mirror of
https://github.com/IBM/fp-go.git
synced 2026-01-17 00:53:55 +02:00
Compare commits
13 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
8acea9043f | ||
|
|
c6445ac021 | ||
|
|
840ffbb51d | ||
|
|
380ba2853c | ||
|
|
c18e5e2107 | ||
|
|
89766bdb26 | ||
|
|
21d116d325 | ||
|
|
7f2e76dd94 | ||
|
|
77965a12ff | ||
|
|
ed77bd7971 | ||
|
|
f154790d88 | ||
|
|
e010f13dce | ||
|
|
86a260a204 |
14
v2/DESIGN.md
14
v2/DESIGN.md
@@ -14,6 +14,8 @@ This document explains the key design decisions and principles behind fp-go's AP
|
||||
|
||||
fp-go follows the **"data last"** principle, where the data being operated on is always the last parameter in a function. This design choice enables powerful function composition and partial application patterns.
|
||||
|
||||
This principle is deeply rooted in functional programming tradition, particularly in **Haskell's design philosophy**. Haskell functions are automatically curried and follow the data-last convention, making function composition natural and elegant. For example, Haskell's `map` function has the signature `(a -> b) -> [a] -> [b]`, where the transformation function comes before the list.
|
||||
|
||||
### What is "Data Last"?
|
||||
|
||||
In the "data last" style, functions are structured so that:
|
||||
@@ -31,6 +33,8 @@ The "data last" principle enables:
|
||||
3. **Point-Free Style**: Write transformations without explicitly mentioning the data
|
||||
4. **Reusability**: Create reusable transformation pipelines
|
||||
|
||||
This design aligns with Haskell's approach where all functions are curried by default, enabling elegant composition patterns that have proven effective over decades of functional programming practice.
|
||||
|
||||
### Examples
|
||||
|
||||
#### Basic Transformation
|
||||
@@ -181,8 +185,18 @@ result := O.MonadMap(O.Some("hello"), strings.ToUpper)
|
||||
|
||||
The data-last currying pattern is well-documented in the functional programming community:
|
||||
|
||||
#### Haskell Design Philosophy
|
||||
- [Haskell Wiki - Currying](https://wiki.haskell.org/Currying) - Comprehensive explanation of currying in Haskell
|
||||
- [Learn You a Haskell - Higher Order Functions](http://learnyouahaskell.com/higher-order-functions) - Introduction to currying and partial application
|
||||
- [Haskell's Prelude](https://hackage.haskell.org/package/base/docs/Prelude.html) - Standard library showing data-last convention throughout
|
||||
|
||||
#### General Functional Programming
|
||||
- [Mostly Adequate Guide - Ch. 4: Currying](https://mostly-adequate.gitbook.io/mostly-adequate-guide/ch04) - Excellent introduction with clear examples
|
||||
- [Curry and Function Composition](https://medium.com/javascript-scene/curry-and-function-composition-2c208d774983) by Eric Elliott
|
||||
- [Why Curry Helps](https://hughfdjackson.com/javascript/why-curry-helps/) - Practical benefits of currying
|
||||
|
||||
#### Related Libraries
|
||||
- [fp-ts Documentation](https://gcanti.github.io/fp-ts/) - TypeScript library that inspired fp-go's design
|
||||
- [fp-ts Issue #1238](https://github.com/gcanti/fp-ts/issues/1238) - Real-world examples of data-last refactoring
|
||||
|
||||
## Kleisli and Operator Types
|
||||
|
||||
@@ -446,6 +446,7 @@ func process() IOResult[string] {
|
||||
|
||||
## 📚 Documentation
|
||||
|
||||
- **[Design Decisions](./DESIGN.md)** - Key design principles and patterns explained
|
||||
- **[API Documentation](https://pkg.go.dev/github.com/IBM/fp-go/v2)** - Complete API reference
|
||||
- **[Code Samples](./samples/)** - Practical examples and use cases
|
||||
- **[Go 1.24 Release Notes](https://tip.golang.org/doc/go1.24)** - Information about generic type aliases
|
||||
|
||||
@@ -622,3 +622,128 @@ func Prepend[A any](head A) Operator[A, A] {
|
||||
func Reverse[A any](as []A) []A {
|
||||
return G.Reverse(as)
|
||||
}
|
||||
|
||||
// Extend applies a function to every suffix of an array, creating a new array of results.
|
||||
// This is the comonad extend operation for arrays.
|
||||
//
|
||||
// The function f is applied to progressively smaller suffixes of the input array:
|
||||
// - f(as[0:]) for the first element
|
||||
// - f(as[1:]) for the second element
|
||||
// - f(as[2:]) for the third element
|
||||
// - and so on...
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type of elements in the input array
|
||||
// - B: The type of elements in the output array
|
||||
//
|
||||
// Parameters:
|
||||
// - f: A function that takes an array suffix and returns a value
|
||||
//
|
||||
// Returns:
|
||||
// - A function that transforms an array of A into an array of B
|
||||
//
|
||||
// Behavior:
|
||||
// - Creates a new array with the same length as the input
|
||||
// - For each position i, applies f to the suffix starting at i
|
||||
// - Returns an empty array if the input is empty
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Sum all elements from current position to end
|
||||
// sumSuffix := array.Extend(func(as []int) int {
|
||||
// return array.Reduce(func(acc, x int) int { return acc + x }, 0)(as)
|
||||
// })
|
||||
// result := sumSuffix([]int{1, 2, 3, 4})
|
||||
// // result: []int{10, 9, 7, 4}
|
||||
// // Explanation: [1+2+3+4, 2+3+4, 3+4, 4]
|
||||
//
|
||||
// Example with length:
|
||||
//
|
||||
// // Get remaining length at each position
|
||||
// lengths := array.Extend(array.Size[int])
|
||||
// result := lengths([]int{10, 20, 30})
|
||||
// // result: []int{3, 2, 1}
|
||||
//
|
||||
// Example with head:
|
||||
//
|
||||
// // Duplicate each element (extract head of each suffix)
|
||||
// duplicate := array.Extend(func(as []int) int {
|
||||
// return F.Pipe1(as, array.Head[int], O.GetOrElse(F.Constant(0)))
|
||||
// })
|
||||
// result := duplicate([]int{1, 2, 3})
|
||||
// // result: []int{1, 2, 3}
|
||||
//
|
||||
// Use cases:
|
||||
// - Computing cumulative or rolling operations
|
||||
// - Implementing sliding window algorithms
|
||||
// - Creating context-aware transformations
|
||||
// - Building comonadic computations
|
||||
//
|
||||
// Comonad laws:
|
||||
// - Left identity: Extend(Extract) == Identity
|
||||
// - Right identity: Extract ∘ Extend(f) == f
|
||||
// - Associativity: Extend(f) ∘ Extend(g) == Extend(f ∘ Extend(g))
|
||||
//
|
||||
//go:inline
|
||||
func Extend[A, B any](f func([]A) B) Operator[A, B] {
|
||||
return func(as []A) []B {
|
||||
return G.MakeBy[[]B](len(as), func(i int) B { return f(as[i:]) })
|
||||
}
|
||||
}
|
||||
|
||||
// Extract returns the first element of an array, or a zero value if empty.
|
||||
// This is the comonad extract operation for arrays.
|
||||
//
|
||||
// Extract is the dual of the monadic return/of operation. While Of wraps a value
|
||||
// in a context, Extract unwraps a value from its context.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type of elements in the array
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input array
|
||||
//
|
||||
// Returns:
|
||||
// - The first element if the array is non-empty, otherwise the zero value of type A
|
||||
//
|
||||
// Behavior:
|
||||
// - Returns as[0] if the array has at least one element
|
||||
// - Returns the zero value of A if the array is empty
|
||||
// - Does not modify the input array
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// result := array.Extract([]int{1, 2, 3})
|
||||
// // result: 1
|
||||
//
|
||||
// Example with empty array:
|
||||
//
|
||||
// result := array.Extract([]int{})
|
||||
// // result: 0 (zero value for int)
|
||||
//
|
||||
// Example with strings:
|
||||
//
|
||||
// result := array.Extract([]string{"hello", "world"})
|
||||
// // result: "hello"
|
||||
//
|
||||
// Example with empty string array:
|
||||
//
|
||||
// result := array.Extract([]string{})
|
||||
// // result: "" (zero value for string)
|
||||
//
|
||||
// Use cases:
|
||||
// - Extracting the current focus from a comonadic context
|
||||
// - Getting the head element with a default zero value
|
||||
// - Implementing comonad-based computations
|
||||
//
|
||||
// Comonad laws:
|
||||
// - Extract ∘ Of == Identity (extracting from a singleton returns the value)
|
||||
// - Extract ∘ Extend(f) == f (extract after extend equals applying f)
|
||||
//
|
||||
// Note: For a safer alternative that handles empty arrays explicitly,
|
||||
// consider using Head which returns an Option[A].
|
||||
//
|
||||
//go:inline
|
||||
func Extract[A any](as []A) A {
|
||||
return G.Extract(as)
|
||||
}
|
||||
|
||||
@@ -474,3 +474,293 @@ func TestReverseProperties(t *testing.T) {
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtract tests the Extract function
|
||||
func TestExtract(t *testing.T) {
|
||||
t.Run("Extract from non-empty array", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, 1, result)
|
||||
})
|
||||
|
||||
t.Run("Extract from single element array", func(t *testing.T) {
|
||||
input := []string{"hello"}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, "hello", result)
|
||||
})
|
||||
|
||||
t.Run("Extract from empty array returns zero value", func(t *testing.T) {
|
||||
input := []int{}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, 0, result)
|
||||
})
|
||||
|
||||
t.Run("Extract from empty string array returns empty string", func(t *testing.T) {
|
||||
input := []string{}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, "", result)
|
||||
})
|
||||
|
||||
t.Run("Extract does not modify original array", func(t *testing.T) {
|
||||
original := []int{1, 2, 3}
|
||||
originalCopy := []int{1, 2, 3}
|
||||
_ = Extract(original)
|
||||
assert.Equal(t, originalCopy, original)
|
||||
})
|
||||
|
||||
t.Run("Extract with floats", func(t *testing.T) {
|
||||
input := []float64{3.14, 2.71, 1.41}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, 3.14, result)
|
||||
})
|
||||
|
||||
t.Run("Extract with structs", func(t *testing.T) {
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
input := []Person{
|
||||
{"Alice", 30},
|
||||
{"Bob", 25},
|
||||
}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, Person{"Alice", 30}, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtractComonadLaws tests comonad laws for Extract
|
||||
func TestExtractComonadLaws(t *testing.T) {
|
||||
t.Run("Extract ∘ Of == Identity", func(t *testing.T) {
|
||||
value := 42
|
||||
result := Extract(Of(value))
|
||||
assert.Equal(t, value, result)
|
||||
})
|
||||
|
||||
t.Run("Extract ∘ Extend(f) == f", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4}
|
||||
f := func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}
|
||||
|
||||
// Extract(Extend(f)(input)) should equal f(input)
|
||||
extended := Extend(f)(input)
|
||||
result := Extract(extended)
|
||||
expected := f(input)
|
||||
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtend tests the Extend function
|
||||
func TestExtend(t *testing.T) {
|
||||
t.Run("Extend with sum of suffixes", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4}
|
||||
sumSuffix := Extend(func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
})
|
||||
result := sumSuffix(input)
|
||||
expected := []int{10, 9, 7, 4} // [1+2+3+4, 2+3+4, 3+4, 4]
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with length of suffixes", func(t *testing.T) {
|
||||
input := []int{10, 20, 30}
|
||||
lengths := Extend(Size[int])
|
||||
result := lengths(input)
|
||||
expected := []int{3, 2, 1}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with head extraction", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
duplicate := Extend(func(as []int) int {
|
||||
return F.Pipe2(as, Head[int], O.GetOrElse(F.Constant(0)))
|
||||
})
|
||||
result := duplicate(input)
|
||||
expected := []int{1, 2, 3}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with empty array", func(t *testing.T) {
|
||||
input := []int{}
|
||||
result := Extend(Size[int])(input)
|
||||
assert.Equal(t, []int{}, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with single element", func(t *testing.T) {
|
||||
input := []string{"hello"}
|
||||
result := Extend(func(as []string) int { return len(as) })(input)
|
||||
expected := []int{1}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend does not modify original array", func(t *testing.T) {
|
||||
original := []int{1, 2, 3}
|
||||
originalCopy := []int{1, 2, 3}
|
||||
_ = Extend(Size[int])(original)
|
||||
assert.Equal(t, originalCopy, original)
|
||||
})
|
||||
|
||||
t.Run("Extend with string concatenation", func(t *testing.T) {
|
||||
input := []string{"a", "b", "c"}
|
||||
concat := Extend(func(as []string) string {
|
||||
return MonadReduce(as, func(acc, s string) string { return acc + s }, "")
|
||||
})
|
||||
result := concat(input)
|
||||
expected := []string{"abc", "bc", "c"}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with max of suffixes", func(t *testing.T) {
|
||||
input := []int{3, 1, 4, 1, 5}
|
||||
maxSuffix := Extend(func(as []int) int {
|
||||
if len(as) == 0 {
|
||||
return 0
|
||||
}
|
||||
max := as[0]
|
||||
for _, v := range as[1:] {
|
||||
if v > max {
|
||||
max = v
|
||||
}
|
||||
}
|
||||
return max
|
||||
})
|
||||
result := maxSuffix(input)
|
||||
expected := []int{5, 5, 5, 5, 5}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendComonadLaws tests comonad laws for Extend
|
||||
func TestExtendComonadLaws(t *testing.T) {
|
||||
t.Run("Left identity: Extend(Extract) == Identity", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5}
|
||||
result := Extend(Extract[int])(input)
|
||||
assert.Equal(t, input, result)
|
||||
})
|
||||
|
||||
t.Run("Right identity: Extract ∘ Extend(f) == f", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4}
|
||||
f := func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}
|
||||
|
||||
// Extract(Extend(f)(input)) should equal f(input)
|
||||
result := F.Pipe2(input, Extend(f), Extract[int])
|
||||
expected := f(input)
|
||||
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Associativity: Extend(f) ∘ Extend(g) == Extend(f ∘ Extend(g))", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
|
||||
// f: sum of array
|
||||
f := func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}
|
||||
|
||||
// g: length of array
|
||||
g := func(as []int) int {
|
||||
return len(as)
|
||||
}
|
||||
|
||||
// Left side: Extend(f) ∘ Extend(g)
|
||||
left := F.Pipe2(input, Extend(g), Extend(f))
|
||||
|
||||
// Right side: Extend(f ∘ Extend(g))
|
||||
right := Extend(func(as []int) int {
|
||||
return f(Extend(g)(as))
|
||||
})(input)
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendComposition tests Extend with other array operations
|
||||
func TestExtendComposition(t *testing.T) {
|
||||
t.Run("Extend after Map", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
result := F.Pipe2(
|
||||
input,
|
||||
Map(N.Mul(2)),
|
||||
Extend(func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}),
|
||||
)
|
||||
expected := []int{12, 10, 6} // [2+4+6, 4+6, 6]
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Map after Extend", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
result := F.Pipe2(
|
||||
input,
|
||||
Extend(Size[int]),
|
||||
Map(N.Mul(10)),
|
||||
)
|
||||
expected := []int{30, 20, 10}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with Filter", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5, 6}
|
||||
result := F.Pipe2(
|
||||
input,
|
||||
Filter(func(n int) bool { return n%2 == 0 }),
|
||||
Extend(Size[int]),
|
||||
)
|
||||
expected := []int{3, 2, 1} // lengths of [2,4,6], [4,6], [6]
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendUseCases demonstrates practical use cases for Extend
|
||||
func TestExtendUseCases(t *testing.T) {
|
||||
t.Run("Running sum (cumulative sum from each position)", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5}
|
||||
runningSum := Extend(func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
})
|
||||
result := runningSum(input)
|
||||
expected := []int{15, 14, 12, 9, 5}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Sliding window average", func(t *testing.T) {
|
||||
input := []float64{1.0, 2.0, 3.0, 4.0, 5.0}
|
||||
windowAvg := Extend(func(as []float64) float64 {
|
||||
if len(as) == 0 {
|
||||
return 0
|
||||
}
|
||||
sum := MonadReduce(as, func(acc, x float64) float64 { return acc + x }, 0.0)
|
||||
return sum / float64(len(as))
|
||||
})
|
||||
result := windowAvg(input)
|
||||
expected := []float64{3.0, 3.5, 4.0, 4.5, 5.0}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Check if suffix is sorted", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 2, 1}
|
||||
isSorted := Extend(func(as []int) bool {
|
||||
for i := 1; i < len(as); i++ {
|
||||
if as[i] < as[i-1] {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
})
|
||||
result := isSorted(input)
|
||||
expected := []bool{false, false, false, false, true}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Count remaining elements", func(t *testing.T) {
|
||||
events := []string{"start", "middle", "end"}
|
||||
remaining := Extend(Size[string])
|
||||
result := remaining(events)
|
||||
expected := []int{3, 2, 1}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
@@ -375,3 +375,102 @@ func Prepend[ENDO ~func(AS) AS, AS []A, A any](head A) ENDO {
|
||||
func Reverse[GT ~[]T, T any](as GT) GT {
|
||||
return array.Reverse(as)
|
||||
}
|
||||
|
||||
// Extract returns the first element of an array, or a zero value if empty.
|
||||
// This is the comonad extract operation for arrays.
|
||||
//
|
||||
// Extract is the dual of the monadic return/of operation. While Of wraps a value
|
||||
// in a context, Extract unwraps a value from its context.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - GA: The array type constraint
|
||||
// - A: The type of elements in the array
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input array
|
||||
//
|
||||
// Returns:
|
||||
// - The first element if the array is non-empty, otherwise the zero value of type A
|
||||
//
|
||||
// Behavior:
|
||||
// - Returns as[0] if the array has at least one element
|
||||
// - Returns the zero value of A if the array is empty
|
||||
// - Does not modify the input array
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// result := Extract([]int{1, 2, 3})
|
||||
// // result: 1
|
||||
//
|
||||
// Example with empty array:
|
||||
//
|
||||
// result := Extract([]int{})
|
||||
// // result: 0 (zero value for int)
|
||||
//
|
||||
// Comonad laws:
|
||||
// - Extract ∘ Of == Identity (extracting from a singleton returns the value)
|
||||
// - Extract ∘ Extend(f) == f (extract after extend equals applying f)
|
||||
//
|
||||
//go:inline
|
||||
func Extract[GA ~[]A, A any](as GA) A {
|
||||
if len(as) > 0 {
|
||||
return as[0]
|
||||
}
|
||||
var zero A
|
||||
return zero
|
||||
}
|
||||
|
||||
// Extend applies a function to every suffix of an array, creating a new array of results.
|
||||
// This is the comonad extend operation for arrays.
|
||||
//
|
||||
// The function f is applied to progressively smaller suffixes of the input array:
|
||||
// - f(as[0:]) for the first element
|
||||
// - f(as[1:]) for the second element
|
||||
// - f(as[2:]) for the third element
|
||||
// - and so on...
|
||||
//
|
||||
// Type Parameters:
|
||||
// - GA: The input array type constraint
|
||||
// - GB: The output array type constraint
|
||||
// - A: The type of elements in the input array
|
||||
// - B: The type of elements in the output array
|
||||
//
|
||||
// Parameters:
|
||||
// - f: A function that takes an array suffix and returns a value
|
||||
//
|
||||
// Returns:
|
||||
// - A function that transforms an array of A into an array of B
|
||||
//
|
||||
// Behavior:
|
||||
// - Creates a new array with the same length as the input
|
||||
// - For each position i, applies f to the suffix starting at i
|
||||
// - Returns an empty array if the input is empty
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Sum all elements from current position to end
|
||||
// sumSuffix := Extend[[]int, []int](func(as []int) int {
|
||||
// return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
// })
|
||||
// result := sumSuffix([]int{1, 2, 3, 4})
|
||||
// // result: []int{10, 9, 7, 4}
|
||||
// // Explanation: [1+2+3+4, 2+3+4, 3+4, 4]
|
||||
//
|
||||
// Example with length:
|
||||
//
|
||||
// // Get remaining length at each position
|
||||
// lengths := Extend[[]int, []int](Size[[]int, int])
|
||||
// result := lengths([]int{10, 20, 30})
|
||||
// // result: []int{3, 2, 1}
|
||||
//
|
||||
// Comonad laws:
|
||||
// - Left identity: Extend(Extract) == Identity
|
||||
// - Right identity: Extract ∘ Extend(f) == f
|
||||
// - Associativity: Extend(f) ∘ Extend(g) == Extend(f ∘ Extend(g))
|
||||
//
|
||||
//go:inline
|
||||
func Extend[GA ~[]A, GB ~[]B, A, B any](f func(GA) B) func(GA) GB {
|
||||
return func(as GA) GB {
|
||||
return MakeBy[GB](len(as), func(i int) B { return f(as[i:]) })
|
||||
}
|
||||
}
|
||||
|
||||
298
v2/array/generic/array_test.go
Normal file
298
v2/array/generic/array_test.go
Normal file
@@ -0,0 +1,298 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package generic
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestExtract tests the Extract function
|
||||
func TestExtract(t *testing.T) {
|
||||
t.Run("Extract from non-empty array", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, 1, result)
|
||||
})
|
||||
|
||||
t.Run("Extract from single element array", func(t *testing.T) {
|
||||
input := []string{"hello"}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, "hello", result)
|
||||
})
|
||||
|
||||
t.Run("Extract from empty array returns zero value", func(t *testing.T) {
|
||||
input := []int{}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, 0, result)
|
||||
})
|
||||
|
||||
t.Run("Extract from empty string array returns empty string", func(t *testing.T) {
|
||||
input := []string{}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, "", result)
|
||||
})
|
||||
|
||||
t.Run("Extract does not modify original array", func(t *testing.T) {
|
||||
original := []int{1, 2, 3}
|
||||
originalCopy := []int{1, 2, 3}
|
||||
_ = Extract(original)
|
||||
assert.Equal(t, originalCopy, original)
|
||||
})
|
||||
|
||||
t.Run("Extract with floats", func(t *testing.T) {
|
||||
input := []float64{3.14, 2.71, 1.41}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, 3.14, result)
|
||||
})
|
||||
|
||||
t.Run("Extract with custom slice type", func(t *testing.T) {
|
||||
type IntSlice []int
|
||||
input := IntSlice{10, 20, 30}
|
||||
result := Extract(input)
|
||||
assert.Equal(t, 10, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtractComonadLaws tests comonad laws for Extract
|
||||
func TestExtractComonadLaws(t *testing.T) {
|
||||
t.Run("Extract ∘ Of == Identity", func(t *testing.T) {
|
||||
value := 42
|
||||
result := Extract(Of[[]int](value))
|
||||
assert.Equal(t, value, result)
|
||||
})
|
||||
|
||||
t.Run("Extract ∘ Extend(f) == f", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4}
|
||||
f := func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}
|
||||
|
||||
// Extract(Extend(f)(input)) should equal f(input)
|
||||
extended := Extend[[]int, []int](f)(input)
|
||||
result := Extract(extended)
|
||||
expected := f(input)
|
||||
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtend tests the Extend function
|
||||
func TestExtend(t *testing.T) {
|
||||
t.Run("Extend with sum of suffixes", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4}
|
||||
sumSuffix := Extend[[]int, []int](func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
})
|
||||
result := sumSuffix(input)
|
||||
expected := []int{10, 9, 7, 4} // [1+2+3+4, 2+3+4, 3+4, 4]
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with length of suffixes", func(t *testing.T) {
|
||||
input := []int{10, 20, 30}
|
||||
lengths := Extend[[]int, []int](Size[[]int, int])
|
||||
result := lengths(input)
|
||||
expected := []int{3, 2, 1}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with head extraction", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
duplicate := Extend[[]int, []int](Extract[[]int, int])
|
||||
result := duplicate(input)
|
||||
expected := []int{1, 2, 3}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with empty array", func(t *testing.T) {
|
||||
input := []int{}
|
||||
result := Extend[[]int, []int](Size[[]int, int])(input)
|
||||
assert.Equal(t, []int{}, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with single element", func(t *testing.T) {
|
||||
input := []string{"hello"}
|
||||
result := Extend[[]string, []int](func(as []string) int { return len(as) })(input)
|
||||
expected := []int{1}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend does not modify original array", func(t *testing.T) {
|
||||
original := []int{1, 2, 3}
|
||||
originalCopy := []int{1, 2, 3}
|
||||
_ = Extend[[]int, []int](Size[[]int, int])(original)
|
||||
assert.Equal(t, originalCopy, original)
|
||||
})
|
||||
|
||||
t.Run("Extend with string concatenation", func(t *testing.T) {
|
||||
input := []string{"a", "b", "c"}
|
||||
concat := Extend[[]string, []string](func(as []string) string {
|
||||
return MonadReduce(as, func(acc, s string) string { return acc + s }, "")
|
||||
})
|
||||
result := concat(input)
|
||||
expected := []string{"abc", "bc", "c"}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with custom slice types", func(t *testing.T) {
|
||||
type IntSlice []int
|
||||
type ResultSlice []int
|
||||
input := IntSlice{1, 2, 3}
|
||||
sumSuffix := Extend[IntSlice, ResultSlice](func(as IntSlice) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
})
|
||||
result := sumSuffix(input)
|
||||
expected := ResultSlice{6, 5, 3}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendComonadLaws tests comonad laws for Extend
|
||||
func TestExtendComonadLaws(t *testing.T) {
|
||||
t.Run("Left identity: Extend(Extract) == Identity", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5}
|
||||
result := Extend[[]int, []int](Extract[[]int, int])(input)
|
||||
assert.Equal(t, input, result)
|
||||
})
|
||||
|
||||
t.Run("Right identity: Extract ∘ Extend(f) == f", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4}
|
||||
f := func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}
|
||||
|
||||
// Extract(Extend(f)(input)) should equal f(input)
|
||||
result := F.Pipe2(input, Extend[[]int, []int](f), Extract[[]int, int])
|
||||
expected := f(input)
|
||||
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Associativity: Extend(f) ∘ Extend(g) == Extend(f ∘ Extend(g))", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
|
||||
// f: sum of array
|
||||
f := func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}
|
||||
|
||||
// g: length of array
|
||||
g := func(as []int) int {
|
||||
return len(as)
|
||||
}
|
||||
|
||||
// Left side: Extend(f) ∘ Extend(g)
|
||||
left := F.Pipe2(input, Extend[[]int, []int](g), Extend[[]int, []int](f))
|
||||
|
||||
// Right side: Extend(f ∘ Extend(g))
|
||||
right := Extend[[]int, []int](func(as []int) int {
|
||||
return f(Extend[[]int, []int](g)(as))
|
||||
})(input)
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendComposition tests Extend with other array operations
|
||||
func TestExtendComposition(t *testing.T) {
|
||||
t.Run("Extend after Map", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
result := F.Pipe2(
|
||||
input,
|
||||
Map[[]int, []int](func(x int) int { return x * 2 }),
|
||||
Extend[[]int, []int](func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
}),
|
||||
)
|
||||
expected := []int{12, 10, 6} // [2+4+6, 4+6, 6]
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Map after Extend", func(t *testing.T) {
|
||||
input := []int{1, 2, 3}
|
||||
result := F.Pipe2(
|
||||
input,
|
||||
Extend[[]int, []int](Size[[]int, int]),
|
||||
Map[[]int, []int](func(x int) int { return x * 10 }),
|
||||
)
|
||||
expected := []int{30, 20, 10}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Extend with Filter", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5, 6}
|
||||
result := F.Pipe2(
|
||||
input,
|
||||
Filter[[]int](func(n int) bool { return n%2 == 0 }),
|
||||
Extend[[]int, []int](Size[[]int, int]),
|
||||
)
|
||||
expected := []int{3, 2, 1} // lengths of [2,4,6], [4,6], [6]
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendUseCases demonstrates practical use cases for Extend
|
||||
func TestExtendUseCases(t *testing.T) {
|
||||
t.Run("Running sum (cumulative sum from each position)", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 4, 5}
|
||||
runningSum := Extend[[]int, []int](func(as []int) int {
|
||||
return MonadReduce(as, func(acc, x int) int { return acc + x }, 0)
|
||||
})
|
||||
result := runningSum(input)
|
||||
expected := []int{15, 14, 12, 9, 5}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Sliding window average", func(t *testing.T) {
|
||||
input := []float64{1.0, 2.0, 3.0, 4.0, 5.0}
|
||||
windowAvg := Extend[[]float64, []float64](func(as []float64) float64 {
|
||||
if len(as) == 0 {
|
||||
return 0
|
||||
}
|
||||
sum := MonadReduce(as, func(acc, x float64) float64 { return acc + x }, 0.0)
|
||||
return sum / float64(len(as))
|
||||
})
|
||||
result := windowAvg(input)
|
||||
expected := []float64{3.0, 3.5, 4.0, 4.5, 5.0}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Check if suffix is sorted", func(t *testing.T) {
|
||||
input := []int{1, 2, 3, 2, 1}
|
||||
isSorted := Extend[[]int, []bool](func(as []int) bool {
|
||||
for i := 1; i < len(as); i++ {
|
||||
if as[i] < as[i-1] {
|
||||
return false
|
||||
}
|
||||
}
|
||||
return true
|
||||
})
|
||||
result := isSorted(input)
|
||||
expected := []bool{false, false, false, false, true}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("Count remaining elements", func(t *testing.T) {
|
||||
events := []string{"start", "middle", "end"}
|
||||
remaining := Extend[[]string, []int](Size[[]string, string])
|
||||
result := remaining(events)
|
||||
expected := []int{3, 2, 1}
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
@@ -23,12 +23,45 @@ import (
|
||||
S "github.com/IBM/fp-go/v2/semigroup"
|
||||
)
|
||||
|
||||
// Of constructs a single element array
|
||||
// Of constructs a single element NonEmptyArray.
|
||||
// This is the simplest way to create a NonEmptyArray with exactly one element.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - first: The single element to include in the array
|
||||
//
|
||||
// Returns:
|
||||
// - NonEmptyArray[A]: A NonEmptyArray containing only the provided element
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := Of(42) // NonEmptyArray[int]{42}
|
||||
// str := Of("hello") // NonEmptyArray[string]{"hello"}
|
||||
func Of[A any](first A) NonEmptyArray[A] {
|
||||
return G.Of[NonEmptyArray[A]](first)
|
||||
}
|
||||
|
||||
// From constructs a [NonEmptyArray] from a set of variadic arguments
|
||||
// From constructs a NonEmptyArray from a set of variadic arguments.
|
||||
// The first argument is required to ensure the array is non-empty, and additional
|
||||
// elements can be provided as variadic arguments.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - first: The first element (required to ensure non-emptiness)
|
||||
// - data: Additional elements (optional)
|
||||
//
|
||||
// Returns:
|
||||
// - NonEmptyArray[A]: A NonEmptyArray containing all provided elements
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr1 := From(1) // NonEmptyArray[int]{1}
|
||||
// arr2 := From(1, 2, 3) // NonEmptyArray[int]{1, 2, 3}
|
||||
// arr3 := From("a", "b", "c") // NonEmptyArray[string]{"a", "b", "c"}
|
||||
func From[A any](first A, data ...A) NonEmptyArray[A] {
|
||||
count := len(data)
|
||||
if count == 0 {
|
||||
@@ -41,79 +74,358 @@ func From[A any](first A, data ...A) NonEmptyArray[A] {
|
||||
return buffer
|
||||
}
|
||||
|
||||
// IsEmpty always returns false for NonEmptyArray since it's guaranteed to have at least one element.
|
||||
// This function exists for API consistency with regular arrays.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - _: The NonEmptyArray (unused, as the result is always false)
|
||||
//
|
||||
// Returns:
|
||||
// - bool: Always false
|
||||
//
|
||||
//go:inline
|
||||
func IsEmpty[A any](_ NonEmptyArray[A]) bool {
|
||||
return false
|
||||
}
|
||||
|
||||
// IsNonEmpty always returns true for NonEmptyArray since it's guaranteed to have at least one element.
|
||||
// This function exists for API consistency with regular arrays.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - _: The NonEmptyArray (unused, as the result is always true)
|
||||
//
|
||||
// Returns:
|
||||
// - bool: Always true
|
||||
//
|
||||
//go:inline
|
||||
func IsNonEmpty[A any](_ NonEmptyArray[A]) bool {
|
||||
return true
|
||||
}
|
||||
|
||||
// MonadMap applies a function to each element of a NonEmptyArray, returning a new NonEmptyArray with the results.
|
||||
// This is the monadic version of Map that takes the array as the first parameter.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The input element type
|
||||
// - B: The output element type
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input NonEmptyArray
|
||||
// - f: The function to apply to each element
|
||||
//
|
||||
// Returns:
|
||||
// - NonEmptyArray[B]: A new NonEmptyArray with the transformed elements
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3)
|
||||
// doubled := MonadMap(arr, func(x int) int { return x * 2 }) // NonEmptyArray[int]{2, 4, 6}
|
||||
//
|
||||
//go:inline
|
||||
func MonadMap[A, B any](as NonEmptyArray[A], f func(a A) B) NonEmptyArray[B] {
|
||||
return G.MonadMap[NonEmptyArray[A], NonEmptyArray[B]](as, f)
|
||||
}
|
||||
|
||||
// Map applies a function to each element of a NonEmptyArray, returning a new NonEmptyArray with the results.
|
||||
// This is the curried version that returns a function.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The input element type
|
||||
// - B: The output element type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: The function to apply to each element
|
||||
//
|
||||
// Returns:
|
||||
// - Operator[A, B]: A function that transforms NonEmptyArray[A] to NonEmptyArray[B]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// double := Map(func(x int) int { return x * 2 })
|
||||
// result := double(From(1, 2, 3)) // NonEmptyArray[int]{2, 4, 6}
|
||||
//
|
||||
//go:inline
|
||||
func Map[A, B any](f func(a A) B) Operator[A, B] {
|
||||
return G.Map[NonEmptyArray[A], NonEmptyArray[B]](f)
|
||||
}
|
||||
|
||||
// Reduce applies a function to each element of a NonEmptyArray from left to right,
|
||||
// accumulating a result starting from an initial value.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type of the array
|
||||
// - B: The accumulator type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: The reducer function that takes (accumulator, element) and returns a new accumulator
|
||||
// - initial: The initial value for the accumulator
|
||||
//
|
||||
// Returns:
|
||||
// - func(NonEmptyArray[A]) B: A function that reduces the array to a single value
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// sum := Reduce(func(acc int, x int) int { return acc + x }, 0)
|
||||
// result := sum(From(1, 2, 3, 4)) // 10
|
||||
//
|
||||
// concat := Reduce(func(acc string, x string) string { return acc + x }, "")
|
||||
// result := concat(From("a", "b", "c")) // "abc"
|
||||
func Reduce[A, B any](f func(B, A) B, initial B) func(NonEmptyArray[A]) B {
|
||||
return func(as NonEmptyArray[A]) B {
|
||||
return array.Reduce(as, f, initial)
|
||||
}
|
||||
}
|
||||
|
||||
// ReduceRight applies a function to each element of a NonEmptyArray from right to left,
|
||||
// accumulating a result starting from an initial value.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type of the array
|
||||
// - B: The accumulator type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: The reducer function that takes (element, accumulator) and returns a new accumulator
|
||||
// - initial: The initial value for the accumulator
|
||||
//
|
||||
// Returns:
|
||||
// - func(NonEmptyArray[A]) B: A function that reduces the array to a single value
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// concat := ReduceRight(func(x string, acc string) string { return acc + x }, "")
|
||||
// result := concat(From("a", "b", "c")) // "cba"
|
||||
func ReduceRight[A, B any](f func(A, B) B, initial B) func(NonEmptyArray[A]) B {
|
||||
return func(as NonEmptyArray[A]) B {
|
||||
return array.ReduceRight(as, f, initial)
|
||||
}
|
||||
}
|
||||
|
||||
// Tail returns all elements of a NonEmptyArray except the first one.
|
||||
// Returns an empty slice if the array has only one element.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - []A: A slice containing all elements except the first (may be empty)
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3, 4)
|
||||
// tail := Tail(arr) // []int{2, 3, 4}
|
||||
//
|
||||
// single := From(1)
|
||||
// tail := Tail(single) // []int{}
|
||||
//
|
||||
//go:inline
|
||||
func Tail[A any](as NonEmptyArray[A]) []A {
|
||||
return as[1:]
|
||||
}
|
||||
|
||||
// Head returns the first element of a NonEmptyArray.
|
||||
// This operation is always safe since NonEmptyArray is guaranteed to have at least one element.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - A: The first element
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3)
|
||||
// first := Head(arr) // 1
|
||||
//
|
||||
//go:inline
|
||||
func Head[A any](as NonEmptyArray[A]) A {
|
||||
return as[0]
|
||||
}
|
||||
|
||||
// First returns the first element of a NonEmptyArray.
|
||||
// This is an alias for Head.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - A: The first element
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3)
|
||||
// first := First(arr) // 1
|
||||
//
|
||||
//go:inline
|
||||
func First[A any](as NonEmptyArray[A]) A {
|
||||
return as[0]
|
||||
}
|
||||
|
||||
// Last returns the last element of a NonEmptyArray.
|
||||
// This operation is always safe since NonEmptyArray is guaranteed to have at least one element.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - A: The last element
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3)
|
||||
// last := Last(arr) // 3
|
||||
//
|
||||
//go:inline
|
||||
func Last[A any](as NonEmptyArray[A]) A {
|
||||
return as[len(as)-1]
|
||||
}
|
||||
|
||||
// Size returns the number of elements in a NonEmptyArray.
|
||||
// The result is always at least 1.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - int: The number of elements (always >= 1)
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3)
|
||||
// size := Size(arr) // 3
|
||||
//
|
||||
//go:inline
|
||||
func Size[A any](as NonEmptyArray[A]) int {
|
||||
return G.Size(as)
|
||||
}
|
||||
|
||||
// Flatten flattens a NonEmptyArray of NonEmptyArrays into a single NonEmptyArray.
|
||||
// This operation concatenates all inner arrays into one.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - mma: A NonEmptyArray of NonEmptyArrays
|
||||
//
|
||||
// Returns:
|
||||
// - NonEmptyArray[A]: A flattened NonEmptyArray containing all elements
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// nested := From(From(1, 2), From(3, 4), From(5))
|
||||
// flat := Flatten(nested) // NonEmptyArray[int]{1, 2, 3, 4, 5}
|
||||
func Flatten[A any](mma NonEmptyArray[NonEmptyArray[A]]) NonEmptyArray[A] {
|
||||
return G.Flatten(mma)
|
||||
}
|
||||
|
||||
// MonadChain applies a function that returns a NonEmptyArray to each element and flattens the results.
|
||||
// This is the monadic bind operation (flatMap) that takes the array as the first parameter.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The input element type
|
||||
// - B: The output element type
|
||||
//
|
||||
// Parameters:
|
||||
// - fa: The input NonEmptyArray
|
||||
// - f: A function that takes an element and returns a NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - NonEmptyArray[B]: The flattened result
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3)
|
||||
// result := MonadChain(arr, func(x int) NonEmptyArray[int] {
|
||||
// return From(x, x*10)
|
||||
// }) // NonEmptyArray[int]{1, 10, 2, 20, 3, 30}
|
||||
func MonadChain[A, B any](fa NonEmptyArray[A], f Kleisli[A, B]) NonEmptyArray[B] {
|
||||
return G.MonadChain(fa, f)
|
||||
}
|
||||
|
||||
// Chain applies a function that returns a NonEmptyArray to each element and flattens the results.
|
||||
// This is the curried version of MonadChain.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The input element type
|
||||
// - B: The output element type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: A function that takes an element and returns a NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - Operator[A, B]: A function that transforms NonEmptyArray[A] to NonEmptyArray[B]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// duplicate := Chain(func(x int) NonEmptyArray[int] { return From(x, x) })
|
||||
// result := duplicate(From(1, 2, 3)) // NonEmptyArray[int]{1, 1, 2, 2, 3, 3}
|
||||
func Chain[A, B any](f func(A) NonEmptyArray[B]) Operator[A, B] {
|
||||
return G.Chain[NonEmptyArray[A]](f)
|
||||
}
|
||||
|
||||
// MonadAp applies a NonEmptyArray of functions to a NonEmptyArray of values.
|
||||
// Each function is applied to each value, producing a cartesian product of results.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - B: The output element type
|
||||
// - A: The input element type
|
||||
//
|
||||
// Parameters:
|
||||
// - fab: A NonEmptyArray of functions
|
||||
// - fa: A NonEmptyArray of values
|
||||
//
|
||||
// Returns:
|
||||
// - NonEmptyArray[B]: The result of applying all functions to all values
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// fns := From(func(x int) int { return x * 2 }, func(x int) int { return x + 10 })
|
||||
// vals := From(1, 2)
|
||||
// result := MonadAp(fns, vals) // NonEmptyArray[int]{2, 4, 11, 12}
|
||||
func MonadAp[B, A any](fab NonEmptyArray[func(A) B], fa NonEmptyArray[A]) NonEmptyArray[B] {
|
||||
return G.MonadAp[NonEmptyArray[B]](fab, fa)
|
||||
}
|
||||
|
||||
// Ap applies a NonEmptyArray of functions to a NonEmptyArray of values.
|
||||
// This is the curried version of MonadAp.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - B: The output element type
|
||||
// - A: The input element type
|
||||
//
|
||||
// Parameters:
|
||||
// - fa: A NonEmptyArray of values
|
||||
//
|
||||
// Returns:
|
||||
// - func(NonEmptyArray[func(A) B]) NonEmptyArray[B]: A function that applies functions to the values
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// vals := From(1, 2)
|
||||
// applyTo := Ap[int](vals)
|
||||
// fns := From(func(x int) int { return x * 2 }, func(x int) int { return x + 10 })
|
||||
// result := applyTo(fns) // NonEmptyArray[int]{2, 4, 11, 12}
|
||||
func Ap[B, A any](fa NonEmptyArray[A]) func(NonEmptyArray[func(A) B]) NonEmptyArray[B] {
|
||||
return G.Ap[NonEmptyArray[B], NonEmptyArray[func(A) B]](fa)
|
||||
}
|
||||
@@ -136,7 +448,23 @@ func Fold[A any](s S.Semigroup[A]) func(NonEmptyArray[A]) A {
|
||||
}
|
||||
}
|
||||
|
||||
// Prepend prepends a single value to an array
|
||||
// Prepend prepends a single value to the beginning of a NonEmptyArray.
|
||||
// Returns a new NonEmptyArray with the value at the front.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - head: The value to prepend
|
||||
//
|
||||
// Returns:
|
||||
// - EM.Endomorphism[NonEmptyArray[A]]: A function that prepends the value to a NonEmptyArray
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(2, 3, 4)
|
||||
// prepend1 := Prepend(1)
|
||||
// result := prepend1(arr) // NonEmptyArray[int]{1, 2, 3, 4}
|
||||
func Prepend[A any](head A) EM.Endomorphism[NonEmptyArray[A]] {
|
||||
return array.Prepend[EM.Endomorphism[NonEmptyArray[A]]](head)
|
||||
}
|
||||
@@ -226,3 +554,59 @@ func ToNonEmptyArray[A any](as []A) Option[NonEmptyArray[A]] {
|
||||
}
|
||||
return option.Some(NonEmptyArray[A](as))
|
||||
}
|
||||
|
||||
// Extract returns the first element of a NonEmptyArray.
|
||||
// This is an alias for Head and is part of the Comonad interface.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type
|
||||
//
|
||||
// Parameters:
|
||||
// - as: The input NonEmptyArray
|
||||
//
|
||||
// Returns:
|
||||
// - A: The first element
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3)
|
||||
// first := Extract(arr) // 1
|
||||
//
|
||||
//go:inline
|
||||
func Extract[A any](as NonEmptyArray[A]) A {
|
||||
return Head(as)
|
||||
}
|
||||
|
||||
// Extend applies a function to all suffixes of a NonEmptyArray.
|
||||
// For each position i, it applies the function to the subarray starting at position i.
|
||||
// This is part of the Comonad interface.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The input element type
|
||||
// - B: The output element type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: A function that takes a NonEmptyArray and returns a value
|
||||
//
|
||||
// Returns:
|
||||
// - Operator[A, B]: A function that transforms NonEmptyArray[A] to NonEmptyArray[B]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// arr := From(1, 2, 3, 4)
|
||||
// sumSuffix := Extend(func(xs NonEmptyArray[int]) int {
|
||||
// sum := 0
|
||||
// for _, x := range xs {
|
||||
// sum += x
|
||||
// }
|
||||
// return sum
|
||||
// })
|
||||
// result := sumSuffix(arr) // NonEmptyArray[int]{10, 9, 7, 4}
|
||||
// // [1,2,3,4] -> 10, [2,3,4] -> 9, [3,4] -> 7, [4] -> 4
|
||||
//
|
||||
//go:inline
|
||||
func Extend[A, B any](f func(NonEmptyArray[A]) B) Operator[A, B] {
|
||||
return func(as NonEmptyArray[A]) NonEmptyArray[B] {
|
||||
return G.MakeBy[NonEmptyArray[B]](len(as), func(i int) B { return f(as[i:]) })
|
||||
}
|
||||
}
|
||||
|
||||
@@ -16,10 +16,13 @@
|
||||
package nonempty
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"testing"
|
||||
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
O "github.com/IBM/fp-go/v2/option"
|
||||
STR "github.com/IBM/fp-go/v2/string"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
@@ -368,3 +371,522 @@ func TestToNonEmptyArrayUseCases(t *testing.T) {
|
||||
assert.Equal(t, "default", result2)
|
||||
})
|
||||
}
|
||||
|
||||
// TestOf tests the Of function
|
||||
func TestOf(t *testing.T) {
|
||||
t.Run("Create single element array with int", func(t *testing.T) {
|
||||
arr := Of(42)
|
||||
assert.Equal(t, 1, Size(arr))
|
||||
assert.Equal(t, 42, Head(arr))
|
||||
})
|
||||
|
||||
t.Run("Create single element array with string", func(t *testing.T) {
|
||||
arr := Of("hello")
|
||||
assert.Equal(t, 1, Size(arr))
|
||||
assert.Equal(t, "hello", Head(arr))
|
||||
})
|
||||
|
||||
t.Run("Create single element array with struct", func(t *testing.T) {
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
person := Person{Name: "Alice", Age: 30}
|
||||
arr := Of(person)
|
||||
assert.Equal(t, 1, Size(arr))
|
||||
assert.Equal(t, "Alice", Head(arr).Name)
|
||||
})
|
||||
}
|
||||
|
||||
// TestFrom tests the From function
|
||||
func TestFrom(t *testing.T) {
|
||||
t.Run("Create array with single element", func(t *testing.T) {
|
||||
arr := From(1)
|
||||
assert.Equal(t, 1, Size(arr))
|
||||
assert.Equal(t, 1, Head(arr))
|
||||
})
|
||||
|
||||
t.Run("Create array with multiple elements", func(t *testing.T) {
|
||||
arr := From(1, 2, 3, 4, 5)
|
||||
assert.Equal(t, 5, Size(arr))
|
||||
assert.Equal(t, 1, Head(arr))
|
||||
assert.Equal(t, 5, Last(arr))
|
||||
})
|
||||
|
||||
t.Run("Create array with strings", func(t *testing.T) {
|
||||
arr := From("a", "b", "c")
|
||||
assert.Equal(t, 3, Size(arr))
|
||||
assert.Equal(t, "a", Head(arr))
|
||||
assert.Equal(t, "c", Last(arr))
|
||||
})
|
||||
}
|
||||
|
||||
// TestIsEmpty tests the IsEmpty function
|
||||
func TestIsEmpty(t *testing.T) {
|
||||
t.Run("IsEmpty always returns false", func(t *testing.T) {
|
||||
arr := From(1, 2, 3)
|
||||
assert.False(t, IsEmpty(arr))
|
||||
})
|
||||
|
||||
t.Run("IsEmpty returns false for single element", func(t *testing.T) {
|
||||
arr := Of(1)
|
||||
assert.False(t, IsEmpty(arr))
|
||||
})
|
||||
}
|
||||
|
||||
// TestIsNonEmpty tests the IsNonEmpty function
|
||||
func TestIsNonEmpty(t *testing.T) {
|
||||
t.Run("IsNonEmpty always returns true", func(t *testing.T) {
|
||||
arr := From(1, 2, 3)
|
||||
assert.True(t, IsNonEmpty(arr))
|
||||
})
|
||||
|
||||
t.Run("IsNonEmpty returns true for single element", func(t *testing.T) {
|
||||
arr := Of(1)
|
||||
assert.True(t, IsNonEmpty(arr))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonadMap tests the MonadMap function
|
||||
func TestMonadMap(t *testing.T) {
|
||||
t.Run("Map integers to doubles", func(t *testing.T) {
|
||||
arr := From(1, 2, 3, 4)
|
||||
result := MonadMap(arr, func(x int) int { return x * 2 })
|
||||
assert.Equal(t, 4, Size(result))
|
||||
assert.Equal(t, 2, Head(result))
|
||||
assert.Equal(t, 8, Last(result))
|
||||
})
|
||||
|
||||
t.Run("Map strings to lengths", func(t *testing.T) {
|
||||
arr := From("a", "bb", "ccc")
|
||||
result := MonadMap(arr, func(s string) int { return len(s) })
|
||||
assert.Equal(t, 3, Size(result))
|
||||
assert.Equal(t, 1, Head(result))
|
||||
assert.Equal(t, 3, Last(result))
|
||||
})
|
||||
|
||||
t.Run("Map single element", func(t *testing.T) {
|
||||
arr := Of(5)
|
||||
result := MonadMap(arr, func(x int) int { return x * 10 })
|
||||
assert.Equal(t, 1, Size(result))
|
||||
assert.Equal(t, 50, Head(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMap tests the Map function
|
||||
func TestMap(t *testing.T) {
|
||||
t.Run("Curried map with integers", func(t *testing.T) {
|
||||
double := Map(func(x int) int { return x * 2 })
|
||||
arr := From(1, 2, 3)
|
||||
result := double(arr)
|
||||
assert.Equal(t, 3, Size(result))
|
||||
assert.Equal(t, 2, Head(result))
|
||||
assert.Equal(t, 6, Last(result))
|
||||
})
|
||||
|
||||
t.Run("Curried map with strings", func(t *testing.T) {
|
||||
toUpper := Map(func(s string) string { return s + "!" })
|
||||
arr := From("hello", "world")
|
||||
result := toUpper(arr)
|
||||
assert.Equal(t, 2, Size(result))
|
||||
assert.Equal(t, "hello!", Head(result))
|
||||
assert.Equal(t, "world!", Last(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestReduce tests the Reduce function
|
||||
func TestReduce(t *testing.T) {
|
||||
t.Run("Sum integers", func(t *testing.T) {
|
||||
sum := Reduce(func(acc int, x int) int { return acc + x }, 0)
|
||||
arr := From(1, 2, 3, 4, 5)
|
||||
result := sum(arr)
|
||||
assert.Equal(t, 15, result)
|
||||
})
|
||||
|
||||
t.Run("Concatenate strings", func(t *testing.T) {
|
||||
concat := Reduce(func(acc string, x string) string { return acc + x }, "")
|
||||
arr := From("a", "b", "c")
|
||||
result := concat(arr)
|
||||
assert.Equal(t, "abc", result)
|
||||
})
|
||||
|
||||
t.Run("Product of numbers", func(t *testing.T) {
|
||||
product := Reduce(func(acc int, x int) int { return acc * x }, 1)
|
||||
arr := From(2, 3, 4)
|
||||
result := product(arr)
|
||||
assert.Equal(t, 24, result)
|
||||
})
|
||||
|
||||
t.Run("Reduce single element", func(t *testing.T) {
|
||||
sum := Reduce(func(acc int, x int) int { return acc + x }, 10)
|
||||
arr := Of(5)
|
||||
result := sum(arr)
|
||||
assert.Equal(t, 15, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestReduceRight tests the ReduceRight function
|
||||
func TestReduceRight(t *testing.T) {
|
||||
t.Run("Concatenate strings right to left", func(t *testing.T) {
|
||||
concat := ReduceRight(func(x string, acc string) string { return acc + x }, "")
|
||||
arr := From("a", "b", "c")
|
||||
result := concat(arr)
|
||||
assert.Equal(t, "cba", result)
|
||||
})
|
||||
|
||||
t.Run("Build list right to left", func(t *testing.T) {
|
||||
buildList := ReduceRight(func(x int, acc []int) []int { return append(acc, x) }, []int{})
|
||||
arr := From(1, 2, 3)
|
||||
result := buildList(arr)
|
||||
assert.Equal(t, []int{3, 2, 1}, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestTail tests the Tail function
|
||||
func TestTail(t *testing.T) {
|
||||
t.Run("Get tail of multi-element array", func(t *testing.T) {
|
||||
arr := From(1, 2, 3, 4)
|
||||
tail := Tail(arr)
|
||||
assert.Equal(t, 3, len(tail))
|
||||
assert.Equal(t, []int{2, 3, 4}, tail)
|
||||
})
|
||||
|
||||
t.Run("Get tail of single element array", func(t *testing.T) {
|
||||
arr := Of(1)
|
||||
tail := Tail(arr)
|
||||
assert.Equal(t, 0, len(tail))
|
||||
assert.Equal(t, []int{}, tail)
|
||||
})
|
||||
|
||||
t.Run("Get tail of two element array", func(t *testing.T) {
|
||||
arr := From(1, 2)
|
||||
tail := Tail(arr)
|
||||
assert.Equal(t, 1, len(tail))
|
||||
assert.Equal(t, []int{2}, tail)
|
||||
})
|
||||
}
|
||||
|
||||
// TestHead tests the Head function
|
||||
func TestHead(t *testing.T) {
|
||||
t.Run("Get head of multi-element array", func(t *testing.T) {
|
||||
arr := From(1, 2, 3)
|
||||
head := Head(arr)
|
||||
assert.Equal(t, 1, head)
|
||||
})
|
||||
|
||||
t.Run("Get head of single element array", func(t *testing.T) {
|
||||
arr := Of(42)
|
||||
head := Head(arr)
|
||||
assert.Equal(t, 42, head)
|
||||
})
|
||||
|
||||
t.Run("Get head of string array", func(t *testing.T) {
|
||||
arr := From("first", "second", "third")
|
||||
head := Head(arr)
|
||||
assert.Equal(t, "first", head)
|
||||
})
|
||||
}
|
||||
|
||||
// TestFirst tests the First function
|
||||
func TestFirst(t *testing.T) {
|
||||
t.Run("First is alias for Head", func(t *testing.T) {
|
||||
arr := From(1, 2, 3)
|
||||
assert.Equal(t, Head(arr), First(arr))
|
||||
})
|
||||
|
||||
t.Run("Get first element", func(t *testing.T) {
|
||||
arr := From("a", "b", "c")
|
||||
first := First(arr)
|
||||
assert.Equal(t, "a", first)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLast tests the Last function
|
||||
func TestLast(t *testing.T) {
|
||||
t.Run("Get last of multi-element array", func(t *testing.T) {
|
||||
arr := From(1, 2, 3, 4, 5)
|
||||
last := Last(arr)
|
||||
assert.Equal(t, 5, last)
|
||||
})
|
||||
|
||||
t.Run("Get last of single element array", func(t *testing.T) {
|
||||
arr := Of(42)
|
||||
last := Last(arr)
|
||||
assert.Equal(t, 42, last)
|
||||
})
|
||||
|
||||
t.Run("Get last of string array", func(t *testing.T) {
|
||||
arr := From("first", "second", "third")
|
||||
last := Last(arr)
|
||||
assert.Equal(t, "third", last)
|
||||
})
|
||||
}
|
||||
|
||||
// TestSize tests the Size function
|
||||
func TestSize(t *testing.T) {
|
||||
t.Run("Size of multi-element array", func(t *testing.T) {
|
||||
arr := From(1, 2, 3, 4, 5)
|
||||
size := Size(arr)
|
||||
assert.Equal(t, 5, size)
|
||||
})
|
||||
|
||||
t.Run("Size of single element array", func(t *testing.T) {
|
||||
arr := Of(1)
|
||||
size := Size(arr)
|
||||
assert.Equal(t, 1, size)
|
||||
})
|
||||
|
||||
t.Run("Size of large array", func(t *testing.T) {
|
||||
elements := make([]int, 1000)
|
||||
arr := From(1, elements...)
