; + Style := Style and not WS_BORDER; + end + else + Style := Style or WS_BORDER; + end + else + Style := Style and not WS_BORDER; + + // Left scrollbars can be used with Win2K and up, regardless of the system locale. +//b if BidiMode <> bdLeftToRight then +//b ExStyle := ExStyle or WS_EX_LEFTSCROLLBAR; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CreateWnd; + +// Initializes data which depends on a valid window handle. + +begin + DoStateChange([tsWindowCreating]); + inherited; + DoStateChange([], [tsWindowCreating]); + + {$ifdef ThemeSupport} + if ThemeServices.ThemesEnabled and (toThemeAware in TreeOptions.PaintOptions) then + DoStateChange([tsUseThemes]) + else + {$endif ThemeSupport} + DoStateChange([], [tsUseThemes]); + + // Because of the special recursion and update stopper when creating the window (or resizing it) + // we have to manually trigger the auto size calculation here. + if hoAutoResize in FHeader.FOptions then + FHeader.FColumns.AdjustAutoSize(InvalidColumn); + + // Initialize flat scroll bar library if required. + {$ifdef UseFlatScrollbars} + if FScrollBarOptions.FScrollBarStyle <> sbmRegular then + begin + InitializeFlatSB(Handle); + FlatSB_SetScrollProp(Handle, WSB_PROP_HSTYLE, ScrollBarProp[FScrollBarOptions.ScrollBarStyle], False); + FlatSB_SetScrollProp(Handle, WSB_PROP_VSTYLE, ScrollBarProp[FScrollBarOptions.ScrollBarStyle], False); + end; + {$endif UseFlatScrollbars} + + PrepareBitmaps(True, True); + + // Register tree as OLE drop target. +//x if not (csDesigning in ComponentState) and (toAcceptOLEDrop in FOptions.FMiscOptions) then +//x RegisterDragDrop(Handle, DragManager as IDropTarget); + + UpdateScrollBars(True); + UpdateHeaderRect; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DefineProperties(Filer: TFiler); + +// There were heavy changes in some properties during development of VT. This method helps to make migration easier +// by reading old properties manually and put them into the new properties as appropriate. +// Note: these old properties are never written again and silently disappear. +// June 2002: Meanwhile another task is done here too: working around the problem that TCollection is not streamed +// correctly when using Visual Form Inheritance (VFI). + +var + StoreIt: Boolean; + +begin + inherited; + + // The header can prevent writing columns altogether. + if FHeader.CanWriteColumns then + begin + // Check if we inherit from an ancestor form (Visual Form Inheritance). + StoreIt := Filer.Ancestor = nil; + // If there is an ancestor then save columns only if they are different to the base set. + if not StoreIt then + StoreIt := not FHeader.Columns.Equals(TBaseVirtualTree(Filer.Ancestor).FHeader.Columns); + end + else + StoreIt := False; + + Filer.DefineProperty('Columns', @FHeader.ReadColumns, @FHeader.WriteColumns, StoreIt); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DetermineHiddenChildrenFlag(Node: PVirtualNode); + +// Update the hidden children flag of the given node. + +var + Run: PVirtualNode; + +begin + // Iterate through all siblings and stop when one visible is found. + Run := Node^.FirstChild; + while Assigned(Run) and not (vsVisible in Run^.States) do + Run := Run^.NextSibling; + if Assigned(Run) then + Exclude(Node^.States, vsAllChildrenHidden) + else + Include(Node^.States, vsAllChildrenHidden); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DetermineHiddenChildrenFlagAllNodes; + +var + Run: PVirtualNode; + +begin + Run := GetFirstNoInit; + while Assigned(Run) do + begin + DetermineHiddenChildrenFlag(Run); + Run := GetNextNoInit(Run); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DetermineHitPositionLTR(var HitInfo: THitInfo; Offset, Right: Integer; + Alignment: TAlignment); + +// This method determines the hit position within a node with left-to-right orientation. + +var + MainColumnHit, + Ghosted: Boolean; + Run: PVirtualNode; + xIndent, + TextWidth, + ImageOffset: Integer; + +begin + MainColumnHit := HitInfo.HitColumn = FHeader.MainColumn; + xIndent := 0; + + // If columns are not used or the main column is hit then the tree indentation must be considered too. + if MainColumnHit then + begin + Run := HitInfo.HitNode; + while (Run^.Parent <> FRoot) do + begin + Inc(xIndent, FIndent); + Run := Run^.Parent; + end; + if toShowRoot in FOptions.FPaintOptions then + Inc(xIndent, FIndent); + end; + + if Offset < xIndent then + begin + // Position is to the left of calculated indentation which can only happen for the main column. + // Check whether it corresponds to a button/checkbox. + if (toShowButtons in FOptions.FPaintOptions) and (vsHasChildren in HitInfo.HitNode^.States) then + begin + // Position of button is interpreted very generously to avoid forcing the user + // to click exactly into the 9x9 pixels area. The entire node height and one full + // indentation level is accepted as button hit. + if Offset >= xIndent - Integer(FIndent) then + Include(HitInfo.HitPositions, hiOnItemButton); + end; + // no button hit so position is on indent + if HitInfo.HitPositions = [] then + Include(HitInfo.HitPositions, hiOnItemIndent); + end + else + begin + // The next hit positions can be: + // - on the check box + // - on the state image + // - on the normal image + // - to the left of the text area + // - on the label or + // - to the right of the text area + // (in this order). + + // In report mode no hit other than in the main column is possible. + if MainColumnHit or not (toReportMode in FOptions.FMiscOptions) then + begin + ImageOffset := xIndent + FMargin; + + // Check support is only available for the main column. + if MainColumnHit and (toCheckSupport in FOptions.FMiscOptions) and Assigned(FCheckImages) and + (HitInfo.HitNode^.CheckType <> ctNone) then + Inc(ImageOffset, FCheckImages.Width + 2); + + if MainColumnHit and (Offset < ImageOffset) then + HitInfo.HitPositions := [hiOnItem, hiOnItemCheckBox] + else + begin + if Assigned(FStateImages) and (GetImageIndex(HitInfo.HitNode, ikState, HitInfo.HitColumn, Ghosted) > -1) then + Inc(ImageOffset, FStateImages.Width + 2); + if Offset < ImageOffset then + Include(HitInfo.HitPositions, hiOnStateIcon) + else + begin + if Assigned(FImages) and (GetImageIndex(HitInfo.HitNode, ikNormal, HitInfo.HitColumn, Ghosted) > -1) then + Inc(ImageOffset, FImages.Width + 2); + if Offset < ImageOffset then + Include(HitInfo.HitPositions, hiOnNormalIcon) + else + begin + // ImageOffset contains now the left border of the node label area. This is used to calculate the + // correct alignment in the column. + TextWidth := DoGetNodeWidth(HitInfo.HitNode, HitInfo.HitColumn); + + // Check if the text can be aligned at all. This is only possible if there is enough room + // in the remaining text rectangle. + if TextWidth > Right - ImageOffset then + Include(HitInfo.HitPositions, hiOnItemLabel) + else + begin + case Alignment of + taCenter: + begin + xIndent := (ImageOffset + Right - TextWidth) div 2; + if Offset < xIndent then + Include(HitInfo.HitPositions, hiOnItemLeft) + else + if Offset < xIndent + TextWidth then + Include(HitInfo.HitPositions, hiOnItemLabel) + else + Include(HitInfo.HitPositions, hiOnItemRight) + end; + taRightJustify: + begin + xIndent := Right - TextWidth; + if Offset < xIndent then + Include(HitInfo.HitPositions, hiOnItemLeft) + else + Include(HitInfo.HitPositions, hiOnItemLabel); + end; + else // taLeftJustify + if Offset < ImageOffset + TextWidth then + Include(HitInfo.HitPositions, hiOnItemLabel) + else + Include(HitInfo.HitPositions, hiOnItemRight); + end; + end; + end; + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DetermineHitPositionRTL(var HitInfo: THitInfo; Offset, Right: Integer; Alignment: TAlignment); + +// This method determines the hit position within a node with right-to-left orientation. + +var + MainColumnHit, + Ghosted: Boolean; + Run: PVirtualNode; + xIndent, + TextWidth, + ImageOffset: Integer; + +begin + MainColumnHit := HitInfo.HitColumn = FHeader.MainColumn; + + // If columns are not used or the main column is hit then the tree indentation must be considered too. + if MainColumnHit then + begin + Run := HitInfo.HitNode; + while (Run^.Parent <> FRoot) do + begin + Dec(Right, FIndent); + Run := Run^.Parent; + end; + if toShowRoot in FOptions.FPaintOptions then + Dec(Right, FIndent); + end; + + if Offset >= Right then + begin + // Position is to the right of calculated indentation which can only happen for the main column. + // Check whether it corresponds to a button/checkbox. + if (toShowButtons in FOptions.FPaintOptions) and (vsHasChildren in HitInfo.HitNode^.States) then + begin + // Position of button is interpreted very generously to avoid forcing the user + // to click exactly into the 9x9 pixels area. The entire node height and one full + // indentation level is accepted as button hit. + if Offset <= Right + Integer(FIndent) then + Include(HitInfo.HitPositions, hiOnItemButton); + end; + // no button hit so position is on indent + if HitInfo.HitPositions = [] then + Include(HitInfo.HitPositions, hiOnItemIndent); + end + else + begin + // The next hit positions can be: + // - on the check box + // - on the state image + // - on the normal image + // - to the left of the text area + // - on the label or + // - to the right of the text area + // (in this order). + + // In report mode no hit other than in the main column is possible. + if MainColumnHit or not (toReportMode in FOptions.FMiscOptions) then + begin + ImageOffset := Right - FMargin; + + // Check support is only available for the main column. + if MainColumnHit and (toCheckSupport in FOptions.FMiscOptions) and Assigned(FCheckImages) and + (HitInfo.HitNode^.CheckType <> ctNone) then + Dec(ImageOffset, FCheckImages.Width + 2); + + if MainColumnHit and (Offset > ImageOffset) then + HitInfo.HitPositions := [hiOnItem, hiOnItemCheckBox] + else + begin + if Assigned(FStateImages) and (GetImageIndex(HitInfo.HitNode, ikState, HitInfo.HitColumn, Ghosted) > -1) then + Dec(ImageOffset, FStateImages.Width + 2); + if Offset > ImageOffset then + Include(HitInfo.HitPositions, hiOnStateIcon) + else + begin + if Assigned(FImages) and (GetImageIndex(HitInfo.HitNode, ikNormal, HitInfo.HitColumn, Ghosted) > -1) then + Dec(ImageOffset, FImages.Width + 2); + if Offset > ImageOffset then + Include(HitInfo.HitPositions, hiOnNormalIcon) + else + begin + // ImageOffset contains now the right border of the node label area. This is used to calculate the + // correct alignment in the column. + TextWidth := DoGetNodeWidth(HitInfo.HitNode, HitInfo.HitColumn); + + // Check if the text can be aligned at all. This is only possible if there is enough room + // in the remaining text rectangle. + if TextWidth > ImageOffset then + Include(HitInfo.HitPositions, hiOnItemLabel) + else + begin + // Consider bidi mode here. In RTL context does left alignment actually mean right alignment + // and vice versa. +//b ChangeBiDiModeAlignment(Alignment); + + case Alignment of + taCenter: + begin + xIndent := (ImageOffset - TextWidth) div 2; + if Offset < xIndent then + Include(HitInfo.HitPositions, hiOnItemLeft) + else + if Offset < xIndent + TextWidth then + Include(HitInfo.HitPositions, hiOnItemLabel) + else + Include(HitInfo.HitPositions, hiOnItemRight) + end; + taRightJustify: + begin + xIndent := ImageOffset - TextWidth; + if Offset < xIndent then + Include(HitInfo.HitPositions, hiOnItemLeft) + else + Include(HitInfo.HitPositions, hiOnItemLabel); + end; + else // taLeftJustify + if Offset > TextWidth then + Include(HitInfo.HitPositions, hiOnItemRight) + else + Include(HitInfo.HitPositions, hiOnItemLabel); + end; + end; + end; + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DetermineNextCheckState(CheckType: TCheckType; CheckState: TCheckState): TCheckState; + +// Determines the next check state in case the user click the check image or pressed the space key. + +begin + case CheckType of + ctTriStateCheckBox, + ctCheckBox: + if CheckState = csCheckedNormal then + Result := csUncheckedNormal + else + Result := csCheckedNormal; + ctRadioButton: + Result := csCheckedNormal; + ctButton: + Result := csUncheckedNormal; + else + Result := csMixedNormal; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DetermineScrollDirections(X, Y: Integer): TScrollDirections; + +// Determines which direction the client area must be scrolled depending on the given position. + +begin + Result:= []; + + if CanAutoScroll then + begin + // Calculation for wheel panning/scrolling is a bit different to normal auto scroll. + if [tsWheelPanning, tsWheelScrolling] * FStates <> [] then + begin + if (X - FLastClickPos.X) < -8 then + Include(Result, sdLeft); + if (X - FLastClickPos.X) > 8 then + Include(Result, sdRight); + + if (Y - FLastClickPos.Y) < -8 then + Include(Result, sdUp); + if (Y - FLastClickPos.Y) > 8 then + Include(Result, sdDown); + end + else + begin + if (X < Integer(FDefaultNodeHeight)) and (FEffectiveOffsetX <> 0) then + Include(Result, sdLeft); + if (ClientWidth - FEffectiveOffsetX < Integer(FRangeX)) and (X > ClientWidth - Integer(FDefaultNodeHeight)) then + Include(Result, sdRight); + + if (Y < Integer(FDefaultNodeHeight)) and (FOffsetY <> 0) then + Include(Result, sdUp); + if (ClientHeight - FOffsetY < Integer(FRangeY)) and (Y > ClientHeight - Integer(FDefaultNodeHeight)) then + Include(Result, sdDown); + + // Since scrolling during dragging is not handled via the timer we do a check here whether the auto + // scroll timeout already has elapsed or not. +//x if (Result <> []) and +//x ((Assigned(FDragManager) and DragManager.IsDropTarget) or +//x (FindDragTarget(Point(X, Y), False) = Self)) then +//x begin +//x if FDragScrollStart = 0 then +//x FDragScrollStart := timeGetTime; +//x // Reset any scroll direction to avoid scroll in the case the user is dragging and the auto scroll time has not +//x // yet elapsed. +//x if ((timeGetTime - FDragScrollStart) < FAutoScrollDelay) then +//x Result := []; +//x end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoAdvancedHeaderDraw(var PaintInfo: THeaderPaintInfo; const Elements: THeaderPaintElements); + +begin + if Assigned(FOnAdvancedHeaderDraw) then + FOnAdvancedHeaderDraw(FHeader, PaintInfo, Elements); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoAfterCellPaint(xCanvas: TCanvas; Node: PVirtualNode; Column: TColumnIndex; CellRect: TRect); + +begin + if Assigned(FOnAfterCellPaint) then + FOnAfterCellPaint(Self, xCanvas, Node, Column, CellRect); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoAfterItemErase(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect); + +begin + if Assigned(FOnAfterItemErase) then + FOnAfterItemErase(Self, xCanvas, Node, ItemRect); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoAfterItemPaint(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect); + +begin + if Assigned(FOnAfterItemPaint) then + FOnAfterItemPaint(Self, xCanvas, Node, ItemRect); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoAfterPaint(xCanvas: TCanvas); + +begin + if Assigned(FOnAfterPaint) then + FOnAfterPaint(Self, xCanvas); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoAutoScroll(X, Y: Integer); + +begin + FScrollDirections := DetermineScrollDirections(X, Y); + + if FStates * [tsWheelPanning, tsWheelScrolling] = [] then + begin + if FScrollDirections = [] then + begin + if ((FStates * [tsScrollPending, tsScrolling]) <> []) then + begin + StopTimer(ScrollTimer); + DoStateChange([], [tsScrollPending, tsScrolling]); + end; + end + else + begin + // start auto scroll if not yet done + if (FStates * [tsScrollPending, tsScrolling]) = [] then + begin + DoStateChange([tsScrollPending]); + StartTimer(ScrollTimer, FAutoScrollDelay); +// SetTimer(Handle, ScrollTimer, FAutoScrollDelay, nil); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoBeforeCellPaint(xCanvas: TCanvas; Node: PVirtualNode; Column: TColumnIndex; CellRect: TRect); + +begin + if Assigned(FOnBeforeCellPaint) then + FOnBeforeCellPaint(Self, xCanvas, Node, Column, CellRect); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoBeforeItemErase(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect; var xColor: TColor; + var EraseAction: TItemEraseAction); + +begin + if Assigned(FOnBeforeItemErase) then + FOnBeforeItemErase(Self, xCanvas, Node, ItemRect, xColor, EraseAction); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoBeforeItemPaint(xCanvas: TCanvas; Node: PVirtualNode; ItemRect: TRect): Boolean; + +begin + // By default custom draw will not be used, so the tree handles drawing the node. + Result := False; + if Assigned(FOnBeforeItemPaint) then + FOnBeforeItemPaint(Self, xCanvas, Node, ItemRect, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoBeforePaint(xCanvas: TCanvas); + +begin + if Assigned(FOnBeforePaint) then + FOnBeforePaint(Self, xCanvas); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoCancelEdit: Boolean; + +// Called when the current edit action or a pending edit must be cancelled. + +begin + StopTimer(EditTimer); + DoStateChange([], [tsEditPending]); + Result := (tsEditing in FStates) and FEditLink.CancelEdit; + if Result then + begin + DoStateChange([], [tsEditing]); + if Assigned(FOnEditCancelled) then + FOnEditCancelled(Self, FEditColumn); + if not (csDestroying in ComponentState) then + FEditLink := nil; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoCanEdit(Node: PVirtualNode; Column: TColumnIndex; var Allowed: Boolean); + +begin + if Assigned(FOnEditing) then + FOnEditing(Self, Node, Column, Allowed); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoChange(Node: PVirtualNode); + +begin + StopTimer(ChangeTimer); + if Assigned(FOnChange) then + FOnChange(Self, Node); + + // This is a good place to reset the cached node. This is the same as the node passed in here. + // This is necessary to allow descentants to override this method and get the node then. + DoStateChange([], [tsChangePending]); + FLastChangedNode := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoCheckClick(Node: PVirtualNode; NewCheckState: TCheckState); + +begin + if ChangeCheckState(Node, NewCheckState) then + DoChecked(Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoChecked(Node: PVirtualNode); + +begin + if Assigned(FOnChecked) then + FOnChecked(Self, Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoChecking(Node: PVirtualNode; var NewCheckState: TCheckState): Boolean; + +// Determines if a node is allowed to change its check state to NewCheckState. + +begin + if toReadOnly in FOptions.FMiscOptions then + Result := False + else + begin + Result := True; + if Assigned(FOnChecking) then + FOnChecking(Self, Node, NewCheckState, Result); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoCollapsed(Node: PVirtualNode); + +begin + if Assigned(FOnCollapsed) then + FOnCollapsed(Self, Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoCollapsing(Node: PVirtualNode): Boolean; + +begin + Result := True; + if Assigned(FOnCollapsing) then + FOnCollapsing(Self, Node, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoColumnClick(Column: TColumnIndex; Shift: TShiftState); + +begin + if Assigned(FOnColumnClick) then + FOnColumnClick(Self, Column, Shift); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoColumnDblClick(Column: TColumnIndex; Shift: TShiftState); + +begin + if Assigned(FOnColumnDblClick) then + FOnColumnDblClick(Self, Column, Shift); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoColumnResize(Column: TColumnIndex); + +var + R: TRect; + Run: PVirtualNode; + +begin + if not (csLoading in ComponentState) and HandleAllocated then + begin + // Reset all vsHeightMeasured flags if we are in multiline mode. + Run := GetFirstInitialized; + while Assigned(Run) do + begin + if vsMultiline in Run^.States then + Exclude(Run^.States, vsHeightMeasured); + Run := GetNextInitialized(Run); + end; + + UpdateHorizontalScrollBar(True); + // Invalidate client area from the current column all to the right. + R := ClientRect; + if not (toAutoSpanColumns in FOptions.FAutoOptions) then + R.Left := FHeader.Columns[Column].Left; + InvalidateRect(Handle, @R, False); + FHeader.Invalidate(FHeader.Columns[Column], True); + if hsTracking in FHeader.States then + UpdateWindow(Handle); + + UpdateDesigner; // design time only + + if Assigned(FOnColumnResize) then + FOnColumnResize(FHeader, Column); + + // If the tree is currently in edit state then notify edit link. + if tsEditing in FStates then + UpdateEditBounds; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoCompare(Node1, Node2: PVirtualNode; Column: TColumnIndex): Integer; + +begin + Result := 0; + if Assigned(FOnCompareNodes) then + FOnCompareNodes(Self, Node1, Node2, Column, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{function TBaseVirtualTree.DoCreateDragManager: IVTDragManager; + +begin + Result := nil; + if Assigned(FOnCreateDragManager) then + FOnCreateDragManager(Self, Result); +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoCreateEditor(Node: PVirtualNode; Column: TColumnIndex): IVTEditLink; + +begin + Result := nil; + if Assigned(FOnCreateEditor) then + begin + FOnCreateEditor(Self, Node, Column, Result); + if Result = nil then + ShowError(SEditLinkIsNil, hcTFEditLinkIsNil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + + +procedure TBaseVirtualTree.DoEdit; + +begin + Application.CancelHint; + StopTimer(ScrollTimer); + StopTimer(EditTimer); + DoStateChange([], [tsEditPending]); + if Assigned(FFocusedNode) and not (vsDisabled in FFocusedNode^.States) and + not (toReadOnly in FOptions.FMiscOptions) and (FEditLink = nil) then + begin + FEditLink := DoCreateEditor(FFocusedNode, FEditColumn); + if Assigned(FEditLink) then + begin + DoStateChange([tsEditing], [tsDrawSelecting, tsDrawSelPending, tsToggleFocusedSelection, tsOLEDragPending, + tsOLEDragging, tsClearPending, tsScrollPending, tsScrolling, tsMouseCheckPending]); + ScrollIntoView(FFocusedNode, toCenterScrollIntoView in FOptions.SelectionOptions, True); + if FEditLink.PrepareEdit(Self, FFocusedNode, FEditColumn) then + begin + UpdateEditBounds; + // Node needs repaint because the selection rectangle and static text must disappear. + InvalidateNode(FFocusedNode); + if not FEditLink.BeginEdit then + DoStateChange([], [tsEditing]); + end + else + DoStateChange([], [tsEditing]); + if not (tsEditing in FStates) then + FEditLink := nil; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoEndEdit: Boolean; + +begin + Result := (tsEditing in FStates) and FEditLink.EndEdit; + if Result then + begin + DoStateChange([], [tsEditing]); + FEditLink := nil; + if Assigned(FOnEdited) then + FOnEdited(Self, FFocusedNode, FEditColumn); + end; + DoStateChange([], [tsEditPending]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoExpanded(Node: PVirtualNode); + +begin + if Assigned(FOnExpanded) then + FOnExpanded(Self, Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoExpanding(Node: PVirtualNode): Boolean; + +begin + Result := True; + if Assigned(FOnExpanding) then + FOnExpanding(Self, Node, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoFocusChange(Node: PVirtualNode; Column: TColumnIndex); + +begin + if Assigned(FOnFocusChanged) then + FOnFocusChanged(Self, Node, Column); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoFocusChanging(OldNode, NewNode: PVirtualNode; OldColumn, NewColumn: TColumnIndex): Boolean; + +begin + Result := True; + if Assigned(FOnFocusChanging) then + FOnFocusChanging(Self, OldNode, NewNode, OldColumn, NewColumn, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoFocusNode(Node: PVirtualNode; Ask: Boolean); + +begin + if not (tsEditing in FStates) or EndEditNode then + begin + if Node = FRoot then + Node := nil; + if (FFocusedNode <> Node) and (not Ask or DoFocusChanging(FFocusedNode, Node, FFocusedColumn, FFocusedColumn)) then + begin + if Assigned(FFocusedNode) then + begin + // Do automatic collapsing of last focused node if enabled. This is however only done if + // old and new focused node have a common parent node. + if (toAutoExpand in FOptions.FAutoOptions) and Assigned(Node) and (Node^.Parent = FFocusedNode^.Parent) and + (vsExpanded in FFocusedNode^.States) then + ToggleNode(FFocusedNode) + else + InvalidateNode(FFocusedNode); + end; + FFocusedNode := Node; + end; + + // Have to scroll the node into view, even it is the same node as before. + if Assigned(FFocusedNode) then + begin + // Make sure a valid column is set if columns are used and no column has currently the focus. + if FHeader.UseColumns and (FFocusedColumn < 0) then + FFocusedColumn := 0; + // Do automatic expansion of the newly focused node if enabled. + if (toAutoExpand in FOptions.FAutoOptions) and not (vsExpanded in FFocusedNode^.States) then + ToggleNode(FFocusedNode); + InvalidateNode(FFocusedNode); + if FUpdateCount = 0 then + ScrollIntoView(FFocusedNode, (toCenterScrollIntoView in FOptions.SelectionOptions) and + (MouseButtonDown * FStates = []), not (toDisableAutoscrollOnFocus in FOptions.FAutoOptions)); + end; + + // Reset range anchor if necessary. + if FSelectionCount = 0 then + ResetRangeAnchor; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoFreeNode(Node: PVirtualNode); + +begin + if Node = FCurrentHotNode then + FCurrentHotNode := nil; + if Assigned(FOnFreeNode) and ([vsInitialized, vsInitialUserData] * Node^.States <> []) then + FOnFreeNode(Self, Node); + {$ifdef UseLocalMemoryManager} + FNodeMemoryManager.FreeNode(Node); + {$else} + FreeMem(Node); + {$endif UseLocalMemoryManager} +end; + +//---------------------------------------------------------------------------------------------------------------------- + +// These constants are defined in the platform SDK for W2K/XP, but not yet in Delphi. +const + SPI_GETTOOLTIPANIMATION = $1016; + SPI_GETTOOLTIPFADE = $1018; + +function TBaseVirtualTree.DoGetAnimationType: THintAnimationType; + +// Determines (depending on the properties settings and the system) which hint +// animation type is to be used. + +var + Animation: BOOL; + +begin + Result := FAnimationType; + if Result = hatSystemDefault then + begin +//? if not IsWinNT then + Result := hatSlide +//? else +//? begin +//? SystemParametersInfo(SPI_GETTOOLTIPANIMATION, 0, @Animation, 0); +//? if not Animation then +//? Result := hatNone +//? else +//? begin +//? SystemParametersInfo(SPI_GETTOOLTIPFADE, 0, @Animation, 0); +//? if Animation then +//? Result := hatFade +//? else +//? Result := hatSlide; +//? end; +//? end; + end; + + // Check availability of MMX if fading is requested. + if not MMXAvailable and (Result = hatFade) then + Result := hatSlide; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoGetCursor(var xCursor: TCursor); + +begin + if Assigned(FOnGetCursor) then + FOnGetCursor(Self, xCursor); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoGetHeaderCursor(var xCursor: HCURSOR); + +begin + if Assigned(FOnGetHeaderCursor) then + FOnGetHeaderCursor(FHeader, xCursor); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoGetImageIndex(Node: PVirtualNode; Kind: TVTImageKind; Column: TColumnIndex; + var Ghosted: Boolean; var Index: Integer); + +begin + if Assigned(FOnGetImage) then + FOnGetImage(Self, Node, Kind, Column, Ghosted, Index); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoGetLineStyle(var Bits: Pointer); + +begin + if Assigned(FOnGetLineStyle) then + FOnGetLineStyle(Self, Bits); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoGetNodeHint(Node: PVirtualNode; Column: TColumnIndex): WideString; + +begin + Result := Hint; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoGetNodeTooltip(Node: PVirtualNode; Column: TColumnIndex): WideString; + +begin + Result := Hint; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoGetNodeWidth(Node: PVirtualNode; Column: TColumnIndex; xCanvas: TCanvas = nil): Integer; + +begin + Result := 0; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoGetPopupMenu(Node: PVirtualNode; Column: TColumnIndex; Position: TPoint): TPopupMenu; + +// Queries the application whether there is a node specific popup menu. + +var + Run: PVirtualNode; + AskParent: Boolean; + +begin + Result := nil; + if Assigned(FOnGetPopupMenu) then + begin + Run := Node; + + if Assigned(Run) then + begin + AskParent := True; + repeat + FOnGetPopupMenu(Self, Run, Column, Position, AskParent, Result); + Run := Run^.Parent; + until (Run = FRoot) or Assigned(Result) or not AskParent; + end + else + FOnGetPopupMenu(Self, nil, -1, Position, AskParent, Result); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.DoGetUserClipboardFormats(var Formats: TFormatEtcArray); + +begin + if Assigned(FOnGetUserClipboardFormats) then + FOnGetUserClipboardFormats(Self, Formats); +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHeaderClick(Column: TColumnIndex; Button: TMouseButton; Shift: TShiftState; X, Y: Integer); + +begin + if Assigned(FOnHeaderClick) then + FOnHeaderClick(FHeader, Column, Button, Shift, X, Y); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHeaderDblClick(Column: TColumnIndex; Button: TMouseButton; Shift: TShiftState; X, Y: Integer); + +begin + if Assigned(FOnHeaderDblClick) then + FOnHeaderDblClick(FHeader, Column, Button, Shift, X, Y); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHeaderDraw(xCanvas: TCanvas; Column: TVirtualTreeColumn; R: TRect; Hover, Pressed: Boolean; + DropMark: TVTDropMarkMode); + +begin + if Assigned(FOnHeaderDraw) then + FOnHeaderDraw(FHeader, xCanvas, Column, R, Hover, Pressed, DropMark); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHeaderDrawQueryElements(var PaintInfo: THeaderPaintInfo; var Elements: THeaderPaintElements); + +begin + if Assigned(FOnHeaderDrawQueryElements) then + FOnHeaderDrawQueryElements(FHeader, PaintInfo, Elements); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHeaderMouseDown(Button: TMouseButton; Shift: TShiftState; X, Y: Integer); + +begin + if Assigned(FOnHeaderMouseDown) then + FOnHeaderMouseDown(FHeader, Button, Shift, X, Y); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHeaderMouseMove(Shift: TShiftState; X, Y: Integer); + +begin + if Assigned(FOnHeaderMouseMove) then + FOnHeaderMouseMove(FHeader, Shift, X, Y); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHeaderMouseUp(Button: TMouseButton; Shift: TShiftState; X, Y: Integer); + +begin + if Assigned(FOnHeaderMouseUp) then + FOnHeaderMouseUp(FHeader, Button, Shift, X, Y); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoHotChange(Old, New: PVirtualNode); + +begin + if Assigned(FOnHotChange) then + FOnHotChange(Self, Old, New); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoIncrementalSearch(Node: PVirtualNode; const xText: WideString): Integer; + +begin + Result := 0; + if Assigned(FOnIncrementalSearch) then + FOnIncrementalSearch(Self, Node, xText, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoInitChildren(Node: PVirtualNode; var ChildCount: Cardinal); + +begin + if Assigned(FOnInitChildren) then + FOnInitChildren(Self, Node, ChildCount); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoInitNode(xParent, Node: PVirtualNode; var InitStates: TVirtualNodeInitStates); + +begin + if Assigned(FOnInitNode) then + FOnInitNode(Self, xParent, Node, InitStates); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoKeyAction(var CharCode: Word; var Shift: TShiftState): Boolean; + +begin + Result := True; + if Assigned(FOnKeyAction) then + FOnKeyAction(Self, CharCode, Shift, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoLoadUserData(Node: PVirtualNode; Stream: TStream); + +begin + if Assigned(FOnLoadNode) then + if Node = FRoot then + FOnLoadNode(Self, nil, Stream) + else + FOnLoadNode(Self, Node, Stream); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoMeasureItem(TargetCanvas: TCanvas; Node: PVirtualNode; var NodeHeight: Integer); + +begin + if Assigned(FOnMeasureItem) then + FOnMeasureItem(Self, TargetCanvas, Node, NodeHeight); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoNodeCopied(Node: PVirtualNode); + +begin + if Assigned(FOnNodeCopied) then + FOnNodeCopied(Self, Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoNodeCopying(Node, NewParent: PVirtualNode): Boolean; + +begin + Result := True; + if Assigned(FOnNodeCopying) then + FOnNodeCopying(Self, Node, NewParent, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoNodeMoved(Node: PVirtualNode); + +begin + if Assigned(FOnNodeMoved) then + FOnNodeMoved(Self, Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoNodeMoving(Node, NewParent: PVirtualNode): Boolean; + +begin + Result := True; + if Assigned(FOnNodeMoving) then + FOnNodeMoving(Self, Node, NewParent, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoPaintBackground(xCanvas: TCanvas; R: TRect): Boolean; + +begin + Result := False; + if Assigned(FOnPaintBackground) then + FOnPaintBackground(Self, xCanvas, R, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoPaintNode(var PaintInfo: TVTPaintInfo); +begin +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoPopupMenu(Node: PVirtualNode; Column: TColumnIndex; Position: TPoint); + +// Support for node dependent popup menus. + +var + Menu: TPopupMenu; + +begin + Menu := DoGetPopupMenu(Node, Column, Position); + + if Assigned(Menu) then + begin + DoStateChange([tsPopupMenuShown]); + StopTimer(EditTimer); + Menu.PopupComponent := Self; + with ClientToScreen(Position) do + Menu.Popup(X, Y); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoReset(Node: PVirtualNode); + +begin + if Assigned(FOnResetNode) then + FOnResetNode(Self, Node); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoSaveUserData(Node: PVirtualNode; Stream: TStream); + +begin + if Assigned(FOnSaveNode) then + if Node = FRoot then + FOnSaveNode(Self, nil, Stream) + else + FOnSaveNode(Self, Node, Stream); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoScroll(DeltaX, DeltaY: Integer); + +begin + if Assigned(FOnScroll) then + FOnScroll(Self, DeltaX, DeltaY); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoSetOffsetXY(Value: TPoint; Options: TScrollUpdateOptions; ClipRect: PRect = nil): Boolean; + +// Actual offset setter used to scroll the client area, update scroll bars and invalidating the header (all optional). +// Returns True if the offset really changed otherwise False is returned. + +var + DeltaX: Integer; + DeltaY: Integer; +//? DWPStructure: HDWP; + I: Integer; + P: TPoint; + R: TRect; + +begin + // Range check, order is important here. + if Value.X < (ClientWidth - Integer(FRangeX)) then + Value.X := ClientWidth - Integer(FRangeX); + if Value.X > 0 then + Value.X := 0; + DeltaX := Value.X - FOffsetX; + if Value.Y < (ClientHeight - Integer(FRangeY)) then + Value.Y := ClientHeight - Integer(FRangeY); + if Value.Y > 0 then + Value.Y := 0; + DeltaY := Value.Y - FOffsetY; + + Result := (DeltaX <> 0) or (DeltaY <> 0); + if Result then + begin + FOffsetX := Value.X; + FOffsetY := Value.Y; + Result := True; + + Application.CancelHint; + if FUpdateCount = 0 then + begin + // The drag image from VCL controls need special consideration. +//? if tsVCLDragging in FStates then +//? ImageList_DragShowNolock(False); + + if suoScrollClientArea in Options then + begin + // Have to invalidate the entire window if there's a background. + if (toShowBackground in FOptions.FPaintOptions) and (FBackground.Graphic is TBitmap) then + begin + // Since we don't use ScrollWindow here we have to move all client windows ourselves. +//?