|
||||
size := Size(arr)
|
||||
assert.Equal(t, 1001, size)
|
||||
})
|
||||
}
|
||||
|
||||
// TestFlatten tests the Flatten function
|
||||
func TestFlatten(t *testing.T) {
|
||||
t.Run("Flatten nested arrays", func(t *testing.T) {
|
||||
nested := From(From(1, 2), From(3, 4), From(5))
|
||||
flat := Flatten(nested)
|
||||
assert.Equal(t, 5, Size(flat))
|
||||
assert.Equal(t, 1, Head(flat))
|
||||
assert.Equal(t, 5, Last(flat))
|
||||
})
|
||||
|
||||
t.Run("Flatten single nested array", func(t *testing.T) {
|
||||
nested := Of(From(1, 2, 3))
|
||||
flat := Flatten(nested)
|
||||
assert.Equal(t, 3, Size(flat))
|
||||
assert.Equal(t, []int{1, 2, 3}, []int(flat))
|
||||
})
|
||||
|
||||
t.Run("Flatten arrays of different sizes", func(t *testing.T) {
|
||||
nested := From(Of(1), From(2, 3, 4), From(5, 6))
|
||||
flat := Flatten(nested)
|
||||
assert.Equal(t, 6, Size(flat))
|
||||
assert.Equal(t, []int{1, 2, 3, 4, 5, 6}, []int(flat))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonadChain tests the MonadChain function
|
||||
func TestMonadChain(t *testing.T) {
|
||||
t.Run("Chain with duplication", func(t *testing.T) {
|
||||
arr := From(1, 2, 3)
|
||||
result := MonadChain(arr, func(x int) NonEmptyArray[int] {
|
||||
return From(x, x*10)
|
||||
})
|
||||
assert.Equal(t, 6, Size(result))
|
||||
assert.Equal(t, []int{1, 10, 2, 20, 3, 30}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Chain with expansion", func(t *testing.T) {
|
||||
arr := From(1, 2)
|
||||
result := MonadChain(arr, func(x int) NonEmptyArray[int] {
|
||||
return From(x, x+1, x+2)
|
||||
})
|
||||
assert.Equal(t, 6, Size(result))
|
||||
assert.Equal(t, []int{1, 2, 3, 2, 3, 4}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Chain single element", func(t *testing.T) {
|
||||
arr := Of(5)
|
||||
result := MonadChain(arr, func(x int) NonEmptyArray[int] {
|
||||
return From(x, x*2)
|
||||
})
|
||||
assert.Equal(t, 2, Size(result))
|
||||
assert.Equal(t, []int{5, 10}, []int(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestChain tests the Chain function
|
||||
func TestChain(t *testing.T) {
|
||||
t.Run("Curried chain with duplication", func(t *testing.T) {
|
||||
duplicate := Chain(func(x int) NonEmptyArray[int] {
|
||||
return From(x, x)
|
||||
})
|
||||
arr := From(1, 2, 3)
|
||||
result := duplicate(arr)
|
||||
assert.Equal(t, 6, Size(result))
|
||||
assert.Equal(t, []int{1, 1, 2, 2, 3, 3}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Curried chain with transformation", func(t *testing.T) {
|
||||
expand := Chain(func(x int) NonEmptyArray[string] {
|
||||
return Of(fmt.Sprintf("%d", x))
|
||||
})
|
||||
arr := From(1, 2, 3)
|
||||
result := expand(arr)
|
||||
assert.Equal(t, 3, Size(result))
|
||||
assert.Equal(t, "1", Head(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonadAp tests the MonadAp function
|
||||
func TestMonadAp(t *testing.T) {
|
||||
t.Run("Apply functions to values", func(t *testing.T) {
|
||||
fns := From(
|
||||
func(x int) int { return x * 2 },
|
||||
func(x int) int { return x + 10 },
|
||||
)
|
||||
vals := From(1, 2)
|
||||
result := MonadAp(fns, vals)
|
||||
assert.Equal(t, 4, Size(result))
|
||||
assert.Equal(t, []int{2, 4, 11, 12}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Apply single function to multiple values", func(t *testing.T) {
|
||||
fns := Of(func(x int) int { return x * 3 })
|
||||
vals := From(1, 2, 3)
|
||||
result := MonadAp(fns, vals)
|
||||
assert.Equal(t, 3, Size(result))
|
||||
assert.Equal(t, []int{3, 6, 9}, []int(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestAp tests the Ap function
|
||||
func TestAp(t *testing.T) {
|
||||
t.Run("Curried apply", func(t *testing.T) {
|
||||
vals := From(1, 2)
|
||||
applyTo := Ap[int](vals)
|
||||
fns := From(
|
||||
func(x int) int { return x * 2 },
|
||||
func(x int) int { return x + 10 },
|
||||
)
|
||||
result := applyTo(fns)
|
||||
assert.Equal(t, 4, Size(result))
|
||||
assert.Equal(t, []int{2, 4, 11, 12}, []int(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestFoldMap tests the FoldMap function
|
||||
func TestFoldMap(t *testing.T) {
|
||||
t.Run("FoldMap with sum semigroup", func(t *testing.T) {
|
||||
sumSemigroup := N.SemigroupSum[int]()
|
||||
arr := From(1, 2, 3, 4)
|
||||
result := FoldMap[int, int](sumSemigroup)(func(x int) int { return x * 2 })(arr)
|
||||
assert.Equal(t, 20, result) // (1*2) + (2*2) + (3*2) + (4*2) = 20
|
||||
})
|
||||
|
||||
t.Run("FoldMap with string concatenation", func(t *testing.T) {
|
||||
concatSemigroup := STR.Semigroup
|
||||
arr := From(1, 2, 3)
|
||||
result := FoldMap[int, string](concatSemigroup)(func(x int) string { return fmt.Sprintf("%d", x) })(arr)
|
||||
assert.Equal(t, "123", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestFold tests the Fold function
|
||||
func TestFold(t *testing.T) {
|
||||
t.Run("Fold with sum semigroup", func(t *testing.T) {
|
||||
sumSemigroup := N.SemigroupSum[int]()
|
||||
arr := From(1, 2, 3, 4, 5)
|
||||
result := Fold(sumSemigroup)(arr)
|
||||
assert.Equal(t, 15, result)
|
||||
})
|
||||
|
||||
t.Run("Fold with string concatenation", func(t *testing.T) {
|
||||
concatSemigroup := STR.Semigroup
|
||||
arr := From("a", "b", "c")
|
||||
result := Fold(concatSemigroup)(arr)
|
||||
assert.Equal(t, "abc", result)
|
||||
})
|
||||
|
||||
t.Run("Fold single element", func(t *testing.T) {
|
||||
sumSemigroup := N.SemigroupSum[int]()
|
||||
arr := Of(42)
|
||||
result := Fold(sumSemigroup)(arr)
|
||||
assert.Equal(t, 42, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestPrepend tests the Prepend function
|
||||
func TestPrepend(t *testing.T) {
|
||||
t.Run("Prepend to multi-element array", func(t *testing.T) {
|
||||
arr := From(2, 3, 4)
|
||||
prepend1 := Prepend(1)
|
||||
result := prepend1(arr)
|
||||
assert.Equal(t, 4, Size(result))
|
||||
assert.Equal(t, 1, Head(result))
|
||||
assert.Equal(t, 4, Last(result))
|
||||
})
|
||||
|
||||
t.Run("Prepend to single element array", func(t *testing.T) {
|
||||
arr := Of(2)
|
||||
prepend1 := Prepend(1)
|
||||
result := prepend1(arr)
|
||||
assert.Equal(t, 2, Size(result))
|
||||
assert.Equal(t, []int{1, 2}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Prepend string", func(t *testing.T) {
|
||||
arr := From("world")
|
||||
prependHello := Prepend("hello")
|
||||
result := prependHello(arr)
|
||||
assert.Equal(t, 2, Size(result))
|
||||
assert.Equal(t, "hello", Head(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtract tests the Extract function
|
||||
func TestExtract(t *testing.T) {
|
||||
t.Run("Extract from multi-element array", func(t *testing.T) {
|
||||
arr := From(1, 2, 3)
|
||||
result := Extract(arr)
|
||||
assert.Equal(t, 1, result)
|
||||
})
|
||||
|
||||
t.Run("Extract from single element array", func(t *testing.T) {
|
||||
arr := Of(42)
|
||||
result := Extract(arr)
|
||||
assert.Equal(t, 42, result)
|
||||
})
|
||||
|
||||
t.Run("Extract is same as Head", func(t *testing.T) {
|
||||
arr := From("a", "b", "c")
|
||||
assert.Equal(t, Head(arr), Extract(arr))
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtend tests the Extend function
|
||||
func TestExtend(t *testing.T) {
|
||||
t.Run("Extend with sum of suffixes", func(t *testing.T) {
|
||||
arr := From(1, 2, 3, 4)
|
||||
sumSuffix := Extend(func(xs NonEmptyArray[int]) int {
|
||||
sum := 0
|
||||
for _, x := range xs {
|
||||
sum += x
|
||||
}
|
||||
return sum
|
||||
})
|
||||
result := sumSuffix(arr)
|
||||
assert.Equal(t, 4, Size(result))
|
||||
assert.Equal(t, []int{10, 9, 7, 4}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Extend with head of suffixes", func(t *testing.T) {
|
||||
arr := From(1, 2, 3)
|
||||
getHeads := Extend(Head[int])
|
||||
result := getHeads(arr)
|
||||
assert.Equal(t, 3, Size(result))
|
||||
assert.Equal(t, []int{1, 2, 3}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Extend with size of suffixes", func(t *testing.T) {
|
||||
arr := From("a", "b", "c", "d")
|
||||
getSizes := Extend(Size[string])
|
||||
result := getSizes(arr)
|
||||
assert.Equal(t, 4, Size(result))
|
||||
assert.Equal(t, []int{4, 3, 2, 1}, []int(result))
|
||||
})
|
||||
|
||||
t.Run("Extend single element", func(t *testing.T) {
|
||||
arr := Of(5)
|
||||
double := Extend(func(xs NonEmptyArray[int]) int {
|
||||
return Head(xs) * 2
|
||||
})
|
||||
result := double(arr)
|
||||
assert.Equal(t, 1, Size(result))
|
||||
assert.Equal(t, 10, Head(result))
|
||||
})
|
||||
}
|
||||
|
||||
@@ -519,6 +519,8 @@ func RunAll(testcases map[string]Reader) Reader {
|
||||
// by providing a function that converts R2 to R1. This allows you to focus a test on a
|
||||
// specific property or subset of a larger data structure.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This is particularly useful when you have an assertion that operates on a specific field
|
||||
// or property, and you want to apply it to a complete object. Instead of extracting the
|
||||
// property and then asserting on it, you can transform the assertion to work directly
|
||||
|
||||
630
v2/circuitbreaker/circuitbreaker.go
Normal file
630
v2/circuitbreaker/circuitbreaker.go
Normal file
@@ -0,0 +1,630 @@
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/either"
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
"github.com/IBM/fp-go/v2/identity"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/ioref"
|
||||
"github.com/IBM/fp-go/v2/lazy"
|
||||
"github.com/IBM/fp-go/v2/optics/lens"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
"github.com/IBM/fp-go/v2/readerio"
|
||||
"github.com/IBM/fp-go/v2/retry"
|
||||
)
|
||||
|
||||
var (
|
||||
canaryRequestLens = lens.MakeLensWithName(
|
||||
func(os openState) bool { return os.canaryRequest },
|
||||
func(os openState, flag bool) openState {
|
||||
os.canaryRequest = flag
|
||||
return os
|
||||
},
|
||||
"openState.CanaryRequest",
|
||||
)
|
||||
|
||||
retryStatusLens = lens.MakeLensWithName(
|
||||
func(os openState) retry.RetryStatus { return os.retryStatus },
|
||||
func(os openState, status retry.RetryStatus) openState {
|
||||
os.retryStatus = status
|
||||
return os
|
||||
},
|
||||
"openState.RetryStatus",
|
||||
)
|
||||
|
||||
resetAtLens = lens.MakeLensWithName(
|
||||
func(os openState) time.Time { return os.resetAt },
|
||||
func(os openState, tm time.Time) openState {
|
||||
os.resetAt = tm
|
||||
return os
|
||||
},
|
||||
"openState.ResetAt",
|
||||
)
|
||||
|
||||
openedAtLens = lens.MakeLensWithName(
|
||||
func(os openState) time.Time { return os.openedAt },
|
||||
func(os openState, tm time.Time) openState {
|
||||
os.openedAt = tm
|
||||
return os
|
||||
},
|
||||
"openState.OpenedAt",
|
||||
)
|
||||
|
||||
createClosedCircuit = either.Right[openState, ClosedState]
|
||||
createOpenCircuit = either.Left[ClosedState, openState]
|
||||
|
||||
// MakeClosedIORef creates an IORef containing a closed circuit breaker state.
|
||||
// It wraps the provided ClosedState in a Right (closed) BreakerState and creates
|
||||
// a mutable reference to it.
|
||||
//
|
||||
// Parameters:
|
||||
// - closedState: The initial closed state configuration
|
||||
//
|
||||
// Returns:
|
||||
// - An IO operation that creates an IORef[BreakerState] initialized to closed state
|
||||
//
|
||||
// Thread Safety: The returned IORef[BreakerState] is thread-safe. It uses atomic
|
||||
// operations for all read/write/modify operations. The BreakerState itself is immutable.
|
||||
MakeClosedIORef = F.Flow2(
|
||||
createClosedCircuit,
|
||||
ioref.MakeIORef,
|
||||
)
|
||||
|
||||
// IsOpen checks if a BreakerState is in the open state.
|
||||
// Returns true if the circuit breaker is open (blocking requests), false otherwise.
|
||||
IsOpen = either.IsLeft[openState, ClosedState]
|
||||
|
||||
// IsClosed checks if a BreakerState is in the closed state.
|
||||
// Returns true if the circuit breaker is closed (allowing requests), false otherwise.
|
||||
IsClosed = either.IsRight[openState, ClosedState]
|
||||
|
||||
// modifyV creates a Reader that sequences an IORef modification operation.
|
||||
// It takes an IORef[BreakerState] and returns a Reader that, when given an endomorphism
|
||||
// (a function from BreakerState to BreakerState), produces an IO operation that modifies
|
||||
// the IORef and returns the new state.
|
||||
//
|
||||
// This is used internally to create state modification operations that can be composed
|
||||
// with other Reader-based operations in the circuit breaker logic.
|
||||
//
|
||||
// Thread Safety: The IORef modification is atomic. Multiple concurrent calls will be
|
||||
// serialized by the IORef's atomic operations.
|
||||
//
|
||||
// Type signature: Reader[IORef[BreakerState], IO[Endomorphism[BreakerState]]]
|
||||
modifyV = reader.Sequence(ioref.Modify[BreakerState])
|
||||
|
||||
initialRetry = retry.DefaultRetryStatus
|
||||
|
||||
// testCircuit sets the canaryRequest flag to true in an openState.
|
||||
// This is used to mark that the circuit breaker is in half-open state,
|
||||
// allowing a single test request (canary) to check if the service has recovered.
|
||||
//
|
||||
// When canaryRequest is true:
|
||||
// - One request is allowed through to test the service
|
||||
// - If the canary succeeds, the circuit closes
|
||||
// - If the canary fails, the circuit remains open with an extended reset time
|
||||
//
|
||||
// Thread Safety: This is a pure function that returns a new openState; it does not
|
||||
// modify its input. Safe for concurrent use.
|
||||
//
|
||||
// Type signature: Endomorphism[openState]
|
||||
testCircuit = canaryRequestLens.Set(true)
|
||||
)
|
||||
|
||||
// makeOpenCircuitFromPolicy creates a function that constructs an openState from a retry policy.
|
||||
// This is a curried function that takes a retry policy and returns a function that takes a retry status
|
||||
// and current time to produce an openState with calculated reset time.
|
||||
//
|
||||
// The function applies the retry policy to determine the next retry delay and calculates
|
||||
// the resetAt time by adding the delay to the current time. If no previous delay exists
|
||||
// (first failure), the resetAt is set to the current time.
|
||||
//
|
||||
// Parameters:
|
||||
// - policy: The retry policy that determines backoff strategy (e.g., exponential backoff)
|
||||
//
|
||||
// Returns:
|
||||
// - A curried function that takes:
|
||||
// 1. rs (retry.RetryStatus): The current retry status containing retry count and previous delay
|
||||
// 2. ct (time.Time): The current time when the circuit is opening
|
||||
// And returns an openState with:
|
||||
// - openedAt: Set to the current time (ct)
|
||||
// - resetAt: Current time plus the delay from the retry policy
|
||||
// - retryStatus: The updated retry status from applying the policy
|
||||
// - canaryRequest: false (will be set to true when reset time is reached)
|
||||
//
|
||||
// Thread Safety: This is a pure function that creates new openState instances.
|
||||
// Safe for concurrent use.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// policy := retry.ExponentialBackoff(1*time.Second, 2.0, 10)
|
||||
// makeOpen := makeOpenCircuitFromPolicy(policy)
|
||||
// openState := makeOpen(retry.DefaultRetryStatus)(time.Now())
|
||||
// // openState.resetAt will be approximately 1 second from now
|
||||
func makeOpenCircuitFromPolicy(policy retry.RetryPolicy) func(rs retry.RetryStatus) func(ct time.Time) openState {
|
||||
|
||||
return func(rs retry.RetryStatus) func(ct time.Time) openState {
|
||||
|
||||
retryStatus := retry.ApplyPolicy(policy, rs)
|
||||
|
||||
return func(ct time.Time) openState {
|
||||
|
||||
resetTime := F.Pipe2(
|
||||
retryStatus,
|
||||
retry.PreviousDelayLens.Get,
|
||||
option.Fold(
|
||||
F.Pipe1(
|
||||
ct,
|
||||
lazy.Of,
|
||||
),
|
||||
ct.Add,
|
||||
),
|
||||
)
|
||||
|
||||
return openState{openedAt: ct, resetAt: resetTime, retryStatus: retryStatus}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// extendOpenCircuitFromMakeCircuit creates a function that extends the open state of a circuit breaker
|
||||
// when a canary request fails. It takes a circuit maker function and returns a function that,
|
||||
// given the current time, produces an endomorphism that updates an openState.
|
||||
//
|
||||
// This function is used when a canary request (test request in half-open state) fails.
|
||||
// It extends the circuit breaker's open period by:
|
||||
// 1. Extracting the current retry status from the open state
|
||||
// 2. Using the makeCircuit function to calculate a new open state with updated retry status
|
||||
// 3. Applying the current time to get the new state
|
||||
// 4. Setting the canaryRequest flag to true to allow another test request later
|
||||
//
|
||||
// Parameters:
|
||||
// - makeCircuit: A function that creates an openState from a retry status and current time.
|
||||
// This is typically created by makeOpenCircuitFromPolicy.
|
||||
//
|
||||
// Returns:
|
||||
// - A curried function that takes:
|
||||
// 1. ct (time.Time): The current time when extending the circuit
|
||||
// And returns an Endomorphism[openState] that:
|
||||
// - Increments the retry count
|
||||
// - Calculates a new resetAt time based on the retry policy (typically with exponential backoff)
|
||||
// - Sets canaryRequest to true for the next test attempt
|
||||
//
|
||||
// Thread Safety: This is a pure function that returns new openState instances.
|
||||
// Safe for concurrent use.
|
||||
//
|
||||
// Usage Context:
|
||||
// - Called when a canary request fails in the half-open state
|
||||
// - Extends the open period with increased backoff delay
|
||||
// - Prepares the circuit for another canary attempt at the new resetAt time
|
||||
func extendOpenCircuitFromMakeCircuit(
|
||||
makeCircuit func(rs retry.RetryStatus) func(ct time.Time) openState,
|
||||
) func(time.Time) Endomorphism[openState] {
|
||||
return func(ct time.Time) Endomorphism[openState] {
|
||||
return F.Flow4(
|
||||
retryStatusLens.Get,
|
||||
makeCircuit,
|
||||
identity.Flap[openState](ct),
|
||||
testCircuit,
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
// isResetTimeExceeded checks if the reset time for an open circuit has been exceeded.
|
||||
// This is used to determine if the circuit breaker should transition from open to half-open state
|
||||
// by allowing a canary request.
|
||||
//
|
||||
// The function returns an option.Kleisli that succeeds (returns Some) only when:
|
||||
// 1. The circuit is not already in canary mode (canaryRequest is false)
|
||||
// 2. The current time is after the resetAt time
|
||||
//
|
||||
// Parameters:
|
||||
// - ct: The current time to compare against the reset time
|
||||
//
|
||||
// Returns:
|
||||
// - An option.Kleisli[openState, openState] that:
|
||||
// - Returns Some(openState) if the reset time has been exceeded and no canary is active
|
||||
// - Returns None if the reset time has not been exceeded or a canary request is already active
|
||||
//
|
||||
// Thread Safety: This is a pure function that does not modify its input.
|
||||
// Safe for concurrent use.
|
||||
//
|
||||
// Usage Context:
|
||||
// - Called when the circuit is open to check if it's time to attempt a canary request
|
||||
// - If this returns Some, the circuit transitions to half-open state (canary mode)
|
||||
// - If this returns None, the circuit remains fully open and requests are blocked
|
||||
func isResetTimeExceeded(ct time.Time) option.Kleisli[openState, openState] {
|
||||
return option.FromPredicate(func(open openState) bool {
|
||||
return !open.canaryRequest && ct.After(resetAtLens.Get(open))
|
||||
})
|
||||
}
|
||||
|
||||
// handleSuccessOnClosed creates a Reader that handles successful requests when the circuit is closed.
|
||||
// This function is used to update the circuit breaker state after a successful operation completes
|
||||
// while the circuit is in the closed state.
|
||||
//
|
||||
// The function takes a Reader that adds a success record to the ClosedState and lifts it to work
|
||||
// with BreakerState by mapping over the Right (closed) side of the Either type. This ensures that
|
||||
// success tracking only affects the closed state and leaves any open state unchanged.
|
||||
//
|
||||
// Parameters:
|
||||
// - addSuccess: A Reader that takes the current time and returns an Endomorphism that updates
|
||||
// the ClosedState by recording a successful operation. This typically increments a success
|
||||
// counter or updates a success history.
|
||||
//
|
||||
// Returns:
|
||||
// - A Reader[time.Time, Endomorphism[BreakerState]] that, when given the current time, produces
|
||||
// an endomorphism that updates the BreakerState by applying the success update to the closed
|
||||
// state (if closed) or leaving the state unchanged (if open).
|
||||
//
|
||||
// Thread Safety: This is a pure function that creates new state instances. The returned
|
||||
// endomorphism is safe for concurrent use as it does not mutate its input.
|
||||
//
|
||||
// Usage Context:
|
||||
// - Called after a successful request completes while the circuit is closed
|
||||
// - Updates success metrics/counters in the ClosedState
|
||||
// - Does not affect the circuit state if it's already open
|
||||
// - Part of the normal operation flow when the circuit breaker is functioning properly
|
||||
func handleSuccessOnClosed(
|
||||
addSuccess Reader[time.Time, Endomorphism[ClosedState]],
|
||||
) Reader[time.Time, Endomorphism[BreakerState]] {
|
||||
return F.Flow2(
|
||||
addSuccess,
|
||||
either.Map[openState],
|
||||
)
|
||||
}
|
||||
|
||||
// handleFailureOnClosed creates a Reader that handles failed requests when the circuit is closed.
|
||||
// This function manages the critical logic for determining whether a failure should cause the
|
||||
// circuit breaker to open (transition from closed to open state).
|
||||
//
|
||||
// The function orchestrates three key operations:
|
||||
// 1. Records the failure in the ClosedState using addError
|
||||
// 2. Checks if the failure threshold has been exceeded using checkClosedState
|
||||
// 3. If threshold exceeded, opens the circuit; otherwise, keeps it closed with updated error count
|
||||
//
|
||||
// The decision flow is:
|
||||
// - Add the error to the closed state's error tracking
|
||||
// - Check if the updated closed state exceeds the failure threshold
|
||||
// - If threshold exceeded (checkClosedState returns None):
|
||||
// - Create a new openState with calculated reset time based on retry policy
|
||||
// - Transition the circuit to open state (Left side of Either)
|
||||
// - If threshold not exceeded (checkClosedState returns Some):
|
||||
// - Keep the circuit closed with the updated error count
|
||||
// - Continue allowing requests through
|
||||
//
|
||||
// Parameters:
|
||||
// - addError: A Reader that takes the current time and returns an Endomorphism that updates
|
||||
// the ClosedState by recording a failed operation. This typically increments an error
|
||||
// counter or adds to an error history.
|
||||
// - checkClosedState: A Reader that takes the current time and returns an option.Kleisli that
|
||||
// validates whether the ClosedState is still within acceptable failure thresholds.
|
||||
// Returns Some(ClosedState) if threshold not exceeded, None if threshold exceeded.
|
||||
// - openCircuit: A Reader that takes the current time and creates a new openState with
|
||||
// appropriate reset time calculated from the retry policy. Used when transitioning to open.
|
||||
//
|
||||
// Returns:
|
||||
// - A Reader[time.Time, Endomorphism[BreakerState]] that, when given the current time, produces
|
||||
// an endomorphism that either:
|
||||
// - Keeps the circuit closed with updated error tracking (if threshold not exceeded)
|
||||
// - Opens the circuit with calculated reset time (if threshold exceeded)
|
||||
//
|
||||
// Thread Safety: This is a pure function that creates new state instances. The returned
|
||||
// endomorphism is safe for concurrent use as it does not mutate its input.
|
||||
//
|
||||
// Usage Context:
|
||||
// - Called after a failed request completes while the circuit is closed
|
||||
// - Implements the core circuit breaker logic for opening the circuit
|
||||
// - Determines when to stop allowing requests through to protect the failing service
|
||||
// - Critical for preventing cascading failures in distributed systems
|
||||
//
|
||||
// State Transition:
|
||||
// - Closed (under threshold) -> Closed (with incremented error count)
|
||||
// - Closed (at/over threshold) -> Open (with reset time for recovery attempt)
|
||||
func handleFailureOnClosed(
|
||||
addError Reader[time.Time, Endomorphism[ClosedState]],
|
||||
checkClosedState Reader[time.Time, option.Kleisli[ClosedState, ClosedState]],
|
||||
openCircuit Reader[time.Time, openState],
|
||||
) Reader[time.Time, Endomorphism[BreakerState]] {
|
||||
return F.Pipe2(
|
||||
F.Pipe1(
|
||||
addError,
|
||||
reader.ApS(reader.Map[ClosedState], checkClosedState),
|
||||
),
|
||||
reader.Chain(F.Flow2(
|
||||
reader.Map[ClosedState](option.Fold(
|
||||
F.Pipe2(
|
||||
openCircuit,
|
||||
reader.Map[time.Time](createOpenCircuit),
|
||||
lazy.Of,
|
||||
),
|
||||
F.Flow2(
|
||||
createClosedCircuit,
|
||||
reader.Of[time.Time],
|
||||
),
|
||||
)),
|
||||
reader.Sequence,
|
||||
)),
|
||||
reader.Map[time.Time](either.Chain[openState, ClosedState, ClosedState]),
|
||||
)
|
||||
}
|
||||
|
||||
func handleErrorOnClosed2[E any](
|
||||
checkError option.Kleisli[E, E],
|
||||
onSuccess Reader[time.Time, Endomorphism[BreakerState]],
|
||||
onFailure Reader[time.Time, Endomorphism[BreakerState]],
|
||||
) reader.Kleisli[time.Time, E, Endomorphism[BreakerState]] {
|
||||
return F.Flow3(
|
||||
checkError,
|
||||
option.MapTo[E](onFailure),
|
||||
option.GetOrElse(lazy.Of(onSuccess)),
|
||||
)
|
||||
}
|
||||
|
||||
func stateModifier(
|
||||
modify io.Kleisli[Endomorphism[BreakerState], BreakerState],
|
||||
) reader.Operator[time.Time, Endomorphism[BreakerState], IO[BreakerState]] {
|
||||
return reader.Map[time.Time](modify)
|
||||
}
|
||||
|
||||
func reportOnClose2(
|
||||
onClosed ReaderIO[time.Time, Void],
|
||||
onOpened ReaderIO[time.Time, Void],
|
||||
) readerio.Operator[time.Time, BreakerState, Void] {
|
||||
return readerio.Chain(either.Fold(
|
||||
reader.Of[openState](onOpened),
|
||||
reader.Of[ClosedState](onClosed),
|
||||
))
|
||||
}
|
||||
|
||||
func applyAndReportClose2(
|
||||
currentTime IO[time.Time],
|
||||
metrics readerio.Operator[time.Time, BreakerState, Void],
|
||||
) func(io.Kleisli[Endomorphism[BreakerState], BreakerState]) func(Reader[time.Time, Endomorphism[BreakerState]]) IO[Void] {
|
||||
return func(modify io.Kleisli[Endomorphism[BreakerState], BreakerState]) func(Reader[time.Time, Endomorphism[BreakerState]]) IO[Void] {
|
||||
return F.Flow3(
|
||||
reader.Map[time.Time](modify),
|
||||
metrics,
|
||||
readerio.ReadIO[Void](currentTime),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
// MakeCircuitBreaker creates a circuit breaker implementation for a higher-kinded type.
|
||||
//
|
||||
// This is a generic circuit breaker factory that works with any monad-like type (HKTT).
|
||||
// It implements the circuit breaker pattern by wrapping operations and managing state transitions
|
||||
// between closed, open, and half-open states based on failure rates and retry policies.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - E: The error type
|
||||
// - T: The success value type
|
||||
// - HKTT: The higher-kinded type representing the computation (e.g., IO[T], ReaderIO[R, T])
|
||||
// - HKTOP: The higher-kinded type for operators (e.g., IO[func(HKTT) HKTT])
|
||||
// - HKTHKTT: The nested higher-kinded type (e.g., IO[IO[T]])
|
||||
//
|
||||
// Parameters:
|
||||
// - left: Constructs an error result in HKTT from an error value
|
||||
// - chainFirstIOK: Chains an IO operation that runs after success, preserving the original value
|
||||
// - chainFirstLeftIOK: Chains an IO operation that runs after error, preserving the original error
|
||||
// - fromIO: Lifts an IO operation into HKTOP
|
||||
// - flap: Applies a value to a function wrapped in a higher-kinded type
|
||||
// - flatten: Flattens nested higher-kinded types (join operation)
|
||||
// - currentTime: IO operation that provides the current time
|
||||
// - closedState: The initial closed state configuration
|
||||
// - makeError: Creates an error from a reset time when the circuit is open
|
||||
// - checkError: Predicate to determine if an error should trigger circuit breaker logic
|
||||
// - policy: Retry policy for determining reset times when circuit opens
|
||||
// - logger: Logging function for circuit breaker events
|
||||
//
|
||||
// Thread Safety: The returned State monad creates operations that are thread-safe when
|
||||
// executed. The IORef[BreakerState] uses atomic operations for all state modifications.
|
||||
// Multiple concurrent requests will be properly serialized at the IORef level.
|
||||
//
|
||||
// Returns:
|
||||
// - A State monad that transforms a pair of (IORef[BreakerState], HKTT) into HKTT,
|
||||
// applying circuit breaker logic to the computation
|
||||
func MakeCircuitBreaker[E, T, HKTT, HKTOP, HKTHKTT any](
|
||||
|
||||
left func(E) HKTT,
|
||||
chainFirstIOK func(io.Kleisli[T, BreakerState]) func(HKTT) HKTT,
|
||||
chainFirstLeftIOK func(io.Kleisli[E, BreakerState]) func(HKTT) HKTT,
|
||||
|
||||
chainFirstIOK2 func(io.Kleisli[Either[E, T], Void]) func(HKTT) HKTT,
|
||||
|
||||
fromIO func(IO[func(HKTT) HKTT]) HKTOP,
|
||||
flap func(HKTT) func(HKTOP) HKTHKTT,
|
||||
flatten func(HKTHKTT) HKTT,
|
||||
|
||||
currentTime IO[time.Time],
|
||||
closedState ClosedState,
|
||||
makeError Reader[time.Time, E],
|
||||
checkError option.Kleisli[E, E],
|
||||
policy retry.RetryPolicy,
|
||||
metrics Metrics,
|
||||
) State[Pair[IORef[BreakerState], HKTT], HKTT] {
|
||||
|
||||
type Operator = func(HKTT) HKTT
|
||||
|
||||
addSuccess := reader.From1(ClosedState.AddSuccess)
|
||||
addError := reader.From1(ClosedState.AddError)
|
||||
checkClosedState := reader.From1(ClosedState.Check)
|
||||
|
||||
closedCircuit := createClosedCircuit(closedState.Empty())
|
||||
makeOpenCircuit := makeOpenCircuitFromPolicy(policy)
|
||||
|
||||
openCircuit := F.Pipe1(
|
||||
initialRetry,
|
||||
makeOpenCircuit,
|
||||
)
|
||||
|
||||
extendOpenCircuit := extendOpenCircuitFromMakeCircuit(makeOpenCircuit)
|
||||
|
||||
failWithError := F.Flow4(
|
||||
resetAtLens.Get,
|
||||
makeError,
|
||||
left,
|
||||
reader.Of[HKTT],
|
||||
)
|
||||
|
||||
handleSuccess2 := handleSuccessOnClosed(addSuccess)
|
||||
handleFailure2 := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
|
||||
handleError2 := handleErrorOnClosed2(checkError, handleSuccess2, handleFailure2)
|
||||
|
||||
metricsClose2 := reportOnClose2(metrics.Accept, metrics.Open)
|
||||
apply2 := applyAndReportClose2(currentTime, metricsClose2)
|
||||
|
||||
onClosed := func(modify io.Kleisli[Endomorphism[BreakerState], BreakerState]) Operator {
|
||||
return chainFirstIOK2(F.Flow2(
|
||||
either.Fold(
|
||||
handleError2,
|
||||
reader.Of[T](handleSuccess2),
|
||||
),
|
||||
apply2(modify),
|
||||
))
|
||||
}
|
||||
|
||||
onCanary := func(modify io.Kleisli[Endomorphism[BreakerState], BreakerState]) Operator {
|
||||
|
||||
handleSuccess := F.Pipe2(
|
||||
closedCircuit,
|
||||
reader.Of[BreakerState],
|
||||
modify,
|
||||
)
|
||||
|
||||
return F.Flow2(
|
||||
// the canary request fails
|
||||
chainFirstLeftIOK(F.Flow2(
|
||||
checkError,
|
||||
option.Fold(
|
||||
// the canary request succeeds, we close the circuit
|
||||
F.Pipe1(
|
||||
handleSuccess,
|
||||
lazy.Of,
|
||||
),
|
||||
// the canary request fails, we extend the circuit
|
||||
F.Pipe1(
|
||||
F.Pipe1(
|
||||
currentTime,
|
||||
io.Chain(func(ct time.Time) IO[BreakerState] {
|
||||
return F.Pipe1(
|
||||
F.Flow2(
|
||||
either.Fold(
|
||||
extendOpenCircuit(ct),
|
||||
F.Pipe1(
|
||||
openCircuit(ct),
|
||||
reader.Of[ClosedState],
|
||||
),
|
||||
),
|
||||
createOpenCircuit,
|
||||
),
|
||||
modify,
|
||||
)
|
||||
}),
|
||||
),
|
||||
reader.Of[E],
|
||||
),
|
||||
),
|
||||
)),
|
||||
// the canary request succeeds, we'll close the circuit
|
||||
chainFirstIOK(F.Pipe1(
|
||||
handleSuccess,
|
||||
reader.Of[T],
|
||||
)),
|
||||
)
|
||||
}
|
||||
|
||||
onOpen := func(ref IORef[BreakerState]) Operator {
|
||||
|
||||
modify := modifyV(ref)
|
||||
|
||||
return F.Pipe3(
|
||||
currentTime,
|
||||
io.Chain(func(ct time.Time) IO[Operator] {
|
||||
return F.Pipe1(
|
||||
ref,
|
||||
ioref.ModifyWithResult(either.Fold(
|
||||
func(open openState) Pair[BreakerState, Operator] {
|
||||
return option.Fold(
|
||||
func() Pair[BreakerState, Operator] {
|
||||
return pair.MakePair(createOpenCircuit(open), failWithError(open))
|
||||
},
|
||||
func(open openState) Pair[BreakerState, Operator] {
|
||||
return pair.MakePair(createOpenCircuit(testCircuit(open)), onCanary(modify))
|
||||
},
|
||||
)(isResetTimeExceeded(ct)(open))
|
||||
},
|
||||
func(closed ClosedState) Pair[BreakerState, Operator] {
|
||||
return pair.MakePair(createClosedCircuit(closed), onClosed(modify))
|
||||
},
|
||||
)),
|
||||
)
|
||||
}),
|
||||
fromIO,
|
||||
func(src HKTOP) Operator {
|
||||
return func(rdr HKTT) HKTT {
|
||||
return F.Pipe2(
|
||||
src,
|
||||
flap(rdr),
|
||||
flatten,
|
||||
)
|
||||
}
|
||||
},
|
||||
)
|
||||
}
|
||||
|
||||
return func(e Pair[IORef[BreakerState], HKTT]) Pair[Pair[IORef[BreakerState], HKTT], HKTT] {
|
||||
return pair.MakePair(e, onOpen(pair.Head(e))(pair.Tail(e)))
|
||||
}
|
||||
}
|
||||
|
||||
// MakeSingletonBreaker creates a singleton circuit breaker operator for a higher-kinded type.
|
||||
//
|
||||
// This function creates a circuit breaker that maintains its own internal state reference.
|
||||
// It's called "singleton" because it creates a single, self-contained circuit breaker instance
|
||||
// with its own IORef for state management. The returned function can be used to wrap
|
||||
// computations with circuit breaker protection.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - HKTT: The higher-kinded type representing the computation (e.g., IO[T], ReaderIO[R, T])
|
||||
//
|
||||
// Parameters:
|
||||
// - cb: The circuit breaker State monad created by MakeCircuitBreaker
|
||||
// - closedState: The initial closed state configuration for the circuit breaker
|
||||
//
|
||||
// Returns:
|
||||
// - A function that wraps a computation (HKTT) with circuit breaker logic.
|
||||
// The circuit breaker state is managed internally and persists across invocations.
|
||||
//
|
||||
// Thread Safety: The returned function is thread-safe. The internal IORef[BreakerState]
|
||||
// uses atomic operations to manage state. Multiple concurrent calls to the returned function
|
||||
// will be properly serialized at the state modification level.
|
||||
//
|
||||
// Example Usage:
|
||||
//
|
||||
// // Create a circuit breaker for IO operations
|
||||
// breaker := MakeSingletonBreaker(
|
||||
// MakeCircuitBreaker(...),
|
||||
// MakeClosedStateCounter(3),
|
||||
// )
|
||||
//
|
||||
// // Use it to wrap operations
|
||||
// protectedOp := breaker(myIOOperation)
|
||||
func MakeSingletonBreaker[HKTT any](
|
||||
cb State[Pair[IORef[BreakerState], HKTT], HKTT],
|
||||
closedState ClosedState,
|
||||
) func(HKTT) HKTT {
|
||||
return F.Flow3(
|
||||
F.Pipe3(
|
||||
closedState,
|
||||
MakeClosedIORef,
|
||||
io.Run,
|
||||
pair.FromHead[HKTT],
|
||||
),
|
||||
cb,
|
||||
pair.Tail,
|
||||
)
|
||||
}
|
||||
951
v2/circuitbreaker/circuitbreaker_test.go
Normal file
951
v2/circuitbreaker/circuitbreaker_test.go
Normal file
@@ -0,0 +1,951 @@
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"sync"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/either"
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/ioref"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/retry"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
type testMetrics struct {
|
||||
accepts int
|
||||
rejects int
|
||||
opens int
|
||||
closes int
|
||||
canary int
|
||||
|
||||
mu sync.Mutex
|
||||
}
|
||||
|
||||
func (m *testMetrics) Accept(_ time.Time) IO[Void] {
|
||||
return func() Void {
|
||||
m.mu.Lock()
|
||||
defer m.mu.Unlock()
|
||||
m.accepts++
|
||||
return function.VOID
|
||||
}
|
||||
}
|
||||
|
||||
func (m *testMetrics) Open(_ time.Time) IO[Void] {
|
||||
return func() Void {
|
||||
m.mu.Lock()
|
||||
defer m.mu.Unlock()
|
||||
m.opens++
|
||||
return function.VOID
|
||||
}
|
||||
}
|
||||
|
||||
func (m *testMetrics) Close(_ time.Time) IO[Void] {
|
||||
return func() Void {
|
||||
m.mu.Lock()
|
||||
defer m.mu.Unlock()
|
||||
m.closes++
|
||||
return function.VOID
|
||||
}
|
||||
}
|
||||
|
||||
func (m *testMetrics) Reject(_ time.Time) IO[Void] {
|
||||
return func() Void {
|
||||
m.mu.Lock()
|
||||
defer m.mu.Unlock()
|
||||
m.rejects++
|
||||
return function.VOID
|
||||
}
|
||||
}
|
||||
|
||||
func (m *testMetrics) Canary(_ time.Time) IO[Void] {
|
||||
return func() Void {
|
||||
m.mu.Lock()
|
||||
defer m.mu.Unlock()
|
||||
m.canary++
|
||||
return function.VOID
|
||||
}
|
||||
}
|
||||
|
||||
// VirtualTimer provides a controllable time source for testing
|
||||
type VirtualTimer struct {
|
||||
mu sync.Mutex
|
||||
current time.Time
|
||||
}
|
||||
|
||||
func NewMockMetrics() Metrics {
|
||||
return &testMetrics{}
|
||||
}
|
||||
|
||||
// NewVirtualTimer creates a new virtual timer starting at the given time
|
||||
func NewVirtualTimer(start time.Time) *VirtualTimer {
|
||||
return &VirtualTimer{current: start}
|
||||
}
|
||||
|
||||
// Now returns the current virtual time
|
||||
func (vt *VirtualTimer) Now() time.Time {
|
||||
vt.mu.Lock()
|
||||
defer vt.mu.Unlock()
|
||||
return vt.current
|
||||
}
|
||||
|
||||
// Advance moves the virtual time forward by the given duration
|
||||
func (vt *VirtualTimer) Advance(d time.Duration) {
|
||||
vt.mu.Lock()
|
||||
defer vt.mu.Unlock()
|
||||
vt.current = vt.current.Add(d)
|
||||
}
|
||||
|
||||
// Set sets the virtual time to a specific value
|
||||
func (vt *VirtualTimer) Set(t time.Time) {
|
||||
vt.mu.Lock()
|
||||
defer vt.mu.Unlock()
|
||||
vt.current = t
|
||||
}
|
||||
|
||||
// TestModifyV tests the modifyV variable
|
||||
func TestModifyV(t *testing.T) {
|
||||
t.Run("modifyV creates a Reader that modifies IORef", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
|
||||
// Create initial state
|
||||
initialState := createClosedCircuit(MakeClosedStateCounter(3))
|
||||
ref := io.Run(ioref.MakeIORef(initialState))
|
||||
|
||||
// Create an endomorphism that opens the circuit
|
||||
now := vt.Now()
|
||||
openState := openState{
|
||||
openedAt: now,
|
||||
resetAt: now.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
endomorphism := func(bs BreakerState) BreakerState {
|
||||
return createOpenCircuit(openState)
|
||||
}
|
||||
|
||||
// Apply modifyV
|
||||
modifyOp := modifyV(ref)
|
||||
result := io.Run(modifyOp(endomorphism))
|
||||
|
||||
// Verify the state was modified
|
||||
assert.True(t, IsOpen(result), "state should be open after modification")
|
||||
})
|
||||
|
||||
t.Run("modifyV returns the new state", func(t *testing.T) {
|
||||
initialState := createClosedCircuit(MakeClosedStateCounter(3))
|
||||
ref := io.Run(ioref.MakeIORef(initialState))
|
||||
|
||||
// Create a simple endomorphism
|
||||
endomorphism := F.Identity[BreakerState]
|
||||
|
||||
modifyOp := modifyV(ref)
|
||||
result := io.Run(modifyOp(endomorphism))
|
||||
|
||||
assert.True(t, IsClosed(result), "state should remain closed")
|
||||
})
|
||||
}
|
||||
|
||||
// TestTestCircuit tests the testCircuit variable
|
||||
func TestTestCircuit(t *testing.T) {
|
||||
t.Run("testCircuit sets canaryRequest to true", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
now := vt.Now()
|
||||
|
||||
openState := openState{
|
||||
openedAt: now,
|
||||
resetAt: now.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
result := testCircuit(openState)
|
||||
|
||||
assert.True(t, result.canaryRequest, "canaryRequest should be set to true")
|
||||
assert.Equal(t, openState.openedAt, result.openedAt, "openedAt should be unchanged")
|
||||
assert.Equal(t, openState.resetAt, result.resetAt, "resetAt should be unchanged")
|
||||
})
|
||||
|
||||
t.Run("testCircuit is idempotent", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
now := vt.Now()
|
||||
|
||||
openState := openState{
|
||||
openedAt: now,
|
||||
resetAt: now.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: true, // already true
|
||||
}
|
||||
|
||||
result := testCircuit(openState)
|
||||
|
||||
assert.True(t, result.canaryRequest, "canaryRequest should remain true")
|
||||
})
|
||||
|
||||
t.Run("testCircuit preserves other fields", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
now := vt.Now()
|
||||
resetTime := now.Add(2 * time.Minute)
|
||||
retryStatus := retry.RetryStatus{
|
||||
IterNumber: 5,
|
||||
PreviousDelay: option.Some(30 * time.Second),
|
||||
}
|
||||
|
||||
openState := openState{
|
||||
openedAt: now,
|
||||
resetAt: resetTime,
|
||||
retryStatus: retryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
result := testCircuit(openState)
|
||||
|
||||
assert.Equal(t, now, result.openedAt, "openedAt should be preserved")
|
||||
assert.Equal(t, resetTime, result.resetAt, "resetAt should be preserved")
|
||||
assert.Equal(t, retryStatus.IterNumber, result.retryStatus.IterNumber, "retryStatus should be preserved")
|
||||
assert.True(t, result.canaryRequest, "canaryRequest should be set to true")
|
||||
})
|
||||
}
|
||||
|
||||
// TestMakeOpenCircuitFromPolicy tests the makeOpenCircuitFromPolicy function
|
||||
func TestMakeOpenCircuitFromPolicy(t *testing.T) {
|
||||
t.Run("creates openState with calculated reset time", func(t *testing.T) {
|
||||
policy := retry.LimitRetries(5)
|
||||
makeOpen := makeOpenCircuitFromPolicy(policy)
|
||||
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
result := makeOpen(retry.DefaultRetryStatus)(currentTime)
|
||||
|
||||
assert.Equal(t, currentTime, result.openedAt, "openedAt should be current time")
|
||||
assert.False(t, result.canaryRequest, "canaryRequest should be false initially")
|
||||
assert.NotNil(t, result.retryStatus, "retryStatus should be set")
|
||||
})
|
||||
|
||||
t.Run("applies retry policy to calculate delay", func(t *testing.T) {
|
||||
// Use exponential backoff policy with limit and cap
|
||||
policy := retry.Monoid.Concat(
|
||||
retry.LimitRetries(10),
|
||||
retry.CapDelay(10*time.Second, retry.ExponentialBackoff(1*time.Second)),
|
||||
)
|
||||
makeOpen := makeOpenCircuitFromPolicy(policy)
|
||||
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// First retry (iter 0)
|
||||
result1 := makeOpen(retry.DefaultRetryStatus)(currentTime)
|
||||
|
||||
// The first delay should be approximately 1 second
|
||||
expectedResetTime1 := currentTime.Add(1 * time.Second)
|
||||
assert.WithinDuration(t, expectedResetTime1, result1.resetAt, 100*time.Millisecond,
|
||||
"first reset time should be ~1 second from now")
|
||||
|
||||
// Second retry (iter 1) - should double
|
||||
result2 := makeOpen(result1.retryStatus)(currentTime)
|
||||
expectedResetTime2 := currentTime.Add(2 * time.Second)
|
||||
assert.WithinDuration(t, expectedResetTime2, result2.resetAt, 100*time.Millisecond,
|
||||
"second reset time should be ~2 seconds from now")
|
||||
})
|
||||
|
||||
t.Run("handles first failure with no previous delay", func(t *testing.T) {
|
||||
policy := retry.LimitRetries(3)
|
||||
makeOpen := makeOpenCircuitFromPolicy(policy)
|
||||
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
result := makeOpen(retry.DefaultRetryStatus)(currentTime)
|
||||
|
||||
// With no previous delay, resetAt should be current time
|
||||
assert.Equal(t, currentTime, result.resetAt, "resetAt should be current time when no previous delay")
|
||||
})
|
||||
|
||||
t.Run("increments retry iteration number", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
policy := retry.LimitRetries(10)
|
||||
makeOpen := makeOpenCircuitFromPolicy(policy)
|
||||
|
||||
currentTime := vt.Now()
|
||||
initialStatus := retry.DefaultRetryStatus
|
||||
|
||||
result := makeOpen(initialStatus)(currentTime)
|
||||
|
||||
assert.Greater(t, result.retryStatus.IterNumber, initialStatus.IterNumber,
|
||||
"retry iteration should be incremented")
|
||||
})
|
||||
|
||||
t.Run("curried function can be partially applied", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
policy := retry.LimitRetries(5)
|
||||
makeOpen := makeOpenCircuitFromPolicy(policy)
|
||||
|
||||
// Partially apply with retry status
|
||||
makeOpenWithStatus := makeOpen(retry.DefaultRetryStatus)
|
||||
|
||||
currentTime := vt.Now()
|
||||
result := makeOpenWithStatus(currentTime)
|
||||
|
||||
assert.NotNil(t, result, "partially applied function should work")
|
||||
assert.Equal(t, currentTime, result.openedAt)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendOpenCircuitFromMakeCircuit tests the extendOpenCircuitFromMakeCircuit function
|
||||
func TestExtendOpenCircuitFromMakeCircuit(t *testing.T) {
|
||||
t.Run("extends open circuit with new retry status", func(t *testing.T) {
|
||||
policy := retry.Monoid.Concat(
|
||||
retry.LimitRetries(10),
|
||||
retry.ExponentialBackoff(1*time.Second),
|
||||
)
|
||||
makeCircuit := makeOpenCircuitFromPolicy(policy)
|
||||
extendCircuit := extendOpenCircuitFromMakeCircuit(makeCircuit)
|
||||
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Create initial open state
|
||||
initialOpen := openState{
|
||||
openedAt: currentTime.Add(-1 * time.Minute),
|
||||
resetAt: currentTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
// Extend the circuit
|
||||
extendOp := extendCircuit(currentTime)
|
||||
result := extendOp(initialOpen)
|
||||
|
||||
assert.True(t, result.canaryRequest, "canaryRequest should be set to true")
|
||||
assert.Greater(t, result.retryStatus.IterNumber, initialOpen.retryStatus.IterNumber,
|
||||
"retry iteration should be incremented")
|
||||
assert.True(t, result.resetAt.After(currentTime), "resetAt should be in the future")
|
||||
})
|
||||
|
||||
t.Run("sets canaryRequest to true for next test", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
policy := retry.LimitRetries(5)
|
||||
makeCircuit := makeOpenCircuitFromPolicy(policy)
|
||||
extendCircuit := extendOpenCircuitFromMakeCircuit(makeCircuit)
|
||||
|
||||
currentTime := vt.Now()
|
||||
initialOpen := openState{
|
||||
openedAt: currentTime.Add(-30 * time.Second),
|
||||
resetAt: currentTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
result := extendCircuit(currentTime)(initialOpen)
|
||||
|
||||
assert.True(t, result.canaryRequest, "canaryRequest must be true after extension")
|
||||
})
|
||||
|
||||
t.Run("applies exponential backoff on successive extensions", func(t *testing.T) {
|
||||
policy := retry.Monoid.Concat(
|
||||
retry.LimitRetries(10),
|
||||
retry.ExponentialBackoff(1*time.Second),
|
||||
)
|
||||
makeCircuit := makeOpenCircuitFromPolicy(policy)
|
||||
extendCircuit := extendOpenCircuitFromMakeCircuit(makeCircuit)
|
||||
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// First extension
|
||||
state1 := openState{
|
||||
openedAt: currentTime,
|
||||
resetAt: currentTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
result1 := extendCircuit(currentTime)(state1)
|
||||
delay1 := result1.resetAt.Sub(currentTime)
|
||||
|
||||
// Second extension (should have longer delay)
|
||||
result2 := extendCircuit(currentTime)(result1)
|
||||
delay2 := result2.resetAt.Sub(currentTime)
|
||||
|
||||
assert.Greater(t, delay2, delay1, "second extension should have longer delay due to exponential backoff")
|
||||
})
|
||||
}
|
||||
|
||||
// TestIsResetTimeExceeded tests the isResetTimeExceeded function
|
||||
func TestIsResetTimeExceeded(t *testing.T) {
|
||||
t.Run("returns Some when reset time is exceeded and no canary active", func(t *testing.T) {
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
resetTime := currentTime.Add(-1 * time.Second) // in the past
|
||||
|
||||
openState := openState{
|
||||
openedAt: currentTime.Add(-1 * time.Minute),
|
||||
resetAt: resetTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
result := isResetTimeExceeded(currentTime)(openState)
|
||||
|
||||
assert.True(t, option.IsSome(result), "should return Some when reset time exceeded")
|
||||
})
|
||||
|
||||
t.Run("returns None when reset time not yet exceeded", func(t *testing.T) {
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
resetTime := currentTime.Add(1 * time.Minute) // in the future
|
||||
|
||||
openState := openState{
|
||||
openedAt: currentTime.Add(-30 * time.Second),
|
||||
resetAt: resetTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
result := isResetTimeExceeded(currentTime)(openState)
|
||||
|
||||
assert.True(t, option.IsNone(result), "should return None when reset time not exceeded")
|
||||
})
|
||||
|
||||
t.Run("returns None when canary request is already active", func(t *testing.T) {
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
resetTime := currentTime.Add(-1 * time.Second) // in the past
|
||||
|
||||
openState := openState{
|
||||
openedAt: currentTime.Add(-1 * time.Minute),
|
||||
resetAt: resetTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: true, // canary already active
|
||||
}
|
||||
|
||||
result := isResetTimeExceeded(currentTime)(openState)
|
||||
|
||||
assert.True(t, option.IsNone(result), "should return None when canary is already active")
|
||||
})
|
||||
|
||||
t.Run("returns Some at exact reset time boundary", func(t *testing.T) {
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
resetTime := currentTime.Add(-1 * time.Nanosecond) // just passed
|
||||
|
||||
openState := openState{
|
||||
openedAt: currentTime.Add(-1 * time.Minute),
|
||||
resetAt: resetTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
result := isResetTimeExceeded(currentTime)(openState)
|
||||
|
||||
assert.True(t, option.IsSome(result), "should return Some when current time is after reset time")
|
||||
})
|
||||
|
||||
t.Run("returns None when current time equals reset time", func(t *testing.T) {
|
||||
currentTime := time.Date(2026, 1, 9, 12, 0, 0, 0, time.UTC)
|
||||
resetTime := currentTime // exactly equal
|
||||
|
||||
openState := openState{
|
||||
openedAt: currentTime.Add(-1 * time.Minute),
|
||||
resetAt: resetTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
|
||||
result := isResetTimeExceeded(currentTime)(openState)
|
||||
|
||||
assert.True(t, option.IsNone(result), "should return None when times are equal (not After)")
|
||||
})
|
||||
}
|
||||
|
||||
// TestHandleSuccessOnClosed tests the handleSuccessOnClosed function
|
||||
func TestHandleSuccessOnClosed(t *testing.T) {
|
||||
t.Run("updates closed state with success when circuit is closed", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
// Create a simple addSuccess reader that increments a counter
|
||||
addSuccess := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddSuccess(ct)
|
||||
}
|
||||
}
|
||||
|
||||
// Create initial closed state
|
||||
initialClosed := MakeClosedStateCounter(3)
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
// Apply handleSuccessOnClosed
|
||||
handler := handleSuccessOnClosed(addSuccess)
|
||||
endomorphism := handler(currentTime)
|
||||
result := endomorphism(initialState)
|
||||
|
||||
// Verify the state is still closed
|
||||
assert.True(t, IsClosed(result), "state should remain closed after success")
|
||||
|
||||
// Verify the closed state was updated
|
||||
closedState := either.Fold(
|
||||
func(openState) ClosedState { return initialClosed },
|
||||
F.Identity[ClosedState],
|
||||
)(result)
|
||||
// The success should have been recorded (implementation-specific verification)
|
||||
assert.NotNil(t, closedState, "closed state should be present")
|
||||
})
|
||||
|
||||
t.Run("does not affect open state", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
addSuccess := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddSuccess(ct)
|
||||
}
|
||||
}
|
||||
|
||||
// Create initial open state
|
||||
initialOpen := openState{
|
||||
openedAt: currentTime.Add(-1 * time.Minute),
|
||||
resetAt: currentTime.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
initialState := createOpenCircuit(initialOpen)
|
||||
|
||||
// Apply handleSuccessOnClosed
|
||||
handler := handleSuccessOnClosed(addSuccess)
|
||||
endomorphism := handler(currentTime)
|
||||
result := endomorphism(initialState)
|
||||
|
||||
// Verify the state remains open and unchanged
|
||||
assert.True(t, IsOpen(result), "state should remain open")
|
||||
|
||||
// Extract and verify the open state is unchanged
|
||||
openResult := either.Fold(
|
||||
func(os openState) openState { return os },
|
||||
func(ClosedState) openState { return initialOpen },
|
||||
)(result)
|
||||
assert.Equal(t, initialOpen.openedAt, openResult.openedAt, "openedAt should be unchanged")
|
||||
assert.Equal(t, initialOpen.resetAt, openResult.resetAt, "resetAt should be unchanged")
|
||||
assert.Equal(t, initialOpen.canaryRequest, openResult.canaryRequest, "canaryRequest should be unchanged")
|
||||
})
|
||||
|
||||
t.Run("preserves time parameter through reader", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
time1 := vt.Now()
|
||||
vt.Advance(1 * time.Hour)
|
||||
time2 := vt.Now()
|
||||
|
||||
var capturedTime time.Time
|
||||
addSuccess := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
capturedTime = ct
|
||||
return F.Identity[ClosedState]
|
||||
}
|
||||
|
||||
initialClosed := MakeClosedStateCounter(3)
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleSuccessOnClosed(addSuccess)
|
||||
|
||||
// Apply with time1
|
||||
endomorphism1 := handler(time1)
|
||||
endomorphism1(initialState)
|
||||
assert.Equal(t, time1, capturedTime, "should pass time1 to addSuccess")
|
||||
|
||||
// Apply with time2
|
||||
endomorphism2 := handler(time2)
|
||||
endomorphism2(initialState)
|
||||
assert.Equal(t, time2, capturedTime, "should pass time2 to addSuccess")
|
||||
})
|
||||
|
||||
t.Run("composes correctly with multiple successes", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
addSuccess := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddSuccess(ct)
|
||||
}
|
||||
}
|
||||
|
||||
initialClosed := MakeClosedStateCounter(3)
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleSuccessOnClosed(addSuccess)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// Apply multiple times
|
||||
result1 := endomorphism(initialState)
|
||||
result2 := endomorphism(result1)
|
||||
result3 := endomorphism(result2)
|
||||
|
||||
// All should remain closed
|
||||
assert.True(t, IsClosed(result1), "state should remain closed after first success")
|
||||
assert.True(t, IsClosed(result2), "state should remain closed after second success")
|
||||
assert.True(t, IsClosed(result3), "state should remain closed after third success")
|
||||
})
|
||||
}
|
||||
|
||||
// TestHandleFailureOnClosed tests the handleFailureOnClosed function
|
||||
func TestHandleFailureOnClosed(t *testing.T) {
|
||||
t.Run("keeps circuit closed when threshold not exceeded", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
// Create a closed state that allows 3 errors
|
||||
initialClosed := MakeClosedStateCounter(3)
|
||||
|
||||
// addError increments error count
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
// checkClosedState returns Some if under threshold
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
// openCircuit creates an open state (shouldn't be called in this test)
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: ct.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// First error - should stay closed
|
||||
result1 := endomorphism(initialState)
|
||||
assert.True(t, IsClosed(result1), "circuit should remain closed after first error")
|
||||
|
||||
// Second error - should stay closed
|
||||
result2 := endomorphism(result1)
|
||||
assert.True(t, IsClosed(result2), "circuit should remain closed after second error")
|
||||
})
|
||||
|
||||
t.Run("opens circuit when threshold exceeded", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
// Create a closed state that allows only 2 errors (opens at 2nd error)
|
||||
initialClosed := MakeClosedStateCounter(2)
|
||||
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: ct.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// First error - should stay closed (count=1, threshold=2)
|
||||
result1 := endomorphism(initialState)
|
||||
assert.True(t, IsClosed(result1), "circuit should remain closed after first error")
|
||||
|
||||
// Second error - should open (count=2, threshold=2)
|
||||
result2 := endomorphism(result1)
|
||||
assert.True(t, IsOpen(result2), "circuit should open when threshold reached")
|
||||
})
|
||||
|
||||
t.Run("creates open state with correct reset time", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
expectedResetTime := currentTime.Add(5 * time.Minute)
|
||||
|
||||
initialClosed := MakeClosedStateCounter(1) // Opens at 1st error
|
||||
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: expectedResetTime,
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// First error - should open immediately (threshold=1)
|
||||
result1 := endomorphism(initialState)
|
||||
assert.True(t, IsOpen(result1), "circuit should open after first error")
|
||||
|
||||
// Verify the open state has correct reset time
|
||||
resultOpen := either.Fold(
|
||||
func(os openState) openState { return os },
|
||||
func(ClosedState) openState { return openState{} },
|
||||
)(result1)
|
||||
assert.Equal(t, expectedResetTime, resultOpen.resetAt, "reset time should match expected")
|
||||
assert.Equal(t, currentTime, resultOpen.openedAt, "opened time should be current time")
|
||||
})
|
||||
|
||||
t.Run("edge case: zero error threshold", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
// Create a closed state that allows 0 errors (opens immediately)
|
||||
initialClosed := MakeClosedStateCounter(0)
|
||||
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: ct.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// First error should immediately open the circuit
|
||||
result := endomorphism(initialState)
|
||||
assert.True(t, IsOpen(result), "circuit should open immediately with zero threshold")
|
||||
})
|
||||
|
||||
t.Run("edge case: very high error threshold", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
// Create a closed state that allows 1000 errors
|
||||
initialClosed := MakeClosedStateCounter(1000)
|
||||
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: ct.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// Apply many errors
|
||||
result := initialState
|
||||
for i := 0; i < 100; i++ {
|
||||
result = endomorphism(result)
|
||||
}
|
||||
|
||||
// Should still be closed after 100 errors
|
||||
assert.True(t, IsClosed(result), "circuit should remain closed with high threshold")
|
||||
})
|
||||
|
||||
t.Run("preserves time parameter through reader chain", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
time1 := vt.Now()
|
||||
vt.Advance(2 * time.Hour)
|
||||
time2 := vt.Now()
|
||||
|
||||
var capturedAddErrorTime, capturedCheckTime, capturedOpenTime time.Time
|
||||
|
||||
initialClosed := MakeClosedStateCounter(2) // Need 2 errors to open
|
||||
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
capturedAddErrorTime = ct
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
capturedCheckTime = ct
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
capturedOpenTime = ct
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: ct.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
initialState := createClosedCircuit(initialClosed)
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
|
||||
// Apply with time1 - first error, stays closed
|
||||
endomorphism1 := handler(time1)
|
||||
result1 := endomorphism1(initialState)
|
||||
assert.Equal(t, time1, capturedAddErrorTime, "addError should receive time1")
|
||||
assert.Equal(t, time1, capturedCheckTime, "checkClosedState should receive time1")
|
||||
|
||||
// Apply with time2 - second error, should trigger open
|
||||
endomorphism2 := handler(time2)
|
||||
endomorphism2(result1)
|
||||
assert.Equal(t, time2, capturedAddErrorTime, "addError should receive time2")
|
||||
assert.Equal(t, time2, capturedCheckTime, "checkClosedState should receive time2")
|
||||
assert.Equal(t, time2, capturedOpenTime, "openCircuit should receive time2")
|
||||
})
|
||||
|
||||
t.Run("handles transition from closed to open correctly", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
initialClosed := MakeClosedStateCounter(2) // Opens at 2nd error
|
||||
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: ct.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// Start with closed state
|
||||
state := createClosedCircuit(initialClosed)
|
||||
assert.True(t, IsClosed(state), "initial state should be closed")
|
||||
|
||||
// First error - should stay closed (count=1, threshold=2)
|
||||
state = endomorphism(state)
|
||||
assert.True(t, IsClosed(state), "should remain closed after first error")
|
||||
|
||||
// Second error - should open (count=2, threshold=2)
|
||||
state = endomorphism(state)
|
||||
assert.True(t, IsOpen(state), "should open after second error")
|
||||
|
||||
// Verify it's truly open with correct properties
|
||||
resultOpen := either.Fold(
|
||||
func(os openState) openState { return os },
|
||||
func(ClosedState) openState { return openState{} },
|
||||
)(state)
|
||||
assert.False(t, resultOpen.canaryRequest, "canaryRequest should be false initially")
|
||||
assert.Equal(t, currentTime, resultOpen.openedAt, "openedAt should be current time")
|
||||
})
|
||||
|
||||
t.Run("does not affect already open state", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
currentTime := vt.Now()
|
||||
|
||||
addError := func(ct time.Time) Endomorphism[ClosedState] {
|
||||
return func(cs ClosedState) ClosedState {
|
||||
return cs.AddError(ct)
|
||||
}
|
||||
}
|
||||
|
||||
checkClosedState := func(ct time.Time) option.Kleisli[ClosedState, ClosedState] {
|
||||
return func(cs ClosedState) Option[ClosedState] {
|
||||
return cs.Check(ct)
|
||||
}
|
||||
}
|
||||
|
||||
openCircuit := func(ct time.Time) openState {
|
||||
return openState{
|
||||
openedAt: ct,
|
||||
resetAt: ct.Add(1 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: false,
|
||||
}
|
||||
}
|
||||
|
||||
// Start with an already open state
|
||||
existingOpen := openState{
|
||||
openedAt: currentTime.Add(-5 * time.Minute),
|
||||
resetAt: currentTime.Add(5 * time.Minute),
|
||||
retryStatus: retry.DefaultRetryStatus,
|
||||
canaryRequest: true,
|
||||
}
|
||||
initialState := createOpenCircuit(existingOpen)
|
||||
|
||||
handler := handleFailureOnClosed(addError, checkClosedState, openCircuit)
|
||||
endomorphism := handler(currentTime)
|
||||
|
||||
// Apply to open state - should not change it
|
||||
result := endomorphism(initialState)
|
||||
|
||||
assert.True(t, IsOpen(result), "state should remain open")
|
||||
|
||||
// The open state should be unchanged since handleFailureOnClosed
|
||||
// only operates on the Right (closed) side of the Either
|
||||
openResult := either.Fold(
|
||||
func(os openState) openState { return os },
|
||||
func(ClosedState) openState { return openState{} },
|
||||
)(result)
|
||||
assert.Equal(t, existingOpen.openedAt, openResult.openedAt, "openedAt should be unchanged")
|
||||
assert.Equal(t, existingOpen.resetAt, openResult.resetAt, "resetAt should be unchanged")
|
||||
assert.Equal(t, existingOpen.canaryRequest, openResult.canaryRequest, "canaryRequest should be unchanged")
|
||||
})
|
||||
}
|
||||
329
v2/circuitbreaker/closed.go
Normal file
329
v2/circuitbreaker/closed.go
Normal file
@@ -0,0 +1,329 @@
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"slices"
|
||||
"time"
|
||||
|
||||
A "github.com/IBM/fp-go/v2/array"
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
"github.com/IBM/fp-go/v2/optics/lens"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/ord"
|
||||
)
|
||||
|
||||
type (
|
||||
// ClosedState represents the closed state of a circuit breaker.
|
||||
// In the closed state, requests are allowed to pass through, but failures are tracked.
|
||||
// If a failure condition is met, the circuit breaker transitions to an open state.
|
||||
//
|
||||
// # Thread Safety
|
||||
//
|
||||
// All ClosedState implementations MUST be thread-safe. The recommended approach is to
|
||||
// make all methods return new copies rather than modifying the receiver, which provides
|
||||
// automatic thread safety through immutability.
|
||||
//
|
||||
// Implementations should ensure that:
|
||||
// - Empty() returns a new instance with cleared state
|
||||
// - AddError() returns a new instance with the error recorded
|
||||
// - AddSuccess() returns a new instance with success recorded
|
||||
// - Check() does not modify the receiver
|
||||
//
|
||||
// Both provided implementations (closedStateWithErrorCount and closedStateWithHistory)
|
||||
// follow this pattern and are safe for concurrent use.