(laz:not_defined-windows-centric) DWPStructure := BeginDeferWindowPos(ControlCount); + for I := 0 to ControlCount - 1 do + if Controls[I] is TWinControl then + //laz patch (only the next line): instead of moving the windows in batch, we do it right now for each child... + SetWindowPos(Handle, HWND_NOTOPMOST, Left+DeltaX, Top+DeltaY, 0, 0, SWP_NOZORDER or SWP_NOACTIVATE or SWP_NOSIZE); +//?(laz:not_defined-windows-centric) begin +//?(laz:not_defined-windows-centric) with Controls[I] as TWinControl do +//?(laz:not_defined-windows-centric) DWPStructure := DeferWindowPos(DWPStructure, Handle, 0, Left + DeltaX, Top + DeltaY, 0, 0, +//?(laz:not_defined-windows-centric) SWP_NOZORDER or SWP_NOACTIVATE or SWP_NOSIZE); +//?(laz:not_defined-windows-centric) if DWPStructure = 0 then +//?(laz:not_defined-windows-centric) Break; +//?(laz:not_defined-windows-centric) end; +//?(laz:not_defined-windows-centric) if DWPStructure <> 0 then +//?(laz:not_defined-windows-centric) EndDeferWindowPos(DWPStructure); + InvalidateRect(Handle, nil, False); + end + else + begin + if (DeltaX <> 0) and (Header.Columns.GetVisibleFixedWidth > 0) then + begin + // When fixed columns exists we have to scroll separately horizontally and vertically. + // Horizontally is scroll only the client area not occupied by fixed columns and + // vertically entire client area (or clipping area if one exists). + R := ClientRect; + R.Left := Header.Columns.GetVisibleFixedWidth; + + ScrollWindowEx(Handle, DeltaX, 0, @R, @R, 0, nil, SW_INVALIDATE or SW_SCROLLCHILDREN); + if DeltaY <> 0 then + ScrollWindowEx(Handle, 0, DeltaY, ClipRect, ClipRect, 0, nil, SW_INVALIDATE or SW_SCROLLCHILDREN); + end + else + ScrollWindowEx(Handle, DeltaX, DeltaY, ClipRect, ClipRect, 0, nil, SW_INVALIDATE or SW_SCROLLCHILDREN); + end; + end; + + if suoUpdateNCArea in Options then + begin + if DeltaX <> 0 then + begin + if (suoRepaintHeader in Options) and (hoVisible in FHeader.FOptions) then + FHeader.Invalidate(nil); + if not (tsSizing in FStates) and (FScrollBarOptions.ScrollBars in [ssHorizontal, ssBoth]) then + UpdateHorizontalScrollBar(suoRepaintScrollbars in Options); + end; + + if (DeltaY <> 0) and ([tsThumbTracking, tsSizing] * FStates = []) then + begin + UpdateVerticalScrollBar(suoRepaintScrollbars in Options); + if not (FHeader.UseColumns or IsMouseSelecting) and + (FScrollBarOptions.ScrollBars in [ssHorizontal, ssBoth]) then + UpdateHorizontalScrollBar(suoRepaintScrollbars in Options); + end; + end; + +//? if tsVCLDragging in FStates then +//? ImageList_DragShowNolock(True); + end; + + // Finally update "hot" node if hot tracking is activated + GetCursorPos(P); + P := ScreenToClient(P); + if PtInRect(ClientRect, P) then + HandleHotTrack(P.X, P.Y); + + DoScroll(DeltaX, DeltaY); + {$IFNDEF WINDOWS} + Invalidate; + {$ENDIF} + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoStateChange(Enter: TVirtualTreeStates; Leave: TVirtualTreeStates = []); + +var + ActualEnter, + ActualLeave: TVirtualTreeStates; + +begin + if Assigned(FOnStateChange) then + begin + ActualEnter := Enter - FStates; + ActualLeave := FStates * Leave; + if (ActualEnter + ActualLeave) <> [] then + FOnStateChange(Self, Enter, Leave); + end; + FStates := FStates + Enter - Leave; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoStructureChange(Node: PVirtualNode; Reason: TChangeReason); + +begin + StopTimer(StructureChangeTimer); + if Assigned(FOnStructureChange) then + FOnStructureChange(Self, Node, Reason); + + // This is a good place to reset the cached node and reason. These are the same as the values passed in here. + // This is necessary to allow descentants to override this method and get them. + DoStateChange([], [tsStructureChangePending]); + FLastStructureChangeNode := nil; + FLastStructureChangeReason := crIgnore; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoTimerScroll; + +var + P, + ClientP: TPoint; + InRect, + Panning: Boolean; + R, + ClipRect: TRect; + DeltaX, + DeltaY: Integer; + +begin + GetCursorPos(P); + R := ClientRect; + ClipRect := R; + MapWindowPoints(Handle, 0, R, 2); + InRect := PtInRect(R, P); + ClientP := ScreenToClient(P); + Panning := [tsWheelPanning, tsWheelScrolling] * FStates <> []; + + if IsMouseSelecting or InRect or ([tsWheelPanning, tsWheelScrolling] * FStates <> []) then + begin + DeltaX := 0; + DeltaY := 0; + if sdUp in FScrollDirections then + begin + if Panning then + DeltaY := FLastClickPos.Y - ClientP.Y - 8 + else + if InRect then + DeltaY := Min(FScrollBarOptions.FIncrementY, ClientHeight) + else + DeltaY := Min(FScrollBarOptions.FIncrementY, ClientHeight) * Abs(R.Top - P.Y); + if FOffsetY = 0 then + Exclude(FScrollDirections, sdUp); + end; + + if sdDown in FScrollDirections then + begin + if Panning then + DeltaY := FLastClickPos.Y - ClientP.Y + 8 + else + if InRect then + DeltaY := -Min(FScrollBarOptions.FIncrementY, ClientHeight) + else + DeltaY := -Min(FScrollBarOptions.FIncrementY, ClientHeight) * Abs(P.Y - R.Bottom); + if (ClientHeight - FOffsetY) = Integer(FRangeY) then + Exclude(FScrollDirections, sdDown); + end; + + if sdLeft in FScrollDirections then + begin + if Panning then + DeltaX := FLastClickPos.X - ClientP.X - 8 + else + if InRect then + DeltaX := FScrollBarOptions.FIncrementX + else + DeltaX := FScrollBarOptions.FIncrementX * Abs(R.Left - P.X); + if FEffectiveOffsetX = 0 then + Exclude(FScrollDirections, sdleft); + end; + + if sdRight in FScrollDirections then + begin + if Panning then + DeltaX := FLastClickPos.X - ClientP.X + 8 + else + if InRect then + DeltaX := -FScrollBarOptions.FIncrementX + else + DeltaX := -FScrollBarOptions.FIncrementX * Abs(P.X - R.Right); + + if (ClientWidth - FEffectiveOffsetX) = Integer(FRangeX) then + Exclude(FScrollDirections, sdRight); + end; + + if IsMouseSelecting then + begin + // In order to avoid scrolling the area which needs a repaint due to the changed selection rectangle + // we limit the scroll area explicitely. + OffsetRect(ClipRect, DeltaX, DeltaY); + DoSetOffsetXY(Point(FOffsetX + DeltaX, FOffsetY + DeltaY), DefaultScrollUpdateFlags, @ClipRect); + // When selecting with the mouse then either update only the parts of the window which have been uncovered + // by the scroll operation if no change in the selection happend or invalidate and redraw the entire + // client area otherwise (to avoid the time consuming task of determining the display rectangles of every + // changed node). + if CalculateSelectionRect(ClientP.X, ClientP.Y) and HandleDrawSelection(ClientP.X, ClientP.Y) then + InvalidateRect(Handle, nil, False) + else + begin + // The selection did not change so invalidate only the part of the window which really needs an update. + // 1) Invalidate the parts uncovered by the scroll operation. Add another offset range, we have to + // scroll only one stripe but have to update two. + OffsetRect(ClipRect, DeltaX, DeltaY); +//w SubtractRect(ClipRect, ClientRect, ClipRect); + InvalidateRect(Handle, @ClipRect, False); + + // 2) Invalidate the selection rectangles. + UnionRect(ClipRect, OrderRect(FNewSelRect), OrderRect(FLastSelRect)); + OffsetRect(ClipRect, FOffsetX, FOffsetY); + InvalidateRect(Handle, @ClipRect, False); + end; + end + else + begin + // Scroll only if there is no drag'n drop in progress. Drag'n drop scrolling is handled in DragOver. +//x if ((FDragManager = nil) or not DragManager.IsDropTarget) and ((DeltaX <> 0) or (DeltaY <> 0)) then +//x DoSetOffsetXY(Point(FOffsetX + DeltaX, FOffsetY + DeltaY), DefaultScrollUpdateFlags, nil); + end; + UpdateWindow(Handle); + + if (FScrollDirections = []) and ([tsWheelPanning, tsWheelScrolling] * FStates = []) then + begin + StopTimer(ScrollTimer); + DoStateChange([], [tsScrollPending, tsScrolling]); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DoUpdating(State: TVTUpdateState); + +begin + if Assigned(FOnUpdating) then + FOnUpdating(Self, State); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.DoValidateCache: Boolean; + +// This method fills the caches used in various situations to speed up search for nodes. +// The strategy is simple: Take the current number of visible nodes and distribute evenly a number of marks +// (which are stored in FPositionCache) so that iterating through the tree doesn't cost too much time. +// If there are less than 'CacheThreshold' nodes in the tree then the cache remains empty. +// Result is True if the cache was filled without interruption, otherwise False. +// Note: You can adjust the maximum number of nodes between two cache entries by changing CacheThreshold. + +var + EntryCount, + CurrentTop, + Index: Cardinal; + CurrentNode, + Temp: PVirtualNode; + +begin + EntryCount := 0; + if not (tsStopValidation in FStates) then + begin + if FStartIndex = 0 then + FPositionCache := nil; + + if FVisibleCount > CacheThreshold then + begin + EntryCount := CalculateCacheEntryCount; + SetLength(FPositionCache, EntryCount); + if FStartIndex > EntryCount then + FStartIndex := EntryCount; + + // Optimize validation by starting with FStartIndex if set. + if (FStartIndex > 0) and Assigned(FPositionCache[FStartIndex - 1].Node) then + begin + // Index is the current entry in FPositionCache. + Index := FStartIndex - 1; + // Running term for absolute top value. + CurrentTop := FPositionCache[Index].AbsoluteTop; + // Running node pointer. + CurrentNode := FPositionCache[Index].Node; + end + else + begin + // Index is the current entry in FPositionCache. + Index := 0; + // Running term for absolute top value. + CurrentTop := 0; + // Running node pointer. + CurrentNode := GetFirstVisibleNoInit; + end; + + // EntryCount serves as counter for processed nodes here. This value can always start at 0 as + // the validation either starts also at index 0 or an index which is always a multiple of CacheThreshold + // and EntryCount is only used with modulo CacheThreshold. + EntryCount := 0; + if Assigned(CurrentNode) then + begin + while not (tsStopValidation in FStates) do + begin + if (EntryCount mod CacheThreshold) = 0 then + begin + // New cache entry to set up. + with FPositionCache[Index] do + begin + Node := CurrentNode; + AbsoluteTop := CurrentTop; + end; + Inc(Index); + end; + + Inc(CurrentTop, NodeHeight[CurrentNode]); + // Advance to next visible node. + Temp := GetNextVisibleNoInit(CurrentNode); + // If there is no further node or the cache is full then stop the loop. + if (Temp = nil) or (Integer(Index) = Length(FPositionCache)) then + Break; + + CurrentNode := Temp; + Inc(EntryCount); + end; + end; + // Finalize the position cache so no nil entry remains there. + if not (tsStopValidation in FStates) and (Integer(Index) <= High(FPositionCache)) then + begin + SetLength(FPositionCache, Index + 1); + with FPositionCache[Index] do + begin + Node := CurrentNode; + AbsoluteTop := CurrentTop; + end; + end; + end; + end; + + Result := (EntryCount > 0) and not (tsStopValidation in FStates); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DrawDottedHLine(const PaintInfo: TVTPaintInfo; xLeft, Right, xTop: Integer); + +// Draws a horizontal line with alternating pixels (this style is not supported for pens under Win9x). + +{var + R: TRect; + OldBrush : TBrush;} + procedure DrawHorzLine(X1,Y1,X2: integer); +const + xColor = clGray; + begin + if X2= 0 then + L := LowBound; + H := FSelectionCount - 1; + if HighBound >= 0 then + H := HighBound; + while L <= H do + begin + I := (L + H) shr 1; + C := Integer(FSelection[I]) - Integer(P); + if C < 0 then + L := I + 1 + else + begin + H := I - 1; + if C = 0 then + begin + Result := True; + L := I; + end; + end; + end; + Index := L; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.FinishChunkHeader(Stream: TStream; StartPos, EndPos: Integer); + +// used while streaming out a node to finally write out the size of the chunk + +var + Size: Integer; + +begin + // seek back to the second entry in the chunk header + Stream.Position := StartPos + SizeOf(Integer); + // determine size of chunk without the chunk header + Size := EndPos - StartPos - SizeOf(TChunkHeader); + // write the size... + Stream.Write(Size, SizeOf(Size)); + // ... and seek to the last endposition + Stream.Position := EndPos; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.FontChanged(AFont: TObject); + +// Little helper function for font changes (as they are not tracked in TBitmap/TCanvas.OnChange). + +begin + FFontChanged := True; + if Assigned(FOldFontChange) then + FOldFontChange(AFont); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetBorderDimensions: TSize; + +// Returns the overall width of the current window border, depending on border styles. +// Note: these numbers represent the system's standards not special properties, which can be set for TWinControl +// (e.g. bevels, border width). + +var + Styles: Integer; + +begin + Result.cx := 0; + Result.cy := 0; + + Styles := GetWindowLong(Handle, GWL_STYLE); + if (Styles and WS_BORDER) <> 0 then + begin + Dec(Result.cx); + Dec(Result.cy); + end; + if (Styles and WS_THICKFRAME) <> 0 then + begin + Dec(Result.cx, GetSystemMetrics(SM_CXFIXEDFRAME)); + Dec(Result.cy, GetSystemMetrics(SM_CYFIXEDFRAME)); + end; + Styles := GetWindowLong(Handle, GWL_EXSTYLE); + if (Styles and WS_EX_CLIENTEDGE) <> 0 then + begin + Dec(Result.cx, GetSystemMetrics(SM_CXEDGE)); + Dec(Result.cy, GetSystemMetrics(SM_CYEDGE)); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetCheckImage(Node: PVirtualNode): Integer; + +// Determines the index into the check image list for the given node depending on the check type +// and enabled state. + +const + // Four dimensional array consisting of image indices for the check type, the check state, the enabled state and the + // hot state. + CheckStateToCheckImage: array[ctCheckBox..ctButton, csUncheckedNormal..csMixedPressed, Boolean, Boolean] of Integer = ( + // ctCheckBox, ctTriStateCheckBox + ( + // csUncheckedNormal (disabled [not hot, hot], enabled [not hot, hot]) + ((ckCheckUncheckedDisabled, ckCheckUncheckedDisabled), (ckCheckUncheckedNormal, ckCheckUncheckedHot)), + // csUncheckedPressed (disabled [not hot, hot], enabled [not hot, hot]) + ((ckCheckUncheckedDisabled, ckCheckUncheckedDisabled), (ckCheckUncheckedPressed, ckCheckUncheckedPressed)), + // csCheckedNormal + ((ckCheckCheckedDisabled, ckCheckCheckedDisabled), (ckCheckCheckedNormal, ckCheckCheckedHot)), + // csCheckedPressed + ((ckCheckCheckedDisabled, ckCheckCheckedDisabled), (ckCheckCheckedPressed, ckCheckCheckedPressed)), + // csMixedNormal + ((ckCheckMixedDisabled, ckCheckMixedDisabled), (ckCheckMixedNormal, ckCheckMixedHot)), + // csMixedPressed + ((ckCheckMixedDisabled, ckCheckMixedDisabled), (ckCheckMixedPressed, ckCheckMixedPressed)) + ), + // ctRadioButton + ( + // csUncheckedNormal (disabled [not hot, hot], enabled [not hot, hot]) + ((ckRadioUncheckedDisabled, ckRadioUncheckedDisabled), (ckRadioUncheckedNormal, ckRadioUncheckedHot)), + // csUncheckedPressed (disabled [not hot, hot], enabled [not hot, hot]) + ((ckRadioUncheckedDisabled, ckRadioUncheckedDisabled), (ckRadioUncheckedPressed, ckRadioUncheckedPressed)), + // csCheckedNormal + ((ckRadioCheckedDisabled, ckRadioCheckedDisabled), (ckRadioCheckedNormal, ckRadioCheckedHot)), + // csCheckedPressed + ((ckRadioCheckedDisabled, ckRadioCheckedDisabled), (ckRadioCheckedPressed, ckRadioCheckedPressed)), + // csMixedNormal (should never appear with ctRadioButton) + ((ckCheckMixedDisabled, ckCheckMixedDisabled), (ckCheckMixedNormal, ckCheckMixedHot)), + // csMixedPressed (should never appear with ctRadioButton) + ((ckCheckMixedDisabled, ckCheckMixedDisabled), (ckCheckMixedPressed, ckCheckMixedPressed)) + ), + // ctButton + ( + // csUncheckedNormal (disabled [not hot, hot], enabled [not hot, hot]) + ((ckButtonDisabled, ckButtonDisabled), (ckButtonNormal, ckButtonHot)), + // csUncheckedPressed (disabled [not hot, hot], enabled [not hot, hot]) + ((ckButtonDisabled, ckButtonDisabled), (ckButtonPressed, ckButtonPressed)), + // csCheckedNormal + ((ckButtonDisabled, ckButtonDisabled), (ckButtonNormal, ckButtonHot)), + // csCheckedPressed + ((ckButtonDisabled, ckButtonDisabled), (ckButtonPressed, ckButtonPressed)), + // csMixedNormal (should never appear with ctButton) + ((ckCheckMixedDisabled, ckCheckMixedDisabled), (ckCheckMixedNormal, ckCheckMixedHot)), + // csMixedPressed (should never appear with ctButton) + ((ckCheckMixedDisabled, ckCheckMixedDisabled), (ckCheckMixedPressed, ckCheckMixedPressed)) + ) + ); + +var + AType: TCheckType; + +begin + if Node^.CheckType = ctNone then + Result := -1 + else + begin + AType := Node^.CheckType; + if AType = ctTriStateCheckBox then + AType := ctCheckBox; + Result := CheckStateToCheckImage[AType, Node^.CheckState, not (vsDisabled in Node^.States) and Enabled, + Node = FCurrentHotNode]; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetColumnClass: TVirtualTreeColumnClass; + +begin + Result := TVirtualTreeColumn; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetHeaderClass: TVTHeaderClass; + +begin + Result := TVTHeader; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetImageIndex(Node: PVirtualNode; Kind: TVTImageKind; Column: TColumnIndex; + var Ghosted: Boolean): Integer; + +begin + Result := -1; + Ghosted := False; + DoGetImageIndex(Node, Kind, Column, Ghosted, Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetMaxRightExtend: Cardinal; + +// Determines the maximum with of the currently visible part of the tree, depending on the length +// of the node texts. This method is used for determining the horizontal scroll range if no columns are used. + +var + Node, + NextNode: PVirtualNode; + TopPosition: Integer; + NodeLeft, + CurrentWidth: Integer; + WithCheck: Boolean; + CheckOffset: Integer; + +begin + Node := GetNodeAt(0, 0, True, TopPosition); + Result := 0; + if toShowRoot in FOptions.FPaintOptions then + NodeLeft := (GetNodeLevel(Node) + 1) * FIndent + else + NodeLeft := GetNodeLevel(Node) * FIndent; + + if Assigned(FStateImages) then + Inc(NodeLeft, FStateImages.Width + 2); + if Assigned(FImages) then + Inc(NodeLeft, FImages.Width + 2); + WithCheck := (toCheckSupport in FOptions.FMiscOptions) and Assigned(FCheckImages); + if WithCheck then + CheckOffset := FCheckImages.Width + 2 + else + CheckOffset := 0; + + while Assigned(Node) do + begin + if not (vsInitialized in Node^.States) then + InitNode(Node); + + if WithCheck and (Node^.CheckType <> ctNone) then + Inc(NodeLeft, CheckOffset); + CurrentWidth := DoGetNodeWidth(Node, NoColumn); + if Integer(Result) < (NodeLeft + CurrentWidth) then + Result := NodeLeft + CurrentWidth; + Inc(TopPosition, NodeHeight[Node]); + if TopPosition > Height then + Break; + + if WithCheck and (Node^.CheckType <> ctNone) then + Dec(NodeLeft, CheckOffset); + + // Get next visible node and update left node position. + NextNode := GetNextVisible(Node); + if NextNode = nil then + Break; + Inc(NodeLeft, CountLevelDifference(Node, NextNode) * Integer(FIndent)); + Node := NextNode; + end; + + Inc(Result, 2 * FMargin); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.GetNativeClipboardFormats(var Formats: TFormatEtcArray); + +// Returns the supported clipboard formats of the tree. + +begin + InternalClipboardFormats.EnumerateFormats(TVirtualTreeClass(ClassType), Formats, FClipboardFormats); + // Ask application/descentants for self defined formats. + DoGetUserClipboardFormats(Formats); +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetOptionsClass: TTreeOptionsClass; + +begin + Result := TVirtualTreeOptions; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.GetTextInfo(Node: PVirtualNode; Column: TColumnIndex; const AFont: TFont; var R: TRect; + var xText: WideString); + +// Generic base method for editors, hint windows etc. to get some info about a node. + +begin + R := Rect(0, 0, 0, 0); + xText := ''; + AFont.Assign(Font); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.HandleHotTrack(X, Y: Integer); + +// Updates the current "hot" node. + +var + HitInfo: THitInfo; + DoInvalidate: Boolean; + +begin + // Get information about the hit. + GetHitTestInfoAt(X, Y, True, HitInfo); + // Only make the new node being "hot" if its label is hit or full row selection is enabled. + if ([hiOnItemLabel, hiOnItemCheckbox] * HitInfo.HitPositions = []) and + not (toFullRowSelect in FOptions.FSelectionOptions) then + HitInfo.HitNode := nil; + if HitInfo.HitNode <> FCurrentHotNode then + begin + DoInvalidate := (toHotTrack in FOptions.PaintOptions) or (toCheckSupport in FOptions.FMiscOptions); + DoHotChange(FCurrentHotNode, HitInfo.HitNode); + if Assigned(FCurrentHotNode) and DoInvalidate then + InvalidateNode(FCurrentHotNode); + FCurrentHotNode := HitInfo.HitNode; + if Assigned(FCurrentHotNode) and DoInvalidate then + InvalidateNode(FCurrentHotNode); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.HandleIncrementalSearch(CharCode: Word); + +var + Run, Stop: PVirtualNode; + GetNextNode: TGetNextNodeProc; + NewSearchText: WideString; + SingleLetter, + PreviousSearch: Boolean; // True if VK_BACK was sent. + SearchDirection: TVTSearchDirection; + + //--------------- local functions ------------------------------------------- + + procedure SetupNavigation; + + // If the search buffer is empty then we start searching with the next node after the last one, otherwise + // we continue with the last one. Node navigation function is set up too here, to avoid frequent checks. + + var + FindNextNode: Boolean; + + begin + FindNextNode := (Length(FSearchBuffer) = 0) or (Run = nil) or SingleLetter or PreviousSearch; + case FIncrementalSearch of + isVisibleOnly: + if SearchDirection = sdForward then + begin + GetNextNode := @GetNextVisible; + if FindNextNode then + begin + if Run = nil then + Run := GetFirstVisible + else + begin + Run := GetNextVisible(Run); + // Do wrap around. + if Run = nil then + Run := GetFirstVisible; + end; + end; + end + else + begin + GetNextNode := @GetPreviousVisible; + if FindNextNode then + begin + if Run = nil then + Run := GetLastVisible + else + begin + Run := GetPreviousVisible(Run); + // Do wrap around. + if Run = nil then + Run := GetLastVisible; + end; + end; + end; + isInitializedOnly: + if SearchDirection = sdForward then + begin + GetNextNode := @GetNextNoInit; + if FindNextNode then + begin + if Run = nil then + Run := GetFirstNoInit + else + begin + Run := GetNextNoInit(Run); + // Do wrap around. + if Run = nil then + Run := GetFirstNoInit; + end; + end; + end + else + begin + GetNextNode := @GetPreviousNoInit; + if FindNextNode then + begin + if Run = nil then + Run := GetLastNoInit + else + begin + Run := GetPreviousNoInit(Run); + // Do wrap around. + if Run = nil then + Run := GetLastNoInit; + end; + end; + end; + else + // isAll + if SearchDirection = sdForward then + begin + GetNextNode := @GetNext; + if FindNextNode then + begin + if Run = nil then + Run := GetFirst + else + begin + Run := GetNext(Run); + // Do wrap around. + if Run = nil then + Run := GetFirst; + end; + end; + end + else + begin + GetNextNode := @GetPrevious; + if FindNextNode then + begin + if Run = nil then + Run := GetLast + else + begin + Run := GetPrevious(Run); + // Do wrap around. + if Run = nil then + Run := GetLast; + end; + end; + end; + end; + end; + + //--------------------------------------------------------------------------- + + {todofunction CodePageFromLocale(Language: LCID): Integer; + + // Determines the code page for a given locale. + // Unfortunately there is no easier way than this, currently. + + var + Buf: array[0..6] of Char; + + begin + GetLocaleInfo(Language, LOCALE_IDEFAULTANSICODEPAGE, Buf, 6); + Result := StrToIntDef(Buf, GetACP); + end; + + //--------------------------------------------------------------------------- + + function KeyUnicode(C: Char): WideChar; + + // Converts the given character into its corresponding Unicode character + // depending on the active keyboard layout. + + begin + MultiByteToWideChar(CodePageFromLocale(GetKeyboardLayout(0) and $FFFF), + MB_USEGLYPHCHARS, @C, 1, @Result, 1); + end;} + + //--------------- end local functions --------------------------------------- + +var + FoundMatch: Boolean; + NewChar: WideChar; + +begin + StopTimer(SearchTimer); + + if FIncrementalSearch <> isNone then + begin + if CharCode <> 0 then + begin + DoStateChange([tsIncrementalSearching]); + + // Convert the given virtual key code into a Unicode character based on the current locale. + NewChar := {todoKeyUnicode(}Char(CharCode){)}; + PreviousSearch := NewChar = WideChar(VK_BACK); + // We cannot do a search with an empty search buffer. + if not PreviousSearch or (Length(FSearchBuffer) > 1) then + begin + // Determine which method to use to advance nodes and the start node to search from. + case FSearchStart of + ssAlwaysStartOver: + Run := nil; + ssFocusedNode: + Run := FFocusedNode; + else // ssLastHit + Run := FLastSearchNode; + end; + + // Make sure the start node corresponds to the search criterion. + if Assigned(Run) then + begin + case FIncrementalSearch of + isInitializedOnly: + if not (vsInitialized in Run^.States) then + Run := nil; + isVisibleOnly: + if not FullyVisible[Run] then + Run := nil; + end; + end; + Stop := Run; + + // VK_BACK temporarily changes search direction to opposite mode. + if PreviousSearch then + begin + if SearchDirection = sdBackward then + SearchDirection := sdForward + else + SearchDirection := sdBackward + end + else + SearchDirection := FSearchDirection; + // The "single letter mode" is used to advance quickly from node to node when pressing the same key several times. + SingleLetter := (Length(FSearchBuffer) = 1) and not PreviousSearch and (FSearchBuffer[1] = NewChar); + // However if the current hit (if there is one) would fit also with a repeated character then + // don't use single letter mode. + if SingleLetter and (DoIncrementalSearch(Run, FSearchBuffer + NewChar) = 0) then + SingleLetter := False; + SetupNavigation; + FoundMatch := False; + + if Assigned(Run) then + begin + if SingleLetter then + NewSearchText := FSearchBuffer + else + if PreviousSearch then + begin + SetLength(FSearchBuffer, Length(FSearchBuffer) - 1); + NewSearchText := FSearchBuffer; + end + else + NewSearchText := FSearchBuffer + NewChar; + + repeat + if DoIncrementalSearch(Run, NewSearchText) = 0 then + begin + FoundMatch := True; + Break; + end; + + // Advance to next node if we have not found a match. + Run := GetNextNode(Run); + // Do wrap around start or end of tree. + if (Run <> Stop) and (Run = nil) then + SetupNavigation; + until Run = Stop; + end; + + if FoundMatch then + begin + ClearSelection; + FSearchBuffer := NewSearchText; + FLastSearchNode := Run; + FocusedNode := Run; + Selected[Run] := True; + FLastSearchNode := Run; + end + else + // Play an acoustic signal if nothing could be found but don't beep if only the currently + // focused node matches. + if Assigned(Run) and (DoIncrementalSearch(Run, NewSearchText) <> 0) then + Beep; + end; + end; + + // Restart search timeout interval. + StartTimer(SearchTimer, FSearchTimeout); +// SetTimer(Handle, SearchTimer, FSearchTimeout, nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.HandleMouseDblClick(var Message: TLMMouse; const HitInfo: THitInfo); + +var + NewCheckState: TCheckState; + +begin + if tsEditPending in FStates then + begin + StopTimer(EditTimer); + DoStateChange([], [tsEditPending]); + end; + + if not (tsEditing in FStates) or DoEndEdit then + begin + if HitInfo.HitColumn = FHeader.FColumns.FClickIndex then + DoColumnDblClick(HitInfo.HitColumn, KeysToShiftState(Message.Keys)); + + if hiOnItemCheckBox in HitInfo.HitPositions then + begin + if (FStates * [tsMouseCheckPending, tsKeyCheckPending] = []) and not (vsDisabled in HitInfo.HitNode^.States) then + begin + with HitInfo.HitNode^ do + NewCheckState := DetermineNextCheckState(CheckType, CheckState); + if DoChecking(HitInfo.HitNode, NewCheckState) then + begin + DoStateChange([tsMouseCheckPending]); + FCheckNode := HitInfo.HitNode; + FPendingCheckState := NewCheckState; + FCheckNode^.CheckState := PressedState[FCheckNode^.CheckState]; + InvalidateNode(HitInfo.HitNode); + end; + end; + end + else + begin + if hiOnItemButton in HitInfo.HitPositions then + ToggleNode(HitInfo.HitNode) + else + begin + if toToggleOnDblClick in FOptions.FMiscOptions then + begin + if ((([hiOnItemButton, hiOnItemLabel, hiOnNormalIcon, hiOnStateIcon] * HitInfo.HitPositions) <> []) or + ((toFullRowSelect in FOptions.FSelectionOptions) and Assigned(HitInfo.HitNode))) then + ToggleNode(HitInfo.HitNode); + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.HandleMouseDown(var Message: TLMMouse; const HitInfo: THitInfo); + +// centralized mouse button down handling + +var + LastFocused: PVirtualNode; + Column: TColumnIndex; + ShiftState: TShiftState; + + // helper variables to shorten boolean equations/expressions + AutoDrag, // automatic (or allowed) drag start + IsHit, // the node's caption or images are hit + IsCellHit, // for grid extension or full row select (but not check box, button) + IsAnyHit, // either IsHit or IsCellHit + MultiSelect, // multiselection is enabled + ShiftEmpty, // ShiftState = [] + NodeSelected: Boolean; // the new node (if any) is selected + NewColumn: Boolean; // column changed + NeedChange: Boolean; // change event is required for selection change + CanClear: Boolean; + NewCheckState: TCheckState; + AltPressed: Boolean; // Pressing the Alt key enables special processing for selection. + FullRowDrag: Boolean; // Start dragging anywhere within a node's bound. + +begin + if [tsWheelPanning, tsWheelScrolling] * FStates <> [] then + begin + StopWheelPanning; + Exit; + end; + + if tsEditPending in FStates then + begin + StopTimer(EditTimer); + DoStateChange([], [tsEditPending]); + end; + + if not (tsEditing in FStates) or DoEndEdit then + begin + // Focus change. + if not Focused and CanFocus then + SetFocus; + + // Keep clicked column in case the application needs it. + FHeader.FColumns.FClickIndex := HitInfo.HitColumn; + + // Change column only if we have hit the node label. + if (hiOnItemLabel in HitInfo.HitPositions) or + (toFullRowSelect in FOptions.FSelectionOptions) or + (toGridExtensions in FOptions.FMiscOptions) then + begin + NewColumn := FFocusedColumn <> HitInfo.HitColumn; + if toExtendedFocus in FOptions.FSelectionOptions then + Column := HitInfo.HitColumn + else + Column := FHeader.MainColumn; + end + else + begin + NewColumn := False; + Column := FFocusedColumn; + end; + + // Translate keys and filter out shift and control key. + ShiftState := KeysToShiftState(Message.Keys) * [ssShift, ssCtrl, ssAlt]; + if ssAlt in ShiftState then + begin + AltPressed := True; + // Remove the Alt key from the shift state. It is not meaningful there. + Exclude(ShiftState, ssAlt); + end + else + AltPressed := False; + + // Various combinations determine what states the tree enters now. + // We initialize shorthand variables to avoid the following expressions getting too large + // and to avoid repeative expensive checks. + IsHit := not AltPressed and ((hiOnItemLabel in HitInfo.HitPositions) or (hiOnNormalIcon in HitInfo.HitPositions)); + IsCellHit := not AltPressed and not IsHit and Assigned(HitInfo.HitNode) and + ([hiOnItemButton, hiOnItemCheckBox] * HitInfo.HitPositions = []) and + ((toFullRowSelect in FOptions.FSelectionOptions) or (toGridExtensions in FOptions.FMiscOptions)); + IsAnyHit := IsHit or IsCellHit; + MultiSelect := toMultiSelect in FOptions.FSelectionOptions; + ShiftEmpty := ShiftState = []; + NodeSelected := IsAnyHit and (vsSelected in HitInfo.HitNode^.States); + FullRowDrag := toFullRowDrag in FOptions.FMiscOptions; + + // Dragging might be started in the inherited handler manually (which is discouraged for stability reasons) + // the test for manual mode is done below (after the focused node is set). + AutoDrag := ((DragMode = dmAutomatic) or Dragging) and (not IsCellHit or FullRowDrag); + + // handle button clicks + if (hiOnItemButton in HitInfo.HitPositions) and (vsHasChildren in HitInfo.HitNode^.States) then + begin + ToggleNode(HitInfo.HitNode); + Exit; + end; + + // check event + if hiOnItemCheckBox in HitInfo.HitPositions then + begin + if (FStates * [tsMouseCheckPending, tsKeyCheckPending] = []) and not (vsDisabled in HitInfo.HitNode^.States) then + begin + with HitInfo.HitNode^ do + NewCheckState := DetermineNextCheckState(CheckType, CheckState); + if DoChecking(HitInfo.HitNode, NewCheckState) then + begin + DoStateChange([tsMouseCheckPending]); + FCheckNode := HitInfo.HitNode; + FPendingCheckState := NewCheckState; + FCheckNode^.CheckState := PressedState[FCheckNode^.CheckState]; + InvalidateNode(HitInfo.HitNode); + end; + end; + Exit; + end; + + // Keep this node's level in case we need it for constraint selection. + if (FRoot^.ChildCount > 0) and ShiftEmpty or (FSelectionCount = 0) then + if Assigned(HitInfo.HitNode) then + FLastSelectionLevel := GetNodeLevel(HitInfo.HitNode) + else + FLastSelectionLevel := GetNodeLevel(GetLastVisibleNoInit); + + // pending clearance + if MultiSelect and ShiftEmpty and not (hiOnItemCheckbox in HitInfo.HitPositions) and + (IsHit and ShiftEmpty and AutoDrag and NodeSelected) then + DoStateChange([tsClearPending]); + + // immediate clearance + // Determine for the right mouse button if there is a popup menu. In this case and if drag'n drop is pending + // the current selection has to stay as it is. + with HitInfo, Message do + CanClear := not AutoDrag and + (not (tsRightButtonDown in FStates) or not HasPopupMenu(HitNode, HitColumn, Point(XPos, YPos))); + if (not (IsAnyHit or FullRowDrag) and MultiSelect and ShiftEmpty) or + (IsAnyHit and (not NodeSelected or (NodeSelected and CanClear)) and (ShiftEmpty or not MultiSelect)) then + begin + Assert(not (tsClearPending in FStates), 'Pending and direct clearance are mutual exclusive!'); + + // If the currently hit node was already selected then we have to reselect it again after clearing the current + // selection, but without a change event if it is the only selected node. + // The same applies if the Alt key is pressed, which allows to start drawing the selection rectangle also + // on node captions and images. Here the previous selection state does not matter, though. + if NodeSelected or (AltPressed and (HitInfo.HitColumn = FHeader.MainColumn)) then + begin + NeedChange := FSelectionCount > 1; + InternalClearSelection; + InternalAddToSelection(HitInfo.HitNode, True); + if NeedChange then + begin + Invalidate; + Change(nil); + end; + end + else + ClearSelection; + end; + + // pending node edit + if Focused and + ((hiOnItemLabel in HitInfo.HitPositions) or ((toGridExtensions in FOptions.FMiscOptions) and + (hiOnItem in HitInfo.HitPositions))) and NodeSelected and not NewColumn and ShiftEmpty then + DoStateChange([tsEditPending]); + + // User starts a selection with a selection rectangle. + if not (toDisableDrawSelection in FOptions.FSelectionOptions) and not (IsHit or FullRowDrag) and MultiSelect then + begin + SetCapture(Handle); + DoStateChange([tsDrawSelPending]); + FDrawSelShiftState := ShiftState; + FNewSelRect := Rect(Message.XPos - FEffectiveOffsetX, Message.YPos - FOffsetY, Message.XPos - FEffectiveOffsetX, + Message.YPos - FOffsetY); + FLastSelRect := Rect(0, 0, 0, 0); + if not IsCellHit then + Exit; + end; + + // Keep current mouse position. + FLastClickPos := Point(Message.XPos, Message.YPos); + + // Handle selection and node focus change. + if (IsHit or IsCellHit) and + DoFocusChanging(FFocusedNode, HitInfo.HitNode, FFocusedColumn, Column) then + begin + if NewColumn then + begin + InvalidateColumn(FFocusedColumn); + InvalidateColumn(Column); + FFocusedColumn := Column; + end; + if DragKind = dkDock then + begin + StopTimer(ScrollTimer); + DoStateChange([], [tsScrollPending, tsScrolling]); + end; + // Get the currently focused node to make multiple multi-selection blocks possible. + LastFocused := FFocusedNode; + DoFocusNode(HitInfo.HitNode, False); + + if MultiSelect and not ShiftEmpty then + HandleClickSelection(LastFocused, HitInfo.HitNode, ShiftState, AutoDrag) + else + begin + if ShiftEmpty then + FRangeAnchor := HitInfo.HitNode; + + // If the hit node is not yet selected then do it now. + if not NodeSelected then + AddToSelection(HitInfo.HitNode); + end; + + DoFocusChange(FFocusedNode, FFocusedColumn); + end; + + // Drag'n drop initiation + // If we lost focus in the interim the button states would be cleared in WM_KILLFOCUS. + if AutoDrag and (FStates * [tsLeftButtonDown, tsRightButtonDown, tsMiddleButtonDown] <> []) then + BeginDrag(False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.HandleMouseUp(var Message: TLMMouse; const HitInfo: THitInfo); + +// Counterpart to the mouse down handler. + +var + ReselectFocusedNode: Boolean; + +begin + ReleaseCapture; + + if not (tsVCLDragPending in FStates) then + begin + // reset pending or persistent states + if IsMouseSelecting then + begin + DoStateChange([], [tsDrawSelecting, tsDrawSelPending, tsToggleFocusedSelection]); + Invalidate; + end; + + if tsClearPending in FStates then + begin + ReselectFocusedNode := Assigned(FFocusedNode) and (vsSelected in FFocusedNode^.States); + ClearSelection; + if ReselectFocusedNode then + AddToSelection(FFocusedNode); + end; + + if (tsToggleFocusedSelection in FStates) and (HitInfo.HitNode = FFocusedNode) then + begin + if vsSelected in HitInfo.HitNode^.States then + RemoveFromSelection(HitInfo.HitNode) + else + AddToSelection(HitInfo.HitNode); + InvalidateNode(HitInfo.HitNode); + end; + + DoStateChange([], [tsOLEDragPending, tsOLEDragging, tsClearPending, tsDrawSelPending, tsToggleFocusedSelection, + tsScrollPending, tsScrolling]); + StopTimer(ScrollTimer); + + if tsMouseCheckPending in FStates then + begin + DoStateChange([], [tsMouseCheckPending]); + // Is the mouse still over the same node? + if (HitInfo.HitNode = FCheckNode) and (hiOnItem in HitInfo.HitPositions) then + DoCheckClick(FCheckNode, FPendingCheckState) + else + FCheckNode^.CheckState := UnpressedState[FCheckNode^.CheckState]; + InvalidateNode(FCheckNode); + FCheckNode := nil; + end; + + if (FHeader.FColumns.FClickIndex > NoColumn) and (FHeader.FColumns.FClickIndex = HitInfo.HitColumn) then + DoColumnClick(HitInfo.HitColumn, KeysToShiftState(Message.Keys)); + + // handle a pending edit event + if tsEditPending in FStates then + begin + // Is the mouse still over the same node? + if (HitInfo.HitNode = FFocusedNode) and (hiOnItem in HitInfo.HitPositions) and + CanEdit(FFocusedNode, HitInfo.HitColumn) then + begin + FEditColumn := FFocusedColumn; + StartTimer(EditTimer, FEditDelay); +// SetTimer(Handle, EditTimer, FEditDelay, nil); + end + else + DoStateChange([], [tsEditPending]); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.HasPopupMenu(Node: PVirtualNode; Column: TColumnIndex; Pos: TPoint): Boolean; + +// Determines whether the tree got a popup menu, either in its PopupMenu property, via the OnGetPopupMenu event or +// through inheritannce. The latter case must be checked by the descendant which must override this method. + +begin + Result := Assigned(PopupMenu) or Assigned(DoGetPopupMenu(Node, Column, Pos)); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InitChildren(Node: PVirtualNode); + +// Initiates the initialization of the child number of the given node. + +var + Count: Cardinal; + +begin + if Assigned(Node) and (Node <> FRoot) and (vsHasChildren in Node^.States) then + begin + Count := Node^.ChildCount; + DoInitChildren(Node, Count); + if Count = 0 then + begin + // Remove any child node which is already there. + DeleteChildren(Node); + Exclude(Node^.States, vsHasChildren); + end + else + SetChildCount(Node, Count); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InitNode(Node: PVirtualNode); + +// Initiates the initialization of the given node to allow the application to load needed data for it. + +var + InitStates: TVirtualNodeInitStates; + +begin + with Node^ do + begin + Include(States, vsInitialized); + InitStates := []; + if Parent = FRoot then + DoInitNode(nil, Node, InitStates) + else + DoInitNode(Parent, Node, InitStates); + if ivsDisabled in InitStates then + Include(States, vsDisabled); + if ivsHasChildren in InitStates then + Include(States, vsHasChildren); + if ivsSelected in InitStates then + begin + FSingletonNodeArray[0] := Node; + InternalAddToSelection(FSingletonNodeArray, 1, False); + end; + if ivsMultiline in InitStates then + Include(States, vsMultiline); + + // Expanded may already be set (when called from ReinitNode) or be set in DoInitNode, allow both. + if (vsExpanded in Node^.States) xor (ivsExpanded in InitStates) then + begin + // Expand node if not yet done (this will automatically initialize child nodes). + if ivsExpanded in InitStates then + ToggleNode(Node) + else + // If the node already was expanded then explicitly trigger child initialization. + if vsHasChildren in Node^.States then + InitChildren(Node); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InternalAddFromStream(Stream: TStream; Version: Integer; Node: PVirtualNode); + +// Loads nodes from the given stream and adds them as children to Node. +// Because the new nodes might be selected this method also fixes the selection array. + +var + Stop: PVirtualNode; + LastVisibleCount: Cardinal; + Index: Integer; + +begin + if Node = nil then + Node := FRoot; + + // Read in the new nodes, keep number of visible nodes for a correction. + LastVisibleCount := FVisibleCount; + ReadNode(Stream, Version, Node); + + // I need to fix the visible count here because of the hierarchical load procedure. + if (Node = FRoot) or ([vsExpanded, vsVisible] * Node^.Parent^.States = [vsExpanded, vsVisible]) then + FVisibleCount := LastVisibleCount + CountVisibleChildren(Node) + else + FVisibleCount := LastVisibleCount; + + // Fix selection array. + ClearTempCache; + if Node = FRoot then + Stop := nil + else + Stop := Node^.NextSibling; + + if toMultiSelect in FOptions.FSelectionOptions then + begin + // Add all nodes which were selected before to the current selection (unless they are already there). + while Node <> Stop do + begin + if (vsSelected in Node^.States) and not FindNodeInSelection(Node, Index, 0, High(FSelection)) then + InternalCacheNode(Node); + Node := GetNextNoInit(Node); + end; + if FTempNodeCount > 0 then + AddToSelection(FTempNodeCache, FTempNodeCount, True); + ClearTempCache; + end + else // No further selected nodes allowed so delete the corresponding flag in all new nodes. + while Node <> Stop do + begin + Exclude(Node^.States, vsSelected); + Node := GetNextNoInit(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.InternalAddToSelection(Node: PVirtualNode; ForceInsert: Boolean): Boolean; + +begin + Assert(Assigned(Node), 'Node must not be nil!'); + FSingletonNodeArray[0] := Node; + Result := InternalAddToSelection(FSingletonNodeArray, 1, ForceInsert); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.InternalAddToSelection(NewItems: TNodeArray; NewLength: Integer; + ForceInsert: Boolean): Boolean; + +// Internal version of method AddToSelection which does not trigger OnChange events + +var + I, J: Integer; + CurrentEnd: Integer; + Constrained, + SiblingConstrained: Boolean; + +begin + + // The idea behind this code is to use a kind of reverse merge sort. QuickSort is quite fast + // and would do the job here too but has a serious problem with already sorted lists like FSelection. + + // 1) Remove already selected items, mark all other as being selected. + if ForceInsert then + begin + for I := 0 to NewLength - 1 do + Include(NewItems[I]^.States, vsSelected); + end + else + begin + Constrained := toLevelSelectConstraint in FOptions.FSelectionOptions; + if Constrained and (FLastSelectionLevel = -1) then + FLastSelectionLevel := GetNodeLevel(NewItems[0]); + SiblingConstrained := toSiblingSelectConstraint in FOptions.FSelectionOptions; + if SiblingConstrained and (FRangeAnchor = nil) then + FRangeAnchor := NewItems[0]; + + for I := 0 to NewLength - 1 do + if ([vsSelected, vsDisabled] * NewItems[I]^.States <> []) or + (Constrained and (Cardinal(FLastSelectionLevel) <> GetNodeLevel(NewItems[I]))) or + (SiblingConstrained and (FRangeAnchor^.Parent <> NewItems[I]^.Parent)) then + Inc(Cardinal(NewItems[I])) + else + Include(NewItems[I]^.States, vsSelected); + end; + + I := PackArray(NewItems, NewLength); + if I > -1 then + NewLength := I; + + Result := NewLength > 0; + if Result then + begin + // 2) Sort the new item list so we can easily traverse it. + if NewLength > 1 then + QuickSort(NewItems, 0, NewLength - 1); + // 3) Make room in FSelection for the new items. + if FSelectionCount + NewLength >= Length(FSelection) then + SetLength(FSelection, FSelectionCount + NewLength); + + // 4) Merge in new items + J := NewLength - 1; + CurrentEnd := FSelectionCount - 1; + + while J >= 0 do + begin + // First insert all new entries which are greater than the greatest entry in the old list. + // If the current end marker is < 0 then there's nothing more to move in the selection + // array and only the remaining new items must be inserted. + if CurrentEnd >= 0 then + begin + while (J >= 0) and (Cardinal(NewItems[J]) > Cardinal(FSelection[CurrentEnd])) do + begin + FSelection[CurrentEnd + J + 1] := NewItems[J]; + Dec(J); + end; + // early out if nothing more needs to be copied + if J < 0 then + Break; + end + else + begin + // insert remaining new entries at position 0 + Move(NewItems[0], FSelection[0], (J + 1) * SizeOf(Pointer)); + // nothing more to do so exit main loop + Break; + end; + + // find the last entry in the remaining selection list which is smaller then the largest + // entry in the remaining new items list + FindNodeInSelection(NewItems[J], I, 0, CurrentEnd); + Dec(I); + // move all entries which are greater than the greatest entry in the new items list up + // so the remaining gap travels down to where new items must be inserted + Move(FSelection[I + 1], FSelection[I + J + 2], (CurrentEnd - I) * SizeOf(Pointer)); + CurrentEnd := I; + end; + + Inc(FSelectionCount, NewLength); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InternalCacheNode(Node: PVirtualNode); + +// Adds the given node to the temporary node cache (used when collecting possibly large amounts of nodes). + +var + Len: Cardinal; + +begin + Len := Length(FTempNodeCache); + if FTempNodeCount = Len then + begin + if Len < 100 then + Len := 100 + else + Len := Len + Len div 10; + SetLength(FTempNodeCache, Len); + end; + FTempNodeCache[FTempNodeCount] := Node; + Inc(FTempNodeCount); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InternalClearSelection; + +var + Count: Integer; + +begin + // It is possible that there are invalid node references in the selection array + // if the tree update is locked and changes in the structure were made. + // Handle this potentially dangerous situation by packing the selection array explicitely. + if FUpdateCount > 0 then + begin + Count := PackArray(FSelection, FSelectionCount); + if Count > -1 then + begin + FSelectionCount := Count; + SetLength(FSelection, FSelectionCount); + end; + end; + + while FSelectionCount > 0 do + begin + Dec(FSelectionCount); + Exclude(FSelection[FSelectionCount]^.States, vsSelected); + end; + ResetRangeAnchor; + FSelection := nil; + DoStateChange([], [tsClearPending]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InternalConnectNode(Node, Destination: PVirtualNode; Target: TBaseVirtualTree; + Mode: TVTNodeAttachMode); + +// Connects Node with Destination depending on Mode. +// No error checking takes place. Node as well as Destination must be valid. Node must never be a root node and +// Destination must not be a root node if Mode is amInsertBefore or amInsertAfter. + +var + Run: PVirtualNode; + +begin + // Keep in mind that the destination node might belong to another tree. + with Target do + begin + case Mode of + amInsertBefore: + begin + Node^.PrevSibling := Destination^.PrevSibling; + Destination^.PrevSibling := Node; + Node^.NextSibling := Destination; + Node^.Parent := Destination^.Parent; + Node^.Index := Destination^.Index; + if Node^.PrevSibling = nil then + Node^.Parent^.FirstChild := Node + else + Node^.PrevSibling^.NextSibling := Node; + + // reindex all following nodes + Run := Destination; + while Assigned(Run) do + begin + Inc(Run^.Index); + Run := Run^.NextSibling; + end; + + Inc(Destination^.Parent^.ChildCount); + Include(Destination^.Parent^.States, vsHasChildren); + AdjustTotalCount(Destination^.Parent, Node^.TotalCount, True); + + // Add the new node's height only if its parent is expanded. + if vsExpanded in Destination^.Parent^.States then + AdjustTotalHeight(Destination^.Parent, Node^.TotalHeight, True); + if FullyVisible[Node] then + Inc(FVisibleCount, CountVisibleChildren(Node) + 1); + end; + amInsertAfter: + begin + Node^.NextSibling := Destination^.NextSibling; + Destination^.NextSibling := Node; + Node^.PrevSibling := Destination; + Node^.Parent := Destination^.Parent; + if Node^.NextSibling = nil then + Node^.Parent^.LastChild := Node + else + Node^.NextSibling^.PrevSibling := Node; + Node^.Index := Destination^.Index; + + // reindex all following nodes + Run := Node; + while Assigned(Run) do + begin + Inc(Run^.Index); + Run := Run^.NextSibling; + end; + + Inc(Destination^.Parent^.ChildCount); + Include(Destination^.Parent^.States, vsHasChildren); + AdjustTotalCount(Destination^.Parent, Node^.TotalCount, True); + + // Add the new node's height only if its parent is expanded. + if vsExpanded in Destination^.Parent^.States then + AdjustTotalHeight(Destination^.Parent, Node^.TotalHeight, True); + if FullyVisible[Node] then + Inc(FVisibleCount, CountVisibleChildren(Node) + 1); + end; + amAddChildFirst: + begin + if Assigned(Destination^.FirstChild) then + begin + // If there's a first child then there must also be a last child. + Destination^.FirstChild^.PrevSibling := Node; + Node^.NextSibling := Destination^.FirstChild; + Destination^.FirstChild := Node; + end + else + begin + // First child node at this location. + Destination^.FirstChild := Node; + Destination^.LastChild := Node; + Node^.NextSibling := nil; + end; + Node^.PrevSibling := nil; + Node^.Parent := Destination; + Node^.Index := 0; + // reindex all following nodes + Run := Node^.NextSibling; + while Assigned(Run) do + begin + Inc(Run^.Index); + Run := Run^.NextSibling; + end; + + Inc(Destination^.ChildCount); + Include(Destination^.States, vsHasChildren); + AdjustTotalCount(Destination, Node^.TotalCount, True); + // add the new node's height only if its parent is expanded (visibility is handled elsewhere) + if vsExpanded in Destination^.States then + AdjustTotalHeight(Destination, Node^.TotalHeight, True); + if FullyVisible[Node] then + Inc(FVisibleCount, CountVisibleChildren(Node) + 1); + end; + amAddChildLast: + begin + if Assigned(Destination^.LastChild) then + begin + // If there's a last child then there must also be a first child. + Destination^.LastChild^.NextSibling := Node; + Node^.PrevSibling := Destination^.LastChild; + Destination^.LastChild := Node; + end + else + begin + // first child node at this location + Destination^.FirstChild := Node; + Destination^.LastChild := Node; + Node^.PrevSibling := nil; + end; + Node^.NextSibling := nil; + Node^.Parent := Destination; + if Assigned(Node^.PrevSibling) then + Node^.Index := Node^.PrevSibling^.Index + 1 + else + Node^.Index := 0; + Inc(Destination^.ChildCount); + Include(Destination^.States, vsHasChildren); + AdjustTotalCount(Destination, Node^.TotalCount, True); + // Add the new node's height only if its parent is expanded (visibility is handled elsewhere). + if vsExpanded in Destination^.States then + AdjustTotalHeight(Destination, Node^.TotalHeight, True); + if FullyVisible[Node] then + Inc(FVisibleCount, CountVisibleChildren(Node) + 1); + end; + else + // amNoWhere: do nothing + end; + + // Remove temporary states. + Node^.States := Node^.States - [vsChecking, vsCutOrCopy, vsDeleting, vsClearing]; + + // Update the hidden children flag of the parent. + if (Mode <> amNoWhere) and (Node^.Parent <> FRoot) then + begin + // If we have added a visible node then simply remove the all-children-hidden flag. + if vsVisible in Node^.States then + Exclude(Node^.Parent^.States, vsAllChildrenHidden) + else + // If we have added an invisible node and this is the only child node then + // make sure the all-children-hidden flag is in a determined state. + // If there were child nodes before then no action is needed. + if Node^.Parent^.ChildCount = 1 then + Include(Node^.Parent^.States, vsAllChildrenHidden); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.InternalData(Node: PVirtualNode): Pointer; + +begin + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InternalDisconnectNode(Node: PVirtualNode; KeepFocus: Boolean; Reindex: Boolean = True); + +// Disconnects the given node from its parent and siblings. The node's pointer are not reset so they can still be used +// after return from this method (probably a very short time only!). +// If KeepFocus is True then the focused node is not reset. This is useful if the given node is reconnected to the tree +// immediately after return of this method and should stay being the focused node if it was it before. +// Note: Node must not be nil or the root node. + +var + xParent, + Run: PVirtualNode; + Index: Integer; + AdjustHeight: Boolean; + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Node must neither be nil nor the root node.'); + + if (Node = FFocusedNode) and not KeepFocus then + begin + DoFocusNode(nil, False); + DoFocusChange(FFocusedNode, FFocusedColumn); + end; + + if Node = FRangeAnchor then + ResetRangeAnchor; + + // Update the hidden children flag of the parent. + if (Node^.Parent <> FRoot) and not (vsClearing in Node^.Parent^.States) then + DetermineHiddenChildrenFlag(Node^.Parent); + + if not (vsDeleting in Node^.States) then + begin + // Some states are only temporary so take them out. + Node^.States := Node^.States - [vsChecking]; + xParent := Node^.Parent; + Dec(xParent^.ChildCount); + AdjustHeight := (vsExpanded in xParent^.States); + if xParent^.ChildCount = 0 then + begin + xParent^.States := xParent^.States - [vsAllChildrenHidden, vsHasChildren]; + if (xParent <> FRoot) and (vsExpanded in xParent^.States) then + begin + AdjustHeight := True; + Exclude(xParent^.States, vsExpanded); + end; + end; + AdjustTotalCount(xParent, -Integer(Node^.TotalCount), True); + if AdjustHeight then + AdjustTotalHeight(xParent, -Integer(Node^.TotalHeight), True); + if FullyVisible[Node] then + Dec(FVisibleCount, CountVisibleChildren(Node) + 1); + if Assigned(Node^.PrevSibling) then + Node^.PrevSibling^.NextSibling := Node^.NextSibling + else + xParent^.FirstChild := Node^.NextSibling; + + if Assigned(Node^.NextSibling) then + begin + Node^.NextSibling^.PrevSibling := Node^.PrevSibling; + // Reindex all following nodes. + if Reindex then + begin + Run := Node^.NextSibling; + Index := Node^.Index; + while Assigned(Run) do + begin + Run^.Index := Index; + Inc(Index); + Run := Run^.NextSibling; + end; + end; + end + else + xParent^.LastChild := Node^.PrevSibling; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InternalRemoveFromSelection(Node: PVirtualNode); + +// Special version to mark a node to be no longer in the current selection. PackArray must +// be used to remove finally those entries. + +var + Index: Integer; + +begin + // Because pointers are always DWORD aligned we can simply increment all those + // which we want to have removed (see also PackArray) and still have the + // order in the list preserved. + if FindNodeInSelection(Node, Index, -1, -1) then + begin + Exclude(Node^.States, vsSelected); + Inc(Cardinal(FSelection[Index])); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InvalidateCache; + +// Marks the cache as invalid. + +begin + DoStateChange([tsValidationNeeded], [tsUseCache]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.MarkCutCopyNodes; + +// Sets the vsCutOrCopy style in every currently selected but not disabled node to indicate it is +// now part of a clipboard operation. + +var + Nodes: TNodeArray; + I: Integer; + +begin + Nodes := nil; + if FSelectionCount > 0 then + begin + // need the current selection sorted to exclude selected nodes which are children, grandchildren etc. of + // already selected nodes + Nodes := GetSortedSelection(False); + for I := 0 to High(Nodes) do + with Nodes[I]^ do + if not (vsDisabled in States) then + Include(States, vsCutOrCopy); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Loaded; + +var + LastRootCount: Cardinal; + IsReadOnly: Boolean; + +begin + inherited; + + // If a root node count has been set during load of the tree then update its child structure now + // as this hasn't been done yet in this case. + if (tsNeedRootCountUpdate in FStates) and (FRoot^.ChildCount > 0) then + begin + DoStateChange([], [tsNeedRootCountUpdate]); + IsReadOnly := toReadOnly in FOptions.FMiscOptions; + Exclude(FOptions.FMiscOptions, toReadOnly); + LastRootCount := FRoot^.ChildCount; + FRoot^.ChildCount := 0; + BeginUpdate; + SetChildCount(FRoot, LastRootCount); + EndUpdate; + if IsReadOnly then + Include(FOptions.FMiscOptions, toReadOnly); + end; + + // Prevent the object inspector at design time from marking the header as being modified + // when auto resize is enabled. + Updating; + try + FHeader.UpdateMainColumn; + FHeader.FColumns.FixPositions; + FHeader.RecalculateHeader; + if hoAutoResize in FHeader.FOptions then + FHeader.FColumns.AdjustAutoSize(InvalidColumn, True); + finally + Updated; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.MainColumnChanged; + +begin + DoCancelEdit; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.MouseMove(Shift: TShiftState; X, Y: Integer); + +var + R: TRect; + +begin + // Remove current selection in case the user clicked somewhere in the window (but not a node) + // and moved the mouse. + if tsDrawSelPending in FStates then + begin + if CalculateSelectionRect(X, Y) then + begin + InvalidateRect(Handle, @FNewSelRect, False); + UpdateWindow(Handle); + if (Abs(FNewSelRect.Right - FNewSelRect.Left) > Mouse.DragThreshold) or + (Abs(FNewSelRect.Bottom - FNewSelRect.Top) > Mouse.DragThreshold) then + begin + if tsClearPending in FStates then + begin + DoStateChange([], [tsClearPending]); + ClearSelection; + end; + DoStateChange([tsDrawSelecting], [tsDrawSelPending]); + // reset to main column for multiselection + FocusedColumn := FHeader.MainColumn; + + // The current rectangle may already include some node captions. Handle this. + if HandleDrawSelection(X, Y) then + InvalidateRect(Handle, nil, False); + end; + end; + end + else + begin + // If both wheel panning and auto scrolling are pending then the user moved the mouse while holding down the + // middle mouse button. This means panning is being used, hence remove the autoscroll flag. + if [tsWheelPanning, tsWheelScrolling] * FStates = [tsWheelPanning, tsWheelScrolling] then + begin + if ((Abs(FLastClickPos.X - X) >= Mouse.DragThreshold) or (Abs(FLastClickPos.Y - Y) >= Mouse.DragThreshold)) then + DoStateChange([], [tsWheelScrolling]); + end; + + // Really start dragging if the mouse has been moved more than the threshold. + begin + if CanAutoScroll then + DoAutoScroll(X, Y); + if [tsWheelPanning, tsWheelScrolling] * FStates <> [] then + AdjustPanningCursor(X, Y); + if not IsMouseSelecting then + begin + HandleHotTrack(X, Y); + inherited MouseMove(Shift, X, Y); + end + else + begin + // Handle draw selection if required, but don't do the work twice if the + // auto scrolling code already cares about the selection. + if not (tsScrolling in FStates) and CalculateSelectionRect(X, Y) then + begin + // If something in the selection changed then invalidate the entire + // tree instead trying to figure out the display rects of all changed nodes. + if HandleDrawSelection(X, Y) then + InvalidateRect(Handle, nil, False) + else + begin + UnionRect(R, OrderRect(FNewSelRect), OrderRect(FLastSelRect)); + OffsetRect(R, FEffectiveOffsetX, FOffsetY); + InvalidateRect(Handle, @R, False); + end; + UpdateWindow(Handle); + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Notification(AComponent: TComponent; Operation: TOperation); + +begin + if (AComponent <> Self) and (Operation = opRemove) then + begin + // Check for components linked to the tree. + if AComponent = FImages then + begin + Images := nil; + if not (csDestroying in ComponentState) then + Invalidate; + end + else + if AComponent = FStateImages then + begin + StateImages := nil; + if not (csDestroying in ComponentState) then + Invalidate; + end + else + if AComponent = FCustomCheckImages then + begin + CustomCheckImages := nil; + FCheckImageKind := ckLightCheck; + if not (csDestroying in ComponentState) then + Invalidate; + end + else + if AComponent = PopupMenu then + PopupMenu := nil + else + // Check for components linked to the header. + if Assigned(FHeader) then + begin + if AComponent = FHeader.FImages then + FHeader.Images := nil + else + if AComponent = FHeader.PopupMenu then + FHeader.PopupMenu := nil; + end; + end; + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.OriginalWMNCPaint(DC: HDC); + +// Unfortunately, the painting for the non-client area in TControl is not always correct and does also not consider +// existing clipping regions, so it has been modified here to take this into account. + +const +//todo InnerStyles: array[TBevelCut] of Integer = (0, BDR_SUNKENINNER, BDR_RAISEDINNER, 0); +// OuterStyles: array[TBevelCut] of Integer = (0, BDR_SUNKENOUTER, BDR_RAISEDOUTER, 0); +// EdgeStyles: array[TBevelKind] of Integer = (0, 0, BF_SOFT, BF_FLAT); + Ctl3DStyles: array[Boolean] of Integer = (BF_MONO, 0); + +var + RC, RW: TRect; + EdgeSize: Integer; + Size: TSize; + +begin + if True{todo(BevelKind <> bkNone)} or (BorderWidth > 0) then + begin + RC := Rect(0, 0, Width, Height); + Size := GetBorderDimensions; + InflateRect(RC, Size.cx, Size.cy); + + RW := RC; + + if True{todoBevelKind <> bkNone} then + begin + DrawEdge(DC, RC, BDR_RAISEDINNER{InnerStyles[BevelInner]} or 0{OuterStyles[BevelOuter]}, 15{Byte(BevelEdges)} or 0{EdgeStyles[BevelKind]} or + Ctl3DStyles[Ctl3D]); + + EdgeSize := 0; +// if BevelInner <> bvNone then + Inc(EdgeSize, 1{BevelWidth}); +// if BevelOuter <> bvNone then + Inc(EdgeSize, 1{BevelWidth}); + with RC do + begin +// if beLeft in BevelEdges then + Inc(Left, EdgeSize); +// if beTop in BevelEdges then + Inc(Top, EdgeSize); +// if beRight in BevelEdges then + Dec(Right, EdgeSize); +// if beBottom in BevelEdges then + Dec(Bottom, EdgeSize); + end; + end; + + // Repaint only the part in the original clipping region and not yet drawn parts. + IntersectClipRect(DC, RC.Left, RC.Top, RC.Right, RC.Bottom); + + // Determine inner rectangle to exclude (RC corresponds then to the client area). + InflateRect(RC, -BorderWidth, -BorderWidth); + + // Remove the inner rectangle. + ExcludeClipRect(DC, RC.Left, RC.Top, RC.Right, RC.Bottom); + + // Erase parts not drawn. + Brush.Color := FColors.BorderColor; + FillRect(DC, RW, Brush.Handle); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Paint; + +// Window paint routine. Used when the tree window needs to be updated. + +var + Window,R: TRect; + Target: TPoint; + +begin + // The update rect has already been filled in WMPaint, as it is the window's update rect, which gets + // reset when BeginPaint is called (in the ancestor). + // The difference to the DC's clipbox is that it is also valid with internal paint operations used + // e.g. by the Explorer while dragging, but show window content while dragging is disabled. + if not IsRectEmpty(FUpdateRect) then + begin + Window := FUpdateRect; + Target := Window.TopLeft; + if hoVisible in FHeader.FOptions then + inc(Target.y,FHeader.Height); + + if hoVisible in FHeader.FOptions then + begin + R := FHeaderRect; + FHeader.FColumns.PaintHeader(Canvas.Handle, R, FOffsetX); + end; + // The clipping rectangle is given in client coordinates of the window. We have to convert it into + // a sliding window of the tree image. + // OffsetRect(Window, -FEffectiveOffsetX, -FOffsetY); //theo 24.2.2007 + OffsetRect(Window, 0, -FOffsetY); //theo 24.2.2007 + PaintTree(Canvas, Window, Target, [poBackground, poColumnColor, poDrawFocusRect, poDrawDropMark, poDrawSelection, + poGridLines]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PaintCheckImage(const PaintInfo: TVTPaintInfo); + +var + ForegroundColor: COLORREF; + {$ifdef ThemeSupport} + R: TRect; + Details: TThemedElementDetails; + {$endif ThemeSupport} + +begin + with PaintInfo, ImageInfo[iiCheck] do + begin + {$ifdef ThemeSupport} + if (tsUseThemes in FStates) and (FCheckImageKind <> ckCustom) then + begin + R := Rect(XPos - 1, YPos, XPos + 16, YPos + 16); + Details.Element := teButton; + case Index of + 0..8: // radio buttons + begin + Details.Part := BP_RADIOBUTTON; + Details.State := Index; + end; + 9..20: // check boxes + begin + Details.Part := BP_CHECKBOX; + Details.State := Index - 8; + end; + 21..24: // buttons + begin + Details.Part := BP_PUSHBUTTON; + Details.State := Index - 20; + end; + else + Details.Part := 0; + Details.State := 0; + end; + ThemeServices.DrawElement(Canvas.Handle, Details, R); + if Index in [21..24] then + UtilityImages.Draw(Canvas, XPos - 1, YPos, 4); + end + else + {$endif ThemeSupport} + with FCheckImages do + begin + if (vsSelected in Node^.States) and not Ghosted then + begin + if Focused or (toPopupMode in FOptions.FPaintOptions) then + ForegroundColor := ColorToRGB(FColors.FocusedSelectionColor) + else + ForegroundColor := ColorToRGB(FColors.UnfocusedSelectionColor); + end + else + ForegroundColor := GetRGBColor(BlendColor); + + Draw(Canvas, XPos, YPos, Index, True); //later: draw transparent +// org code: +// ImageList_DrawEx(Handle, Index, Canvas.Handle, XPos, YPos, 0, 0, GetRGBColor(BkColor), ForegroundColor, +// ILD_TRANSPARENT); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PaintImage(const PaintInfo: TVTPaintInfo; ImageInfoIndex: TVTImageInfoIndex; + Images: TCustomImageList; DoOverlay: Boolean); + +const + Style: array[TImageType] of Cardinal = (0, $0010{ILD_MASK}); + +var + OverlayImage: Integer; + OverlayGhosted: Boolean; + ExtraStyle: Cardinal; + ForegroundColor: COLORREF; + CutNode: Boolean; + PaintFocused: Boolean; + +begin + with PaintInfo, ImageInfo[ImageInfoIndex], Images do + begin + CutNode := (vsCutOrCopy in Node^.States) and (tsCutPending in FStates); + PaintFocused := Focused or (toGhostedIfUnfocused in FOptions.FPaintOptions); + + if (vsSelected in Node^.States) and not (Ghosted or CutNode) then + begin + if PaintFocused or (toPopupMode in FOptions.FPaintOptions) then + ForegroundColor := ColorToRGB(FColors.FocusedSelectionColor) + else + ForegroundColor := ColorToRGB(FColors.UnfocusedSelectionColor); + end + else + ForegroundColor := GetRGBColor(Color); + + // Since the overlay image must be specified together with the image to draw + // it is meaningfull to retrieve it in advance. + if DoOverlay then + OverlayImage := GetImageIndex(PaintInfo.Node, ikOverlay, PaintInfo.Column, OverlayGhosted) + else + OverlayImage := -1; + if (vsDisabled in Node^.States) or not Enabled then + begin + // The internal handling for disabled images in TImageList destroys the forground color on Windows API level. + // Hence the canvas does not recognize the change and we have to restore the color manually. + ForegroundColor := ColorToRGB(Canvas.Font.Color); + + // If the tree or the current node is disabled then let the VCL draw the image as it already + // contains code to convert the image to the system colors. +//todwin if OverlayImage > -1 then +// Images.DrawOverlay(Canvas, XPos, YPos, Index, OverlayImage, False) +// else + Images.Draw(Canvas, XPos, YPos, Index, False); + + SetTextColor(Canvas.Handle, ForegroundColor); + end + else + begin +//todowin if OverlayImage > -1 then +// ExtraStyle := ILD_TRANSPARENT or ILD_OVERLAYMASK and IndexToOverlayMask(OverlayImage + 1) +// else +// ExtraStyle := ILD_TRANSPARENT; + + // Blend image if enabled and the tree has the focus (or ghosted images must be drawn also if unfocused) ... + if (toUseBlendedImages in FOptions.FPaintOptions) and PaintFocused + // ... and the image is ghosted... + and (Ghosted or + // ... or it is not the check image and the node is selected (but selection is not for the entire row)... + ((vsSelected in Node^.States) and + not (toFullRowSelect in FOptions.FSelectionOptions) and + not (toGridExtensions in FOptions.FMiscOptions)) or + // ... or the node must be shown in cut mode. + CutNode) then + ExtraStyle := ExtraStyle {todowinor ILD_BLEND50}; + + if (vsSelected in Node^.States) and not Ghosted then + ForegroundColor := clDefault{CLR_DEFAULT}; + Images.Draw(Canvas,XPos,YPos,Index); +//todowin ImageList_DrawEx(Handle, Index, Canvas.Handle, XPos, YPos, 0, 0, GetRGBColor(BkColor), ForegroundColor, +// Style[ImageType] or ExtraStyle); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PaintNodeButton(xCanvas: TCanvas; Node: PVirtualNode; const R: TRect; ButtonX, + ButtonY: Integer; BidiMode: TBiDiMode); + +var + Bitmap: TBitmap; + XPos: Integer; + +begin + if vsExpanded in Node^.States then + Bitmap := FMinusBM + else + Bitmap := FPlusBM; + + // Draw the node's plus/minus button according to the directionality. +//b if BidiMode = bdLeftToRight then + XPos := R.Left + ButtonX; +//b else +//b XPos := R.Right - ButtonX - Bitmap.Width; + + // Need to draw this masked. + xCanvas.Draw(XPos, R.Top + ButtonY, Bitmap); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PaintTreeLines(const PaintInfo: TVTPaintInfo; VAlignment, IndentSize: Integer; + LineImage: TLineImage); + +var + I: Integer; + XPos, + Offset: Integer; + NewStyles: TLineImage; + +begin + NewStyles := nil; + + with PaintInfo do + begin +//b if BidiMode = bdLeftToRight then +//b begin + XPos := CellRect.Left; + Offset := FIndent; +//b end +//b else +//b begin +//b Offset := -Integer(FIndent); +//b XPos := CellRect.Right + Offset; +//b end; + + case FLineMode of + lmBands: + if poGridLines in PaintInfo.PaintOptions then + begin + // Convert the line images in correct bands. + SetLength(NewStyles, Length(LineImage)); + for I := IndentSize - 1 downto 0 do + begin + if vsExpanded in Node^.States then + NewStyles[I] := ltLeft + else + case LineImage[I] of + ltRight, + ltBottomRight, + ltTopDownRight, + ltTopRight: + NewStyles[I] := ltLeftBottom; + ltNone: + // Have to take over the image to the right of this one. A no line entry can never appear as + // last entry so I don't need an end check here. + if LineImage[I + 1] in [ltNone, ltTopRight] then + NewStyles[I] := NewStyles[I + 1] + else + NewStyles[I] := ltLeft; + ltTopDown: + // Have to check the image to the right of this one. A top down line can never appear as + // last entry so I don't need an end check here. + if LineImage[I + 1] in [ltNone, ltTopRight] then + NewStyles[I] := NewStyles[I + 1] + else + NewStyles[I] := ltLeft; + end; + end; + + PaintInfo.Canvas.Font.Color := FColors.GridLineColor; + for I := 0 to IndentSize - 1 do + begin + DrawLineImage(PaintInfo, XPos, CellRect.Top, NodeHeight[Node] - 1, VAlignment, NewStyles[I], + {bBidiMode <> bdLeftToRight}False); + Inc(XPos, Offset); + end; + end; + else // lmNormal + PaintInfo.Canvas.Font.Color := FColors.TreeLineColor; + for I := 0 to IndentSize - 1 do + begin + DrawLineImage(PaintInfo, XPos, CellRect.Top, NodeHeight[Node], VAlignment, LineImage[I], + {bBidiMode <> bdLeftToRight}False); + Inc(XPos, Offset); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PaintSelectionRectangle(Target: TCanvas; WindowOrgX: Integer; const SelectionRect: TRect; + TargetRect: TRect); + +// Helper routine to draw a selection rectangle in the mode determined by DrawSelectionMode. + +var + BlendRect: TRect; + TextColorBackup, + BackColorBackup: COLORREF; // used to restore forground and background colors when drawing a selection rectangle + +begin + if ((FDrawSelectionMode = smDottedRectangle) and not (tsUseThemes in FStates)) or + not MMXAvailable then + begin + // Classical selection rectangle using dotted borderlines. + TextColorBackup := GetTextColor(Target.Handle); + SetTextColor(Target.Handle, $FFFFFF); +//todowin BackColorBackup := GetBkColor(Target.Handle); + SetBkColor(Target.Handle, 0); +//todo Target.DrawFocusRect(SelectionRect); + SetTextColor(Target.Handle, TextColorBackup); + SetBkColor(Target.Handle, BackColorBackup); + end + else + begin + // Modern alpha blended style. + OffsetRect(TargetRect, WindowOrgX, 0); + if IntersectRect(BlendRect, OrderRect(SelectionRect), TargetRect) then + begin + OffsetRect(BlendRect, -WindowOrgX, 0); + AlphaBlend(0, Target.Handle, BlendRect, Point(0, 0), bmConstantAlphaAndColor, FSelectionBlendFactor, + ColorToRGB(FColors.SelectionRectangleBlendColor)); + + Target.Brush.Color := FColors.SelectionRectangleBorderColor; + Target.FrameRect(SelectionRect); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PanningWindowProc(var Message: TLMessage); + +var + PS: TPaintStruct; + xCanvas: TCanvas; + +begin + if Message.Msg = LM_PAINT then + begin + BeginPaint(FPanningWindow, PS); + xCanvas := TCanvas.Create; + xCanvas.Handle := PS.hdc; + try + xCanvas.Draw(0, 0, FPanningImage); + finally + xCanvas.Handle := 0; + xCanvas.Free; + EndPaint(FPanningWindow, PS); + end; + Message.Result := 0; + end + else +//todowin with Message do +// Result := DefWindowProc(FPanningWindow, Msg, wParam, lParam); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.ReadChunk(Stream: TStream; Version: Integer; Node: PVirtualNode; ChunkType, + ChunkSize: Integer): Boolean; + +// Called while loading a tree structure, Node is already valid (allocated) at this point. +// The function handles the base and user chunks, any other chunk is marked as being unknown (result becomes False) +// and skipped. Descentants may handle them by overriding this method. +// Returns True if the chunk could be handled, otherwise False. + +var + ChunkBody: TBaseChunkBody; + Run: PVirtualNode; + LastPosition: Integer; + +begin + case ChunkType of + BaseChunk: + begin + // Load base chunk's body (chunk header has already been consumed). + if Version > 1 then + Stream.Read(ChunkBody, SizeOf(ChunkBody)) + else + begin + with ChunkBody do + begin + // In version prior to 2 there was a smaller chunk body. Hence we have to read it entry by entry now. + Stream.Read(ChildCount, SizeOf(ChildCount)); + Stream.Read(NodeHeight, SizeOf(NodeHeight)); + // TVirtualNodeStates was a byte sized type in version 1 + States := []; + Stream.Read(States, SizeOf(Byte)); + // vsVisible is now in the place where vsSelected was before, but every node was visible in the old version + // so we need to fix this too. + if vsVisible in States then + Include(States, vsSelected) + else + Include(States, vsVisible); + Stream.Read(Align, SizeOf(Align)); + Stream.Read(CheckState, SizeOf(CheckState)); + Stream.Read(CheckType, SizeOf(CheckType)); + end; + end; + + with Node^ do + begin + // Set states first, in case the node is invisble. + States := ChunkBody.States; + + NodeHeight := ChunkBody.NodeHeight; + AdjustTotalHeight(Node, NodeHeight); + + Align := ChunkBody.Align; + CheckState := ChunkBody.CheckState; + CheckType := ChunkBody.CheckType; + + // Create and read child nodes. + while ChunkBody.ChildCount > 0 do + begin + Run := MakeNewNode; + InternalConnectNode(Run, Node, Self, amAddChildLast); + ReadNode(Stream, Version, Run); + Dec(ChunkBody.ChildCount); + end; + end; + Result := True; + end; + UserChunk: + if ChunkSize > 0 then + begin + // need to know whether the data was read + LastPosition := Stream.Position; + DoLoadUserData(Node, Stream); + // compare stream position to learn whether the data was read + Result := Stream.Position > LastPosition; + // Improve stability by advancing the stream to the chunk's real end if + // the application did not read what has been written. + if not Result or (Stream.Position <> (LastPosition + ChunkSize)) then + Stream.Position := LastPosition + ChunkSize; + end + else + Result := True; + else + // unknown chunk, skip it + Stream.Position := Stream.Position + ChunkSize; + Result := False; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ReadNode(Stream: TStream; Version: Integer; Node: PVirtualNode); + +// Reads the anchor chunk of each node and initiates reading the sub chunks for this node + +var + xHeader: TChunkHeader; + EndPosition: Integer; + +begin + with Stream do + begin + // Read anchor chunk of the node. + Stream.Read(xHeader, SizeOf(xHeader)); + if xHeader.ChunkType = NodeChunk then + begin + EndPosition := Stream.Position + xHeader.ChunkSize; + // Read all subchunks until the indicated chunk end position is reached in the stream. + while Position < EndPosition do + begin + // Read new chunk header. + Stream.Read(xHeader, SizeOf(xHeader)); + ReadChunk(Stream, Version, Node, xHeader.ChunkType, xHeader.ChunkSize); + end; + // If the last chunk does not end at the given end position then there is something wrong. + if Position <> EndPosition then + ShowError(SCorruptStream2, hcTFCorruptStream2); + end + else + ShowError(SCorruptStream1, hcTFCorruptStream1); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.RedirectFontChangeEvent(xCanvas: TCanvas); + +begin + if @xCanvas.Font.OnChange <> @FOldFontChange then + begin + FOldFontChange := xCanvas.Font.OnChange; + xCanvas.Font.OnChange := @FontChanged; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.RemoveFromSelection(Node: PVirtualNode); + +var + Index: Integer; + +begin + Assert(Assigned(Node), 'Node must not be nil!'); + if vsSelected in Node^.States then + begin + Exclude(Node^.States, vsSelected); + if FindNodeInSelection(Node, Index, -1, -1) and (Index < FSelectionCount - 1) then + Move(FSelection[Index + 1], FSelection[Index], (FSelectionCount - Index - 1) * 4); + if FSelectionCount > 0 then + Dec(FSelectionCount); + SetLength(FSelection, FSelectionCount); + + if FSelectionCount = 0 then + ResetRangeAnchor; + + Change(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ResetRangeAnchor; + +// Called when there is no selected node anymore and the selection range anchor needs a new value. + +begin + FRangeAnchor := FFocusedNode; + FLastSelectionLevel := -1; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.RestoreFontChangeEvent(xCanvas: TCanvas); + +begin + xCanvas.Font.OnChange := FOldFontChange; + FOldFontChange := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SelectNodes(StartNode, EndNode: PVirtualNode; AddOnly: Boolean); + +// Selects a range of nodes and unselects all other eventually selected nodes which are not in this range if +// AddOnly is False. +// EndNode must be visible while StartNode does not necessarily as in the case where the last focused node is the start +// node but it is a child of a node which has been collapsed previously. In this case the first visible parent node +// is used as start node. StartNode can be nil in which case the very first node in the tree is used. + +var + NodeFrom, + NodeTo, + LastAnchor: PVirtualNode; + Index: Integer; + +begin + Assert(Assigned(EndNode), 'EndNode must not be nil!'); + ClearTempCache; + if StartNode = nil then + StartNode := FRoot^.FirstChild + else + if not FullyVisible[StartNode] then + begin + StartNode := GetPreviousVisible(StartNode); + if StartNode = nil then + StartNode := FRoot^.FirstChild + end; + + if CompareNodePositions(StartNode, EndNode) < 0 then + begin + NodeFrom := StartNode; + NodeTo := EndNode; + end + else + begin + NodeFrom := EndNode; + NodeTo := StartNode; + end; + + // The range anchor will be reset by the following call. + LastAnchor := FRangeAnchor; + if not AddOnly then + InternalClearSelection; + + while NodeFrom <> NodeTo do + begin + InternalCacheNode(NodeFrom); + NodeFrom := GetNextVisible(NodeFrom); + end; + // select last node too + InternalCacheNode(NodeFrom); + // now add them all in "one" step + AddToSelection(FTempNodeCache, FTempNodeCount); + ClearTempCache; + if Assigned(LastAnchor) and FindNodeInSelection(LastAnchor, Index, -1, -1) then + FRangeAnchor := LastAnchor; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{bprocedure TBaseVirtualTree.SetBiDiMode(Value: TBiDiMode); + +begin + inherited; + + RecreateWnd; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SetFocusedNodeAndColumn(Node: PVirtualNode; Column: TColumnIndex); + +var + OldColumn: TColumnIndex; + +begin + OldColumn := FFocusedColumn; + FFocusedColumn := Column; + // Initiate the focus change chain. + FocusedNode := Node; + // Check if the change was accepted. + if FFocusedNode = Node then + CancelEditNode + else + // If the user did not accept the new cell to focus then set also the focused column back + // to its original state. + FFocusedColumn := OldColumn; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SkipNode(Stream: TStream); + +// Skips the data for the next node in the given stream (including the child nodes). + +var + xHeader: TChunkHeader; + +begin + with Stream do + begin + // read achor chunk of the node + Stream.Read(xHeader, SizeOf(xHeader)); + if xHeader.ChunkType = NodeChunk then + Stream.Position := Stream.Position + xHeader.ChunkSize + else + ShowError(SCorruptStream1, hcTFCorruptStream1); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +(*todovar + PanningWindowClass: TWndClass = ( + style: 0; + lpfnWndProc: @DefWindowProc; + cbClsExtra: 0; + cbWndExtra: 0; + hInstance: 0; + hIcon: 0; + hCursor: 0; + hbrBackground: 0; + lpszMenuName: nil; + lpszClassName: 'VTPanningWindow' + ); + *) +procedure TBaseVirtualTree.StartWheelPanning(Position: TPoint); + +// Called when wheel panning should start. A little helper window is created to indicate the reference position, +// which determines in which direction and how far wheel panning/scrolling will happen. + + //--------------- local function -------------------------------------------- + + function CreateClipRegion: HRGN; + + // In order to avoid doing all the transparent drawing ourselves we use a + // window region for the wheel window. + // Since we only work on a very small image (32x32 pixels) this is acceptable. + + var + Start, X, Y: Integer; + Temp: HRGN; + + begin + Assert(not FPanningImage.Empty, 'Invalid wheel panning image.'); + + // Create an initial region on which we operate. + Result := CreateRectRgn(0, 0, 0, 0); + with FPanningImage, Canvas do + begin + for Y := 0 to Height - 1 do + begin + Start := -1; + for X := 0 to Width - 1 do + begin + // Start a new span if we found a non-transparent pixel and no span is currently started. + if (Start = -1) and (Pixels[X, Y] <> clFuchsia) then + Start := X + else + if (Start > -1) and (Pixels[X, Y] = clFuchsia) then + begin + // A non-transparent span is finished. Add it to the result region. + Temp := CreateRectRgn(Start, Y, X, Y + 1); + CombineRgn(Result, Result, Temp, RGN_OR); + DeleteObject(Temp); + Start := -1; + end; + end; + // If there is an open span then add this also to the result region. + if Start > -1 then + begin + Temp := CreateRectRgn(Start, Y, Width, Y + 1); + CombineRgn(Result, Result, Temp, RGN_OR); + DeleteObject(Temp); + end; + end; + end; + // The resulting region is used as window region so we must not delete it. + // Windows will own it after the assignment below. + end; + + //--------------- end local function ---------------------------------------- + +var + TempClass: TWndClass; + ClassRegistered: Boolean; + ImageName: string; + +begin + (*// Set both panning and scrolling flag. One will be removed shortly depending on whether the middle mouse button is + // released before the mouse is moved or vice versa. The first case is referred to as wheel scrolling while the + // latter is called wheel panning. + StopTimer(ScrollTimer); + DoStateChange([tsWheelPanning, tsWheelScrolling]); + + // Register the helper window class. + PanningWindowClass.hInstance := HInstance; + ClassRegistered := GetClassInfo(HInstance, PanningWindowClass.lpszClassName, TempClass); + if not ClassRegistered or (TempClass.lpfnWndProc <> @DefWindowProc) then + begin + if ClassRegistered then + Windows.UnregisterClass(PanningWindowClass.lpszClassName, HInstance); + Windows.RegisterClass(PanningWindowClass); + end; + // Create the helper window and show it at the given position without activating it. + with ClientToScreen(Position) do + FPanningWindow := CreateWindowEx(WS_EX_TOOLWINDOW, PanningWindowClass.lpszClassName, nil, WS_POPUP, X - 16, Y - 16, + 32, 32, Handle, 0, HInstance, nil); + + FPanningImage := TBitmap.Create; + if Integer(FRangeX) > ClientWidth then + begin + if Integer(FRangeY) > ClientHeight then + ImageName := 'VT_MOVEALL' + else + ImageName := 'VT_MOVEEW' + end + else + ImageName := 'VT_MOVENS'; + FPanningImage.LoadFromResourceName(HInstance, ImageName); + SetWindowRgn(FPanningWindow, CreateClipRegion, False); + + {$ifdef COMPILER_6_UP} + SetWindowLong(FPanningWindow, GWL_WNDPROC, Integer(Classes.MakeObjectInstance(PanningWindowProc))); + {$else} + SetWindowLong(FPanningWindow, GWL_WNDPROC, Integer(MakeObjectInstance(PanningWindowProc))); + {$endif} + ShowWindow(FPanningWindow, SW_SHOWNOACTIVATE); + + // Setup the panscroll timer and capture all mouse input. + SetFocus; + SetCapture(Handle); + SetTimer(Handle, ScrollTimer, 20, nil);*) +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.StopWheelPanning; + +// Stops panning if currently active and destroys the helper window. + +var + Instance: Pointer; + +begin + if [tsWheelPanning, tsWheelScrolling] * FStates <> [] then + begin + // Release the mouse capture and stop the panscroll timer. + StopTimer(ScrollTimer); + ReleaseCapture; + DoStateChange([], [tsWheelPanning, tsWheelScrolling]); + + // Destroy the helper window. + Instance := Pointer(GetWindowLong(FPanningWindow, GWL_WNDPROC)); +//todowin DestroyWindow(FPanningWindow); +//todowin if Instance <> @DefWindowProc then +//todowin {$ifdef COMPILER_6_UP} +//todowin Classes.FreeObjectInstance(Instance); +//todowin {$else} +//todowin FreeObjectInstance(Instance); +//todowin {$endif} + FPanningWindow := 0; + FPanningImage.Free; + FPanningImage := nil; + DeleteObject(FPanningCursor); + FPanningCursor := 0; +//todowin Windows.SetCursor(Screen.Cursors[Cursor]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.StructureChange(Node: PVirtualNode; Reason: TChangeReason); + +begin + AdviseChangeEvent(True, Node, Reason); + + if FUpdateCount = 0 then + begin + if (FChangeDelay > 0) and not (tsSynchMode in FStates) then + StartTimer(StructureChangeTimer, FChangeDelay) +// SetTimer(Handle, StructureChangeTimer, FChangeDelay, nil) + else + DoStructureChange(Node, Reason); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.SuggestDropEffect(Source: TObject; Shift: TShiftState; Pt: TPoint; + AllowedEffects: Integer): Integer; + +// determines the drop action to take if the drag'n drop operation ends on this tree +// Note: Source can be any Delphi object not just a virtual tree + +begin + Result := AllowedEffects; +{todo + // prefer MOVE if source and target are the same control, otherwise whatever is allowed as initial value + if Assigned(Source) and (Source = Self) then + if (AllowedEffects and DROPEFFECT_MOVE) <> 0 then + Result := DROPEFFECT_MOVE + else // no change + else + // drag between different applicatons + if (AllowedEffects and DROPEFFECT_COPY) <> 0 then + Result := DROPEFFECT_COPY; + + // consider modifier keys and what is allowed at the moment, if none of the following conditions apply then + // the initial value just set is used + if ssCtrl in Shift then + begin + // copy or link + if ssShift in Shift then + begin + // link + if (AllowedEffects and DROPEFFECT_LINK) <> 0 then + Result := DROPEFFECT_LINK; + end + else + begin + // copy + if (AllowedEffects and DROPEFFECT_COPY) <> 0 then + Result := DROPEFFECT_COPY; + end; + end + else + begin + // move, link or default + if ssShift in Shift then + begin + // move + if (AllowedEffects and DROPEFFECT_MOVE) <> 0 then + Result := DROPEFFECT_MOVE; + end + else + begin + // link or default + if ssAlt in Shift then + begin + // link + if (AllowedEffects and DROPEFFECT_LINK) <> 0 then + Result := DROPEFFECT_LINK; + end; + // else default + end; + end; } +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ToggleSelection(StartNode, EndNode: PVirtualNode); + +// Switchs the selection state of a range of nodes. +// Note: This method is specifically designed to help selecting ranges with the keyboard and considers therefore +// the range anchor. + +var + NodeFrom, + NodeTo: PVirtualNode; + NewSize: Integer; + Position: Integer; + +begin + Assert(Assigned(EndNode), 'EndNode must not be nil!'); + if StartNode = nil then + StartNode := FRoot^.FirstChild + else + if not FullyVisible[StartNode] then + StartNode := GetPreviousVisible(StartNode); + + Position := CompareNodePositions(StartNode, EndNode); + // nothing to do if start and end node are the same + if Position <> 0 then + begin + if Position < 0 then + begin + NodeFrom := StartNode; + NodeTo := EndNode; + end + else + begin + NodeFrom := EndNode; + NodeTo := StartNode; + end; + + ClearTempCache; + + // 1) toggle the start node if it is before the range anchor + if CompareNodePositions(NodeFrom, FRangeAnchor) < 0 then + if not (vsSelected in NodeFrom^.States) then + InternalCacheNode(NodeFrom) + else + InternalRemoveFromSelection(NodeFrom); + + // 2) toggle all nodes within the range + NodeFrom := GetNextVisible(NodeFrom); + while NodeFrom <> NodeTo do + begin + if not (vsSelected in NodeFrom^.States) then + InternalCacheNode(NodeFrom) + else + InternalRemoveFromSelection(NodeFrom); + NodeFrom := GetNextVisible(NodeFrom); + end; + + // 3) toggle end node if it is after the range anchor + if CompareNodePositions(NodeFrom, FRangeAnchor) > 0 then + if not (vsSelected in NodeFrom^.States) then + InternalCacheNode(NodeFrom) + else + InternalRemoveFromSelection(NodeFrom); + + // Do some housekeeping if there was a change. + NewSize := PackArray(FSelection, FSelectionCount); + if NewSize > -1 then + begin + FSelectionCount := NewSize; + SetLength(FSelection, FSelectionCount); + end; + // If the range went over the anchor then we need to reselect it. + if not (vsSelected in FRangeAnchor^.States) then + InternalCacheNode(FRangeAnchor); + if FTempNodeCount > 0 then + AddToSelection(FTempNodeCache, FTempNodeCount); + ClearTempCache; + + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.UnselectNodes(StartNode, EndNode: PVirtualNode); + +// Deselects a range of nodes. +// EndNode must be visible while StartNode must not as in the case where the last focused node is the start node +// but it is a child of a node which has been collapsed previously. In this case the first visible parent node +// is used as start node. StartNode can be nil in which case the very first node in the tree is used. + +var + NodeFrom, + NodeTo: PVirtualNode; + NewSize: Integer; + +begin + Assert(Assigned(EndNode), 'EndNode must not be nil!'); + + if StartNode = nil then + StartNode := FRoot^.FirstChild + else + if not FullyVisible[StartNode] then + begin + StartNode := GetPreviousVisible(StartNode); + if StartNode = nil then + StartNode := FRoot^.FirstChild + end; + + if CompareNodePositions(StartNode, EndNode) < 0 then + begin + NodeFrom := StartNode; + NodeTo := EndNode; + end + else + begin + NodeFrom := EndNode; + NodeTo := StartNode; + end; + + while NodeFrom <> NodeTo do + begin + InternalRemoveFromSelection(NodeFrom); + NodeFrom := GetNextVisible(NodeFrom); + end; + // Deselect last node too. + InternalRemoveFromSelection(NodeFrom); + + // Do some housekeeping. + NewSize := PackArray(FSelection, FSelectionCount); + if NewSize > -1 then + begin + FSelectionCount := NewSize; + SetLength(FSelection, FSelectionCount); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.UpdateDesigner; + +var + ParentForm: TCustomForm; + +begin + if (csDesigning in ComponentState) and not (csUpdating in ComponentState) then + begin + ParentForm := GetParentForm(Self); + if Assigned(ParentForm) and Assigned(ParentForm.Designer) then + ParentForm.Designer.Modified; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.UpdateHeaderRect; + +// Calculates the rectangle the header occupies in non-client area. +// These coordinates are in window rectangle. + +var + xOffsetX, + xOffsetY: Integer; + EdgeSize: Integer; + Size: TSize; + +begin + FHeaderRect := Rect(0, 0, Width, Height); + + // Consider borders... + Size := GetBorderDimensions; + InflateRect(FHeaderRect, Size.cx, Size.cy); + + // ... and bevels. + xOffsetX := BorderWidth; + xOffsetY := BorderWidth; + {todoif BevelKind <> bkNone then + begin + EdgeSize := 0; + if BevelInner <> bvNone then + Inc(EdgeSize, BevelWidth); + if BevelOuter <> bvNone then + Inc(EdgeSize, BevelWidth); + if beLeft in BevelEdges then + Inc(xOffsetX, EdgeSize); + if beTop in BevelEdges then + Inc(xOffsetY, EdgeSize); + end;} + + InflateRect(FHeaderRect, -xOffsetX, -xOffsetY); + + if hoVisible in FHeader.FOptions then + begin + if FHeaderRect.Left <= FHeaderRect.Right then + FHeaderRect.Bottom := FHeaderRect.Top + Integer(FHeader.FHeight) + else + FHeaderRect := Rect(0, 0, 0, 0); + end + else + FHeaderRect.Bottom := FHeaderRect.Top; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.UpdateEditBounds; + +// Used to update the bounds of the current node editor if editing is currently active. + +var + R: TRect; + Dummy: Integer; + CurrentAlignment: TAlignment; + CurrentBidiMode: TBidiMode; + +begin + if tsEditing in FStates then + begin + if vsMultiline in FFocusedNode^.States then + R := GetDisplayRect(FFocusedNode, FEditColumn, True, False) + else + R := GetDisplayRect(FFocusedNode, FEditColumn, True, True); + if (toGridExtensions in FOptions.FMiscOptions) then + begin + // Adjust edit bounds depending on alignment and bidi mode. + if FEditColumn = NoColumn then + begin + CurrentAlignment := Alignment; +//b CurrentBidiMode := BiDiMode; + end + else + begin + CurrentAlignment := FHeader.Columns[FEditColumn].FAlignment; +//b CurrentBidiMode := FHeader.Columns[FEditColumn].FBidiMode; + end; + // Consider bidi mode here. In RTL context does left alignment actually mean right alignment and vice versa. +//b if CurrentBidiMode <> bdLeftToRight then +//b ChangeBiDiModeAlignment(CurrentAlignment); + if CurrentAlignment = taLeftJustify then + FHeader.Columns.GetColumnBounds(FEditColumn, Dummy, R.Right) + else + FHeader.Columns.GetColumnBounds(FEditColumn, R.Left, Dummy); + end; + if toShowHorzGridLines in TreeOptions.PaintOptions then + Dec(R.Bottom); + FEditLink.SetBounds(R); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +const + ScrollMasks: array[Boolean] of Cardinal = (0, SIF_DISABLENOSCROLL); + +const // Region identifiers for GetRandomRgn + CLIPRGN = 1; + METARGN = 2; + APIRGN = 3; + SYSRGN = 4; + +(*function GetRandomRgn(DC: HDC; Rgn: HRGN; iNum: Integer): Integer; stdcall; external 'GDI32.DLL'; + +procedure TBaseVirtualTree.UpdateWindowAndDragImage(const Tree: TBaseVirtualTree; TreeRect: TRect; UpdateNCArea, + ReshowDragImage: Boolean); + +// Method to repaint part of the window area which is not covered by the drag image and to initiate a recapture +// of the drag image. +// Note: This method must only be called during a drag operation and the tree passed in is the one managing the current +// drag image (so it is the actual drag source). + +var + DragRegion, // the region representing the drag image + UpdateRegion, // the unclipped region within the tree to be updated + NCRegion: HRGN; // the region representing the non-client area of the tree + DragRect, + NCRect: TRect; + RedrawFlags: Cardinal; + + VisibleTreeRegion: HRGN; + + DC: HDC; + +begin + if IntersectRect(TreeRect, TreeRect, ClientRect) then + begin + // Retrieve the visible region of the window. This is important to avoid overpainting parts of other windows + // which overlap this one. + VisibleTreeRegion := CreateRectRgn(0, 0, 1, 1); + DC := GetDCEx(Handle, 0, DCX_CACHE or DCX_WINDOW or DCX_CLIPSIBLINGS or DCX_CLIPCHILDREN); + GetRandomRgn(DC, VisibleTreeRegion, SYSRGN); + ReleaseDC(Handle, DC); + + // In Win9x the returned visible region is given in client coordinates. We need it in screen coordinates, though. + if not IsWinNT then + with ClientToScreen(Point(0, 0)) do + OffsetRgn(VisibleTreeRegion, X, Y); + + // The drag image will figure out itself what part of the rectangle can be recaptured. + // Recapturing is not done by taking a snapshot of the screen, but by letting the tree draw itself + // into the back bitmap of the drag image. So the order here is unimportant. + Tree.FDragImage.RecaptureBackground(Self, TreeRect, VisibleTreeRegion, UpdateNCArea, ReshowDragImage); + + // Calculate the screen area not covered by the drag image and which needs an update. + DragRect := Tree.FDragImage.GetDragImageRect; + MapWindowPoints(0, Handle, DragRect, 2); + DragRegion := CreateRectRgnIndirect(DragRect); + + // Start with non-client area if requested. + if UpdateNCArea then + begin + // Compute the part of the non-client area which must be updated. + + // Determine the outer rectangle of the entire tree window. + GetWindowRect(Handle, NCRect); + // Express the tree window rectangle in client coordinates (because RedrawWindow wants them so). + MapWindowPoints(0, Handle, NCRect, 2); + NCRegion := CreateRectRgnIndirect(NCRect); + // Determine client rect in screen coordinates and create another region for it. + UpdateRegion := CreateRectRgnIndirect(ClientRect); + // Create a region which only contains the NC part by subtracting out the client area. + CombineRgn(NCRegion, NCRegion, UpdateRegion, RGN_DIFF); + // Subtract also out what is hidden by the drag image. + CombineRgn(NCRegion, NCRegion, DragRegion, RGN_DIFF); + RedrawWindow(Handle, nil, NCRegion, RDW_FRAME or RDW_NOERASE or RDW_NOCHILDREN or RDW_INVALIDATE or RDW_VALIDATE or + RDW_UPDATENOW); + DeleteObject(NCRegion); + DeleteObject(UpdateRegion); + end; + + UpdateRegion := CreateRectRgnIndirect(TreeRect); + RedrawFlags := RDW_INVALIDATE or RDW_VALIDATE or RDW_UPDATENOW or RDW_NOERASE or RDW_NOCHILDREN; + // Remove the part of the update region which is covered by the drag image. + CombineRgn(UpdateRegion, UpdateRegion, DragRegion, RGN_DIFF); + RedrawWindow(Handle, nil, UpdateRegion, RedrawFlags); + DeleteObject(UpdateRegion); + DeleteObject(DragRegion); + DeleteObject(VisibleTreeRegion); + end; +end;*) + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ValidateCache; + +// Starts cache validation if not already done by adding this instance to the worker thread's waiter list +// (if not already there) and signalling the thread it can start validating. + +begin exit; + // Wait for thread to stop validation if it is currently validating this tree's cache. + InterruptValidation; + + FStartIndex := 0; + if tsValidationNeeded in FStates then + begin + // Tell the thread this tree needs actually something to do. + WorkerThread.AddTree(Self); + WorkEvent.SetEvent; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ValidateNodeDataSize(var Size: Integer); + +begin + Size := 0; + if Assigned(FOnGetNodeDataSize) then + FOnGetNodeDataSize(Self, Size); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WndProc(var Message: TLMessage); + +var + Handled: Boolean; + +begin + Handled := False; + + // Try the header whether it needs to take this message. + if Assigned(FHeader) and (FHeader.FStates <> []) then + Handled := FHeader.HandleMessage(Message); + if not Handled then + begin + // For auto drag mode, let tree handle itself, instead of TControl. + if not (csDesigning in ComponentState) and + ((Message.Msg = LM_LBUTTONDOWN) or (Message.Msg = LM_LBUTTONDBLCLK)) then + begin + if (DragMode = dmAutomatic) and (DragKind = dkDrag) then + begin + if IsControlMouseMsg(TLMMouse(Message)) then + Handled := True; + if not Handled then + begin + ControlState := ControlState + [csLButtonDown]; + Dispatch(Message); // overrides TControl's BeginDrag + Handled := True; + end; + end; + end; + + if not Handled and Assigned(FHeader) then + Handled := FHeader.HandleMessage(Message); + + if not Handled then + begin + if (Message.Msg in [LM_NCLBUTTONDOWN{todo, LM_NCRBUTTONDOWN, LM_NCMBUTTONDOWN}]) and not Focused and CanFocus then + SetFocus; + inherited; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WriteChunks(Stream: TStream; Node: PVirtualNode); + +// Writes the core chunks for Node into the stream. +// Note: Descentants can optionally override this method to add other node specific chunks. +// Keep in mind that this method is also called for the root node. Using this fact in descentants you can +// create a kind of "global" chunks not directly bound to a specific node. + +var + xHeader: TChunkHeader; + LastPosition, + ChunkSize: Integer; + Chunk: TBaseChunk; + Run: PVirtualNode; + +begin + with Stream do + begin + // 1. The base chunk... + LastPosition := Position; + Chunk.Header.ChunkType := BaseChunk; + with Node^, Chunk do + begin + Body.ChildCount := ChildCount; + Body.NodeHeight := NodeHeight; + // Some states are only temporary so take them out as they make no sense at the new location. + Body.States := States - [vsChecking, vsCutOrCopy, vsDeleting, vsInitialUserData, vsHeightMeasured]; + Body.Align := Align; + Body.CheckState := CheckState; + Body.CheckType := CheckType; + Body.Reserved := 0; + end; + // write the base chunk + Write(Chunk, SizeOf(Chunk)); + + // 2. ... directly followed by the child node chunks (actually they are child chunks of + // the base chunk) + if vsInitialized in Node^.States then + begin + Run := Node^.FirstChild; + while Assigned(Run) do + begin + WriteNode(Stream, Run); + Run := Run^.NextSibling; + end; + end; + + FinishChunkHeader(Stream, LastPosition, Position); + + // 3. write user data + LastPosition := Position; + xHeader.ChunkType := UserChunk; + Write(xHeader, SizeOf(xHeader)); + DoSaveUserData(Node, Stream); + // check if the application actually wrote data + ChunkSize := Position - LastPosition - SizeOf(TChunkHeader); + // seek back to start of chunk if nothing has been written + if ChunkSize = 0 then + begin + Position := LastPosition; + Size := Size - SizeOf(xHeader); + end + else + FinishChunkHeader(Stream, LastPosition, Position); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.WriteNode(Stream: TStream; Node: PVirtualNode); + +// Writes the "cover" chunk for Node to Stream and initiates writing child nodes and chunks. + +var + LastPosition: Integer; + xHeader: TChunkHeader; + +begin + // Initialize the node first if necessary and wanted. + if toInitOnSave in FOptions.FMiscOptions then + begin + if not (vsInitialized in Node^.States) then + InitNode(Node); + if (vsHasChildren in Node^.States) and (Node^.ChildCount = 0) then + InitChildren(Node); + end; + + with Stream do + begin + LastPosition := Position; + // Emit the anchor chunk. + xHeader.ChunkType := NodeChunk; + Write(xHeader, SizeOf(xHeader)); + // Write other chunks to stream taking their size into this chunk's size. + WriteChunks(Stream, Node); + + // Update chunk size. + FinishChunkHeader(Stream, LastPosition, Position); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.AbsoluteIndex(Node: PVirtualNode): Cardinal; + +begin + Result := 0; + while Assigned(Node) and (Node <> FRoot) do + begin + if not (vsInitialized in Node^.States) then + InitNode(Node); + if Assigned(Node^.PrevSibling) then + begin + // if there's a previous sibling then add its total count to the result + Node := Node^.PrevSibling; + Inc(Result, Node^.TotalCount); + end + else + begin + Node := Node^.Parent; + if Node <> FRoot then + Inc(Result); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.AddChild(xParent: PVirtualNode; UserData: Pointer = nil): PVirtualNode; + +// Adds a new node to the given parent node. This is simply done by increasing the child count of the +// parent node. If Parent is nil then the new node is added as (last) top level node. +// UserData can be used to set the first 4 bytes of the user data area to an initial value which can be used +// in OnInitNode and will also cause to trigger the OnFreeNode event (if <> nil) even if the node is not yet +// "officially" initialized. +// AddChild is a compatibility method and will implicitly validate the parent node. This is however +// against the virtual paradigm and hence I dissuade from its usage. + +var + NodeData: ^Pointer; + +begin + if not (toReadOnly in FOptions.FMiscOptions) then + begin + CancelEditNode; + + if xParent = nil then + xParent := FRoot; + if not (vsInitialized in xParent^.States) then + InitNode(xParent); + // Locally stop updates of the tree in order to avoid usage of the new node before it is correctly set up. + // If the update count was 0 on enter then there will be a correct update at the end of this method. + Inc(FUpdateCount); + try + SetChildCount(xParent, xParent^.ChildCount + 1); + // Update the hidden children flag of the parent. Nodes are added as being visible by default. + Exclude(xParent^.States, vsAllChildrenHidden); + finally + Dec(FUpdateCount); + end; + Result := xParent^.LastChild; + + // Check if there is initial user data and there is also enough user data space allocated. + if Assigned(UserData) then + if FNodeDataSize >= 4 then + begin + NodeData := Pointer(PChar(@Result^.Data) + FTotalInternalDataSize); + NodeData^ := UserData; + Include(Result^.States, vsInitialUserData); + end + else + ShowError(SCannotSetUserData, hcTFCannotSetUserData); + + if FUpdateCount = 0 then + begin + ValidateCache; + if tsStructureChangePending in FStates then + begin + if xParent = FRoot then + StructureChange(nil, crChildAdded) + else + StructureChange(xParent, crChildAdded); + end; + + if (toAutoSort in FOptions.FAutoOptions) and (FHeader.FSortColumn > InvalidColumn) then + Sort(xParent, FHeader.FSortColumn, FHeader.FSortDirection, True); + + InvalidateToBottom(xParent); + UpdateScrollbars(True); + end; + end + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AddFromStream(Stream: TStream; TargetNode: PVirtualNode); + +// loads nodes from the given stream and adds them to TargetNode +// the current content is not cleared before the load process starts (see also LoadFromStream) + +var + ThisID: TMagicID; + Version, + Count: Cardinal; + Node: PVirtualNode; + +begin + if not (toReadOnly in FOptions.FMiscOptions) then + begin + // check first whether this is a stream we can read + Stream.ReadBuffer(ThisID, SizeOf(TMagicID)); + if (ThisID[0] = MagicID[0]) and + (ThisID[1] = MagicID[1]) and + (ThisID[2] = MagicID[2]) and + (ThisID[5] = MagicID[5]) then + begin + Version := Word(ThisID[3]); + if Version <= VTTreeStreamVersion then + begin + BeginUpdate; + try + if Version < 2 then + Count := MaxInt + else + Stream.ReadBuffer(Count, SizeOf(Count)); + + while (Stream.Position < Stream.Size) and (Count > 0) do + begin + Dec(Count); + Node := MakeNewNode; + InternalConnectNode(Node, TargetNode, Self, amAddChildLast); + InternalAddFromStream(Stream, Version, Node); + end; + if TargetNode = FRoot then + DoNodeCopied(nil) + else + DoNodeCopied(TargetNode); + finally + EndUpdate; + end; + end + else + ShowError(SWrongStreamVersion, hcTFWrongStreamVersion); + end + else + ShowError(SWrongStreamVersion, hcTFWrongStreamVersion); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.AfterConstruction; + +begin + inherited; + + if FRoot = nil then + InitRootNode; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Assign(Source: TPersistent); + +begin + if (Source is TBaseVirtualTree) and not (toReadOnly in FOptions.FMiscOptions) then + with Source as TBaseVirtualTree do + begin + Self.Align := Align; + Self.Anchors := Anchors; + Self.AutoScrollDelay := AutoScrollDelay; + Self.AutoScrollInterval := AutoScrollInterval; + Self.AutoSize := AutoSize; + Self.Background := Background; +// Self.BevelEdges := BevelEdges; +// Self.BevelInner := BevelInner; +// Self.BevelKind := BevelKind; +// Self.BevelOuter := BevelOuter; +// Self.BevelWidth := BevelWidth; +//b Self.BiDiMode := BiDiMode; + Self.BorderStyle := BorderStyle; + Self.BorderWidth := BorderWidth; + Self.ChangeDelay := ChangeDelay; + Self.CheckImageKind := CheckImageKind; + Self.Color := Color; + Self.Colors.Assign(Colors); + Self.Constraints.Assign(Constraints); + Self.Ctl3D := Ctl3D; + Self.DefaultNodeHeight := DefaultNodeHeight; + Self.DefaultPasteMode := DefaultPasteMode; + Self.DragCursor := DragCursor; + Self.Enabled := Enabled; + Self.Font := Font; + Self.Header := Header; + Self.HintAnimation := HintAnimation; + Self.HintMode := HintMode; + Self.HotCursor := HotCursor; + Self.Images := Images; +// Self.ImeMode := ImeMode; +// Self.ImeName := ImeName; + Self.Indent := Indent; + Self.Margin := Margin; + Self.NodeAlignment := NodeAlignment; + Self.NodeDataSize := NodeDataSize; + Self.TreeOptions := TreeOptions; +//b Self.ParentBiDiMode := ParentBiDiMode; + Self.ParentColor := ParentColor; + Self.ParentCtl3D := ParentCtl3D; + Self.ParentFont := ParentFont; + Self.ParentShowHint := ParentShowHint; + Self.PopupMenu := PopupMenu; + Self.RootNodeCount := RootNodeCount; + Self.ScrollBarOptions := ScrollBarOptions; + Self.ShowHint := ShowHint; + Self.StateImages := StateImages; + Self.TabOrder := TabOrder; + Self.TabStop := TabStop; + Self.Visible := Visible; + Self.SelectionCurveRadius := SelectionCurveRadius; + Self.SelectionBlendFactor := SelectionBlendFactor; + end + else + inherited; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.BeginSynch; + +// Starts the synchronous update mode (if not already active). + +begin + if not (csDestroying in ComponentState) then + begin + if FSynchUpdateCount = 0 then + begin + DoUpdating(usBeginSynch); + + // Stop all timers... + StopTimer(ChangeTimer); + StopTimer(StructureChangeTimer); + StopTimer(ExpandTimer); + StopTimer(EditTimer); + StopTimer(HeaderTimer); + StopTimer(ScrollTimer); + StopTimer(SearchTimer); + FSearchBuffer := ''; + FLastSearchNode := nil; + DoStateChange([], [tsEditPending, tsScrollPending, tsScrolling, tsIncrementalSearching]); + + // ...and trigger pending update states. + if tsStructureChangePending in FStates then + DoStructureChange(FLastStructureChangeNode, FLastStructureChangeReason); + if tsChangePending in FStates then + DoChange(FLastChangedNode); + end + else + DoUpdating(usSynch); + end; + Inc(FSynchUpdateCount); + DoStateChange([tsSynchMode]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.BeginUpdate; + +begin + if not (csDestroying in ComponentState) then + begin + if FUpdateCount = 0 then + begin + DoUpdating(usBegin); + SetUpdateState(True); + end + else + DoUpdating(usUpdate); + end; + Inc(FUpdateCount); + DoStateChange([tsUpdating]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CancelCutOrCopy; + +// Resets nodes which are marked as being cut. + +var + Run: PVirtualNode; + +begin + if ([tsCutPending, tsCopyPending] * FStates) <> [] then + begin + Run := FRoot^.FirstChild; + while Assigned(Run) do + begin + if vsCutOrCopy in Run^.States then + Exclude(Run^.States, vsCutOrCopy); + Run := GetNextNoInit(Run); + end; + end; + DoStateChange([], [tsCutPending, tsCopyPending]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CancelEditNode: Boolean; + +// Called by the application or the current edit link to cancel the edit action. + +begin + if HandleAllocated and ([tsEditing, tsEditPending] * FStates <> []) then + Result := DoCancelEdit + else + Result := True; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CanFocus: Boolean; + +var + Form: TCustomForm; + +begin + Result := inherited CanFocus; + + if Result and not (csDesigning in ComponentState) then + begin + Form := GetParentForm(Self); + Result := (Form = nil) or (Form.Enabled and Form.Visible); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Clear; + +begin + if not (toReadOnly in FOptions.FMiscOptions) or (csDestroying in ComponentState) then + begin + BeginUpdate; + try + InterruptValidation; + if IsEditing then + CancelEditNode; + + if ClipboardStates * FStates <> [] then + begin +//x OleSetClipBoard(nil); + DoStateChange([], ClipboardStates); + end; + ClearSelection; + FFocusedNode := nil; + FLastSelected := nil; + FCurrentHotNode := nil; + DeleteChildren(FRoot, True); + FVisibleCount := 0; + FOffsetX := 0; + FOffsetY := 0; + + {$ifdef UseLocalMemoryManager} + FNodeMemoryManager.Clear; + {$endif UseLocalMemoryManager} + finally + EndUpdate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ClearSelection; + +var + Node: PVirtualNode; + Dummy: Integer; + R: TRect; + Counter: Integer; + +begin + if (FSelectionCount > 0) and not (csDestroying in ComponentState) then + begin + if (FUpdateCount = 0) and HandleAllocated and (FVisibleCount > 0) then + begin + // Iterate through nodes currently visible in the client area and invalidate them. + Node := GetNodeAt(0, 0, True, Dummy); + if Assigned(Node) then + R := GetDisplayRect(Node, NoColumn, False); + Counter := FSelectionCount; + + while Assigned(Node) do + begin + R.Bottom := R.Top + Integer(NodeHeight[Node]); + if vsSelected in Node^.States then + begin + InvalidateRect(Handle, @R, False); + Dec(Counter); + // Only try as many nodes as are selected. + if Counter = 0 then + Break; + end; + R.Top := R.Bottom; + if R.Top > ClientHeight then + Break; + Node := GetNextVisibleNoInit(Node); + end; + end; + + InternalClearSelection; + Change(nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CopyTo(Source: PVirtualNode; Tree: TBaseVirtualTree; Mode: TVTNodeAttachMode; + ChildrenOnly: Boolean): PVirtualNode; + +// A simplified CopyTo method to allow to copy nodes to the root of another tree. + +begin + Result := CopyTo(Source, Tree.FRoot, Mode, ChildrenOnly); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.CopyTo(Source, Target: PVirtualNode; Mode: TVTNodeAttachMode; + ChildrenOnly: Boolean): PVirtualNode; + +// Copies Source and all its child nodes to Target. +// Mode is used to specify further where to add the new node actually (as sibling of Target or as child of Target). +// Result is the newly created node to which source has been copied if ChildrenOnly is False or just contains Target +// in the other case. +// ChildrenOnly determines whether to copy also the source node or only its child nodes. + +var + TargetTree: TBaseVirtualTree; + Stream: TMemoryStream; + +begin + Assert(TreeFromNode(Source) = Self, 'The source tree must contain the source node.'); + + Result := nil; + if (Mode <> amNoWhere) and Assigned(Source) and (Source <> FRoot) then + begin + // Assume that an empty destination means the root in this (the source) tree. + if Target = nil then + begin + TargetTree := Self; + Target := FRoot; + Mode := amAddChildFirst; + end + else + TargetTree := TreeFromNode(Target); + + if not (toReadOnly in TargetTree.FOptions.FMiscOptions) then + begin + if Target = TargetTree.FRoot then + begin + case Mode of + amInsertBefore: + Mode := amAddChildFirst; + amInsertAfter: + Mode := amAddChildLast; + end; + end; + + Stream := TMemoryStream.Create; + try + // Write all nodes into a temprary stream depending on the ChildrenOnly flag. + if not ChildrenOnly then + WriteNode(Stream, Source) + else + begin + Source := Source^.FirstChild; + while Assigned(Source) do + begin + WriteNode(Stream, Source); + Source := Source^.NextSibling; + end; + end; + // Now load the serialized nodes into the target node (tree). + TargetTree.BeginUpdate; + try + Stream.Position := 0; + while Stream.Position < Stream.Size do + begin + Result := TargetTree.MakeNewNode; + InternalConnectNode(Result, Target, TargetTree, Mode); + TargetTree.InternalAddFromStream(Stream, VTTreeStreamVersion, Result); + if not DoNodeCopying(Result, Target) then + begin + TargetTree.DeleteNode(Result); + Result := nil; + end + else + DoNodeCopied(Result); + end; + if ChildrenOnly then + Result := Target; + finally + TargetTree.EndUpdate; + end; + finally + Stream.Free; + end; + + with TargetTree do + begin + InvalidateCache; + if FUpdateCount = 0 then + begin + ValidateCache; + UpdateScrollBars(True); + Invalidate; + end; + StructureChange(Source, crNodeCopied); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CopyToClipBoard; + +//xvar +//x DataObject: IDataObject; + +begin + if FSelectionCount > 0 then + begin +//x DataObject := TVTDataObject.Create(Self, True) as IDataObject; +//x if OleSetClipBoard(DataObject) = S_OK then +//x begin +//x MarkCutCopyNodes; +//x DoStateChange([tsCopyPending]); +//x Invalidate; +//x end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.CutToClipBoard; + +//xvar +//x DataObject: IDataObject; + +begin + if (FSelectionCount > 0) and not (toReadOnly in FOptions.FMiscOptions) then + begin +//x DataObject := TVTDataObject.Create(Self, True) as IDataObject; +//x if OleSetClipBoard(DataObject) = S_OK then +//x begin +//x MarkCutCopyNodes; +//x DoStateChange([tsCutPending], [tsCopyPending]); +//x Invalidate; +//x end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DeleteChildren(Node: PVirtualNode; ResetHasChildren: Boolean = False); + +// Removes all children and their children from memory without changing the vsHasChildren style by default. + +var + Run, + Mark: PVirtualNode; + LastTop, + LastLeft: Integer; + ParentVisible: Boolean; + +begin + if (Node^.ChildCount > 0) and not (toReadOnly in FOptions.FMiscOptions) then + begin + Assert(not (tsIterating in FStates), 'Deleting nodes during tree iteration leads to invalid pointers.'); + + // The code below uses some flags for speed improvements which may cause invalid pointers if updates of + // the tree happen. Hence switch updates off until we have finished the operation. + Inc(FUpdateCount); + try + InterruptValidation; + LastLeft := -FEffectiveOffsetX; + LastTop := FOffsetY; + + // Make a local copy of the visibility state of this node to speed up + // adjusting the visible nodes count. + ParentVisible := Node = FRoot; + if not ParentVisible then + ParentVisible := FullyVisible[Node] and (vsExpanded in Node^.States); + + // Show that we are clearing the child list, to avoid registering structure change events. + Include(Node^.States, vsClearing); + Run := Node^.LastChild; + while Assigned(Run) do + begin + if ParentVisible and (vsVisible in Run^.States) then + Dec(FVisibleCount); + + Include(Run^.States, vsDeleting); + Mark := Run; + Run := Run^.PrevSibling; + // Important, to avoid exchange of invalid pointers while disconnecting the node. + if Assigned(Run) then + Run^.NextSibling := nil; + DeleteNode(Mark); + end; + Exclude(Node^.States, vsClearing); + if ResetHasChildren then + Exclude(Node^.States, vsHasChildren); + if Node <> FRoot then + Exclude(Node^.States, vsExpanded); + Node^.ChildCount := 0; + if (Node = FRoot) or (vsDeleting in Node^.States) then + begin + Node^.TotalHeight := FDefaultNodeHeight + NodeHeight[Node]; + Node^.TotalCount := 1; + end + else + begin + AdjustTotalHeight(Node, NodeHeight[Node]); + AdjustTotalCount(Node, 1); + end; + Node^.FirstChild := nil; + Node^.LastChild := nil; + finally + Dec(FUpdateCount); + end; + + InvalidateCache; + if FUpdateCount = 0 then + begin + ValidateCache; + UpdateScrollbars(True); + // Invalidate entire tree if it scrolled e.g. to make the last node also the + // bottom node in the treeview. + if (LastLeft <> FOffsetX) or (LastTop <> FOffsetY) then + Invalidate + else + InvalidateToBottom(Node); + end; + StructureChange(Node, crChildDeleted); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DeleteNode(Node: PVirtualNode; Reindex: Boolean = True); + +var + LastTop, + LastLeft: Integer; + LastParent: PVirtualNode; + WasInSynchMode: Boolean; + ParentClearing: Boolean; + +begin + if Assigned(Node) and (Node <> FRoot) and not (toReadOnly in FOptions.FMiscOptions) then + begin + Assert(not (tsIterating in FStates), 'Deleting nodes during tree iteration leads to invalid pointers.'); + + // Determine parent node for structure change notification. + ParentClearing := vsClearing in Node^.Parent^.States; + LastParent := Node^.Parent; + + if not ParentClearing then + begin + if LastParent = FRoot then + StructureChange(nil, crChildDeleted) + else + StructureChange(LastParent, crChildDeleted); + end; + + LastLeft := -FEffectiveOffsetX; + LastTop := FOffsetY; + + if vsSelected in Node^.States then + begin + if FUpdateCount = 0 then + begin + // Go temporarily into sync mode to avoid a delayed change event for the node + // when unselecting. + WasInSynchMode := tsSynchMode in FStates; + Include(FStates, tsSynchMode); + RemoveFromSelection(Node); + if not WasInSynchMode then + Exclude(FStates, tsSynchMode); + InvalidateToBottom(LastParent); + end + else + InternalRemoveFromSelection(Node); + end + else + InvalidateToBottom(LastParent); + + if tsHint in FStates then + begin + Application.CancelHint; + DoStateChange([], [tsHint]); + end; + + DeleteChildren(Node); + InternalDisconnectNode(Node, False, Reindex); + DoFreeNode(Node); + + if not ParentClearing then + begin + DetermineHiddenChildrenFlag(LastParent); + InvalidateCache; + if FUpdateCount = 0 then + begin + ValidateCache; + UpdateScrollbars(True); + // Invalidate entire tree if it scrolled e.g. to make the last node also the + // bottom node in the treeview. + if (LastLeft <> FOffsetX) or (LastTop <> FOffsetY) then + Invalidate; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.DeleteSelectedNodes; + +// Deletes all currently selected nodes (including their child nodes). + +var + Nodes: TNodeArray; + I: Integer; + LevelChange: Boolean; + +begin + Nodes := nil; + if (FSelectionCount > 0) and not (toReadOnly in FOptions.FMiscOptions) then + begin + BeginUpdate; + try + Nodes := GetSortedSelection(True); + for I := High(Nodes) downto 1 do + begin + LevelChange := Nodes[I]^.Parent <> Nodes[I - 1]^.Parent; + DeleteNode(Nodes[I], LevelChange); + end; + DeleteNode(Nodes[0]); + finally + EndUpdate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.EditNode(Node: PVirtualNode; Column: TColumnIndex): Boolean; + +// Application triggered edit event for the given node. +// Returns True if the tree started editing otherwise False. + +begin + Assert(Assigned(Node), 'Node must not be nil.'); + Assert((Column > InvalidColumn) and (Column < FHeader.Columns.Count), + 'Column must be a valid column index (-1 if no header is shown).'); + + Result := tsEditing in FStates; + // If the tree is already editing then we don't disrupt this. + if not Result and not (toReadOnly in FOptions.FMiscOptions) then + begin + FocusedNode := Node; + if Assigned(FFocusedNode) and (Node = FFocusedNode) and CanEdit(FFocusedNode, Column) then + begin + FEditColumn := Column; + if not (vsInitialized in Node^.States) then + InitNode(Node); + DoEdit; + Result := tsEditing in FStates; + end + else + Result := False; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.EndEditNode: Boolean; + +// Called by the application or the current edit link to finish the edit action. + +begin + if [tsEditing, tsEditPending] * FStates <> [] then + Result := DoEndEdit + else + Result := True; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.EndSynch; + +begin + if FSynchUpdateCount > 0 then + Dec(FSynchUpdateCount); + + if not (csDestroying in ComponentState) then + begin + if FSynchUpdateCount = 0 then + begin + DoStateChange([], [tsSynchMode]); + DoUpdating(usEndSynch); + end + else + DoUpdating(usSynch); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.EndUpdate; + +var + NewSize: Integer; + +begin + if FUpdateCount > 0 then + Dec(FUpdateCount); + + if not (csDestroying in ComponentState) then + begin + if (FUpdateCount = 0) and (tsUpdating in FStates) then + begin + if tsUpdateHiddenChildrenNeeded in FStates then + begin + DetermineHiddenChildrenFlagAllNodes; + Exclude(FStates, tsUpdateHiddenChildrenNeeded); + end; + + DoStateChange([], [tsUpdating]); + NewSize := PackArray(FSelection, FSelectionCount); + if NewSize > -1 then + begin + FSelectionCount := NewSize; + SetLength(FSelection, FSelectionCount); + end; + ValidateCache; + if HandleAllocated then + UpdateScrollBars(True); + + if tsStructureChangePending in FStates then + DoStructureChange(FLastStructureChangeNode, FLastStructureChangeReason); + if tsChangePending in FStates then + DoChange(FLastChangedNode); + + if toAutoSort in FOptions.FAutoOptions then + SortTree(FHeader.FSortColumn, FHeader.FSortDirection, True); + + SetUpdateState(False); + if HandleAllocated then + Invalidate; + end; + + if FUpdateCount = 0 then + DoUpdating(usEnd) + else + DoUpdating(usUpdate); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.ExecuteAction(xAction: TBasicAction): Boolean; + +// Some support for standard actions. + +begin + Result := inherited ExecuteAction(xAction); + + if not Result then + begin + Result := xAction is TEditSelectAll; + if Result then + SelectAll(False) + else + begin + Result := xAction is TEditCopy; + if Result then + CopyToClipboard + else + if not (toReadOnly in FOptions.FMiscOptions) then + begin + Result := xAction is TEditCut; + if Result then + CutToClipboard + else + begin + Result := xAction is TEditPaste; + if Result then + PasteFromClipboard + else + begin + Result := xAction is TEditDelete; + if Result then + DeleteSelectedNodes + end; + end; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.FinishCutOrCopy; + +// Deletes nodes which are marked as being cutted. + +var + Run: PVirtualNode; + +begin + if tsCutPending in FStates then + begin + Run := FRoot^.FirstChild; + while Assigned(Run) do + begin + if vsCutOrCopy in Run^.States then + DeleteNode(Run); + Run := GetNextNoInit(Run); + end; + DoStateChange([], [tsCutPending]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.FlushClipboard; + +// Used to render the data which is currently on the clipboard (finishes delayed rendering). + +begin + if ClipboardStates * FStates <> [] then + begin + DoStateChange([tsClipboardFlushing]); +//x OleFlushClipboard; + CancelCutOrCopy; + DoStateChange([], [tsClipboardFlushing]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.FullCollapse(Node: PVirtualNode = nil); + +// This routine collapses all expanded nodes in the subtree given by Node or the whole tree if Node is FRoot or nil. +// Only nodes which are expanded will be collapsed. This excludes uninitialized nodes but nodes marked as visible +// will still be collapsed if they are expanded. + +var + Stop: PVirtualNode; + +begin + if FRoot^.TotalCount > 1 then + begin + if Node = FRoot then + Node := nil; + + DoStateChange([tsCollapsing]); + BeginUpdate; + try + Stop := Node; + Node := GetLastVisibleNoInit(Node); + + if Assigned(Node) then + begin + repeat + if [vsHasChildren, vsExpanded] * Node^.States = [vsHasChildren, vsExpanded] then + ToggleNode(Node); + Node := GetPreviousNoInit(Node); + until Node = Stop; + + // Collapse the start node too. + if Assigned(Node) and ([vsHasChildren, vsExpanded] * Node^.States = [vsHasChildren, vsExpanded]) then + ToggleNode(Node); + end; + finally + EndUpdate; + DoStateChange([], [tsCollapsing]); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.FullExpand(Node: PVirtualNode = nil); + +// This routine expands all collapsed nodes in the subtree given by Node or the whole tree if Node is FRoot or nil. +// All nodes on the way down are initialized so this procedure might take a long time. +// Since all nodes are validated, the tree cannot make use of optimatizations. Hence it is counter productive and you +// should consider avoiding its use. + +var + Stop: PVirtualNode; + +begin + if FRoot^.TotalCount > 1 then + begin + DoStateChange([tsExpanding]); + BeginUpdate; + try + if Node = nil then + begin + Node := FRoot^.FirstChild; + Stop := nil; + end + else + begin + Stop := Node^.NextSibling; + if Stop = nil then + begin + Stop := Node; + repeat + Stop := Stop^.Parent; + until (Stop = FRoot) or Assigned(Stop^.NextSibling); + if Stop = FRoot then + Stop := nil + else + Stop := Stop^.NextSibling; + end; + end; + + // Initialize the start node. Others will be initialized in GetNext. + if not (vsInitialized in Node^.States) then + InitNode(Node); + + repeat + if not (vsExpanded in Node^.States) then + ToggleNode(Node); + Node := GetNext(Node); + until Node = Stop; + finally + EndUpdate; + DoStateChange([], [tsExpanding]); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetControlsAlignment: TAlignment; + +begin + Result := FAlignment; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetDisplayRect(Node: PVirtualNode; Column: TColumnIndex; TextOnly: Boolean; + Unclipped: Boolean = False): TRect; + +// Determines the client coordinates the given node covers, depending on scrolling, expand state etc. +// If the given node cannot be found (because one of its parents is collapsed or it is invisible) then an empty +// rectangle is returned. +// If TextOnly is True then only the text bounds are returned, that is, the resulting rectangle's left and right border +// are updated according to bidi mode, alignment and text width of the node. +// If Unclipped is True (which only makes sense if also TextOnly is True) then the calculated text rectangle is +// not clipped if the text does not entirely fit into the text space. This is special handling needed for hints. +// If Column is -1 then the entire client width is used before determining the node's width otherwise the bounds of the +// particular column are used. +// Note: Column must be a valid column and is used independent of whether the header is visible or not. + +var + Temp: PVirtualNode; + Offset: Cardinal; + xIndent, + TextWidth: Integer; + MainColumnHit, + Ghosted: Boolean; + CurrentBidiMode: TBidiMode; + CurrentAlignment: TAlignment; + +begin + Assert(Assigned(Node), 'Node must not be nil.'); + Assert(Node <> FRoot, 'Node must not be the hidden root node.'); + + MainColumnHit := (Column + 1) in [0, FHeader.MainColumn + 1]; + if not (vsInitialized in Node^.States) then + InitNode(Node); + + Result := Rect(0, 0, 0, 0); + + // Check whether the node is visible (determine indentation level btw.). + Temp := Node; + xIndent := 0; + while Temp <> FRoot do + begin + if not (vsVisible in Temp^.States) or not (vsExpanded in Temp^.Parent^.States) then + Exit; + Temp := Temp^.Parent; + if MainColumnHit and (Temp <> FRoot) then + Inc(xIndent, FIndent); + end; + + // Here we know the node is visible. + Offset := 0; + if tsUseCache in FStates then + begin + // If we can use the position cache then do a binary search to find a cached node which is as close as possible + // to the current node. Iterate then through all following and visible nodes and sum up their heights. + Temp := FindInPositionCache(Node, Offset); + while Assigned(Temp) and (Temp <> Node) do + begin + Inc(Offset, NodeHeight[Temp]); + Temp := GetNextVisibleNoInit(Temp); + end; + end + else + begin + // If the cache is not available then go straight through all nodes up to the root and sum up their heights. + Temp := Node; + repeat + Temp := GetPreviousVisibleNoInit(Temp); + if Temp = nil then + Break; + Inc(Offset, NodeHeight[Temp]); + until False; + end; + + Result := Rect(0, Offset, Max(FRangeX, ClientWidth), Offset + NodeHeight[Node]); + + // Limit left and right bounds to the given column (if any) and move bounds according to current scroll state. + if Column > NoColumn then + begin + FHeader.FColumns.GetColumnBounds(Column, Result.Left, Result.Right); + // The right column border is not part of this cell. + Dec(Result.Right); + OffsetRect(Result, 0, FOffsetY); + end + else + OffsetRect(Result, -FEffectiveOffsetX, FOffsetY); + + // Limit left and right bounds further if only the text area is required. + if TextOnly then + begin + // Start with the offset of the text in the column and consider the indentation level too. + Offset := FMargin + xIndent; + // If the text of a node is involved then we have to consider directionality and alignment too. + if Column = NoColumn then + begin +//b CurrentBidiMode := BidiMode; + CurrentAlignment := Alignment; + end + else + begin +//b CurrentBidiMode := FHeader.FColumns[Column].BidiMode; + CurrentAlignment := FHeader.FColumns[Column].Alignment; + end; + + TextWidth := DoGetNodeWidth(Node, Column); + + if MainColumnHit then + begin + if toShowRoot in FOptions.FPaintOptions then + Inc(Offset, FIndent); + if (toCheckSupport in FOptions.FMiscOptions) and Assigned(FCheckImages) and (Node^.CheckType <> ctNone) then + Inc(Offset, FCheckImages.Width + 2); + end; + // Consider associated images. + if Assigned(FStateImages) and (GetImageIndex(Node, ikState, Column, Ghosted) > -1) then + Inc(Offset, FStateImages.Width + 2); + if Assigned(FImages) and (GetImageIndex(Node, ikNormal, Column, Ghosted) > -1) then + Inc(Offset, FImages.Width + 2); + + // Offset contains now the distance from the left or right border of the rectangle (depending on bidi mode). + // Now consider the alignment too and calculate the final result. +//b if CurrentBidiMode = bdLeftToRight then +//b begin + Inc(Result.Left, Offset); + // Left-to-right reading does not need any special adjustment of the alignment. +//b end +//b else +//b begin +//b Dec(Result.Right, Offset); +//b +//b // Consider bidi mode here. In RTL context does left alignment actually mean right alignment and vice versa. +//b ChangeBiDiModeAlignment(CurrentAlignment); +//b end; + + if Unclipped then + begin + // The caller requested the text coordinates unclipped. This means they must be calculated so as would + // there be enough space, regardless of column bounds etc. + // The layout still depends on the available space too, because this determines the position + // of the unclipped text rectangle. + if Result.Right - Result.Left < TextWidth then +//b if CurrentBidiMode = bdLeftToRight then + CurrentAlignment := taLeftJustify; +//b else +//b CurrentAlignment := taRightJustify; + + case CurrentAlignment of + taCenter: + begin + Result.Left := (Result.Left + Result.Right - TextWidth) div 2; + Result.Right := Result.Left + TextWidth; + end; + taRightJustify: + Result.Left := Result.Right - TextWidth; + else // taLeftJustify + Result.Right := Result.Left + TextWidth; + end; + end + else + // Modify rectangle only if the text fits entirely into the given room. + if Result.Right - Result.Left > TextWidth then + case CurrentAlignment of + taCenter: + begin + Result.Left := (Result.Left + Result.Right - TextWidth) div 2; + Result.Right := Result.Left + TextWidth; + end; + taRightJustify: + Result.Left := Result.Right - TextWidth; + else // taLeftJustify + Result.Right := Result.Left + TextWidth; + end; + end; + if hoVisible in FHeader.FOptions then + inc(Result.Top,FHeader.Height); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirst: PVirtualNode; + +// Returns the first node in the tree. + +begin + Result := FRoot^.FirstChild; + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstChild(Node: PVirtualNode): PVirtualNode; + +// Returns the first child of the given node. The result node is initialized before exit. + +begin + if (Node = nil) or (Node = FRoot) then + Result := FRoot^.FirstChild + else + begin + if not (vsInitialized in Node^.States) then + InitNode(Node); + if vsHasChildren in Node^.States then + begin + if Node^.ChildCount = 0 then + InitChildren(Node); + Result := Node^.FirstChild; + end + else + Result := nil; + end; + + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstCutCopy: PVirtualNode; + +// Returns the first node in the tree which is currently marked for a clipboard operation. +// See also GetNextCutCopy for comments on initialization. + +begin + Result := GetNextCutCopy(nil); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstInitialized: PVirtualNode; + +// Returns the first node which is already initialized. + +begin + Result := FRoot^.FirstChild; + if Assigned(Result) and not (vsInitialized in Result^.States) then + Result := GetNextInitialized(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstNoInit: PVirtualNode; + +begin + Result := FRoot^.FirstChild; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstSelected: PVirtualNode; + +// Returns the first node in the current selection. + +begin + Result := GetNextSelected(nil); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstVisible: PVirtualNode; + +// Returns the first visible node in the tree. If necessary nodes are initialized on demand. + +begin + if vsHasChildren in FRoot^.States then + begin + Result := FRoot; + + if Result^.ChildCount = 0 then + InitChildren(Result); + + // Child nodes are the first choice if possible. + if Assigned(Result^.FirstChild) then + begin + Result := GetFirstChild(Result); + + // If there are no children or the first child is not visible then search the sibling nodes or traverse parents. + if not (vsVisible in Result^.States) then + begin + repeat + // Is there a next sibling? + if Assigned(Result^.NextSibling) then + begin + Result := Result^.NextSibling; + // The visible state can be removed during initialization so init the node first. + if not (vsInitialized in Result^.States) then + InitNode(Result); + if vsVisible in Result^.States then + Break; + end + else + begin + // No sibling anymore, so use the parent's next sibling. + if Result^.Parent <> FRoot then + Result := Result^.Parent + else + begin + // There are no further nodes to examine, hence there is no further visible node. + Result := nil; + Break; + end; + end; + until False; + end; + end + else + Result := nil; + end + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstVisibleChild(Node: PVirtualNode): PVirtualNode; + +// Returns the first visible child node of Node. If necessary nodes are initialized on demand. + +begin + Result := GetFirstChild(Node); + if Assigned(Result) and not (vsVisible in Result^.States) then + Result := GetNextVisibleSibling(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstVisibleChildNoInit(Node: PVirtualNode): PVirtualNode; + +// Returns the first visible child node of Node. + +begin + if Node = nil then + Node := FRoot; + Result := Node^.FirstChild; + if Assigned(Result) and not (vsVisible in Result^.States) then + Result := GetNextVisibleSiblingNoInit(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetFirstVisibleNoInit: PVirtualNode; + +// Returns the first visible node in the tree. No initialization is performed. + +begin + if vsHasChildren in FRoot^.States then + begin + Result := FRoot; + + // Child nodes are the first choice if possible. + if Assigned(Result^.FirstChild) then + begin + Result := Result^.FirstChild; + + // If there are no children or the first child is not visible then search the sibling nodes or traverse parents. + if not (vsVisible in Result^.States) then + begin + repeat + // Is there a next sibling? + if Assigned(Result^.NextSibling) then + begin + Result := Result^.NextSibling; + if vsVisible in Result^.States then + Break; + end + else + begin + // No sibling anymore, so use the parent's next sibling. + if Result^.Parent <> FRoot then + Result := Result^.Parent + else + begin + // There are no further nodes to examine, hence there is no further visible node. + Result := nil; + Break; + end; + end; + until False; + end; + end + else + Result := nil; + end + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.GetHitTestInfoAt(X, Y: Integer; Relative: Boolean; var HitInfo: THitInfo); + +// Determines the node that occupies the specified point or nil if there's none. The parameter Relative determines +// whether to consider X and Y as being client coordinates (if True) or as being absolute tree coordinates. +// HitInfo is filled with flags describing the hit further. + +var + ColLeft, + ColRight: Integer; + NodeTop: Integer; + InitialColumn, + NextColumn: TColumnIndex; + CurrentBidiMode: TBidiMode; + CurrentAlignment: TAlignment; + +begin + HitInfo.HitNode := nil; + HitInfo.HitPositions := []; + HitInfo.HitColumn := NoColumn; + + // Determine if point lies in the tree's client area. + if X < 0 then + Include(HitInfo.HitPositions, hiToLeft) + else + if X > Max(FRangeX, ClientWidth) then + Include(HitInfo.HitPositions, hiToRight); + + if Y < 0 then + Include(HitInfo.HitPositions, hiAbove) + else + if Y > Max(FRangeY, ClientHeight) then + Include(HitInfo.HitPositions, hiBelow); + + // Convert position into absolute coordinate if necessary. + if Relative then + begin + if X > Header.Columns.GetVisibleFixedWidth then + Inc(X, FEffectiveOffsetX); + Inc(Y, -FOffsetY); + end; + if hoVisible in FHeader.FOptions then + dec(Y,FHeader.Height); + // If the point is in the tree area then check the nodes. + if HitInfo.HitPositions = [] then + begin + HitInfo.HitNode := GetNodeAt(X, Y, False, NodeTop); + if HitInfo.HitNode = nil then + Include(HitInfo.HitPositions, hiNowhere) + else + begin + // At this point we need some info about the node, so it must be initialized. + if not (vsInitialized in HitInfo.HitNode^.States) then + InitNode(HitInfo.HitNode); + + if FHeader.UseColumns then + begin + HitInfo.HitColumn := FHeader.Columns.GetColumnAndBounds(Point(X, Y), ColLeft, ColRight, False); + // If auto column spanning is enabled then look for the last non empty column. + if toAutoSpanColumns in FOptions.FAutoOptions then + begin + InitialColumn := HitInfo.HitColumn; + // Search to the left of the hit column for empty columns. + while (HitInfo.HitColumn > NoColumn) and ColumnIsEmpty(HitInfo.HitNode, HitInfo.HitColumn) do + begin + NextColumn := FHeader.FColumns.GetPreviousVisibleColumn(HitInfo.HitColumn); + if NextColumn = InvalidColumn then + Break; + HitInfo.HitColumn := NextColumn; + Dec(ColLeft, FHeader.FColumns[NextColumn].Width); + end; + // Search to the right of the hit column for empty columns. + repeat + InitialColumn := FHeader.FColumns.GetNextVisibleColumn(InitialColumn); + if (InitialColumn = InvalidColumn) or not ColumnIsEmpty(HitInfo.HitNode, InitialColumn) then + Break; + Inc(ColRight, FHeader.FColumns[InitialColumn].Width); + until False; + end; + // Make the X position and the right border relative to the start of the column. + Dec(X, ColLeft); + Dec(ColRight, ColLeft); + end + else + begin + HitInfo.HitColumn := NoColumn; + ColRight := Max(FRangeX, ClientWidth); + end; + ColLeft := 0; + + if HitInfo.HitColumn = InvalidColumn then + Include(HitInfo.HitPositions, hiNowhere) + else + begin + // From now on X is in "column" coordinates (relative to the left column border). + HitInfo.HitPositions := [hiOnItem]; + if HitInfo.HitColumn = NoColumn then + begin +//b CurrentBidiMode := BidiMode; + CurrentAlignment := Alignment; + end + else + begin +//b CurrentBidiMode := FHeader.FColumns[HitInfo.HitColumn].BidiMode; + CurrentAlignment := FHeader.FColumns[HitInfo.HitColumn].Alignment; + end; + +//b if CurrentBidiMode = bdLeftToRight then + DetermineHitPositionLTR(HitInfo, X, ColRight, CurrentAlignment); +//b else +//b DetermineHitPositionRTL(HitInfo, X, ColRight, CurrentAlignment); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLast(Node: PVirtualNode = nil): PVirtualNode; + +// Returns the very last node in the tree branch given by Node and initializes the nodes all the way down including the +// result. By using Node = nil the very last node in the tree is returned. + +var + Next: PVirtualNode; + +begin + Result := GetLastChild(Node); + while Assigned(Result) do + begin + // Test if there is a next last child. If not keep the node from the last run. + // Otherwise use the next last child. + Next := GetLastChild(Result); + if Next = nil then + Break; + Result := Next; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastInitialized(Node: PVirtualNode): PVirtualNode; + +// Returns the very last initialized child node in the tree branch given by Node. + +begin + Result := GetLastNoInit(Node); + if Assigned(Result) and not (vsInitialized in Result^.States) then + Result := GetPreviousInitialized(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastNoInit(Node: PVirtualNode = nil): PVirtualNode; + +// Returns the very last node in the tree branch given by Node without initialization. + +var + Next: PVirtualNode; + +begin + Result := GetLastChildNoInit(Node); + while Assigned(Result) do + begin + // Test if there is a next last child. If not keep the node from the last run. + // Otherwise use the next last child. + Next := GetLastChildNoInit(Result); + if Next = nil then + Break; + Result := Next; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastChild(Node: PVirtualNode): PVirtualNode; + +// Determines the last child of the given node and initializes it if there is one. + +begin + if (Node = nil) or (Node = FRoot) then + Result := FRoot^.LastChild + else + begin + if not (vsInitialized in Node^.States) then + InitNode(Node); + if vsHasChildren in Node^.States then + begin + if Node^.ChildCount = 0 then + InitChildren(Node); + Result := Node^.LastChild; + end + else + Result := nil; + end; + + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastChildNoInit(Node: PVirtualNode): PVirtualNode; + +// Determines the last child of the given node but does not initialize it. + +begin + if (Node = nil) or (Node = FRoot) then + Result := FRoot^.LastChild + else + begin + if vsHasChildren in Node^.States then + Result := Node^.LastChild + else + Result := nil; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastVisible(Node: PVirtualNode = nil): PVirtualNode; + +// Returns the very last visible node in the tree and initializes nodes all the way down including the result node. + +var + Next: PVirtualNode; + +begin + Result := GetLastVisibleChild(Node); + while Assigned(Result) do + begin + // Test if there is a next last visible child. If not keep the node from the last run. + // Otherwise use the next last visible child. + Next := GetLastVisibleChild(Result); + if Next = nil then + Break; + Result := Next; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastVisibleChild(Node: PVirtualNode): PVirtualNode; + +// Determines the last visible child of the given node and initializes it if necessary. + +begin + if (Node = nil) or (Node = FRoot) then + Result := GetLastChild(FRoot) + else + if FullyVisible[Node] and (vsExpanded in Node^.States) then + Result := GetLastChild(Node) + else + Result := nil; + + if Assigned(Result) and not (vsVisible in Result^.States) then + Result := GetPreviousVisibleSibling(Result); + + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastVisibleChildNoInit(Node: PVirtualNode): PVirtualNode; + +// Determines the last visible child of the given node without initialization. + +begin + if (Node = nil) or (Node = FRoot) then + Result := GetLastChildNoInit(FRoot) + else + if FullyVisible[Node] and (vsExpanded in Node^.States) then + Result := GetLastChildNoInit(Node) + else + Result := nil; + + if Assigned(Result) and not (vsVisible in Result^.States) then + Result := GetPreviousVisibleSiblingNoInit(Result); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetLastVisibleNoInit(Node: PVirtualNode = nil): PVirtualNode; + +// Returns the very last visible node in the tree without initialization. + +var + Next: PVirtualNode; + +begin + Result := GetLastVisibleChildNoInit(Node); + while Assigned(Result) do + begin + // Test if there is a next last visible child. If not keep the node from the last run. + // Otherwise use the next last visible child. + Next := GetLastVisibleChildNoInit(Result); + if Next = nil then + Break; + Result := Next; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetMaxColumnWidth(Column: TColumnIndex): Integer; + +// This method determines the width of the largest node in the given column. +// Note: Every visible node in the tree will be initialized contradicting so the virtual paradigm. + +var + Run, + NextNode: PVirtualNode; + NodeLeft, + TextLeft, + CurrentWidth: Integer; + WithCheck, + WithImages, + WithStateImages, + Ghosted: Boolean; + CheckOffset, + ImageOffset, + StateImageOffset: Integer; + +begin + Result := 0; + + // Don't check the event here as descendant trees might have overriden the DoGetImageIndex method. + WithImages := Assigned(FImages); + if WithImages then + ImageOffset := FImages.Width + 2 + else + ImageOffset := 0; + WithStateImages := Assigned(FStateImages); + if WithStateImages then + StateImageOffset := FStateImages.Width + 2 + else + StateImageOffset := 0; + if Assigned(FCheckImages) then + CheckOffset := FCheckImages.Width + 2 + else + CheckOffset := 0; + + Run := GetFirstVisible; + if Column = FHeader.MainColumn then + begin + if toShowRoot in FOptions.FPaintOptions then + NodeLeft := Integer((GetNodeLevel(Run) + 1) * FIndent) + else + NodeLeft := Integer(GetNodeLevel(Run) * FIndent); + + WithCheck := (toCheckSupport in FOptions.FMiscOptions) and Assigned(FCheckImages); + end + else + begin + NodeLeft := 0; + WithCheck := False; + end; + + // Leave a margin at both sides of the nodes. + Inc(NodeLeft, 2 * FMargin); + + while Assigned(Run) do + begin + TextLeft := NodeLeft; + if WithCheck and (Run^.CheckType <> ctNone) then + Inc(TextLeft, CheckOffset); + if WithImages and (GetImageIndex(Run, ikNormal, Column, Ghosted) > -1) then + Inc(TextLeft, ImageOffset); + if WithStateImages and (GetImageIndex(Run, ikState, Column, Ghosted) > -1) then + Inc(TextLeft, StateImageOffset); + + CurrentWidth := DoGetNodeWidth(Run, Column); + + if Result < (TextLeft + CurrentWidth) then + Result := TextLeft + CurrentWidth; + + // Get next visible node and update left node position if needed. + NextNode := GetNextVisible(Run); + if NextNode = nil then + Break; + if Column = Header.MainColumn then + Inc(NodeLeft, CountLevelDifference(Run, NextNode) * Integer(FIndent)); + Run := NextNode; + end; + if toShowVertGridLines in FOptions.FPaintOptions then + Inc(Result) +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNext(Node: PVirtualNode): PVirtualNode; + +// Returns next node in tree (advances to next sibling of the node's parent or its parent, if necessary). + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // Has this node got children? + if vsHasChildren in Result^.States then + begin + // Yes, there are child nodes. Initialize them if necessary. + if Result^.ChildCount = 0 then + InitChildren(Result); + end; + + // if there is no child node try siblings + if Assigned(Result^.FirstChild) then + Result := Result^.FirstChild + else + begin + repeat + // Is there a next sibling? + if Assigned(Result^.NextSibling) then + begin + Result := Result^.NextSibling; + Break; + end + else + begin + // No sibling anymore, so use the parent's next sibling. + if Result^.Parent <> FRoot then + Result := Result^.Parent + else + begin + // There are no further nodes to examine, hence there is no further visible node. + Result := nil; + Break; + end; + end; + until False; + end; + + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextCutCopy(Node: PVirtualNode): PVirtualNode; + +// Returns the next node in the tree which is currently marked for a clipboard operation. Since only visible nodes can +// be marked (or they are hidden after they have been marked) it is not necessary to initialize nodes to check for +// child nodes. The result, however, is initialized if necessary. + +begin + if ClipboardStates * FStates <> [] then + begin + if (Node = nil) or (Node = FRoot) then + Result := FRoot^.FirstChild + else + Result := GetNextNoInit(Node); + while Assigned(Result) and not (vsCutOrCopy in Result^.States) do + Result := GetNextNoInit(Result); + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); + end + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextInitialized(Node: PVirtualNode): PVirtualNode; + +// Returns the next node in tree which is initialized. + +begin + Result := Node; + repeat + Result := GetNextNoInit(Result); + until (Result = nil) or (vsInitialized in Result^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextNoInit(Node: PVirtualNode): PVirtualNode; + +// Optimized variant of GetNext, no initialization of nodes is performed (if a node is not initialized +// then it is considered as not being there). + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // If there is no child node try siblings. + if Assigned(Result^.FirstChild) then + Result := Result^.FirstChild + else + begin + repeat + // Is there a next sibling? + if Assigned(Result^.NextSibling) then + begin + Result := Result^.NextSibling; + Break; + end + else + begin + // No sibling anymore, so use the parent's next sibling. + if Result^.Parent <> FRoot then + Result := Result^.Parent + else + begin + // There are no further nodes to examine, hence there is no further visible node. + Result := nil; + Break; + end; + end; + until False; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextSelected(Node: PVirtualNode): PVirtualNode; + +// Returns the next node in the tree which is currently selected. Since children of unitialized nodes cannot be +// in the current selection (because they simply do not exist yet) it is not necessary to initialize nodes here. +// The result however is initialized if necessary. + +begin + if FSelectionCount > 0 then + begin + if (Node = nil) or (Node = FRoot) then + Result := FRoot^.FirstChild + else + Result := GetNextNoInit(Node); + while Assigned(Result) and not (vsSelected in Result^.States) do + Result := GetNextNoInit(Result); + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); + end + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextSibling(Node: PVirtualNode): PVirtualNode; + +// Returns the next sibling of Node and initializes it if necessary. + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + Result := Result^.NextSibling; + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextVisible(Node: PVirtualNode): PVirtualNode; + +// Returns next node in tree, with regard to Node, which is visible. +// Nodes which need an initialization (including the result) are initialized. + +var + ForceSearch: Boolean; + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // If the given node is not visible then look for a parent node which is visible, otherwise we will + // likely go unnecessarily through a whole bunch of invisible nodes. + if not FullyVisible[Result] then + Result := GetVisibleParent(Result); + + // Has this node got children? + if [vsHasChildren, vsExpanded] * Result^.States = [vsHasChildren, vsExpanded] then + begin + // Yes, there are child nodes. Initialize them if necessary. + if Result^.ChildCount = 0 then + InitChildren(Result); + end; + + // Child nodes are the first choice if possible. + if (vsExpanded in Result^.States) and Assigned(Result^.FirstChild) then + begin + Result := GetFirstChild(Result); + ForceSearch := False; + end + else + ForceSearch := True; + + // If there are no children or the first child is not visible then search the sibling nodes or traverse parents. + if Assigned(Result) and (ForceSearch or not (vsVisible in Result^.States)) then + begin + repeat + // Is there a next sibling? + if Assigned(Result^.NextSibling) then + begin + Result := Result^.NextSibling; + if not (vsInitialized in Result^.States) then + InitNode(Result); + if vsVisible in Result^.States then + Break; + end + else + begin + // No sibling anymore, so use the parent's next sibling. + if Result^.Parent <> FRoot then + Result := Result^.Parent + else + begin + // There are no further nodes to examine, hence there is no further visible node. + Result := nil; + Break; + end; + end; + until False; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextVisibleNoInit(Node: PVirtualNode): PVirtualNode; + +// Returns the next node in tree, with regard to Node, which is visible. +// No initialization is done. + +var + ForceSearch: Boolean; + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // If the given node is not visible then look for a parent node which is visible, otherwise we will + // likely go unnecessarily through a whole bunch of invisible nodes. + if not FullyVisible[Result] then + Result := GetVisibleParent(Result); + + // Child nodes are the first choice if possible. + if (vsExpanded in Result^.States) and Assigned(Result^.FirstChild) then + begin + Result := Result^.FirstChild; + ForceSearch := False; + end + else + ForceSearch := True; + + // If there are no children or the first child is not visible then search the sibling nodes or traverse parents. + if ForceSearch or not (vsVisible in Result^.States) then + begin + repeat + // Is there a next sibling? + if Assigned(Result^.NextSibling) then + begin + Result := Result^.NextSibling; + if vsVisible in Result^.States then + Break; + end + else + begin + // No sibling anymore, so use the parent's next sibling. + if Result^.Parent <> FRoot then + Result := Result^.Parent + else + begin + // There are no further nodes to examine, hence there is no further visible node. + Result := nil; + Break; + end; + end; + until False; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextVisibleSibling(Node: PVirtualNode): PVirtualNode; + +// Returns the next visible sibling after Node. Initialization is done implicitly. + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameter.'); + + Result := Node; + repeat + Result := GetNextSibling(Result); + until (Result = nil) or (vsVisible in Result^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNextVisibleSiblingNoInit(Node: PVirtualNode): PVirtualNode; + +// Returns the next visible sibling after Node. + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameter.'); + + Result := Node; + repeat + Result := Result^.NextSibling; + until (Result = nil) or (vsVisible in Result^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNodeAt(X, Y: Integer): PVirtualNode; + +// Overloaded variant of GetNodeAt to easy life of application developers which do not need to have the exact +// top position returned and always use client coordinates. + +var + Dummy: Integer; + +begin + Result := GetNodeAt(X, Y, True, Dummy); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNodeAt(X, Y: Integer; Relative: Boolean; var NodeTop: Integer): PVirtualNode; + +// This method returns the node that occupies the specified point, or nil if there's none. +// If Releative is True then X and Y are given in client coordinates otherwise they are considered as being +// absolute values into the virtual tree image (regardless of the current offsets in the tree window). +// NodeTop gets the absolute or relative top position of the node returned or is untouched if no node +// could be found. + +var + AbsolutePos, + CurrentPos: Cardinal; + +begin + if Y < 0 then + Y := 0; + + AbsolutePos := Y; + if Relative then + Inc(AbsolutePos, -FOffsetY); + + // CurrentPos tracks a running term of the current position to test for. + // It corresponds always to the top position of the currently considered node. + CurrentPos := 0; + + // If the cache is available then use it. + if tsUseCache in FStates then + Result := FindInPositionCache(AbsolutePos, CurrentPos) + else + Result := GetFirstVisibleNoInit; + + // Determine node, of which position and height corresponds to the scroll position most closely. + while Assigned(Result) and (Result <> FRoot) do + begin + if (vsVisible in Result^.States) and (AbsolutePos < (CurrentPos + Result^.TotalHeight)) then + begin + // Found a node which covers the given position. Now go down one level + // and search its children (if any, otherwise stop looking). + if (AbsolutePos >= CurrentPos + NodeHeight[Result]) and Assigned(Result^.FirstChild) and + (vsExpanded in Result^.States) then + begin + Inc(CurrentPos, NodeHeight[Result]); + Result := Result^.FirstChild; + Continue; + end + else + Break; + end + else + begin + // Advance current position to after the current node, if the node is visible. + if vsVisible in Result^.States then + Inc(CurrentPos, Result^.TotalHeight); + // Find following node not being a child of the currently considered node (e.g. a sibling or parent). + repeat + // Is there a next sibling? + if Assigned(Result^.NextSibling) then + begin + Result := Result^.NextSibling; + if vsVisible in Result^.States then + Break; + end + else + begin + // No sibling anymore, so use the parent's next sibling. + if Result^.Parent <> FRoot then + Result := Result^.Parent + else + begin + // There are no further nodes to examine, hence there is no further visible node. + Result := nil; + Break; + end; + end; + until False; + end; + end; + + if Result = FRoot then + Result := nil; + + // Since the given vertical position is likely not the same as the top position + // of the found node this top position is returned. + if Assigned(Result) then + begin + NodeTop := CurrentPos; + if Relative then + Inc(NodeTop, FOffsetY); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNodeData(Node: PVirtualNode): Pointer; + +// Returns the address of the user defined data area in the node. + +begin + Assert(FNodeDataSize > 0, 'NodeDataSize not initialized.'); + + if (FNodeDataSize <= 0) or (Node = nil) or (Node = FRoot) then + Result := nil + else + Result := PChar(@Node^.Data) + FTotalInternalDataSize; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetNodeLevel(Node: PVirtualNode): Cardinal; + +// returns the level of the given node + +var + Run: PVirtualNode; + +begin + Result := 0; + if Assigned(Node) and (Node <> FRoot) then + begin + Run := Node^.Parent; + while Run <> FRoot do + begin + Run := Run^.Parent; + Inc(Result); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPrevious(Node: PVirtualNode): PVirtualNode; + +// Resturns previous node in tree with regard to Node. The result node is initialized if necessary. + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(vsInitialized in Result^.States, 'Node must already be initialized.'); + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // Is there a previous sibling? + if Assigned(Node^.PrevSibling) then + begin + // Go down and find the last child node. + Result := GetLast(Node^.PrevSibling); + if Result = nil then + Result := Node^.PrevSibling; + end + else + // no previous sibling so the parent of the node is the previous visible node + if Node^.Parent <> FRoot then + Result := Node^.Parent + else + Result := nil; + + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPreviousInitialized(Node: PVirtualNode): PVirtualNode; + +// Returns the previous node in tree which is initialized. + +begin + Result := Node; + repeat + Result := GetPreviousNoInit(Result); + until (Result = nil) or (vsInitialized in Result^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPreviousNoInit(Node: PVirtualNode): PVirtualNode; + +// Returns the previous node in the tree with regard to Node. No initialization in done, hence this +// method might be faster than GetPrevious. Not yet initialized nodes are ignored during search. + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // Is there a previous sibling? + if Assigned(Node^.PrevSibling) then + begin + // Go down and find the last child node. + Result := GetLastNoInit(Node^.PrevSibling); + if Result = nil then + Result := Node^.PrevSibling; + end + else + // No previous sibling so the parent of the node is the previous node. + if Node^.Parent <> FRoot then + Result := Node^.Parent + else + Result := nil + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPreviousSibling(Node: PVirtualNode): PVirtualNode; + +// Get next sibling of Node, initialize it if necessary. + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + Result := Result^.PrevSibling; + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPreviousVisible(Node: PVirtualNode): PVirtualNode; + +// Returns the previous node in tree, with regard to Node, which is visible. +// Nodes which need an initialization (including the result) are initialized. + +var + Marker: PVirtualNode; + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(vsInitialized in Result^.States, 'Node must already be initialized.'); + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // If the given node is not visible then look for a parent node which is visible and use its last visible + // child or the parent node (if there is no visible child) as result. + if not FullyVisible[Result] then + begin + Result := GetVisibleParent(Result); + if Result = FRoot then + Result := nil; + Marker := GetLastVisible(Result); + if Assigned(Marker) then + Result := Marker; + end + else + begin + repeat + // Is there a previous sibling node? + if Assigned(Result^.PrevSibling) then + begin + Result := Result^.PrevSibling; + // Initialize the new node and check its visibility. + if not (vsInitialized in Result^.States) then + InitNode(Result); + if vsVisible in Result^.States then + begin + // If there are visible child nodes then use the last one. + Marker := GetLastVisible(Result); + if Assigned(Marker) then + Result := Marker; + Break; + end; + end + else + begin + // No previous sibling there so the parent node is the nearest previous node. + Result := Result^.Parent; + if Result = FRoot then + Result := nil; + Break; + end; + until False; + + if Assigned(Result) and not (vsInitialized in Result^.States) then + InitNode(Result); + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPreviousVisibleNoInit(Node: PVirtualNode): PVirtualNode; + +// Returns the previous node in tree, with regard to Node, which is visible. + +var + Marker: PVirtualNode; + +begin + Result := Node; + if Assigned(Result) then + begin + Assert(Result <> FRoot, 'Node must not be the hidden root node.'); + + // If the given node is not visible then look for a parent node which is visible and use its last visible + // child or the parent node (if there is no visible child) as result. + if not FullyVisible[Result] then + begin + Result := GetVisibleParent(Result); + if Result = FRoot then + Result := nil; + Marker := GetLastVisibleNoInit(Result); + if Assigned(Marker) then + Result := Marker; + end + else + begin + repeat + // Is there a previous sibling node? + if Assigned(Result^.PrevSibling) then + begin + Result := Result^.PrevSibling; + if vsVisible in Result^.States then + begin + // If there are visible child nodes then use the last one. + Marker := GetLastVisibleNoInit(Result); + if Assigned(Marker) then + Result := Marker; + Break; + end; + end + else + begin + // No previous sibling there so the parent node is the nearest previous node. + Result := Result^.Parent; + if Result = FRoot then + Result := nil; + Break; + end; + until False; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPreviousVisibleSibling(Node: PVirtualNode): PVirtualNode; + +// Returns the previous visible sibling before Node. Initialization is done implicitly. + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameter.'); + + Result := Node; + repeat + Result := GetPreviousSibling(Result); + until (Result = nil) or (vsVisible in Result^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetPreviousVisibleSiblingNoInit(Node: PVirtualNode): PVirtualNode; + +// Returns the previous visible sibling before Node. + +begin + Assert(Assigned(Node) and (Node <> FRoot), 'Invalid parameter.'); + + Result := Node; + repeat + Result := Result^.PrevSibling; + until (Result = nil) or (vsVisible in Result^.States); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetSortedCutCopySet(Resolve: Boolean): TNodeArray; + +// Same as GetSortedSelection but with nodes marked as being part in the current cut/copy set (e.g. for clipboard). + +var + Run: PVirtualNode; + Counter: Cardinal; + + //--------------- local function -------------------------------------------- + + procedure IncludeThisNode(Node: PVirtualNode); + + // adds the given node to the result + + var + Len: Cardinal; + + begin + Len := Length(Result); + if Counter = Len then + begin + if Len < 100 then + Len := 100 + else + Len := Len + Len div 10; + SetLength(Result, Len); + end; + Result[Counter] := Node; + Inc(Counter); + end; + + //--------------- end local function ---------------------------------------- + +begin + Run := FRoot^.FirstChild; + Counter := 0; + if Resolve then + begin + // Resolving is actually easy: just find the first cutted node in logical order + // and then never go deeper in level than this node as long as there's a sibling node. + // Restart the search for a cutted node (at any level) if there are no further siblings. + while Assigned(Run) do + begin + if vsCutOrCopy in Run^.States then + begin + IncludeThisNode(Run); + if Assigned(Run^.NextSibling) then + Run := Run^.NextSibling + else + begin + // If there are no further siblings then go up one or more levels until a node is + // found or all nodes have been processed. Although we consider here only initialized + // nodes we don't need to make any special checks as only initialized nodes can also be selected. + repeat + Run := Run^.Parent; + until (Run = FRoot) or Assigned(Run^.NextSibling); + if Run = FRoot then + Break + else + Run := Run^.NextSibling; + end; + end + else + Run := GetNextNoInit(Run); + end; + end + else + while Assigned(Run) do + begin + if vsCutOrCopy in Run^.States then + IncludeThisNode(Run); + Run := GetNextNoInit(Run); + end; + + // set the resulting array to its real length + SetLength(Result, Counter); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetSortedSelection(Resolve: Boolean): TNodeArray; + +// Returns a list of selected nodes sorted in logical order, that is, as they appear in the tree. +// If Resolve is True then nodes which are children of other selected nodes are not put into the new array. +// This feature is in particuar important when doing drag'n drop as in this case all selected node plus their children +// need to be considered. A selected node which is child (grand child etc.) of another selected node is then +// automatically included and doesn't need to be explicitely mentioned in the returned selection array. +// +// Note: The caller is responsible for freeing the array. Allocation is done here. Usually, though, freeing the array +// doesn't need additional attention as it is automatically freed by Delphi when it gets out of scope. + +var + Run: PVirtualNode; + Counter: Cardinal; + +begin + SetLength(Result, FSelectionCount); + if FSelectionCount > 0 then + begin + Run := FRoot^.FirstChild; + Counter := 0; + if Resolve then + begin + // Resolving is actually easy: just find the first selected node in logical order + // and then never go deeper in level than this node as long as there's a sibling node. + // Restart the search for a selected node (at any level) if there are no further siblings. + while Assigned(Run) do + begin + if vsSelected in Run^.States then + begin + Result[Counter] := Run; + Inc(Counter); + if Assigned(Run^.NextSibling) then + Run := Run^.NextSibling + else + begin + // If there are no further siblings then go up one or more levels until a node is + // found or all nodes have been processed. Although we consider here only initialized + // nodes we don't need to make any special checks as only initialized nodes can also be selected. + repeat + Run := Run^.Parent; + until (Run = FRoot) or Assigned(Run^.NextSibling); + if Run = FRoot then + Break + else + Run := Run^.NextSibling; + end; + end + else + Run := GetNextNoInit(Run); + end; + end + else + while Assigned(Run) do + begin + if vsSelected in Run^.States then + begin + Result[Counter] := Run; + Inc(Counter); + end; + Run := GetNextNoInit(Run); + end; + + // Since we may have skipped some nodes the result array is likely to be smaller than the + // selection array, hence shorten the result to true length. + if Integer(Counter) < Length(Result) then + SetLength(Result, Counter); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetTreeRect: TRect; + +// Returns the true size of the tree in pixels. This size is at least ClientHeight x ClientWidth and depends on +// the expand state, header size etc. +// Note: if no columns are used then the width of the tree is determined by the largest node which is currently in the +// client area. This might however not be the largest node in the entire tree. + +begin + Result := Rect(0, 0, Max(FRangeX, ClientWidth), Max(FRangeY, ClientHeight)); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.GetVisibleParent(Node: PVirtualNode): PVirtualNode; + +// Returns the first (nearest) parent node of Node which is visible. +// This method is one of the seldom cases where the hidden root node could be returned. + +begin + Assert(Assigned(Node), 'Node must not be nil.'); + + Result := Node; + while Result <> FRoot do + begin + // FRoot is always expanded hence the loop will safely stop there if no other node is expanded + repeat + Result := Result^.Parent; + until vsExpanded in Result^.States; + + if (Result = FRoot) or FullyVisible[Result] then + Break; + + // if there is still a collapsed parent node then advance to it and repeat the entire loop + while (Result <> FRoot) and (vsExpanded in Result^.Parent^.States) do + Result := Result^.Parent; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.HasAsParent(Node, PotentialParent: PVirtualNode): Boolean; + +// Determines whether Node has got PotentialParent as one of its parents. + +var + Run: PVirtualNode; + +begin + Result := Assigned(Node) and Assigned(PotentialParent) and (Node <> PotentialParent); + if Result then + begin + Run := Node; + while (Run <> FRoot) and (Run <> PotentialParent) do + Run := Run^.Parent; + Result := Run = PotentialParent; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.InsertNode(Node: PVirtualNode; Mode: TVTNodeAttachMode; UserData: Pointer = nil): PVirtualNode; + +// Adds a new node relative to Node. The final position is determined by Mode. +// UserData can be used to set the first 4 bytes of the user data area to an initial value which can be used +// in OnInitNode and will also cause to trigger the OnFreeNode event (if <> nil) even if the node is not yet +// "officially" initialized. +// InsertNode is a compatibility method and will implicitly validate the given node if the new node +// is to be added as child node. This is however against the virtual paradigm and hence I dissuade from its usage. + +var + NodeData: ^Pointer; + +begin + if Mode <> amNoWhere then + begin + CancelEditNode; + + if Node = nil then + Node := FRoot; + // we need a new node... + Result := MakeNewNode; + // avoid erronous attach modes + if Node = FRoot then + begin + case Mode of + amInsertBefore: + Mode := amAddChildFirst; + amInsertAfter: + Mode := amAddChildLast; + end; + end; + + // Validate given node in case the new node becomes its child. + if (Mode in [amAddChildFirst, amAddChildLast]) and not (vsInitialized in Node^.States) then + InitNode(Node); + InternalConnectNode(Result, Node, Self, Mode); + + // Check if there is initial user data and there is also enough user data space allocated. + if Assigned(UserData) then + if FNodeDataSize >= 4 then + begin + NodeData := Pointer(PChar(@Result^.Data) + FTotalInternalDataSize); + NodeData^ := UserData; + Include(Result^.States, vsInitialUserData); + end + else + ShowError(SCannotSetUserData, hcTFCannotSetUserData); + + if FUpdateCount = 0 then + begin + // If auto sort is enabled then sort the node or its parent (depending on the insert mode). + if (toAutoSort in FOptions.FAutoOptions) and (FHeader.FSortColumn > InvalidColumn) then + case Mode of + amInsertBefore, + amInsertAfter: + // Here no initialization is necessary because *if* a node has already got children then it + // must also be initialized. + // Note: Node can never be FRoot at this point. + Sort(Node^.Parent, FHeader.FSortColumn, FHeader.FSortDirection, True); + amAddChildFirst, + amAddChildLast: + Sort(Node, FHeader.FSortColumn, FHeader.FSortDirection, True); + end; + + UpdateScrollbars(True); + if Mode = amInsertBefore then + InvalidateToBottom(Result) + else + InvalidateToBottom(Node); + end; + StructureChange(Result, crNodeAdded); + end + else + Result := nil; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InvalidateChildren(Node: PVirtualNode; Recursive: Boolean); + +// Invalidates Node and its immediate children. +// If Recursive is True then all grandchildren are invalidated as well. +// The node itself is initialized if necessary and its child nodes are created (and initialized too if +// Recursive is True). + +var + Run: PVirtualNode; + +begin + if Assigned(Node) then + begin + if not (vsInitialized in Node^.States) then + InitNode(Node); + InvalidateNode(Node); + if (vsHasChildren in Node^.States) and (Node^.ChildCount = 0) then + InitChildren(Node); + Run := Node^.FirstChild; + end + else + Run := FRoot^.FirstChild; + + while Assigned(Run) do + begin + InvalidateNode(Run); + if Recursive then + InvalidateChildren(Run, True); + Run := Run^.NextSibling; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InvalidateColumn(Column: TColumnIndex); + +// Invalidates the client area part of a column. + +var + R: TRect; + +begin + if (FUpdateCount = 0) and FHeader.Columns.IsValidColumn(Column) then + begin + R := ClientRect; + FHeader.Columns.GetColumnBounds(Column, R.Left, R.Right); + InvalidateRect(Handle, @R, False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.InvalidateNode(Node: PVirtualNode): TRect; + +// Initiates repaint of the given node and returns the just invalidated rectangle. + +begin + if (FUpdateCount = 0) and HandleAllocated then + begin + Result := GetDisplayRect(Node, NoColumn, False); + InvalidateRect(Handle, @Result, False); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InvalidateToBottom(Node: PVirtualNode); + +// Initiates repaint of client area starting at given node. If this node is not visible or not yet initialized +// then nothing happens. + +var + R: TRect; + +begin + if FUpdateCount = 0 then + begin + if (Node = nil) or (Node = FRoot) then + Invalidate + else + if [vsInitialized, vsVisible] * Node^.States = [vsInitialized, vsVisible] then + begin + R := GetDisplayRect(Node, -1, False); + if R.Top < ClientHeight then + begin + R.Bottom := ClientHeight; + InvalidateRect(Handle, @R, False); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InvertSelection(VisibleOnly: Boolean); + +// Inverts the current selection (so nodes which are selected become unselected and vice versa). +// If VisibleOnly is True then only visible nodes are considered. + +var + Run: PVirtualNode; + NewSize: Integer; + NextFunction: function(Node: PVirtualNode): PVirtualNode of object; + TriggerChange: Boolean; + +begin + if toMultiSelect in FOptions.FSelectionOptions then + begin + Run := FRoot^.FirstChild; + ClearTempCache; + if VisibleOnly then + NextFunction := @GetNextVisibleNoInit + else + NextFunction := @GetNextNoInit; + while Assigned(Run) do + begin + if vsSelected in Run^.States then + InternalRemoveFromSelection(Run) + else + InternalCacheNode(Run); + Run := NextFunction(Run); + end; + + // do some housekeeping + // Need to trigger the OnChange event from here if nodes were only deleted but not added. + TriggerChange := False; + NewSize := PackArray(FSelection, FSelectionCount); + if NewSize > -1 then + begin + FSelectionCount := NewSize; + SetLength(FSelection, FSelectionCount); + TriggerChange := True; + end; + if FTempNodeCount > 0 then + begin + AddToSelection(FTempNodeCache, FTempNodeCount); + ClearTempCache; + TriggerChange := False; + end; + Invalidate; + if TriggerChange then + Change(nil); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.IsEditing: Boolean; + +begin + Result := tsEditing in FStates; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.IsMouseSelecting: Boolean; + +begin + Result := (tsDrawSelPending in FStates) or (tsDrawSelecting in FStates); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.IterateSubtree(Node: PVirtualNode; Callback: TVTGetNodeProc; Data: Pointer; + Filter: TVirtualNodeStates = []; DoInit: Boolean = False; ChildNodesOnly: Boolean = False): PVirtualNode; + +// Iterates through the all children and grandchildren etc. of Node (or the entire tree if Node = nil) +// and calls for each node the provided callback method (which must not be empty). +// Filter determines which nodes to consider (an empty set denotes all nodes). +// If DoInit is True then nodes which aren't initialized yet will be initialized. +// Note: During execution of the callback the application can set Abort to True. In this case the iteration is stopped +// and the last accessed node (the one on which the callback set Abort to True) is returned to the caller. +// Otherwise (no abort) nil is returned. + +var + Stop: PVirtualNode; + Abort: Boolean; + GetNextNode: TGetNextNodeProc; + WasIterating: Boolean; + +begin + Assert(Node <> FRoot, 'Node must not be the hidden root node.'); + + WasIterating := tsIterating in FStates; + DoStateChange([tsIterating]); + try + // prepare function to be used when advancing + if DoInit then + GetNextNode := @GetNext + else + GetNextNode := @GetNextNoInit; + + Abort := False; + if Node = nil then + Stop := nil + else + begin + if not (vsInitialized in Node^.States) and DoInit then + InitNode(Node); + + // The stopper does not need to be initialized since it is not taken into the enumeration. + Stop := Node^.NextSibling; + if Stop = nil then + begin + Stop := Node; + repeat + Stop := Stop^.Parent; + until (Stop = FRoot) or Assigned(Stop^.NextSibling); + if Stop = FRoot then + Stop := nil + else + Stop := Stop^.NextSibling; + end; + end; + + // Use first node if we start with the root. + if Node = nil then + Node := GetFirstNoInit; + + if Assigned(Node) then + begin + if not (vsInitialized in Node^.States) and DoInit then + InitNode(Node); + + // Skip given node if only the child nodes are requested. + if ChildNodesOnly then + begin + if Node^.ChildCount = 0 then + Node := nil + else + Node := GetNextNode(Node); + end; + + if Filter = [] then + begin + // unfiltered loop + while Assigned(Node) and (Node <> Stop) do + begin + Callback(Self, Node, Data, Abort); + if Abort then + Break; + Node := GetNextNode(Node); + end; + end + else + begin + // filtered loop + while Assigned(Node) and (Node <> Stop) do + begin + if Node^.States * Filter = Filter then + Callback(Self, Node, Data, Abort); + if Abort then + Break; + Node := GetNextNode(Node) + end; + end; + end; + + if Abort then + Result := Node + else + Result := nil; + finally + if not WasIterating then + DoStateChange([], [tsIterating]); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.LoadFromFile(const FileName: TFileName); + +var + FileStream: TFileStream; + +begin + FileStream := TFileStream.Create(FileName, fmOpenRead or fmShareDenyWrite); + try + LoadFromStream(FileStream); + finally + FileStream.Free; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.LoadFromStream(Stream: TStream); + +// Clears the current content of the tree and loads a new structure from the given stream. + +var + ThisID: TMagicID; + Version, + Count: Cardinal; + Node: PVirtualNode; + +begin + if not (toReadOnly in FOptions.FMiscOptions) then + begin + Clear; + // Check first whether this is a stream we can read. + if Stream.Read(ThisID, SizeOf(TMagicID)) < SizeOf(TMagicID) then + ShowError(SStreamTooSmall, hcTFStreamTooSmall); + + if (ThisID[0] = MagicID[0]) and (ThisID[1] = MagicID[1]) and (ThisID[2] = MagicID[2]) and + (ThisID[5] = MagicID[5]) then + begin + Version := Word(ThisID[3]); + if Version <= VTTreeStreamVersion then + begin + BeginUpdate; + try + if Version < 2 then + Count := MaxInt + else + Stream.ReadBuffer(Count, SizeOf(Count)); + + while (Stream.Position < Stream.Size) and (Count > 0) do + begin + Dec(Count); + Node := MakeNewNode; + InternalConnectNode(Node, FRoot, Self, amAddChildLast); + InternalAddFromStream(Stream, Version, Node); + end; + DoNodeCopied(nil); + finally + EndUpdate; + end; + end + else + ShowError(SWrongStreamVersion, hcTFWrongStreamVersion); + end + else + ShowError(SWrongStreamFormat, hcTFWrongStreamFormat); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.MeasureItemHeight(const xCanvas: TCanvas; Node: PVirtualNode); + +// If the height of the given node has not yet been measured then do it now. + +var + NewNodeHeight: Integer; + +begin + if not (vsHeightMeasured in Node^.States) then + begin + Include(Node^.States, vsHeightMeasured); + NewNodeHeight := Node^.NodeHeight; + DoMeasureItem(xCanvas, Node, NewNodeHeight); + if NewNodeHeight <> Node^.NodeHeight then + SetNodeHeight(Node, NewNodeHeight); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.MoveTo(Node: PVirtualNode; Tree: TBaseVirtualTree; Mode: TVTNodeAttachMode; + ChildrenOnly: Boolean); + +// A simplified method to allow to move nodes to the root of another tree. + +begin + MoveTo(Node, Tree.FRoot, Mode, ChildrenOnly); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.MoveTo(Source, Target: PVirtualNode; Mode: TVTNodeAttachMode; ChildrenOnly: Boolean); + +// Moves the given node (and all its children) to Target. Source must belong to the tree instance which calls this +// MoveTo method. Mode determines how to connect Source to Target. +// This method might involve a change of the tree if Target belongs to a different tree than Source. + +var + TargetTree: TBaseVirtualTree; + Allowed: Boolean; + NewNode: PVirtualNode; + Stream: TMemoryStream; + +begin + Assert(TreeFromNode(Source) = Self, 'The source tree must contain the source node.'); + + // When moving nodes then source and target must not be the same node unless only the source's children are + // moved and they are inserted before or after the node itself. + Allowed := (Source <> Target) or ((Mode in [amInsertBefore, amInsertAfter]) and ChildrenOnly); + + if Allowed and (Mode <> amNoWhere) and Assigned(Source) and (Source <> FRoot) and + not (toReadOnly in FOptions.FMiscOptions) then + begin + // Assume that an empty destination means the root in this (the source) tree. + if Target = nil then + begin + TargetTree := Self; + Target := FRoot; + Mode := amAddChildFirst; + end + else + TargetTree := TreeFromNode(Target); + + if Target = TargetTree.FRoot then + begin + case Mode of + amInsertBefore: + Mode := amAddChildFirst; + amInsertAfter: + Mode := amAddChildLast; + end; + end; + + if TargetTree = Self then + begin + // Simple case: move node(s) within the same tree. + if Target = FRoot then + Allowed := DoNodeMoving(Source, nil) + else + Allowed := DoNodeMoving(Source, Target); + if Allowed then + begin + // Check first that Source is not added as new child to a target node which + // is already a child of Source. + // Consider the case Source and Target are the same node, but only child nodes are moved. + if (Source <> Target) and HasAsParent(Target, Source) then + ShowError(SWrongMoveError, hcTFWrongMoveError); + + if not ChildrenOnly then + begin + // Disconnect from old location. + InternalDisconnectNode(Source, True); + // Connect to new location. + InternalConnectNode(Source, Target, Self, Mode); + DoNodeMoved(Source); + end + else + begin + // Only child nodes should be moved. + Source := Source^.LastChild; + while Assigned(Source) do + begin + NewNode := Source^.PrevSibling; + // Disconnect from old location. + InternalDisconnectNode(Source, True, False); + // Connect to new location. + InternalConnectNode(Source, Target, Self, Mode); + DoNodeMoved(Source); + Source := NewNode; + end; + end; + end; + end + else + begin + // Difficult case: move node(s) to another tree. + // In opposition to node copying we ask only once if moving is allowed because + // we cannot take back a move once done. + if Target = TargetTree.FRoot then + Allowed := DoNodeMoving(Source, nil) + else + Allowed := DoNodeMoving(Source, Target); + + if Allowed then + begin + Stream := TMemoryStream.Create; + try + // Write all nodes into a temporary stream depending on the ChildrenOnly flag. + if not ChildrenOnly then + WriteNode(Stream, Source) + else + begin + Source := Source^.FirstChild; + while Assigned(Source) do + begin + WriteNode(Stream, Source); + Source := Source^.NextSibling; + end; + end; + // Now load the serialized nodes into the target node (tree). + TargetTree.BeginUpdate; + try + Stream.Position := 0; + while Stream.Position < Stream.Size do + begin + NewNode := TargetTree.MakeNewNode; + InternalConnectNode(NewNode, Target, TargetTree, Mode); + TargetTree.InternalAddFromStream(Stream, VTTreeStreamVersion, NewNode); + DoNodeMoved(NewNode); + end; + finally + TargetTree.EndUpdate; + end; + finally + Stream.Free; + end; + // finally delete original nodes + BeginUpdate; + try + if ChildrenOnly then + DeleteChildren(Source) + else + DeleteNode(Source); + finally + EndUpdate; + end; + end; + end; + + InvalidateCache; + if (FUpdateCount = 0) and Allowed then + begin + ValidateCache; + UpdateScrollBars(True); + Invalidate; + if TargetTree <> Self then + TargetTree.Invalidate; + end; + StructureChange(Source, crNodeMoved); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.PaintTree(TargetCanvas: TCanvas; Window: TRect; Target: TPoint; + PaintOptions: TVTInternalPaintOptions; PixelFormat: TPixelFormat); + +// This is the core paint routine of the tree. It is responsible for maintaining the paint cycles per node as well +// as coordinating drawing of the various parts of the tree image. +// TargetCanvas is the canvas to which to draw the tree image. This is usually the tree window itself but could well +// be a bitmap or printer canvas. +// Window determines which part of the entire tree image to draw. The full size of the virtual image is determined +// by GetTreeRect. +// Target is the position in TargetCanvas where to draw the tree part specified by Window. +// PaintOptions determines what of the tree to draw. For different tasks usually different parts need to be drawn, with +// a full image in the window, selected only nodes for a drag image etc. + +const + ImageKind: array[Boolean] of TVTImageKind = (ikNormal, ikSelected); + +var + DrawSelectionRect, + UseBackground, + ShowImages, + ShowStateImages, + ShowCheckImages, + UseColumns, + IsMainColumn: Boolean; + + VAlign, + IndentSize, + ButtonX, + ButtonY: Integer; + Temp: PVirtualNode; + LineImage: TLineImage; + PaintInfo: TVTPaintInfo; // all necessary information about a node to pass to the paint routines + + R, // the area of an entire node in its local coordinate + TargetRect, // the area of a node (part) in the target canvas + SelectionRect: TRect; // ordered rectangle used for drawing the selection focus rect + NextColumn: TColumnIndex; + BaseOffset: Integer; // top position of the top node to draw given in absolute tree coordinates + NodeBitmap: TBitmap; // small buffer to draw flicker free + MaximumRight, // maximum horizontal target position + MaximumBottom: Integer; // maximum vertical target position + SelectLevel: Integer; // > 0 if current node is selected or child/grandchild etc. of a selected node + FirstColumn: TColumnIndex; // index of first column which is at least partially visible in the given window + +begin + DoStateChange([tsPainting]); + + DoBeforePaint(TargetCanvas); + + // Create small bitmaps and initialize default values. + // The bitmaps are used to paint one node at a time and to draw the result to the target (e.g. screen) in one step, + // to prevent flickering. + NodeBitmap := TBitmap.Create; + // For alpha blending we need the 32 bit pixel format. For other targets there might be a need for a certain + // pixel format (e.g. printing). + if MMXAvailable and ((FDrawSelectionMode = smBlendedRectangle) or (tsUseThemes in FStates) or + (toUseBlendedSelection in FOptions.PaintOptions)) then + NodeBitmap.PixelFormat := pf32Bit + else + NodeBitmap.PixelFormat := PixelFormat; + + // Prepare paint info structure and lock the back bitmap canvas to avoid that it gets freed on the way. + FillChar(PaintInfo, SizeOf(PaintInfo), 0); + PaintInfo.Canvas := NodeBitmap.Canvas; + NodeBitmap.Canvas.Lock; + try + // Prepare the current selection rectangle once. The corner points are absolute tree coordinates. + SelectionRect := OrderRect(FNewSelRect); + DrawSelectionRect := IsMouseSelecting and not IsRectEmpty(SelectionRect); + + // R represents an entire node (all columns), but is a bit unprecise when it comes to + // trees without any column defined, because FRangeX only represents the maximum width of all + // nodes in the client area (not all defined nodes). There might be, however, wider nodes somewhere. Without full + // validation I cannot better determine the width, though. By using at least the control's width it is ensured + // that the tree is fully displayed on screen. + R := Rect(0, 0, Max(FRangeX, ClientWidth), 0); + NodeBitmap.Width := Window.Right - Window.Left; + + // For quick checks some intermediate variables are used. + UseBackground := (toShowBackground in FOptions.FPaintOptions) and (FBackground.Graphic is TBitmap) and + (poBackground in PaintOptions); + ShowImages := Assigned(FImages); + ShowStateImages := Assigned(FStateImages); + ShowCheckImages := Assigned(FCheckImages) and (toCheckSupport in FOptions.FMiscOptions); + UseColumns := FHeader.UseColumns; + + // Adjust paint options to tree settings. Hide selection if told so or the tree is unfocused. + if (toAlwaysHideSelection in FOptions.FPaintOptions) or + (not Focused and (toHideSelection in FOptions.FPaintOptions)) then + Exclude(PaintOptions, poDrawSelection); + if toHideFocusRect in FOptions.FPaintOptions then + Exclude(PaintOptions, poDrawFocusRect); + + // Determine node to start drawing with. +//TODO:whats this ???? Baseoffset cant be 0 or not ? + BaseOffset := 0; + + + PaintInfo.Node := GetNodeAt(0, Window.Top, False, BaseOffset); + + // Transform selection rectangle into node bitmap coordinates. + if DrawSelectionRect then + OffsetRect(SelectionRect, 0, -BaseOffset); + + // The target rectangle holds the coordinates of the exact area to blit in target canvas coordinates. + // It is usually smaller than an entire node and wanders while the paint loop advances. + MaximumRight := Target.X + (Window.Right - Window.Left); + MaximumBottom := Target.Y + (Window.Bottom - Window.Top); + + TargetRect := Rect(Target.X, Target.Y - (Window.Top - BaseOffset), MaximumRight, 0); + TargetRect.Bottom := TargetRect.Top; + + // This marker gets the index of the first column which is visible in the given window. + // This is needed for column based background colors. + FirstColumn := InvalidColumn; + PaintInfo.Canvas.Brush.Color := clCream; + if Assigned(PaintInfo.Node) then + begin + SelectLevel := InitializeLineImageAndSelectLevel(PaintInfo.Node, LineImage); + IndentSize := Length(LineImage); + + // Precalculate horizontal position of buttons relative to the column start. + ButtonX := (Length(LineImage) * Integer(FIndent)) + Round((Integer(FIndent) - FPlusBM.Width) / 2) - FIndent; + // ----- main node paint loop + while Assigned(PaintInfo.Node) do + begin + // Initialize node if not already done. + if not (vsInitialized in PaintInfo.Node^.States) then + InitNode(PaintInfo.Node); + if vsSelected in PaintInfo.Node^.States then + Inc(SelectLevel); + + // Ensure the node's height is determined. + MeasureItemHeight(PaintInfo.Canvas, PaintInfo.Node); + + // Adjust the brush origin for dotted lines depending on the current source position. + // It is applied some lines later, as the canvas might get reallocated, when changing the node bitmap. +// PaintInfo.BrushOrigin := Point(Window.Left and 1, BaseOffset and 1); + Inc(BaseOffset, PaintInfo.Node^.NodeHeight); + + TargetRect.Bottom := TargetRect.Top + PaintInfo.Node^.NodeHeight; + + // If poSelectedOnly is active then do the following stuff only for selected nodes or nodes + // which are children of selected nodes. + if (SelectLevel > 0) or not (poSelectedOnly in PaintOptions) then + begin + // Adjust height of temporary node bitmap. + with NodeBitmap do + begin + if Height <> PaintInfo.Node^.NodeHeight then + begin + // Avoid that the VCL copies the bitmap while changing its height. + Height := 0; + Height := PaintInfo.Node^.NodeHeight; + SetWindowOrgEx(Canvas.Handle, Window.Left, 0, nil); + R.Bottom := PaintInfo.Node^.NodeHeight; + end; + // Set the origin of the canvas' brush. This depends on the node heights. +//todo with PaintInfo do +//win SetBrushOrgEx(Canvas.Handle, BrushOrigin.X, BrushOrigin.Y, nil); + end; + CalculateVerticalAlignments(ShowImages, ShowStateImages, PaintInfo.Node, VAlign, ButtonY); + + // Let application decide whether the node should normally be drawn or by the application itself. + if not DoBeforeItemPaint(PaintInfo.Canvas, PaintInfo.Node, R) then + begin + // Init paint options for the background painting. + PaintInfo.PaintOptions := PaintOptions; + + // The node background can contain a single color, a bitmap or can be drawn by the application. +// LimitPaintingToArea(Canvas, Rect(Window.Left, TargetRect.Top, Window.Right, TargetRect.Bottom)); + ClearNodeBackground(PaintInfo, UseBackground, True, Rect(Window.Left, TargetRect.Top, Window.Right, + TargetRect.Bottom)); +// SelectClipRgn(PaintInfo.Canvas.Handle, 0); + + // Prepare column, position and node clipping rectangle. + PaintInfo.CellRect := R; + if UseColumns then + InitializeFirstColumnValues(PaintInfo); + + // Now go through all visible columns (there's still one run if columns aren't used). + with FHeader.FColumns do + begin + while ((PaintInfo.Column > InvalidColumn) or not UseColumns) + and (PaintInfo.CellRect.Left < Window.Right) do + begin + if UseColumns then + begin + PaintInfo.Column := FPositionToIndex[PaintInfo.Position]; + if FirstColumn = InvalidColumn then + FirstColumn := PaintInfo.Column; +//b PaintInfo.BidiMode := Items[PaintInfo.Column].FBiDiMode; + PaintInfo.Alignment := Items[PaintInfo.Column].FAlignment; + end + else + begin + PaintInfo.Column := NoColumn; +//b PaintInfo.BidiMode := BidiMode; + PaintInfo.Alignment := FAlignment; + end; + + PaintInfo.PaintOptions := PaintOptions; + with PaintInfo do + begin + if (tsEditing in FStates) and (Node = FFocusedNode) and + ((Column = FEditColumn) or not UseColumns) then + Exclude(PaintOptions, poDrawSelection); + if not UseColumns or + ((vsSelected in Node^.States) and (toFullRowSelect in FOptions.FSelectionOptions) and + (poDrawSelection in PaintOptions)) or + (coParentColor in Items[PaintInfo.Column].Options) then + Exclude(PaintOptions, poColumnColor); + end; + IsMainColumn := PaintInfo.Column = FHeader.MainColumn; + + // Consider bidi mode here. In RTL context means left alignment actually right alignment and vice versa. +//b if PaintInfo.BidiMode <> bdLeftToRight then +//b ChangeBiDiModeAlignment(PaintInfo.Alignment); + + // Paint the current cell if it is marked as being visible or columns aren't used and + // if this cell belongs to the main column if only the main column should be drawn. + if (not UseColumns or (coVisible in Items[PaintInfo.Column].FOptions)) and + (not (poMainOnly in PaintOptions) or IsMainColumn) then + begin + AdjustPaintCellRect(PaintInfo, NextColumn); + + // Paint the cell only if it is in the current window. + if PaintInfo.CellRect.Right > Window.Left then + begin + with PaintInfo do + begin + // Fill in remaining values in the paint info structure. + NodeWidth := DoGetNodeWidth(Node, Column, Canvas); + // Not the entire cell is covered by text. Hence we need a running rectangle to follow up. + ContentRect := CellRect; + // Set up the distance from column border (margin). +//b if BidiMode <> bdLeftToRight then +//b Dec(ContentRect.Right, FMargin) +//b else + Inc(ContentRect.Left, FMargin); + + if ShowCheckImages and IsMainColumn then + begin + ImageInfo[iiCheck].Index := GetCheckImage(Node); + if ImageInfo[iiCheck].Index > -1 then + begin + AdjustImageBorder(FCheckImages, 0, VAlign, ContentRect, ImageInfo[iiCheck]); + ImageInfo[iiCheck].Ghosted := False; + end; + end + else + ImageInfo[iiCheck].Index := -1; + if ShowStateImages then + begin + ImageInfo[iiState].Index := GetImageIndex(Node, ikState, Column, ImageInfo[iiState].Ghosted); + if ImageInfo[iiState].Index > -1 then + AdjustImageBorder(FStateImages, 0, VAlign, ContentRect, ImageInfo[iiState]); + end + else + ImageInfo[iiState].Index := -1; + if ShowImages then + begin + ImageInfo[iiNormal].Index := GetImageIndex(Node, ImageKind[vsSelected in Node^.States], Column, + ImageInfo[iiNormal].Ghosted); + if ImageInfo[iiNormal].Index > -1 then + AdjustImageBorder(FImages, 0, VAlign, ContentRect, ImageInfo[iiNormal]); + end + else + ImageInfo[iiNormal].Index := -1; + + // Take the space for the tree lines into account. + if IsMainColumn then + AdjustCoordinatesByIndent(PaintInfo, IndentSize); + + if UseColumns then + LimitPaintingToArea(Canvas, CellRect); + + // Paint the horizontal grid line. + if (poGridLines in PaintOptions) and (toShowHorzGridLines in FOptions.FPaintOptions) then + begin + Canvas.Font.Color := FColors.GridLineColor; + if IsMainColumn and (FLineMode = lmBands) then + begin +//b if BidiMode = bdLeftToRight then +//b begin + DrawDottedHLine(PaintInfo, CellRect.Left + IndentSize * Integer(FIndent), CellRect.Right - 1, + CellRect.Bottom - 1); +//b end +//b else +//b begin +//b DrawDottedHLine(PaintInfo, CellRect.Left, CellRect.Right - IndentSize * Integer(FIndent) - 1, +//b CellRect.Bottom - 1); +//b end; + end + else + DrawDottedHLine(PaintInfo, CellRect.Left, CellRect.Right, CellRect.Bottom - 1); + Dec(CellRect.Bottom); + Dec(ContentRect.Bottom); + end; + + if UseColumns then + begin + // Paint vertical grid line. + // Don't draw if this is the last column and the header is in autosize mode. + if (poGridLines in PaintOptions) and (toShowVertGridLines in FOptions.FPaintOptions) and + (not (hoAutoResize in FHeader.FOptions) or (Position < TColumnPosition(Count - 1))) then + begin + if True or not ColumnIsEmpty(Node, Column) then + begin + Canvas.Font.Color := FColors.GridLineColor; + DrawDottedVLine(PaintInfo, CellRect.Top, CellRect.Bottom, CellRect.Right - 1); + end; + Dec(CellRect.Right); + Dec(ContentRect.Right); + end; + end; + + // Prepare background and focus rect for the current cell. + PrepareCell(PaintInfo, Window.Left, NodeBitmap.Width); + + // Some parts are only drawn for the main column. + if IsMainColumn then + begin + if toShowTreeLines in FOptions.FPaintOptions then + PaintTreeLines(PaintInfo, VAlign, IndentSize, LineImage); + // Show node button if allowed, if there child nodes and at least one of the child + // nodes is visible or auto button hiding is disabled. + if (toShowButtons in FOptions.FPaintOptions) and (vsHasChildren in Node^.States) and + not ((vsAllChildrenHidden in Node^.States) and + (toAutoHideButtons in TreeOptions.FAutoOptions)) then + PaintNodeButton(Canvas, Node, CellRect, ButtonX, ButtonY, 0); + + if ImageInfo[iiCheck].Index > -1 then + PaintCheckImage(PaintInfo); + end; + + if ImageInfo[iiState].Index > -1 then + PaintImage(PaintInfo, iiState, FStateImages, False); + if ImageInfo[iiNormal].Index > -1 then + PaintImage(PaintInfo, iiNormal, FImages, True); + + // Now let descendants or applications draw whatever they want, + // but don't draw the node if it is currently being edited. + if not ((tsEditing in FStates) and (Node = FFocusedNode) and + ((Column = FEditColumn) or not UseColumns)) then + DoPaintNode(PaintInfo); + + DoAfterCellPaint(Canvas, Node, Column, CellRect); + end; + end; + + // leave after first run if columns aren't used + if not UseColumns then + Break; + end + else + NextColumn := GetNextVisibleColumn(PaintInfo.Column); + + SelectClipRgn(PaintInfo.Canvas.Handle, 0); + // Stop column loop if there are no further columns in the given window. + if (PaintInfo.CellRect.Left >= Window.Right) or (NextColumn = InvalidColumn) then + Break; + + // Move on to next column which might not be the one immediately following the current one + // because of auto span feature. + PaintInfo.Position := Items[NextColumn].Position; + + // Move clip rectangle and continue. + if coVisible in Items[NextColumn].FOptions then + with PaintInfo do + begin + Items[NextColumn].GetAbsoluteBounds(CellRect.Left, CellRect.Right); + + CellRect.Bottom := Node^.NodeHeight; + ContentRect.Bottom := Node^.NodeHeight; + end; + end; + end; + + // This node is finished, notify descentants/application. + with PaintInfo do + begin + DoAfterItemPaint(Canvas, Node, R); + end; + end; + + with PaintInfo.Canvas do + begin + if DrawSelectionRect then + begin + PaintSelectionRectangle(PaintInfo.Canvas, Window.Left, SelectionRect, Rect(0, 0, NodeBitmap.Width, + NodeBitmap.Height)); + end; + + // Put the constructed node image onto the target canvas. + with TargetRect, NodeBitmap do + TargetCanvas.Draw(Left,Top,NodeBitmap); +// BitBlt(TargetCanvas.Handle, Left, Top, Width, Height, Canvas.Handle, Window.Left, 0, SRCCOPY); + end; + end; + + Inc(TargetRect.Top, PaintInfo.Node^.NodeHeight); + if TargetRect.Top >= MaximumBottom then + Break; + + // Keep selection rectangle coordinates in sync. + if DrawSelectionRect then + OffsetRect(SelectionRect, 0, -PaintInfo.Node^.NodeHeight); + + // Advance to next visible node. + Temp := GetNextVisible(PaintInfo.Node); + if Assigned(Temp) then + begin + // Adjust line bitmap (and so also indentation level). + if Temp^.Parent = PaintInfo.Node then + begin + // New node is a child node. Need to adjust previous bitmap level. + if IndentSize > 0 then + if HasVisibleNextSibling(PaintInfo.Node) then + LineImage[IndentSize - 1] := ltTopDown + else + LineImage[IndentSize - 1] := ltNone; + // Enhance line type array if necessary. + Inc(IndentSize); + if Length(LineImage) <= IndentSize then + SetLength(LineImage, IndentSize + 8); + Inc(ButtonX, FIndent); + end + else + begin + // New node is at the same or higher tree level. + // Take back select level increase if the node was selected + if vsSelected in PaintInfo.Node^.States then + Dec(SelectLevel); + if PaintInfo.Node^.Parent <> Temp^.Parent then + begin + // We went up one or more levels. Determine how many levels it was actually. + while PaintInfo.Node^.Parent <> Temp^.Parent do + begin + Dec(IndentSize); + Dec(ButtonX, FIndent); + PaintInfo.Node := PaintInfo.Node^.Parent; + // Take back one selection level increase for every step up. + if vsSelected in PaintInfo.Node^.States then + Dec(SelectLevel); + end; + end; + end; + + // Set new image in front of the new node. + if IndentSize > 0 then + if HasVisibleNextSibling(Temp) then + LineImage[IndentSize - 1] := ltTopDownRight + else + LineImage[IndentSize - 1] := ltTopRight; + end; + + PaintInfo.Node := Temp; + end; + end; + + + + // Erase rest of window not covered by a node. + if TargetRect.Top < MaximumBottom then + begin + // Keep the horizontal target position to determine the selection rectangle offset later (if necessary). + BaseOffset := Target.X; + Target := TargetRect.TopLeft; + R := Rect(TargetRect.Left, 0, TargetRect.Left, MaximumBottom - Target.Y); + TargetRect := Rect(0, 0, MaximumRight - Target.X, MaximumBottom - Target.Y); + OffsetRect(TargetRect,-OffsetX,0); //theo 24.2.2007 + // Avoid unnecessary copying of bitmap content. This will destroy the DC handle too. + NodeBitmap.Height := 0; +// NodeBitmap.PixelFormat := pf32Bit; + NodeBitmap.Width := TargetRect.Right - TargetRect.Left + 1; + NodeBitmap.Height := TargetRect.Bottom - TargetRect.Top + 1; + + // Call back application/descentants whether they want to erase this area. + SetWindowOrgEx(NodeBitmap.Canvas.Handle, Target.X, 0, nil); + if not DoPaintBackground(NodeBitmap.Canvas, TargetRect) then + begin + if UseBackground then + begin + SetWindowOrgEx(NodeBitmap.Canvas.Handle, 0, 0, nil); + TileBackground(FBackground.Bitmap, NodeBitmap.Canvas, Target, TargetRect); + end + else + begin + // Consider here also colors of the columns. + if UseColumns then + begin + with FHeader.FColumns do + begin + // If there is no content in the tree then the first column has not yet been determined. + if FirstColumn = InvalidColumn then + begin + FirstColumn := GetFirstVisibleColumn; + repeat + if FirstColumn <> InvalidColumn then + begin + R.Left := Items[FirstColumn].Left; + R.Right := R.Left + Items[FirstColumn].FWidth; + if R.Right > TargetRect.Left then + Break; + FirstColumn := GetNextVisibleColumn(FirstColumn); + end; + until FirstColumn = InvalidColumn; + end + else + begin + R.Left := Items[FirstColumn].Left; + R.Right := R.Left + Items[FirstColumn].FWidth; + end; + + NodeBitmap.Canvas.Font.Color := FColors.GridLineColor; + while (FirstColumn <> InvalidColumn) and (R.Left < TargetRect.Right + Target.X) do + begin + if (poGridLines in PaintOptions) and + (toFullVertGridLines in FOptions.FPaintOptions) and + (toShowVertGridLines in FOptions.FPaintOptions) and + (not (hoAutoResize in FHeader.FOptions) or (Cardinal(FirstColumn) < TColumnPosition(Count - 1))) then + begin + DrawDottedVLine(PaintInfo, R.Top, R.Bottom, R.Right - 1); + Dec(R.Right); + end; + + if not (coParentColor in Items[FirstColumn].FOptions) then + NodeBitmap.Canvas.Brush.Color := Items[FirstColumn].FColor + else + NodeBitmap.Canvas.Brush.Color := Color; + + NodeBitmap.Canvas.FillRect(R); + FirstColumn := GetNextVisibleColumn(FirstColumn); + if FirstColumn <> InvalidColumn then + begin + R.Left := Items[FirstColumn].Left; + R.Right := R.Left + Items[FirstColumn].FWidth; + end; + end; + + // Erase also the part of the tree not covert by a column. + if R.Right < TargetRect.Right + Target.X then + begin + R.Left := R.Right; + R.Right := TargetRect.Right + Target.X; + // Prevent erasing the last vertical grid line. + if (poGridLines in PaintOptions) and + (toFullVertGridLines in FOptions.FPaintOptions) and (toShowVertGridLines in FOptions.FPaintOptions) and + (not (hoAutoResize in FHeader.FOptions)) then + Inc(R.Left); + NodeBitmap.Canvas.Brush.Color := Color; + NodeBitmap.Canvas.FillRect(R); + end; + end; + SetWindowOrgEx(NodeBitmap.Canvas.Handle, 0, 0, nil); + end + else + begin + // No columns nor bitmap background. Simply erase it with the tree color. + SetWindowOrgEx(NodeBitmap.Canvas.Handle, 0, 0, nil); + NodeBitmap.Canvas.Brush.Color := Color; + NodeBitmap.Canvas.FillRect(TargetRect); + end; + end; + end; + SetWindowOrgEx(NodeBitmap.Canvas.Handle, 0, 0, nil); + + if DrawSelectionRect then + begin + R := OrderRect(FNewSelRect); + // Remap the selection rectangle to the current window of the tree. + // Since Target has been used for other tasks BaseOffset got the left extent of the target position here. + OffsetRect(R, -Target.X + BaseOffset - Window.Left, -Target.Y); +//todowin SetBrushOrgEx(NodeBitmap.Canvas.Handle, 0, Target.X and 1, nil); + PaintSelectionRectangle(NodeBitmap.Canvas, 0, R, TargetRect); + end; + with Target, NodeBitmap do + BitBlt(TargetCanvas.Handle, X, Y, Width, Height, Canvas.Handle, 0, 0, SRCCOPY); + end; + finally + NodeBitmap.Canvas.Unlock; + NodeBitmap.Free; + end; + DoAfterPaint(TargetCanvas); + DoStateChange([], [tsPainting]); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.PasteFromClipboard: Boolean; + +// Reads what is currently on the clipboard into the tree (if the format is supported). +// Note: If the application wants to have text or special formats to be inserted then it must implement +// its own code (OLE). Here only the native tree format is accepted. + +{xvar + Data: IDataObject; + Source: TBaseVirtualTree;} + +begin + Result := False; +{x if not (toReadOnly in FOptions.FMiscOptions) then + begin + if OleGetClipboard(Data) <> S_OK then + ShowError(SClipboardFailed, hcTFClipboardFailed) + else + try + // Try to get the source tree of the operation to optimize the operation. + Source := GetTreeFromDataObject(Data); + Result := ProcessOLEData(Source, Data, FFocusedNode, FDefaultPasteMode, Assigned(Source) and + (tsCutPending in Source.FStates)); + if Assigned(Source) then + if Source <> Self then + Source.FinishCutOrCopy + else + DoStateChange([], [tsCutPending]); + finally + Data := nil; + end; + end;} +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{procedure TBaseVirtualTree.PrepareDragImage(Hotspot: TPoint; const DataObject: IDataObject); + +// Initiates an image drag operation. Hotspot is the position of the mouse in client coordinates. + +var + PaintOptions: TVTInternalPaintOptions; + TreeRect, + PaintRect: TRect; + LocalSpot, + ImagePos, + PaintTarget: TPoint; + Image: TBitmap; + +begin + if CanShowDragImage then + begin + // Determine the drag rectangle which is a square around the hot spot. Operate in virtual tree space. + LocalSpot := HotSpot; + Dec(LocalSpot.X, FOffsetX); + Dec(LocalSpot.Y, FOffsetY); + TreeRect := Rect(LocalSpot.X - FDragWidth div 2, LocalSpot.Y - FDragHeight div 2, LocalSpot.X + FDragWidth div 2, + LocalSpot.Y + FDragHeight div 2); + + // Check that we have a valid rectangle. + with TreeRect do + begin + PaintRect := TreeRect; + if Left < 0 then + begin + PaintTarget.X := -Left; + PaintRect.Left := 0; + end + else + PaintTarget.X := 0; + if Top < 0 then + begin + PaintTarget.Y := -Top; + PaintRect.Top := 0; + end + else + PaintTarget.Y := 0; + end; + + Image := TBitmap.Create; + with Image do + try + PixelFormat := pf32Bit; + Width := TreeRect.Right - TreeRect.Left; + Height := TreeRect.Bottom - TreeRect.Top; + // Erase the entire image with the color key value, for the case not everything + // in the image is covered by the tree image. + Canvas.Brush.Color := Color; //todo: color points to tcontrol.color + Canvas.FillRect(Rect(0, 0, Width, Height)); + + PaintOptions := [poDrawSelection, poSelectedOnly]; + if FDragImageKind = diMainColumnOnly then + Include(PaintOptions, poMainOnly); + PaintTree(Image.Canvas, PaintRect, PaintTarget, PaintOptions); + + // Once we have got the drag image we can convert all necessary coordinates into screen space. + OffsetRect(TreeRect, FOffsetX, FOffsetY); + ImagePos := ClientToScreen(TreeRect.TopLeft); + HotSpot := ClientToScreen(HotSpot); + + FDragImage.ColorKey := Color; //todo: see above + FDragImage.PrepareDrag(Image, ImagePos, HotSpot, DataObject); + finally + Image.Free; + end; + end; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Print(Printer: TPrinter; PrintHeader: Boolean); + +var + SaveTreeFont: TFont; // Remembers the tree's current font. + SaveHeaderFont: TFont; // Remembers the header's current font. + ImgRect, // Describes the dimensions of Image. + TreeRect, // The total VTree dimensions. + DestRect, // Dimensions of PrinterImage. + SrcRect: TRect; // Clip dimensions from Image -> PrinterImage + P: TPoint; // Used by PaintTree. + Options: TVTInternalPaintOptions; // Used by PaintTree. + Image, // Complete Tree is drawn to this image. + PrinterImage: TBitmap; // This is the image that gets printed. + SaveColor: TColor; // Remembers the VTree Color. + pTxtHeight, // Height of font in the TPrinter.Canvas + vTxtHeight, // Height of font in the VTree Canvas + vPageWidth, + vPageHeight, // Printer height in VTree resolution + xPageNum, yPageNum, // # of pages (except the occasional last one) + xPage, yPage: Integer; // Loop counter + Scale: Extended; // Scale factor between Printer Canvas and VTree Canvas + LogFont: TLogFont; + +begin + if Assigned(Printer) then + begin + BeginUpdate; + + // Grid lines are the only parts which are desirable when printing. + Options := [poGridLines]; + + // Remember the tree font. + SaveTreeFont := TFont.Create; + SaveTreeFont.Assign(Font); + // Create a new font for printing which does not use clear type output (but is antialiased, if possible) + // and which has the highest possible quality. + GetObject(Font.Handle, SizeOf(TLogFont), @LogFont); + LogFont.lfQuality := ANTIALIASED_QUALITY; + Font.Handle := CreateFontIndirect(LogFont); + + // Create an image that will hold the complete VTree + Image := TBitmap.Create; +// Image.PixelFormat := pf32Bit; + PrinterImage := nil; + try + TreeRect := GetTreeRect; + + Image.Width := TreeRect.Right - TreeRect.Left; + P := Point(0, 0); + if (hoVisible in FHeader.Options) and PrintHeader then + begin + Inc(TreeRect.Bottom, FHeader.Height); + Inc(P.Y, FHeader.Height); + end; + Image.Height := TreeRect.Bottom - TreeRect.Top; + + ImgRect.Left := 0; + ImgRect.Top := 0; + ImgRect.Right := Image.Width; + + // Force the background to white color during the rendering. + SaveColor := Color; + Color := clWhite; + // Print header if it is visible. + if (hoVisible in FHeader.Options) and PrintHeader then + begin + SaveHeaderFont := TFont.Create; + try + SaveHeaderFont.Assign(FHeader.Font); + // Create a new font for printing which does not use clear type output (but is antialiased, if possible) + // and which has the highest possible quality. + GetObject(FHeader.Font.Handle, SizeOf(TLogFont), @LogFont); + LogFont.lfQuality := ANTIALIASED_QUALITY; + FHeader.Font.Handle := CreateFontIndirect(LogFont); + ImgRect.Bottom := FHeader.Height; + FHeader.FColumns.PaintHeader(Image.Canvas.Handle, ImgRect, 0); + FHeader.Font := SaveHeaderFont; + finally + SaveHeaderFont.Free; + end; + end; + // The image's height is already adjusted for the header if it is visible. + ImgRect.Bottom := Image.Height; + + PaintTree(Image.Canvas, ImgRect, P, Options, pf32Bit); + Color := SaveColor; + + // Activate the printer + Printer.BeginDoc; + Printer.Canvas.Font := Font; + + // Now we can calculate the scaling : + pTxtHeight := Printer.Canvas.TextHeight('Tj'); + vTxtHeight := Canvas.TextHeight('Tj'); + + Scale := pTxtHeight / vTxtHeight; + + // Create an Image that has the same dimensions as the printer canvas but + // scaled to the VTree resolution: + PrinterImage := TBitmap.Create; + + vPageHeight := Round(Printer.PageHeight / Scale); + vPageWidth := Round(Printer.PageWidth / Scale); + + // We do a minumum of one page. + xPageNum := Trunc(Image.Width / vPageWidth); + yPageNum := Trunc(Image.Height / vPageHeight); + + PrinterImage.Width := vPageWidth; + PrinterImage.Height := vPageHeight; + + // Split vertically: + for yPage := 0 to yPageNum do + begin + DestRect.Left := 0; + DestRect.Top := 0; + DestRect.Right := PrinterImage.Width; + DestRect.Bottom := PrinterImage.Height; + + // Split horizontally: + for xPage := 0 to xPageNum do + begin + SrcRect.Left := vPageWidth * xPage; + SrcRect.Top := vPageHeight * yPage; + SrcRect.Right := vPageWidth * xPage + PrinterImage.Width; + SrcRect.Bottom := SrcRect.Top + vPageHeight; + + // Clear the image + PrinterImage.Canvas.Brush.Color := clWhite; + PrinterImage.Canvas.FillRect(Rect(0, 0, PrinterImage.Width, PrinterImage.Height)); + PrinterImage.Canvas.CopyRect(DestRect, Image.Canvas, SrcRect); + PrtStretchDrawDIB(Printer.Canvas, Rect(0, 0, Printer.PageWidth, Printer.PageHeight - 1), PrinterImage); + if xPage <> xPageNum then + Printer.NewPage; + end; + if yPage <> yPageNum then + Printer.NewPage; + end; + + // Restore tree font. + Font := SaveTreeFont; + SaveTreeFont.Free; + Printer.EndDoc; + finally + PrinterImage.Free; + Image.Free; + EndUpdate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +{function TBaseVirtualTree.ProcessDrop(DataObject: IDataObject; TargetNode: PVirtualNode; var Effect: Integer; + Mode: TVTNodeAttachMode): Boolean; + +// Recreates the (sub) tree structure serialized into memory and provided by DataObject. The new nodes are attached to +// the passed node or FRoot if TargetNode is nil. +// Returns True on success, i.e. the CF_VIRTUALTREE format is supported by the data object and the structure could be +// recreated, otherwise False. + +var + Source: TBaseVirtualTree; + +begin + Result := False; + if Mode = amNoWhere then + Effect := DROPEFFECT_NONE + else + begin + BeginUpdate; + // try to get the source tree of the operation + Source := GetTreeFromDataObject(DataObject); + if Assigned(Source) then + Source.BeginUpdate; + try + try + // Before adding the new nodes try to optimize the operation if source and target tree reside in + // the same application and operation is a move. + if ((Effect and DROPEFFECT_MOVE) <> 0) and Assigned(Source) then + begin + // If both copy and move are specified then prefer a copy because this is not destructing. + Result := ProcessOLEData(Source, DataObject, TargetNode, Mode, (Effect and DROPEFFECT_COPY) = 0); + // Since we made an optimized move or a copy there's no reason to act further after DoDragging returns. + Effect := DROPEFFECT_NONE; + end + else + // Act only if move or copy operation is requested. + if (Effect and (DROPEFFECT_MOVE or DROPEFFECT_COPY)) <> 0 then + Result := ProcessOLEData(Source, DataObject, TargetNode, Mode, False) + else + Result := False; + except + Effect := DROPEFFECT_NONE; + end; + finally + if Assigned(Source) then + Source.EndUpdate; + EndUpdate; + end; + end; +end;} + +//---------------------------------------------------------------------------------------------------------------------- + + +procedure TBaseVirtualTree.ReinitChildren(Node: PVirtualNode; Recursive: Boolean); + +// Forces all child nodes of Node to be reinitialized. +// If Recursive is True then also the grandchildren are reinitialized. + +var + Run: PVirtualNode; + +begin + if Assigned(Node) then + begin + InitChildren(Node); + Run := Node^.FirstChild; + end + else + begin + InitChildren(FRoot); + Run := FRoot^.FirstChild; + end; + + while Assigned(Run) do + begin + ReinitNode(Run, Recursive); + Run := Run^.NextSibling; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ReinitNode(Node: PVirtualNode; Recursive: Boolean); + +// Forces the given node and all its children (if recursive is True) to be initialized again without +// modifying any data in the nodes nor deleting children (unless the application requests a different amount). + +begin + if Assigned(Node) and (Node <> FRoot) then + begin + // Remove dynamic styles. + Node^.States := Node^.States - [vsChecking, vsCutOrCopy, vsDeleting, vsHeightMeasured]; + InitNode(Node); + end; + + if Recursive then + ReinitChildren(Node, True); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.RepaintNode(Node: PVirtualNode); + +// Causes an immediate repaint of the given node. + +var + R: Trect; + +begin + if Assigned(Node) and (Node <> FRoot) then + begin + R := GetDisplayRect(Node, -1, False); +//todo:win RedrawWindow(Handle, @R, 0, RDW_INVALIDATE or RDW_UPDATENOW or RDW_NOERASE or RDW_VALIDATE or RDW_NOCHILDREN); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ResetNode(Node: PVirtualNode); + +// Deletes all children of the given node and marks it as being uninitialized. + +begin + DoCancelEdit; + if (Node = nil) or (Node = FRoot) then + Clear + else + begin + DoReset(Node); + DeleteChildren(Node); + // Remove initialized and other dynamic styles, keep persistent styles. + Node^.States := Node^.States - [vsInitialized, vsChecking, vsCutOrCopy, vsDeleting, vsHasChildren, vsExpanded, + vsHeightMeasured]; + InvalidateNode(Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SaveToFile(const FileName: TFileName); + +// Saves the entire content of the tree into a file (see further notes in SaveToStream). + +var + FileStream: TFileStream; + +begin + FileStream := TFileStream.Create(FileName, fmCreate); + try + SaveToStream(FileStream); + finally + FileStream.Free; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SaveToStream(Stream: TStream; Node: PVirtualNode = nil); + +// Saves Node and all its children to Stream. If Node is nil then all top level nodes will be stored. +// Note: You should be careful about assuming what is actually saved. The problem here is that we are dealing with +// virtual data. The tree can so not know what it has to save. The only fact we reliably know is the tree's +// structure. To be flexible for future enhancements as well as unknown content (unknown to the tree class which +// is saving/loading the stream) a chunk based approach is used here. Every tree class handles only those +// chunks which are not handled by an anchestor class and are known by the class. +// +// The base tree class saves only the structure of the tree along with application provided data. Descentants may +// optionally add their own chunks to store additional information. See: WriteChunks. + +var + Count: Cardinal; + +begin + Stream.Write(MagicID, SizeOf(MagicID)); + if Node = nil then + begin + // Keep number of top level nodes for easy restauration. + Count := FRoot^.ChildCount; + Stream.WriteBuffer(Count, SizeOf(Count)); + + // Save entire tree here. + Node := FRoot^.FirstChild; + while Assigned(Node) do + begin + WriteNode(Stream, Node); + Node := Node^.NextSibling; + end; + end + else + begin + Count := 1; + Stream.WriteBuffer(Count, SizeOf(Count)); + WriteNode(Stream, Node); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.ScrollIntoView(Node: PVirtualNode; Center: Boolean; Horizontally: Boolean = False): Boolean; + +// Scrolls the tree so that the given node is in the client area and returns True if the tree really has been +// scrolled (e.g. to avoid further updates) else returns False. If extened focus is enabled then the tree will also +// be horizontally scrolled if needed. +// Note: All collapsed parents of the node are expanded. + +var + R: TRect; + Run: PVirtualNode; + UseColumns, + HScrollBarVisible: Boolean; + NewOffset: Integer; + +begin + Result := False; + if Assigned(Node) and (Node <> FRoot) then + begin + // Make sure all parents of the node are expanded. + Run := Node^.Parent; + while Run <> FRoot do + begin + if not (vsExpanded in Run^.States) then + ToggleNode(Run); + Run := Run^.Parent; + end; + UseColumns := FHeader.UseColumns; + if UseColumns then + R := GetDisplayRect(Node, FFocusedColumn, not (toGridExtensions in FOptions.FMiscOptions)) + else + R := GetDisplayRect(Node, NoColumn, not (toGridExtensions in FOptions.FMiscOptions)); + + // The returned rectangle can never be empty after the expand code above. + // 1) scroll vertically + if R.Top < 0 then + begin + if Center then + SetOffsetY(FOffsetY - R.Top + ClientHeight div 2) + else + SetOffsetY(FOffsetY - R.Top); + Result := True; + end + else + if (R.Bottom > ClientHeight) or Center then + begin + HScrollBarVisible := (ScrollBarOptions.ScrollBars in [ssBoth, ssHorizontal]) and + (ScrollBarOptions.AlwaysVisible or (Integer(FRangeX) > ClientWidth)); + if Center then + SetOffsetY(FOffsetY - R.Bottom + ClientHeight div 2) + else + SetOffsetY(FOffsetY - R.Bottom + ClientHeight); + // When scrolling up and the horizontal scroll appears because of the operation + // then we have to move up the node the horizontal scrollbar's height too + // in order to avoid that the scroll bar hides the node which we wanted to have in view. + if not UseColumns and not HScrollBarVisible and (Integer(FRangeX) > ClientWidth) then + SetOffsetY(FOffsetY - GetSystemMetrics(SM_CYHSCROLL)); + Result := True; + end; + + if Horizontally then + begin + // 2) scroll horizontally + if Header.Columns.GetVisibleFixedWidth > 0 then + begin + if (Abs(R.Left - Header.Columns.GetVisibleFixedWidth) > 1) then + begin + NewOffset := FEffectiveOffsetX - (R.Left - Header.Columns.GetVisibleFixedWidth); +{ if UseRightToLeftAlignment then + SetOffsetX(-Integer(FRangeX) + ClientWidth + NewOffset) + else} + SetOffsetX(-NewOffset); + Result := True; + end; + end + else + if (R.Right > ClientWidth) or (R.Left < 0) then + begin + NewOffset := FEffectiveOffsetX + ((R.Left + R.Right) div 2) - (ClientWidth div 2); +{ if UseRightToLeftAlignment then + SetOffsetX(-Integer(FRangeX) + ClientWidth + NewOffset) + else} + SetOffsetX(-NewOffset); + Result := True; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SelectAll(VisibleOnly: Boolean); + +// Select all nodes in the tree. +// If VisibleOnly is True then only visible nodes are selected. + +var + Run: PVirtualNode; + NextFunction: function(Node: PVirtualNode): PVirtualNode of object; + +begin + if toMultiSelect in FOptions.FSelectionOptions then + begin + ClearTempCache; + if VisibleOnly then + begin + Run := GetFirstVisible; + NextFunction := @GetNextVisible; + end + else + begin + Run := GetFirst; + NextFunction := @GetNext; + end; + + while Assigned(Run) do + begin + if not(vsSelected in Run^.States) then + InternalCacheNode(Run); + Run := NextFunction(Run); + end; + if FTempNodeCount > 0 then + AddToSelection(FTempNodeCache, FTempNodeCount); + ClearTempCache; + Invalidate; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.Sort(Node: PVirtualNode; Column: TColumnIndex; Direction: TSortDirection; DoInit: Boolean = True); + +// Sorts the given node. The application is queried about how to sort via the OnCompareNodes event. +// Column is simply passed to the the compare function so the application can also sort in a particular column. +// In order to free the application from taking care about the sort direction the parameter Direction is used. +// This way the application can always sort in increasing order, while this method reorders nodes according to this flag. + + //--------------- local functions ------------------------------------------- + + function MergeAscending(A, B: PVirtualNode): PVirtualNode; + + // Merges A and B (which both must be sorted via Compare) into one list. + + var + Dummy: TVirtualNode; + + begin + // This avoids checking for Result = nil in the loops. + Result := @Dummy; + while Assigned(A) and Assigned(B) do + begin + if DoCompare(A, B, Column) <= 0 then + begin + Result^.NextSibling := A; + Result := A; + A := A^.NextSibling; + end + else + begin + Result^.NextSibling := B; + Result := B; + B := B^.NextSibling; + end; + end; + + // Just append the list which is not nil (or set end of result list to nil if both lists are nil). + if Assigned(A) then + Result^.NextSibling := A + else + Result^.NextSibling := B; + // return start of the new merged list + Result := Dummy.NextSibling; + end; + + //--------------------------------------------------------------------------- + + function MergeDescending(A, B: PVirtualNode): PVirtualNode; + + // Merges A and B (which both must be sorted via Compare) into one list. + + var + Dummy: TVirtualNode; + + begin + // this avoids checking for Result = nil in the loops + Result := @Dummy; + while Assigned(A) and Assigned(B) do + begin + if DoCompare(A, B, Column) >= 0 then + begin + Result^.NextSibling := A; + Result := A; + A := A^.NextSibling; + end + else + begin + Result^.NextSibling := B; + Result := B; + B := B^.NextSibling; + end; + end; + + // Just append the list which is not nil (or set end of result list to nil if both lists are nil). + if Assigned(A) then + Result^.NextSibling := A + else + Result^.NextSibling := B; + // Return start of the newly merged list. + Result := Dummy.NextSibling; + end; + + //--------------------------------------------------------------------------- + + function MergeSortAscending(var Node: PVirtualNode; N: Cardinal): PVirtualNode; + + // Sorts the list of nodes given by Node (which must not be nil). + + var + A, B: PVirtualNode; + + begin + if N > 1 then + begin + A := MergeSortAscending(Node, N div 2); + B := MergeSortAscending(Node, (N + 1) div 2); + Result := MergeAscending(A, B); + end + else + begin + Result := Node; + Node := Node^.NextSibling; + Result^.NextSibling := nil; + end; + end; + + //--------------------------------------------------------------------------- + + function MergeSortDescending(var Node: PVirtualNode; N: Cardinal): PVirtualNode; + + // Sorts the list of nodes given by Node (which must not be nil). + + var + A, B: PVirtualNode; + + begin + if N > 1 then + begin + A := MergeSortDescending(Node, N div 2); + B := MergeSortDescending(Node, (N + 1) div 2); + Result := MergeDescending(A, B); + end + else + begin + Result := Node; + Node := Node^.NextSibling; + Result^.NextSibling := nil; + end; + end; + + //--------------- end local functions --------------------------------------- + +var + Run: PVirtualNode; + Index: Cardinal; + +begin + InterruptValidation; + if tsEditPending in FStates then + begin + StopTimer(EditTimer); + DoStateChange([], [tsEditPending]); + end; + + if not (tsEditing in FStates) or DoEndEdit then + begin + if Node = nil then + Node := FRoot; + if vsHasChildren in Node^.States then + begin + if (Node^.ChildCount = 0) and DoInit then + InitChildren(Node); + // Make sure the children are valid, so they can be sorted at all. + if DoInit and (Node^.ChildCount > 0) then + ValidateChildren(Node, False); + // Child count might have changed. + if Node^.ChildCount > 1 then + begin + // Sort the linked list, check direction flag only once. + if Direction = sdAscending then + Node^.FirstChild := MergeSortAscending(Node^.FirstChild, Node^.ChildCount) + else + Node^.FirstChild := MergeSortDescending(Node^.FirstChild, Node^.ChildCount); + // Consolidate the child list finally. + Run := Node^.FirstChild; + Run^.PrevSibling := nil; + Index := 0; + repeat + Run^.Index := Index; + Inc(Index); + if Run^.NextSibling = nil then + Break; + Run^.NextSibling^.PrevSibling := Run; + Run := Run^.NextSibling; + until False; + Node^.LastChild := Run; + + InvalidateCache; + end; + if FUpdateCount = 0 then + begin + ValidateCache; + Invalidate; + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.SortTree(Column: TColumnIndex; Direction: TSortDirection; DoInit: Boolean = True); + + //--------------- local function -------------------------------------------- + + procedure DoSort(Node: PVirtualNode); + + // Recursively sorts Node and its child nodes. + + var + Run: PVirtualNode; + + begin + Sort(Node, Column, Direction, DoInit); + + Run := Node^.FirstChild; + while Assigned(Run) do + begin + if DoInit and not (vsInitialized in Run^.States) then + InitNode(Run); + if vsInitialized in Run^.States then + DoSort(Run); + Run := Run^.NextSibling; + end; + end; + + //--------------- end local function ---------------------------------------- + +begin + // Instead of wrapping the sort using BeginUpdate/EndUpdate simply the update counter + // is modified. Otherwise the EndUpdate call will recurse here. + Inc(FUpdateCount); + try + if Column > InvalidColumn then + DoSort(FRoot); + InvalidateCache; + finally + if FUpdateCount > 0 then + Dec(FUpdateCount); + if FUpdateCount = 0 then + begin + ValidateCache; + Invalidate; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ToggleNode(Node: PVirtualNode); + +// Changes a node's expand state to the opposite state. + +var + LastTopNode, + Child: PVirtualNode; + NewHeight: Integer; + NeedUpdate: Boolean; + ToggleData: TToggleAnimationData; + +begin + Assert(Assigned(Node), 'Node must not be nil.'); + NeedUpdate := False; + + // We don't need to switch the expand state if the node is being deleted otherwise some + // updates (e.g. visible node count) are done twice with disasterous results). + if not (vsDeleting in Node^.States) then + begin + // LastTopNode is needed to know when the entire tree scrolled during toggling. + // It is of course only needed when we also update the display here. + if FUpdateCount = 0 then + LastTopNode := GetTopNode + else + LastTopNode := nil; + + if vsExpanded in Node^.States then + begin + if DoCollapsing(Node) then + begin + NeedUpdate := True; + + if (FUpdateCount = 0) and (toAnimatedToggle in FOptions.FAnimationOptions) and not (tsCollapsing in FStates) then + begin + Application.CancelHint; + UpdateWindow(Handle); + + // animated collapsing + with ToggleData do + begin + Expand := False; + R := GetDisplayRect(Node, NoColumn, False); + R.Bottom := ClientHeight; + Inc(R.Top, NodeHeight[Node]); + Window := Handle; + DC := GetDC(Handle); + Self.Brush.Color := Color; + Brush := Self.Brush.Handle; + try + Animate(Min(R.Bottom - R.Top + 1, Node^.TotalHeight - NodeHeight[Node]), FAnimationDuration, @ToggleCallback, + @ToggleData); + finally + ReleaseDC(Window, DC); + end; + end; + end; + + // collapse the node + AdjustTotalHeight(Node, NodeHeight[Node]); + if FullyVisible[Node] then + Dec(FVisibleCount, CountVisibleChildren(Node)); + Exclude(Node^.States, vsExpanded); + DoCollapsed(Node); + + // Remove child nodes now, if enabled. + if (toAutoFreeOnCollapse in FOptions.FAutoOptions) and (Node^.ChildCount > 0) then + begin + DeleteChildren(Node); + Include(Node^.States, vsHasChildren); + end; + end; + end + else + if DoExpanding(Node) then + begin + NeedUpdate := True; + // expand the node, need to adjust the height + if not (vsInitialized in Node^.States) then + InitNode(Node); + if (vsHasChildren in Node^.States) and (Node^.ChildCount = 0) then + InitChildren(Node); + + // Avoid setting the vsExpanded style if there are no child nodes. + if Node^.ChildCount > 0 then + begin + // Iterate through the child nodes without initializing them. We have to determine the entire height. + NewHeight := 0; + Child := Node^.FirstChild; + repeat + if vsVisible in Child^.States then + Inc(NewHeight, Child^.TotalHeight); + Child := Child^.NextSibling; + until Child = nil; + + if FUpdateCount = 0 then + begin + ToggleData.R := GetDisplayRect(Node, NoColumn, False); + + // Do animated expanding if enabled and it is not the last visible node to be expanded. + if (ToggleData.R.Top < ClientHeight) and ([tsPainting, tsExpanding] * FStates = []) and + (toAnimatedToggle in FOptions.FAnimationOptions) and (GetNextVisibleNoInit(Node) <> nil) then + begin + Application.CancelHint; + UpdateWindow(Handle); + // animated expanding + with ToggleData do + begin + Inc(R.Top, NodeHeight[Node]); + R.Bottom := ClientHeight; + if R.Bottom > R.Top then + begin + Expand := True; + Window := Handle; + DC := GetDC(Handle); + + Self.Brush.Color := Color; + Brush := Self.Brush.Handle; + try + Animate(Min(R.Bottom - R.Top + 1, NewHeight), FAnimationDuration, @ToggleCallback, @ToggleData); + finally + ReleaseDC(Window, DC); + end; + end; + end; + end; + end; + + Include(Node^.States, vsExpanded); + AdjustTotalHeight(Node, NewHeight, True); + if FullyVisible[Node] then + Inc(FVisibleCount, CountVisibleChildren(Node)); + + DoExpanded(Node); + end; + end; + + if NeedUpdate then + begin + InvalidateCache; + if FUpdateCount = 0 then + begin + ValidateCache; + if Node^.ChildCount > 0 then + begin + UpdateScrollbars(True); + // Scroll as much child nodes into view as possible if the node has been expanded. + if (toAutoScrollOnExpand in FOptions.FAutoOptions) and (vsExpanded in Node^.States) then + begin + if Integer(Node^.TotalHeight) <= ClientHeight then + ScrollIntoView(GetLastChild(Node), toCenterScrollIntoView in FOptions.SelectionOptions) + else + TopNode := Node; + end; + + // Check for automatically scrolled tree. + if LastTopNode <> GetTopNode then + Invalidate + else + InvalidateToBottom(Node); + end + else + InvalidateNode(Node); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.UpdateAction(xAction: TBasicAction): Boolean; + +// Support for standard actions. + +begin + if not Focused then + Result := inherited UpdateAction(xAction) + else + begin + Result := (xAction is TEditCut) or (xAction is TEditCopy) + {.$ifdef COMPILER_5_UP} or (xAction is TEditDelete) {.$endif COMPILER_5_UP}; + + if Result then + TAction(xAction).Enabled := (FSelectionCount > 0) and + ({.$ifdef COMPILER_5_UP} (xAction is TEditDelete) or {.$endif COMPILER_5_UP} (FClipboardFormats.Count > 0)) + else + begin + Result := xAction is TEditPaste; + if Result then + TAction(xAction).Enabled := True + else + begin + {.$ifdef COMPILER_5_UP} + Result := xAction is TEditSelectAll; + if Result then + TAction(xAction).Enabled := (toMultiSelect in FOptions.FSelectionOptions) and (FVisibleCount > 0) + else + {.$endif COMPILER_5_UP} + Result := inherited UpdateAction(xAction); + end; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.UpdateHorizontalScrollBar(DoRepaint: Boolean); + +var + ScrollInfo: TScrollInfo; + +begin + if FHeader.UseColumns then + FRangeX := FHeader.FColumns.TotalWidth + else + FRangeX := GetMaxRightExtend; + + // Adjust effect scroll offset depending on bidi mode. +{ if UseRightToLeftAlignment then + FEffectiveOffsetX := Integer(FRangeX) - ClientWidth + FOffsetX + else} + FEffectiveOffsetX := -FOffsetX; + + if FScrollBarOptions.ScrollBars in [ssHorizontal, ssBoth] then + begin + FillChar(ScrollInfo, SizeOf(ScrollInfo), 0); + ScrollInfo.cbSize := SizeOf(ScrollInfo); + ScrollInfo.fMask := SIF_ALL; + {$ifdef UseFlatScrollbars} + FlatSB_GetScrollInfo(Handle, SB_HORZ, ScrollInfo); + {$else} + GetScrollInfo(Handle, SB_HORZ, ScrollInfo); + {$endif UseFlatScrollbars} + + if (Integer(FRangeX) > ClientWidth) or FScrollBarOptions.AlwaysVisible then + begin + ShowScrollBar(Handle,SB_HORZ, True); + + ScrollInfo.nMin := 0; + ScrollInfo.nMax := FRangeX; + ScrollInfo.nPos := FEffectiveOffsetX; + ScrollInfo.nPage := Max(0, ClientWidth + 1); + + ScrollInfo.fMask := SIF_ALL or ScrollMasks[FScrollBarOptions.AlwaysVisible]; + {$ifdef UseFlatScrollbars} + FlatSB_SetScrollInfo(Handle, SB_HORZ, ScrollInfo, DoRepaint); + {$else} + SetScrollInfo(Handle, SB_HORZ, ScrollInfo, DoRepaint); + {$endif UseFlatScrollbars} + end + else + begin + ScrollInfo.nMin := 0; + ScrollInfo.nMax := 0; + ScrollInfo.nPos := 0; + ScrollInfo.nPage := 0; + ShowScrollBar(Handle,SB_HORZ, False); + {$ifdef UseFlatScrollbars} + FlatSB_SetScrollInfo(Handle, SB_HORZ, ScrollInfo, False); + {$else} + SetScrollInfo(Handle, SB_HORZ, ScrollInfo, False); + {$endif UseFlatScrollbars} + end; + + // Since the position is automatically changed if it doesn't meet the range + // we better read the current position back to stay synchronized. + {$ifdef UseFlatScrollbars} + FScrollOffsetX := FlatSB_GetScrollPos(Handle, SB_HORZ); + {$else} + //todo: Use get scrollinfo instead of GetScrollPos?? + FEffectiveOffsetX := GetScrollPos(Handle, SB_HORZ); + {$endif UseFlatScrollbars} +{ if UseRightToLeftAlignment then + SetOffsetX(-Integer(FRangeX) + ClientWidth + FEffectiveOffsetX) + else} + SetOffsetX(-FEffectiveOffsetX); + end + else + begin + ShowScrollBar(Handle,SB_HORZ, False); + + // Reset the current horizontal offset to account for window resize etc. + SetOffsetX(FOffsetX); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.UpdateScrollBars(DoRepaint: Boolean); + +// adjusts scrollbars to reflect current size and paint offset of the tree + +begin + if HandleAllocated then + begin + UpdateHorizontalScrollBar(DoRepaint); + UpdateVerticalScrollBar(DoRepaint); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.UpdateVerticalScrollBar(DoRepaint: Boolean); + +var + ScrollInfo: TScrollInfo; + +begin + // Total node height includes the height of the invisble root node. + if FRoot^.TotalHeight < FDefaultNodeHeight then + FRoot^.TotalHeight := FDefaultNodeHeight; + FRangeY := FRoot^.TotalHeight - FRoot^.NodeHeight; + + if FScrollBarOptions.ScrollBars in [ssVertical, ssBoth] then + begin + ScrollInfo.cbSize := SizeOf(ScrollInfo); + ScrollInfo.fMask := SIF_ALL; + {$ifdef UseFlatScrollbars} + FlatSB_GetScrollInfo(Handle, SB_VERT, ScrollInfo); + {$else} + GetScrollInfo(Handle, SB_VERT, ScrollInfo); + {$endif UseFlatScrollbars} + + if (Integer(FRangeY) > ClientHeight) or FScrollBarOptions.AlwaysVisible then + begin + {$ifdef UseFlatScrollbars} + FlatSB_ShowScrollBar(Handle, SB_VERT, True); + {$else} + ShowScrollBar(Handle, SB_VERT, True); + {$endif UseFlatScrollbars} + + ScrollInfo.nMin := 0; + ScrollInfo.nMax := FRangeY; + ScrollInfo.nPos := -FOffsetY; + ScrollInfo.nPage := Max(0, ClientHeight + 1); + + ScrollInfo.fMask := SIF_ALL or ScrollMasks[FScrollBarOptions.AlwaysVisible]; + {$ifdef UseFlatScrollbars} + FlatSB_SetScrollInfo(Handle, SB_VERT, ScrollInfo, DoRepaint); + {$else} + SetScrollInfo(Handle, SB_VERT, ScrollInfo, DoRepaint); + {$endif UseFlatScrollbars} + end + else + begin + ScrollInfo.nMin := 0; + ScrollInfo.nMax := 0; + ScrollInfo.nPos := 0; + ScrollInfo.nPage := 0; + {$ifdef UseFlatScrollbars} + FlatSB_ShowScrollBar(Handle, SB_VERT, False); + FlatSB_SetScrollInfo(Handle, SB_VERT, ScrollInfo, False); + {$else} + ShowScrollBar(Handle, SB_VERT, False); + SetScrollInfo(Handle, SB_VERT, ScrollInfo, False); + {$endif UseFlatScrollbars} + end; + + // Since the position is automatically changed if it doesn't meet the range + // we better read the current position back to stay synchronized. + {$ifdef UseFlatScrollbars} + SetOffsetY(-FlatSB_GetScrollPos(Handle, SB_VERT)); + {$else} + SetOffsetY(-GetScrollPos(Handle, SB_VERT)); + {$endif UseFlatScrollBars} + end + else + begin + {$ifdef UseFlatScrollbars} + FlatSB_ShowScrollBar(Handle, SB_VERT, False); + {$else} + ShowScrollBar(Handle, SB_VERT, False); + {$endif UseFlatScrollbars} + + // Reset the current vertical offset to account for window resize etc. + SetOffsetY(FOffsetY); + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +function TBaseVirtualTree.UseRightToLeftReading: Boolean; + +// The tree can handle right-to-left reading also on non-middle-east systems, so we cannot use the same function as +// it is implemented in TControl. + +begin +//b Result := BiDiMode <> bdLeftToRight; + Result := False; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ValidateChildren(Node: PVirtualNode; Recursive: Boolean); + +// Ensures that the children of the given node (and all their children, if Recursive is True) are initialized. +// Node must already be initialized + +var + Child: PVirtualNode; + +begin + if Node = nil then + Node := FRoot; + + if (vsHasChildren in Node^.States) and (Node^.ChildCount = 0) then + InitChildren(Node); + Child := Node^.FirstChild; + while Assigned(Child) do + begin + ValidateNode(Child, Recursive); + Child := Child^.NextSibling; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.ValidateNode(Node: PVirtualNode; Recursive: Boolean); + +// Ensures that the given node (and all its children, if Recursive is True) are initialized. + +var + Child: PVirtualNode; + +begin + if Node = nil then + Node := FRoot + else + if not (vsInitialized in Node^.States) then + InitNode(Node); + + if Recursive then + begin + if (vsHasChildren in Node^.States) and (Node^.ChildCount = 0) then + InitChildren(Node); + Child := Node^.FirstChild; + while Assigned(Child) do + begin + ValidateNode(Child, recursive); + Child := Child^.NextSibling; + end; + end; +end; + +//---------------------------------------------------------------------------------------------------------------------- + +(*procedure TBaseVirtualTree.Invalidate; + +// Litte helpers, since LCL does not support GetUpdateRect + +var + R: TRect; + +begin + R := ClientRect; + InvalidateRect(Handle, @R, False); +end; + +//---------------------------------------------------------------------------------------------------------------------- + +procedure TBaseVirtualTree.InvalidateRect(xHandle: Integer; aRect: PRect; Erase: Boolean); + +// Litte helpers, since LCL does not support GetUpdateRect + +begin + FUpdateRect := PRect(aRect)^; + LCLIntf.InvalidateRect(Handle, aRect, Erase); +end;*) + +//----------------- TVTEdit -------------------------------------------------------------------------------------------- + +// Implementation of a generic node caption editor. + + + +initialization + {$i VirtualTrees.inc.res} + {$i VirtualTrees.lrs} + // This watcher is used whenever a global structure could be modified by more than one thread. + Watcher := TCriticalSection.Create; +finalization + if Initialized then + FinalizeGlobalStructures; + + InternalClipboardFormats.Free; + Watcher.Free; +end.