|
||||
ClosedState interface {
|
||||
// Empty returns a new ClosedState with all tracked failures cleared.
|
||||
// This is used when transitioning back to a closed state from an open state.
|
||||
//
|
||||
// Thread Safety: Returns a new instance; safe for concurrent use.
|
||||
Empty() ClosedState
|
||||
|
||||
// AddError records a failure at the given time.
|
||||
// Returns an updated ClosedState reflecting the recorded failure.
|
||||
//
|
||||
// Thread Safety: Returns a new instance; safe for concurrent use.
|
||||
// The original ClosedState is not modified.
|
||||
AddError(time.Time) ClosedState
|
||||
|
||||
// AddSuccess records a successful request at the given time.
|
||||
// Returns an updated ClosedState reflecting the successful request.
|
||||
//
|
||||
// Thread Safety: Returns a new instance; safe for concurrent use.
|
||||
// The original ClosedState is not modified.
|
||||
AddSuccess(time.Time) ClosedState
|
||||
|
||||
// Check verifies if the circuit breaker should remain closed at the given time.
|
||||
// Returns Some(ClosedState) if the circuit should stay closed,
|
||||
// or None if the circuit should open due to exceeding the failure threshold.
|
||||
//
|
||||
// Thread Safety: Does not modify the receiver; safe for concurrent use.
|
||||
Check(time.Time) Option[ClosedState]
|
||||
}
|
||||
|
||||
// closedStateWithErrorCount is a counter-based implementation of ClosedState.
|
||||
// It tracks the number of consecutive failures and opens the circuit when
|
||||
// the failure count exceeds a configured threshold.
|
||||
//
|
||||
// Thread Safety: This implementation is immutable. All methods return new instances
|
||||
// rather than modifying the receiver, making it safe for concurrent use without locks.
|
||||
closedStateWithErrorCount struct {
|
||||
// checkFailures is a Kleisli arrow that checks if the failure count exceeds the threshold.
|
||||
// Returns Some(count) if threshold is exceeded, None otherwise.
|
||||
checkFailures option.Kleisli[uint, uint]
|
||||
// failureCount tracks the current number of consecutive failures.
|
||||
failureCount uint
|
||||
}
|
||||
|
||||
// closedStateWithHistory is a time-window-based implementation of ClosedState.
|
||||
// It tracks failures within a sliding time window and opens the circuit when
|
||||
// the failure count within the window exceeds a configured threshold.
|
||||
//
|
||||
// Thread Safety: This implementation is immutable. All methods return new instances
|
||||
// with new slices rather than modifying the receiver, making it safe for concurrent
|
||||
// use without locks. The history slice is never modified in place; addToSlice always
|
||||
// creates a new slice.
|
||||
closedStateWithHistory struct {
|
||||
ordTime Ord[time.Time]
|
||||
// maxFailures is the maximum number of failures allowed within the time window.
|
||||
checkFailures option.Kleisli[int, int]
|
||||
timeWindow time.Duration
|
||||
history []time.Time
|
||||
}
|
||||
)
|
||||
|
||||
var (
|
||||
failureCountLens = lens.MakeLensStrictWithName(
|
||||
func(s *closedStateWithErrorCount) uint { return s.failureCount },
|
||||
func(s *closedStateWithErrorCount, c uint) *closedStateWithErrorCount {
|
||||
s.failureCount = c
|
||||
return s
|
||||
},
|
||||
"closeStateWithErrorCount.failureCount",
|
||||
)
|
||||
|
||||
historyLens = lens.MakeLensRefWithName(
|
||||
func(s *closedStateWithHistory) []time.Time { return s.history },
|
||||
func(s *closedStateWithHistory, c []time.Time) *closedStateWithHistory {
|
||||
s.history = c
|
||||
return s
|
||||
},
|
||||
"closedStateWithHistory.history",
|
||||
)
|
||||
|
||||
resetHistory = historyLens.Set(A.Empty[time.Time]())
|
||||
resetFailureCount = failureCountLens.Set(0)
|
||||
incFailureCount = lens.Modify[*closedStateWithErrorCount](N.Add(uint(1)))(failureCountLens)
|
||||
)
|
||||
|
||||
// Empty returns a new closedStateWithErrorCount with the failure count reset to zero.
|
||||
//
|
||||
// Thread Safety: Returns a new instance; the original is not modified.
|
||||
// Safe for concurrent use.
|
||||
func (s *closedStateWithErrorCount) Empty() ClosedState {
|
||||
return resetFailureCount(s)
|
||||
}
|
||||
|
||||
// AddError increments the failure count and returns a new closedStateWithErrorCount.
|
||||
// The time parameter is ignored in this counter-based implementation.
|
||||
//
|
||||
// Thread Safety: Returns a new instance; the original is not modified.
|
||||
// Safe for concurrent use.
|
||||
func (s *closedStateWithErrorCount) AddError(_ time.Time) ClosedState {
|
||||
return incFailureCount(s)
|
||||
}
|
||||
|
||||
// AddSuccess resets the failure count to zero and returns a new closedStateWithErrorCount.
|
||||
// The time parameter is ignored in this counter-based implementation.
|
||||
//
|
||||
// Thread Safety: Returns a new instance; the original is not modified.
|
||||
// Safe for concurrent use.
|
||||
func (s *closedStateWithErrorCount) AddSuccess(_ time.Time) ClosedState {
|
||||
return resetFailureCount(s)
|
||||
}
|
||||
|
||||
// Check verifies if the failure count is below the threshold.
|
||||
// Returns Some(ClosedState) if below threshold, None if at or above threshold.
|
||||
// The time parameter is ignored in this counter-based implementation.
|
||||
//
|
||||
// Thread Safety: Does not modify the receiver; safe for concurrent use.
|
||||
func (s *closedStateWithErrorCount) Check(_ time.Time) Option[ClosedState] {
|
||||
return F.Pipe3(
|
||||
s,
|
||||
failureCountLens.Get,
|
||||
s.checkFailures,
|
||||
option.MapTo[uint](ClosedState(s)),
|
||||
)
|
||||
}
|
||||
|
||||
// MakeClosedStateCounter creates a counter-based ClosedState implementation.
|
||||
// The circuit breaker will open when the number of consecutive failures reaches maxFailures.
|
||||
//
|
||||
// Parameters:
|
||||
// - maxFailures: The threshold for consecutive failures. The circuit opens when
|
||||
// failureCount >= maxFailures (greater than or equal to).
|
||||
//
|
||||
// Returns:
|
||||
// - A ClosedState that tracks failures using a simple counter.
|
||||
//
|
||||
// Example:
|
||||
// - If maxFailures is 3, the circuit will open on the 3rd consecutive failure.
|
||||
// - Each AddError call increments the counter.
|
||||
// - Each AddSuccess call resets the counter to 0 (only consecutive failures count).
|
||||
// - Empty resets the counter to 0.
|
||||
//
|
||||
// Behavior:
|
||||
// - Check returns Some(ClosedState) when failureCount < maxFailures (circuit stays closed)
|
||||
// - Check returns None when failureCount >= maxFailures (circuit should open)
|
||||
// - AddSuccess resets the failure count, so only consecutive failures trigger circuit opening
|
||||
//
|
||||
// Thread Safety: The returned ClosedState is safe for concurrent use. All methods
|
||||
// return new instances rather than modifying the receiver.
|
||||
func MakeClosedStateCounter(maxFailures uint) ClosedState {
|
||||
return &closedStateWithErrorCount{
|
||||
checkFailures: option.FromPredicate(N.LessThan(maxFailures)),
|
||||
}
|
||||
}
|
||||
|
||||
// Empty returns a new closedStateWithHistory with an empty failure history.
|
||||
//
|
||||
// Thread Safety: Returns a new instance with a new empty slice; the original is not modified.
|
||||
// Safe for concurrent use.
|
||||
func (s *closedStateWithHistory) Empty() ClosedState {
|
||||
return resetHistory(s)
|
||||
}
|
||||
|
||||
// addToSlice creates a new sorted slice by adding an item to an existing slice.
|
||||
// This function does not modify the input slice; it creates a new slice with the item added
|
||||
// and returns it in sorted order.
|
||||
//
|
||||
// Parameters:
|
||||
// - o: An Ord instance for comparing time.Time values to determine sort order
|
||||
// - ar: The existing slice of time.Time values (assumed to be sorted)
|
||||
// - item: The new time.Time value to add to the slice
|
||||
//
|
||||
// Returns:
|
||||
// - A new slice containing all elements from ar plus the new item, sorted in ascending order
|
||||
//
|
||||
// Implementation Details:
|
||||
// - Creates a new slice with capacity len(ar)+1
|
||||
// - Copies all elements from ar to the new slice
|
||||
// - Appends the new item
|
||||
// - Sorts the entire slice using the provided Ord comparator
|
||||
//
|
||||
// Thread Safety: This function is pure and does not modify its inputs. It always returns
|
||||
// a new slice, making it safe for concurrent use. This is a key component of the immutable
|
||||
// design of closedStateWithHistory.
|
||||
//
|
||||
// Note: This function is used internally by closedStateWithHistory.AddError to maintain
|
||||
// a sorted history of failure timestamps for efficient binary search operations.
|
||||
func addToSlice(o ord.Ord[time.Time], ar []time.Time, item time.Time) []time.Time {
|
||||
cpy := make([]time.Time, len(ar)+1)
|
||||
cpy[copy(cpy, ar)] = item
|
||||
slices.SortFunc(cpy, o.Compare)
|
||||
return cpy
|
||||
}
|
||||
|
||||
// AddError records a failure at the given time and returns a new closedStateWithHistory.
|
||||
// The new instance contains the failure in its history, with old failures outside the
|
||||
// time window automatically pruned.
|
||||
//
|
||||
// Thread Safety: Returns a new instance with a new history slice; the original is not modified.
|
||||
// Safe for concurrent use. The addToSlice function creates a new slice, ensuring immutability.
|
||||
func (s *closedStateWithHistory) AddError(currentTime time.Time) ClosedState {
|
||||
|
||||
addFailureToHistory := F.Pipe1(
|
||||
historyLens,
|
||||
lens.Modify[*closedStateWithHistory](func(old []time.Time) []time.Time {
|
||||
// oldest valid entry
|
||||
idx, _ := slices.BinarySearchFunc(old, currentTime.Add(-s.timeWindow), s.ordTime.Compare)
|
||||
return addToSlice(s.ordTime, old[idx:], currentTime)
|
||||
}),
|
||||
)
|
||||
|
||||
return addFailureToHistory(s)
|
||||
}
|
||||
|
||||
// AddSuccess purges the entire failure history and returns a new closedStateWithHistory.
|
||||
// The time parameter is ignored; any success clears all tracked failures.
|
||||
//
|
||||
// Thread Safety: Returns a new instance with a new empty slice; the original is not modified.
|
||||
// Safe for concurrent use.
|
||||
func (s *closedStateWithHistory) AddSuccess(_ time.Time) ClosedState {
|
||||
return resetHistory(s)
|
||||
}
|
||||
|
||||
// Check verifies if the number of failures in the history is below the threshold.
|
||||
// Returns Some(ClosedState) if below threshold, None if at or above threshold.
|
||||
// The time parameter is ignored; the check is based on the current history size.
|
||||
//
|
||||
// Thread Safety: Does not modify the receiver; safe for concurrent use.
|
||||
func (s *closedStateWithHistory) Check(_ time.Time) Option[ClosedState] {
|
||||
|
||||
return F.Pipe4(
|
||||
s,
|
||||
historyLens.Get,
|
||||
A.Size,
|
||||
s.checkFailures,
|
||||
option.MapTo[int](ClosedState(s)),
|
||||
)
|
||||
}
|
||||
|
||||
// MakeClosedStateHistory creates a time-window-based ClosedState implementation.
|
||||
// The circuit breaker will open when the number of failures within a sliding time window reaches maxFailures.
|
||||
//
|
||||
// Unlike MakeClosedStateCounter which tracks consecutive failures, this implementation tracks
|
||||
// all failures within a time window. However, any successful request will purge the entire history,
|
||||
// effectively resetting the failure tracking.
|
||||
//
|
||||
// Parameters:
|
||||
// - timeWindow: The duration of the sliding time window. Failures older than this are automatically
|
||||
// discarded from the history when new failures are added.
|
||||
// - maxFailures: The threshold for failures within the time window. The circuit opens when
|
||||
// the number of failures in the window reaches this value (failureCount >= maxFailures).
|
||||
//
|
||||
// Returns:
|
||||
// - A ClosedState that tracks failures using a time-based sliding window.
|
||||
//
|
||||
// Example:
|
||||
// - If timeWindow is 1 minute and maxFailures is 5, the circuit will open when 5 failures
|
||||
// occur within any 1-minute period.
|
||||
// - Failures older than 1 minute are automatically removed from the history when AddError is called.
|
||||
// - Any successful request immediately purges all tracked failures from the history.
|
||||
//
|
||||
// Behavior:
|
||||
// - AddError records the failure timestamp and removes failures outside the time window
|
||||
// (older than currentTime - timeWindow).
|
||||
// - AddSuccess purges the entire failure history (all tracked failures are removed).
|
||||
// - Check returns Some(ClosedState) when failureCount < maxFailures (circuit stays closed).
|
||||
// - Check returns None when failureCount >= maxFailures (circuit should open).
|
||||
// - Empty purges the entire failure history.
|
||||
//
|
||||
// Time Window Management:
|
||||
// - The history is automatically pruned on each AddError call to remove failures older than
|
||||
// currentTime - timeWindow.
|
||||
// - The history is kept sorted by time for efficient binary search and pruning.
|
||||
//
|
||||
// Important Note:
|
||||
// - A successful request resets everything by purging the entire history. This means that
|
||||
// unlike a pure sliding window, a single success will clear all tracked failures, even
|
||||
// those within the time window. This behavior is similar to MakeClosedStateCounter but
|
||||
// with time-based tracking for failures.
|
||||
//
|
||||
// Thread Safety: The returned ClosedState is safe for concurrent use. All methods return
|
||||
// new instances with new slices rather than modifying the receiver. The history slice is
|
||||
// never modified in place.
|
||||
//
|
||||
// Use Cases:
|
||||
// - Systems where a successful request indicates recovery and past failures should be forgotten.
|
||||
// - Rate limiting with success-based reset: Allow bursts of failures but reset on success.
|
||||
// - Hybrid approach: Time-based failure tracking with success-based recovery.
|
||||
func MakeClosedStateHistory(
|
||||
timeWindow time.Duration,
|
||||
maxFailures uint) ClosedState {
|
||||
return &closedStateWithHistory{
|
||||
checkFailures: option.FromPredicate(N.LessThan(int(maxFailures))),
|
||||
ordTime: ord.OrdTime(),
|
||||
history: A.Empty[time.Time](),
|
||||
timeWindow: timeWindow,
|
||||
}
|
||||
}
|
||||
934
v2/circuitbreaker/closed_test.go
Normal file
934
v2/circuitbreaker/closed_test.go
Normal file
@@ -0,0 +1,934 @@
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/ord"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func TestMakeClosedStateCounter(t *testing.T) {
|
||||
t.Run("creates a valid ClosedState", func(t *testing.T) {
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
|
||||
assert.NotNil(t, state, "MakeClosedStateCounter should return a non-nil ClosedState")
|
||||
})
|
||||
|
||||
t.Run("initial state passes Check", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
result := state.Check(now)
|
||||
|
||||
assert.True(t, option.IsSome(result), "initial state should pass Check (return Some, circuit stays closed)")
|
||||
})
|
||||
|
||||
t.Run("Empty resets failure count", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Add some errors
|
||||
state = state.AddError(now)
|
||||
state = state.AddError(now)
|
||||
|
||||
// Reset the state
|
||||
state = state.Empty()
|
||||
|
||||
// Should pass check after reset
|
||||
result := state.Check(now)
|
||||
assert.True(t, option.IsSome(result), "state should pass Check after Empty")
|
||||
})
|
||||
|
||||
t.Run("AddSuccess resets failure count", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
|
||||
// Add errors
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Add success (should reset counter)
|
||||
state = state.AddSuccess(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Add another error (this is now the first consecutive error)
|
||||
state = state.AddError(vt.Now())
|
||||
|
||||
// Should still pass check (only 1 consecutive error, threshold is 3)
|
||||
result := state.Check(vt.Now())
|
||||
assert.True(t, option.IsSome(result), "AddSuccess should reset failure count")
|
||||
})
|
||||
|
||||
t.Run("circuit opens when failures reach threshold", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Add errors up to but not including threshold
|
||||
state = state.AddError(now)
|
||||
state = state.AddError(now)
|
||||
|
||||
// Should still pass before threshold
|
||||
result := state.Check(now)
|
||||
assert.True(t, option.IsSome(result), "should pass Check before threshold")
|
||||
|
||||
// Add one more error to reach threshold
|
||||
state = state.AddError(now)
|
||||
|
||||
// Should fail check at threshold
|
||||
result = state.Check(now)
|
||||
assert.True(t, option.IsNone(result), "should fail Check when reaching threshold")
|
||||
})
|
||||
|
||||
t.Run("circuit opens exactly at maxFailures", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(5)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Add exactly maxFailures - 1 errors
|
||||
for i := uint(0); i < maxFailures-1; i++ {
|
||||
state = state.AddError(now)
|
||||
}
|
||||
|
||||
// Should still pass
|
||||
result := state.Check(now)
|
||||
assert.True(t, option.IsSome(result), "should pass Check before maxFailures")
|
||||
|
||||
// Add one more to reach maxFailures
|
||||
state = state.AddError(now)
|
||||
|
||||
// Should fail now
|
||||
result = state.Check(now)
|
||||
assert.True(t, option.IsNone(result), "should fail Check at maxFailures")
|
||||
})
|
||||
|
||||
t.Run("zero maxFailures means circuit is always open", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(0)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Initial state should already fail (0 >= 0)
|
||||
result := state.Check(now)
|
||||
assert.True(t, option.IsNone(result), "initial state should fail Check with maxFailures=0")
|
||||
|
||||
// Add one error
|
||||
state = state.AddError(now)
|
||||
|
||||
// Should still fail
|
||||
result = state.Check(now)
|
||||
assert.True(t, option.IsNone(result), "should fail Check after error with maxFailures=0")
|
||||
})
|
||||
|
||||
t.Run("AddSuccess resets counter between errors", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
|
||||
// Add errors
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Add success (resets counter)
|
||||
state = state.AddSuccess(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Add more errors
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddError(vt.Now())
|
||||
|
||||
// Should still pass (only 2 consecutive errors after reset)
|
||||
result := state.Check(vt.Now())
|
||||
assert.True(t, option.IsSome(result), "should pass with 2 consecutive errors after reset")
|
||||
|
||||
// Add one more to reach threshold
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddError(vt.Now())
|
||||
|
||||
// Should fail at threshold
|
||||
result = state.Check(vt.Now())
|
||||
assert.True(t, option.IsNone(result), "should fail after reaching threshold")
|
||||
})
|
||||
|
||||
t.Run("Empty can be called multiple times", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Add errors
|
||||
state = state.AddError(now)
|
||||
state = state.AddError(now)
|
||||
state = state.AddError(now)
|
||||
|
||||
// Reset multiple times
|
||||
state = state.Empty()
|
||||
state = state.Empty()
|
||||
state = state.Empty()
|
||||
|
||||
// Should still pass
|
||||
result := state.Check(now)
|
||||
assert.True(t, option.IsSome(result), "state should pass Check after multiple Empty calls")
|
||||
})
|
||||
|
||||
t.Run("time parameter is ignored in counter implementation", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
|
||||
// Use different times for each operation
|
||||
time1 := vt.Now()
|
||||
time2 := time1.Add(1 * time.Hour)
|
||||
|
||||
state = state.AddError(time1)
|
||||
state = state.AddError(time2)
|
||||
|
||||
// Check with yet another time
|
||||
time3 := time1.Add(2 * time.Hour)
|
||||
result := state.Check(time3)
|
||||
|
||||
// Should still pass (2 errors, threshold is 3, not reached yet)
|
||||
assert.True(t, option.IsSome(result), "time parameter should not affect counter behavior")
|
||||
|
||||
// Add one more to reach threshold
|
||||
state = state.AddError(time1)
|
||||
result = state.Check(time1)
|
||||
assert.True(t, option.IsNone(result), "should fail after reaching threshold regardless of time")
|
||||
})
|
||||
|
||||
t.Run("large maxFailures value", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(1000)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Add many errors but not reaching threshold
|
||||
for i := uint(0); i < maxFailures-1; i++ {
|
||||
state = state.AddError(now)
|
||||
}
|
||||
|
||||
// Should still pass
|
||||
result := state.Check(now)
|
||||
assert.True(t, option.IsSome(result), "should pass Check with large maxFailures before threshold")
|
||||
|
||||
// Add one more to reach threshold
|
||||
state = state.AddError(now)
|
||||
|
||||
// Should fail
|
||||
result = state.Check(now)
|
||||
assert.True(t, option.IsNone(result), "should fail Check with large maxFailures at threshold")
|
||||
})
|
||||
|
||||
t.Run("state is immutable - original unchanged after AddError", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(2)
|
||||
originalState := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Create new state by adding error
|
||||
newState := originalState.AddError(now)
|
||||
|
||||
// Original should still pass check
|
||||
result := originalState.Check(now)
|
||||
assert.True(t, option.IsSome(result), "original state should be unchanged")
|
||||
|
||||
// New state should reach threshold (2 errors total, threshold is 2)
|
||||
newState = newState.AddError(now)
|
||||
|
||||
result = newState.Check(now)
|
||||
assert.True(t, option.IsNone(result), "new state should fail after reaching threshold")
|
||||
|
||||
// Original should still pass
|
||||
result = originalState.Check(now)
|
||||
assert.True(t, option.IsSome(result), "original state should still be unchanged")
|
||||
})
|
||||
|
||||
t.Run("state is immutable - original unchanged after Empty", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
now := vt.Now()
|
||||
|
||||
// Add errors to original
|
||||
state = state.AddError(now)
|
||||
state = state.AddError(now)
|
||||
stateWithErrors := state
|
||||
|
||||
// Create new state by calling Empty
|
||||
emptyState := stateWithErrors.Empty()
|
||||
|
||||
// Original with errors should reach threshold (2 errors total, threshold is 2)
|
||||
result := stateWithErrors.Check(now)
|
||||
assert.True(t, option.IsNone(result), "state with errors should fail after reaching threshold")
|
||||
|
||||
// Empty state should pass
|
||||
result = emptyState.Check(now)
|
||||
assert.True(t, option.IsSome(result), "empty state should pass Check")
|
||||
})
|
||||
|
||||
t.Run("AddSuccess prevents circuit from opening", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
|
||||
// Add errors close to threshold
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Add success before reaching threshold
|
||||
state = state.AddSuccess(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Add more errors
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddError(vt.Now())
|
||||
|
||||
// Should still pass (only 2 consecutive errors)
|
||||
result := state.Check(vt.Now())
|
||||
assert.True(t, option.IsSome(result), "circuit should stay closed after success reset")
|
||||
})
|
||||
|
||||
t.Run("multiple AddSuccess calls keep counter at zero", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
|
||||
// Add error
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Multiple successes
|
||||
state = state.AddSuccess(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddSuccess(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddSuccess(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
|
||||
// Should still pass
|
||||
result := state.Check(vt.Now())
|
||||
assert.True(t, option.IsSome(result), "multiple AddSuccess should keep counter at zero")
|
||||
|
||||
// Add errors to reach threshold
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(1 * time.Second)
|
||||
state = state.AddError(vt.Now())
|
||||
|
||||
// Should fail
|
||||
result = state.Check(vt.Now())
|
||||
assert.True(t, option.IsNone(result), "should fail after reaching threshold")
|
||||
})
|
||||
|
||||
t.Run("alternating errors and successes never opens circuit", func(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC))
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateCounter(maxFailures)
|
||||
|
||||
// Alternate errors and successes
|
||||
for i := 0; i < 10; i++ {
|
||||
state = state.AddError(vt.Now())
|
||||
vt.Advance(500 * time.Millisecond)
|
||||
state = state.AddSuccess(vt.Now())
|
||||
vt.Advance(500 * time.Millisecond)
|
||||
}
|
||||
|
||||
// Should still pass (never had consecutive failures)
|
||||
result := state.Check(vt.Now())
|
||||
assert.True(t, option.IsSome(result), "alternating errors and successes should never open circuit")
|
||||
})
|
||||
}
|
||||
|
||||
func TestAddToSlice(t *testing.T) {
|
||||
ordTime := ord.OrdTime()
|
||||
|
||||
t.Run("adds item to empty slice and returns sorted result", func(t *testing.T) {
|
||||
input := []time.Time{}
|
||||
item := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
assert.Len(t, result, 1, "result should have 1 element")
|
||||
assert.Equal(t, item, result[0], "result should contain the added item")
|
||||
})
|
||||
|
||||
t.Run("adds item and maintains sorted order", func(t *testing.T) {
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
input := []time.Time{
|
||||
baseTime,
|
||||
baseTime.Add(20 * time.Second),
|
||||
baseTime.Add(40 * time.Second),
|
||||
}
|
||||
item := baseTime.Add(30 * time.Second)
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
assert.Len(t, result, 4, "result should have 4 elements")
|
||||
// Verify sorted order
|
||||
assert.Equal(t, baseTime, result[0])
|
||||
assert.Equal(t, baseTime.Add(20*time.Second), result[1])
|
||||
assert.Equal(t, baseTime.Add(30*time.Second), result[2])
|
||||
assert.Equal(t, baseTime.Add(40*time.Second), result[3])
|
||||
})
|
||||
|
||||
t.Run("adds item at beginning when it's earliest", func(t *testing.T) {
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
input := []time.Time{
|
||||
baseTime.Add(20 * time.Second),
|
||||
baseTime.Add(40 * time.Second),
|
||||
}
|
||||
item := baseTime
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
assert.Len(t, result, 3, "result should have 3 elements")
|
||||
assert.Equal(t, baseTime, result[0], "earliest item should be first")
|
||||
assert.Equal(t, baseTime.Add(20*time.Second), result[1])
|
||||
assert.Equal(t, baseTime.Add(40*time.Second), result[2])
|
||||
})
|
||||
|
||||
t.Run("adds item at end when it's latest", func(t *testing.T) {
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
input := []time.Time{
|
||||
baseTime,
|
||||
baseTime.Add(20 * time.Second),
|
||||
}
|
||||
item := baseTime.Add(40 * time.Second)
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
assert.Len(t, result, 3, "result should have 3 elements")
|
||||
assert.Equal(t, baseTime, result[0])
|
||||
assert.Equal(t, baseTime.Add(20*time.Second), result[1])
|
||||
assert.Equal(t, baseTime.Add(40*time.Second), result[2], "latest item should be last")
|
||||
})
|
||||
|
||||
t.Run("does not modify original slice", func(t *testing.T) {
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
input := []time.Time{
|
||||
baseTime,
|
||||
baseTime.Add(20 * time.Second),
|
||||
}
|
||||
originalLen := len(input)
|
||||
originalFirst := input[0]
|
||||
originalLast := input[1]
|
||||
item := baseTime.Add(10 * time.Second)
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
// Verify original slice is unchanged
|
||||
assert.Len(t, input, originalLen, "original slice length should be unchanged")
|
||||
assert.Equal(t, originalFirst, input[0], "original slice first element should be unchanged")
|
||||
assert.Equal(t, originalLast, input[1], "original slice last element should be unchanged")
|
||||
|
||||
// Verify result is different and has correct length
|
||||
assert.Len(t, result, 3, "result should have new length")
|
||||
// Verify the result contains the new item in sorted order
|
||||
assert.Equal(t, baseTime, result[0])
|
||||
assert.Equal(t, baseTime.Add(10*time.Second), result[1])
|
||||
assert.Equal(t, baseTime.Add(20*time.Second), result[2])
|
||||
})
|
||||
|
||||
t.Run("handles duplicate timestamps", func(t *testing.T) {
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
input := []time.Time{
|
||||
baseTime,
|
||||
baseTime.Add(20 * time.Second),
|
||||
}
|
||||
item := baseTime // duplicate of first element
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
assert.Len(t, result, 3, "result should have 3 elements including duplicate")
|
||||
// Both instances of baseTime should be present
|
||||
count := 0
|
||||
for _, t := range result {
|
||||
if t.Equal(baseTime) {
|
||||
count++
|
||||
}
|
||||
}
|
||||
assert.Equal(t, 2, count, "should have 2 instances of the duplicate timestamp")
|
||||
})
|
||||
|
||||
t.Run("maintains sort order with unsorted input", func(t *testing.T) {
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
// Input is intentionally unsorted
|
||||
input := []time.Time{
|
||||
baseTime.Add(40 * time.Second),
|
||||
baseTime,
|
||||
baseTime.Add(20 * time.Second),
|
||||
}
|
||||
item := baseTime.Add(30 * time.Second)
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
assert.Len(t, result, 4, "result should have 4 elements")
|
||||
// Verify result is sorted regardless of input order
|
||||
for i := 0; i < len(result)-1; i++ {
|
||||
assert.True(t, result[i].Before(result[i+1]) || result[i].Equal(result[i+1]),
|
||||
"result should be sorted: element %d (%v) should be <= element %d (%v)",
|
||||
i, result[i], i+1, result[i+1])
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("works with nanosecond precision", func(t *testing.T) {
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
input := []time.Time{
|
||||
baseTime,
|
||||
baseTime.Add(2 * time.Nanosecond),
|
||||
}
|
||||
item := baseTime.Add(1 * time.Nanosecond)
|
||||
|
||||
result := addToSlice(ordTime, input, item)
|
||||
|
||||
assert.Len(t, result, 3, "result should have 3 elements")
|
||||
assert.Equal(t, baseTime, result[0])
|
||||
assert.Equal(t, baseTime.Add(1*time.Nanosecond), result[1])
|
||||
assert.Equal(t, baseTime.Add(2*time.Nanosecond), result[2])
|
||||
})
|
||||
}
|
||||
|
||||
func TestMakeClosedStateHistory(t *testing.T) {
|
||||
t.Run("creates a valid ClosedState", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
|
||||
assert.NotNil(t, state, "MakeClosedStateHistory should return a non-nil ClosedState")
|
||||
})
|
||||
|
||||
t.Run("initial state passes Check", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
now := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
result := state.Check(now)
|
||||
|
||||
assert.True(t, option.IsSome(result), "initial state should pass Check (return Some, circuit stays closed)")
|
||||
})
|
||||
|
||||
t.Run("Empty purges failure history", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add some errors
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
|
||||
// Reset the state
|
||||
state = state.Empty()
|
||||
|
||||
// Should pass check after reset
|
||||
result := state.Check(baseTime.Add(20 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "state should pass Check after Empty")
|
||||
})
|
||||
|
||||
t.Run("AddSuccess purges entire failure history", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
|
||||
// Add success (should purge all history)
|
||||
state = state.AddSuccess(baseTime.Add(20 * time.Second))
|
||||
|
||||
// Add another error (this is now the first error in history)
|
||||
state = state.AddError(baseTime.Add(30 * time.Second))
|
||||
|
||||
// Should still pass check (only 1 error in history, threshold is 3)
|
||||
result := state.Check(baseTime.Add(30 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "AddSuccess should purge entire failure history")
|
||||
})
|
||||
|
||||
t.Run("circuit opens when failures reach threshold within time window", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors within time window but not reaching threshold
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
|
||||
// Should still pass before threshold
|
||||
result := state.Check(baseTime.Add(20 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "should pass Check before threshold")
|
||||
|
||||
// Add one more error to reach threshold
|
||||
state = state.AddError(baseTime.Add(30 * time.Second))
|
||||
|
||||
// Should fail check at threshold
|
||||
result = state.Check(baseTime.Add(30 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "should fail Check when reaching threshold")
|
||||
})
|
||||
|
||||
t.Run("old failures outside time window are automatically removed", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors that will be outside the time window
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
|
||||
// Add error after time window has passed (this should remove old errors)
|
||||
state = state.AddError(baseTime.Add(2 * time.Minute))
|
||||
|
||||
// Should pass check (only 1 error in window, old ones removed)
|
||||
result := state.Check(baseTime.Add(2 * time.Minute))
|
||||
assert.True(t, option.IsSome(result), "old failures should be removed from history")
|
||||
})
|
||||
|
||||
t.Run("failures within time window are retained", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors within time window
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(30 * time.Second))
|
||||
state = state.AddError(baseTime.Add(50 * time.Second))
|
||||
|
||||
// All errors are within 1 minute window, should fail check
|
||||
result := state.Check(baseTime.Add(50 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "failures within time window should be retained")
|
||||
})
|
||||
|
||||
t.Run("sliding window behavior - errors slide out over time", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add 3 errors to reach threshold
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
state = state.AddError(baseTime.Add(20 * time.Second))
|
||||
|
||||
// Circuit should be open
|
||||
result := state.Check(baseTime.Add(20 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "circuit should be open with 3 failures")
|
||||
|
||||
// Add error after first failure has expired (> 1 minute from first error)
|
||||
// This should remove the first error, leaving only 3 in window
|
||||
state = state.AddError(baseTime.Add(70 * time.Second))
|
||||
|
||||
// Should still fail check (3 errors in window after pruning)
|
||||
result = state.Check(baseTime.Add(70 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "circuit should remain open with 3 failures in window")
|
||||
})
|
||||
|
||||
t.Run("zero maxFailures means circuit is always open", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(0)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Initial state should already fail (0 >= 0)
|
||||
result := state.Check(baseTime)
|
||||
assert.True(t, option.IsNone(result), "initial state should fail Check with maxFailures=0")
|
||||
|
||||
// Add one error
|
||||
state = state.AddError(baseTime)
|
||||
|
||||
// Should still fail
|
||||
result = state.Check(baseTime)
|
||||
assert.True(t, option.IsNone(result), "should fail Check after error with maxFailures=0")
|
||||
})
|
||||
|
||||
t.Run("success purges history even with failures in time window", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors within time window
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
|
||||
// Add success (purges all history)
|
||||
state = state.AddSuccess(baseTime.Add(20 * time.Second))
|
||||
|
||||
// Add more errors
|
||||
state = state.AddError(baseTime.Add(30 * time.Second))
|
||||
state = state.AddError(baseTime.Add(40 * time.Second))
|
||||
|
||||
// Should still pass (only 2 errors after purge)
|
||||
result := state.Check(baseTime.Add(40 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "success should purge all history")
|
||||
|
||||
// Add one more to reach threshold
|
||||
state = state.AddError(baseTime.Add(50 * time.Second))
|
||||
|
||||
// Should fail at threshold
|
||||
result = state.Check(baseTime.Add(50 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "should fail after reaching threshold")
|
||||
})
|
||||
|
||||
t.Run("multiple successes keep history empty", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add error
|
||||
state = state.AddError(baseTime)
|
||||
|
||||
// Multiple successes
|
||||
state = state.AddSuccess(baseTime.Add(10 * time.Second))
|
||||
state = state.AddSuccess(baseTime.Add(20 * time.Second))
|
||||
state = state.AddSuccess(baseTime.Add(30 * time.Second))
|
||||
|
||||
// Should still pass
|
||||
result := state.Check(baseTime.Add(30 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "multiple AddSuccess should keep history empty")
|
||||
|
||||
// Add errors to reach threshold
|
||||
state = state.AddError(baseTime.Add(40 * time.Second))
|
||||
state = state.AddError(baseTime.Add(50 * time.Second))
|
||||
|
||||
// Should fail
|
||||
result = state.Check(baseTime.Add(50 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "should fail after reaching threshold")
|
||||
})
|
||||
|
||||
t.Run("state is immutable - original unchanged after AddError", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(2)
|
||||
originalState := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Create new state by adding error
|
||||
newState := originalState.AddError(baseTime)
|
||||
|
||||
// Original should still pass check
|
||||
result := originalState.Check(baseTime)
|
||||
assert.True(t, option.IsSome(result), "original state should be unchanged")
|
||||
|
||||
// New state should reach threshold after another error
|
||||
newState = newState.AddError(baseTime.Add(10 * time.Second))
|
||||
|
||||
result = newState.Check(baseTime.Add(10 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "new state should fail after reaching threshold")
|
||||
|
||||
// Original should still pass
|
||||
result = originalState.Check(baseTime)
|
||||
assert.True(t, option.IsSome(result), "original state should still be unchanged")
|
||||
})
|
||||
|
||||
t.Run("state is immutable - original unchanged after Empty", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors to original
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
stateWithErrors := state
|
||||
|
||||
// Create new state by calling Empty
|
||||
emptyState := stateWithErrors.Empty()
|
||||
|
||||
// Original with errors should fail check
|
||||
result := stateWithErrors.Check(baseTime.Add(10 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "state with errors should fail after reaching threshold")
|
||||
|
||||
// Empty state should pass
|
||||
result = emptyState.Check(baseTime.Add(10 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "empty state should pass Check")
|
||||
})
|
||||
|
||||
t.Run("exact time window boundary behavior", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add error at baseTime
|
||||
state = state.AddError(baseTime)
|
||||
|
||||
// Add error exactly at time window boundary
|
||||
state = state.AddError(baseTime.Add(1 * time.Minute))
|
||||
|
||||
// The first error should be removed (it's now outside the window)
|
||||
// Only 1 error should remain
|
||||
result := state.Check(baseTime.Add(1 * time.Minute))
|
||||
assert.True(t, option.IsSome(result), "error at exact window boundary should remove older errors")
|
||||
})
|
||||
|
||||
t.Run("multiple errors at same timestamp", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add multiple errors at same time
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime)
|
||||
|
||||
// Should fail check (3 errors at same time)
|
||||
result := state.Check(baseTime)
|
||||
assert.True(t, option.IsNone(result), "multiple errors at same timestamp should count separately")
|
||||
})
|
||||
|
||||
t.Run("errors added out of chronological order are sorted", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(4)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors out of order
|
||||
state = state.AddError(baseTime.Add(30 * time.Second))
|
||||
state = state.AddError(baseTime.Add(5 * time.Second))
|
||||
state = state.AddError(baseTime.Add(50 * time.Second))
|
||||
|
||||
// Add error that should trigger pruning
|
||||
state = state.AddError(baseTime.Add(70 * time.Second))
|
||||
|
||||
// The error at 5s should be removed (> 1 minute from 70s: 70-5=65 > 60)
|
||||
// Should have 3 errors remaining (30s, 50s, 70s)
|
||||
result := state.Check(baseTime.Add(70 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "errors should be sorted and pruned correctly")
|
||||
})
|
||||
|
||||
t.Run("large time window with many failures", func(t *testing.T) {
|
||||
timeWindow := 24 * time.Hour
|
||||
maxFailures := uint(100)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add many failures within the window
|
||||
for i := 0; i < 99; i++ {
|
||||
state = state.AddError(baseTime.Add(time.Duration(i) * time.Minute))
|
||||
}
|
||||
|
||||
// Should still pass (99 < 100)
|
||||
result := state.Check(baseTime.Add(99 * time.Minute))
|
||||
assert.True(t, option.IsSome(result), "should pass with 99 failures when threshold is 100")
|
||||
|
||||
// Add one more to reach threshold
|
||||
state = state.AddError(baseTime.Add(100 * time.Minute))
|
||||
|
||||
// Should fail
|
||||
result = state.Check(baseTime.Add(100 * time.Minute))
|
||||
assert.True(t, option.IsNone(result), "should fail at threshold with large window")
|
||||
})
|
||||
|
||||
t.Run("very short time window", func(t *testing.T) {
|
||||
timeWindow := 100 * time.Millisecond
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors within short window
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(50 * time.Millisecond))
|
||||
state = state.AddError(baseTime.Add(90 * time.Millisecond))
|
||||
|
||||
// Should fail (3 errors within 100ms)
|
||||
result := state.Check(baseTime.Add(90 * time.Millisecond))
|
||||
assert.True(t, option.IsNone(result), "should fail with errors in short time window")
|
||||
|
||||
// Add error after window expires
|
||||
state = state.AddError(baseTime.Add(200 * time.Millisecond))
|
||||
|
||||
// Should pass (old errors removed, only 1 in window)
|
||||
result = state.Check(baseTime.Add(200 * time.Millisecond))
|
||||
assert.True(t, option.IsSome(result), "should pass after short window expires")
|
||||
})
|
||||
|
||||
t.Run("success prevents circuit from opening", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(3)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors close to threshold
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
|
||||
// Add success before reaching threshold
|
||||
state = state.AddSuccess(baseTime.Add(20 * time.Second))
|
||||
|
||||
// Add more errors
|
||||
state = state.AddError(baseTime.Add(30 * time.Second))
|
||||
state = state.AddError(baseTime.Add(40 * time.Second))
|
||||
|
||||
// Should still pass (only 2 errors after success purge)
|
||||
result := state.Check(baseTime.Add(40 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "circuit should stay closed after success purge")
|
||||
})
|
||||
|
||||
t.Run("Empty can be called multiple times", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(2)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add errors
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(10 * time.Second))
|
||||
state = state.AddError(baseTime.Add(20 * time.Second))
|
||||
|
||||
// Reset multiple times
|
||||
state = state.Empty()
|
||||
state = state.Empty()
|
||||
state = state.Empty()
|
||||
|
||||
// Should still pass
|
||||
result := state.Check(baseTime.Add(30 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "state should pass Check after multiple Empty calls")
|
||||
})
|
||||
|
||||
t.Run("gradual failure accumulation within window", func(t *testing.T) {
|
||||
timeWindow := 1 * time.Minute
|
||||
maxFailures := uint(5)
|
||||
state := MakeClosedStateHistory(timeWindow, maxFailures)
|
||||
baseTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
|
||||
// Add failures gradually
|
||||
state = state.AddError(baseTime)
|
||||
state = state.AddError(baseTime.Add(15 * time.Second))
|
||||
state = state.AddError(baseTime.Add(30 * time.Second))
|
||||
state = state.AddError(baseTime.Add(45 * time.Second))
|
||||
|
||||
// Should still pass (4 < 5)
|
||||
result := state.Check(baseTime.Add(45 * time.Second))
|
||||
assert.True(t, option.IsSome(result), "should pass before threshold")
|
||||
|
||||
// Add one more within window
|
||||
state = state.AddError(baseTime.Add(55 * time.Second))
|
||||
|
||||
// Should fail (5 >= 5)
|
||||
result = state.Check(baseTime.Add(55 * time.Second))
|
||||
assert.True(t, option.IsNone(result), "should fail at threshold")
|
||||
})
|
||||
}
|
||||
338
v2/circuitbreaker/error.go
Normal file
338
v2/circuitbreaker/error.go
Normal file
@@ -0,0 +1,338 @@
|
||||
// Package circuitbreaker provides error types and utilities for circuit breaker implementations.
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"crypto/x509"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net"
|
||||
"net/http"
|
||||
"net/url"
|
||||
"syscall"
|
||||
"time"
|
||||
|
||||
E "github.com/IBM/fp-go/v2/errors"
|
||||
FH "github.com/IBM/fp-go/v2/http"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
)
|
||||
|
||||
// CircuitBreakerError represents an error that occurs when a circuit breaker is in the open state.
|
||||
//
|
||||
// When a circuit breaker opens due to too many failures, it prevents further operations
|
||||
// from executing until a reset time is reached. This error type communicates that state
|
||||
// and provides information about when the circuit breaker will attempt to close again.
|
||||
//
|
||||
// Fields:
|
||||
// - Name: The name identifying this circuit breaker instance
|
||||
// - ResetAt: The time at which the circuit breaker will transition from open to half-open state
|
||||
//
|
||||
// Thread Safety: This type is immutable and safe for concurrent use.
|
||||
type CircuitBreakerError struct {
|
||||
// Name: The name identifying this circuit breaker instance
|
||||
Name string
|
||||
|
||||
// ResetAt: The time at which the circuit breaker will transition from open to half-open state
|
||||
ResetAt time.Time
|
||||
}
|
||||
|
||||
// Error implements the error interface for CircuitBreakerError.
|
||||
//
|
||||
// Returns a formatted error message indicating that the circuit breaker is open
|
||||
// and when it will attempt to close.
|
||||
//
|
||||
// Returns:
|
||||
// - A string describing the circuit breaker state and reset time
|
||||
//
|
||||
// Thread Safety: This method is safe for concurrent use as it only reads immutable fields.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// err := &CircuitBreakerError{Name: "API", ResetAt: time.Now().Add(30 * time.Second)}
|
||||
// fmt.Println(err.Error())
|
||||
// // Output: circuit breaker is open [API], will close at 2026-01-09 12:20:47.123 +0100 CET
|
||||
func (e *CircuitBreakerError) Error() string {
|
||||
return fmt.Sprintf("circuit breaker is open [%s], will close at %s", e.Name, e.ResetAt)
|
||||
}
|
||||
|
||||
// MakeCircuitBreakerErrorWithName creates a circuit breaker error constructor with a custom name.
|
||||
//
|
||||
// This function returns a constructor that creates CircuitBreakerError instances with a specific
|
||||
// circuit breaker name. This is useful when you have multiple circuit breakers in your system
|
||||
// and want to identify which one is open in error messages.
|
||||
//
|
||||
// Parameters:
|
||||
// - name: The name to identify this circuit breaker in error messages
|
||||
//
|
||||
// Returns:
|
||||
// - A function that takes a reset time and returns a CircuitBreakerError with the specified name
|
||||
//
|
||||
// Thread Safety: The returned function is safe for concurrent use as it creates new error
|
||||
// instances on each call.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// makeDBError := MakeCircuitBreakerErrorWithName("Database Circuit Breaker")
|
||||
// err := makeDBError(time.Now().Add(30 * time.Second))
|
||||
// fmt.Println(err.Error())
|
||||
// // Output: circuit breaker is open [Database Circuit Breaker], will close at 2026-01-09 12:20:47.123 +0100 CET
|
||||
func MakeCircuitBreakerErrorWithName(name string) func(time.Time) error {
|
||||
return func(resetTime time.Time) error {
|
||||
return &CircuitBreakerError{Name: name, ResetAt: resetTime}
|
||||
}
|
||||
}
|
||||
|
||||
// MakeCircuitBreakerError creates a new CircuitBreakerError with the specified reset time.
|
||||
//
|
||||
// This constructor function creates a circuit breaker error that indicates when the
|
||||
// circuit breaker will transition from the open state to the half-open state, allowing
|
||||
// test requests to determine if the underlying service has recovered.
|
||||
//
|
||||
// Parameters:
|
||||
// - resetTime: The time at which the circuit breaker will attempt to close
|
||||
//
|
||||
// Returns:
|
||||
// - An error representing the circuit breaker open state
|
||||
//
|
||||
// Thread Safety: This function is safe for concurrent use as it creates new error
|
||||
// instances on each call.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// resetTime := time.Now().Add(30 * time.Second)
|
||||
// err := MakeCircuitBreakerError(resetTime)
|
||||
// if cbErr, ok := err.(*CircuitBreakerError); ok {
|
||||
// fmt.Printf("Circuit breaker will reset at: %s\n", cbErr.ResetAt)
|
||||
// }
|
||||
var MakeCircuitBreakerError = MakeCircuitBreakerErrorWithName("Generic Circuit Breaker")
|
||||
|
||||
// AnyError converts an error to an Option, wrapping non-nil errors in Some and nil errors in None.
|
||||
//
|
||||
// This variable provides a functional way to handle errors by converting them to Option types.
|
||||
// It's particularly useful in functional programming contexts where you want to treat errors
|
||||
// as optional values rather than using traditional error handling patterns.
|
||||
//
|
||||
// Behavior:
|
||||
// - If the error is non-nil, returns Some(error)
|
||||
// - If the error is nil, returns None
|
||||
//
|
||||
// Thread Safety: This function is pure and safe for concurrent use.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// err := errors.New("something went wrong")
|
||||
// optErr := AnyError(err) // Some(error)
|
||||
//
|
||||
// var noErr error = nil
|
||||
// optNoErr := AnyError(noErr) // None
|
||||
//
|
||||
// // Using in functional pipelines
|
||||
// result := F.Pipe2(
|
||||
// someOperation(),
|
||||
// AnyError,
|
||||
// O.Map(func(e error) string { return e.Error() }),
|
||||
// )
|
||||
var AnyError = option.FromPredicate(E.IsNonNil)
|
||||
|
||||
// shouldOpenCircuit determines if an error should cause a circuit breaker to open.
|
||||
//
|
||||
// This function checks if an error represents an infrastructure or server problem
|
||||
// that indicates the service is unhealthy and should trigger circuit breaker protection.
|
||||
// It examines both the error type and, for HTTP errors, the status code.
|
||||
//
|
||||
// Errors that should open the circuit include:
|
||||
// - HTTP 5xx server errors (500-599) indicating server-side problems
|
||||
// - Network errors (connection refused, connection reset, timeouts)
|
||||
// - DNS resolution errors
|
||||
// - TLS/certificate errors
|
||||
// - Other infrastructure-related errors
|
||||
//
|
||||
// Errors that should NOT open the circuit include:
|
||||
// - HTTP 4xx client errors (bad request, unauthorized, not found, etc.)
|
||||
// - Application-level validation errors
|
||||
// - Business logic errors
|
||||
//
|
||||
// The function unwraps error chains to find the root cause, making it compatible
|
||||
// with wrapped errors created by fmt.Errorf with %w or errors.Join.
|
||||
//
|
||||
// Parameters:
|
||||
// - err: The error to evaluate (may be nil)
|
||||
//
|
||||
// Returns:
|
||||
// - true if the error should cause the circuit to open, false otherwise
|
||||
//
|
||||
// Thread Safety: This function is pure and safe for concurrent use. It does not
|
||||
// modify any state.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // HTTP 500 error - should open circuit
|
||||
// httpErr := &FH.HttpError{...} // status 500
|
||||
// if shouldOpenCircuit(httpErr) {
|
||||
// // Open circuit breaker
|
||||
// }
|
||||
//
|
||||
// // HTTP 404 error - should NOT open circuit (client error)
|
||||
// notFoundErr := &FH.HttpError{...} // status 404
|
||||
// if !shouldOpenCircuit(notFoundErr) {
|
||||
// // Don't open circuit, this is a client error
|
||||
// }
|
||||
//
|
||||
// // Network timeout - should open circuit
|
||||
// timeoutErr := &net.OpError{Op: "dial", Err: syscall.ETIMEDOUT}
|
||||
// if shouldOpenCircuit(timeoutErr) {
|
||||
// // Open circuit breaker
|
||||
// }
|
||||
func shouldOpenCircuit(err error) bool {
|
||||
if err == nil {
|
||||
return false
|
||||
}
|
||||
|
||||
// Check for HTTP errors with server status codes (5xx)
|
||||
var httpErr *FH.HttpError
|
||||
if errors.As(err, &httpErr) {
|
||||
statusCode := httpErr.StatusCode()
|
||||
// Only 5xx errors should open the circuit
|
||||
// 4xx errors are client errors and shouldn't affect circuit state
|
||||
return statusCode >= http.StatusInternalServerError && statusCode < 600
|
||||
}
|
||||
|
||||
// Check for network operation errors
|
||||
var opErr *net.OpError
|
||||
if errors.As(err, &opErr) {
|
||||
// Network timeouts should open the circuit
|
||||
if opErr.Timeout() {
|
||||
return true
|
||||
}
|
||||
// Check the underlying error
|
||||
if opErr.Err != nil {
|
||||
return isInfrastructureError(opErr.Err)
|
||||
}
|
||||
return true
|
||||
}
|
||||
|
||||
// Check for DNS errors
|
||||
var dnsErr *net.DNSError
|
||||
if errors.As(err, &dnsErr) {
|
||||
return true
|
||||
}
|
||||
|
||||
// Check for URL errors (often wrap network errors)
|
||||
var urlErr *url.Error
|
||||
if errors.As(err, &urlErr) {
|
||||
if urlErr.Timeout() {
|
||||
return true
|
||||
}
|
||||
// Recursively check the wrapped error
|
||||
return shouldOpenCircuit(urlErr.Err)
|
||||
}
|
||||
|
||||
// Check for specific syscall errors that indicate infrastructure problems
|
||||
return isInfrastructureError(err) || isTLSError(err)
|
||||
}
|
||||
|
||||
// isInfrastructureError checks if an error is a low-level infrastructure error
|
||||
// that should cause the circuit to open.
|
||||
//
|
||||
// This function examines syscall errors to identify network and system-level failures
|
||||
// that indicate the service is unavailable or unreachable.
|
||||
//
|
||||
// Infrastructure errors include:
|
||||
// - ECONNREFUSED: Connection refused (service not listening)
|
||||
// - ECONNRESET: Connection reset by peer (service crashed or network issue)
|
||||
// - ECONNABORTED: Connection aborted (network issue)
|
||||
// - ENETUNREACH: Network unreachable (routing problem)
|
||||
// - EHOSTUNREACH: Host unreachable (host down or network issue)
|
||||
// - EPIPE: Broken pipe (connection closed unexpectedly)
|
||||
// - ETIMEDOUT: Operation timed out (service not responding)
|
||||
//
|
||||
// Parameters:
|
||||
// - err: The error to check
|
||||
//
|
||||
// Returns:
|
||||
// - true if the error is an infrastructure error, false otherwise
|
||||
//
|
||||
// Thread Safety: This function is pure and safe for concurrent use.
|
||||
func isInfrastructureError(err error) bool {
|
||||
|
||||
var syscallErr *syscall.Errno
|
||||
|
||||
if errors.As(err, &syscallErr) {
|
||||
switch *syscallErr {
|
||||
case syscall.ECONNREFUSED,
|
||||
syscall.ECONNRESET,
|
||||
syscall.ECONNABORTED,
|
||||
syscall.ENETUNREACH,
|
||||
syscall.EHOSTUNREACH,
|
||||
syscall.EPIPE,
|
||||
syscall.ETIMEDOUT:
|
||||
return true
|
||||
}
|
||||
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// isTLSError checks if an error is a TLS/certificate error that should cause the circuit to open.
|
||||
//
|
||||
// TLS errors typically indicate infrastructure or configuration problems that prevent
|
||||
// secure communication with the service. These errors suggest the service is not properly
|
||||
// configured or accessible.
|
||||
//
|
||||
// TLS errors include:
|
||||
// - Certificate verification failures (invalid, expired, or malformed certificates)
|
||||
// - Unknown certificate authority errors (untrusted CA)
|
||||
//
|
||||
// Parameters:
|
||||
// - err: The error to check
|
||||
//
|
||||
// Returns:
|
||||
// - true if the error is a TLS/certificate error, false otherwise
|
||||
//
|
||||
// Thread Safety: This function is pure and safe for concurrent use.
|
||||
func isTLSError(err error) bool {
|
||||
// Certificate verification failed
|
||||
var certErr *x509.CertificateInvalidError
|
||||
if errors.As(err, &certErr) {
|
||||
return true
|
||||
}
|
||||
|
||||
// Unknown authority
|
||||
var unknownAuthErr *x509.UnknownAuthorityError
|
||||
if errors.As(err, &unknownAuthErr) {
|
||||
return true
|
||||
}
|
||||
|
||||
return false
|
||||
}
|
||||
|
||||
// InfrastructureError is a predicate that converts errors to Options based on whether
|
||||
// they should trigger circuit breaker opening.
|
||||
//
|
||||
// This variable provides a functional way to filter errors that represent infrastructure
|
||||
// failures (network issues, server errors, timeouts, etc.) from application-level errors
|
||||
// (validation errors, business logic errors, client errors).
|
||||
//
|
||||
// Behavior:
|
||||
// - Returns Some(error) if the error should open the circuit (infrastructure failure)
|
||||
// - Returns None if the error should not open the circuit (application error)
|
||||
//
|
||||
// Thread Safety: This function is pure and safe for concurrent use.
|
||||
//
|
||||
// Use this in circuit breaker configurations to determine which errors should count
|
||||
// toward the failure threshold.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // In a circuit breaker configuration
|
||||
// breaker := MakeCircuitBreaker(
|
||||
// ...,
|
||||
// checkError: InfrastructureError, // Only infrastructure errors open the circuit
|
||||
// ...,
|
||||
// )
|
||||
//
|
||||
// // HTTP 500 error - returns Some(error)
|
||||
// result := InfrastructureError(&FH.HttpError{...}) // Some(error)
|
||||
//
|
||||
// // HTTP 404 error - returns None
|
||||
// result := InfrastructureError(&FH.HttpError{...}) // None
|
||||
var InfrastructureError = option.FromPredicate(shouldOpenCircuit)
|
||||
503
v2/circuitbreaker/error_test.go
Normal file
503
v2/circuitbreaker/error_test.go
Normal file
@@ -0,0 +1,503 @@
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"crypto/x509"
|
||||
"errors"
|
||||
"fmt"
|
||||
"net"
|
||||
"net/http"
|
||||
"net/url"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
FH "github.com/IBM/fp-go/v2/http"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestCircuitBreakerError tests the CircuitBreakerError type
|
||||
func TestCircuitBreakerError(t *testing.T) {
|
||||
t.Run("Error returns formatted message with reset time", func(t *testing.T) {
|
||||
resetTime := time.Date(2026, 1, 9, 12, 30, 0, 0, time.UTC)
|
||||
err := &CircuitBreakerError{ResetAt: resetTime}
|
||||
|
||||
result := err.Error()
|
||||
|
||||
assert.Contains(t, result, "circuit breaker is open")
|
||||
assert.Contains(t, result, "will close at")
|
||||
assert.Contains(t, result, resetTime.String())
|
||||
})
|
||||
|
||||
t.Run("Error message includes full timestamp", func(t *testing.T) {
|
||||
resetTime := time.Now().Add(30 * time.Second)
|
||||
err := &CircuitBreakerError{ResetAt: resetTime}
|
||||
|
||||
result := err.Error()
|
||||
|
||||
assert.NotEmpty(t, result)
|
||||
assert.Contains(t, result, "circuit breaker is open")
|
||||
})
|
||||
}
|
||||
|
||||
// TestMakeCircuitBreakerError tests the constructor function
|
||||
func TestMakeCircuitBreakerError(t *testing.T) {
|
||||
t.Run("creates CircuitBreakerError with correct reset time", func(t *testing.T) {
|
||||
resetTime := time.Date(2026, 1, 9, 13, 0, 0, 0, time.UTC)
|
||||
|
||||
err := MakeCircuitBreakerError(resetTime)
|
||||
|
||||
assert.NotNil(t, err)
|
||||
cbErr, ok := err.(*CircuitBreakerError)
|
||||
assert.True(t, ok, "should return *CircuitBreakerError type")
|
||||
assert.Equal(t, resetTime, cbErr.ResetAt)
|
||||
})
|
||||
|
||||
t.Run("returns error interface", func(t *testing.T) {
|
||||
resetTime := time.Now().Add(1 * time.Minute)
|
||||
|
||||
err := MakeCircuitBreakerError(resetTime)
|
||||
|
||||
// Should be assignable to error interface
|
||||
var _ error = err
|
||||
assert.NotNil(t, err)
|
||||
})
|
||||
|
||||
t.Run("created error can be type asserted", func(t *testing.T) {
|
||||
resetTime := time.Now().Add(45 * time.Second)
|
||||
|
||||
err := MakeCircuitBreakerError(resetTime)
|
||||
|
||||
cbErr, ok := err.(*CircuitBreakerError)
|
||||
assert.True(t, ok)
|
||||
assert.Equal(t, resetTime, cbErr.ResetAt)
|
||||
})
|
||||
}
|
||||
|
||||
// TestAnyError tests the AnyError function
|
||||
func TestAnyError(t *testing.T) {
|
||||
t.Run("returns Some for non-nil error", func(t *testing.T) {
|
||||
err := errors.New("test error")
|
||||
|
||||
result := AnyError(err)
|
||||
|
||||
assert.True(t, option.IsSome(result), "should return Some for non-nil error")
|
||||
value := option.GetOrElse(func() error { return nil })(result)
|
||||
assert.Equal(t, err, value)
|
||||
})
|
||||
|
||||
t.Run("returns None for nil error", func(t *testing.T) {
|
||||
var err error = nil
|
||||
|
||||
result := AnyError(err)
|
||||
|
||||
assert.True(t, option.IsNone(result), "should return None for nil error")
|
||||
})
|
||||
|
||||
t.Run("works with different error types", func(t *testing.T) {
|
||||
err1 := fmt.Errorf("wrapped: %w", errors.New("inner"))
|
||||
err2 := &CircuitBreakerError{ResetAt: time.Now()}
|
||||
|
||||
result1 := AnyError(err1)
|
||||
result2 := AnyError(err2)
|
||||
|
||||
assert.True(t, option.IsSome(result1))
|
||||
assert.True(t, option.IsSome(result2))
|
||||
})
|
||||
}
|
||||
|
||||
// TestShouldOpenCircuit tests the shouldOpenCircuit function
|
||||
func TestShouldOpenCircuit(t *testing.T) {
|
||||
t.Run("returns false for nil error", func(t *testing.T) {
|
||||
result := shouldOpenCircuit(nil)
|
||||
assert.False(t, result)
|
||||
})
|
||||
|
||||
t.Run("HTTP 5xx errors should open circuit", func(t *testing.T) {
|
||||
testCases := []struct {
|
||||
name string
|
||||
statusCode int
|
||||
expected bool
|
||||
}{
|
||||
{"500 Internal Server Error", 500, true},
|
||||
{"501 Not Implemented", 501, true},
|
||||
{"502 Bad Gateway", 502, true},
|
||||
{"503 Service Unavailable", 503, true},
|
||||
{"504 Gateway Timeout", 504, true},
|
||||
{"599 Custom Server Error", 599, true},
|
||||
}
|
||||
|
||||
for _, tc := range testCases {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: tc.statusCode,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
|
||||
result := shouldOpenCircuit(httpErr)
|
||||
|
||||
assert.Equal(t, tc.expected, result)
|
||||
})
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("HTTP 4xx errors should NOT open circuit", func(t *testing.T) {
|
||||
testCases := []struct {
|
||||
name string
|
||||
statusCode int
|
||||
expected bool
|
||||
}{
|
||||
{"400 Bad Request", 400, false},
|
||||
{"401 Unauthorized", 401, false},
|
||||
{"403 Forbidden", 403, false},
|
||||
{"404 Not Found", 404, false},
|
||||
{"422 Unprocessable Entity", 422, false},
|
||||
{"429 Too Many Requests", 429, false},
|
||||
{"499 Custom Client Error", 499, false},
|
||||
}
|
||||
|
||||
for _, tc := range testCases {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: tc.statusCode,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
|
||||
result := shouldOpenCircuit(httpErr)
|
||||
|
||||
assert.Equal(t, tc.expected, result)
|
||||
})
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("HTTP 2xx and 3xx should NOT open circuit", func(t *testing.T) {
|
||||
testCases := []int{200, 201, 204, 301, 302, 304}
|
||||
|
||||
for _, statusCode := range testCases {
|
||||
t.Run(fmt.Sprintf("Status %d", statusCode), func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: statusCode,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
|
||||
result := shouldOpenCircuit(httpErr)
|
||||
|
||||
assert.False(t, result)
|
||||
})
|
||||
}
|
||||
})
|
||||
|
||||
t.Run("network timeout errors should open circuit", func(t *testing.T) {
|
||||
opErr := &net.OpError{
|
||||
Op: "dial",
|
||||
Err: &timeoutError{},
|
||||
}
|
||||
|
||||
result := shouldOpenCircuit(opErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("DNS errors should open circuit", func(t *testing.T) {
|
||||
dnsErr := &net.DNSError{
|
||||
Err: "no such host",
|
||||
Name: "example.com",
|
||||
}
|
||||
|
||||
result := shouldOpenCircuit(dnsErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("URL timeout errors should open circuit", func(t *testing.T) {
|
||||
urlErr := &url.Error{
|
||||
Op: "Get",
|
||||
URL: "http://example.com",
|
||||
Err: &timeoutError{},
|
||||
}
|
||||
|
||||
result := shouldOpenCircuit(urlErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("URL errors with nested network timeout should open circuit", func(t *testing.T) {
|
||||
urlErr := &url.Error{
|
||||
Op: "Get",
|
||||
URL: "http://example.com",
|
||||
Err: &net.OpError{
|
||||
Op: "dial",
|
||||
Err: &timeoutError{},
|
||||
},
|
||||
}
|
||||
|
||||
result := shouldOpenCircuit(urlErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("OpError with nil Err should open circuit", func(t *testing.T) {
|
||||
opErr := &net.OpError{
|
||||
Op: "dial",
|
||||
Err: nil,
|
||||
}
|
||||
|
||||
result := shouldOpenCircuit(opErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("wrapped HTTP 5xx error should open circuit", func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: 503,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
wrappedErr := fmt.Errorf("service error: %w", httpErr)
|
||||
|
||||
result := shouldOpenCircuit(wrappedErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("wrapped HTTP 4xx error should NOT open circuit", func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: 404,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
wrappedErr := fmt.Errorf("not found: %w", httpErr)
|
||||
|
||||
result := shouldOpenCircuit(wrappedErr)
|
||||
|
||||
assert.False(t, result)
|
||||
})
|
||||
|
||||
t.Run("generic application error should NOT open circuit", func(t *testing.T) {
|
||||
err := errors.New("validation failed")
|
||||
|
||||
result := shouldOpenCircuit(err)
|
||||
|
||||
assert.False(t, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestIsInfrastructureError tests infrastructure error detection through shouldOpenCircuit
|
||||
func TestIsInfrastructureError(t *testing.T) {
|
||||
t.Run("network timeout is infrastructure error", func(t *testing.T) {
|
||||
opErr := &net.OpError{Op: "dial", Err: &timeoutError{}}
|
||||
result := shouldOpenCircuit(opErr)
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("OpError with nil Err is infrastructure error", func(t *testing.T) {
|
||||
opErr := &net.OpError{Op: "dial", Err: nil}
|
||||
result := shouldOpenCircuit(opErr)
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("generic error returns false", func(t *testing.T) {
|
||||
err := errors.New("generic error")
|
||||
result := shouldOpenCircuit(err)
|
||||
assert.False(t, result)
|
||||
})
|
||||
|
||||
t.Run("wrapped network timeout is detected", func(t *testing.T) {
|
||||
opErr := &net.OpError{Op: "dial", Err: &timeoutError{}}
|
||||
wrappedErr := fmt.Errorf("connection failed: %w", opErr)
|
||||
result := shouldOpenCircuit(wrappedErr)
|
||||
assert.True(t, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestIsTLSError tests the isTLSError function
|
||||
func TestIsTLSError(t *testing.T) {
|
||||
t.Run("certificate invalid error is TLS error", func(t *testing.T) {
|
||||
certErr := &x509.CertificateInvalidError{
|
||||
Reason: x509.Expired,
|
||||
}
|
||||
|
||||
result := isTLSError(certErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("unknown authority error is TLS error", func(t *testing.T) {
|
||||
authErr := &x509.UnknownAuthorityError{}
|
||||
|
||||
result := isTLSError(authErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("generic error is not TLS error", func(t *testing.T) {
|
||||
err := errors.New("generic error")
|
||||
|
||||
result := isTLSError(err)
|
||||
|
||||
assert.False(t, result)
|
||||
})
|
||||
|
||||
t.Run("wrapped certificate error is detected", func(t *testing.T) {
|
||||
certErr := &x509.CertificateInvalidError{
|
||||
Reason: x509.Expired,
|
||||
}
|
||||
wrappedErr := fmt.Errorf("TLS handshake failed: %w", certErr)
|
||||
|
||||
result := isTLSError(wrappedErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
|
||||
t.Run("wrapped unknown authority error is detected", func(t *testing.T) {
|
||||
authErr := &x509.UnknownAuthorityError{}
|
||||
wrappedErr := fmt.Errorf("certificate verification failed: %w", authErr)
|
||||
|
||||
result := isTLSError(wrappedErr)
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestInfrastructureError tests the InfrastructureError variable
|
||||
func TestInfrastructureError(t *testing.T) {
|
||||
t.Run("returns Some for infrastructure errors", func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: 503,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
|
||||
result := InfrastructureError(httpErr)
|
||||
|
||||
assert.True(t, option.IsSome(result))
|
||||
})
|
||||
|
||||
t.Run("returns None for non-infrastructure errors", func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: 404,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
|
||||
result := InfrastructureError(httpErr)
|
||||
|
||||
assert.True(t, option.IsNone(result))
|
||||
})
|
||||
|
||||
t.Run("returns None for nil error", func(t *testing.T) {
|
||||
result := InfrastructureError(nil)
|
||||
|
||||
assert.True(t, option.IsNone(result))
|
||||
})
|
||||
|
||||
t.Run("returns Some for network timeout", func(t *testing.T) {
|
||||
opErr := &net.OpError{
|
||||
Op: "dial",
|
||||
Err: &timeoutError{},
|
||||
}
|
||||
|
||||
result := InfrastructureError(opErr)
|
||||
|
||||
assert.True(t, option.IsSome(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestComplexErrorScenarios tests complex real-world error scenarios
|
||||
func TestComplexErrorScenarios(t *testing.T) {
|
||||
t.Run("deeply nested URL error with HTTP 5xx", func(t *testing.T) {
|
||||
testURL, _ := url.Parse("http://api.example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: 502,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
urlErr := &url.Error{
|
||||
Op: "Get",
|
||||
URL: "http://api.example.com",
|
||||
Err: httpErr,
|
||||
}
|
||||
wrappedErr := fmt.Errorf("API call failed: %w", urlErr)
|
||||
|
||||
result := shouldOpenCircuit(wrappedErr)
|
||||
|
||||
assert.True(t, result, "should detect HTTP 5xx through multiple layers")
|
||||
})
|
||||
|
||||
t.Run("URL error with timeout nested in OpError", func(t *testing.T) {
|
||||
opErr := &net.OpError{
|
||||
Op: "dial",
|
||||
Err: &timeoutError{},
|
||||
}
|
||||
urlErr := &url.Error{
|
||||
Op: "Post",
|
||||
URL: "http://api.example.com",
|
||||
Err: opErr,
|
||||
}
|
||||
|
||||
result := shouldOpenCircuit(urlErr)
|
||||
|
||||
assert.True(t, result, "should detect timeout through URL error")
|
||||
})
|
||||
|
||||
t.Run("multiple wrapped errors with infrastructure error at core", func(t *testing.T) {
|
||||
coreErr := &net.OpError{Op: "dial", Err: &timeoutError{}}
|
||||
layer1 := fmt.Errorf("connection attempt failed: %w", coreErr)
|
||||
layer2 := fmt.Errorf("retry exhausted: %w", layer1)
|
||||
layer3 := fmt.Errorf("service unavailable: %w", layer2)
|
||||
|
||||
result := shouldOpenCircuit(layer3)
|
||||
|
||||
assert.True(t, result, "should unwrap to find infrastructure error")
|
||||
})
|
||||
|
||||
t.Run("OpError with nil Err should open circuit", func(t *testing.T) {
|
||||
opErr := &net.OpError{
|
||||
Op: "dial",
|
||||
Err: nil,
|
||||
}
|
||||
|
||||
result := shouldOpenCircuit(opErr)
|
||||
|
||||
assert.True(t, result, "OpError with nil Err should be treated as infrastructure error")
|
||||
})
|
||||
|
||||
t.Run("mixed error types - HTTP 4xx with network error", func(t *testing.T) {
|
||||
// This tests that we correctly identify the error type
|
||||
testURL, _ := url.Parse("http://example.com")
|
||||
resp := &http.Response{
|
||||
StatusCode: 400,
|
||||
Request: &http.Request{URL: testURL},
|
||||
Body: http.NoBody,
|
||||
}
|
||||
httpErr := FH.StatusCodeError(resp)
|
||||
|
||||
result := shouldOpenCircuit(httpErr)
|
||||
|
||||
assert.False(t, result, "HTTP 4xx should not open circuit even if wrapped")
|
||||
})
|
||||
}
|
||||
|
||||
// Helper type for testing timeout errors
|
||||
type timeoutError struct{}
|
||||
|
||||
func (e *timeoutError) Error() string { return "timeout" }
|
||||
func (e *timeoutError) Timeout() bool { return true }
|
||||
func (e *timeoutError) Temporary() bool { return true }
|
||||
304
v2/circuitbreaker/metrics.go
Normal file
304
v2/circuitbreaker/metrics.go
Normal file
@@ -0,0 +1,304 @@
|
||||
// Package circuitbreaker provides metrics collection for circuit breaker state transitions and events.
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"log"
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
)
|
||||
|
||||
type (
|
||||
// Metrics defines the interface for collecting circuit breaker metrics and events.
|
||||
// Implementations can use this interface to track circuit breaker behavior for
|
||||
// monitoring, alerting, and debugging purposes.
|
||||
//
|
||||
// All methods accept a time.Time parameter representing when the event occurred,
|
||||
// and return an IO[Void] operation that performs the metric recording when executed.
|
||||
//
|
||||
// Thread Safety: Implementations must be thread-safe as circuit breakers may be
|
||||
// accessed concurrently from multiple goroutines.
|
||||
//
|
||||
// Example Usage:
|
||||
//
|
||||
// logger := log.New(os.Stdout, "[CircuitBreaker] ", log.LstdFlags)
|
||||
// metrics := MakeMetricsFromLogger("API-Service", logger)
|
||||
//
|
||||
// // In circuit breaker implementation
|
||||
// io.Run(metrics.Accept(time.Now())) // Record accepted request
|
||||
// io.Run(metrics.Reject(time.Now())) // Record rejected request
|
||||
// io.Run(metrics.Open(time.Now())) // Record circuit opening
|
||||
// io.Run(metrics.Close(time.Now())) // Record circuit closing
|
||||
// io.Run(metrics.Canary(time.Now())) // Record canary request
|
||||
Metrics interface {
|
||||
// Accept records that a request was accepted and allowed through the circuit breaker.
|
||||
// This is called when the circuit is closed or in half-open state (canary request).
|
||||
//
|
||||
// Parameters:
|
||||
// - time.Time: The timestamp when the request was accepted
|
||||
//
|
||||
// Returns:
|
||||
// - IO[Void]: An IO operation that records the acceptance when executed
|
||||
//
|
||||
// Thread Safety: Must be safe to call concurrently.
|
||||
Accept(time.Time) IO[Void]
|
||||
|
||||
// Reject records that a request was rejected because the circuit breaker is open.
|
||||
// This is called when a request is blocked due to the circuit being in open state
|
||||
// and the reset time has not been reached.
|
||||
//
|
||||
// Parameters:
|
||||
// - time.Time: The timestamp when the request was rejected
|
||||
//
|
||||
// Returns:
|
||||
// - IO[Void]: An IO operation that records the rejection when executed
|
||||
//
|
||||
// Thread Safety: Must be safe to call concurrently.
|
||||
Reject(time.Time) IO[Void]
|
||||
|
||||
// Open records that the circuit breaker transitioned to the open state.
|
||||
// This is called when the failure threshold is exceeded and the circuit opens
|
||||
// to prevent further requests from reaching the failing service.
|
||||
//
|
||||
// Parameters:
|
||||
// - time.Time: The timestamp when the circuit opened
|
||||
//
|
||||
// Returns:
|
||||
// - IO[Void]: An IO operation that records the state transition when executed
|
||||
//
|
||||
// Thread Safety: Must be safe to call concurrently.
|
||||
Open(time.Time) IO[Void]
|
||||
|
||||
// Close records that the circuit breaker transitioned to the closed state.
|
||||
// This is called when:
|
||||
// - A canary request succeeds in half-open state
|
||||
// - The circuit is manually reset
|
||||
// - The circuit breaker is initialized
|
||||
//
|
||||
// Parameters:
|
||||
// - time.Time: The timestamp when the circuit closed
|
||||
//
|
||||
// Returns:
|
||||
// - IO[Void]: An IO operation that records the state transition when executed
|
||||
//
|
||||
// Thread Safety: Must be safe to call concurrently.
|
||||
Close(time.Time) IO[Void]
|
||||
|
||||
// Canary records that a canary (test) request is being attempted.
|
||||
// This is called when the circuit is in half-open state and a single test request
|
||||
// is allowed through to check if the service has recovered.
|
||||
//
|
||||
// Parameters:
|
||||
// - time.Time: The timestamp when the canary request was initiated
|
||||
//
|
||||
// Returns:
|
||||
// - IO[Void]: An IO operation that records the canary attempt when executed
|
||||
//
|
||||
// Thread Safety: Must be safe to call concurrently.
|
||||
Canary(time.Time) IO[Void]
|
||||
}
|
||||
|
||||
// loggingMetrics is a simple implementation of the Metrics interface that logs
|
||||
// circuit breaker events using Go's standard log.Logger.
|
||||
//
|
||||
// This implementation is thread-safe as log.Logger is safe for concurrent use.
|
||||
//
|
||||
// Fields:
|
||||
// - name: A human-readable name identifying the circuit breaker instance
|
||||
// - logger: The log.Logger instance used for writing log messages
|
||||
loggingMetrics struct {
|
||||
name string
|
||||
logger *log.Logger
|
||||
}
|
||||
|
||||
// voidMetrics is a no-op implementation of the Metrics interface that does nothing.
|
||||
// All methods return the same pre-allocated IO[Void] operation that immediately returns
|
||||
// without performing any action.
|
||||
//
|
||||
// This implementation is useful for:
|
||||
// - Testing scenarios where metrics collection is not needed
|
||||
// - Production environments where metrics overhead should be eliminated
|
||||
// - Benchmarking circuit breaker logic without metrics interference
|
||||
// - Default initialization when no metrics implementation is provided
|
||||
//
|
||||
// Thread Safety: This implementation is safe for concurrent use. The noop IO operation
|
||||
// is immutable and can be safely shared across goroutines.
|
||||
//
|
||||
// Performance: This is the most efficient Metrics implementation as it performs no
|
||||
// operations and has minimal memory overhead (single shared IO[Void] instance).
|
||||
voidMetrics struct {
|
||||
noop IO[Void]
|
||||
}
|
||||
)
|
||||
|
||||
// doLog is a helper method that creates an IO operation for logging a circuit breaker event.
|
||||
// It formats the log message with the event prefix, circuit breaker name, and timestamp.
|
||||
//
|
||||
// Parameters:
|
||||
// - prefix: The event type (e.g., "Accept", "Reject", "Open", "Close", "Canary")
|
||||
// - ct: The timestamp when the event occurred
|
||||
//
|
||||
// Returns:
|
||||
// - IO[Void]: An IO operation that logs the event when executed
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use as log.Logger is thread-safe.
|
||||
//
|
||||
// Log Format: "<prefix>: <name>, <timestamp>"
|
||||
// Example: "Open: API-Service, 2026-01-09 15:30:45.123 +0100 CET"
|
||||
func (m *loggingMetrics) doLog(prefix string, ct time.Time) IO[Void] {
|
||||
return func() Void {
|
||||
m.logger.Printf("%s: %s, %s\n", prefix, m.name, ct)
|
||||
return function.VOID
|
||||
}
|
||||
}
|
||||
|
||||
// Accept implements the Metrics interface for loggingMetrics.
|
||||
// Logs when a request is accepted through the circuit breaker.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *loggingMetrics) Accept(ct time.Time) IO[Void] {
|
||||
return m.doLog("Accept", ct)
|
||||
}
|
||||
|
||||
// Open implements the Metrics interface for loggingMetrics.
|
||||
// Logs when the circuit breaker transitions to open state.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *loggingMetrics) Open(ct time.Time) IO[Void] {
|
||||
return m.doLog("Open", ct)
|
||||
}
|
||||
|
||||
// Close implements the Metrics interface for loggingMetrics.
|
||||
// Logs when the circuit breaker transitions to closed state.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *loggingMetrics) Close(ct time.Time) IO[Void] {
|
||||
return m.doLog("Close", ct)
|
||||
}
|
||||
|
||||
// Reject implements the Metrics interface for loggingMetrics.
|
||||
// Logs when a request is rejected because the circuit breaker is open.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *loggingMetrics) Reject(ct time.Time) IO[Void] {
|
||||
return m.doLog("Reject", ct)
|
||||
}
|
||||
|
||||
// Canary implements the Metrics interface for loggingMetrics.
|
||||
// Logs when a canary (test) request is attempted in half-open state.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *loggingMetrics) Canary(ct time.Time) IO[Void] {
|
||||
return m.doLog("Canary", ct)
|
||||
}
|
||||
|
||||
// MakeMetricsFromLogger creates a Metrics implementation that logs circuit breaker events
|
||||
// using the provided log.Logger.
|
||||
//
|
||||
// This is a simple metrics implementation suitable for development, debugging, and
|
||||
// basic production monitoring. For more sophisticated metrics collection (e.g., Prometheus,
|
||||
// StatsD), implement the Metrics interface with a custom type.
|
||||
//
|
||||
// Parameters:
|
||||
// - name: A human-readable name identifying the circuit breaker instance.
|
||||
// This name appears in all log messages to distinguish between multiple circuit breakers.
|
||||
// - logger: The log.Logger instance to use for writing log messages.
|
||||
// If nil, this will panic when metrics are recorded.
|
||||
//
|
||||
// Returns:
|
||||
// - Metrics: A thread-safe Metrics implementation that logs events
|
||||
//
|
||||
// Thread Safety: The returned Metrics implementation is safe for concurrent use
|
||||
// as log.Logger is thread-safe.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// logger := log.New(os.Stdout, "[CB] ", log.LstdFlags)
|
||||
// metrics := MakeMetricsFromLogger("UserService", logger)
|
||||
//
|
||||
// // Use with circuit breaker
|
||||
// io.Run(metrics.Open(time.Now()))
|
||||
// // Output: [CB] 2026/01/09 15:30:45 Open: UserService, 2026-01-09 15:30:45.123 +0100 CET
|
||||
//
|
||||
// io.Run(metrics.Reject(time.Now()))
|
||||
// // Output: [CB] 2026/01/09 15:30:46 Reject: UserService, 2026-01-09 15:30:46.456 +0100 CET
|
||||
func MakeMetricsFromLogger(name string, logger *log.Logger) Metrics {
|
||||
return &loggingMetrics{name: name, logger: logger}
|
||||
}
|
||||
|
||||
// Open implements the Metrics interface for voidMetrics.
|
||||
// Returns a no-op IO operation that does nothing.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *voidMetrics) Open(_ time.Time) IO[Void] {
|
||||
return m.noop
|
||||
}
|
||||
|
||||
// Accept implements the Metrics interface for voidMetrics.
|
||||
// Returns a no-op IO operation that does nothing.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *voidMetrics) Accept(_ time.Time) IO[Void] {
|
||||
return m.noop
|
||||
}
|
||||
|
||||
// Canary implements the Metrics interface for voidMetrics.
|
||||
// Returns a no-op IO operation that does nothing.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *voidMetrics) Canary(_ time.Time) IO[Void] {
|
||||
return m.noop
|
||||
}
|
||||
|
||||
// Close implements the Metrics interface for voidMetrics.
|
||||
// Returns a no-op IO operation that does nothing.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *voidMetrics) Close(_ time.Time) IO[Void] {
|
||||
return m.noop
|
||||
}
|
||||
|
||||
// Reject implements the Metrics interface for voidMetrics.
|
||||
// Returns a no-op IO operation that does nothing.
|
||||
//
|
||||
// Thread Safety: Safe for concurrent use.
|
||||
func (m *voidMetrics) Reject(_ time.Time) IO[Void] {
|
||||
return m.noop
|
||||
}
|
||||
|
||||
// MakeVoidMetrics creates a no-op Metrics implementation that performs no operations.
|
||||
// All methods return the same pre-allocated IO[Void] operation that does nothing when executed.
|
||||
//
|
||||
// This is useful for:
|
||||
// - Testing scenarios where metrics collection is not needed
|
||||
// - Production environments where metrics overhead should be eliminated
|
||||
// - Benchmarking circuit breaker logic without metrics interference
|
||||
// - Default initialization when no metrics implementation is provided
|
||||
//
|
||||
// Returns:
|
||||
// - Metrics: A thread-safe no-op Metrics implementation
|
||||
//
|
||||
// Thread Safety: The returned Metrics implementation is safe for concurrent use.
|
||||
// All methods return the same immutable IO[Void] operation.
|
||||
//
|
||||
// Performance: This is the most efficient Metrics implementation with minimal overhead.
|
||||
// The IO[Void] operation is pre-allocated once and reused for all method calls.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// metrics := MakeVoidMetrics()
|
||||
//
|
||||
// // All operations do nothing
|
||||
// io.Run(metrics.Open(time.Now())) // No-op
|
||||
// io.Run(metrics.Accept(time.Now())) // No-op
|
||||
// io.Run(metrics.Reject(time.Now())) // No-op
|
||||
//
|
||||
// // Useful for testing
|
||||
// breaker := MakeCircuitBreaker(
|
||||
// // ... other parameters ...
|
||||
// MakeVoidMetrics(), // No metrics overhead
|
||||
// )
|
||||
func MakeVoidMetrics() Metrics {
|
||||
return &voidMetrics{io.Of(function.VOID)}
|
||||
}
|
||||
946
v2/circuitbreaker/metrics_test.go
Normal file
946
v2/circuitbreaker/metrics_test.go
Normal file
@@ -0,0 +1,946 @@
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"log"
|
||||
"strings"
|
||||
"sync"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestMakeMetricsFromLogger tests the MakeMetricsFromLogger constructor
|
||||
func TestMakeMetricsFromLogger(t *testing.T) {
|
||||
t.Run("creates valid Metrics implementation", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
|
||||
assert.NotNil(t, metrics, "MakeMetricsFromLogger should return non-nil Metrics")
|
||||
})
|
||||
|
||||
t.Run("returns loggingMetrics type", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
|
||||
_, ok := metrics.(*loggingMetrics)
|
||||
assert.True(t, ok, "should return *loggingMetrics type")
|
||||
})
|
||||
|
||||
t.Run("stores name correctly", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
name := "MyCircuitBreaker"
|
||||
|
||||
metrics := MakeMetricsFromLogger(name, logger).(*loggingMetrics)
|
||||
|
||||
assert.Equal(t, name, metrics.name, "name should be stored correctly")
|
||||
})
|
||||
|
||||
t.Run("stores logger correctly", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger).(*loggingMetrics)
|
||||
|
||||
assert.Equal(t, logger, metrics.logger, "logger should be stored correctly")
|
||||
})
|
||||
}
|
||||
|
||||
// TestLoggingMetricsAccept tests the Accept method
|
||||
func TestLoggingMetricsAccept(t *testing.T) {
|
||||
t.Run("logs accept event with correct format", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Date(2026, 1, 9, 15, 30, 45, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "Accept:", "should contain Accept prefix")
|
||||
assert.Contains(t, output, "TestCircuit", "should contain circuit name")
|
||||
assert.Contains(t, output, timestamp.String(), "should contain timestamp")
|
||||
})
|
||||
|
||||
t.Run("returns IO[Void] that can be executed", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Accept(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
result := io.Run(ioOp)
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
|
||||
t.Run("logs multiple accept events", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
time1 := time.Date(2026, 1, 9, 15, 30, 0, 0, time.UTC)
|
||||
time2 := time.Date(2026, 1, 9, 15, 31, 0, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Accept(time1))
|
||||
io.Run(metrics.Accept(time2))
|
||||
|
||||
output := buf.String()
|
||||
lines := strings.Split(strings.TrimSpace(output), "\n")
|
||||
assert.Len(t, lines, 2, "should have 2 log lines")
|
||||
assert.Contains(t, lines[0], time1.String())
|
||||
assert.Contains(t, lines[1], time2.String())
|
||||
})
|
||||
}
|
||||
|
||||
// TestLoggingMetricsReject tests the Reject method
|
||||
func TestLoggingMetricsReject(t *testing.T) {
|
||||
t.Run("logs reject event with correct format", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Date(2026, 1, 9, 15, 30, 45, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Reject(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "Reject:", "should contain Reject prefix")
|
||||
assert.Contains(t, output, "TestCircuit", "should contain circuit name")
|
||||
assert.Contains(t, output, timestamp.String(), "should contain timestamp")
|
||||
})
|
||||
|
||||
t.Run("returns IO[Void] that can be executed", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Reject(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
result := io.Run(ioOp)
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
}
|
||||
|
||||
// TestLoggingMetricsOpen tests the Open method
|
||||
func TestLoggingMetricsOpen(t *testing.T) {
|
||||
t.Run("logs open event with correct format", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Date(2026, 1, 9, 15, 30, 45, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Open(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "Open:", "should contain Open prefix")
|
||||
assert.Contains(t, output, "TestCircuit", "should contain circuit name")
|
||||
assert.Contains(t, output, timestamp.String(), "should contain timestamp")
|
||||
})
|
||||
|
||||
t.Run("returns IO[Void] that can be executed", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Open(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
result := io.Run(ioOp)
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
}
|
||||
|
||||
// TestLoggingMetricsClose tests the Close method
|
||||
func TestLoggingMetricsClose(t *testing.T) {
|
||||
t.Run("logs close event with correct format", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Date(2026, 1, 9, 15, 30, 45, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Close(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "Close:", "should contain Close prefix")
|
||||
assert.Contains(t, output, "TestCircuit", "should contain circuit name")
|
||||
assert.Contains(t, output, timestamp.String(), "should contain timestamp")
|
||||
})
|
||||
|
||||
t.Run("returns IO[Void] that can be executed", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Close(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
result := io.Run(ioOp)
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
}
|
||||
|
||||
// TestLoggingMetricsCanary tests the Canary method
|
||||
func TestLoggingMetricsCanary(t *testing.T) {
|
||||
t.Run("logs canary event with correct format", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Date(2026, 1, 9, 15, 30, 45, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Canary(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "Canary:", "should contain Canary prefix")
|
||||
assert.Contains(t, output, "TestCircuit", "should contain circuit name")
|
||||
assert.Contains(t, output, timestamp.String(), "should contain timestamp")
|
||||
})
|
||||
|
||||
t.Run("returns IO[Void] that can be executed", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Canary(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
result := io.Run(ioOp)
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
}
|
||||
|
||||
// TestLoggingMetricsDoLog tests the doLog helper method
|
||||
func TestLoggingMetricsDoLog(t *testing.T) {
|
||||
t.Run("formats log message correctly", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := &loggingMetrics{name: "TestCircuit", logger: logger}
|
||||
timestamp := time.Date(2026, 1, 9, 15, 30, 45, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.doLog("CustomEvent", timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "CustomEvent:", "should contain custom prefix")
|
||||
assert.Contains(t, output, "TestCircuit", "should contain circuit name")
|
||||
assert.Contains(t, output, timestamp.String(), "should contain timestamp")
|
||||
})
|
||||
|
||||
t.Run("handles different prefixes", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := &loggingMetrics{name: "TestCircuit", logger: logger}
|
||||
timestamp := time.Now()
|
||||
|
||||
prefixes := []string{"Accept", "Reject", "Open", "Close", "Canary", "Custom"}
|
||||
for _, prefix := range prefixes {
|
||||
buf.Reset()
|
||||
io.Run(metrics.doLog(prefix, timestamp))
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, prefix+":", "should contain prefix: "+prefix)
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
// TestMetricsIntegration tests integration scenarios
|
||||
func TestMetricsIntegration(t *testing.T) {
|
||||
t.Run("logs complete circuit breaker lifecycle", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("APICircuit", logger)
|
||||
baseTime := time.Date(2026, 1, 9, 15, 30, 0, 0, time.UTC)
|
||||
|
||||
// Simulate circuit breaker lifecycle
|
||||
io.Run(metrics.Accept(baseTime)) // Request accepted
|
||||
io.Run(metrics.Accept(baseTime.Add(1 * time.Second))) // Another request
|
||||
io.Run(metrics.Open(baseTime.Add(2 * time.Second))) // Circuit opens
|
||||
io.Run(metrics.Reject(baseTime.Add(3 * time.Second))) // Request rejected
|
||||
io.Run(metrics.Canary(baseTime.Add(30 * time.Second))) // Canary attempt
|
||||
io.Run(metrics.Close(baseTime.Add(31 * time.Second))) // Circuit closes
|
||||
|
||||
output := buf.String()
|
||||
lines := strings.Split(strings.TrimSpace(output), "\n")
|
||||
assert.Len(t, lines, 6, "should have 6 log lines")
|
||||
|
||||
assert.Contains(t, lines[0], "Accept:")
|
||||
assert.Contains(t, lines[1], "Accept:")
|
||||
assert.Contains(t, lines[2], "Open:")
|
||||
assert.Contains(t, lines[3], "Reject:")
|
||||
assert.Contains(t, lines[4], "Canary:")
|
||||
assert.Contains(t, lines[5], "Close:")
|
||||
})
|
||||
|
||||
t.Run("distinguishes between multiple circuit breakers", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics1 := MakeMetricsFromLogger("Circuit1", logger)
|
||||
metrics2 := MakeMetricsFromLogger("Circuit2", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
io.Run(metrics1.Accept(timestamp))
|
||||
io.Run(metrics2.Accept(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "Circuit1", "should contain first circuit name")
|
||||
assert.Contains(t, output, "Circuit2", "should contain second circuit name")
|
||||
})
|
||||
}
|
||||
|
||||
// TestMetricsThreadSafety tests concurrent access to metrics
|
||||
func TestMetricsThreadSafety(t *testing.T) {
|
||||
t.Run("handles concurrent metric recording", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("ConcurrentCircuit", logger)
|
||||
|
||||
var wg sync.WaitGroup
|
||||
numGoroutines := 100
|
||||
wg.Add(numGoroutines)
|
||||
|
||||
// Launch multiple goroutines recording metrics concurrently
|
||||
for i := 0; i < numGoroutines; i++ {
|
||||
go func(id int) {
|
||||
defer wg.Done()
|
||||
timestamp := time.Now()
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
}(i)
|
||||
}
|
||||
|
||||
wg.Wait()
|
||||
|
||||
output := buf.String()
|
||||
lines := strings.Split(strings.TrimSpace(output), "\n")
|
||||
assert.Len(t, lines, numGoroutines, "should have logged all events")
|
||||
})
|
||||
|
||||
t.Run("handles concurrent different event types", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("ConcurrentCircuit", logger)
|
||||
|
||||
var wg sync.WaitGroup
|
||||
numIterations := 20
|
||||
wg.Add(numIterations * 5) // 5 event types
|
||||
|
||||
timestamp := time.Now()
|
||||
|
||||
for i := 0; i < numIterations; i++ {
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Reject(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Open(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Close(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Canary(timestamp))
|
||||
}()
|
||||
}
|
||||
|
||||
wg.Wait()
|
||||
|
||||
output := buf.String()
|
||||
lines := strings.Split(strings.TrimSpace(output), "\n")
|
||||
assert.Len(t, lines, numIterations*5, "should have logged all events")
|
||||
})
|
||||
}
|
||||
|
||||
// TestMetricsEdgeCases tests edge cases and special scenarios
|
||||
func TestMetricsEdgeCases(t *testing.T) {
|
||||
t.Run("handles empty circuit breaker name", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.NotEmpty(t, output, "should still log even with empty name")
|
||||
})
|
||||
|
||||
t.Run("handles very long circuit breaker name", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
longName := strings.Repeat("VeryLongCircuitBreakerName", 100)
|
||||
metrics := MakeMetricsFromLogger(longName, logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, longName, "should handle long names")
|
||||
})
|
||||
|
||||
t.Run("handles special characters in name", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
specialName := "Circuit-Breaker_123!@#$%^&*()"
|
||||
metrics := MakeMetricsFromLogger(specialName, logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, specialName, "should handle special characters")
|
||||
})
|
||||
|
||||
t.Run("handles zero time", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
zeroTime := time.Time{}
|
||||
|
||||
io.Run(metrics.Accept(zeroTime))
|
||||
|
||||
output := buf.String()
|
||||
assert.NotEmpty(t, output, "should handle zero time")
|
||||
assert.Contains(t, output, "Accept:")
|
||||
})
|
||||
|
||||
t.Run("handles far future time", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
futureTime := time.Date(9999, 12, 31, 23, 59, 59, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Accept(futureTime))
|
||||
|
||||
output := buf.String()
|
||||
assert.NotEmpty(t, output, "should handle far future time")
|
||||
assert.Contains(t, output, "9999")
|
||||
})
|
||||
}
|
||||
|
||||
// TestMetricsWithCustomLogger tests metrics with different logger configurations
|
||||
func TestMetricsWithCustomLogger(t *testing.T) {
|
||||
t.Run("works with logger with custom prefix", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "[CB] ", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.Contains(t, output, "[CB]", "should include custom prefix")
|
||||
assert.Contains(t, output, "Accept:")
|
||||
})
|
||||
|
||||
t.Run("works with logger with flags", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", log.Ldate|log.Ltime)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
|
||||
output := buf.String()
|
||||
assert.NotEmpty(t, output, "should log with flags")
|
||||
assert.Contains(t, output, "Accept:")
|
||||
})
|
||||
}
|
||||
|
||||
// TestMetricsIOOperations tests IO operation behavior
|
||||
func TestMetricsIOOperations(t *testing.T) {
|
||||
t.Run("IO operations are lazy", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
// Create IO operation but don't execute it
|
||||
_ = metrics.Accept(timestamp)
|
||||
|
||||
// Buffer should be empty because IO wasn't executed
|
||||
assert.Empty(t, buf.String(), "IO operation should be lazy")
|
||||
})
|
||||
|
||||
t.Run("IO operations execute when run", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Accept(timestamp)
|
||||
io.Run(ioOp)
|
||||
|
||||
assert.NotEmpty(t, buf.String(), "IO operation should execute when run")
|
||||
})
|
||||
|
||||
t.Run("same IO operation can be executed multiple times", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
metrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Accept(timestamp)
|
||||
io.Run(ioOp)
|
||||
io.Run(ioOp)
|
||||
io.Run(ioOp)
|
||||
|
||||
output := buf.String()
|
||||
lines := strings.Split(strings.TrimSpace(output), "\n")
|
||||
assert.Len(t, lines, 3, "should execute multiple times")
|
||||
})
|
||||
}
|
||||
|
||||
// TestMakeVoidMetrics tests the MakeVoidMetrics constructor
|
||||
func TestMakeVoidMetrics(t *testing.T) {
|
||||
t.Run("creates valid Metrics implementation", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
|
||||
assert.NotNil(t, metrics, "MakeVoidMetrics should return non-nil Metrics")
|
||||
})
|
||||
|
||||
t.Run("returns voidMetrics type", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
|
||||
_, ok := metrics.(*voidMetrics)
|
||||
assert.True(t, ok, "should return *voidMetrics type")
|
||||
})
|
||||
|
||||
t.Run("initializes noop IO operation", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics().(*voidMetrics)
|
||||
|
||||
assert.NotNil(t, metrics.noop, "noop IO operation should be initialized")
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsAccept tests the Accept method of voidMetrics
|
||||
func TestVoidMetricsAccept(t *testing.T) {
|
||||
t.Run("returns non-nil IO operation", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Accept(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
})
|
||||
|
||||
t.Run("IO operation executes without side effects", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Accept(timestamp)
|
||||
result := io.Run(ioOp)
|
||||
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
|
||||
t.Run("returns same IO operation instance", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics().(*voidMetrics)
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp1 := metrics.Accept(timestamp)
|
||||
ioOp2 := metrics.Accept(timestamp)
|
||||
|
||||
// Both should be non-nil (we can't compare functions directly in Go)
|
||||
assert.NotNil(t, ioOp1, "should return non-nil IO operation")
|
||||
assert.NotNil(t, ioOp2, "should return non-nil IO operation")
|
||||
|
||||
// Verify they execute without error
|
||||
io.Run(ioOp1)
|
||||
io.Run(ioOp2)
|
||||
})
|
||||
|
||||
t.Run("ignores timestamp parameter", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
time1 := time.Date(2026, 1, 9, 15, 30, 0, 0, time.UTC)
|
||||
time2 := time.Date(2026, 1, 9, 16, 30, 0, 0, time.UTC)
|
||||
|
||||
ioOp1 := metrics.Accept(time1)
|
||||
ioOp2 := metrics.Accept(time2)
|
||||
|
||||
// Should return same operation regardless of timestamp
|
||||
io.Run(ioOp1)
|
||||
io.Run(ioOp2)
|
||||
// No assertions needed - just verify it doesn't panic
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsReject tests the Reject method of voidMetrics
|
||||
func TestVoidMetricsReject(t *testing.T) {
|
||||
t.Run("returns non-nil IO operation", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Reject(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
})
|
||||
|
||||
t.Run("IO operation executes without side effects", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Reject(timestamp)
|
||||
result := io.Run(ioOp)
|
||||
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
|
||||
t.Run("returns same IO operation instance", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Reject(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
io.Run(ioOp) // Verify it executes without error
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsOpen tests the Open method of voidMetrics
|
||||
func TestVoidMetricsOpen(t *testing.T) {
|
||||
t.Run("returns non-nil IO operation", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Open(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
})
|
||||
|
||||
t.Run("IO operation executes without side effects", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Open(timestamp)
|
||||
result := io.Run(ioOp)
|
||||
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
|
||||
t.Run("returns same IO operation instance", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Open(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
io.Run(ioOp) // Verify it executes without error
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsClose tests the Close method of voidMetrics
|
||||
func TestVoidMetricsClose(t *testing.T) {
|
||||
t.Run("returns non-nil IO operation", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Close(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
})
|
||||
|
||||
t.Run("IO operation executes without side effects", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Close(timestamp)
|
||||
result := io.Run(ioOp)
|
||||
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
|
||||
t.Run("returns same IO operation instance", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Close(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
io.Run(ioOp) // Verify it executes without error
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsCanary tests the Canary method of voidMetrics
|
||||
func TestVoidMetricsCanary(t *testing.T) {
|
||||
t.Run("returns non-nil IO operation", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Canary(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
})
|
||||
|
||||
t.Run("IO operation executes without side effects", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Canary(timestamp)
|
||||
result := io.Run(ioOp)
|
||||
|
||||
assert.NotNil(t, result, "IO operation should execute successfully")
|
||||
})
|
||||
|
||||
t.Run("returns same IO operation instance", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Canary(timestamp)
|
||||
|
||||
assert.NotNil(t, ioOp, "should return non-nil IO operation")
|
||||
io.Run(ioOp) // Verify it executes without error
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsThreadSafety tests concurrent access to voidMetrics
|
||||
func TestVoidMetricsThreadSafety(t *testing.T) {
|
||||
t.Run("handles concurrent metric calls", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
|
||||
var wg sync.WaitGroup
|
||||
numGoroutines := 100
|
||||
wg.Add(numGoroutines * 5) // 5 methods
|
||||
|
||||
timestamp := time.Now()
|
||||
|
||||
// Launch multiple goroutines calling all methods concurrently
|
||||
for i := 0; i < numGoroutines; i++ {
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Reject(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Open(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Close(timestamp))
|
||||
}()
|
||||
go func() {
|
||||
defer wg.Done()
|
||||
io.Run(metrics.Canary(timestamp))
|
||||
}()
|
||||
}
|
||||
|
||||
wg.Wait()
|
||||
// Test passes if no panic occurs
|
||||
})
|
||||
|
||||
t.Run("all methods return valid IO operations concurrently", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
|
||||
var wg sync.WaitGroup
|
||||
numGoroutines := 50
|
||||
wg.Add(numGoroutines)
|
||||
|
||||
timestamp := time.Now()
|
||||
results := make([]IO[Void], numGoroutines)
|
||||
|
||||
for i := 0; i < numGoroutines; i++ {
|
||||
go func(idx int) {
|
||||
defer wg.Done()
|
||||
// Each goroutine calls a different method
|
||||
switch idx % 5 {
|
||||
case 0:
|
||||
results[idx] = metrics.Accept(timestamp)
|
||||
case 1:
|
||||
results[idx] = metrics.Reject(timestamp)
|
||||
case 2:
|
||||
results[idx] = metrics.Open(timestamp)
|
||||
case 3:
|
||||
results[idx] = metrics.Close(timestamp)
|
||||
case 4:
|
||||
results[idx] = metrics.Canary(timestamp)
|
||||
}
|
||||
}(i)
|
||||
}
|
||||
|
||||
wg.Wait()
|
||||
|
||||
// All results should be non-nil and executable
|
||||
for i, result := range results {
|
||||
assert.NotNil(t, result, "result %d should be non-nil", i)
|
||||
io.Run(result) // Verify it executes without error
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsPerformance tests performance characteristics
|
||||
func TestVoidMetricsPerformance(t *testing.T) {
|
||||
t.Run("has minimal overhead", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
// Execute many operations quickly
|
||||
iterations := 10000
|
||||
for i := 0; i < iterations; i++ {
|
||||
io.Run(metrics.Accept(timestamp))
|
||||
io.Run(metrics.Reject(timestamp))
|
||||
io.Run(metrics.Open(timestamp))
|
||||
io.Run(metrics.Close(timestamp))
|
||||
io.Run(metrics.Canary(timestamp))
|
||||
}
|
||||
// Test passes if it completes quickly without issues
|
||||
})
|
||||
|
||||
t.Run("all methods return valid IO operations", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
// All methods should return non-nil IO operations
|
||||
accept := metrics.Accept(timestamp)
|
||||
reject := metrics.Reject(timestamp)
|
||||
open := metrics.Open(timestamp)
|
||||
close := metrics.Close(timestamp)
|
||||
canary := metrics.Canary(timestamp)
|
||||
|
||||
assert.NotNil(t, accept, "Accept should return non-nil")
|
||||
assert.NotNil(t, reject, "Reject should return non-nil")
|
||||
assert.NotNil(t, open, "Open should return non-nil")
|
||||
assert.NotNil(t, close, "Close should return non-nil")
|
||||
assert.NotNil(t, canary, "Canary should return non-nil")
|
||||
|
||||
// All should execute without error
|
||||
io.Run(accept)
|
||||
io.Run(reject)
|
||||
io.Run(open)
|
||||
io.Run(close)
|
||||
io.Run(canary)
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsIntegration tests integration scenarios
|
||||
func TestVoidMetricsIntegration(t *testing.T) {
|
||||
t.Run("can be used as drop-in replacement for loggingMetrics", func(t *testing.T) {
|
||||
// Create both types of metrics
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
loggingMetrics := MakeMetricsFromLogger("TestCircuit", logger)
|
||||
voidMetrics := MakeVoidMetrics()
|
||||
|
||||
timestamp := time.Now()
|
||||
|
||||
// Both should implement the same interface
|
||||
var m1 Metrics = loggingMetrics
|
||||
var m2 Metrics = voidMetrics
|
||||
|
||||
// Both should be callable
|
||||
io.Run(m1.Accept(timestamp))
|
||||
io.Run(m2.Accept(timestamp))
|
||||
|
||||
// Logging metrics should have output
|
||||
assert.NotEmpty(t, buf.String(), "logging metrics should produce output")
|
||||
|
||||
// Void metrics should have no observable side effects
|
||||
// (we can't directly test this, but the test passes if no panic occurs)
|
||||
})
|
||||
|
||||
t.Run("simulates complete circuit breaker lifecycle without side effects", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
baseTime := time.Date(2026, 1, 9, 15, 30, 0, 0, time.UTC)
|
||||
|
||||
// Simulate circuit breaker lifecycle - all should be no-ops
|
||||
io.Run(metrics.Accept(baseTime))
|
||||
io.Run(metrics.Accept(baseTime.Add(1 * time.Second)))
|
||||
io.Run(metrics.Open(baseTime.Add(2 * time.Second)))
|
||||
io.Run(metrics.Reject(baseTime.Add(3 * time.Second)))
|
||||
io.Run(metrics.Canary(baseTime.Add(30 * time.Second)))
|
||||
io.Run(metrics.Close(baseTime.Add(31 * time.Second)))
|
||||
|
||||
// Test passes if no panic occurs and completes quickly
|
||||
})
|
||||
}
|
||||
|
||||
// TestVoidMetricsEdgeCases tests edge cases
|
||||
func TestVoidMetricsEdgeCases(t *testing.T) {
|
||||
t.Run("handles zero time", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
zeroTime := time.Time{}
|
||||
|
||||
io.Run(metrics.Accept(zeroTime))
|
||||
io.Run(metrics.Reject(zeroTime))
|
||||
io.Run(metrics.Open(zeroTime))
|
||||
io.Run(metrics.Close(zeroTime))
|
||||
io.Run(metrics.Canary(zeroTime))
|
||||
|
||||
// Test passes if no panic occurs
|
||||
})
|
||||
|
||||
t.Run("handles far future time", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
futureTime := time.Date(9999, 12, 31, 23, 59, 59, 0, time.UTC)
|
||||
|
||||
io.Run(metrics.Accept(futureTime))
|
||||
io.Run(metrics.Reject(futureTime))
|
||||
io.Run(metrics.Open(futureTime))
|
||||
io.Run(metrics.Close(futureTime))
|
||||
io.Run(metrics.Canary(futureTime))
|
||||
|
||||
// Test passes if no panic occurs
|
||||
})
|
||||
|
||||
t.Run("IO operations are idempotent", func(t *testing.T) {
|
||||
metrics := MakeVoidMetrics()
|
||||
timestamp := time.Now()
|
||||
|
||||
ioOp := metrics.Accept(timestamp)
|
||||
|
||||
// Execute same operation multiple times
|
||||
io.Run(ioOp)
|
||||
io.Run(ioOp)
|
||||
io.Run(ioOp)
|
||||
|
||||
// Test passes if no panic occurs
|
||||
})
|
||||
}
|
||||
|
||||
// TestMetricsComparison compares loggingMetrics and voidMetrics
|
||||
func TestMetricsComparison(t *testing.T) {
|
||||
t.Run("both implement Metrics interface", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
|
||||
var m1 Metrics = MakeMetricsFromLogger("Test", logger)
|
||||
var m2 Metrics = MakeVoidMetrics()
|
||||
|
||||
assert.NotNil(t, m1)
|
||||
assert.NotNil(t, m2)
|
||||
})
|
||||
|
||||
t.Run("voidMetrics has no observable side effects unlike loggingMetrics", func(t *testing.T) {
|
||||
var buf bytes.Buffer
|
||||
logger := log.New(&buf, "", 0)
|
||||
loggingMetrics := MakeMetricsFromLogger("Test", logger)
|
||||
voidMetrics := MakeVoidMetrics()
|
||||
|
||||
timestamp := time.Now()
|
||||
|
||||
// Logging metrics produces output
|
||||
io.Run(loggingMetrics.Accept(timestamp))
|
||||
assert.NotEmpty(t, buf.String(), "logging metrics should produce output")
|
||||
|
||||
// Void metrics has no observable output
|
||||
// (we can only verify it doesn't panic)
|
||||
io.Run(voidMetrics.Accept(timestamp))
|
||||
})
|
||||
}
|
||||
122
v2/circuitbreaker/types.go
Normal file
122
v2/circuitbreaker/types.go
Normal file
@@ -0,0 +1,122 @@
|
||||
// Package circuitbreaker provides a functional implementation of the circuit breaker pattern.
|
||||
// A circuit breaker prevents cascading failures by temporarily blocking requests to a failing service,
|
||||
// allowing it time to recover before retrying.
|
||||
//
|
||||
// # Thread Safety
|
||||
//
|
||||
// All data structures in this package are immutable except for IORef[BreakerState].
|
||||
// The IORef provides thread-safe mutable state through atomic operations.
|
||||
//
|
||||
// Immutable types (safe for concurrent use):
|
||||
// - BreakerState (Either[openState, ClosedState])
|
||||
// - openState
|
||||
// - ClosedState implementations (closedStateWithErrorCount, closedStateWithHistory)
|
||||
// - All function types and readers
|
||||
//
|
||||
// Mutable types (thread-safe through atomic operations):
|
||||
// - IORef[BreakerState] - provides atomic read/write/modify operations
|
||||
//
|
||||
// ClosedState implementations must be thread-safe. The recommended approach is to
|
||||
// return new copies for all operations (Empty, AddError, AddSuccess, Check), which
|
||||
// provides automatic thread safety through immutability.
|
||||
package circuitbreaker
|
||||
|
||||
import (
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/either"
|
||||
"github.com/IBM/fp-go/v2/endomorphism"
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/ioref"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/ord"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
"github.com/IBM/fp-go/v2/predicate"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
"github.com/IBM/fp-go/v2/readerio"
|
||||
"github.com/IBM/fp-go/v2/retry"
|
||||
"github.com/IBM/fp-go/v2/state"
|
||||
)
|
||||
|
||||
type (
|
||||
// Ord is a type alias for ord.Ord, representing a total ordering on type A.
|
||||
// Used for comparing values in a consistent way.
|
||||
Ord[A any] = ord.Ord[A]
|
||||
|
||||
// Option is a type alias for option.Option, representing an optional value.
|
||||
// It can be either Some(value) or None, used for safe handling of nullable values.
|
||||
Option[A any] = option.Option[A]
|
||||
|
||||
// Endomorphism is a type alias for endomorphism.Endomorphism, representing a function from A to A.
|
||||
// Used for transformations that preserve the type.
|
||||
Endomorphism[A any] = endomorphism.Endomorphism[A]
|
||||
|
||||
// IO is a type alias for io.IO, representing a lazy computation that produces a value of type T.
|
||||
// Used for side-effectful operations that are deferred until execution.
|
||||
IO[T any] = io.IO[T]
|
||||
|
||||
// Pair is a type alias for pair.Pair, representing a tuple of two values.
|
||||
// Used for grouping related values together.
|
||||
Pair[L, R any] = pair.Pair[L, R]
|
||||
|
||||
// IORef is a type alias for ioref.IORef, representing a mutable reference to a value of type T.
|
||||
// Used for managing mutable state in a functional way with IO operations.
|
||||
IORef[T any] = ioref.IORef[T]
|
||||
|
||||
// State is a type alias for state.State, representing a stateful computation.
|
||||
// It transforms a state of type T and produces a result of type R.
|
||||
State[T, R any] = state.State[T, R]
|
||||
|
||||
// Either is a type alias for either.Either, representing a value that can be one of two types.
|
||||
// Left[E] represents an error or alternative path, Right[A] represents the success path.
|
||||
Either[E, A any] = either.Either[E, A]
|
||||
|
||||
// Predicate is a type alias for predicate.Predicate, representing a function that tests a value.
|
||||
// Returns true if the value satisfies the predicate condition, false otherwise.
|
||||
Predicate[A any] = predicate.Predicate[A]
|
||||
|
||||
// Reader is a type alias for reader.Reader, representing a computation that depends on an environment R
|
||||
// and produces a value of type A. Used for dependency injection and configuration.
|
||||
Reader[R, A any] = reader.Reader[R, A]
|
||||
|
||||
ReaderIO[R, A any] = readerio.ReaderIO[R, A]
|
||||
|
||||
// openState represents the internal state when the circuit breaker is open.
|
||||
// In the open state, requests are blocked to give the failing service time to recover.
|
||||
// The circuit breaker will transition to a half-open state (canary request) after resetAt.
|
||||
openState struct {
|
||||
// openedAt is the time when the circuit breaker opened the circuit
|
||||
openedAt time.Time
|
||||
|
||||
// resetAt is the time when the circuit breaker should attempt a canary request
|
||||
// to test if the service has recovered. Calculated based on the retry policy.
|
||||
resetAt time.Time
|
||||
|
||||
// retryStatus tracks the current retry attempt information, including the number
|
||||
// of retries and the delay between attempts. Used by the retry policy to calculate
|
||||
// exponential backoff or other retry strategies.
|
||||
retryStatus retry.RetryStatus
|
||||
|
||||
// canaryRequest indicates whether the circuit is in half-open state, allowing
|
||||
// a single test request (canary) to check if the service has recovered.
|
||||
// If true, one request is allowed through to test the service.
|
||||
// If the canary succeeds, the circuit closes; if it fails, the circuit remains open
|
||||
// with an extended reset time.
|
||||
canaryRequest bool
|
||||
}
|
||||
|
||||
// BreakerState represents the current state of the circuit breaker.
|
||||
// It is an Either type where:
|
||||
// - Left[openState] represents an open circuit (requests are blocked)
|
||||
// - Right[ClosedState] represents a closed circuit (requests are allowed through)
|
||||
//
|
||||
// State Transitions:
|
||||
// - Closed -> Open: When failure threshold is exceeded in ClosedState
|
||||
// - Open -> Half-Open: When resetAt is reached (canaryRequest = true)
|
||||
// - Half-Open -> Closed: When canary request succeeds
|
||||
// - Half-Open -> Open: When canary request fails (with extended resetAt)
|
||||
BreakerState = Either[openState, ClosedState]
|
||||
|
||||
Void = function.Void
|
||||
)
|
||||
@@ -19,11 +19,13 @@ package consumer
|
||||
// This is the contravariant map operation for Consumers, analogous to reader.Local
|
||||
// but operating on the input side rather than the output side.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Given a Consumer[R1] that consumes values of type R1, and a function f that
|
||||
// converts R2 to R1, Local creates a new Consumer[R2] that:
|
||||
// 1. Takes a value of type R2
|
||||
// 2. Applies f to convert it to R1
|
||||
// 3. Passes the result to the original Consumer[R1]
|
||||
// 1. Takes a value of type R2
|
||||
// 2. Applies f to convert it to R1
|
||||
// 3. Passes the result to the original Consumer[R1]
|
||||
//
|
||||
// This is particularly useful for adapting consumers to work with different input types,
|
||||
// similar to how reader.Local adapts readers to work with different environment types.
|
||||
@@ -168,7 +170,7 @@ package consumer
|
||||
// - reader.Local transforms the environment before reading
|
||||
// - consumer.Local transforms the input before consuming
|
||||
// - Both are contravariant functors on their input type
|
||||
func Local[R2, R1 any](f func(R2) R1) Operator[R1, R2] {
|
||||
func Local[R1, R2 any](f func(R2) R1) Operator[R1, R2] {
|
||||
return func(c Consumer[R1]) Consumer[R2] {
|
||||
return func(r2 R2) {
|
||||
c(f(r2))
|
||||
|
||||
@@ -29,8 +29,8 @@ import "github.com/IBM/fp-go/v2/io"
|
||||
// )
|
||||
//
|
||||
//go:inline
|
||||
func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
return ChainIOK(io.FromConsumerK(c))
|
||||
func ChainConsumer[A any](c Consumer[A]) Operator[A, Void] {
|
||||
return ChainIOK(io.FromConsumer(c))
|
||||
}
|
||||
|
||||
// ChainFirstConsumer chains a consumer function into a ReaderIO computation, preserving the original value.
|
||||
@@ -61,5 +61,5 @@ func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
//
|
||||
//go:inline
|
||||
func ChainFirstConsumer[A any](c Consumer[A]) Operator[A, A] {
|
||||
return ChainFirstIOK(io.FromConsumerK(c))
|
||||
return ChainFirstIOK(io.FromConsumer(c))
|
||||
}
|
||||
|
||||
74
v2/context/readerio/profunctor.go
Normal file
74
v2/context/readerio/profunctor.go
Normal file
@@ -0,0 +1,74 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerio
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
)
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a context-based ReaderIO.
|
||||
// It applies f to the input context (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Modify the context before passing it to the ReaderIO (via f)
|
||||
// - Transform the result value after the IO effect completes (via g)
|
||||
//
|
||||
// The function f returns both a new context and a CancelFunc that should be called to release resources.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The original result type produced by the ReaderIO
|
||||
// - B: The new output result type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input context (contravariant)
|
||||
// - g: Function to transform the output value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderIO[A] and returns a ReaderIO[B]
|
||||
//
|
||||
//go:inline
|
||||
func Promap[A, B any](f func(context.Context) (context.Context, context.CancelFunc), g func(A) B) Operator[A, B] {
|
||||
return function.Flow2(
|
||||
Local[A](f),
|
||||
Map(g),
|
||||
)
|
||||
}
|
||||
|
||||
// Contramap changes the context during the execution of a ReaderIO.
|
||||
// This is the contravariant functor operation that transforms the input context.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Contramap is an alias for Local and is useful for adapting a ReaderIO to work with
|
||||
// a modified context by providing a function that transforms the context.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The result type (unchanged)
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the context, returning a new context and CancelFunc
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderIO[A] and returns a ReaderIO[A]
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A any](f func(context.Context) (context.Context, context.CancelFunc)) Operator[A, A] {
|
||||
return Local[A](f)
|
||||
}
|
||||
97
v2/context/readerio/profunctor_test.go
Normal file
97
v2/context/readerio/profunctor_test.go
Normal file
@@ -0,0 +1,97 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerio
|
||||
|
||||
import (
|
||||
"context"
|
||||
"strconv"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both context and output", func(t *testing.T) {
|
||||
// ReaderIO that reads a value from context
|
||||
getValue := func(ctx context.Context) IO[int] {
|
||||
return func() int {
|
||||
if v := ctx.Value("key"); v != nil {
|
||||
return v.(int)
|
||||
}
|
||||
return 0
|
||||
}
|
||||
}
|
||||
|
||||
// Transform context and result
|
||||
addKey := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "key", 42)
|
||||
return newCtx, func() {}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(addKey, toString)(getValue)
|
||||
result := adapted(context.Background())()
|
||||
|
||||
assert.Equal(t, "42", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("context transformation", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) IO[int] {
|
||||
return func() int {
|
||||
if v := ctx.Value("key"); v != nil {
|
||||
return v.(int)
|
||||
}
|
||||
return 0
|
||||
}
|
||||
}
|
||||
|
||||
addKey := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "key", 100)
|
||||
return newCtx, func() {}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](addKey)(getValue)
|
||||
result := adapted(context.Background())()
|
||||
|
||||
assert.Equal(t, 100, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLocalBasic tests basic Local functionality
|
||||
func TestLocalBasic(t *testing.T) {
|
||||
t.Run("adds timeout to context", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) IO[bool] {
|
||||
return func() bool {
|
||||
_, hasDeadline := ctx.Deadline()
|
||||
return hasDeadline
|
||||
}
|
||||
}
|
||||
|
||||
addTimeout := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
return context.WithTimeout(ctx, time.Second)
|
||||
}
|
||||
|
||||
adapted := Local[bool](addTimeout)(getValue)
|
||||
result := adapted(context.Background())()
|
||||
|
||||
assert.True(t, result)
|
||||
})
|
||||
}
|
||||
@@ -20,6 +20,7 @@ import (
|
||||
|
||||
"github.com/IBM/fp-go/v2/consumer"
|
||||
"github.com/IBM/fp-go/v2/either"
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/lazy"
|
||||
"github.com/IBM/fp-go/v2/predicate"
|
||||
@@ -78,4 +79,6 @@ type (
|
||||
Trampoline[B, L any] = tailrec.Trampoline[B, L]
|
||||
|
||||
Predicate[A any] = predicate.Predicate[A]
|
||||
|
||||
Void = function.Void
|
||||
)
|
||||
|
||||
@@ -402,7 +402,125 @@ result := pipeline(db)(ctx)()
|
||||
|
||||
## Practical Benefits
|
||||
|
||||
### 1. **Improved Testability**
|
||||
### 1. **Performance: Eager Construction, Lazy Execution**
|
||||
|
||||
One of the most important but often overlooked benefits of point-free style is its performance characteristic: **the program structure is constructed eagerly (at definition time), but execution happens lazily (at runtime)**.
|
||||
|
||||
#### Construction Happens Once
|
||||
|
||||
When you define a pipeline using point-free style with `F.Flow`, `F.Pipe`, or function composition, the composition structure is built immediately at definition time:
|
||||
|
||||
```go
|
||||
// Point-free style - composition built ONCE at definition time
|
||||
var processUser = F.Flow3(
|
||||
getDatabase,
|
||||
SequenceReader[DatabaseConfig, Database],
|
||||
applyConfig(dbConfig),
|
||||
)
|
||||
// The pipeline structure is now fixed in memory
|
||||
```
|
||||
|
||||
#### Execution Happens on Demand
|
||||
|
||||
The actual computation only runs when you provide the final parameters and invoke the result:
|
||||
|
||||
```go
|
||||
// Execute multiple times - only execution cost, no re-composition
|
||||
result1 := processUser(ctx1)() // Fast - reuses pre-built pipeline
|
||||
result2 := processUser(ctx2)() // Fast - reuses pre-built pipeline
|
||||
result3 := processUser(ctx3)() // Fast - reuses pre-built pipeline
|
||||
```
|
||||
|
||||
#### Performance Benefit for Repeated Execution
|
||||
|
||||
If a flow is executed multiple times, the point-free style is significantly more efficient because:
|
||||
|
||||
1. **Composition overhead is paid once** - The function composition happens at definition time
|
||||
2. **No re-interpretation** - Each execution doesn't need to rebuild the pipeline
|
||||
3. **Memory efficiency** - The composed function is created once and reused
|
||||
4. **Better for hot paths** - Ideal for high-frequency operations
|
||||
|
||||
#### Comparison: Point-Free vs. Imperative
|
||||
|
||||
```go
|
||||
// Imperative style - reconstruction on EVERY call
|
||||
func processUserImperative(ctx context.Context) Either[error, Database] {
|
||||
// This function body is re-interpreted/executed every time
|
||||
dbComp := getDatabase()(ctx)()
|
||||
if dbReader, err := either.Unwrap(dbComp); err != nil {
|
||||
return Left[Database](err)
|
||||
}
|
||||
db := dbReader(dbConfig)
|
||||
// ... manual composition happens on every invocation
|
||||
return Right[error](db)
|
||||
}
|
||||
|
||||
// Point-free style - composition built ONCE
|
||||
var processUserPointFree = F.Flow3(
|
||||
getDatabase,
|
||||
SequenceReader[DatabaseConfig, Database],
|
||||
applyConfig(dbConfig),
|
||||
)
|
||||
|
||||
// Benchmark scenario: 1000 executions
|
||||
for i := 0; i < 1000; i++ {
|
||||
// Imperative: pays composition cost 1000 times
|
||||
result := processUserImperative(ctx)()
|
||||
|
||||
// Point-free: pays composition cost once, execution cost 1000 times
|
||||
result := processUserPointFree(ctx)()
|
||||
}
|
||||
```
|
||||
|
||||
#### When This Matters Most
|
||||
|
||||
The performance benefit of eager construction is particularly important for:
|
||||
|
||||
- **High-frequency operations** - APIs, event handlers, request processors
|
||||
- **Batch processing** - Same pipeline processes many items
|
||||
- **Long-running services** - Pipelines defined once at startup, executed millions of times
|
||||
- **Hot code paths** - Performance-critical sections that run repeatedly
|
||||
- **Stream processing** - Processing continuous data streams
|
||||
|
||||
#### Example: API Handler
|
||||
|
||||
```go
|
||||
// Define pipeline once at application startup
|
||||
var handleUserRequest = F.Flow4(
|
||||
parseRequest,
|
||||
SequenceReader[Database, UserRequest],
|
||||
applyDatabase(db),
|
||||
Chain(validateAndProcess),
|
||||
)
|
||||
|
||||
// Execute thousands of times per second
|
||||
func apiHandler(w http.ResponseWriter, r *http.Request) {
|
||||
// No composition overhead - just execution
|
||||
result := handleUserRequest(r.Context())()
|
||||
// ... handle result
|
||||
}
|
||||
```
|
||||
|
||||
#### Memory and CPU Efficiency
|
||||
|
||||
```go
|
||||
// Point-free: O(1) composition overhead
|
||||
var pipeline = F.Flow5(step1, step2, step3, step4, step5)
|
||||
// Composed once, stored in memory
|
||||
|
||||
// Execute N times: O(N) execution cost only
|
||||
for i := 0; i < N; i++ {
|
||||
result := pipeline(input[i])
|
||||
}
|
||||
|
||||
// Imperative: O(N) composition + execution cost
|
||||
for i := 0; i < N; i++ {
|
||||
// Composition logic runs every iteration
|
||||
result := step5(step4(step3(step2(step1(input[i])))))
|
||||
}
|
||||
```
|
||||
|
||||
### 2. **Improved Testability**
|
||||
|
||||
Inject test dependencies easily:
|
||||
|
||||
@@ -418,7 +536,7 @@ testQuery := queryWithDB(testDB)
|
||||
// Same computation, different dependencies
|
||||
```
|
||||
|
||||
### 2. **Better Separation of Concerns**
|
||||
### 3. **Better Separation of Concerns**
|
||||
|
||||
Separate configuration from execution:
|
||||
|
||||
@@ -431,7 +549,7 @@ computation := sequenced(cfg)
|
||||
result := computation(ctx)()
|
||||
```
|
||||
|
||||
### 3. **Enhanced Composability**
|
||||
### 4. **Enhanced Composability**
|
||||
|
||||
Build complex pipelines from simple pieces:
|
||||
|
||||
@@ -444,7 +562,7 @@ var processUser = F.Flow4(
|
||||
)
|
||||
```
|
||||
|
||||
### 4. **Reduced Boilerplate**
|
||||
### 5. **Reduced Boilerplate**
|
||||
|
||||
No need to manually thread parameters:
|
||||
|
||||
@@ -651,6 +769,7 @@ var processUser = func(userID string) ReaderIOResult[ProcessedUser] {
|
||||
5. **Reusability** increases as computations can be specialized early
|
||||
6. **Testability** improves through easy dependency injection
|
||||
7. **Separation of concerns** is clearer (configuration vs. execution)
|
||||
8. **Performance benefit**: Eager construction (once) + lazy execution (many times) = efficiency for repeated operations
|
||||
|
||||
## When to Use Sequence
|
||||
|
||||
|
||||
64
v2/context/readerioresult/circuitbreaker.go
Normal file
64
v2/context/readerioresult/circuitbreaker.go
Normal file
@@ -0,0 +1,64 @@
|
||||
package readerioresult
|
||||
|
||||
import (
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/circuitbreaker"
|
||||
"github.com/IBM/fp-go/v2/context/readerio"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/retry"
|
||||
)
|
||||
|
||||
type (
|
||||
ClosedState = circuitbreaker.ClosedState
|
||||
|
||||
Env[T any] = Pair[IORef[circuitbreaker.BreakerState], ReaderIOResult[T]]
|
||||
|
||||
CircuitBreaker[T any] = State[Env[T], ReaderIOResult[T]]
|
||||
)
|
||||
|
||||
func MakeCircuitBreaker[T any](
|
||||
currentTime IO[time.Time],
|
||||
closedState ClosedState,
|
||||
checkError option.Kleisli[error, error],
|
||||
policy retry.RetryPolicy,
|
||||
metrics circuitbreaker.Metrics,
|
||||
) CircuitBreaker[T] {
|
||||
return circuitbreaker.MakeCircuitBreaker[error, T](
|
||||
Left,
|
||||
ChainFirstIOK,
|
||||
ChainFirstLeftIOK,
|
||||
|
||||
readerio.ChainFirstIOK,
|
||||
|
||||
FromIO,
|
||||
Flap,
|
||||
Flatten,
|
||||
|
||||
currentTime,
|
||||
closedState,
|
||||
circuitbreaker.MakeCircuitBreakerError,
|
||||
checkError,
|
||||
policy,
|
||||
metrics,
|
||||
)
|
||||
}
|
||||
|
||||
func MakeSingletonBreaker[T any](
|
||||
currentTime IO[time.Time],
|
||||
closedState ClosedState,
|
||||
checkError option.Kleisli[error, error],
|
||||
policy retry.RetryPolicy,
|
||||
metrics circuitbreaker.Metrics,
|
||||
) Operator[T, T] {
|
||||
return circuitbreaker.MakeSingletonBreaker(
|
||||
MakeCircuitBreaker[T](
|
||||
currentTime,
|
||||
closedState,
|
||||
checkError,
|
||||
policy,
|
||||
metrics,
|
||||
),
|
||||
closedState,
|
||||
)
|
||||
}
|
||||
246
v2/context/readerioresult/circuitbreaker_doc.md
Normal file
246
v2/context/readerioresult/circuitbreaker_doc.md
Normal file
@@ -0,0 +1,246 @@
|
||||
# Circuit Breaker Documentation
|
||||
|
||||
## Overview
|
||||
|
||||
The `circuitbreaker.go` file provides a circuit breaker implementation for the `readerioresult` package. A circuit breaker is a design pattern used to detect failures and prevent cascading failures in distributed systems by temporarily blocking operations that are likely to fail.
|
||||
|
||||
## Package
|
||||
|
||||
```go
|
||||
package readerioresult
|
||||
```
|
||||
|
||||
This is part of the `context/readerioresult` package, which provides functional programming abstractions for operations that:
|
||||
- Depend on a `context.Context` (Reader aspect)
|
||||
- Perform side effects (IO aspect)
|
||||
- Can fail with an `error` (Result/Either aspect)
|
||||
|
||||
## Type Definitions
|
||||
|
||||
### ClosedState
|
||||
|
||||
```go
|
||||
type ClosedState = circuitbreaker.ClosedState
|
||||
```
|
||||
|
||||
A type alias for the circuit breaker's closed state. When the circuit is closed, requests are allowed to pass through normally. The closed state tracks success and failure counts to determine when to open the circuit.
|
||||
|
||||
### Env[T any]
|
||||
|
||||
```go
|
||||
type Env[T any] = Pair[IORef[circuitbreaker.BreakerState], ReaderIOResult[T]]
|
||||
```
|
||||
|
||||
The environment type for the circuit breaker state machine. It contains:
|
||||
- `IORef[circuitbreaker.BreakerState]`: A mutable reference to the current breaker state
|
||||
- `ReaderIOResult[T]`: The computation to be protected by the circuit breaker
|
||||
|
||||
### CircuitBreaker[T any]
|
||||
|
||||
```go
|
||||
type CircuitBreaker[T any] = State[Env[T], ReaderIOResult[T]]
|
||||
```
|
||||
|
||||
The main circuit breaker type. It's a state monad that:
|
||||
- Takes an environment containing the breaker state and the protected computation
|
||||
- Returns a new environment and a wrapped computation that respects the circuit breaker logic
|
||||
|
||||
## Functions
|
||||
|
||||
### MakeCircuitBreaker
|
||||
|
||||
```go
|
||||
func MakeCircuitBreaker[T any](
|
||||
currentTime IO[time.Time],
|
||||
closedState ClosedState,
|
||||
checkError option.Kleisli[error, error],
|
||||
policy retry.RetryPolicy,
|
||||
logger io.Kleisli[string, string],
|
||||
) CircuitBreaker[T]
|
||||
```
|
||||
|
||||
Creates a new circuit breaker with the specified configuration.
|
||||
|
||||
#### Parameters
|
||||
|
||||
- **currentTime** `IO[time.Time]`: A function that returns the current time. This can be a virtual timer for testing purposes, allowing you to control time progression in tests.
|
||||
|
||||
- **closedState** `ClosedState`: The initial closed state configuration. This defines:
|
||||
- Maximum number of failures before opening the circuit
|
||||
- Time window for counting failures
|
||||
- Other closed state parameters
|
||||
|
||||
- **checkError** `option.Kleisli[error, error]`: A function that determines whether an error should be counted as a failure. Returns:
|
||||
- `Some(error)`: The error should be counted as a failure
|
||||
- `None`: The error should be ignored (not counted as a failure)
|
||||
|
||||
This allows you to distinguish between transient errors (that should trigger circuit breaking) and permanent errors (that shouldn't).
|
||||
|
||||
- **policy** `retry.RetryPolicy`: The retry policy that determines:
|
||||
- How long to wait before attempting to close the circuit (reset time)
|
||||
- Exponential backoff or other delay strategies
|
||||
- Maximum number of retry attempts
|
||||
|
||||
- **logger** `io.Kleisli[string, string]`: A logging function for circuit breaker events. Receives log messages and performs side effects (like writing to a log file or console).
|
||||
|
||||
#### Returns
|
||||
|
||||
A `CircuitBreaker[T]` that wraps computations with circuit breaker logic.
|
||||
|
||||
#### Circuit Breaker States
|
||||
|
||||
The circuit breaker operates in three states:
|
||||
|
||||
1. **Closed**: Normal operation. Requests pass through. Failures are counted.
|
||||
- If failure threshold is exceeded, transitions to Open state
|
||||
|
||||
2. **Open**: Circuit is broken. Requests fail immediately without executing.
|
||||
- After reset time expires, transitions to Half-Open state
|
||||
|
||||
3. **Half-Open** (Canary): Testing if the service has recovered.
|
||||
- Allows a single test request (canary request)
|
||||
- If canary succeeds, transitions to Closed state
|
||||
- If canary fails, transitions back to Open state with extended reset time
|
||||
|
||||
#### Implementation Details
|
||||
|
||||
The function delegates to the generic `circuitbreaker.MakeCircuitBreaker` function, providing the necessary type-specific operations:
|
||||
|
||||
- **Left**: Creates a failed computation from an error
|
||||
- **ChainFirstIOK**: Chains an IO operation that runs for side effects on success
|
||||
- **ChainFirstLeftIOK**: Chains an IO operation that runs for side effects on failure
|
||||
- **FromIO**: Lifts an IO computation into ReaderIOResult
|
||||
- **Flap**: Applies a computation to a function
|
||||
- **Flatten**: Flattens nested ReaderIOResult structures
|
||||
|
||||
These operations allow the generic circuit breaker to work with the `ReaderIOResult` monad.
|
||||
|
||||
## Usage Example
|
||||
|
||||
```go
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/circuitbreaker"
|
||||
"github.com/IBM/fp-go/v2/context/readerioresult"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/ioref"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/retry"
|
||||
)
|
||||
|
||||
// Create a circuit breaker configuration
|
||||
func createCircuitBreaker() readerioresult.CircuitBreaker[string] {
|
||||
// Use real time
|
||||
currentTime := func() time.Time { return time.Now() }
|
||||
|
||||
// Configure closed state: open after 5 failures in 10 seconds
|
||||
closedState := circuitbreaker.MakeClosedState(5, 10*time.Second)
|
||||
|
||||
// Check all errors (count all as failures)
|
||||
checkError := func(err error) option.Option[error] {
|
||||
return option.Some(err)
|
||||
}
|
||||
|
||||
// Retry policy: exponential backoff with max 5 retries
|
||||
policy := retry.Monoid.Concat(
|
||||
retry.LimitRetries(5),
|
||||
retry.ExponentialBackoff(100*time.Millisecond),
|
||||
)
|
||||
|
||||
// Simple logger
|
||||
logger := func(msg string) io.IO[string] {
|
||||
return func() string {
|
||||
fmt.Println("Circuit Breaker:", msg)
|
||||
return msg
|
||||
}
|
||||
}
|
||||
|
||||
return readerioresult.MakeCircuitBreaker[string](
|
||||
currentTime,
|
||||
closedState,
|
||||
checkError,
|
||||
policy,
|
||||
logger,
|
||||
)
|
||||
}
|
||||
|
||||
// Use the circuit breaker
|
||||
func main() {
|
||||
cb := createCircuitBreaker()
|
||||
|
||||
// Create initial state
|
||||
stateRef := ioref.NewIORef(circuitbreaker.InitialState())
|
||||
|
||||
// Your protected operation
|
||||
operation := func(ctx context.Context) readerioresult.IOResult[string] {
|
||||
return func() readerioresult.Result[string] {
|
||||
// Your actual operation here
|
||||
return result.Of("success")
|
||||
}
|
||||
}
|
||||
|
||||
// Apply circuit breaker
|
||||
env := pair.MakePair(stateRef, operation)
|
||||
result := cb(env)
|
||||
|
||||
// Execute the protected operation
|
||||
ctx := context.Background()
|
||||
protectedOp := pair.Tail(result)
|
||||
outcome := protectedOp(ctx)()
|
||||
}
|
||||
```
|
||||
|
||||
## Testing with Virtual Timer
|
||||
|
||||
For testing, you can provide a virtual timer instead of `time.Now()`:
|
||||
|
||||
```go
|
||||
// Virtual timer for testing
|
||||
type VirtualTimer struct {
|
||||
current time.Time
|
||||
}
|
||||
|
||||
func (vt *VirtualTimer) Now() time.Time {
|
||||
return vt.current
|
||||
}
|
||||
|
||||
func (vt *VirtualTimer) Advance(d time.Duration) {
|
||||
vt.current = vt.current.Add(d)
|
||||
}
|
||||
|
||||
// Use in tests
|
||||
func TestCircuitBreaker(t *testing.T) {
|
||||
vt := &VirtualTimer{current: time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC)}
|
||||
|
||||
currentTime := func() time.Time { return vt.Now() }
|
||||
|
||||
cb := readerioresult.MakeCircuitBreaker[string](
|
||||
currentTime,
|
||||
closedState,
|
||||
checkError,
|
||||
policy,
|
||||
logger,
|
||||
)
|
||||
|
||||
// Test circuit breaker behavior
|
||||
// Advance time as needed
|
||||
vt.Advance(5 * time.Second)
|
||||
}
|
||||
```
|
||||
|
||||
## Related Types
|
||||
|
||||
- `circuitbreaker.BreakerState`: The internal state of the circuit breaker (closed or open)
|
||||
- `circuitbreaker.ClosedState`: Configuration for the closed state
|
||||
- `retry.RetryPolicy`: Policy for retry delays and limits
|
||||
- `option.Kleisli[error, error]`: Function type for error checking
|
||||
- `io.Kleisli[string, string]`: Function type for logging
|
||||
|
||||
## See Also
|
||||
|
||||
- `circuitbreaker` package: Generic circuit breaker implementation
|
||||
- `retry` package: Retry policies and strategies
|
||||
- `readerioresult` package: Core ReaderIOResult monad operations
|
||||
974
v2/context/readerioresult/circuitbreaker_test.go
Normal file
974
v2/context/readerioresult/circuitbreaker_test.go
Normal file
@@ -0,0 +1,974 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerioresult
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"log"
|
||||
"sync"
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/IBM/fp-go/v2/array"
|
||||
"github.com/IBM/fp-go/v2/circuitbreaker"
|
||||
"github.com/IBM/fp-go/v2/ioref"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
"github.com/IBM/fp-go/v2/result"
|
||||
"github.com/IBM/fp-go/v2/retry"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
)
|
||||
|
||||
// VirtualTimer provides a controllable time source for testing
|
||||
type VirtualTimer struct {
|
||||
mu sync.Mutex
|
||||
current time.Time
|
||||
}
|
||||
|
||||
// NewVirtualTimer creates a new virtual timer starting at the given time
|
||||
func NewVirtualTimer(start time.Time) *VirtualTimer {
|
||||
return &VirtualTimer{current: start}
|
||||
}
|
||||
|
||||
// Now returns the current virtual time
|
||||
func (vt *VirtualTimer) Now() time.Time {
|
||||
vt.mu.Lock()
|
||||
defer vt.mu.Unlock()
|
||||
return vt.current
|
||||
}
|
||||
|
||||
// Advance moves the virtual time forward by the given duration
|
||||
func (vt *VirtualTimer) Advance(d time.Duration) {
|
||||
vt.mu.Lock()
|
||||
defer vt.mu.Unlock()
|
||||
vt.current = vt.current.Add(d)
|
||||
}
|
||||
|
||||
// Set sets the virtual time to a specific value
|
||||
func (vt *VirtualTimer) Set(t time.Time) {
|
||||
vt.mu.Lock()
|
||||
defer vt.mu.Unlock()
|
||||
vt.current = t
|
||||
}
|
||||
|
||||
// Helper function to create a test logger that collects messages
|
||||
func testMetrics(_ *[]string) circuitbreaker.Metrics {
|
||||
return circuitbreaker.MakeMetricsFromLogger("testMetrics", log.Default())
|
||||
}
|
||||
|
||||
// Helper function to create a simple closed state
|
||||
func testCBClosedState() circuitbreaker.ClosedState {
|
||||
return circuitbreaker.MakeClosedStateCounter(3)
|
||||
}
|
||||
|
||||
// Helper function to create a test retry policy
|
||||
func testCBRetryPolicy() retry.RetryPolicy {
|
||||
return retry.Monoid.Concat(
|
||||
retry.LimitRetries(3),
|
||||
retry.ExponentialBackoff(100*time.Millisecond),
|
||||
)
|
||||
}
|
||||
|
||||
// Helper function that checks all errors
|
||||
func checkAllErrors(err error) option.Option[error] {
|
||||
return option.Some(err)
|
||||
}
|
||||
|
||||
// Helper function that ignores specific errors
|
||||
func ignoreSpecificError(ignoredMsg string) func(error) option.Option[error] {
|
||||
return func(err error) option.Option[error] {
|
||||
if err.Error() == ignoredMsg {
|
||||
return option.None[error]()
|
||||
}
|
||||
return option.Some(err)
|
||||
}
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_SuccessfulOperation tests that successful operations
|
||||
// pass through the circuit breaker without issues
|
||||
func TestCircuitBreaker_SuccessfulOperation(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
// Create initial state
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
// Successful operation
|
||||
operation := Of("success")
|
||||
|
||||
// Apply circuit breaker
|
||||
env := pair.MakePair(stateRef, operation)
|
||||
resultEnv := cb(env)
|
||||
|
||||
// Execute
|
||||
ctx := t.Context()
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.Equal(t, result.Of("success"), outcome)
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_SingleFailure tests that a single failure is handled
|
||||
// but doesn't open the circuit
|
||||
func TestCircuitBreaker_SingleFailure(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
expError := errors.New("operation failed")
|
||||
|
||||
// Failing operation
|
||||
operation := Left[string](expError)
|
||||
|
||||
env := pair.MakePair(stateRef, operation)
|
||||
resultEnv := cb(env)
|
||||
|
||||
ctx := t.Context()
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.Equal(t, result.Left[string](expError), outcome)
|
||||
|
||||
// Circuit should still be closed after one failure
|
||||
state := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsClosed(state))
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_OpensAfterThreshold tests that the circuit opens
|
||||
// after exceeding the failure threshold
|
||||
func TestCircuitBreaker_OpensAfterThreshold(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(), // Opens after 3 failures
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
expError := errors.New("operation failed")
|
||||
|
||||
// Failing operation
|
||||
operation := Left[string](expError)
|
||||
|
||||
ctx := t.Context()
|
||||
|
||||
// Execute 3 failures to open the circuit
|
||||
for range 3 {
|
||||
env := pair.MakePair(stateRef, operation)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
assert.Equal(t, result.Left[string](expError), outcome)
|
||||
}
|
||||
|
||||
// Circuit should now be open
|
||||
state := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsOpen(state))
|
||||
|
||||
// Next request should fail immediately with circuit breaker error
|
||||
env := pair.MakePair(stateRef, operation)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.True(t, result.IsLeft(outcome))
|
||||
_, err := result.Unwrap(outcome)
|
||||
var cbErr *circuitbreaker.CircuitBreakerError
|
||||
assert.ErrorAs(t, err, &cbErr)
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_HalfOpenAfterResetTime tests that the circuit
|
||||
// transitions to half-open state after the reset time
|
||||
func TestCircuitBreaker_HalfOpenAfterResetTime(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
expError := errors.New("operation failed")
|
||||
|
||||
// Failing operation
|
||||
failingOp := Left[string](expError)
|
||||
|
||||
ctx := t.Context()
|
||||
|
||||
// Open the circuit with 3 failures
|
||||
for range 3 {
|
||||
env := pair.MakePair(stateRef, failingOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.Equal(t, result.Left[string](expError), outcome)
|
||||
}
|
||||
|
||||
// Verify circuit is open
|
||||
state := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsOpen(state))
|
||||
|
||||
// Advance time past the reset time (exponential backoff starts at 100ms)
|
||||
vt.Advance(200 * time.Millisecond)
|
||||
|
||||
// Now create a successful operation for the canary request
|
||||
successOp := Of("success")
|
||||
|
||||
// Next request should be a canary request
|
||||
env := pair.MakePair(stateRef, successOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
// Canary should succeed
|
||||
assert.Equal(t, result.Of("success"), outcome)
|
||||
|
||||
// Circuit should now be closed again
|
||||
state = ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsClosed(state))
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_CanaryFailureExtendsOpenTime tests that a failed
|
||||
// canary request extends the open time
|
||||
func TestCircuitBreaker_CanaryFailureExtendsOpenTime(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
expError := errors.New("operation failed")
|
||||
|
||||
// Failing operation
|
||||
failingOp := Left[string](expError)
|
||||
|
||||
ctx := t.Context()
|
||||
|
||||
// Open the circuit
|
||||
for range 3 {
|
||||
env := pair.MakePair(stateRef, failingOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
assert.Equal(t, result.Left[string](expError), outcome)
|
||||
}
|
||||
|
||||
// Advance time to trigger canary
|
||||
vt.Advance(200 * time.Millisecond)
|
||||
|
||||
// Canary request fails
|
||||
env := pair.MakePair(stateRef, failingOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.True(t, result.IsLeft(outcome))
|
||||
|
||||
// Circuit should still be open
|
||||
state := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsOpen(state))
|
||||
|
||||
// Immediate next request should fail with circuit breaker error
|
||||
env = pair.MakePair(stateRef, failingOp)
|
||||
resultEnv = cb(env)
|
||||
protectedOp = pair.Tail(resultEnv)
|
||||
outcome = protectedOp(ctx)()
|
||||
|
||||
assert.True(t, result.IsLeft(outcome))
|
||||
_, err := result.Unwrap(outcome)
|
||||
var cbErr *circuitbreaker.CircuitBreakerError
|
||||
assert.ErrorAs(t, err, &cbErr)
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_IgnoredErrorsDoNotCount tests that errors filtered
|
||||
// by checkError don't count toward opening the circuit
|
||||
func TestCircuitBreaker_IgnoredErrorsDoNotCount(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
// Ignore "ignorable error"
|
||||
checkError := ignoreSpecificError("ignorable error")
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkError,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
ctx := t.Context()
|
||||
ignorableError := errors.New("ignorable error")
|
||||
|
||||
// Execute 5 ignorable errors
|
||||
ignorableOp := Left[string](ignorableError)
|
||||
|
||||
for range 5 {
|
||||
env := pair.MakePair(stateRef, ignorableOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
assert.Equal(t, result.Left[string](ignorableError), outcome)
|
||||
}
|
||||
|
||||
// Circuit should still be closed
|
||||
state := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsClosed(state))
|
||||
|
||||
realError := errors.New("real error")
|
||||
|
||||
// Now send a real error
|
||||
realErrorOp := Left[string](realError)
|
||||
|
||||
env := pair.MakePair(stateRef, realErrorOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.Equal(t, result.Left[string](realError), outcome)
|
||||
|
||||
// Circuit should still be closed (only 1 counted error)
|
||||
state = ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsClosed(state))
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_MixedSuccessAndFailure tests the circuit behavior
|
||||
// with a mix of successful and failed operations
|
||||
func TestCircuitBreaker_MixedSuccessAndFailure(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
ctx := t.Context()
|
||||
|
||||
successOp := Of("success")
|
||||
expError := errors.New("failure")
|
||||
|
||||
failOp := Left[string](expError)
|
||||
|
||||
// Pattern: fail, fail, success, fail
|
||||
ops := array.From(failOp, failOp, successOp, failOp)
|
||||
|
||||
for _, op := range ops {
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
_ = protectedOp(ctx)()
|
||||
}
|
||||
|
||||
// Circuit should still be closed (success resets the count)
|
||||
state := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsClosed(state))
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_ConcurrentOperations tests that the circuit breaker
|
||||
// handles concurrent operations correctly
|
||||
func TestCircuitBreaker_ConcurrentOperations(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[int](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
ctx := t.Context()
|
||||
|
||||
var wg sync.WaitGroup
|
||||
results := make([]Result[int], 10)
|
||||
|
||||
// Launch 10 concurrent operations
|
||||
for i := range 10 {
|
||||
wg.Add(1)
|
||||
go func(idx int) {
|
||||
defer wg.Done()
|
||||
|
||||
op := Of(idx)
|
||||
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
results[idx] = protectedOp(ctx)()
|
||||
}(i)
|
||||
}
|
||||
|
||||
wg.Wait()
|
||||
|
||||
// All operations should succeed
|
||||
for i, res := range results {
|
||||
assert.True(t, result.IsRight(res), "Operation %d should succeed", i)
|
||||
}
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_DifferentTypes tests that the circuit breaker works
|
||||
// with different result types
|
||||
func TestCircuitBreaker_DifferentTypes(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
// Test with int
|
||||
cbInt := MakeCircuitBreaker[int](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRefInt := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
opInt := Of(42)
|
||||
|
||||
ctx := t.Context()
|
||||
envInt := pair.MakePair(stateRefInt, opInt)
|
||||
resultEnvInt := cbInt(envInt)
|
||||
protectedOpInt := pair.Tail(resultEnvInt)
|
||||
outcomeInt := protectedOpInt(ctx)()
|
||||
|
||||
assert.Equal(t, result.Of(42), outcomeInt)
|
||||
|
||||
// Test with struct
|
||||
type User struct {
|
||||
ID int
|
||||
Name string
|
||||
}
|
||||
|
||||
cbUser := MakeCircuitBreaker[User](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRefUser := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
opUser := Of(User{ID: 1, Name: "Alice"})
|
||||
|
||||
envUser := pair.MakePair(stateRefUser, opUser)
|
||||
resultEnvUser := cbUser(envUser)
|
||||
protectedOpUser := pair.Tail(resultEnvUser)
|
||||
outcomeUser := protectedOpUser(ctx)()
|
||||
|
||||
require.Equal(t, result.Of(User{ID: 1, Name: "Alice"}), outcomeUser)
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_VirtualTimerAdvancement tests that the virtual timer
|
||||
// correctly controls time-based behavior
|
||||
func TestCircuitBreaker_VirtualTimerAdvancement(t *testing.T) {
|
||||
startTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
vt := NewVirtualTimer(startTime)
|
||||
|
||||
// Verify initial time
|
||||
assert.Equal(t, startTime, vt.Now())
|
||||
|
||||
// Advance by 1 hour
|
||||
vt.Advance(1 * time.Hour)
|
||||
assert.Equal(t, startTime.Add(1*time.Hour), vt.Now())
|
||||
|
||||
// Advance by 30 minutes
|
||||
vt.Advance(30 * time.Minute)
|
||||
assert.Equal(t, startTime.Add(90*time.Minute), vt.Now())
|
||||
|
||||
// Set to specific time
|
||||
newTime := time.Date(2024, 6, 15, 10, 30, 0, 0, time.UTC)
|
||||
vt.Set(newTime)
|
||||
assert.Equal(t, newTime, vt.Now())
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_InitialState tests that the circuit starts in closed state
|
||||
func TestCircuitBreaker_InitialState(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
// Check initial state is closed
|
||||
state := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsClosed(state), "Circuit should start in closed state")
|
||||
|
||||
// First operation should execute normally
|
||||
op := Of("first operation")
|
||||
|
||||
ctx := t.Context()
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.Equal(t, result.Of("first operation"), outcome)
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_ErrorMessageFormat tests that circuit breaker errors
|
||||
// have appropriate error messages
|
||||
func TestCircuitBreaker_ErrorMessageFormat(t *testing.T) {
|
||||
vt := NewVirtualTimer(time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC))
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
|
||||
ctx := t.Context()
|
||||
|
||||
expError := errors.New("service unavailable")
|
||||
|
||||
failOp := Left[string](expError)
|
||||
|
||||
// Open the circuit
|
||||
for range 3 {
|
||||
env := pair.MakePair(stateRef, failOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
_ = protectedOp(ctx)()
|
||||
}
|
||||
|
||||
// Next request should fail with circuit breaker error
|
||||
env := pair.MakePair(stateRef, failOp)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
assert.True(t, result.IsLeft(outcome))
|
||||
|
||||
// Error message should indicate circuit breaker is open
|
||||
_, err := result.Unwrap(outcome)
|
||||
errMsg := err.Error()
|
||||
assert.Contains(t, errMsg, "circuit", "Error should mention circuit breaker")
|
||||
}
|
||||
|
||||
// RequestSpec defines a virtual request with timing and outcome information
|
||||
type RequestSpec struct {
|
||||
ID int // Unique identifier for the request
|
||||
StartTime time.Duration // Virtual start time relative to test start
|
||||
Duration time.Duration // How long the request takes to execute
|
||||
ShouldFail bool // Whether this request should fail
|
||||
}
|
||||
|
||||
// RequestResult captures the outcome of a request execution
|
||||
type RequestResult struct {
|
||||
ID int
|
||||
StartTime time.Time
|
||||
EndTime time.Time
|
||||
Success bool
|
||||
Error error
|
||||
CircuitBreakerError bool // True if failed due to circuit breaker being open
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_ConcurrentBatchWithThresholdExceeded tests a complex
|
||||
// concurrent scenario where:
|
||||
// 1. Initial requests succeed
|
||||
// 2. A batch of failures exceeds the threshold, opening the circuit
|
||||
// 3. Subsequent requests fail immediately due to open circuit
|
||||
// 4. After timeout, a canary request succeeds
|
||||
// 5. Following requests succeed again
|
||||
func TestCircuitBreaker_ConcurrentBatchWithThresholdExceeded(t *testing.T) {
|
||||
startTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
vt := NewVirtualTimer(startTime)
|
||||
var logMessages []string
|
||||
|
||||
// Circuit opens after 3 failures, with exponential backoff starting at 100ms
|
||||
cb := MakeCircuitBreaker[string](
|
||||
vt.Now,
|
||||
testCBClosedState(), // Opens after 3 failures
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(), // 100ms initial backoff
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
ctx := t.Context()
|
||||
|
||||
// Define the request sequence
|
||||
// Phase 1: Initial successes (0-100ms)
|
||||
// Phase 2: Failures that exceed threshold (100-200ms) - should open circuit
|
||||
// Phase 3: Requests during open circuit (200-300ms) - should fail immediately
|
||||
// Phase 4: After timeout (400ms+) - canary succeeds, then more successes
|
||||
requests := []RequestSpec{
|
||||
// Phase 1: Initial successful requests
|
||||
{ID: 1, StartTime: 0 * time.Millisecond, Duration: 10 * time.Millisecond, ShouldFail: false},
|
||||
{ID: 2, StartTime: 20 * time.Millisecond, Duration: 10 * time.Millisecond, ShouldFail: false},
|
||||
|
||||
// Phase 2: Sequential failures that exceed threshold (3 failures)
|
||||
{ID: 3, StartTime: 100 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: true},
|
||||
{ID: 4, StartTime: 110 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: true},
|
||||
{ID: 5, StartTime: 120 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: true},
|
||||
{ID: 6, StartTime: 130 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: true},
|
||||
|
||||
// Phase 3: Requests during open circuit - should fail with circuit breaker error
|
||||
{ID: 7, StartTime: 200 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: false},
|
||||
{ID: 8, StartTime: 210 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: false},
|
||||
{ID: 9, StartTime: 220 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: false},
|
||||
|
||||
// Phase 4: After reset timeout (100ms backoff from last failure at ~125ms = ~225ms)
|
||||
// Wait longer to ensure we're past the reset time
|
||||
{ID: 10, StartTime: 400 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: false}, // Canary succeeds
|
||||
{ID: 11, StartTime: 410 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: false},
|
||||
{ID: 12, StartTime: 420 * time.Millisecond, Duration: 5 * time.Millisecond, ShouldFail: false},
|
||||
}
|
||||
|
||||
results := make([]RequestResult, len(requests))
|
||||
|
||||
// Execute requests sequentially but model them as if they were concurrent
|
||||
// by advancing the virtual timer to each request's start time
|
||||
for i, req := range requests {
|
||||
// Set virtual time to request start time
|
||||
vt.Set(startTime.Add(req.StartTime))
|
||||
|
||||
// Create the operation based on spec
|
||||
var op ReaderIOResult[string]
|
||||
if req.ShouldFail {
|
||||
op = Left[string](errors.New("operation failed"))
|
||||
} else {
|
||||
op = Of("success")
|
||||
}
|
||||
|
||||
// Apply circuit breaker
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
|
||||
// Record start time
|
||||
execStartTime := vt.Now()
|
||||
|
||||
// Execute the operation
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
// Advance time by operation duration
|
||||
vt.Advance(req.Duration)
|
||||
execEndTime := vt.Now()
|
||||
|
||||
// Analyze the result
|
||||
isSuccess := result.IsRight(outcome)
|
||||
var err error
|
||||
var isCBError bool
|
||||
|
||||
if !isSuccess {
|
||||
_, err = result.Unwrap(outcome)
|
||||
var cbErr *circuitbreaker.CircuitBreakerError
|
||||
isCBError = errors.As(err, &cbErr)
|
||||
}
|
||||
|
||||
results[i] = RequestResult{
|
||||
ID: req.ID,
|
||||
StartTime: execStartTime,
|
||||
EndTime: execEndTime,
|
||||
Success: isSuccess,
|
||||
Error: err,
|
||||
CircuitBreakerError: isCBError,
|
||||
}
|
||||
}
|
||||
|
||||
// Verify Phase 1: Initial requests should succeed
|
||||
assert.True(t, results[0].Success, "Request 1 should succeed")
|
||||
assert.True(t, results[1].Success, "Request 2 should succeed")
|
||||
|
||||
// Verify Phase 2: Failures should be recorded (first 3 fail with actual error)
|
||||
// The 4th might fail with CB error if circuit opened fast enough
|
||||
assert.False(t, results[2].Success, "Request 3 should fail")
|
||||
assert.False(t, results[3].Success, "Request 4 should fail")
|
||||
assert.False(t, results[4].Success, "Request 5 should fail")
|
||||
|
||||
// At least the first 3 failures should be actual operation failures, not CB errors
|
||||
actualFailures := 0
|
||||
for i := 2; i <= 4; i++ {
|
||||
if !results[i].CircuitBreakerError {
|
||||
actualFailures++
|
||||
}
|
||||
}
|
||||
assert.GreaterOrEqual(t, actualFailures, 3, "At least 3 actual operation failures should occur")
|
||||
|
||||
// Verify Phase 3: Requests during open circuit should fail with circuit breaker error
|
||||
for i := 6; i <= 8; i++ {
|
||||
assert.False(t, results[i].Success, "Request %d should fail during open circuit", results[i].ID)
|
||||
assert.True(t, results[i].CircuitBreakerError, "Request %d should fail with circuit breaker error", results[i].ID)
|
||||
}
|
||||
|
||||
// Verify Phase 4: After timeout, canary and subsequent requests should succeed
|
||||
assert.True(t, results[9].Success, "Request 10 (canary) should succeed")
|
||||
assert.True(t, results[10].Success, "Request 11 should succeed after circuit closes")
|
||||
assert.True(t, results[11].Success, "Request 12 should succeed after circuit closes")
|
||||
|
||||
// Verify final state is closed
|
||||
finalState := ioref.Read(stateRef)()
|
||||
assert.True(t, circuitbreaker.IsClosed(finalState), "Circuit should be closed at the end")
|
||||
|
||||
// Log summary for debugging
|
||||
t.Logf("Test completed with %d requests", len(results))
|
||||
successCount := 0
|
||||
cbErrorCount := 0
|
||||
actualErrorCount := 0
|
||||
|
||||
for _, r := range results {
|
||||
if r.Success {
|
||||
successCount++
|
||||
} else if r.CircuitBreakerError {
|
||||
cbErrorCount++
|
||||
} else {
|
||||
actualErrorCount++
|
||||
}
|
||||
}
|
||||
|
||||
t.Logf("Summary: %d successes, %d circuit breaker errors, %d actual errors",
|
||||
successCount, cbErrorCount, actualErrorCount)
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_ConcurrentHighLoad tests circuit breaker behavior
|
||||
// under high concurrent load with mixed success/failure patterns
|
||||
func TestCircuitBreaker_ConcurrentHighLoad(t *testing.T) {
|
||||
startTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
vt := NewVirtualTimer(startTime)
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[int](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
ctx := t.Context()
|
||||
|
||||
// Create a large batch of 50 requests
|
||||
// Pattern: success, success, fail, fail, fail, fail, success, success, ...
|
||||
// This ensures we have initial successes, then failures to open circuit,
|
||||
// then more requests that hit the open circuit
|
||||
numRequests := 50
|
||||
|
||||
results := make([]bool, numRequests)
|
||||
cbErrors := make([]bool, numRequests)
|
||||
|
||||
// Execute requests with controlled timing
|
||||
for i := range numRequests {
|
||||
// Advance time slightly for each request
|
||||
vt.Advance(10 * time.Millisecond)
|
||||
|
||||
// Pattern: 2 success, 4 failures, repeat
|
||||
// This ensures we exceed the threshold (3 failures) early on
|
||||
shouldFail := (i%6) >= 2 && (i%6) < 6
|
||||
|
||||
var op ReaderIOResult[int]
|
||||
if shouldFail {
|
||||
op = Left[int](errors.New("simulated failure"))
|
||||
} else {
|
||||
op = Of(i)
|
||||
}
|
||||
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
|
||||
results[i] = result.IsRight(outcome)
|
||||
|
||||
if !results[i] {
|
||||
_, err := result.Unwrap(outcome)
|
||||
var cbErr *circuitbreaker.CircuitBreakerError
|
||||
cbErrors[i] = errors.As(err, &cbErr)
|
||||
}
|
||||
}
|
||||
|
||||
// Count outcomes
|
||||
successCount := 0
|
||||
failureCount := 0
|
||||
cbErrorCount := 0
|
||||
|
||||
for i := range numRequests {
|
||||
if results[i] {
|
||||
successCount++
|
||||
} else {
|
||||
failureCount++
|
||||
if cbErrors[i] {
|
||||
cbErrorCount++
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
t.Logf("High load test: %d total requests", numRequests)
|
||||
t.Logf("Results: %d successes, %d failures (%d circuit breaker errors)",
|
||||
successCount, failureCount, cbErrorCount)
|
||||
|
||||
// Verify that circuit breaker activated (some requests failed due to open circuit)
|
||||
assert.Greater(t, cbErrorCount, 0, "Circuit breaker should have opened and blocked some requests")
|
||||
|
||||
// Verify that not all requests failed (some succeeded before circuit opened)
|
||||
assert.Greater(t, successCount, 0, "Some requests should have succeeded")
|
||||
}
|
||||
|
||||
// TestCircuitBreaker_TrueConcurrentRequests tests actual concurrent execution
|
||||
// with proper synchronization
|
||||
func TestCircuitBreaker_TrueConcurrentRequests(t *testing.T) {
|
||||
startTime := time.Date(2024, 1, 1, 12, 0, 0, 0, time.UTC)
|
||||
vt := NewVirtualTimer(startTime)
|
||||
var logMessages []string
|
||||
|
||||
cb := MakeCircuitBreaker[int](
|
||||
vt.Now,
|
||||
testCBClosedState(),
|
||||
checkAllErrors,
|
||||
testCBRetryPolicy(),
|
||||
testMetrics(&logMessages),
|
||||
)
|
||||
|
||||
stateRef := circuitbreaker.MakeClosedIORef(testCBClosedState())()
|
||||
ctx := t.Context()
|
||||
|
||||
// Launch 20 concurrent requests
|
||||
numRequests := 20
|
||||
var wg sync.WaitGroup
|
||||
results := make([]bool, numRequests)
|
||||
cbErrors := make([]bool, numRequests)
|
||||
|
||||
// First, send some successful requests
|
||||
for i := range 5 {
|
||||
op := Of(i)
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
results[i] = result.IsRight(outcome)
|
||||
}
|
||||
|
||||
// Now send concurrent failures to open the circuit
|
||||
for i := 5; i < 10; i++ {
|
||||
wg.Add(1)
|
||||
go func(idx int) {
|
||||
defer wg.Done()
|
||||
op := Left[int](errors.New("concurrent failure"))
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
results[idx] = result.IsRight(outcome)
|
||||
if !results[idx] {
|
||||
_, err := result.Unwrap(outcome)
|
||||
var cbErr *circuitbreaker.CircuitBreakerError
|
||||
cbErrors[idx] = errors.As(err, &cbErr)
|
||||
}
|
||||
}(i)
|
||||
}
|
||||
|
||||
wg.Wait()
|
||||
|
||||
// Now send more requests that should hit the open circuit
|
||||
for i := 10; i < numRequests; i++ {
|
||||
op := Of(i)
|
||||
env := pair.MakePair(stateRef, op)
|
||||
resultEnv := cb(env)
|
||||
protectedOp := pair.Tail(resultEnv)
|
||||
outcome := protectedOp(ctx)()
|
||||
results[i] = result.IsRight(outcome)
|
||||
if !results[i] {
|
||||
_, err := result.Unwrap(outcome)
|
||||
var cbErr *circuitbreaker.CircuitBreakerError
|
||||
cbErrors[i] = errors.As(err, &cbErr)
|
||||
}
|
||||
}
|
||||
|
||||
// Count outcomes
|
||||
successCount := 0
|
||||
failureCount := 0
|
||||
cbErrorCount := 0
|
||||
|
||||
for i := range numRequests {
|
||||
if results[i] {
|
||||
successCount++
|
||||
} else {
|
||||
failureCount++
|
||||
if cbErrors[i] {
|
||||
cbErrorCount++
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
t.Logf("Concurrent test: %d total requests", numRequests)
|
||||
t.Logf("Results: %d successes, %d failures (%d circuit breaker errors)",
|
||||
successCount, failureCount, cbErrorCount)
|
||||
|
||||
// Verify initial successes
|
||||
assert.Equal(t, 5, successCount, "First 5 requests should succeed")
|
||||
|
||||
// Verify that circuit breaker opened and blocked some requests
|
||||
assert.Greater(t, cbErrorCount, 0, "Circuit breaker should have opened and blocked some requests")
|
||||
}
|
||||
@@ -28,7 +28,7 @@ import "github.com/IBM/fp-go/v2/io"
|
||||
//
|
||||
//go:inline
|
||||
func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
return ChainIOK(io.FromConsumerK(c))
|
||||
return ChainIOK(io.FromConsumer(c))
|
||||
}
|
||||
|
||||
// ChainFirstConsumer chains a consumer function into a ReaderIOResult computation, preserving the original value.
|
||||
@@ -59,5 +59,5 @@ func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
//
|
||||
//go:inline
|
||||
func ChainFirstConsumer[A any](c Consumer[A]) Operator[A, A] {
|
||||
return ChainFirstIOK(io.FromConsumerK(c))
|
||||
return ChainFirstIOK(io.FromConsumer(c))
|
||||
}
|
||||
|
||||
75
v2/context/readerioresult/profunctor.go
Normal file
75
v2/context/readerioresult/profunctor.go
Normal file
@@ -0,0 +1,75 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerioresult
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
)
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a context-based ReaderIOResult.
|
||||
// It applies f to the input context (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Modify the context before passing it to the ReaderIOResult (via f)
|
||||
// - Transform the success value after the IO effect completes (via g)
|
||||
//
|
||||
// The function f returns both a new context and a CancelFunc that should be called to release resources.
|
||||
// The error type is fixed as error and remains unchanged through the transformation.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The original success type produced by the ReaderIOResult
|
||||
// - B: The new output success type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input context (contravariant)
|
||||
// - g: Function to transform the output success value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderIOResult[A] and returns a ReaderIOResult[B]
|
||||
//
|
||||
//go:inline
|
||||
func Promap[A, B any](f func(context.Context) (context.Context, context.CancelFunc), g func(A) B) Operator[A, B] {
|
||||
return function.Flow2(
|
||||
Local[A](f),
|
||||
Map(g),
|
||||
)
|
||||
}
|
||||
|
||||
// Contramap changes the context during the execution of a ReaderIOResult.
|
||||
// This is the contravariant functor operation that transforms the input context.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Contramap is an alias for Local and is useful for adapting a ReaderIOResult to work with
|
||||
// a modified context by providing a function that transforms the context.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The success type (unchanged)
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the context, returning a new context and CancelFunc
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderIOResult[A] and returns a ReaderIOResult[A]
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A any](f func(context.Context) (context.Context, context.CancelFunc)) Operator[A, A] {
|
||||
return Local[A](f)
|
||||
}
|
||||
98
v2/context/readerioresult/profunctor_test.go
Normal file
98
v2/context/readerioresult/profunctor_test.go
Normal file
@@ -0,0 +1,98 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerioresult
|
||||
|
||||
import (
|
||||
"context"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
R "github.com/IBM/fp-go/v2/result"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both context and output", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) IOResult[int] {
|
||||
return func() R.Result[int] {
|
||||
if v := ctx.Value("key"); v != nil {
|
||||
return R.Of(v.(int))
|
||||
}
|
||||
return R.Of(0)
|
||||
}
|
||||
}
|
||||
|
||||
addKey := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "key", 42)
|
||||
return newCtx, func() {}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(addKey, toString)(getValue)
|
||||
result := adapted(context.Background())()
|
||||
|
||||
assert.Equal(t, R.Of("42"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("context transformation", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) IOResult[int] {
|
||||
return func() R.Result[int] {
|
||||
if v := ctx.Value("key"); v != nil {
|
||||
return R.Of(v.(int))
|
||||
}
|
||||
return R.Of(0)
|
||||
}
|
||||
}
|
||||
|
||||
addKey := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "key", 100)
|
||||
return newCtx, func() {}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](addKey)(getValue)
|
||||
result := adapted(context.Background())()
|
||||
|
||||
assert.Equal(t, R.Of(100), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLocalBasic tests basic Local functionality
|
||||
func TestLocalBasic(t *testing.T) {
|
||||
t.Run("adds value to context", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) IOResult[string] {
|
||||
return func() R.Result[string] {
|
||||
if v := ctx.Value("user"); v != nil {
|
||||
return R.Of(v.(string))
|
||||
}
|
||||
return R.Of("unknown")
|
||||
}
|
||||
}
|
||||
|
||||
addUser := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "user", "Alice")
|
||||
return newCtx, func() {}
|
||||
}
|
||||
|
||||
adapted := Local[string](addUser)(getValue)
|
||||
result := adapted(context.Background())()
|
||||
|
||||
assert.Equal(t, R.Of("Alice"), result)
|
||||
})
|
||||
}
|
||||
@@ -966,6 +966,16 @@ func TapLeft[A, B any](f Kleisli[error, B]) Operator[A, A] {
|
||||
return RIOR.TapLeft[A](WithContextK(f))
|
||||
}
|
||||
|
||||
//go:inline
|
||||
func ChainFirstLeftIOK[A, B any](f io.Kleisli[error, B]) Operator[A, A] {
|
||||
return RIOR.ChainFirstLeftIOK[A, context.Context](f)
|
||||
}
|
||||
|
||||
//go:inline
|
||||
func TapLeftIOK[A, B any](f io.Kleisli[error, B]) Operator[A, A] {
|
||||
return RIOR.TapLeftIOK[A, context.Context](f)
|
||||
}
|
||||
|
||||
// Local transforms the context.Context environment before passing it to a ReaderIOResult computation.
|
||||
//
|
||||
// This is the Reader's local operation, which allows you to modify the environment
|
||||
|
||||
@@ -25,10 +25,12 @@ import (
|
||||
"github.com/IBM/fp-go/v2/endomorphism"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/ioeither"
|
||||
"github.com/IBM/fp-go/v2/ioref"
|
||||
"github.com/IBM/fp-go/v2/lazy"
|
||||
"github.com/IBM/fp-go/v2/optics/lens"
|
||||
"github.com/IBM/fp-go/v2/optics/prism"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
"github.com/IBM/fp-go/v2/predicate"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
"github.com/IBM/fp-go/v2/readereither"
|
||||
@@ -36,6 +38,7 @@ import (
|
||||
RIOR "github.com/IBM/fp-go/v2/readerioresult"
|
||||
"github.com/IBM/fp-go/v2/readeroption"
|
||||
"github.com/IBM/fp-go/v2/result"
|
||||
"github.com/IBM/fp-go/v2/state"
|
||||
"github.com/IBM/fp-go/v2/tailrec"
|
||||
)
|
||||
|
||||
@@ -143,4 +146,10 @@ type (
|
||||
Trampoline[B, L any] = tailrec.Trampoline[B, L]
|
||||
|
||||
Predicate[A any] = predicate.Predicate[A]
|
||||
|
||||
Pair[A, B any] = pair.Pair[A, B]
|
||||
|
||||
IORef[A any] = ioref.IORef[A]
|
||||
|
||||
State[S, A any] = state.State[S, A]
|
||||
)
|
||||
|
||||
106
v2/context/readerresult/profunctor.go
Normal file
106
v2/context/readerresult/profunctor.go
Normal file
@@ -0,0 +1,106 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerresult
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
)
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a context-based ReaderResult.
|
||||
// It applies f to the input context (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Modify the context before passing it to the ReaderResult (via f)
|
||||
// - Transform the success value after the computation completes (via g)
|
||||
//
|
||||
// The function f returns both a new context and a CancelFunc that should be called to release resources.
|
||||
// The error type is fixed as error and remains unchanged through the transformation.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The original success type produced by the ReaderResult
|
||||
// - B: The new output success type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input context (contravariant)
|
||||
// - g: Function to transform the output success value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderResult[A] and returns a ReaderResult[B]
|
||||
//
|
||||
//go:inline
|
||||
func Promap[A, B any](f func(context.Context) (context.Context, context.CancelFunc), g func(A) B) Operator[A, B] {
|
||||
return function.Flow2(
|
||||
Local[A](f),
|
||||
Map(g),
|
||||
)
|
||||
}
|
||||
|
||||
// Contramap changes the context during the execution of a ReaderResult.
|
||||
// This is the contravariant functor operation that transforms the input context.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Contramap is an alias for Local and is useful for adapting a ReaderResult to work with
|
||||
// a modified context by providing a function that transforms the context.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The success type (unchanged)
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the context, returning a new context and CancelFunc
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderResult[A] and returns a ReaderResult[A]
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A any](f func(context.Context) (context.Context, context.CancelFunc)) Operator[A, A] {
|
||||
return Local[A](f)
|
||||
}
|
||||
|
||||
// Local changes the context during the execution of a ReaderResult.
|
||||
// This allows you to modify the context before passing it to a ReaderResult computation.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Local is particularly useful for:
|
||||
// - Adding values to the context
|
||||
// - Setting timeouts or deadlines
|
||||
// - Modifying context metadata
|
||||
//
|
||||
// The function f returns both a new context and a CancelFunc. The CancelFunc is automatically
|
||||
// called (via defer) after the ReaderResult computation completes to ensure proper cleanup.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The result type (unchanged)
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the context, returning a new context and CancelFunc
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderResult[A] and returns a ReaderResult[A]
|
||||
func Local[A any](f func(context.Context) (context.Context, context.CancelFunc)) Operator[A, A] {
|
||||
return func(rr ReaderResult[A]) ReaderResult[A] {
|
||||
return func(ctx context.Context) Result[A] {
|
||||
otherCtx, otherCancel := f(ctx)
|
||||
defer otherCancel()
|
||||
return rr(otherCtx)
|
||||
}
|
||||
}
|
||||
}
|
||||
92
v2/context/readerresult/profunctor_test.go
Normal file
92
v2/context/readerresult/profunctor_test.go
Normal file
@@ -0,0 +1,92 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerresult
|
||||
|
||||
import (
|
||||
"context"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
R "github.com/IBM/fp-go/v2/result"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both context and output", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) Result[int] {
|
||||
if v := ctx.Value("key"); v != nil {
|
||||
return R.Of(v.(int))
|
||||
}
|
||||
return R.Of(0)
|
||||
}
|
||||
|
||||
addKey := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "key", 42)
|
||||
return newCtx, func() {}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(addKey, toString)(getValue)
|
||||
result := adapted(context.Background())
|
||||
|
||||
assert.Equal(t, R.Of("42"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("context transformation", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) Result[int] {
|
||||
if v := ctx.Value("key"); v != nil {
|
||||
return R.Of(v.(int))
|
||||
}
|
||||
return R.Of(0)
|
||||
}
|
||||
|
||||
addKey := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "key", 100)
|
||||
return newCtx, func() {}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](addKey)(getValue)
|
||||
result := adapted(context.Background())
|
||||
|
||||
assert.Equal(t, R.Of(100), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLocalBasic tests basic Local functionality
|
||||
func TestLocalBasic(t *testing.T) {
|
||||
t.Run("adds value to context", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) Result[string] {
|
||||
if v := ctx.Value("user"); v != nil {
|
||||
return R.Of(v.(string))
|
||||
}
|
||||
return R.Of("unknown")
|
||||
}
|
||||
|
||||
addUser := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
newCtx := context.WithValue(ctx, "user", "Alice")
|
||||
return newCtx, func() {}
|
||||
}
|
||||
|
||||
adapted := Local[string](addUser)(getValue)
|
||||
result := adapted(context.Background())
|
||||
|
||||
assert.Equal(t, R.Of("Alice"), result)
|
||||
})
|
||||
}
|
||||
@@ -56,3 +56,77 @@ func AltMonoid[E, A any](zero Lazy[Either[E, A]]) Monoid[E, A] {
|
||||
MonadAlt[E, A],
|
||||
)
|
||||
}
|
||||
|
||||
// takeFirst is a helper function that returns the first Right value, or the second if the first is Left.
|
||||
func takeFirst[E, A any](l, r Either[E, A]) Either[E, A] {
|
||||
if IsRight(l) {
|
||||
return l
|
||||
}
|
||||
return r
|
||||
}
|
||||
|
||||
// FirstMonoid creates a Monoid for Either[E, A] that returns the first Right value.
|
||||
// This monoid prefers the left operand when it is Right, otherwise returns the right operand.
|
||||
// The empty value is provided as a lazy computation.
|
||||
//
|
||||
// This is equivalent to AltMonoid but implemented more directly.
|
||||
//
|
||||
// Truth table:
|
||||
//
|
||||
// | x | y | concat(x, y) |
|
||||
// | --------- | --------- | ------------ |
|
||||
// | left(e1) | left(e2) | left(e2) |
|
||||
// | right(a) | left(e) | right(a) |
|
||||
// | left(e) | right(b) | right(b) |
|
||||
// | right(a) | right(b) | right(a) |
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import "errors"
|
||||
// zero := func() either.Either[error, int] { return either.Left[int](errors.New("empty")) }
|
||||
// m := either.FirstMonoid[error, int](zero)
|
||||
// m.Concat(either.Right[error](2), either.Right[error](3)) // Right(2) - returns first Right
|
||||
// m.Concat(either.Left[int](errors.New("err")), either.Right[error](3)) // Right(3)
|
||||
// m.Concat(either.Right[error](2), either.Left[int](errors.New("err"))) // Right(2)
|
||||
// m.Empty() // Left(error("empty"))
|
||||
//
|
||||
//go:inline
|
||||
func FirstMonoid[E, A any](zero Lazy[Either[E, A]]) M.Monoid[Either[E, A]] {
|
||||
return M.MakeMonoid(takeFirst[E, A], zero())
|
||||
}
|
||||
|
||||
// takeLast is a helper function that returns the last Right value, or the first if the last is Left.
|
||||
func takeLast[E, A any](l, r Either[E, A]) Either[E, A] {
|
||||
if IsRight(r) {
|
||||
return r
|
||||
}
|
||||
return l
|
||||
}
|
||||
|
||||
// LastMonoid creates a Monoid for Either[E, A] that returns the last Right value.
|
||||
// This monoid prefers the right operand when it is Right, otherwise returns the left operand.
|
||||
// The empty value is provided as a lazy computation.
|
||||
//
|
||||
// Truth table:
|
||||
//
|
||||
// | x | y | concat(x, y) |
|
||||
// | --------- | --------- | ------------ |
|
||||
// | left(e1) | left(e2) | left(e1) |
|
||||
// | right(a) | left(e) | right(a) |
|
||||
// | left(e) | right(b) | right(b) |
|
||||
// | right(a) | right(b) | right(b) |
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import "errors"
|
||||
// zero := func() either.Either[error, int] { return either.Left[int](errors.New("empty")) }
|
||||
// m := either.LastMonoid[error, int](zero)
|
||||
// m.Concat(either.Right[error](2), either.Right[error](3)) // Right(3) - returns last Right
|
||||
// m.Concat(either.Left[int](errors.New("err")), either.Right[error](3)) // Right(3)
|
||||
// m.Concat(either.Right[error](2), either.Left[int](errors.New("err"))) // Right(2)
|
||||
// m.Empty() // Left(error("empty"))
|
||||
//
|
||||
//go:inline
|
||||
func LastMonoid[E, A any](zero Lazy[Either[E, A]]) M.Monoid[Either[E, A]] {
|
||||
return M.MakeMonoid(takeLast[E, A], zero())
|
||||
}
|
||||
|
||||
402
v2/either/monoid_test.go
Normal file
402
v2/either/monoid_test.go
Normal file
@@ -0,0 +1,402 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package either
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestFirstMonoid tests the FirstMonoid implementation
|
||||
func TestFirstMonoid(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := FirstMonoid(zero)
|
||||
|
||||
t.Run("both Right values - returns first", func(t *testing.T) {
|
||||
result := m.Concat(Right[error](2), Right[error](3))
|
||||
assert.Equal(t, Right[error](2), result)
|
||||
})
|
||||
|
||||
t.Run("left Right, right Left", func(t *testing.T) {
|
||||
result := m.Concat(Right[error](2), Left[int](errors.New("err")))
|
||||
assert.Equal(t, Right[error](2), result)
|
||||
})
|
||||
|
||||
t.Run("left Left, right Right", func(t *testing.T) {
|
||||
result := m.Concat(Left[int](errors.New("err")), Right[error](3))
|
||||
assert.Equal(t, Right[error](3), result)
|
||||
})
|
||||
|
||||
t.Run("both Left", func(t *testing.T) {
|
||||
err1 := errors.New("err1")
|
||||
err2 := errors.New("err2")
|
||||
result := m.Concat(Left[int](err1), Left[int](err2))
|
||||
// Should return the second Left
|
||||
assert.True(t, IsLeft(result))
|
||||
_, leftErr := Unwrap(result)
|
||||
assert.Equal(t, err2, leftErr)
|
||||
})
|
||||
|
||||
t.Run("empty value", func(t *testing.T) {
|
||||
empty := m.Empty()
|
||||
assert.True(t, IsLeft(empty))
|
||||
_, leftErr := Unwrap(empty)
|
||||
assert.Equal(t, "empty", leftErr.Error())
|
||||
})
|
||||
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
x := Right[error](5)
|
||||
result := m.Concat(m.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
x := Right[error](5)
|
||||
result := m.Concat(x, m.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("associativity", func(t *testing.T) {
|
||||
a := Right[error](1)
|
||||
b := Right[error](2)
|
||||
c := Right[error](3)
|
||||
|
||||
left := m.Concat(m.Concat(a, b), c)
|
||||
right := m.Concat(a, m.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, Right[error](1), left)
|
||||
})
|
||||
|
||||
t.Run("multiple concatenations", func(t *testing.T) {
|
||||
// Should return the first Right value encountered
|
||||
result := m.Concat(
|
||||
m.Concat(Left[int](errors.New("err1")), Right[error](1)),
|
||||
m.Concat(Right[error](2), Right[error](3)),
|
||||
)
|
||||
assert.Equal(t, Right[error](1), result)
|
||||
})
|
||||
|
||||
t.Run("with strings", func(t *testing.T) {
|
||||
zeroStr := func() Either[error, string] { return Left[string](errors.New("empty")) }
|
||||
strMonoid := FirstMonoid(zeroStr)
|
||||
|
||||
result := strMonoid.Concat(Right[error]("first"), Right[error]("second"))
|
||||
assert.Equal(t, Right[error]("first"), result)
|
||||
|
||||
result = strMonoid.Concat(Left[string](errors.New("err")), Right[error]("second"))
|
||||
assert.Equal(t, Right[error]("second"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLastMonoid tests the LastMonoid implementation
|
||||
func TestLastMonoid(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := LastMonoid(zero)
|
||||
|
||||
t.Run("both Right values - returns last", func(t *testing.T) {
|
||||
result := m.Concat(Right[error](2), Right[error](3))
|
||||
assert.Equal(t, Right[error](3), result)
|
||||
})
|
||||
|
||||
t.Run("left Right, right Left", func(t *testing.T) {
|
||||
result := m.Concat(Right[error](2), Left[int](errors.New("err")))
|
||||
assert.Equal(t, Right[error](2), result)
|
||||
})
|
||||
|
||||
t.Run("left Left, right Right", func(t *testing.T) {
|
||||
result := m.Concat(Left[int](errors.New("err")), Right[error](3))
|
||||
assert.Equal(t, Right[error](3), result)
|
||||
})
|
||||
|
||||
t.Run("both Left", func(t *testing.T) {
|
||||
err1 := errors.New("err1")
|
||||
err2 := errors.New("err2")
|
||||
result := m.Concat(Left[int](err1), Left[int](err2))
|
||||
// Should return the first Left
|
||||
assert.True(t, IsLeft(result))
|
||||
_, leftErr := Unwrap(result)
|
||||
assert.Equal(t, err1, leftErr)
|
||||
})
|
||||
|
||||
t.Run("empty value", func(t *testing.T) {
|
||||
empty := m.Empty()
|
||||
assert.True(t, IsLeft(empty))
|
||||
_, leftErr := Unwrap(empty)
|
||||
assert.Equal(t, "empty", leftErr.Error())
|
||||
})
|
||||
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
x := Right[error](5)
|
||||
result := m.Concat(m.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
x := Right[error](5)
|
||||
result := m.Concat(x, m.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("associativity", func(t *testing.T) {
|
||||
a := Right[error](1)
|
||||
b := Right[error](2)
|
||||
c := Right[error](3)
|
||||
|
||||
left := m.Concat(m.Concat(a, b), c)
|
||||
right := m.Concat(a, m.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, Right[error](3), left)
|
||||
})
|
||||
|
||||
t.Run("multiple concatenations", func(t *testing.T) {
|
||||
// Should return the last Right value encountered
|
||||
result := m.Concat(
|
||||
m.Concat(Right[error](1), Right[error](2)),
|
||||
m.Concat(Right[error](3), Left[int](errors.New("err"))),
|
||||
)
|
||||
assert.Equal(t, Right[error](3), result)
|
||||
})
|
||||
|
||||
t.Run("with strings", func(t *testing.T) {
|
||||
zeroStr := func() Either[error, string] { return Left[string](errors.New("empty")) }
|
||||
strMonoid := LastMonoid(zeroStr)
|
||||
|
||||
result := strMonoid.Concat(Right[error]("first"), Right[error]("second"))
|
||||
assert.Equal(t, Right[error]("second"), result)
|
||||
|
||||
result = strMonoid.Concat(Right[error]("first"), Left[string](errors.New("err")))
|
||||
assert.Equal(t, Right[error]("first"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestFirstMonoidVsAltMonoid verifies FirstMonoid and AltMonoid have the same behavior
|
||||
func TestFirstMonoidVsAltMonoid(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
firstMonoid := FirstMonoid(zero)
|
||||
altMonoid := AltMonoid(zero)
|
||||
|
||||
testCases := []struct {
|
||||
name string
|
||||
left Either[error, int]
|
||||
right Either[error, int]
|
||||
}{
|
||||
{"both Right", Right[error](1), Right[error](2)},
|
||||
{"left Right, right Left", Right[error](1), Left[int](errors.New("err"))},
|
||||
{"left Left, right Right", Left[int](errors.New("err")), Right[error](2)},
|
||||
{"both Left", Left[int](errors.New("err1")), Left[int](errors.New("err2"))},
|
||||
}
|
||||
|
||||
for _, tc := range testCases {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
firstResult := firstMonoid.Concat(tc.left, tc.right)
|
||||
altResult := altMonoid.Concat(tc.left, tc.right)
|
||||
|
||||
// Both should have the same Right/Left status
|
||||
assert.Equal(t, IsRight(firstResult), IsRight(altResult), "FirstMonoid and AltMonoid should have same Right/Left status")
|
||||
|
||||
if IsRight(firstResult) {
|
||||
rightVal1, _ := Unwrap(firstResult)
|
||||
rightVal2, _ := Unwrap(altResult)
|
||||
assert.Equal(t, rightVal1, rightVal2, "FirstMonoid and AltMonoid should have same Right value")
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// TestFirstMonoidVsLastMonoid verifies the difference between FirstMonoid and LastMonoid
|
||||
func TestFirstMonoidVsLastMonoid(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
firstMonoid := FirstMonoid(zero)
|
||||
lastMonoid := LastMonoid(zero)
|
||||
|
||||
t.Run("both Right - different results", func(t *testing.T) {
|
||||
firstResult := firstMonoid.Concat(Right[error](1), Right[error](2))
|
||||
lastResult := lastMonoid.Concat(Right[error](1), Right[error](2))
|
||||
|
||||
assert.Equal(t, Right[error](1), firstResult)
|
||||
assert.Equal(t, Right[error](2), lastResult)
|
||||
assert.NotEqual(t, firstResult, lastResult)
|
||||
})
|
||||
|
||||
t.Run("with Left values - different behavior", func(t *testing.T) {
|
||||
err1 := errors.New("err1")
|
||||
err2 := errors.New("err2")
|
||||
|
||||
// Both Left: FirstMonoid returns second, LastMonoid returns first
|
||||
firstResult := firstMonoid.Concat(Left[int](err1), Left[int](err2))
|
||||
lastResult := lastMonoid.Concat(Left[int](err1), Left[int](err2))
|
||||
|
||||
assert.True(t, IsLeft(firstResult))
|
||||
assert.True(t, IsLeft(lastResult))
|
||||
_, leftErr1 := Unwrap(firstResult)
|
||||
_, leftErr2 := Unwrap(lastResult)
|
||||
assert.Equal(t, err2, leftErr1)
|
||||
assert.Equal(t, err1, leftErr2)
|
||||
})
|
||||
|
||||
t.Run("mixed values - same results", func(t *testing.T) {
|
||||
testCases := []struct {
|
||||
name string
|
||||
left Either[error, int]
|
||||
right Either[error, int]
|
||||
expected Either[error, int]
|
||||
}{
|
||||
{"left Right, right Left", Right[error](1), Left[int](errors.New("err")), Right[error](1)},
|
||||
{"left Left, right Right", Left[int](errors.New("err")), Right[error](2), Right[error](2)},
|
||||
}
|
||||
|
||||
for _, tc := range testCases {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
firstResult := firstMonoid.Concat(tc.left, tc.right)
|
||||
lastResult := lastMonoid.Concat(tc.left, tc.right)
|
||||
|
||||
assert.Equal(t, tc.expected, firstResult)
|
||||
assert.Equal(t, tc.expected, lastResult)
|
||||
assert.Equal(t, firstResult, lastResult)
|
||||
})
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidLaws verifies monoid laws for FirstMonoid and LastMonoid
|
||||
func TestMonoidLaws(t *testing.T) {
|
||||
t.Run("FirstMonoid laws", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := FirstMonoid(zero)
|
||||
|
||||
a := Right[error](1)
|
||||
b := Right[error](2)
|
||||
c := Right[error](3)
|
||||
|
||||
// Associativity: (a • b) • c = a • (b • c)
|
||||
left := m.Concat(m.Concat(a, b), c)
|
||||
right := m.Concat(a, m.Concat(b, c))
|
||||
assert.Equal(t, left, right)
|
||||
|
||||
// Left identity: Empty() • a = a
|
||||
leftId := m.Concat(m.Empty(), a)
|
||||
assert.Equal(t, a, leftId)
|
||||
|
||||
// Right identity: a • Empty() = a
|
||||
rightId := m.Concat(a, m.Empty())
|
||||
assert.Equal(t, a, rightId)
|
||||
})
|
||||
|
||||
t.Run("LastMonoid laws", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := LastMonoid(zero)
|
||||
|
||||
a := Right[error](1)
|
||||
b := Right[error](2)
|
||||
c := Right[error](3)
|
||||
|
||||
// Associativity: (a • b) • c = a • (b • c)
|
||||
left := m.Concat(m.Concat(a, b), c)
|
||||
right := m.Concat(a, m.Concat(b, c))
|
||||
assert.Equal(t, left, right)
|
||||
|
||||
// Left identity: Empty() • a = a
|
||||
leftId := m.Concat(m.Empty(), a)
|
||||
assert.Equal(t, a, leftId)
|
||||
|
||||
// Right identity: a • Empty() = a
|
||||
rightId := m.Concat(a, m.Empty())
|
||||
assert.Equal(t, a, rightId)
|
||||
})
|
||||
|
||||
t.Run("FirstMonoid laws with Left values", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := FirstMonoid(zero)
|
||||
|
||||
a := Left[int](errors.New("err1"))
|
||||
b := Left[int](errors.New("err2"))
|
||||
c := Left[int](errors.New("err3"))
|
||||
|
||||
// Associativity with Left values
|
||||
left := m.Concat(m.Concat(a, b), c)
|
||||
right := m.Concat(a, m.Concat(b, c))
|
||||
assert.Equal(t, left, right)
|
||||
})
|
||||
|
||||
t.Run("LastMonoid laws with Left values", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := LastMonoid(zero)
|
||||
|
||||
a := Left[int](errors.New("err1"))
|
||||
b := Left[int](errors.New("err2"))
|
||||
c := Left[int](errors.New("err3"))
|
||||
|
||||
// Associativity with Left values
|
||||
left := m.Concat(m.Concat(a, b), c)
|
||||
right := m.Concat(a, m.Concat(b, c))
|
||||
assert.Equal(t, left, right)
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidEdgeCases tests edge cases for monoid operations
|
||||
func TestMonoidEdgeCases(t *testing.T) {
|
||||
t.Run("FirstMonoid with empty concatenations", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := FirstMonoid(zero)
|
||||
|
||||
// Empty with empty
|
||||
result := m.Concat(m.Empty(), m.Empty())
|
||||
assert.True(t, IsLeft(result))
|
||||
})
|
||||
|
||||
t.Run("LastMonoid with empty concatenations", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := LastMonoid(zero)
|
||||
|
||||
// Empty with empty
|
||||
result := m.Concat(m.Empty(), m.Empty())
|
||||
assert.True(t, IsLeft(result))
|
||||
})
|
||||
|
||||
t.Run("FirstMonoid chain of operations", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := FirstMonoid(zero)
|
||||
|
||||
// Chain multiple operations
|
||||
result := m.Concat(
|
||||
m.Concat(
|
||||
m.Concat(Left[int](errors.New("err1")), Left[int](errors.New("err2"))),
|
||||
Right[error](1),
|
||||
),
|
||||
m.Concat(Right[error](2), Right[error](3)),
|
||||
)
|
||||
assert.Equal(t, Right[error](1), result)
|
||||
})
|
||||
|
||||
t.Run("LastMonoid chain of operations", func(t *testing.T) {
|
||||
zero := func() Either[error, int] { return Left[int](errors.New("empty")) }
|
||||
m := LastMonoid(zero)
|
||||
|
||||
// Chain multiple operations
|
||||
result := m.Concat(
|
||||
m.Concat(Right[error](1), Right[error](2)),
|
||||
m.Concat(
|
||||
Right[error](3),
|
||||
m.Concat(Right[error](4), Left[int](errors.New("err"))),
|
||||
),
|
||||
)
|
||||
assert.Equal(t, Right[error](4), result)
|
||||
})
|
||||
}
|
||||
91
v2/either/profunctor.go
Normal file
91
v2/either/profunctor.go
Normal file
@@ -0,0 +1,91 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package either
|
||||
|
||||
import F "github.com/IBM/fp-go/v2/function"
|
||||
|
||||
// MonadExtend applies a function to an Either value, where the function receives the entire Either as input.
|
||||
// This is the Extend (or Comonad) operation that allows computations to depend on the context.
|
||||
//
|
||||
// If the Either is Left, it returns Left unchanged without applying the function.
|
||||
// If the Either is Right, it applies the function to the entire Either and wraps the result in a Right.
|
||||
//
|
||||
// This operation is useful when you need to perform computations that depend on whether
|
||||
// a value is present (Right) or absent (Left), not just on the value itself.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - E: The error type (Left channel)
|
||||
// - A: The input value type (Right channel)
|
||||
// - B: The output value type
|
||||
//
|
||||
// Parameters:
|
||||
// - fa: The Either value to extend
|
||||
// - f: Function that takes the entire Either[E, A] and produces a value of type B
|
||||
//
|
||||
// Returns:
|
||||
// - Either[E, B]: Left if input was Left, otherwise Right containing the result of f(fa)
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Count how many times we've seen a Right value
|
||||
// counter := func(e either.Either[error, int]) int {
|
||||
// return either.Fold(
|
||||
// func(err error) int { return 0 },
|
||||
// func(n int) int { return 1 },
|
||||
// )(e)
|
||||
// }
|
||||
// result := either.MonadExtend(either.Right[error](42), counter) // Right(1)
|
||||
// result := either.MonadExtend(either.Left[int](errors.New("err")), counter) // Left(error)
|
||||
//
|
||||
//go:inline
|
||||
func MonadExtend[E, A, B any](fa Either[E, A], f func(Either[E, A]) B) Either[E, B] {
|
||||
if fa.isLeft {
|
||||
return Left[B](fa.l)
|
||||
}
|
||||
return Of[E](f(fa))
|
||||
}
|
||||
|
||||
// Extend is the curried version of [MonadExtend].
|
||||
// It returns a function that applies the given function to an Either value.
|
||||
//
|
||||
// This is useful for creating reusable transformations that depend on the Either context.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - E: The error type (Left channel)
|
||||
// - A: The input value type (Right channel)
|
||||
// - B: The output value type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function that takes the entire Either[E, A] and produces a value of type B
|
||||
//
|
||||
// Returns:
|
||||
// - Operator[E, A, B]: A function that transforms Either[E, A] to Either[E, B]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Create a reusable extender that extracts metadata
|
||||
// getMetadata := either.Extend(func(e either.Either[error, string]) string {
|
||||
// return either.Fold(
|
||||
// func(err error) string { return "error: " + err.Error() },
|
||||
// func(s string) string { return "value: " + s },
|
||||
// )(e)
|
||||
// })
|
||||
// result := getMetadata(either.Right[error]("hello")) // Right("value: hello")
|
||||
//
|
||||
//go:inline
|
||||
func Extend[E, A, B any](f func(Either[E, A]) B) Operator[E, A, B] {
|
||||
return F.Bind2nd(MonadExtend[E, A, B], f)
|
||||
}
|
||||
375
v2/either/profunctor_test.go
Normal file
375
v2/either/profunctor_test.go
Normal file
@@ -0,0 +1,375 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package either
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
S "github.com/IBM/fp-go/v2/string"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestMonadExtendWithRight tests MonadExtend with Right values
|
||||
func TestMonadExtendWithRight(t *testing.T) {
|
||||
t.Run("applies function to Right value", func(t *testing.T) {
|
||||
input := Right[error](42)
|
||||
|
||||
// Function that extracts and doubles the value if Right
|
||||
f := func(e Either[error, int]) int {
|
||||
return Fold(
|
||||
F.Constant1[error](0),
|
||||
N.Mul(2),
|
||||
)(e)
|
||||
}
|
||||
|
||||
result := MonadExtend(input, f)
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, 84, GetOrElse(F.Constant1[error](0))(result))
|
||||
})
|
||||
|
||||
t.Run("function receives entire Either context", func(t *testing.T) {
|
||||
input := Right[error]("hello")
|
||||
|
||||
// Function that creates metadata about the Either
|
||||
f := func(e Either[error, string]) string {
|
||||
return Fold(
|
||||
func(err error) string { return "error: " + err.Error() },
|
||||
S.Prepend("value: "),
|
||||
)(e)
|
||||
}
|
||||
|
||||
result := MonadExtend(input, f)
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, "value: hello", GetOrElse(func(error) string { return "" })(result))
|
||||
})
|
||||
|
||||
t.Run("can count Right occurrences", func(t *testing.T) {
|
||||
input := Right[error](100)
|
||||
|
||||
counter := func(e Either[error, int]) int {
|
||||
return Fold(
|
||||
F.Constant1[error](0),
|
||||
F.Constant1[int](1),
|
||||
)(e)
|
||||
}
|
||||
|
||||
result := MonadExtend(input, counter)
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, 1, GetOrElse(func(error) int { return -1 })(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonadExtendWithLeft tests MonadExtend with Left values
|
||||
func TestMonadExtendWithLeft(t *testing.T) {
|
||||
t.Run("returns Left without applying function", func(t *testing.T) {
|
||||
testErr := errors.New("test error")
|
||||
input := Left[int](testErr)
|
||||
|
||||
// Function should not be called
|
||||
called := false
|
||||
f := func(e Either[error, int]) int {
|
||||
called = true
|
||||
return 42
|
||||
}
|
||||
|
||||
result := MonadExtend(input, f)
|
||||
|
||||
assert.False(t, called, "function should not be called for Left")
|
||||
assert.True(t, IsLeft(result))
|
||||
_, leftVal := Unwrap(result)
|
||||
assert.Equal(t, testErr, leftVal)
|
||||
})
|
||||
|
||||
t.Run("preserves Left error type", func(t *testing.T) {
|
||||
input := Left[string](errors.New("original error"))
|
||||
|
||||
f := func(e Either[error, string]) string {
|
||||
return "should not be called"
|
||||
}
|
||||
|
||||
result := MonadExtend(input, f)
|
||||
|
||||
assert.True(t, IsLeft(result))
|
||||
_, leftVal := Unwrap(result)
|
||||
assert.Equal(t, "original error", leftVal.Error())
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonadExtendEdgeCases tests edge cases for MonadExtend
|
||||
func TestMonadExtendEdgeCases(t *testing.T) {
|
||||
t.Run("function returns zero value", func(t *testing.T) {
|
||||
input := Right[error](42)
|
||||
|
||||
f := func(e Either[error, int]) int {
|
||||
return 0
|
||||
}
|
||||
|
||||
result := MonadExtend(input, f)
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, 0, GetOrElse(func(error) int { return -1 })(result))
|
||||
})
|
||||
|
||||
t.Run("function changes type", func(t *testing.T) {
|
||||
input := Right[error](42)
|
||||
|
||||
f := func(e Either[error, int]) string {
|
||||
return Fold(
|
||||
F.Constant1[error]("error"),
|
||||
S.Format[int]("number: %d"),
|
||||
)(e)
|
||||
}
|
||||
|
||||
result := MonadExtend(input, f)
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, "number: 42", GetOrElse(func(error) string { return "" })(result))
|
||||
})
|
||||
|
||||
t.Run("nested Either handling", func(t *testing.T) {
|
||||
inner := Right[error](10)
|
||||
outer := Right[error](inner)
|
||||
|
||||
// Extract the inner value
|
||||
f := func(e Either[error, Either[error, int]]) int {
|
||||
return Fold(
|
||||
F.Constant1[error](-1),
|
||||
func(innerEither Either[error, int]) int {
|
||||
return GetOrElse(F.Constant1[error](-2))(innerEither)
|
||||
},
|
||||
)(e)
|
||||
}
|
||||
|
||||
result := MonadExtend(outer, f)
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, 10, GetOrElse(F.Constant1[error](-3))(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendWithRight tests Extend (curried version) with Right values
|
||||
func TestExtendWithRight(t *testing.T) {
|
||||
t.Run("creates reusable extender", func(t *testing.T) {
|
||||
// Create a reusable extender
|
||||
doubler := Extend(func(e Either[error, int]) int {
|
||||
return Fold(
|
||||
F.Constant1[error](0),
|
||||
N.Mul(2),
|
||||
)(e)
|
||||
})
|
||||
|
||||
result1 := doubler(Right[error](21))
|
||||
result2 := doubler(Right[error](50))
|
||||
|
||||
assert.True(t, IsRight(result1))
|
||||
assert.Equal(t, 42, GetOrElse(F.Constant1[error](0))(result1))
|
||||
|
||||
assert.True(t, IsRight(result2))
|
||||
assert.Equal(t, 100, GetOrElse(F.Constant1[error](0))(result2))
|
||||
})
|
||||
|
||||
t.Run("metadata extractor", func(t *testing.T) {
|
||||
getMetadata := Extend(func(e Either[error, string]) string {
|
||||
return Fold(
|
||||
func(err error) string { return "error: " + err.Error() },
|
||||
S.Prepend("value: "),
|
||||
)(e)
|
||||
})
|
||||
|
||||
result := getMetadata(Right[error]("test"))
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, "value: test", GetOrElse(func(error) string { return "" })(result))
|
||||
})
|
||||
|
||||
t.Run("composition with other operations", func(t *testing.T) {
|
||||
// Create an extender that counts characters
|
||||
charCounter := Extend(func(e Either[error, string]) int {
|
||||
return Fold(
|
||||
F.Constant1[error](0),
|
||||
S.Size,
|
||||
)(e)
|
||||
})
|
||||
|
||||
// Apply to a Right value
|
||||
input := Right[error]("hello")
|
||||
result := charCounter(input)
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, 5, GetOrElse(func(error) int { return -1 })(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendWithLeft tests Extend with Left values
|
||||
func TestExtendWithLeft(t *testing.T) {
|
||||
t.Run("returns Left without calling function", func(t *testing.T) {
|
||||
testErr := errors.New("test error")
|
||||
|
||||
called := false
|
||||
extender := Extend(func(e Either[error, int]) int {
|
||||
called = true
|
||||
return 42
|
||||
})
|
||||
|
||||
result := extender(Left[int](testErr))
|
||||
|
||||
assert.False(t, called, "function should not be called for Left")
|
||||
assert.True(t, IsLeft(result))
|
||||
_, leftVal := Unwrap(result)
|
||||
assert.Equal(t, testErr, leftVal)
|
||||
})
|
||||
|
||||
t.Run("preserves error through multiple applications", func(t *testing.T) {
|
||||
originalErr := errors.New("original")
|
||||
|
||||
extender := Extend(func(e Either[error, string]) string {
|
||||
return "transformed"
|
||||
})
|
||||
|
||||
result := extender(Left[string](originalErr))
|
||||
|
||||
assert.True(t, IsLeft(result))
|
||||
_, leftVal := Unwrap(result)
|
||||
assert.Equal(t, originalErr, leftVal)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendChaining tests chaining multiple Extend operations
|
||||
func TestExtendChaining(t *testing.T) {
|
||||
t.Run("chain multiple extenders", func(t *testing.T) {
|
||||
// First extender: double the value
|
||||
doubler := Extend(func(e Either[error, int]) int {
|
||||
return Fold(
|
||||
F.Constant1[error](0),
|
||||
N.Mul(2),
|
||||
)(e)
|
||||
})
|
||||
|
||||
// Second extender: add 10
|
||||
adder := Extend(func(e Either[error, int]) int {
|
||||
return Fold(
|
||||
F.Constant1[error](0),
|
||||
N.Add(10),
|
||||
)(e)
|
||||
})
|
||||
|
||||
input := Right[error](5)
|
||||
result := adder(doubler(input))
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, 20, GetOrElse(F.Constant1[error](0))(result))
|
||||
})
|
||||
|
||||
t.Run("short-circuits on Left", func(t *testing.T) {
|
||||
testErr := errors.New("error")
|
||||
|
||||
extender1 := Extend(func(e Either[error, int]) int { return 1 })
|
||||
extender2 := Extend(func(e Either[error, int]) int { return 2 })
|
||||
|
||||
input := Left[int](testErr)
|
||||
result := extender2(extender1(input))
|
||||
|
||||
assert.True(t, IsLeft(result))
|
||||
_, leftVal := Unwrap(result)
|
||||
assert.Equal(t, testErr, leftVal)
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendTypeTransformations tests type transformations with Extend
|
||||
func TestExtendTypeTransformations(t *testing.T) {
|
||||
t.Run("int to string transformation", func(t *testing.T) {
|
||||
toString := Extend(func(e Either[error, int]) string {
|
||||
return Fold(
|
||||
F.Constant1[error]("error"),
|
||||
strconv.Itoa,
|
||||
)(e)
|
||||
})
|
||||
|
||||
result := toString(Right[error](42))
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, "42", GetOrElse(func(error) string { return "" })(result))
|
||||
})
|
||||
|
||||
t.Run("string to bool transformation", func(t *testing.T) {
|
||||
isEmpty := Extend(func(e Either[error, string]) bool {
|
||||
return Fold(
|
||||
F.Constant1[error](true),
|
||||
S.IsEmpty,
|
||||
)(e)
|
||||
})
|
||||
|
||||
result1 := isEmpty(Right[error](""))
|
||||
result2 := isEmpty(Right[error]("hello"))
|
||||
|
||||
assert.True(t, IsRight(result1))
|
||||
assert.True(t, GetOrElse(F.Constant1[error](false))(result1))
|
||||
|
||||
assert.True(t, IsRight(result2))
|
||||
assert.False(t, GetOrElse(F.Constant1[error](true))(result2))
|
||||
})
|
||||
}
|
||||
|
||||
// TestExtendWithComplexTypes tests Extend with complex types
|
||||
func TestExtendWithComplexTypes(t *testing.T) {
|
||||
type User struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
|
||||
t.Run("extract field from struct", func(t *testing.T) {
|
||||
getName := Extend(func(e Either[error, User]) string {
|
||||
return Fold(
|
||||
func(err error) string { return "unknown" },
|
||||
func(u User) string { return u.Name },
|
||||
)(e)
|
||||
})
|
||||
|
||||
user := User{Name: "Alice", Age: 30}
|
||||
result := getName(Right[error](user))
|
||||
|
||||
assert.True(t, IsRight(result))
|
||||
assert.Equal(t, "Alice", GetOrElse(func(error) string { return "" })(result))
|
||||
})
|
||||
|
||||
t.Run("compute derived value", func(t *testing.T) {
|
||||
isAdult := Extend(func(e Either[error, User]) bool {
|
||||
return Fold(
|
||||
func(err error) bool { return false },
|
||||
func(u User) bool { return u.Age >= 18 },
|
||||
)(e)
|
||||
})
|
||||
|
||||
user1 := User{Name: "Bob", Age: 25}
|
||||
user2 := User{Name: "Charlie", Age: 15}
|
||||
|
||||
result1 := isAdult(Right[error](user1))
|
||||
result2 := isAdult(Right[error](user2))
|
||||
|
||||
assert.True(t, IsRight(result1))
|
||||
assert.True(t, GetOrElse(F.Constant1[error](false))(result1))
|
||||
|
||||
assert.True(t, IsRight(result2))
|
||||
assert.False(t, GetOrElse(F.Constant1[error](true))(result2))
|
||||
})
|
||||
}
|
||||
@@ -20,6 +20,8 @@ package eq
|
||||
// by mapping the input type. It's particularly useful for comparing complex types by
|
||||
// extracting comparable fields.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// The name "contramap" comes from category theory, where it represents a contravariant
|
||||
// functor. Unlike regular map (covariant), which transforms the output, contramap
|
||||
// transforms the input in the opposite direction.
|
||||
|
||||
@@ -31,3 +31,29 @@ import (
|
||||
// err := errors.New("something went wrong")
|
||||
// same := Identity(err) // returns the same error
|
||||
var Identity = F.Identity[error]
|
||||
|
||||
// IsNonNil checks if an error is non-nil.
|
||||
//
|
||||
// This function provides a predicate for testing whether an error value is not nil.
|
||||
// It's useful in functional programming contexts where you need a function to check
|
||||
// error presence, such as in filter operations or conditional logic.
|
||||
//
|
||||
// Parameters:
|
||||
// - err: The error to check
|
||||
//
|
||||
// Returns:
|
||||
// - true if the error is not nil, false otherwise
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// err := errors.New("something went wrong")
|
||||
// if IsNonNil(err) {
|
||||
// // handle error
|
||||
// }
|
||||
//
|
||||
// // Using in functional contexts
|
||||
// errors := []error{nil, errors.New("error1"), nil, errors.New("error2")}
|
||||
// nonNilErrors := F.Filter(IsNonNil)(errors) // [error1, error2]
|
||||
func IsNonNil(err error) bool {
|
||||
return err != nil
|
||||
}
|
||||
|
||||
89
v2/file/doc.go
Normal file
89
v2/file/doc.go
Normal file
@@ -0,0 +1,89 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
// Package file provides functional programming utilities for working with file paths
|
||||
// and I/O interfaces in Go.
|
||||
//
|
||||
// # Overview
|
||||
//
|
||||
// This package offers a collection of utility functions designed to work seamlessly
|
||||
// with functional programming patterns, particularly with the fp-go library's pipe
|
||||
// and composition utilities.
|
||||
//
|
||||
// # Path Manipulation
|
||||
//
|
||||
// The Join function provides a curried approach to path joining, making it easy to
|
||||
// create reusable path builders:
|
||||
//
|
||||
// import (
|
||||
// F "github.com/IBM/fp-go/v2/function"
|
||||
// "github.com/IBM/fp-go/v2/file"
|
||||
// )
|
||||
//
|
||||
// // Create a reusable path builder
|
||||
// addConfig := file.Join("config.json")
|
||||
// configPath := addConfig("/etc/myapp")
|
||||
// // Result: "/etc/myapp/config.json"
|
||||
//
|
||||
// // Use in a functional pipeline
|
||||
// logPath := F.Pipe1("/var/log", file.Join("app.log"))
|
||||
// // Result: "/var/log/app.log"
|
||||
//
|
||||
// // Chain multiple joins
|
||||
// deepPath := F.Pipe2(
|
||||
// "/root",
|
||||
// file.Join("subdir"),
|
||||
// file.Join("file.txt"),
|
||||
// )
|
||||
// // Result: "/root/subdir/file.txt"
|
||||
//
|
||||
// # I/O Interface Conversions
|
||||
//
|
||||
// The package provides generic type conversion functions for common I/O interfaces.
|
||||
// These are useful for type erasure when you need to work with interface types
|
||||
// rather than concrete implementations:
|
||||
//
|
||||
// import (
|
||||
// "bytes"
|
||||
// "io"
|
||||
// "github.com/IBM/fp-go/v2/file"
|
||||
// )
|
||||
//
|
||||
// // Convert concrete types to interfaces
|
||||
// buf := bytes.NewBuffer([]byte("hello"))
|
||||
// var reader io.Reader = file.ToReader(buf)
|
||||
//
|
||||
// writer := &bytes.Buffer{}
|
||||
// var w io.Writer = file.ToWriter(writer)
|
||||
//
|
||||
// f, _ := os.Open("file.txt")
|
||||
// var closer io.Closer = file.ToCloser(f)
|
||||
// defer closer.Close()
|
||||
//
|
||||
// # Design Philosophy
|
||||
//
|
||||
// The functions in this package follow functional programming principles:
|
||||
//
|
||||
// - Currying: Functions like Join return functions, enabling partial application
|
||||
// - Type Safety: Generic functions maintain type safety while providing flexibility
|
||||
// - Composability: All functions work well with fp-go's pipe and composition utilities
|
||||
// - Immutability: Functions don't modify their inputs
|
||||
//
|
||||
// # Performance
|
||||
//
|
||||
// The type conversion functions (ToReader, ToWriter, ToCloser) have zero overhead
|
||||
// as they simply return their input cast to the interface type. The Join function
|
||||
// uses Go's standard filepath.Join internally, ensuring cross-platform compatibility.
|
||||
package file
|
||||
@@ -13,6 +13,9 @@
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
// Package file provides utility functions for working with file paths and I/O interfaces.
|
||||
// It offers functional programming utilities for path manipulation and type conversions
|
||||
// for common I/O interfaces.
|
||||
package file
|
||||
|
||||
import (
|
||||
@@ -20,24 +23,93 @@ import (
|
||||
"path/filepath"
|
||||
)
|
||||
|
||||
// Join appends a filename to a root path
|
||||
func Join(name string) func(root string) string {
|
||||
// Join appends a filename to a root path using the operating system's path separator.
|
||||
// Returns a curried function that takes a root path and joins it with the provided name.
|
||||
//
|
||||
// This function follows the "data last" principle, where the data (root path) is provided
|
||||
// last, making it ideal for use in functional pipelines and partial application. The name
|
||||
// parameter is fixed first, creating a reusable path builder function.
|
||||
//
|
||||
// This is useful for creating reusable path builders in functional pipelines.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// // Data last: fix the filename first, apply root path later
|
||||
// addConfig := file.Join("config.json")
|
||||
// path := addConfig("/etc/myapp")
|
||||
// // path is "/etc/myapp/config.json" on Unix
|
||||
// // path is "\etc\myapp\config.json" on Windows
|
||||
//
|
||||
// // Using with Pipe (data flows through the pipeline)
|
||||
// result := F.Pipe1("/var/log", file.Join("app.log"))
|
||||
// // result is "/var/log/app.log" on Unix
|
||||
//
|
||||
// // Chain multiple joins
|
||||
// result := F.Pipe2(
|
||||
// "/root",
|
||||
// file.Join("subdir"),
|
||||
// file.Join("file.txt"),
|
||||
// )
|
||||
// // result is "/root/subdir/file.txt"
|
||||
func Join(name string) Endomorphism[string] {
|
||||
return func(root string) string {
|
||||
return filepath.Join(root, name)
|
||||
}
|
||||
}
|
||||
|
||||
// ToReader converts a [io.Reader]
|
||||
// ToReader converts any type that implements io.Reader to the io.Reader interface.
|
||||
// This is useful for type erasure when you need to work with the interface type
|
||||
// rather than a concrete implementation.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import (
|
||||
// "bytes"
|
||||
// "io"
|
||||
// )
|
||||
//
|
||||
// buf := bytes.NewBuffer([]byte("hello"))
|
||||
// var reader io.Reader = file.ToReader(buf)
|
||||
// // reader is now of type io.Reader
|
||||
func ToReader[R io.Reader](r R) io.Reader {
|
||||
return r
|
||||
}
|
||||
|
||||
// ToWriter converts a [io.Writer]
|
||||
// ToWriter converts any type that implements io.Writer to the io.Writer interface.
|
||||
// This is useful for type erasure when you need to work with the interface type
|
||||
// rather than a concrete implementation.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import (
|
||||
// "bytes"
|
||||
// "io"
|
||||
// )
|
||||
//
|
||||
// buf := &bytes.Buffer{}
|
||||
// var writer io.Writer = file.ToWriter(buf)
|
||||
// // writer is now of type io.Writer
|
||||
func ToWriter[W io.Writer](w W) io.Writer {
|
||||
return w
|
||||
}
|
||||
|
||||
// ToCloser converts a [io.Closer]
|
||||
// ToCloser converts any type that implements io.Closer to the io.Closer interface.
|
||||
// This is useful for type erasure when you need to work with the interface type
|
||||
// rather than a concrete implementation.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import (
|
||||
// "os"
|
||||
// "io"
|
||||
// )
|
||||
//
|
||||
// f, _ := os.Open("file.txt")
|
||||
// var closer io.Closer = file.ToCloser(f)
|
||||
// defer closer.Close()
|
||||
// // closer is now of type io.Closer
|
||||
func ToCloser[C io.Closer](c C) io.Closer {
|
||||
return c
|
||||
}
|
||||
|
||||
367
v2/file/getters_test.go
Normal file
367
v2/file/getters_test.go
Normal file
@@ -0,0 +1,367 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package file
|
||||
|
||||
import (
|
||||
"bytes"
|
||||
"io"
|
||||
"os"
|
||||
"path/filepath"
|
||||
"strings"
|
||||
"testing"
|
||||
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func TestJoin(t *testing.T) {
|
||||
t.Run("joins simple paths", func(t *testing.T) {
|
||||
result := Join("config.json")("/etc/myapp")
|
||||
expected := filepath.Join("/etc/myapp", "config.json")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("joins with subdirectories", func(t *testing.T) {
|
||||
result := Join("logs/app.log")("/var")
|
||||
expected := filepath.Join("/var", "logs/app.log")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("handles empty root", func(t *testing.T) {
|
||||
result := Join("file.txt")("")
|
||||
assert.Equal(t, "file.txt", result)
|
||||
})
|
||||
|
||||
t.Run("handles empty name", func(t *testing.T) {
|
||||
result := Join("")("/root")
|
||||
expected := filepath.Join("/root", "")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("handles relative paths", func(t *testing.T) {
|
||||
result := Join("config.json")("./app")
|
||||
expected := filepath.Join("./app", "config.json")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("normalizes path separators", func(t *testing.T) {
|
||||
result := Join("file.txt")("/root/path")
|
||||
// Should use OS-specific separator
|
||||
assert.Contains(t, result, "file.txt")
|
||||
assert.Contains(t, result, "root")
|
||||
assert.Contains(t, result, "path")
|
||||
})
|
||||
|
||||
t.Run("works with Pipe", func(t *testing.T) {
|
||||
result := F.Pipe1("/var/log", Join("app.log"))
|
||||
expected := filepath.Join("/var/log", "app.log")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("chains multiple joins", func(t *testing.T) {
|
||||
result := F.Pipe2(
|
||||
"/root",
|
||||
Join("subdir"),
|
||||
Join("file.txt"),
|
||||
)
|
||||
expected := filepath.Join("/root", "subdir", "file.txt")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("handles special characters", func(t *testing.T) {
|
||||
result := Join("my file.txt")("/path with spaces")
|
||||
expected := filepath.Join("/path with spaces", "my file.txt")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
|
||||
t.Run("handles dots in path", func(t *testing.T) {
|
||||
result := Join("../config.json")("/app/current")
|
||||
expected := filepath.Join("/app/current", "../config.json")
|
||||
assert.Equal(t, expected, result)
|
||||
})
|
||||
}
|
||||
|
||||
func TestToReader(t *testing.T) {
|
||||
t.Run("converts bytes.Buffer to io.Reader", func(t *testing.T) {
|
||||
buf := bytes.NewBuffer([]byte("hello world"))
|
||||
reader := ToReader(buf)
|
||||
|
||||
// Verify it's an io.Reader
|
||||
var _ io.Reader = reader
|
||||
|
||||
// Verify it works
|
||||
data, err := io.ReadAll(reader)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "hello world", string(data))
|
||||
})
|
||||
|
||||
t.Run("converts bytes.Reader to io.Reader", func(t *testing.T) {
|
||||
bytesReader := bytes.NewReader([]byte("test data"))
|
||||
reader := ToReader(bytesReader)
|
||||
|
||||
var _ io.Reader = reader
|
||||
|
||||
data, err := io.ReadAll(reader)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "test data", string(data))
|
||||
})
|
||||
|
||||
t.Run("converts strings.Reader to io.Reader", func(t *testing.T) {
|
||||
strReader := strings.NewReader("string content")
|
||||
reader := ToReader(strReader)
|
||||
|
||||
var _ io.Reader = reader
|
||||
|
||||
data, err := io.ReadAll(reader)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "string content", string(data))
|
||||
})
|
||||
|
||||
t.Run("preserves reader functionality", func(t *testing.T) {
|
||||
original := bytes.NewBuffer([]byte("test"))
|
||||
reader := ToReader(original)
|
||||
|
||||
// Read once
|
||||
buf1 := make([]byte, 2)
|
||||
n, err := reader.Read(buf1)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 2, n)
|
||||
assert.Equal(t, "te", string(buf1))
|
||||
|
||||
// Read again
|
||||
buf2 := make([]byte, 2)
|
||||
n, err = reader.Read(buf2)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 2, n)
|
||||
assert.Equal(t, "st", string(buf2))
|
||||
})
|
||||
|
||||
t.Run("handles empty reader", func(t *testing.T) {
|
||||
buf := bytes.NewBuffer([]byte{})
|
||||
reader := ToReader(buf)
|
||||
|
||||
data, err := io.ReadAll(reader)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "", string(data))
|
||||
})
|
||||
}
|
||||
|
||||
func TestToWriter(t *testing.T) {
|
||||
t.Run("converts bytes.Buffer to io.Writer", func(t *testing.T) {
|
||||
buf := &bytes.Buffer{}
|
||||
writer := ToWriter(buf)
|
||||
|
||||
// Verify it's an io.Writer
|
||||
var _ io.Writer = writer
|
||||
|
||||
// Verify it works
|
||||
n, err := writer.Write([]byte("hello"))
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 5, n)
|
||||
assert.Equal(t, "hello", buf.String())
|
||||
})
|
||||
|
||||
t.Run("preserves writer functionality", func(t *testing.T) {
|
||||
buf := &bytes.Buffer{}
|
||||
writer := ToWriter(buf)
|
||||
|
||||
// Write multiple times
|
||||
writer.Write([]byte("hello "))
|
||||
writer.Write([]byte("world"))
|
||||
|
||||
assert.Equal(t, "hello world", buf.String())
|
||||
})
|
||||
|
||||
t.Run("handles empty writes", func(t *testing.T) {
|
||||
buf := &bytes.Buffer{}
|
||||
writer := ToWriter(buf)
|
||||
|
||||
n, err := writer.Write([]byte{})
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 0, n)
|
||||
assert.Equal(t, "", buf.String())
|
||||
})
|
||||
|
||||
t.Run("handles large writes", func(t *testing.T) {
|
||||
buf := &bytes.Buffer{}
|
||||
writer := ToWriter(buf)
|
||||
|
||||
data := make([]byte, 10000)
|
||||
for i := range data {
|
||||
data[i] = byte('A' + (i % 26))
|
||||
}
|
||||
|
||||
n, err := writer.Write(data)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 10000, n)
|
||||
assert.Equal(t, 10000, buf.Len())
|
||||
})
|
||||
}
|
||||
|
||||
func TestToCloser(t *testing.T) {
|
||||
t.Run("converts file to io.Closer", func(t *testing.T) {
|
||||
// Create a temporary file
|
||||
tmpfile, err := os.CreateTemp("", "test")
|
||||
assert.NoError(t, err)
|
||||
defer os.Remove(tmpfile.Name())
|
||||
|
||||
closer := ToCloser(tmpfile)
|
||||
|
||||
// Verify it's an io.Closer
|
||||
var _ io.Closer = closer
|
||||
|
||||
// Verify it works
|
||||
err = closer.Close()
|
||||
assert.NoError(t, err)
|
||||
})
|
||||
|
||||
t.Run("converts nopCloser to io.Closer", func(t *testing.T) {
|
||||
// Use io.NopCloser which is a standard implementation
|
||||
reader := strings.NewReader("test")
|
||||
nopCloser := io.NopCloser(reader)
|
||||
|
||||
closer := ToCloser(nopCloser)
|
||||
var _ io.Closer = closer
|
||||
|
||||
err := closer.Close()
|
||||
assert.NoError(t, err)
|
||||
})
|
||||
|
||||
t.Run("preserves close functionality", func(t *testing.T) {
|
||||
tmpfile, err := os.CreateTemp("", "test")
|
||||
assert.NoError(t, err)
|
||||
defer os.Remove(tmpfile.Name())
|
||||
|
||||
closer := ToCloser(tmpfile)
|
||||
|
||||
// Close should work
|
||||
err = closer.Close()
|
||||
assert.NoError(t, err)
|
||||
|
||||
// Subsequent operations should fail
|
||||
_, err = tmpfile.Write([]byte("test"))
|
||||
assert.Error(t, err)
|
||||
})
|
||||
}
|
||||
|
||||
// Test type conversions work together
|
||||
func TestIntegration(t *testing.T) {
|
||||
t.Run("reader and closer together", func(t *testing.T) {
|
||||
tmpfile, err := os.CreateTemp("", "test")
|
||||
assert.NoError(t, err)
|
||||
defer os.Remove(tmpfile.Name())
|
||||
|
||||
// Write some data
|
||||
tmpfile.Write([]byte("test content"))
|
||||
tmpfile.Seek(0, 0)
|
||||
|
||||
// Convert to interfaces
|
||||
reader := ToReader(tmpfile)
|
||||
closer := ToCloser(tmpfile)
|
||||
|
||||
// Use as reader
|
||||
data, err := io.ReadAll(reader)
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "test content", string(data))
|
||||
|
||||
// Close
|
||||
err = closer.Close()
|
||||
assert.NoError(t, err)
|
||||
})
|
||||
|
||||
t.Run("writer and closer together", func(t *testing.T) {
|
||||
tmpfile, err := os.CreateTemp("", "test")
|
||||
assert.NoError(t, err)
|
||||
defer os.Remove(tmpfile.Name())
|
||||
|
||||
// Convert to interfaces
|
||||
writer := ToWriter(tmpfile)
|
||||
closer := ToCloser(tmpfile)
|
||||
|
||||
// Use as writer
|
||||
n, err := writer.Write([]byte("test data"))
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 9, n)
|
||||
|
||||
// Close
|
||||
err = closer.Close()
|
||||
assert.NoError(t, err)
|
||||
|
||||
// Verify data was written
|
||||
data, err := os.ReadFile(tmpfile.Name())
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "test data", string(data))
|
||||
})
|
||||
|
||||
t.Run("all conversions with file", func(t *testing.T) {
|
||||
tmpfile, err := os.CreateTemp("", "test")
|
||||
assert.NoError(t, err)
|
||||
defer os.Remove(tmpfile.Name())
|
||||
|
||||
// File implements Reader, Writer, and Closer
|
||||
var reader io.Reader = ToReader(tmpfile)
|
||||
var writer io.Writer = ToWriter(tmpfile)
|
||||
var closer io.Closer = ToCloser(tmpfile)
|
||||
|
||||
// All should be non-nil
|
||||
assert.NotNil(t, reader)
|
||||
assert.NotNil(t, writer)
|
||||
assert.NotNil(t, closer)
|
||||
|
||||
// Write, read, close
|
||||
writer.Write([]byte("hello"))
|
||||
tmpfile.Seek(0, 0)
|
||||
data, _ := io.ReadAll(reader)
|
||||
assert.Equal(t, "hello", string(data))
|
||||
closer.Close()
|
||||
})
|
||||
}
|
||||
|
||||
// Benchmark tests
|
||||
func BenchmarkJoin(b *testing.B) {
|
||||
joiner := Join("config.json")
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = joiner("/etc/myapp")
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkToReader(b *testing.B) {
|
||||
buf := bytes.NewBuffer([]byte("test data"))
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = ToReader(buf)
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkToWriter(b *testing.B) {
|
||||
buf := &bytes.Buffer{}
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = ToWriter(buf)
|
||||
}
|
||||
}
|
||||
|
||||
func BenchmarkToCloser(b *testing.B) {
|
||||
tmpfile, _ := os.CreateTemp("", "bench")
|
||||
defer os.Remove(tmpfile.Name())
|
||||
defer tmpfile.Close()
|
||||
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = ToCloser(tmpfile)
|
||||
}
|
||||
}
|
||||
45
v2/file/types.go
Normal file
45
v2/file/types.go
Normal file
@@ -0,0 +1,45 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package file
|
||||
|
||||
import "github.com/IBM/fp-go/v2/endomorphism"
|
||||
|
||||
type (
|
||||
// Endomorphism represents a function from a type to itself: A -> A.
|
||||
// This is a type alias for endomorphism.Endomorphism[A].
|
||||
//
|
||||
// In the context of the file package, this is used for functions that
|
||||
// transform strings (paths) into strings (paths), such as the Join function.
|
||||
//
|
||||
// An endomorphism has useful algebraic properties:
|
||||
// - Identity: There exists an identity endomorphism (the identity function)
|
||||
// - Composition: Endomorphisms can be composed to form new endomorphisms
|
||||
// - Associativity: Composition is associative
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// // Join returns an Endomorphism[string]
|
||||
// addConfig := file.Join("config.json") // Endomorphism[string]
|
||||
// addLogs := file.Join("logs") // Endomorphism[string]
|
||||
//
|
||||
// // Compose endomorphisms
|
||||
// addConfigLogs := F.Flow2(addLogs, addConfig)
|
||||
// result := addConfigLogs("/var")
|
||||
// // result is "/var/logs/config.json"
|
||||
Endomorphism[A any] = endomorphism.Endomorphism[A]
|
||||
)
|
||||
@@ -43,6 +43,7 @@ func Pipe1[F1 ~func(T0) T1, T0, T1 any](t0 T0, f1 F1) T1 {
|
||||
// The final return value is the result of the last function application
|
||||
//go:inline
|
||||
func Flow1[F1 ~func(T0) T1, T0, T1 any](f1 F1) func(T0) T1 {
|
||||
//go:inline
|
||||
return func(t0 T0) T1 {
|
||||
return Pipe1(t0, f1)
|
||||
}
|
||||
@@ -103,6 +104,7 @@ func Pipe2[F1 ~func(T0) T1, F2 ~func(T1) T2, T0, T1, T2 any](t0 T0, f1 F1, f2 F2
|
||||
// The final return value is the result of the last function application
|
||||
//go:inline
|
||||
func Flow2[F1 ~func(T0) T1, F2 ~func(T1) T2, T0, T1, T2 any](f1 F1, f2 F2) func(T0) T2 {
|
||||
//go:inline
|
||||
return func(t0 T0) T2 {
|
||||
return Pipe2(t0, f1, f2)
|
||||
}
|
||||
@@ -169,6 +171,7 @@ func Pipe3[F1 ~func(T0) T1, F2 ~func(T1) T2, F3 ~func(T2) T3, T0, T1, T2, T3 any
|
||||
// The final return value is the result of the last function application
|
||||
//go:inline
|
||||
func Flow3[F1 ~func(T0) T1, F2 ~func(T1) T2, F3 ~func(T2) T3, T0, T1, T2, T3 any](f1 F1, f2 F2, f3 F3) func(T0) T3 {
|
||||
//go:inline
|
||||
return func(t0 T0) T3 {
|
||||
return Pipe3(t0, f1, f2, f3)
|
||||
}
|
||||
|
||||
@@ -15,6 +15,47 @@
|
||||
|
||||
package function
|
||||
|
||||
// Void represents the unit type, a type with exactly one value.
|
||||
//
|
||||
// In functional programming, Void (also known as Unit) is used to represent
|
||||
// the absence of meaningful information. It's similar to void in other languages,
|
||||
// but as a value rather than the absence of a value.
|
||||
//
|
||||
// Common use cases:
|
||||
// - As a return type for functions that perform side effects but don't return meaningful data
|
||||
// - As a placeholder type parameter when a type is required but no data needs to be passed
|
||||
// - In functional patterns where a value is required but the actual data is irrelevant
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Function that performs an action but returns no meaningful data
|
||||
// func logMessage(msg string) Void {
|
||||
// fmt.Println(msg)
|
||||
// return VOID
|
||||
// }
|
||||
//
|
||||
// // Using Void as a type parameter
|
||||
// type Action = func() Void
|
||||
type (
|
||||
Void = struct{}
|
||||
)
|
||||
|
||||
// VOID is the single inhabitant of the Void type.
|
||||
//
|
||||
// This constant represents the only possible value of type Void. Use it when you need
|
||||
// to return or pass a Void value.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// func doSomething() Void {
|
||||
// // perform some action
|
||||
// return VOID
|
||||
// }
|
||||
//
|
||||
// // Ignoring the return value
|
||||
// _ = doSomething()
|
||||
var VOID Void = struct{}{}
|
||||
|
||||
// ToAny converts a value of any type to the any (interface{}) type.
|
||||
//
|
||||
// This function performs an explicit type conversion to the any type, which can be
|
||||
|
||||
@@ -21,54 +21,261 @@ import (
|
||||
"github.com/IBM/fp-go/v2/internal/functor"
|
||||
)
|
||||
|
||||
// MonadAp applies a function to a value in the Identity monad context.
|
||||
// Since Identity has no computational context, this is just function application.
|
||||
//
|
||||
// This is the uncurried version of Ap.
|
||||
//
|
||||
// Implements the Fantasy Land Apply specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#apply
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// result := identity.MonadAp(func(n int) int { return n * 2 }, 21)
|
||||
// // result is 42
|
||||
func MonadAp[B, A any](fab func(A) B, fa A) B {
|
||||
return fab(fa)
|
||||
}
|
||||
|
||||
// Ap applies a wrapped function to a wrapped value.
|
||||
// Returns a function that takes a function and applies the value to it.
|
||||
//
|
||||
// This is the curried version of MonadAp, useful for composition with Pipe.
|
||||
//
|
||||
// Implements the Fantasy Land Apply specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#apply
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// double := func(n int) int { return n * 2 }
|
||||
// result := F.Pipe1(double, identity.Ap[int](21))
|
||||
// // result is 42
|
||||
func Ap[B, A any](fa A) Operator[func(A) B, B] {
|
||||
return function.Bind2nd(MonadAp[B, A], fa)
|
||||
}
|
||||
|
||||
// MonadMap transforms a value using a function in the Identity monad context.
|
||||
// Since Identity has no computational context, this is just function application.
|
||||
//
|
||||
// This is the uncurried version of Map.
|
||||
//
|
||||
// Implements the Fantasy Land Functor specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#functor
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// result := identity.MonadMap(21, func(n int) int { return n * 2 })
|
||||
// // result is 42
|
||||
func MonadMap[A, B any](fa A, f func(A) B) B {
|
||||
return f(fa)
|
||||
}
|
||||
|
||||
// Map transforms a value using a function.
|
||||
// Returns the function itself since Identity adds no context.
|
||||
//
|
||||
// This is the curried version of MonadMap, useful for composition with Pipe.
|
||||
//
|
||||
// Implements the Fantasy Land Functor specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#functor
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// result := F.Pipe1(21, identity.Map(func(n int) int { return n * 2 }))
|
||||
// // result is 42
|
||||
func Map[A, B any](f func(A) B) Operator[A, B] {
|
||||
return f
|
||||
}
|
||||
|
||||
// MonadMapTo replaces a value with a constant, ignoring the input.
|
||||
//
|
||||
// This is the uncurried version of MapTo.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// result := identity.MonadMapTo("ignored", 42)
|
||||
// // result is 42
|
||||
func MonadMapTo[A, B any](_ A, b B) B {
|
||||
return b
|
||||
}
|
||||
|
||||
// MapTo replaces any value with a constant value.
|
||||
// Returns a function that ignores its input and returns the constant.
|
||||
//
|
||||
// This is the curried version of MonadMapTo, useful for composition with Pipe.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// result := F.Pipe1("ignored", identity.MapTo[string](42))
|
||||
// // result is 42
|
||||
func MapTo[A, B any](b B) func(A) B {
|
||||
return function.Constant1[A](b)
|
||||
}
|
||||
|
||||
// Of wraps a value in the Identity monad.
|
||||
// Since Identity has no computational context, this is just the identity function.
|
||||
//
|
||||
// This is the Pointed/Applicative "pure" operation.
|
||||
//
|
||||
// Implements the Fantasy Land Applicative specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#applicative
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// value := identity.Of(42)
|
||||
// // value is 42
|
||||
//
|
||||
//go:inline
|
||||
func Of[A any](a A) A {
|
||||
return a
|
||||
}
|
||||
|
||||
// MonadChain applies a Kleisli arrow to a value in the Identity monad context.
|
||||
// Since Identity has no computational context, this is just function application.
|
||||
//
|
||||
// This is the uncurried version of Chain, also known as "bind" or "flatMap".
|
||||
//
|
||||
// Implements the Fantasy Land Chain specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#chain
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// result := identity.MonadChain(21, func(n int) int { return n * 2 })
|
||||
// // result is 42
|
||||
func MonadChain[A, B any](ma A, f Kleisli[A, B]) B {
|
||||
return f(ma)
|
||||
}
|
||||
|
||||
// Chain applies a Kleisli arrow to a value.
|
||||
// Returns the function itself since Identity adds no context.
|
||||
//
|
||||
// This is the curried version of MonadChain, also known as "bind" or "flatMap".
|
||||
// Useful for composition with Pipe.
|
||||
//
|
||||
// Implements the Fantasy Land Chain specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#chain
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// result := F.Pipe1(21, identity.Chain(func(n int) int { return n * 2 }))
|
||||
// // result is 42
|
||||
//
|
||||
//go:inline
|
||||
func Chain[A, B any](f Kleisli[A, B]) Operator[A, B] {
|
||||
return f
|
||||
}
|
||||
|
||||
// MonadChainFirst executes a computation for its effect but returns the original value.
|
||||
// Useful for side effects like logging while preserving the original value.
|
||||
//
|
||||
// This is the uncurried version of ChainFirst.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// result := identity.MonadChainFirst(42, func(n int) string {
|
||||
// fmt.Printf("Value: %d\n", n)
|
||||
// return "logged"
|
||||
// })
|
||||
// // result is 42 (original value preserved)
|
||||
func MonadChainFirst[A, B any](fa A, f Kleisli[A, B]) A {
|
||||
return chain.MonadChainFirst(MonadChain[A, A], MonadMap[B, A], fa, f)
|
||||
}
|
||||
|
||||
// ChainFirst executes a computation for its effect but returns the original value.
|
||||
// Useful for side effects like logging while preserving the original value.
|
||||
//
|
||||
// This is the curried version of MonadChainFirst, useful for composition with Pipe.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// result := F.Pipe1(
|
||||
// 42,
|
||||
// identity.ChainFirst(func(n int) string {
|
||||
// fmt.Printf("Value: %d\n", n)
|
||||
// return "logged"
|
||||
// }),
|
||||
// )
|
||||
// // result is 42 (original value preserved)
|
||||
func ChainFirst[A, B any](f Kleisli[A, B]) Operator[A, A] {
|
||||
return chain.ChainFirst(Chain[A, A], Map[B, A], f)
|
||||
}
|
||||
|
||||
// MonadFlap applies a value to a function, flipping the normal application order.
|
||||
// Instead of applying a function to a value, it applies a value to a function.
|
||||
//
|
||||
// This is the uncurried version of Flap.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// double := func(n int) int { return n * 2 }
|
||||
// result := identity.MonadFlap(double, 21)
|
||||
// // result is 42
|
||||
func MonadFlap[B, A any](fab func(A) B, a A) B {
|
||||
return functor.MonadFlap(MonadMap[func(A) B, B], fab, a)
|
||||
}
|
||||
|
||||
// Flap applies a value to a function, flipping the normal application order.
|
||||
// Returns a function that takes a function and applies the value to it.
|
||||
//
|
||||
// This is the curried version of MonadFlap, useful for composition with Pipe.
|
||||
// Useful when you have a value and want to apply it to multiple functions.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// double := func(n int) int { return n * 2 }
|
||||
// result := F.Pipe1(double, identity.Flap[int](21))
|
||||
// // result is 42
|
||||
//
|
||||
//go:inline
|
||||
func Flap[B, A any](a A) Operator[func(A) B, B] {
|
||||
return functor.Flap(Map[func(A) B, B], a)
|
||||
}
|
||||
|
||||
// Extract extracts the value from the Identity monad.
|
||||
// Since Identity has no computational context, this is just the identity function.
|
||||
//
|
||||
// This is the Comonad "extract" operation.
|
||||
//
|
||||
// Implements the Fantasy Land Comonad specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#comonad
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// value := identity.Extract(42)
|
||||
// // value is 42
|
||||
//
|
||||
//go:inline
|
||||
func Extract[A any](a A) A {
|
||||
return a
|
||||
}
|
||||
|
||||
// Extend extends a computation over the Identity monad.
|
||||
// Since Identity has no computational context, this is just function application.
|
||||
//
|
||||
// This is the Comonad "extend" operation, also known as "cobind".
|
||||
//
|
||||
// Implements the Fantasy Land Extend specification:
|
||||
// https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#extend
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import F "github.com/IBM/fp-go/v2/function"
|
||||
//
|
||||
// result := F.Pipe1(21, identity.Extend(func(n int) int { return n * 2 }))
|
||||
// // result is 42
|
||||
//
|
||||
//go:inline
|
||||
func Extend[A, B any](f func(A) B) Operator[A, B] {
|
||||
return f
|
||||
}
|
||||
|
||||
@@ -723,3 +723,99 @@ func TestTraverseTuple10(t *testing.T) {
|
||||
assert.Equal(t, T.MakeTuple10(2, 4, 6, 8, 10, 12, 14, 16, 18, 20), result)
|
||||
})
|
||||
}
|
||||
|
||||
func TestExtract(t *testing.T) {
|
||||
t.Run("extracts int value", func(t *testing.T) {
|
||||
result := Extract(42)
|
||||
assert.Equal(t, 42, result)
|
||||
})
|
||||
|
||||
t.Run("extracts string value", func(t *testing.T) {
|
||||
result := Extract("hello")
|
||||
assert.Equal(t, "hello", result)
|
||||
})
|
||||
|
||||
t.Run("extracts struct value", func(t *testing.T) {
|
||||
type Person struct{ Name string }
|
||||
p := Person{Name: "Alice"}
|
||||
result := Extract(p)
|
||||
assert.Equal(t, p, result)
|
||||
})
|
||||
|
||||
t.Run("extracts pointer value", func(t *testing.T) {
|
||||
value := 100
|
||||
ptr := &value
|
||||
result := Extract(ptr)
|
||||
assert.Equal(t, ptr, result)
|
||||
assert.Equal(t, 100, *result)
|
||||
})
|
||||
}
|
||||
|
||||
func TestExtend(t *testing.T) {
|
||||
t.Run("extends with transformation", func(t *testing.T) {
|
||||
result := F.Pipe1(21, Extend(utils.Double))
|
||||
assert.Equal(t, 42, result)
|
||||
})
|
||||
|
||||
t.Run("extends with type change", func(t *testing.T) {
|
||||
result := F.Pipe1(42, Extend(S.Format[int]("Number: %d")))
|
||||
assert.Equal(t, "Number: 42", result)
|
||||
})
|
||||
|
||||
t.Run("chains multiple extends", func(t *testing.T) {
|
||||
result := F.Pipe2(
|
||||
5,
|
||||
Extend(N.Mul(2)),
|
||||
Extend(N.Add(10)),
|
||||
)
|
||||
assert.Equal(t, 20, result)
|
||||
})
|
||||
|
||||
t.Run("extends with complex computation", func(t *testing.T) {
|
||||
result := F.Pipe1(
|
||||
10,
|
||||
Extend(func(n int) string {
|
||||
doubled := n * 2
|
||||
return fmt.Sprintf("Result: %d", doubled)
|
||||
}),
|
||||
)
|
||||
assert.Equal(t, "Result: 20", result)
|
||||
})
|
||||
}
|
||||
|
||||
// Test Comonad laws
|
||||
func TestComonadLaws(t *testing.T) {
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
// Extract(Extend(f)(w)) === f(w)
|
||||
w := 42
|
||||
f := N.Mul(2)
|
||||
|
||||
left := Extract(F.Pipe1(w, Extend(f)))
|
||||
right := f(w)
|
||||
|
||||
assert.Equal(t, right, left)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
// Extend(Extract)(w) === w
|
||||
w := 42
|
||||
|
||||
result := F.Pipe1(w, Extend(Extract[int]))
|
||||
|
||||
assert.Equal(t, w, result)
|
||||
})
|
||||
|
||||
t.Run("associativity", func(t *testing.T) {
|
||||
// Extend(f)(Extend(g)(w)) === Extend(x => f(Extend(g)(x)))(w)
|
||||
w := 5
|
||||
f := N.Mul(2)
|
||||
g := N.Add(10)
|
||||
|
||||
left := F.Pipe2(w, Extend(g), Extend(f))
|
||||
right := F.Pipe1(w, Extend(func(x int) int {
|
||||
return f(F.Pipe1(x, Extend(g)))
|
||||
}))
|
||||
|
||||
assert.Equal(t, right, left)
|
||||
})
|
||||
}
|
||||
|
||||
59
v2/idiomatic/context/readerresult/profunctor.go
Normal file
59
v2/idiomatic/context/readerresult/profunctor.go
Normal file
@@ -0,0 +1,59 @@
|
||||
package readerresult
|
||||
|
||||
import (
|
||||
"context"
|
||||
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
)
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a ReaderResult.
|
||||
// It applies f to the input context (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Adapt the context before passing it to the ReaderResult (via f)
|
||||
// - Transform the success value after the computation completes (via g)
|
||||
//
|
||||
// The error type is fixed as error and remains unchanged through the transformation.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The original success type produced by the ReaderResult
|
||||
// - B: The new output success type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input context, returning a new context and cancel function (contravariant)
|
||||
// - g: Function to transform the output success value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - An Operator that takes a ReaderResult[A] and returns a ReaderResult[B]
|
||||
//
|
||||
//go:inline
|
||||
func Promap[A, B any](f func(context.Context) (context.Context, context.CancelFunc), g func(A) B) Operator[A, B] {
|
||||
return function.Flow2(
|
||||
Local[A](f),
|
||||
Map(g),
|
||||
)
|
||||
}
|
||||
|
||||
// Contramap changes the value of the local context during the execution of a ReaderResult.
|
||||
// This is the contravariant functor operation that transforms the input context.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Contramap is useful for adapting a ReaderResult to work with a modified context
|
||||
// by providing a function that creates a new context (and optional cancel function) from the current one.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The success type (unchanged)
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the context, returning a new context and cancel function
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderResult[A] and returns a ReaderResult[A]
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A any](f func(context.Context) (context.Context, context.CancelFunc)) Kleisli[ReaderResult[A], A] {
|
||||
return Local[A](f)
|
||||
}
|
||||
187
v2/idiomatic/context/readerresult/profunctor_test.go
Normal file
187
v2/idiomatic/context/readerresult/profunctor_test.go
Normal file
@@ -0,0 +1,187 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerresult
|
||||
|
||||
import (
|
||||
"context"
|
||||
"fmt"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both context and output", func(t *testing.T) {
|
||||
// ReaderResult that reads a value from context
|
||||
getValue := func(ctx context.Context) (int, error) {
|
||||
if val := ctx.Value("port"); val != nil {
|
||||
return val.(int), nil
|
||||
}
|
||||
return 0, fmt.Errorf("port not found")
|
||||
}
|
||||
|
||||
// Transform context to add a value and int to string
|
||||
addPort := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
return context.WithValue(ctx, "port", 8080), func() {}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(addPort, toString)(getValue)
|
||||
result, err := adapted(context.Background())
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "8080", result)
|
||||
})
|
||||
|
||||
t.Run("handles error case", func(t *testing.T) {
|
||||
// ReaderResult that returns an error
|
||||
getError := func(ctx context.Context) (int, error) {
|
||||
return 0, fmt.Errorf("error occurred")
|
||||
}
|
||||
|
||||
addPort := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
return context.WithValue(ctx, "port", 8080), func() {}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(addPort, toString)(getError)
|
||||
_, err := adapted(context.Background())
|
||||
|
||||
assert.Error(t, err)
|
||||
assert.Equal(t, "error occurred", err.Error())
|
||||
})
|
||||
|
||||
t.Run("context transformation with cancellation", func(t *testing.T) {
|
||||
getValue := func(ctx context.Context) (string, error) {
|
||||
if val := ctx.Value("key"); val != nil {
|
||||
return val.(string), nil
|
||||
}
|
||||
return "", fmt.Errorf("key not found")
|
||||
}
|
||||
|
||||
addValue := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
ctx, cancel := context.WithCancel(ctx)
|
||||
return context.WithValue(ctx, "key", "value"), cancel
|
||||
}
|
||||
toUpper := func(s string) string {
|
||||
return "UPPER_" + s
|
||||
}
|
||||
|
||||
adapted := Promap(addValue, toUpper)(getValue)
|
||||
result, err := adapted(context.Background())
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "UPPER_value", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("context adaptation", func(t *testing.T) {
|
||||
// ReaderResult that reads from context
|
||||
getPort := func(ctx context.Context) (int, error) {
|
||||
if val := ctx.Value("port"); val != nil {
|
||||
return val.(int), nil
|
||||
}
|
||||
return 0, fmt.Errorf("port not found")
|
||||
}
|
||||
|
||||
// Adapt context to add port value
|
||||
addPort := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
return context.WithValue(ctx, "port", 9000), func() {}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](addPort)(getPort)
|
||||
result, err := adapted(context.Background())
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 9000, result)
|
||||
})
|
||||
|
||||
t.Run("preserves error", func(t *testing.T) {
|
||||
getError := func(ctx context.Context) (int, error) {
|
||||
return 0, fmt.Errorf("config error")
|
||||
}
|
||||
|
||||
addPort := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
return context.WithValue(ctx, "port", 9000), func() {}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](addPort)(getError)
|
||||
_, err := adapted(context.Background())
|
||||
|
||||
assert.Error(t, err)
|
||||
assert.Equal(t, "config error", err.Error())
|
||||
})
|
||||
|
||||
t.Run("multiple context values", func(t *testing.T) {
|
||||
getValues := func(ctx context.Context) (string, error) {
|
||||
host := ctx.Value("host")
|
||||
port := ctx.Value("port")
|
||||
if host != nil && port != nil {
|
||||
return fmt.Sprintf("%s:%d", host, port), nil
|
||||
}
|
||||
return "", fmt.Errorf("missing values")
|
||||
}
|
||||
|
||||
addValues := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
ctx = context.WithValue(ctx, "host", "localhost")
|
||||
ctx = context.WithValue(ctx, "port", 8080)
|
||||
return ctx, func() {}
|
||||
}
|
||||
|
||||
adapted := Contramap[string](addValues)(getValues)
|
||||
result, err := adapted(context.Background())
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "localhost:8080", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapComposition tests that Promap can be composed
|
||||
func TestPromapComposition(t *testing.T) {
|
||||
t.Run("compose two Promap transformations", func(t *testing.T) {
|
||||
reader := func(ctx context.Context) (int, error) {
|
||||
if val := ctx.Value("value"); val != nil {
|
||||
return val.(int), nil
|
||||
}
|
||||
return 0, fmt.Errorf("value not found")
|
||||
}
|
||||
|
||||
f1 := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
return context.WithValue(ctx, "value", 5), func() {}
|
||||
}
|
||||
g1 := N.Mul(2)
|
||||
|
||||
f2 := func(ctx context.Context) (context.Context, context.CancelFunc) {
|
||||
return ctx, func() {}
|
||||
}
|
||||
g2 := N.Add(10)
|
||||
|
||||
// Apply two Promap transformations
|
||||
step1 := Promap(f1, g1)(reader)
|
||||
step2 := Promap(f2, g2)(step1)
|
||||
|
||||
result, err := step2(context.Background())
|
||||
|
||||
// (5 * 2) + 10 = 20
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 20, result)
|
||||
})
|
||||
}
|
||||
74
v2/idiomatic/readerioresult/profunctor.go
Normal file
74
v2/idiomatic/readerioresult/profunctor.go
Normal file
@@ -0,0 +1,74 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerioresult
|
||||
|
||||
import (
|
||||
"github.com/IBM/fp-go/v2/idiomatic/ioresult"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
)
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a ReaderIOResult.
|
||||
// It applies f to the input environment (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Adapt the environment type before passing it to the ReaderIOResult (via f)
|
||||
// - Transform the success value after the IO effect completes (via g)
|
||||
//
|
||||
// The error type is fixed as error and remains unchanged through the transformation.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - E: The original environment type expected by the ReaderIOResult
|
||||
// - A: The original success type produced by the ReaderIOResult
|
||||
// - D: The new input environment type
|
||||
// - B: The new output success type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input environment from D to E (contravariant)
|
||||
// - g: Function to transform the output success value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderIOResult[E, A] and returns a ReaderIOResult[D, B]
|
||||
//
|
||||
//go:inline
|
||||
func Promap[E, A, D, B any](f func(D) E, g func(A) B) Kleisli[D, ReaderIOResult[E, A], B] {
|
||||
return reader.Promap(f, ioresult.Map(g))
|
||||
}
|
||||
|
||||
// Contramap changes the value of the local environment during the execution of a ReaderIOResult.
|
||||
// This is the contravariant functor operation that transforms the input environment.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Contramap is useful for adapting a ReaderIOResult to work with a different environment type
|
||||
// by providing a function that converts the new environment to the expected one.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The success type (unchanged)
|
||||
// - R2: The new input environment type
|
||||
// - R1: The original environment type expected by the ReaderIOResult
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the environment from R2 to R1
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderIOResult[R1, A] and returns a ReaderIOResult[R2, A]
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A, R1, R2 any](f func(R2) R1) Kleisli[R2, ReaderIOResult[R1, A], A] {
|
||||
return Local[A](f)
|
||||
}
|
||||
199
v2/idiomatic/readerioresult/profunctor_test.go
Normal file
199
v2/idiomatic/readerioresult/profunctor_test.go
Normal file
@@ -0,0 +1,199 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerioresult
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
type SimpleConfig struct {
|
||||
Port int
|
||||
}
|
||||
|
||||
type DetailedConfig struct {
|
||||
Host string
|
||||
Port int
|
||||
}
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both input and output", func(t *testing.T) {
|
||||
// ReaderIOResult that reads port from SimpleConfig
|
||||
getPort := func(c SimpleConfig) func() (int, error) {
|
||||
return func() (int, error) {
|
||||
return c.Port, nil
|
||||
}
|
||||
}
|
||||
|
||||
// Transform DetailedConfig to SimpleConfig and int to string
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(simplify, toString)(getPort)
|
||||
result, err := adapted(DetailedConfig{Host: "localhost", Port: 8080})()
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "8080", result)
|
||||
})
|
||||
|
||||
t.Run("handles error case", func(t *testing.T) {
|
||||
// ReaderIOResult that returns an error
|
||||
getError := func(c SimpleConfig) func() (int, error) {
|
||||
return func() (int, error) {
|
||||
return 0, fmt.Errorf("error occurred")
|
||||
}
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(simplify, toString)(getError)
|
||||
_, err := adapted(DetailedConfig{Host: "localhost", Port: 8080})()
|
||||
|
||||
assert.Error(t, err)
|
||||
assert.Equal(t, "error occurred", err.Error())
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("environment adaptation", func(t *testing.T) {
|
||||
// ReaderIOResult that reads from SimpleConfig
|
||||
getPort := func(c SimpleConfig) func() (int, error) {
|
||||
return func() (int, error) {
|
||||
return c.Port, nil
|
||||
}
|
||||
}
|
||||
|
||||
// Adapt to work with DetailedConfig
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](simplify)(getPort)
|
||||
result, err := adapted(DetailedConfig{Host: "localhost", Port: 9000})()
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 9000, result)
|
||||
})
|
||||
|
||||
t.Run("preserves error", func(t *testing.T) {
|
||||
getError := func(c SimpleConfig) func() (int, error) {
|
||||
return func() (int, error) {
|
||||
return 0, fmt.Errorf("config error")
|
||||
}
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](simplify)(getError)
|
||||
_, err := adapted(DetailedConfig{Host: "localhost", Port: 9000})()
|
||||
|
||||
assert.Error(t, err)
|
||||
assert.Equal(t, "config error", err.Error())
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapWithIO tests Promap with actual IO effects
|
||||
func TestPromapWithIO(t *testing.T) {
|
||||
t.Run("transform IO result", func(t *testing.T) {
|
||||
counter := 0
|
||||
|
||||
// ReaderIOResult with side effect
|
||||
getPortWithEffect := func(c SimpleConfig) func() (int, error) {
|
||||
return func() (int, error) {
|
||||
counter++
|
||||
return c.Port, nil
|
||||
}
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(simplify, toString)(getPortWithEffect)
|
||||
result, err := adapted(DetailedConfig{Host: "localhost", Port: 8080})()
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "8080", result)
|
||||
assert.Equal(t, 1, counter) // Side effect occurred
|
||||
})
|
||||
|
||||
t.Run("side effect occurs even on error", func(t *testing.T) {
|
||||
counter := 0
|
||||
|
||||
getErrorWithEffect := func(c SimpleConfig) func() (int, error) {
|
||||
return func() (int, error) {
|
||||
counter++
|
||||
return 0, fmt.Errorf("io error")
|
||||
}
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(simplify, toString)(getErrorWithEffect)
|
||||
_, err := adapted(DetailedConfig{Host: "localhost", Port: 8080})()
|
||||
|
||||
assert.Error(t, err)
|
||||
assert.Equal(t, 1, counter) // Side effect occurred before error
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapComposition tests that Promap can be composed
|
||||
func TestPromapComposition(t *testing.T) {
|
||||
t.Run("compose two Promap transformations", func(t *testing.T) {
|
||||
type Config1 struct{ Value int }
|
||||
type Config2 struct{ Value int }
|
||||
type Config3 struct{ Value int }
|
||||
|
||||
reader := func(c Config1) func() (int, error) {
|
||||
return func() (int, error) {
|
||||
return c.Value, nil
|
||||
}
|
||||
}
|
||||
|
||||
f1 := func(c2 Config2) Config1 { return Config1{Value: c2.Value} }
|
||||
g1 := N.Mul(2)
|
||||
|
||||
f2 := func(c3 Config3) Config2 { return Config2{Value: c3.Value} }
|
||||
g2 := N.Add(10)
|
||||
|
||||
// Apply two Promap transformations
|
||||
step1 := Promap(f1, g1)(reader)
|
||||
step2 := Promap(f2, g2)(step1)
|
||||
|
||||
result, err := step2(Config3{Value: 5})()
|
||||
|
||||
// (5 * 2) + 10 = 20
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 20, result)
|
||||
})
|
||||
}
|
||||
76
v2/idiomatic/readerresult/profunctor.go
Normal file
76
v2/idiomatic/readerresult/profunctor.go
Normal file
@@ -0,0 +1,76 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerresult
|
||||
|
||||
import "github.com/IBM/fp-go/v2/idiomatic/result"
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a ReaderResult.
|
||||
// It applies f to the input environment (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Adapt the environment type before passing it to the ReaderResult (via f)
|
||||
// - Transform the success value after the computation completes (via g)
|
||||
//
|
||||
// The error type is fixed as error and remains unchanged through the transformation.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - E: The original environment type expected by the ReaderResult
|
||||
// - A: The original success type produced by the ReaderResult
|
||||
// - D: The new input environment type
|
||||
// - B: The new output success type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input environment from D to E (contravariant)
|
||||
// - g: Function to transform the output success value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderResult[E, A] and returns a ReaderResult[D, B]
|
||||
//
|
||||
//go:inline
|
||||
func Promap[E, A, D, B any](f func(D) E, g func(A) B) Kleisli[D, ReaderResult[E, A], B] {
|
||||
mp := result.Map(g)
|
||||
return func(rr ReaderResult[E, A]) ReaderResult[D, B] {
|
||||
return func(d D) (B, error) {
|
||||
return mp(rr(f(d)))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Contramap changes the value of the local environment during the execution of a ReaderResult.
|
||||
// This is the contravariant functor operation that transforms the input environment.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Contramap is useful for adapting a ReaderResult to work with a different environment type
|
||||
// by providing a function that converts the new environment to the expected one.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The success type (unchanged)
|
||||
// - R2: The new input environment type
|
||||
// - R1: The original environment type expected by the ReaderResult
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the environment from R2 to R1
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderResult[R1, A] and returns a ReaderResult[R2, A]
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A, R1, R2 any](f func(R2) R1) Kleisli[R2, ReaderResult[R1, A], A] {
|
||||
return Local[A](f)
|
||||
}
|
||||
238
v2/idiomatic/readerresult/profunctor_test.go
Normal file
238
v2/idiomatic/readerresult/profunctor_test.go
Normal file
@@ -0,0 +1,238 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerresult
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
R "github.com/IBM/fp-go/v2/reader"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
type SimpleConfig struct {
|
||||
Port int
|
||||
}
|
||||
|
||||
type DetailedConfig struct {
|
||||
Host string
|
||||
Port int
|
||||
}
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both input and output", func(t *testing.T) {
|
||||
// ReaderResult that reads port from SimpleConfig
|
||||
getPort := func(c SimpleConfig) (int, error) {
|
||||
return c.Port, nil
|
||||
}
|
||||
|
||||
// Transform DetailedConfig to SimpleConfig and int to string
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(simplify, toString)(getPort)
|
||||
result, err := adapted(DetailedConfig{Host: "localhost", Port: 8080})
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "8080", result)
|
||||
})
|
||||
|
||||
t.Run("handles error case", func(t *testing.T) {
|
||||
// ReaderResult that returns an error
|
||||
getError := func(c SimpleConfig) (int, error) {
|
||||
return 0, fmt.Errorf("error occurred")
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(simplify, toString)(getError)
|
||||
_, err := adapted(DetailedConfig{Host: "localhost", Port: 8080})
|
||||
|
||||
assert.Error(t, err)
|
||||
assert.Equal(t, "error occurred", err.Error())
|
||||
})
|
||||
|
||||
t.Run("environment transformation with complex types", func(t *testing.T) {
|
||||
type Database struct {
|
||||
ConnectionString string
|
||||
}
|
||||
type AppConfig struct {
|
||||
DB Database
|
||||
}
|
||||
|
||||
getConnection := func(db Database) (string, error) {
|
||||
if db.ConnectionString == "" {
|
||||
return "", fmt.Errorf("empty connection string")
|
||||
}
|
||||
return db.ConnectionString, nil
|
||||
}
|
||||
|
||||
extractDB := func(cfg AppConfig) Database {
|
||||
return cfg.DB
|
||||
}
|
||||
addPrefix := func(s string) string {
|
||||
return "postgres://" + s
|
||||
}
|
||||
|
||||
adapted := Promap(extractDB, addPrefix)(getConnection)
|
||||
result, err := adapted(AppConfig{DB: Database{ConnectionString: "localhost:5432"}})
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "postgres://localhost:5432", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("environment adaptation", func(t *testing.T) {
|
||||
// ReaderResult that reads from SimpleConfig
|
||||
getPort := func(c SimpleConfig) (int, error) {
|
||||
return c.Port, nil
|
||||
}
|
||||
|
||||
// Adapt to work with DetailedConfig
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](simplify)(getPort)
|
||||
result, err := adapted(DetailedConfig{Host: "localhost", Port: 9000})
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 9000, result)
|
||||
})
|
||||
|
||||
t.Run("preserves error", func(t *testing.T) {
|
||||
getError := func(c SimpleConfig) (int, error) {
|
||||
return 0, fmt.Errorf("config error")
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[int](simplify)(getError)
|
||||
_, err := adapted(DetailedConfig{Host: "localhost", Port: 9000})
|
||||
|
||||
assert.Error(t, err)
|
||||
assert.Equal(t, "config error", err.Error())
|
||||
})
|
||||
|
||||
t.Run("multiple field extraction", func(t *testing.T) {
|
||||
type FullConfig struct {
|
||||
Host string
|
||||
Port int
|
||||
Protocol string
|
||||
}
|
||||
|
||||
getURL := func(c DetailedConfig) (string, error) {
|
||||
return fmt.Sprintf("%s:%d", c.Host, c.Port), nil
|
||||
}
|
||||
|
||||
extractHostPort := func(fc FullConfig) DetailedConfig {
|
||||
return DetailedConfig{Host: fc.Host, Port: fc.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[string](extractHostPort)(getURL)
|
||||
result, err := adapted(FullConfig{Host: "example.com", Port: 443, Protocol: "https"})
|
||||
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "example.com:443", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapComposition tests that Promap can be composed
|
||||
func TestPromapComposition(t *testing.T) {
|
||||
t.Run("compose two Promap transformations", func(t *testing.T) {
|
||||
type Config1 struct{ Value int }
|
||||
type Config2 struct{ Value int }
|
||||
type Config3 struct{ Value int }
|
||||
|
||||
reader := func(c Config1) (int, error) {
|
||||
return c.Value, nil
|
||||
}
|
||||
|
||||
f1 := func(c2 Config2) Config1 { return Config1{Value: c2.Value} }
|
||||
g1 := N.Mul(2)
|
||||
|
||||
f2 := func(c3 Config3) Config2 { return Config2{Value: c3.Value} }
|
||||
g2 := N.Add(10)
|
||||
|
||||
// Apply two Promap transformations
|
||||
step1 := Promap(f1, g1)(reader)
|
||||
step2 := Promap(f2, g2)(step1)
|
||||
|
||||
result, err := step2(Config3{Value: 5})
|
||||
|
||||
// (5 * 2) + 10 = 20
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, 20, result)
|
||||
})
|
||||
|
||||
t.Run("compose Promap and Contramap", func(t *testing.T) {
|
||||
type Config1 struct{ Value int }
|
||||
type Config2 struct{ Value int }
|
||||
|
||||
reader := func(c Config1) (int, error) {
|
||||
return c.Value * 3, nil
|
||||
}
|
||||
|
||||
// First apply Contramap
|
||||
f1 := func(c2 Config2) Config1 { return Config1{Value: c2.Value} }
|
||||
step1 := Contramap[int](f1)(reader)
|
||||
|
||||
// Then apply Promap
|
||||
f2 := func(c2 Config2) Config2 { return c2 }
|
||||
g2 := func(n int) string { return fmt.Sprintf("result: %d", n) }
|
||||
step2 := Promap(f2, g2)(step1)
|
||||
|
||||
result, err := step2(Config2{Value: 7})
|
||||
|
||||
// 7 * 3 = 21
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, "result: 21", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapIdentityLaws tests profunctor identity laws
|
||||
func TestPromapIdentityLaws(t *testing.T) {
|
||||
t.Run("identity law", func(t *testing.T) {
|
||||
// Promap with identity functions should be identity
|
||||
reader := func(c SimpleConfig) (int, error) {
|
||||
return c.Port, nil
|
||||
}
|
||||
|
||||
identity := R.Ask[SimpleConfig]()
|
||||
identityInt := R.Ask[int]()
|
||||
|
||||
adapted := Promap(identity, identityInt)(reader)
|
||||
|
||||
config := SimpleConfig{Port: 8080}
|
||||
result1, err1 := reader(config)
|
||||
result2, err2 := adapted(config)
|
||||
|
||||
assert.Equal(t, err1, err2)
|
||||
assert.Equal(t, result1, result2)
|
||||
})
|
||||
}
|
||||
@@ -501,7 +501,7 @@ func BiMap[R, A, B any](f Endomorphism[error], g func(A) B) Operator[R, A, B] {
|
||||
// rr := readerresult.Of[Config](42)
|
||||
// adapted := readerresult.Local[int](toConfig)(rr)
|
||||
// // adapted now accepts DB instead of Config
|
||||
func Local[A, R2, R1 any](f func(R2) R1) func(ReaderResult[R1, A]) ReaderResult[R2, A] {
|
||||
func Local[A, R1, R2 any](f func(R2) R1) func(ReaderResult[R1, A]) ReaderResult[R2, A] {
|
||||
return func(rr ReaderResult[R1, A]) ReaderResult[R2, A] {
|
||||
return func(r R2) (A, error) {
|
||||
return rr(f(r))
|
||||
|
||||
@@ -22,6 +22,7 @@ import (
|
||||
"testing"
|
||||
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
S "github.com/IBM/fp-go/v2/semigroup"
|
||||
STR "github.com/IBM/fp-go/v2/string"
|
||||
"github.com/stretchr/testify/assert"
|
||||
@@ -267,7 +268,7 @@ func TestApV_ZeroValues(t *testing.T) {
|
||||
sg := makeErrorConcatSemigroup()
|
||||
apv := ApV[int, int](sg)
|
||||
|
||||
identity := func(x int) int { return x }
|
||||
identity := reader.Ask[int]()
|
||||
|
||||
value, verr := Right(0)
|
||||
fn, ferr := Right(identity)
|
||||
|
||||
@@ -15,15 +15,17 @@
|
||||
|
||||
package io
|
||||
|
||||
import "github.com/IBM/fp-go/v2/function"
|
||||
|
||||
// ChainConsumer converts a Consumer into an IO operator that executes the consumer
|
||||
// as a side effect and returns an empty struct.
|
||||
//
|
||||
// This function bridges the gap between pure consumers (functions that consume values
|
||||
// without returning anything) and the IO monad. It takes a Consumer[A] and returns
|
||||
// an Operator that:
|
||||
// 1. Executes the source IO[A] to get a value
|
||||
// 2. Passes that value to the consumer for side effects
|
||||
// 3. Returns IO[struct{}] to maintain the monadic chain
|
||||
// 1. Executes the source IO[A] to get a value
|
||||
// 2. Passes that value to the consumer for side effects
|
||||
// 3. Returns IO[struct{}] to maintain the monadic chain
|
||||
//
|
||||
// The returned IO[struct{}] allows the operation to be composed with other IO operations
|
||||
// while discarding the consumed value. This is useful for operations like logging,
|
||||
@@ -68,11 +70,11 @@ package io
|
||||
// io.Map(func(struct{}) int { return len(values) }),
|
||||
// )
|
||||
// count := pipeline() // Returns 1, values contains [100]
|
||||
func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
return Chain(FromConsumerK(c))
|
||||
func ChainConsumer[A any](c Consumer[A]) Operator[A, Void] {
|
||||
return Chain(FromConsumer(c))
|
||||
}
|
||||
|
||||
// FromConsumerK converts a Consumer into a Kleisli arrow that wraps the consumer
|
||||
// FromConsumer converts a Consumer into a Kleisli arrow that wraps the consumer
|
||||
// in an IO context.
|
||||
//
|
||||
// This function lifts a Consumer[A] (a function that consumes a value and performs
|
||||
@@ -100,7 +102,7 @@ func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
// }
|
||||
//
|
||||
// // Convert to Kleisli arrow
|
||||
// logKleisli := io.FromConsumerK(logger)
|
||||
// logKleisli := io.FromConsumer(logger)
|
||||
//
|
||||
// // Use with Chain
|
||||
// result := F.Pipe2(
|
||||
@@ -117,11 +119,11 @@ func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
// io.Map(func(struct{}) int { return 1 }),
|
||||
// )
|
||||
// }
|
||||
func FromConsumerK[A any](c Consumer[A]) Kleisli[A, struct{}] {
|
||||
return func(a A) IO[struct{}] {
|
||||
return func() struct{} {
|
||||
func FromConsumer[A any](c Consumer[A]) Kleisli[A, Void] {
|
||||
return func(a A) IO[Void] {
|
||||
return func() Void {
|
||||
c(a)
|
||||
return struct{}{}
|
||||
return function.VOID
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
70
v2/io/run.go
Normal file
70
v2/io/run.go
Normal file
@@ -0,0 +1,70 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package io
|
||||
|
||||
// Run executes an IO computation and returns its result.
|
||||
//
|
||||
// This function is the primary way to execute IO computations. It takes an IO[A]
|
||||
// (a lazy computation) and immediately evaluates it, returning the computed value.
|
||||
//
|
||||
// Run is the bridge between the pure functional world (where computations are
|
||||
// described but not executed) and the imperative world (where side effects occur).
|
||||
// It should typically be called at the edges of your application, such as in main()
|
||||
// or in test code.
|
||||
//
|
||||
// Parameters:
|
||||
// - fa: The IO computation to execute
|
||||
//
|
||||
// Returns:
|
||||
// - The result of executing the IO computation
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Create a lazy computation
|
||||
// greeting := io.Of("Hello, World!")
|
||||
//
|
||||
// // Execute it and get the result
|
||||
// result := io.Run(greeting) // result == "Hello, World!"
|
||||
//
|
||||
// Example with side effects:
|
||||
//
|
||||
// // Create a computation that prints and returns a value
|
||||
// computation := func() string {
|
||||
// fmt.Println("Computing...")
|
||||
// return "Done"
|
||||
// }
|
||||
//
|
||||
// // Nothing is printed yet
|
||||
// io := io.MakeIO(computation)
|
||||
//
|
||||
// // Now the computation runs and "Computing..." is printed
|
||||
// result := io.Run(io) // result == "Done"
|
||||
//
|
||||
// Example with composition:
|
||||
//
|
||||
// result := io.Run(
|
||||
// pipe.Pipe2(
|
||||
// io.Of(5),
|
||||
// io.Map(func(x int) int { return x * 2 }),
|
||||
// io.Map(func(x int) int { return x + 1 }),
|
||||
// ),
|
||||
// ) // result == 11
|
||||
//
|
||||
// Note: Run should be used sparingly in application code. Prefer composing
|
||||
// IO computations and only calling Run at the application boundaries.
|
||||
func Run[A any](fa IO[A]) A {
|
||||
return fa()
|
||||
}
|
||||
228
v2/io/run_test.go
Normal file
228
v2/io/run_test.go
Normal file
@@ -0,0 +1,228 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package io
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestRun_BasicValue tests that Run executes a simple IO computation
|
||||
func TestRun_BasicValue(t *testing.T) {
|
||||
io := Of(42)
|
||||
result := Run(io)
|
||||
assert.Equal(t, 42, result)
|
||||
}
|
||||
|
||||
// TestRun_String tests Run with string values
|
||||
func TestRun_String(t *testing.T) {
|
||||
io := Of("Hello, World!")
|
||||
result := Run(io)
|
||||
assert.Equal(t, "Hello, World!", result)
|
||||
}
|
||||
|
||||
// TestRun_WithMap tests Run with a mapped computation
|
||||
func TestRun_WithMap(t *testing.T) {
|
||||
io := F.Pipe1(
|
||||
Of(5),
|
||||
Map(N.Mul(2)),
|
||||
)
|
||||
result := Run(io)
|
||||
assert.Equal(t, 10, result)
|
||||
}
|
||||
|
||||
// TestRun_WithChain tests Run with chained computations
|
||||
func TestRun_WithChain(t *testing.T) {
|
||||
io := F.Pipe1(
|
||||
Of(3),
|
||||
Chain(func(x int) IO[int] {
|
||||
return Of(x * x)
|
||||
}),
|
||||
)
|
||||
result := Run(io)
|
||||
assert.Equal(t, 9, result)
|
||||
}
|
||||
|
||||
// TestRun_ComposedOperations tests Run with multiple composed operations
|
||||
func TestRun_ComposedOperations(t *testing.T) {
|
||||
io := F.Pipe3(
|
||||
Of(5),
|
||||
Map(N.Mul(2)), // 10
|
||||
Map(N.Add(3)), // 13
|
||||
Map(N.Sub(1)), // 12
|
||||
)
|
||||
result := Run(io)
|
||||
assert.Equal(t, 12, result)
|
||||
}
|
||||
|
||||
// TestRun_WithSideEffect tests that Run executes side effects
|
||||
func TestRun_WithSideEffect(t *testing.T) {
|
||||
counter := 0
|
||||
io := func() int {
|
||||
counter++
|
||||
return counter
|
||||
}
|
||||
|
||||
// First execution
|
||||
result1 := Run(io)
|
||||
assert.Equal(t, 1, result1)
|
||||
assert.Equal(t, 1, counter)
|
||||
|
||||
// Second execution (side effect happens again)
|
||||
result2 := Run(io)
|
||||
assert.Equal(t, 2, result2)
|
||||
assert.Equal(t, 2, counter)
|
||||
}
|
||||
|
||||
// TestRun_LazyEvaluation tests that IO is lazy until Run is called
|
||||
func TestRun_LazyEvaluation(t *testing.T) {
|
||||
executed := false
|
||||
io := func() bool {
|
||||
executed = true
|
||||
return true
|
||||
}
|
||||
|
||||
// IO created but not executed
|
||||
assert.False(t, executed, "IO should not execute until Run is called")
|
||||
|
||||
// Now execute
|
||||
result := Run(io)
|
||||
assert.True(t, executed, "IO should execute when Run is called")
|
||||
assert.True(t, result)
|
||||
}
|
||||
|
||||
// TestRun_WithFlatten tests Run with nested IO
|
||||
func TestRun_WithFlatten(t *testing.T) {
|
||||
nested := Of(Of(42))
|
||||
flattened := Flatten(nested)
|
||||
result := Run(flattened)
|
||||
assert.Equal(t, 42, result)
|
||||
}
|
||||
|
||||
// TestRun_WithAp tests Run with applicative operations
|
||||
func TestRun_WithAp(t *testing.T) {
|
||||
double := N.Mul(2)
|
||||
io := F.Pipe1(
|
||||
Of(double),
|
||||
Ap[int](Of(21)),
|
||||
)
|
||||
result := Run(io)
|
||||
assert.Equal(t, 42, result)
|
||||
}
|
||||
|
||||
// TestRun_DifferentTypes tests Run with various types
|
||||
func TestRun_DifferentTypes(t *testing.T) {
|
||||
// Test with bool
|
||||
boolIO := Of(true)
|
||||
assert.True(t, Run(boolIO))
|
||||
|
||||
// Test with float
|
||||
floatIO := Of(3.14)
|
||||
assert.Equal(t, 3.14, Run(floatIO))
|
||||
|
||||
// Test with slice
|
||||
sliceIO := Of([]int{1, 2, 3})
|
||||
assert.Equal(t, []int{1, 2, 3}, Run(sliceIO))
|
||||
|
||||
// Test with struct
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
personIO := Of(Person{Name: "Alice", Age: 30})
|
||||
assert.Equal(t, Person{Name: "Alice", Age: 30}, Run(personIO))
|
||||
}
|
||||
|
||||
// TestRun_WithApFirst tests Run with ApFirst combinator
|
||||
func TestRun_WithApFirst(t *testing.T) {
|
||||
io := F.Pipe1(
|
||||
Of("first"),
|
||||
ApFirst[string](Of("second")),
|
||||
)
|
||||
result := Run(io)
|
||||
assert.Equal(t, "first", result)
|
||||
}
|
||||
|
||||
// TestRun_WithApSecond tests Run with ApSecond combinator
|
||||
func TestRun_WithApSecond(t *testing.T) {
|
||||
io := F.Pipe1(
|
||||
Of("first"),
|
||||
ApSecond[string](Of("second")),
|
||||
)
|
||||
result := Run(io)
|
||||
assert.Equal(t, "second", result)
|
||||
}
|
||||
|
||||
// TestRun_MultipleExecutions tests that Run can be called multiple times
|
||||
func TestRun_MultipleExecutions(t *testing.T) {
|
||||
io := Of(100)
|
||||
|
||||
// Execute multiple times
|
||||
result1 := Run(io)
|
||||
result2 := Run(io)
|
||||
result3 := Run(io)
|
||||
|
||||
assert.Equal(t, 100, result1)
|
||||
assert.Equal(t, 100, result2)
|
||||
assert.Equal(t, 100, result3)
|
||||
}
|
||||
|
||||
// TestRun_WithChainedSideEffects tests Run with multiple side effects
|
||||
func TestRun_WithChainedSideEffects(t *testing.T) {
|
||||
log := []string{}
|
||||
|
||||
io := F.Pipe2(
|
||||
func() string {
|
||||
log = append(log, "step1")
|
||||
return "a"
|
||||
},
|
||||
Chain(func(s string) IO[string] {
|
||||
return func() string {
|
||||
log = append(log, "step2")
|
||||
return s + "b"
|
||||
}
|
||||
}),
|
||||
Chain(func(s string) IO[string] {
|
||||
return func() string {
|
||||
log = append(log, "step3")
|
||||
return s + "c"
|
||||
}
|
||||
}),
|
||||
)
|
||||
|
||||
result := Run(io)
|
||||
assert.Equal(t, "abc", result)
|
||||
assert.Equal(t, []string{"step1", "step2", "step3"}, log)
|
||||
}
|
||||
|
||||
// TestRun_ZeroValue tests Run with zero values
|
||||
func TestRun_ZeroValue(t *testing.T) {
|
||||
// Test with zero int
|
||||
intIO := Of(0)
|
||||
assert.Equal(t, 0, Run(intIO))
|
||||
|
||||
// Test with empty string
|
||||
strIO := Of("")
|
||||
assert.Equal(t, "", Run(strIO))
|
||||
|
||||
// Test with nil slice
|
||||
var nilSlice []int
|
||||
sliceIO := Of(nilSlice)
|
||||
assert.Nil(t, Run(sliceIO))
|
||||
}
|
||||
@@ -4,6 +4,7 @@ import (
|
||||
"iter"
|
||||
|
||||
"github.com/IBM/fp-go/v2/consumer"
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
M "github.com/IBM/fp-go/v2/monoid"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
"github.com/IBM/fp-go/v2/predicate"
|
||||
@@ -48,4 +49,6 @@ type (
|
||||
// Predicate represents a function that tests a value of type A and returns a boolean.
|
||||
// It's commonly used for filtering and conditional operations.
|
||||
Predicate[A any] = predicate.Predicate[A]
|
||||
|
||||
Void = function.Void
|
||||
)
|
||||
|
||||
@@ -23,9 +23,9 @@ import "github.com/IBM/fp-go/v2/io"
|
||||
// This function bridges the gap between pure consumers (functions that consume values
|
||||
// without returning anything) and the IOEither monad. It takes a Consumer[A] and returns
|
||||
// an Operator that:
|
||||
// 1. If the IOEither is Right, executes the consumer with the value as a side effect
|
||||
// 2. If the IOEither is Left, propagates the error without calling the consumer
|
||||
// 3. Returns IOEither[E, struct{}] to maintain the monadic chain
|
||||
// 1. If the IOEither is Right, executes the consumer with the value as a side effect
|
||||
// 2. If the IOEither is Left, propagates the error without calling the consumer
|
||||
// 3. Returns IOEither[E, struct{}] to maintain the monadic chain
|
||||
//
|
||||
// The consumer is only executed for successful (Right) values. Errors (Left values) are
|
||||
// propagated unchanged. This is useful for operations like logging successful results,
|
||||
@@ -79,12 +79,13 @@ import "github.com/IBM/fp-go/v2/io"
|
||||
// ioeither.Map[error](func(struct{}) int { return len(successfulValues) }),
|
||||
// )
|
||||
// count := pipeline() // Returns Right(1), successfulValues contains [100]
|
||||
//
|
||||
//go:inline
|
||||
func ChainConsumer[E, A any](c Consumer[A]) Operator[E, A, struct{}] {
|
||||
return ChainIOK[E](io.FromConsumerK(c))
|
||||
return ChainIOK[E](io.FromConsumer(c))
|
||||
}
|
||||
|
||||
//go:inline
|
||||
func ChainFirstConsumer[E, A any](c Consumer[A]) Operator[E, A, A] {
|
||||
return ChainFirstIOK[E](io.FromConsumerK(c))
|
||||
return ChainFirstIOK[E](io.FromConsumer(c))
|
||||
}
|
||||
|
||||
@@ -240,7 +240,7 @@ func TestCopyFileChaining(t *testing.T) {
|
||||
// Chain two copy operations
|
||||
result := F.Pipe1(
|
||||
CopyFile(srcPath)(dst1Path),
|
||||
IOE.Chain[error](func(string) IOEither[error, string] {
|
||||
IOE.Chain(func(string) IOEither[error, string] {
|
||||
return CopyFile(dst1Path)(dst2Path)
|
||||
}),
|
||||
)()
|
||||
|
||||
@@ -141,7 +141,7 @@ func TestFilterOrElse_WithMap(t *testing.T) {
|
||||
onNegative := func(n int) string { return "negative number" }
|
||||
|
||||
filter := FilterOrElse(isPositive, onNegative)
|
||||
double := Map[string](func(n int) int { return n * 2 })
|
||||
double := Map[string](N.Mul(2))
|
||||
|
||||
// Compose: filter then double
|
||||
result1 := double(filter(Right[string](5)))()
|
||||
|
||||
@@ -4,10 +4,10 @@ import "github.com/IBM/fp-go/v2/io"
|
||||
|
||||
//go:inline
|
||||
func ChainConsumer[A any](c Consumer[A]) Operator[A, struct{}] {
|
||||
return ChainIOK(io.FromConsumerK(c))
|
||||
return ChainIOK(io.FromConsumer(c))
|
||||
}
|
||||
|
||||
//go:inline
|
||||
func ChainFirstConsumer[A any](c Consumer[A]) Operator[A, A] {
|
||||
return ChainFirstIOK(io.FromConsumerK(c))
|
||||
return ChainFirstIOK(io.FromConsumer(c))
|
||||
}
|
||||
|
||||
201
v2/ioref/doc.go
Normal file
201
v2/ioref/doc.go
Normal file
@@ -0,0 +1,201 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
// Package ioref provides mutable references in the IO monad.
|
||||
//
|
||||
// # Overview
|
||||
//
|
||||
// IORef represents a mutable reference that can be read and written within IO computations.
|
||||
// It provides thread-safe access to shared mutable state using read-write locks, making it
|
||||
// safe to use across multiple goroutines.
|
||||
//
|
||||
// This package is inspired by Haskell's Data.IORef module and provides a functional approach
|
||||
// to managing mutable state with explicit IO effects.
|
||||
//
|
||||
// # Core Operations
|
||||
//
|
||||
// The package provides four main operations:
|
||||
//
|
||||
// - MakeIORef: Creates a new IORef with an initial value
|
||||
// - Read: Atomically reads the current value from an IORef
|
||||
// - Write: Atomically writes a new value to an IORef
|
||||
// - Modify: Atomically modifies the value using a transformation function
|
||||
// - ModifyWithResult: Atomically modifies the value and returns a computed result
|
||||
//
|
||||
// # Thread Safety
|
||||
//
|
||||
// All operations on IORef are thread-safe:
|
||||
//
|
||||
// - Read operations use read locks, allowing multiple concurrent readers
|
||||
// - Write and Modify operations use write locks, ensuring exclusive access
|
||||
// - The underlying sync.RWMutex ensures proper synchronization
|
||||
//
|
||||
// # Basic Usage
|
||||
//
|
||||
// Creating and using an IORef:
|
||||
//
|
||||
// import (
|
||||
// "github.com/IBM/fp-go/v2/ioref"
|
||||
// )
|
||||
//
|
||||
// // Create a new IORef
|
||||
// ref := ioref.MakeIORef(42)()
|
||||
//
|
||||
// // Read the current value
|
||||
// value := ioref.Read(ref)() // 42
|
||||
//
|
||||
// // Write a new value
|
||||
// ioref.Write(100)(ref)()
|
||||
//
|
||||
// // Read the updated value
|
||||
// newValue := ioref.Read(ref)() // 100
|
||||
//
|
||||
// # Modifying Values
|
||||
//
|
||||
// Use Modify to transform the value in place:
|
||||
//
|
||||
// ref := ioref.MakeIORef(10)()
|
||||
//
|
||||
// // Double the value
|
||||
// ioref.Modify(func(x int) int { return x * 2 })(ref)()
|
||||
//
|
||||
// // Chain multiple modifications
|
||||
// ioref.Modify(func(x int) int { return x + 5 })(ref)()
|
||||
// ioref.Modify(func(x int) int { return x * 3 })(ref)()
|
||||
//
|
||||
// result := ioref.Read(ref)() // (10 * 2 + 5) * 3 = 75
|
||||
//
|
||||
// # Atomic Modify with Result
|
||||
//
|
||||
// Use ModifyWithResult when you need to both transform the value and compute a result
|
||||
// from the old value in a single atomic operation:
|
||||
//
|
||||
// ref := ioref.MakeIORef(42)()
|
||||
//
|
||||
// // Increment and return the old value
|
||||
// oldValue := ioref.ModifyWithResult(func(x int) pair.Pair[int, int] {
|
||||
// return pair.MakePair(x+1, x)
|
||||
// })(ref)()
|
||||
//
|
||||
// // oldValue is 42, ref now contains 43
|
||||
//
|
||||
// This is particularly useful for implementing counters, swapping values, or any operation
|
||||
// where you need to know the previous state.
|
||||
//
|
||||
// # Concurrent Usage
|
||||
//
|
||||
// IORef is safe to use across multiple goroutines:
|
||||
//
|
||||
// ref := ioref.MakeIORef(0)()
|
||||
//
|
||||
// // Multiple goroutines can safely modify the same IORef
|
||||
// var wg sync.WaitGroup
|
||||
// for i := 0; i < 100; i++ {
|
||||
// wg.Add(1)
|
||||
// go func() {
|
||||
// defer wg.Done()
|
||||
// ioref.Modify(func(x int) int { return x + 1 })(ref)()
|
||||
// }()
|
||||
// }
|
||||
// wg.Wait()
|
||||
//
|
||||
// result := ioref.Read(ref)() // 100
|
||||
//
|
||||
// # Comparison with Haskell's IORef
|
||||
//
|
||||
// This implementation provides the following Haskell IORef operations:
|
||||
//
|
||||
// - newIORef → MakeIORef
|
||||
// - readIORef → Read
|
||||
// - writeIORef → Write
|
||||
// - modifyIORef → Modify
|
||||
// - atomicModifyIORef → ModifyWithResult
|
||||
//
|
||||
// The main difference is that Go's implementation uses explicit locking (sync.RWMutex)
|
||||
// rather than relying on the runtime's STM (Software Transactional Memory) as Haskell does.
|
||||
//
|
||||
// # Performance Considerations
|
||||
//
|
||||
// IORef operations are highly optimized:
|
||||
//
|
||||
// - Read operations are very fast (~5ns) and allow concurrent access
|
||||
// - Write and Modify operations are slightly slower (~7-8ns) due to exclusive locking
|
||||
// - ModifyWithResult is marginally slower (~9ns) due to tuple creation
|
||||
// - All operations have zero allocations in the common case
|
||||
//
|
||||
// For high-contention scenarios, consider:
|
||||
//
|
||||
// - Using multiple IORefs to reduce lock contention
|
||||
// - Batching modifications when possible
|
||||
// - Using Read locks for read-heavy workloads
|
||||
//
|
||||
// # Examples
|
||||
//
|
||||
// Counter with atomic increment:
|
||||
//
|
||||
// counter := ioref.MakeIORef(0)()
|
||||
//
|
||||
// increment := func() int {
|
||||
// return ioref.ModifyWithResult(func(x int) pair.Pair[int, int] {
|
||||
// return pair.MakePair(x+1, x+1)
|
||||
// })(counter)()
|
||||
// }
|
||||
//
|
||||
// id1 := increment() // 1
|
||||
// id2 := increment() // 2
|
||||
// id3 := increment() // 3
|
||||
//
|
||||
// Shared configuration:
|
||||
//
|
||||
// type Config struct {
|
||||
// MaxRetries int
|
||||
// Timeout time.Duration
|
||||
// }
|
||||
//
|
||||
// configRef := ioref.MakeIORef(Config{
|
||||
// MaxRetries: 3,
|
||||
// Timeout: 5 * time.Second,
|
||||
// })()
|
||||
//
|
||||
// // Update configuration
|
||||
// ioref.Modify(func(c Config) Config {
|
||||
// c.MaxRetries = 5
|
||||
// return c
|
||||
// })(configRef)()
|
||||
//
|
||||
// // Read configuration
|
||||
// config := ioref.Read(configRef)()
|
||||
//
|
||||
// Stack implementation:
|
||||
//
|
||||
// type Stack []int
|
||||
//
|
||||
// stackRef := ioref.MakeIORef(Stack{})()
|
||||
//
|
||||
// push := func(value int) {
|
||||
// ioref.Modify(func(s Stack) Stack {
|
||||
// return append(s, value)
|
||||
// })(stackRef)()
|
||||
// }
|
||||
//
|
||||
// pop := func() option.Option[int] {
|
||||
// return ioref.ModifyWithResult(func(s Stack) pair.Pair[Stack, option.Option[int]] {
|
||||
// if len(s) == 0 {
|
||||
// return pair.MakePair(s, option.None[int]())
|
||||
// }
|
||||
// return pair.MakePair(s[:len(s)-1], option.Some(s[len(s)-1]))
|
||||
// })(stackRef)()
|
||||
// }
|
||||
package ioref
|
||||
180
v2/ioref/ioref.go
Normal file
180
v2/ioref/ioref.go
Normal file
@@ -0,0 +1,180 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package ioref
|
||||
|
||||
import (
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
)
|
||||
|
||||
// MakeIORef creates a new IORef containing the given initial value.
|
||||
//
|
||||
// This function returns an IO computation that, when executed, creates a new
|
||||
// mutable reference initialized with the provided value. The reference is
|
||||
// thread-safe and can be safely shared across goroutines.
|
||||
//
|
||||
// Parameters:
|
||||
// - a: The initial value to store in the IORef
|
||||
//
|
||||
// Returns:
|
||||
// - An IO computation that produces a new IORef[A]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Create a new IORef with initial value 42
|
||||
// refIO := ioref.MakeIORef(42)
|
||||
// ref := refIO() // Execute the IO to get the IORef
|
||||
//
|
||||
// // Create an IORef with a string
|
||||
// strRefIO := ioref.MakeIORef("hello")
|
||||
// strRef := strRefIO()
|
||||
//
|
||||
//go:inline
|
||||
func MakeIORef[A any](a A) IO[IORef[A]] {
|
||||
return func() IORef[A] {
|
||||
return &ioRef[A]{a: a}
|
||||
}
|
||||
}
|
||||
|
||||
//go:inline
|
||||
func Write[A any](a A) io.Kleisli[IORef[A], A] {
|
||||
return func(ref IORef[A]) IO[A] {
|
||||
return func() A {
|
||||
ref.mu.Lock()
|
||||
defer ref.mu.Unlock()
|
||||
|
||||
ref.a = a
|
||||
return a
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Read atomically reads the current value from an IORef.
|
||||
//
|
||||
// This function returns an IO computation that reads the value stored in the
|
||||
// IORef. The read operation is thread-safe, using a read lock that allows
|
||||
// multiple concurrent readers but excludes writers.
|
||||
//
|
||||
// Parameters:
|
||||
// - ref: The IORef to read from
|
||||
//
|
||||
// Returns:
|
||||
// - An IO computation that produces the current value of type A
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// ref := ioref.MakeIORef(42)()
|
||||
//
|
||||
// // Read the current value
|
||||
// value := ioref.Read(ref)() // 42
|
||||
//
|
||||
// // Use in a pipeline
|
||||
// result := pipe.Pipe2(
|
||||
// ref,
|
||||
// ioref.Read[int],
|
||||
// io.Map(func(x int) int { return x * 2 }),
|
||||
// )()
|
||||
//
|
||||
//go:inline
|
||||
func Read[A any](ref IORef[A]) IO[A] {
|
||||
return func() A {
|
||||
ref.mu.RLock()
|
||||
defer ref.mu.RUnlock()
|
||||
|
||||
return ref.a
|
||||
}
|
||||
}
|
||||
|
||||
// Modify atomically modifies the value in an IORef using the given function.
|
||||
//
|
||||
// This function returns a Kleisli arrow that takes an IORef and produces an IO
|
||||
// computation that applies the transformation function to the current value.
|
||||
// The modification is atomic and thread-safe, using a write lock to ensure
|
||||
// exclusive access during the read-modify-write cycle.
|
||||
//
|
||||
// Parameters:
|
||||
// - f: An endomorphism (function from A to A) that transforms the current value
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow from IORef[A] to IO[IORef[A]]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// ref := ioref.MakeIORef(42)()
|
||||
//
|
||||
// // Double the value
|
||||
// ioref.Modify(func(x int) int { return x * 2 })(ref)()
|
||||
//
|
||||
// // Chain multiple modifications
|
||||
// pipe.Pipe2(
|
||||
// ref,
|
||||
// ioref.Modify(func(x int) int { return x + 10 }),
|
||||
// io.Chain(ioref.Modify(func(x int) int { return x * 2 })),
|
||||
// )()
|
||||
//
|
||||
//go:inline
|
||||
func Modify[A any](f Endomorphism[A]) io.Kleisli[IORef[A], A] {
|
||||
return func(ref IORef[A]) IO[A] {
|
||||
return func() A {
|
||||
ref.mu.Lock()
|
||||
defer ref.mu.Unlock()
|
||||
|
||||
ref.a = f(ref.a)
|
||||
return ref.a
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// ModifyWithResult atomically modifies the value in an IORef and returns both
|
||||
// the new value and an additional result computed from the old value.
|
||||
//
|
||||
// This function is useful when you need to both transform the stored value and
|
||||
// compute some result based on the old value in a single atomic operation.
|
||||
// It's similar to Haskell's atomicModifyIORef.
|
||||
//
|
||||
// Parameters:
|
||||
// - f: A function that takes the old value and returns a Pair of (new value, result)
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow from IORef[A] to IO[B] that produces the result
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// ref := ioref.MakeIORef(42)()
|
||||
//
|
||||
// // Increment and return the old value
|
||||
// oldValue := ioref.ModifyWithResult(func(x int) pair.Pair[int, int] {
|
||||
// return pair.MakePair(x+1, x)
|
||||
// })(ref)() // Returns 42, ref now contains 43
|
||||
//
|
||||
// // Swap and return the old value
|
||||
// old := ioref.ModifyWithResult(func(x int) pair.Pair[int, int] {
|
||||
// return pair.MakePair(100, x)
|
||||
// })(ref)() // Returns 43, ref now contains 100
|
||||
//
|
||||
//go:inline
|
||||
func ModifyWithResult[A, B any](f func(A) Pair[A, B]) io.Kleisli[IORef[A], B] {
|
||||
return func(ref IORef[A]) IO[B] {
|
||||
return func() B {
|
||||
ref.mu.Lock()
|
||||
defer ref.mu.Unlock()
|
||||
|
||||
result := f(ref.a)
|
||||
ref.a = pair.Head(result)
|
||||
return pair.Tail(result)
|
||||
}
|
||||
}
|
||||
}
|
||||
74
v2/ioref/types.go
Normal file
74
v2/ioref/types.go
Normal file
@@ -0,0 +1,74 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
// Package ioref provides mutable references in the IO monad.
|
||||
//
|
||||
// IORef represents a mutable reference that can be read and written within IO computations.
|
||||
// It provides thread-safe access to shared mutable state using read-write locks.
|
||||
//
|
||||
// This is inspired by Haskell's Data.IORef module and provides a functional approach
|
||||
// to managing mutable state with explicit IO effects.
|
||||
//
|
||||
// Example usage:
|
||||
//
|
||||
// // Create a new IORef
|
||||
// ref := ioref.MakeIORef(42)()
|
||||
//
|
||||
// // Read the current value
|
||||
// value := ioref.Read(ref)() // 42
|
||||
//
|
||||
// // Write a new value
|
||||
// ioref.Write(100)(ref)()
|
||||
//
|
||||
// // Modify the value
|
||||
// ioref.Modify(func(x int) int { return x * 2 })(ref)()
|
||||
//
|
||||
// // Read the modified value
|
||||
// newValue := ioref.Read(ref)() // 200
|
||||
package ioref
|
||||
|
||||
import (
|
||||
"sync"
|
||||
|
||||
"github.com/IBM/fp-go/v2/endomorphism"
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
)
|
||||
|
||||
type (
|
||||
// ioRef is the internal implementation of a mutable reference.
|
||||
// It uses a read-write mutex to ensure thread-safe access.
|
||||
ioRef[A any] struct {
|
||||
mu sync.RWMutex
|
||||
a A
|
||||
}
|
||||
|
||||
// IO represents a synchronous computation that may have side effects.
|
||||
// It's a function that takes no arguments and returns a value of type A.
|
||||
IO[A any] = io.IO[A]
|
||||
|
||||
// IORef represents a mutable reference to a value of type A.
|
||||
// Operations on IORef are thread-safe and performed within the IO monad.
|
||||
//
|
||||
// IORef provides a way to work with mutable state in a functional style,
|
||||
// where mutations are explicit and contained within IO computations.
|
||||
IORef[A any] = *ioRef[A]
|
||||
|
||||
// Endomorphism represents a function from A to A.
|
||||
// It's commonly used with Modify to transform the value in an IORef.
|
||||
Endomorphism[A any] = endomorphism.Endomorphism[A]
|
||||
|
||||
Pair[A, B any] = pair.Pair[A, B]
|
||||
)
|
||||
@@ -52,6 +52,7 @@ import (
|
||||
M "github.com/IBM/fp-go/v2/monoid"
|
||||
"github.com/IBM/fp-go/v2/option"
|
||||
"github.com/IBM/fp-go/v2/pair"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
)
|
||||
|
||||
// Of creates a sequence containing a single element.
|
||||
@@ -507,7 +508,7 @@ func MonadAp[B, A any](fab Seq[func(A) B], fa Seq[A]) Seq[B] {
|
||||
//
|
||||
//go:inline
|
||||
func Ap[B, A any](fa Seq[A]) Operator[func(A) B, B] {
|
||||
return F.Bind2nd(MonadAp[B, A], fa)
|
||||
return Chain(F.Bind1st(MonadMap[A, B], fa))
|
||||
}
|
||||
|
||||
// From creates a sequence from a variadic list of elements.
|
||||
@@ -708,9 +709,7 @@ func Fold[A any](m M.Monoid[A]) func(Seq[A]) A {
|
||||
//
|
||||
//go:inline
|
||||
func MonadFoldMap[A, B any](fa Seq[A], f func(A) B, m M.Monoid[B]) B {
|
||||
return MonadReduce(fa, func(b B, a A) B {
|
||||
return m.Concat(b, f(a))
|
||||
}, m.Empty())
|
||||
return MonadFold(MonadMap(fa, f), m)
|
||||
}
|
||||
|
||||
// FoldMap returns a function that maps and folds using a monoid.
|
||||
@@ -728,11 +727,10 @@ func MonadFoldMap[A, B any](fa Seq[A], f func(A) B, m M.Monoid[B]) B {
|
||||
//
|
||||
//go:inline
|
||||
func FoldMap[A, B any](m M.Monoid[B]) func(func(A) B) func(Seq[A]) B {
|
||||
return func(f func(A) B) func(Seq[A]) B {
|
||||
return func(as Seq[A]) B {
|
||||
return MonadFoldMap(as, f, m)
|
||||
}
|
||||
}
|
||||
return F.Pipe1(
|
||||
Map[A, B],
|
||||
reader.Map[func(A) B](reader.Map[Seq[A]](Fold(m))),
|
||||
)
|
||||
}
|
||||
|
||||
// MonadFoldMapWithIndex maps each element with its index to a monoid value and combines them.
|
||||
@@ -903,11 +901,51 @@ func Zip[A, B any](fb Seq[B]) func(Seq[A]) Seq2[A, B] {
|
||||
return F.Bind2nd(MonadZip[A, B], fb)
|
||||
}
|
||||
|
||||
// MonadMapToArray maps each element in a sequence using a function and collects the results into an array.
|
||||
// This is a convenience function that combines Map and collection into a single operation.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type of elements in the input sequence
|
||||
// - B: The type of elements in the output array
|
||||
//
|
||||
// Parameters:
|
||||
// - fa: The input sequence to map
|
||||
// - f: The mapping function to apply to each element
|
||||
//
|
||||
// Returns:
|
||||
// - A slice containing all mapped elements
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// seq := From(1, 2, 3)
|
||||
// result := MonadMapToArray(seq, N.Mul(2))
|
||||
// // returns: []int{2, 4, 6}
|
||||
//
|
||||
//go:inline
|
||||
func MonadMapToArray[A, B any](fa Seq[A], f func(A) B) []B {
|
||||
return G.MonadMapToArray[Seq[A], []B](fa, f)
|
||||
}
|
||||
|
||||
// MapToArray returns a function that maps elements and collects them into an array.
|
||||
// This is the curried version of MonadMapToArray.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type of elements in the input sequence
|
||||
// - B: The type of elements in the output array
|
||||
//
|
||||
// Parameters:
|
||||
// - f: The mapping function to apply to each element
|
||||
//
|
||||
// Returns:
|
||||
// - A function that takes a sequence and returns a slice of mapped elements
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// double := MapToArray(N.Mul(2))
|
||||
// seq := From(1, 2, 3)
|
||||
// result := double(seq)
|
||||
// // returns: []int{2, 4, 6}
|
||||
//
|
||||
//go:inline
|
||||
func MapToArray[A, B any](f func(A) B) func(Seq[A]) []B {
|
||||
return G.MapToArray[Seq[A], []B](f)
|
||||
|
||||
@@ -19,6 +19,7 @@ import (
|
||||
"fmt"
|
||||
"maps"
|
||||
"slices"
|
||||
"strconv"
|
||||
"strings"
|
||||
"testing"
|
||||
|
||||
@@ -295,13 +296,13 @@ func TestMakeBy(t *testing.T) {
|
||||
}
|
||||
|
||||
func TestMakeByZero(t *testing.T) {
|
||||
seq := MakeBy(0, func(i int) int { return i })
|
||||
seq := MakeBy(0, F.Identity)
|
||||
result := toSlice(seq)
|
||||
assert.Empty(t, result)
|
||||
}
|
||||
|
||||
func TestMakeByNegative(t *testing.T) {
|
||||
seq := MakeBy(-5, func(i int) int { return i })
|
||||
seq := MakeBy(-5, F.Identity)
|
||||
result := toSlice(seq)
|
||||
assert.Empty(t, result)
|
||||
}
|
||||
@@ -375,17 +376,13 @@ func TestFold(t *testing.T) {
|
||||
|
||||
func TestMonadFoldMap(t *testing.T) {
|
||||
seq := From(1, 2, 3)
|
||||
result := MonadFoldMap(seq, func(x int) string {
|
||||
return fmt.Sprintf("%d", x)
|
||||
}, S.Monoid)
|
||||
result := MonadFoldMap(seq, strconv.Itoa, S.Monoid)
|
||||
assert.Equal(t, "123", result)
|
||||
}
|
||||
|
||||
func TestFoldMap(t *testing.T) {
|
||||
seq := From(1, 2, 3)
|
||||
folder := FoldMap[int](S.Monoid)(func(x int) string {
|
||||
return fmt.Sprintf("%d", x)
|
||||
})
|
||||
folder := FoldMap[int](S.Monoid)(strconv.Itoa)
|
||||
result := folder(seq)
|
||||
assert.Equal(t, "123", result)
|
||||
}
|
||||
|
||||
@@ -19,6 +19,7 @@ import (
|
||||
I "iter"
|
||||
|
||||
"github.com/IBM/fp-go/v2/endomorphism"
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
"github.com/IBM/fp-go/v2/iterator/stateless"
|
||||
"github.com/IBM/fp-go/v2/optics/lens"
|
||||
"github.com/IBM/fp-go/v2/optics/prism"
|
||||
@@ -29,41 +30,155 @@ import (
|
||||
|
||||
type (
|
||||
// Option represents an optional value, either Some(value) or None.
|
||||
// It is used to handle computations that may or may not return a value,
|
||||
// providing a type-safe alternative to nil pointers or sentinel values.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type of the value that may be present
|
||||
Option[A any] = option.Option[A]
|
||||
|
||||
// Seq is a single-value iterator sequence from Go 1.23+.
|
||||
// It represents a lazy sequence of values that can be iterated using range.
|
||||
// Operations on Seq are lazy and only execute when the sequence is consumed.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - T: The type of elements in the sequence
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// seq := From(1, 2, 3)
|
||||
// for v := range seq {
|
||||
// fmt.Println(v)
|
||||
// }
|
||||
Seq[T any] = I.Seq[T]
|
||||
|
||||
// Seq2 is a key-value iterator sequence from Go 1.23+.
|
||||
// It represents a lazy sequence of key-value pairs that can be iterated using range.
|
||||
// This is useful for working with map-like data structures in a functional way.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - K: The type of keys in the sequence
|
||||
// - V: The type of values in the sequence
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// seq := MonadZip(From(1, 2, 3), From("a", "b", "c"))
|
||||
// for k, v := range seq {
|
||||
// fmt.Printf("%d: %s\n", k, v)
|
||||
// }
|
||||
Seq2[K, V any] = I.Seq2[K, V]
|
||||
|
||||
// Iterator is a stateless iterator type.
|
||||
// It provides a functional interface for iterating over collections
|
||||
// without maintaining internal state.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - T: The type of elements produced by the iterator
|
||||
Iterator[T any] = stateless.Iterator[T]
|
||||
|
||||
// Predicate is a function that tests a value and returns a boolean.
|
||||
// Predicates are commonly used for filtering operations.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - T: The type of value being tested
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// isEven := func(x int) bool { return x%2 == 0 }
|
||||
// filtered := Filter(isEven)(From(1, 2, 3, 4))
|
||||
Predicate[T any] = predicate.Predicate[T]
|
||||
|
||||
// Kleisli represents a function that takes a value and returns a sequence.
|
||||
// This is the monadic bind operation for sequences.
|
||||
// This is the monadic bind operation for sequences, also known as flatMap.
|
||||
// It's used to chain operations that produce sequences.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The input type
|
||||
// - B: The element type of the output sequence
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// duplicate := func(x int) Seq[int] { return From(x, x) }
|
||||
// result := Chain(duplicate)(From(1, 2, 3))
|
||||
// // yields: 1, 1, 2, 2, 3, 3
|
||||
Kleisli[A, B any] = func(A) Seq[B]
|
||||
|
||||
// Kleisli2 represents a function that takes a value and returns a key-value sequence.
|
||||
// This is the monadic bind operation for key-value sequences.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - K: The key type in the output sequence
|
||||
// - A: The input type
|
||||
// - B: The value type in the output sequence
|
||||
Kleisli2[K, A, B any] = func(A) Seq2[K, B]
|
||||
|
||||
// Operator represents a transformation from one sequence to another.
|
||||
// It's a function that takes a Seq[A] and returns a Seq[B].
|
||||
// Operators are the building blocks for composing sequence transformations.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The element type of the input sequence
|
||||
// - B: The element type of the output sequence
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// double := Map(func(x int) int { return x * 2 })
|
||||
// result := double(From(1, 2, 3))
|
||||
// // yields: 2, 4, 6
|
||||
Operator[A, B any] = Kleisli[Seq[A], B]
|
||||
|
||||
// Operator2 represents a transformation from one key-value sequence to another.
|
||||
// It's a function that takes a Seq2[K, A] and returns a Seq2[K, B].
|
||||
//
|
||||
// Type Parameters:
|
||||
// - K: The key type (preserved in the transformation)
|
||||
// - A: The value type of the input sequence
|
||||
// - B: The value type of the output sequence
|
||||
Operator2[K, A, B any] = Kleisli2[K, Seq2[K, A], B]
|
||||
|
||||
// Lens is an optic that focuses on a field within a structure.
|
||||
// It provides a functional way to get and set values in immutable data structures.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - S: The structure type
|
||||
// - A: The field type being focused on
|
||||
Lens[S, A any] = lens.Lens[S, A]
|
||||
|
||||
// Prism is an optic that focuses on a case of a sum type.
|
||||
// It provides a functional way to work with variant types (like Result or Option).
|
||||
//
|
||||
// Type Parameters:
|
||||
// - S: The sum type
|
||||
// - A: The case type being focused on
|
||||
Prism[S, A any] = prism.Prism[S, A]
|
||||
|
||||
// Endomorphism is a function from a type to itself.
|
||||
// It represents transformations that preserve the type.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type being transformed
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// increment := func(x int) int { return x + 1 }
|
||||
// result := increment(5) // returns 6
|
||||
Endomorphism[A any] = endomorphism.Endomorphism[A]
|
||||
|
||||
// Pair represents a tuple of two values.
|
||||
// It's used to group two related values together.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type of the first element
|
||||
// - B: The type of the second element
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// p := pair.MakePair(1, "hello")
|
||||
// first := pair.Head(p) // returns 1
|
||||
// second := pair.Tail(p) // returns "hello"
|
||||
Pair[A, B any] = pair.Pair[A, B]
|
||||
|
||||
// Void represents the absence of a value, similar to void in other languages.
|
||||
// It's used in functions that perform side effects but don't return meaningful values.
|
||||
Void = function.Void
|
||||
)
|
||||
|
||||
@@ -15,7 +15,10 @@
|
||||
|
||||
package iter
|
||||
|
||||
import F "github.com/IBM/fp-go/v2/function"
|
||||
import (
|
||||
"github.com/IBM/fp-go/v2/function"
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
)
|
||||
|
||||
// Uniq returns an operator that filters a sequence to contain only unique elements,
|
||||
// where uniqueness is determined by a key extraction function.
|
||||
@@ -44,14 +47,14 @@ import F "github.com/IBM/fp-go/v2/function"
|
||||
// Example - Remove duplicate integers:
|
||||
//
|
||||
// seq := From(1, 2, 3, 2, 4, 1, 5)
|
||||
// unique := Uniq(func(x int) int { return x })
|
||||
// unique := Uniq(reader.Ask[int]())
|
||||
// result := unique(seq)
|
||||
// // yields: 1, 2, 3, 4, 5
|
||||
//
|
||||
// Example - Unique by string length:
|
||||
//
|
||||
// seq := From("a", "bb", "c", "dd", "eee")
|
||||
// uniqueByLength := Uniq(func(s string) int { return len(s) })
|
||||
// uniqueByLength := Uniq(S.Size)
|
||||
// result := uniqueByLength(seq)
|
||||
// // yields: "a", "bb", "eee" (first occurrence of each length)
|
||||
//
|
||||
@@ -79,24 +82,24 @@ import F "github.com/IBM/fp-go/v2/function"
|
||||
// Example - Empty sequence:
|
||||
//
|
||||
// seq := Empty[int]()
|
||||
// unique := Uniq(func(x int) int { return x })
|
||||
// unique := Uniq(reader.Ask[int]())
|
||||
// result := unique(seq)
|
||||
// // yields: nothing (empty sequence)
|
||||
//
|
||||
// Example - All duplicates:
|
||||
//
|
||||
// seq := From(1, 1, 1, 1)
|
||||
// unique := Uniq(func(x int) int { return x })
|
||||
// unique := Uniq(reader.Ask[int]())
|
||||
// result := unique(seq)
|
||||
// // yields: 1 (only first occurrence)
|
||||
func Uniq[A any, K comparable](f func(A) K) Operator[A, A] {
|
||||
return func(s Seq[A]) Seq[A] {
|
||||
return func(yield func(A) bool) {
|
||||
items := make(map[K]struct{})
|
||||
items := make(map[K]Void)
|
||||
for a := range s {
|
||||
k := f(a)
|
||||
if _, ok := items[k]; !ok {
|
||||
items[k] = struct{}{}
|
||||
items[k] = function.VOID
|
||||
if !yield(a) {
|
||||
return
|
||||
}
|
||||
|
||||
@@ -377,7 +377,7 @@ func ExampleUniq() {
|
||||
|
||||
func ExampleUniq_byLength() {
|
||||
seq := From("a", "bb", "c", "dd", "eee")
|
||||
uniqueByLength := Uniq(func(s string) int { return len(s) })
|
||||
uniqueByLength := Uniq(S.Size)
|
||||
result := uniqueByLength(seq)
|
||||
|
||||
for v := range result {
|
||||
|
||||
@@ -25,6 +25,7 @@ import (
|
||||
M "github.com/IBM/fp-go/v2/monoid"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
L "github.com/IBM/fp-go/v2/optics/lens"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
@@ -497,7 +498,7 @@ func TestMapComposition(t *testing.T) {
|
||||
Of(5),
|
||||
Map(N.Mul(2)),
|
||||
Map(N.Add(10)),
|
||||
Map(func(x int) int { return x }),
|
||||
Map(reader.Ask[int]()),
|
||||
)
|
||||
|
||||
assert.Equal(t, 20, result())
|
||||
|
||||
@@ -154,7 +154,7 @@ FunctionMonoid - Creates a monoid for functions when the codomain has a monoid:
|
||||
|
||||
funcMonoid := monoid.FunctionMonoid[string, int](intAddMonoid)
|
||||
|
||||
f1 := func(s string) int { return len(s) }
|
||||
f1 := S.Size
|
||||
f2 := func(s string) int { return len(s) * 2 }
|
||||
|
||||
// Combine functions: result(x) = f1(x) + f2(x)
|
||||
|
||||
@@ -49,7 +49,7 @@ import (
|
||||
// funcMonoid := FunctionMonoid[string, int](intAddMonoid)
|
||||
//
|
||||
// // Define some functions
|
||||
// f1 := func(s string) int { return len(s) }
|
||||
// f1 := S.Size
|
||||
// f2 := func(s string) int { return len(s) * 2 }
|
||||
//
|
||||
// // Combine functions: result(x) = f1(x) + f2(x)
|
||||
|
||||
@@ -262,7 +262,7 @@ func imap[S any, AB ~func(A) B, BA ~func(B) A, A, B any](sa Prism[S, A], ab AB,
|
||||
//
|
||||
// intPrism := MakePrism(...) // Prism[Result, int]
|
||||
// stringPrism := IMap[Result](
|
||||
// func(n int) string { return strconv.Itoa(n) },
|
||||
// strconv.Itoa,
|
||||
// func(s string) int { n, _ := strconv.Atoi(s); return n },
|
||||
// )(intPrism) // Prism[Result, string]
|
||||
func IMap[S any, AB ~func(A) B, BA ~func(B) A, A, B any](ab AB, ba BA) Operator[S, A, B] {
|
||||
|
||||
@@ -83,6 +83,8 @@ func Monoid[A any]() func(S.Semigroup[A]) M.Monoid[Option[A]] {
|
||||
// intMonoid := monoid.MakeMonoid(func(a, b int) int { return a + b }, 0)
|
||||
// optMonoid := AlternativeMonoid(intMonoid)
|
||||
// result := optMonoid.Concat(Some(2), Some(3)) // Some(5)
|
||||
//
|
||||
//go:inline
|
||||
func AlternativeMonoid[A any](m M.Monoid[A]) M.Monoid[Option[A]] {
|
||||
return M.AlternativeMonoid(
|
||||
Of[A],
|
||||
@@ -103,9 +105,81 @@ func AlternativeMonoid[A any](m M.Monoid[A]) M.Monoid[Option[A]] {
|
||||
// optMonoid.Concat(Some(2), Some(3)) // Some(2) - returns first Some
|
||||
// optMonoid.Concat(None[int](), Some(3)) // Some(3)
|
||||
// optMonoid.Empty() // None
|
||||
//
|
||||
//go:inline
|
||||
func AltMonoid[A any]() M.Monoid[Option[A]] {
|
||||
return M.AltMonoid(
|
||||
None[A],
|
||||
MonadAlt[A],
|
||||
)
|
||||
}
|
||||
|
||||
// takeFirst is a helper function that returns the first Some value, or the second if the first is None.
|
||||
func takeFirst[A any](l, r Option[A]) Option[A] {
|
||||
if IsSome(l) {
|
||||
return l
|
||||
}
|
||||
return r
|
||||
}
|
||||
|
||||
// FirstMonoid creates a Monoid for Option[A] that returns the first Some value.
|
||||
// This monoid prefers the left operand when it is Some, otherwise returns the right operand.
|
||||
// The empty value is None.
|
||||
//
|
||||
// This is equivalent to AltMonoid but implemented more directly.
|
||||
//
|
||||
// Truth table:
|
||||
//
|
||||
// | x | y | concat(x, y) |
|
||||
// | ------- | ------- | ------------ |
|
||||
// | none | none | none |
|
||||
// | some(a) | none | some(a) |
|
||||
// | none | some(b) | some(b) |
|
||||
// | some(a) | some(b) | some(a) |
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// optMonoid := FirstMonoid[int]()
|
||||
// optMonoid.Concat(Some(2), Some(3)) // Some(2) - returns first Some
|
||||
// optMonoid.Concat(None[int](), Some(3)) // Some(3)
|
||||
// optMonoid.Concat(Some(2), None[int]()) // Some(2)
|
||||
// optMonoid.Empty() // None
|
||||
//
|
||||
//go:inline
|
||||
func FirstMonoid[A any]() M.Monoid[Option[A]] {
|
||||
return M.MakeMonoid(takeFirst[A], None[A]())
|
||||
}
|
||||
|
||||
// takeLast is a helper function that returns the last Some value, or the first if the last is None.
|
||||
func takeLast[A any](l, r Option[A]) Option[A] {
|
||||
if IsSome(r) {
|
||||
return r
|
||||
}
|
||||
return l
|
||||
}
|
||||
|
||||
// LastMonoid creates a Monoid for Option[A] that returns the last Some value.
|
||||
// This monoid prefers the right operand when it is Some, otherwise returns the left operand.
|
||||
// The empty value is None.
|
||||
//
|
||||
// Truth table:
|
||||
//
|
||||
// | x | y | concat(x, y) |
|
||||
// | ------- | ------- | ------------ |
|
||||
// | none | none | none |
|
||||
// | some(a) | none | some(a) |
|
||||
// | none | some(b) | some(b) |
|
||||
// | some(a) | some(b) | some(b) |
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// optMonoid := LastMonoid[int]()
|
||||
// optMonoid.Concat(Some(2), Some(3)) // Some(3) - returns last Some
|
||||
// optMonoid.Concat(None[int](), Some(3)) // Some(3)
|
||||
// optMonoid.Concat(Some(2), None[int]()) // Some(2)
|
||||
// optMonoid.Empty() // None
|
||||
//
|
||||
//go:inline
|
||||
func LastMonoid[A any]() M.Monoid[Option[A]] {
|
||||
return M.MakeMonoid(takeLast[A], None[A]())
|
||||
}
|
||||
|
||||
445
v2/option/monoid_test.go
Normal file
445
v2/option/monoid_test.go
Normal file
@@ -0,0 +1,445 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package option
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
M "github.com/IBM/fp-go/v2/monoid"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
S "github.com/IBM/fp-go/v2/semigroup"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestSemigroupAssociativity tests the associativity law for Semigroup
|
||||
func TestSemigroupAssociativity(t *testing.T) {
|
||||
intSemigroup := S.MakeSemigroup(func(a, b int) int { return a + b })
|
||||
optSemigroup := Semigroup[int]()(intSemigroup)
|
||||
|
||||
a := Some(1)
|
||||
b := Some(2)
|
||||
c := Some(3)
|
||||
|
||||
// Test that (a • b) • c = a • (b • c)
|
||||
left := optSemigroup.Concat(optSemigroup.Concat(a, b), c)
|
||||
right := optSemigroup.Concat(a, optSemigroup.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, Some(6), left)
|
||||
}
|
||||
|
||||
// TestSemigroupWithNone tests Semigroup behavior with None values
|
||||
func TestSemigroupWithNone(t *testing.T) {
|
||||
intSemigroup := S.MakeSemigroup(func(a, b int) int { return a + b })
|
||||
optSemigroup := Semigroup[int]()(intSemigroup)
|
||||
|
||||
t.Run("None with None", func(t *testing.T) {
|
||||
result := optSemigroup.Concat(None[int](), None[int]())
|
||||
assert.Equal(t, None[int](), result)
|
||||
})
|
||||
|
||||
t.Run("associativity with None", func(t *testing.T) {
|
||||
a := None[int]()
|
||||
b := Some(2)
|
||||
c := Some(3)
|
||||
|
||||
left := optSemigroup.Concat(optSemigroup.Concat(a, b), c)
|
||||
right := optSemigroup.Concat(a, optSemigroup.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, Some(5), left)
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidIdentityLaws tests the identity laws for Monoid
|
||||
func TestMonoidIdentityLaws(t *testing.T) {
|
||||
intSemigroup := S.MakeSemigroup(func(a, b int) int { return a + b })
|
||||
optMonoid := Monoid[int]()(intSemigroup)
|
||||
|
||||
t.Run("left identity with Some", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(optMonoid.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity with Some", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(x, optMonoid.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("left identity with None", func(t *testing.T) {
|
||||
x := None[int]()
|
||||
result := optMonoid.Concat(optMonoid.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity with None", func(t *testing.T) {
|
||||
x := None[int]()
|
||||
result := optMonoid.Concat(x, optMonoid.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestAlternativeMonoidIdentityLaws tests identity laws for AlternativeMonoid
|
||||
func TestAlternativeMonoidIdentityLaws(t *testing.T) {
|
||||
intMonoid := N.MonoidSum[int]()
|
||||
optMonoid := AlternativeMonoid(intMonoid)
|
||||
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(optMonoid.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(x, optMonoid.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("empty is Some(0)", func(t *testing.T) {
|
||||
empty := optMonoid.Empty()
|
||||
assert.Equal(t, Some(0), empty)
|
||||
})
|
||||
}
|
||||
|
||||
// TestAltMonoidIdentityLaws tests identity laws for AltMonoid
|
||||
func TestAltMonoidIdentityLaws(t *testing.T) {
|
||||
optMonoid := AltMonoid[int]()
|
||||
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(optMonoid.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(x, optMonoid.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("associativity", func(t *testing.T) {
|
||||
a := Some(1)
|
||||
b := None[int]()
|
||||
c := Some(3)
|
||||
|
||||
left := optMonoid.Concat(optMonoid.Concat(a, b), c)
|
||||
right := optMonoid.Concat(a, optMonoid.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, Some(1), left)
|
||||
})
|
||||
}
|
||||
|
||||
// TestFirstMonoid tests the FirstMonoid implementation
|
||||
func TestFirstMonoid(t *testing.T) {
|
||||
optMonoid := FirstMonoid[int]()
|
||||
|
||||
t.Run("both Some values - returns first", func(t *testing.T) {
|
||||
result := optMonoid.Concat(Some(2), Some(3))
|
||||
assert.Equal(t, Some(2), result)
|
||||
})
|
||||
|
||||
t.Run("left Some, right None", func(t *testing.T) {
|
||||
result := optMonoid.Concat(Some(2), None[int]())
|
||||
assert.Equal(t, Some(2), result)
|
||||
})
|
||||
|
||||
t.Run("left None, right Some", func(t *testing.T) {
|
||||
result := optMonoid.Concat(None[int](), Some(3))
|
||||
assert.Equal(t, Some(3), result)
|
||||
})
|
||||
|
||||
t.Run("both None", func(t *testing.T) {
|
||||
result := optMonoid.Concat(None[int](), None[int]())
|
||||
assert.Equal(t, None[int](), result)
|
||||
})
|
||||
|
||||
t.Run("empty value", func(t *testing.T) {
|
||||
empty := optMonoid.Empty()
|
||||
assert.Equal(t, None[int](), empty)
|
||||
})
|
||||
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(optMonoid.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(x, optMonoid.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("associativity", func(t *testing.T) {
|
||||
a := Some(1)
|
||||
b := Some(2)
|
||||
c := Some(3)
|
||||
|
||||
left := optMonoid.Concat(optMonoid.Concat(a, b), c)
|
||||
right := optMonoid.Concat(a, optMonoid.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, Some(1), left)
|
||||
})
|
||||
|
||||
t.Run("multiple concatenations", func(t *testing.T) {
|
||||
// Should return the first Some value encountered
|
||||
result := optMonoid.Concat(
|
||||
optMonoid.Concat(None[int](), Some(1)),
|
||||
optMonoid.Concat(Some(2), Some(3)),
|
||||
)
|
||||
assert.Equal(t, Some(1), result)
|
||||
})
|
||||
|
||||
t.Run("with strings", func(t *testing.T) {
|
||||
strMonoid := FirstMonoid[string]()
|
||||
|
||||
result := strMonoid.Concat(Some("first"), Some("second"))
|
||||
assert.Equal(t, Some("first"), result)
|
||||
|
||||
result = strMonoid.Concat(None[string](), Some("second"))
|
||||
assert.Equal(t, Some("second"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLastMonoid tests the LastMonoid implementation
|
||||
func TestLastMonoid(t *testing.T) {
|
||||
optMonoid := LastMonoid[int]()
|
||||
|
||||
t.Run("both Some values - returns last", func(t *testing.T) {
|
||||
result := optMonoid.Concat(Some(2), Some(3))
|
||||
assert.Equal(t, Some(3), result)
|
||||
})
|
||||
|
||||
t.Run("left Some, right None", func(t *testing.T) {
|
||||
result := optMonoid.Concat(Some(2), None[int]())
|
||||
assert.Equal(t, Some(2), result)
|
||||
})
|
||||
|
||||
t.Run("left None, right Some", func(t *testing.T) {
|
||||
result := optMonoid.Concat(None[int](), Some(3))
|
||||
assert.Equal(t, Some(3), result)
|
||||
})
|
||||
|
||||
t.Run("both None", func(t *testing.T) {
|
||||
result := optMonoid.Concat(None[int](), None[int]())
|
||||
assert.Equal(t, None[int](), result)
|
||||
})
|
||||
|
||||
t.Run("empty value", func(t *testing.T) {
|
||||
empty := optMonoid.Empty()
|
||||
assert.Equal(t, None[int](), empty)
|
||||
})
|
||||
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(optMonoid.Empty(), x)
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
x := Some(5)
|
||||
result := optMonoid.Concat(x, optMonoid.Empty())
|
||||
assert.Equal(t, x, result)
|
||||
})
|
||||
|
||||
t.Run("associativity", func(t *testing.T) {
|
||||
a := Some(1)
|
||||
b := Some(2)
|
||||
c := Some(3)
|
||||
|
||||
left := optMonoid.Concat(optMonoid.Concat(a, b), c)
|
||||
right := optMonoid.Concat(a, optMonoid.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, Some(3), left)
|
||||
})
|
||||
|
||||
t.Run("multiple concatenations", func(t *testing.T) {
|
||||
// Should return the last Some value encountered
|
||||
result := optMonoid.Concat(
|
||||
optMonoid.Concat(Some(1), Some(2)),
|
||||
optMonoid.Concat(Some(3), None[int]()),
|
||||
)
|
||||
assert.Equal(t, Some(3), result)
|
||||
})
|
||||
|
||||
t.Run("with strings", func(t *testing.T) {
|
||||
strMonoid := LastMonoid[string]()
|
||||
|
||||
result := strMonoid.Concat(Some("first"), Some("second"))
|
||||
assert.Equal(t, Some("second"), result)
|
||||
|
||||
result = strMonoid.Concat(Some("first"), None[string]())
|
||||
assert.Equal(t, Some("first"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestFirstMonoidVsAltMonoid verifies FirstMonoid and AltMonoid have the same behavior
|
||||
func TestFirstMonoidVsAltMonoid(t *testing.T) {
|
||||
firstMonoid := FirstMonoid[int]()
|
||||
altMonoid := AltMonoid[int]()
|
||||
|
||||
testCases := []struct {
|
||||
name string
|
||||
left Option[int]
|
||||
right Option[int]
|
||||
}{
|
||||
{"both Some", Some(1), Some(2)},
|
||||
{"left Some, right None", Some(1), None[int]()},
|
||||
{"left None, right Some", None[int](), Some(2)},
|
||||
{"both None", None[int](), None[int]()},
|
||||
}
|
||||
|
||||
for _, tc := range testCases {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
firstResult := firstMonoid.Concat(tc.left, tc.right)
|
||||
altResult := altMonoid.Concat(tc.left, tc.right)
|
||||
assert.Equal(t, firstResult, altResult, "FirstMonoid and AltMonoid should behave the same")
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// TestFirstMonoidVsLastMonoid verifies the difference between FirstMonoid and LastMonoid
|
||||
func TestFirstMonoidVsLastMonoid(t *testing.T) {
|
||||
firstMonoid := FirstMonoid[int]()
|
||||
lastMonoid := LastMonoid[int]()
|
||||
|
||||
t.Run("both Some - different results", func(t *testing.T) {
|
||||
firstResult := firstMonoid.Concat(Some(1), Some(2))
|
||||
lastResult := lastMonoid.Concat(Some(1), Some(2))
|
||||
|
||||
assert.Equal(t, Some(1), firstResult)
|
||||
assert.Equal(t, Some(2), lastResult)
|
||||
assert.NotEqual(t, firstResult, lastResult)
|
||||
})
|
||||
|
||||
t.Run("with None - same results", func(t *testing.T) {
|
||||
testCases := []struct {
|
||||
name string
|
||||
left Option[int]
|
||||
right Option[int]
|
||||
expected Option[int]
|
||||
}{
|
||||
{"left Some, right None", Some(1), None[int](), Some(1)},
|
||||
{"left None, right Some", None[int](), Some(2), Some(2)},
|
||||
{"both None", None[int](), None[int](), None[int]()},
|
||||
}
|
||||
|
||||
for _, tc := range testCases {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
firstResult := firstMonoid.Concat(tc.left, tc.right)
|
||||
lastResult := lastMonoid.Concat(tc.left, tc.right)
|
||||
|
||||
assert.Equal(t, tc.expected, firstResult)
|
||||
assert.Equal(t, tc.expected, lastResult)
|
||||
assert.Equal(t, firstResult, lastResult)
|
||||
})
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidComparison compares different monoid implementations
|
||||
func TestMonoidComparison(t *testing.T) {
|
||||
t.Run("Monoid vs AlternativeMonoid with addition", func(t *testing.T) {
|
||||
intSemigroup := S.MakeSemigroup(func(a, b int) int { return a + b })
|
||||
regularMonoid := Monoid[int]()(intSemigroup)
|
||||
|
||||
intMonoid := M.MakeMonoid(func(a, b int) int { return a + b }, 0)
|
||||
altMonoid := AlternativeMonoid(intMonoid)
|
||||
|
||||
// Both should combine Some values the same way
|
||||
assert.Equal(t,
|
||||
regularMonoid.Concat(Some(2), Some(3)),
|
||||
altMonoid.Concat(Some(2), Some(3)),
|
||||
)
|
||||
|
||||
// But empty values differ
|
||||
assert.Equal(t, None[int](), regularMonoid.Empty())
|
||||
assert.Equal(t, Some(0), altMonoid.Empty())
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidLaws verifies monoid laws for all monoid implementations
|
||||
func TestMonoidLaws(t *testing.T) {
|
||||
t.Run("Monoid with addition", func(t *testing.T) {
|
||||
intSemigroup := N.SemigroupSum[int]()
|
||||
optMonoid := Monoid[int]()(intSemigroup)
|
||||
|
||||
a := Some(1)
|
||||
b := Some(2)
|
||||
c := Some(3)
|
||||
|
||||
// Associativity: (a • b) • c = a • (b • c)
|
||||
left := optMonoid.Concat(optMonoid.Concat(a, b), c)
|
||||
right := optMonoid.Concat(a, optMonoid.Concat(b, c))
|
||||
assert.Equal(t, left, right)
|
||||
|
||||
// Left identity: Empty() • a = a
|
||||
leftId := optMonoid.Concat(optMonoid.Empty(), a)
|
||||
assert.Equal(t, a, leftId)
|
||||
|
||||
// Right identity: a • Empty() = a
|
||||
rightId := optMonoid.Concat(a, optMonoid.Empty())
|
||||
assert.Equal(t, a, rightId)
|
||||
})
|
||||
|
||||
t.Run("FirstMonoid laws", func(t *testing.T) {
|
||||
optMonoid := FirstMonoid[int]()
|
||||
|
||||
a := Some(1)
|
||||
b := Some(2)
|
||||
c := Some(3)
|
||||
|
||||
// Associativity
|
||||
left := optMonoid.Concat(optMonoid.Concat(a, b), c)
|
||||
right := optMonoid.Concat(a, optMonoid.Concat(b, c))
|
||||
assert.Equal(t, left, right)
|
||||
|
||||
// Left identity
|
||||
leftId := optMonoid.Concat(optMonoid.Empty(), a)
|
||||
assert.Equal(t, a, leftId)
|
||||
|
||||
// Right identity
|
||||
rightId := optMonoid.Concat(a, optMonoid.Empty())
|
||||
assert.Equal(t, a, rightId)
|
||||
})
|
||||
|
||||
t.Run("LastMonoid laws", func(t *testing.T) {
|
||||
optMonoid := LastMonoid[int]()
|
||||
|
||||
a := Some(1)
|
||||
b := Some(2)
|
||||
c := Some(3)
|
||||
|
||||
// Associativity
|
||||
left := optMonoid.Concat(optMonoid.Concat(a, b), c)
|
||||
right := optMonoid.Concat(a, optMonoid.Concat(b, c))
|
||||
assert.Equal(t, left, right)
|
||||
|
||||
// Left identity
|
||||
leftId := optMonoid.Concat(optMonoid.Empty(), a)
|
||||
assert.Equal(t, a, leftId)
|
||||
|
||||
// Right identity
|
||||
rightId := optMonoid.Concat(a, optMonoid.Empty())
|
||||
assert.Equal(t, a, rightId)
|
||||
})
|
||||
}
|
||||
@@ -21,7 +21,21 @@ import (
|
||||
S "github.com/IBM/fp-go/v2/semigroup"
|
||||
)
|
||||
|
||||
// Semigroup implements a two level ordering
|
||||
// Semigroup implements a two-level ordering that combines two Ord instances.
|
||||
// The resulting Ord will first compare using the first ordering, and only if
|
||||
// the values are equal according to the first ordering, it will use the second ordering.
|
||||
//
|
||||
// This is useful for implementing multi-level sorting (e.g., sort by last name, then by first name).
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type Person struct { LastName, FirstName string }
|
||||
// stringOrd := ord.FromStrictCompare[string]()
|
||||
// byLastName := ord.Contramap(func(p Person) string { return p.LastName })(stringOrd)
|
||||
// byFirstName := ord.Contramap(func(p Person) string { return p.FirstName })(stringOrd)
|
||||
// sg := ord.Semigroup[Person]()
|
||||
// personOrd := sg.Concat(byLastName, byFirstName)
|
||||
// // Now persons are ordered by last name, then by first name
|
||||
func Semigroup[A any]() S.Semigroup[Ord[A]] {
|
||||
return S.MakeSemigroup(func(first, second Ord[A]) Ord[A] {
|
||||
return FromCompare(func(a, b A) int {
|
||||
@@ -34,19 +48,48 @@ func Semigroup[A any]() S.Semigroup[Ord[A]] {
|
||||
})
|
||||
}
|
||||
|
||||
// Monoid implements a two level ordering such that
|
||||
// - its `Concat(ord1, ord2)` operation will order first by `ord1`, and then by `ord2`
|
||||
// - its `Empty` value is an `Ord` that always considers compared elements equal
|
||||
// Monoid implements a two-level ordering with an identity element.
|
||||
//
|
||||
// Properties:
|
||||
// - Concat(ord1, ord2) will order first by ord1, and then by ord2
|
||||
// - Empty() returns an Ord that always considers compared elements equal
|
||||
//
|
||||
// The Empty ordering acts as an identity: Concat(ord, Empty()) == ord
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// m := ord.Monoid[int]()
|
||||
// emptyOrd := m.Empty()
|
||||
// result := emptyOrd.Compare(5, 3) // 0 (always equal)
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// combined := m.Concat(intOrd, emptyOrd) // same as intOrd
|
||||
func Monoid[A any]() M.Monoid[Ord[A]] {
|
||||
return M.MakeMonoid(Semigroup[A]().Concat, FromCompare(F.Constant2[A, A](0)))
|
||||
}
|
||||
|
||||
// MaxSemigroup returns a semigroup where `concat` will return the maximum, based on the provided order.
|
||||
// MaxSemigroup returns a semigroup where Concat will return the maximum value
|
||||
// according to the provided ordering.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// maxSg := ord.MaxSemigroup(intOrd)
|
||||
// result := maxSg.Concat(5, 3) // 5
|
||||
// result := maxSg.Concat(3, 5) // 5
|
||||
func MaxSemigroup[A any](o Ord[A]) S.Semigroup[A] {
|
||||
return S.MakeSemigroup(Max(o))
|
||||
}
|
||||
|
||||
// MaxSemigroup returns a semigroup where `concat` will return the minimum, based on the provided order.
|
||||
// MinSemigroup returns a semigroup where Concat will return the minimum value
|
||||
// according to the provided ordering.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// minSg := ord.MinSemigroup(intOrd)
|
||||
// result := minSg.Concat(5, 3) // 3
|
||||
// result := minSg.Concat(3, 5) // 3
|
||||
func MinSemigroup[A any](o Ord[A]) S.Semigroup[A] {
|
||||
return S.MakeSemigroup(Min(o))
|
||||
}
|
||||
|
||||
320
v2/ord/monoid_test.go
Normal file
320
v2/ord/monoid_test.go
Normal file
@@ -0,0 +1,320 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package ord
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// Test Semigroup laws
|
||||
func TestSemigroup_Associativity(t *testing.T) {
|
||||
type Person struct {
|
||||
LastName string
|
||||
FirstName string
|
||||
MiddleName string
|
||||
}
|
||||
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
|
||||
byLastName := Contramap(func(p Person) string { return p.LastName })(stringOrd)
|
||||
byFirstName := Contramap(func(p Person) string { return p.FirstName })(stringOrd)
|
||||
byMiddleName := Contramap(func(p Person) string { return p.MiddleName })(stringOrd)
|
||||
|
||||
sg := Semigroup[Person]()
|
||||
|
||||
// Test associativity: (a <> b) <> c == a <> (b <> c)
|
||||
left := sg.Concat(sg.Concat(byLastName, byFirstName), byMiddleName)
|
||||
right := sg.Concat(byLastName, sg.Concat(byFirstName, byMiddleName))
|
||||
|
||||
p1 := Person{LastName: "Smith", FirstName: "John", MiddleName: "A"}
|
||||
p2 := Person{LastName: "Smith", FirstName: "John", MiddleName: "B"}
|
||||
|
||||
assert.Equal(t, left.Compare(p1, p2), right.Compare(p1, p2), "Associativity should hold")
|
||||
}
|
||||
|
||||
// Test Semigroup with three levels
|
||||
func TestSemigroup_ThreeLevels(t *testing.T) {
|
||||
type Employee struct {
|
||||
Department string
|
||||
Level int
|
||||
Name string
|
||||
}
|
||||
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
intOrd := FromStrictCompare[int]()
|
||||
|
||||
byDept := Contramap(func(e Employee) string { return e.Department })(stringOrd)
|
||||
byLevel := Contramap(func(e Employee) int { return e.Level })(intOrd)
|
||||
byName := Contramap(func(e Employee) string { return e.Name })(stringOrd)
|
||||
|
||||
sg := Semigroup[Employee]()
|
||||
employeeOrd := sg.Concat(sg.Concat(byDept, byLevel), byName)
|
||||
|
||||
e1 := Employee{Department: "IT", Level: 3, Name: "Alice"}
|
||||
e2 := Employee{Department: "IT", Level: 3, Name: "Bob"}
|
||||
e3 := Employee{Department: "IT", Level: 2, Name: "Charlie"}
|
||||
e4 := Employee{Department: "HR", Level: 3, Name: "David"}
|
||||
|
||||
// Same dept, same level, different name
|
||||
assert.Equal(t, -1, employeeOrd.Compare(e1, e2), "Alice < Bob")
|
||||
|
||||
// Same dept, different level
|
||||
assert.Equal(t, 1, employeeOrd.Compare(e1, e3), "Level 3 > Level 2")
|
||||
|
||||
// Different dept
|
||||
assert.Equal(t, -1, employeeOrd.Compare(e4, e1), "HR < IT")
|
||||
}
|
||||
|
||||
// Test Monoid identity laws
|
||||
func TestMonoid_IdentityLaws(t *testing.T) {
|
||||
m := Monoid[int]()
|
||||
intOrd := FromStrictCompare[int]()
|
||||
emptyOrd := m.Empty()
|
||||
|
||||
// Left identity: empty <> x == x
|
||||
leftIdentity := m.Concat(emptyOrd, intOrd)
|
||||
assert.Equal(t, -1, leftIdentity.Compare(3, 5), "Left identity: 3 < 5")
|
||||
assert.Equal(t, 1, leftIdentity.Compare(5, 3), "Left identity: 5 > 3")
|
||||
|
||||
// Right identity: x <> empty == x
|
||||
rightIdentity := m.Concat(intOrd, emptyOrd)
|
||||
assert.Equal(t, -1, rightIdentity.Compare(3, 5), "Right identity: 3 < 5")
|
||||
assert.Equal(t, 1, rightIdentity.Compare(5, 3), "Right identity: 5 > 3")
|
||||
}
|
||||
|
||||
// Test Monoid with multiple empty concatenations
|
||||
func TestMonoid_MultipleEmpty(t *testing.T) {
|
||||
m := Monoid[int]()
|
||||
emptyOrd := m.Empty()
|
||||
|
||||
// Concatenating multiple empty orderings should still be empty
|
||||
combined := m.Concat(m.Concat(emptyOrd, emptyOrd), emptyOrd)
|
||||
|
||||
assert.Equal(t, 0, combined.Compare(5, 3), "Multiple empties: always equal")
|
||||
assert.Equal(t, 0, combined.Compare(3, 5), "Multiple empties: always equal")
|
||||
assert.True(t, combined.Equals(5, 3), "Multiple empties: always equal")
|
||||
}
|
||||
|
||||
// Test MaxSemigroup with edge cases
|
||||
func TestMaxSemigroup_EdgeCases(t *testing.T) {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
maxSg := MaxSemigroup(intOrd)
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
a int
|
||||
b int
|
||||
expected int
|
||||
}{
|
||||
{"both positive", 5, 3, 5},
|
||||
{"both negative", -5, -3, -3},
|
||||
{"mixed signs", -5, 3, 3},
|
||||
{"zero and positive", 0, 5, 5},
|
||||
{"zero and negative", 0, -5, 0},
|
||||
{"both zero", 0, 0, 0},
|
||||
{"equal positive", 5, 5, 5},
|
||||
{"equal negative", -5, -5, -5},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
result := maxSg.Concat(tt.a, tt.b)
|
||||
assert.Equal(t, tt.expected, result)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// Test MinSemigroup with edge cases
|
||||
func TestMinSemigroup_EdgeCases(t *testing.T) {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
minSg := MinSemigroup(intOrd)
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
a int
|
||||
b int
|
||||
expected int
|
||||
}{
|
||||
{"both positive", 5, 3, 3},
|
||||
{"both negative", -5, -3, -5},
|
||||
{"mixed signs", -5, 3, -5},
|
||||
{"zero and positive", 0, 5, 0},
|
||||
{"zero and negative", 0, -5, -5},
|
||||
{"both zero", 0, 0, 0},
|
||||
{"equal positive", 5, 5, 5},
|
||||
{"equal negative", -5, -5, -5},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
result := minSg.Concat(tt.a, tt.b)
|
||||
assert.Equal(t, tt.expected, result)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// Test MaxSemigroup with strings
|
||||
func TestMaxSemigroup_Strings(t *testing.T) {
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
maxSg := MaxSemigroup(stringOrd)
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
a string
|
||||
b string
|
||||
expected string
|
||||
}{
|
||||
{"alphabetical", "apple", "banana", "banana"},
|
||||
{"same string", "apple", "apple", "apple"},
|
||||
{"empty and non-empty", "", "apple", "apple"},
|
||||
{"both empty", "", "", ""},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
result := maxSg.Concat(tt.a, tt.b)
|
||||
assert.Equal(t, tt.expected, result)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// Test MinSemigroup with strings
|
||||
func TestMinSemigroup_Strings(t *testing.T) {
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
minSg := MinSemigroup(stringOrd)
|
||||
|
||||
tests := []struct {
|
||||
name string
|
||||
a string
|
||||
b string
|
||||
expected string
|
||||
}{
|
||||
{"alphabetical", "apple", "banana", "apple"},
|
||||
{"same string", "apple", "apple", "apple"},
|
||||
{"empty and non-empty", "", "apple", ""},
|
||||
{"both empty", "", "", ""},
|
||||
}
|
||||
|
||||
for _, tt := range tests {
|
||||
t.Run(tt.name, func(t *testing.T) {
|
||||
result := minSg.Concat(tt.a, tt.b)
|
||||
assert.Equal(t, tt.expected, result)
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// Test MaxSemigroup associativity
|
||||
func TestMaxSemigroup_Associativity(t *testing.T) {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
maxSg := MaxSemigroup(intOrd)
|
||||
|
||||
// (a <> b) <> c == a <> (b <> c)
|
||||
a, b, c := 5, 3, 7
|
||||
|
||||
left := maxSg.Concat(maxSg.Concat(a, b), c)
|
||||
right := maxSg.Concat(a, maxSg.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right, "MaxSemigroup should be associative")
|
||||
assert.Equal(t, 7, left, "Should return maximum value")
|
||||
}
|
||||
|
||||
// Test MinSemigroup associativity
|
||||
func TestMinSemigroup_Associativity(t *testing.T) {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
minSg := MinSemigroup(intOrd)
|
||||
|
||||
// (a <> b) <> c == a <> (b <> c)
|
||||
a, b, c := 5, 3, 7
|
||||
|
||||
left := minSg.Concat(minSg.Concat(a, b), c)
|
||||
right := minSg.Concat(a, minSg.Concat(b, c))
|
||||
|
||||
assert.Equal(t, left, right, "MinSemigroup should be associative")
|
||||
assert.Equal(t, 3, left, "Should return minimum value")
|
||||
}
|
||||
|
||||
// Test Semigroup with reversed ordering
|
||||
func TestSemigroup_WithReverse(t *testing.T) {
|
||||
type Person struct {
|
||||
Age int
|
||||
Name string
|
||||
}
|
||||
|
||||
intOrd := FromStrictCompare[int]()
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
|
||||
// Order by age descending, then by name ascending
|
||||
byAge := Contramap(func(p Person) int { return p.Age })(Reverse(intOrd))
|
||||
byName := Contramap(func(p Person) string { return p.Name })(stringOrd)
|
||||
|
||||
sg := Semigroup[Person]()
|
||||
personOrd := sg.Concat(byAge, byName)
|
||||
|
||||
p1 := Person{Age: 30, Name: "Alice"}
|
||||
p2 := Person{Age: 30, Name: "Bob"}
|
||||
p3 := Person{Age: 25, Name: "Charlie"}
|
||||
|
||||
// Same age, different name
|
||||
assert.Equal(t, -1, personOrd.Compare(p1, p2), "Alice < Bob (same age)")
|
||||
|
||||
// Different age (descending)
|
||||
assert.Equal(t, -1, personOrd.Compare(p1, p3), "30 > 25 (descending)")
|
||||
}
|
||||
|
||||
// Benchmark MaxSemigroup
|
||||
func BenchmarkMaxSemigroup(b *testing.B) {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
maxSg := MaxSemigroup(intOrd)
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = maxSg.Concat(i, i+1)
|
||||
}
|
||||
}
|
||||
|
||||
// Benchmark MinSemigroup
|
||||
func BenchmarkMinSemigroup(b *testing.B) {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
minSg := MinSemigroup(intOrd)
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = minSg.Concat(i, i+1)
|
||||
}
|
||||
}
|
||||
|
||||
// Benchmark Semigroup concatenation
|
||||
func BenchmarkSemigroup_Concat(b *testing.B) {
|
||||
type Person struct {
|
||||
LastName string
|
||||
FirstName string
|
||||
}
|
||||
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
byLastName := Contramap(func(p Person) string { return p.LastName })(stringOrd)
|
||||
byFirstName := Contramap(func(p Person) string { return p.FirstName })(stringOrd)
|
||||
|
||||
sg := Semigroup[Person]()
|
||||
personOrd := sg.Concat(byLastName, byFirstName)
|
||||
|
||||
p1 := Person{LastName: "Smith", FirstName: "Alice"}
|
||||
p2 := Person{LastName: "Smith", FirstName: "Bob"}
|
||||
|
||||
b.ResetTimer()
|
||||
for i := 0; i < b.N; i++ {
|
||||
_ = personOrd.Compare(p1, p2)
|
||||
}
|
||||
}
|
||||
212
v2/ord/ord.go
212
v2/ord/ord.go
@@ -17,6 +17,7 @@ package ord
|
||||
|
||||
import (
|
||||
"cmp"
|
||||
"time"
|
||||
|
||||
C "github.com/IBM/fp-go/v2/constraints"
|
||||
E "github.com/IBM/fp-go/v2/eq"
|
||||
@@ -80,36 +81,97 @@ func (self ord[T]) Compare(x, y T) int {
|
||||
return self.c(x, y)
|
||||
}
|
||||
|
||||
// ToEq converts an [Ord] to [E.Eq]
|
||||
|
||||
// ToEq converts an [Ord] to [E.Eq].
|
||||
// This allows using an Ord instance where only equality checking is needed.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// intEq := ord.ToEq(intOrd)
|
||||
// result := intEq.Equals(5, 5) // true
|
||||
//
|
||||
//go:inline
|
||||
func ToEq[T any](o Ord[T]) E.Eq[T] {
|
||||
return o
|
||||
}
|
||||
|
||||
// MakeOrd creates an instance of an Ord
|
||||
// MakeOrd creates an instance of an Ord from a compare function and an equals function.
|
||||
//
|
||||
// Parameters:
|
||||
// - c: A comparison function that returns -1 if x < y, 0 if x == y, 1 if x > y
|
||||
// - e: An equality function that returns true if x and y are equal
|
||||
//
|
||||
// The compare and equals functions must be consistent: c(x, y) == 0 iff e(x, y) == true
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.MakeOrd(
|
||||
// func(a, b int) int {
|
||||
// if a < b { return -1 }
|
||||
// if a > b { return 1 }
|
||||
// return 0
|
||||
// },
|
||||
// func(a, b int) bool { return a == b },
|
||||
// )
|
||||
//
|
||||
//go:inline
|
||||
func MakeOrd[T any](c func(x, y T) int, e func(x, y T) bool) Ord[T] {
|
||||
return ord[T]{c: c, e: e}
|
||||
}
|
||||
|
||||
// MakeOrd creates an instance of an Ord from a compare function
|
||||
// FromCompare creates an instance of an Ord from a compare function.
|
||||
// The equals function is automatically derived from the compare function.
|
||||
//
|
||||
// Parameters:
|
||||
// - compare: A comparison function that returns -1 if x < y, 0 if x == y, 1 if x > y
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// stringOrd := ord.FromCompare(func(a, b string) int {
|
||||
// if a < b { return -1 }
|
||||
// if a > b { return 1 }
|
||||
// return 0
|
||||
// })
|
||||
func FromCompare[T any](compare func(T, T) int) Ord[T] {
|
||||
return MakeOrd(compare, func(x, y T) bool {
|
||||
return compare(x, y) == 0
|
||||
})
|
||||
}
|
||||
|
||||
// Reverse creates an inverted ordering
|
||||
// Reverse creates an inverted ordering where the comparison results are reversed.
|
||||
// If the original ordering has x < y, the reversed ordering will have x > y.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// reversedOrd := ord.Reverse(intOrd)
|
||||
// result := reversedOrd.Compare(5, 3) // -1 (reversed from 1)
|
||||
func Reverse[T any](o Ord[T]) Ord[T] {
|
||||
return MakeOrd(func(y, x T) int {
|
||||
return o.Compare(x, y)
|
||||
}, o.Equals)
|
||||
}
|
||||
|
||||
// Contramap creates an ordering under a transformation function
|
||||
func Contramap[A, B any](f func(B) A) func(Ord[A]) Ord[B] {
|
||||
// Contramap creates an ordering under a transformation function.
|
||||
// This allows ordering values of type B by first transforming them to type A
|
||||
// and then using the ordering for type A.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Parameters:
|
||||
// - f: A transformation function from B to A
|
||||
//
|
||||
// Returns a function that takes an Ord[A] and returns an Ord[B]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type Person struct { Name string; Age int }
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// personOrd := ord.Contramap(func(p Person) int {
|
||||
// return p.Age
|
||||
// })(intOrd)
|
||||
// // Now persons are ordered by age
|
||||
func Contramap[A, B any](f func(B) A) Operator[A, B] {
|
||||
return func(o Ord[A]) Ord[B] {
|
||||
return MakeOrd(func(x, y B) int {
|
||||
return o.Compare(f(x), f(y))
|
||||
@@ -119,7 +181,15 @@ func Contramap[A, B any](f func(B) A) func(Ord[A]) Ord[B] {
|
||||
}
|
||||
}
|
||||
|
||||
// Min takes the minimum of two values. If they are considered equal, the first argument is chosen
|
||||
// Min takes the minimum of two values according to the given ordering.
|
||||
// If the values are considered equal, the first argument is chosen.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// min := ord.Min(intOrd)
|
||||
// result := min(5, 3) // 3
|
||||
// result := min(5, 5) // 5 (first argument)
|
||||
func Min[A any](o Ord[A]) func(A, A) A {
|
||||
return func(a, b A) A {
|
||||
if o.Compare(a, b) < 1 {
|
||||
@@ -129,7 +199,15 @@ func Min[A any](o Ord[A]) func(A, A) A {
|
||||
}
|
||||
}
|
||||
|
||||
// Max takes the maximum of two values. If they are considered equal, the first argument is chosen
|
||||
// Max takes the maximum of two values according to the given ordering.
|
||||
// If the values are considered equal, the first argument is chosen.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// max := ord.Max(intOrd)
|
||||
// result := max(5, 3) // 5
|
||||
// result := max(5, 5) // 5 (first argument)
|
||||
func Max[A any](o Ord[A]) func(A, A) A {
|
||||
return func(a, b A) A {
|
||||
if o.Compare(a, b) >= 0 {
|
||||
@@ -139,7 +217,18 @@ func Max[A any](o Ord[A]) func(A, A) A {
|
||||
}
|
||||
}
|
||||
|
||||
// Clamp clamps a value between a minimum and a maximum
|
||||
// Clamp restricts a value to be within a specified range [low, hi].
|
||||
// If the value is less than low, low is returned.
|
||||
// If the value is greater than hi, hi is returned.
|
||||
// Otherwise, the value itself is returned.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// clamp := ord.Clamp(intOrd)(0, 100)
|
||||
// result := clamp(-10) // 0
|
||||
// result := clamp(50) // 50
|
||||
// result := clamp(150) // 100
|
||||
func Clamp[A any](o Ord[A]) func(A, A) func(A) A {
|
||||
return func(low, hi A) func(A) A {
|
||||
clow := F.Bind2nd(o.Compare, low)
|
||||
@@ -166,14 +255,35 @@ func strictEq[A comparable](a, b A) bool {
|
||||
return a == b
|
||||
}
|
||||
|
||||
// FromStrictCompare implements the ordering based on the built in native order
|
||||
// FromStrictCompare implements the ordering based on the built-in native order
|
||||
// for types that satisfy the Ordered constraint (integers, floats, strings).
|
||||
//
|
||||
// This is the most common way to create an Ord for built-in types.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// result := intOrd.Compare(5, 3) // 1
|
||||
//
|
||||
// stringOrd := ord.FromStrictCompare[string]()
|
||||
// result := stringOrd.Compare("apple", "banana") // -1
|
||||
//
|
||||
//go:inline
|
||||
func FromStrictCompare[A C.Ordered]() Ord[A] {
|
||||
return MakeOrd(strictCompare[A], strictEq[A])
|
||||
}
|
||||
|
||||
// Lt tests whether one value is strictly less than another
|
||||
// Lt tests whether one value is strictly less than another.
|
||||
// Returns a curried function that first takes the comparison value,
|
||||
// then takes the value to test.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// isLessThan5 := ord.Lt(intOrd)(5)
|
||||
// result := isLessThan5(3) // true
|
||||
// result := isLessThan5(5) // false
|
||||
// result := isLessThan5(7) // false
|
||||
func Lt[A any](o Ord[A]) func(A) func(A) bool {
|
||||
return func(second A) func(A) bool {
|
||||
return func(first A) bool {
|
||||
@@ -182,7 +292,17 @@ func Lt[A any](o Ord[A]) func(A) func(A) bool {
|
||||
}
|
||||
}
|
||||
|
||||
// Leq Tests whether one value is less or equal than another
|
||||
// Leq tests whether one value is less than or equal to another.
|
||||
// Returns a curried function that first takes the comparison value,
|
||||
// then takes the value to test.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// isAtMost5 := ord.Leq(intOrd)(5)
|
||||
// result := isAtMost5(3) // true
|
||||
// result := isAtMost5(5) // true
|
||||
// result := isAtMost5(7) // false
|
||||
func Leq[A any](o Ord[A]) func(A) func(A) bool {
|
||||
return func(second A) func(A) bool {
|
||||
return func(first A) bool {
|
||||
@@ -191,9 +311,17 @@ func Leq[A any](o Ord[A]) func(A) func(A) bool {
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Test whether one value is strictly greater than another
|
||||
*/
|
||||
// Gt tests whether one value is strictly greater than another.
|
||||
// Returns a curried function that first takes the comparison value,
|
||||
// then takes the value to test.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// isGreaterThan5 := ord.Gt(intOrd)(5)
|
||||
// result := isGreaterThan5(3) // false
|
||||
// result := isGreaterThan5(5) // false
|
||||
// result := isGreaterThan5(7) // true
|
||||
func Gt[A any](o Ord[A]) func(A) func(A) bool {
|
||||
return func(second A) func(A) bool {
|
||||
return func(first A) bool {
|
||||
@@ -202,7 +330,17 @@ func Gt[A any](o Ord[A]) func(A) func(A) bool {
|
||||
}
|
||||
}
|
||||
|
||||
// Geq tests whether one value is greater or equal than another
|
||||
// Geq tests whether one value is greater than or equal to another.
|
||||
// Returns a curried function that first takes the comparison value,
|
||||
// then takes the value to test.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// isAtLeast5 := ord.Geq(intOrd)(5)
|
||||
// result := isAtLeast5(3) // false
|
||||
// result := isAtLeast5(5) // true
|
||||
// result := isAtLeast5(7) // true
|
||||
func Geq[A any](o Ord[A]) func(A) func(A) bool {
|
||||
return func(second A) func(A) bool {
|
||||
return func(first A) bool {
|
||||
@@ -211,7 +349,21 @@ func Geq[A any](o Ord[A]) func(A) func(A) bool {
|
||||
}
|
||||
}
|
||||
|
||||
// Between tests whether a value is between a minimum (inclusive) and a maximum (exclusive)
|
||||
// Between tests whether a value is between a minimum (inclusive) and a maximum (exclusive).
|
||||
// Returns a curried function that first takes the range bounds,
|
||||
// then takes the value to test.
|
||||
//
|
||||
// The range is [lo, hi), meaning lo is included but hi is excluded.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// isBetween3And7 := ord.Between(intOrd)(3, 7)
|
||||
// result := isBetween3And7(2) // false (below range)
|
||||
// result := isBetween3And7(3) // true (at lower bound)
|
||||
// result := isBetween3And7(5) // true (within range)
|
||||
// result := isBetween3And7(7) // false (at upper bound, excluded)
|
||||
// result := isBetween3And7(8) // false (above range)
|
||||
func Between[A any](o Ord[A]) func(A, A) func(A) bool {
|
||||
lt := Lt(o)
|
||||
geq := Geq(o)
|
||||
@@ -220,3 +372,27 @@ func Between[A any](o Ord[A]) func(A, A) func(A) bool {
|
||||
return P.And(lt(hi))(geq(lo))
|
||||
}
|
||||
}
|
||||
|
||||
// compareTime is a helper function that compares two time.Time values.
|
||||
// Returns -1 if a is before b, 1 if a is after b, and 0 if they are equal.
|
||||
func compareTime(a, b time.Time) int {
|
||||
if a.Before(b) {
|
||||
return -1
|
||||
} else if a.After(b) {
|
||||
return 1
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
// OrdTime returns an Ord instance for time.Time values.
|
||||
// Times are ordered chronologically using the Before and After methods.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// timeOrd := ord.OrdTime()
|
||||
// t1 := time.Date(2023, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
// t2 := time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
// result := timeOrd.Compare(t1, t2) // -1 (t1 is before t2)
|
||||
func OrdTime() Ord[time.Time] {
|
||||
return MakeOrd(compareTime, time.Time.Equal)
|
||||
}
|
||||
|
||||
@@ -17,6 +17,7 @@ package ord
|
||||
|
||||
import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
@@ -581,3 +582,306 @@ func BenchmarkClamp(b *testing.B) {
|
||||
_ = clamp(i % 150)
|
||||
}
|
||||
}
|
||||
|
||||
// Test OrdTime
|
||||
func TestOrdTime(t *testing.T) {
|
||||
timeOrd := OrdTime()
|
||||
|
||||
t1 := time.Date(2023, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
t2 := time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
t3 := time.Date(2023, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
|
||||
// Test Compare
|
||||
assert.Equal(t, -1, timeOrd.Compare(t1, t2), "t1 should be before t2")
|
||||
assert.Equal(t, 1, timeOrd.Compare(t2, t1), "t2 should be after t1")
|
||||
assert.Equal(t, 0, timeOrd.Compare(t1, t3), "t1 should equal t3")
|
||||
|
||||
// Test Equals
|
||||
assert.True(t, timeOrd.Equals(t1, t3), "t1 should equal t3")
|
||||
assert.False(t, timeOrd.Equals(t1, t2), "t1 should not equal t2")
|
||||
}
|
||||
|
||||
func TestOrdTime_WithDifferentTimezones(t *testing.T) {
|
||||
timeOrd := OrdTime()
|
||||
|
||||
// Same instant in different timezones
|
||||
utc := time.Date(2023, 6, 15, 12, 0, 0, 0, time.UTC)
|
||||
est := utc.In(time.FixedZone("EST", -5*3600))
|
||||
|
||||
// Should be equal (same instant)
|
||||
assert.Equal(t, 0, timeOrd.Compare(utc, est))
|
||||
assert.True(t, timeOrd.Equals(utc, est))
|
||||
}
|
||||
|
||||
func TestOrdTime_WithNanoseconds(t *testing.T) {
|
||||
timeOrd := OrdTime()
|
||||
|
||||
t1 := time.Date(2023, 1, 1, 0, 0, 0, 100, time.UTC)
|
||||
t2 := time.Date(2023, 1, 1, 0, 0, 0, 200, time.UTC)
|
||||
|
||||
assert.Equal(t, -1, timeOrd.Compare(t1, t2))
|
||||
assert.Equal(t, 1, timeOrd.Compare(t2, t1))
|
||||
}
|
||||
|
||||
func TestOrdTime_MinMax(t *testing.T) {
|
||||
timeOrd := OrdTime()
|
||||
|
||||
t1 := time.Date(2023, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
t2 := time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
|
||||
min := Min(timeOrd)
|
||||
max := Max(timeOrd)
|
||||
|
||||
assert.Equal(t, t1, min(t1, t2))
|
||||
assert.Equal(t, t1, min(t2, t1))
|
||||
|
||||
assert.Equal(t, t2, max(t1, t2))
|
||||
assert.Equal(t, t2, max(t2, t1))
|
||||
}
|
||||
|
||||
// Example tests for documentation
|
||||
func ExampleFromStrictCompare() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
|
||||
result1 := intOrd.Compare(5, 3)
|
||||
result2 := intOrd.Compare(3, 5)
|
||||
result3 := intOrd.Compare(5, 5)
|
||||
|
||||
println(result1) // 1
|
||||
println(result2) // -1
|
||||
println(result3) // 0
|
||||
}
|
||||
|
||||
func ExampleMakeOrd() {
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
|
||||
personOrd := MakeOrd(
|
||||
func(p1, p2 Person) int {
|
||||
if p1.Age < p2.Age {
|
||||
return -1
|
||||
} else if p1.Age > p2.Age {
|
||||
return 1
|
||||
}
|
||||
return 0
|
||||
},
|
||||
func(p1, p2 Person) bool {
|
||||
return p1.Age == p2.Age
|
||||
},
|
||||
)
|
||||
|
||||
p1 := Person{Name: "Alice", Age: 30}
|
||||
p2 := Person{Name: "Bob", Age: 25}
|
||||
|
||||
result := personOrd.Compare(p1, p2)
|
||||
println(result) // 1 (30 > 25)
|
||||
}
|
||||
|
||||
func ExampleFromCompare() {
|
||||
stringOrd := FromCompare(func(a, b string) int {
|
||||
if a < b {
|
||||
return -1
|
||||
} else if a > b {
|
||||
return 1
|
||||
}
|
||||
return 0
|
||||
})
|
||||
|
||||
result := stringOrd.Compare("apple", "banana")
|
||||
println(result) // -1
|
||||
}
|
||||
|
||||
func ExampleReverse() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
reversedOrd := Reverse(intOrd)
|
||||
|
||||
result1 := intOrd.Compare(5, 3)
|
||||
result2 := reversedOrd.Compare(5, 3)
|
||||
|
||||
println(result1) // 1
|
||||
println(result2) // -1
|
||||
}
|
||||
|
||||
func ExampleContramap() {
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
|
||||
intOrd := FromStrictCompare[int]()
|
||||
|
||||
// Order persons by age
|
||||
personOrd := Contramap(func(p Person) int {
|
||||
return p.Age
|
||||
})(intOrd)
|
||||
|
||||
p1 := Person{Name: "Alice", Age: 30}
|
||||
p2 := Person{Name: "Bob", Age: 25}
|
||||
|
||||
result := personOrd.Compare(p1, p2)
|
||||
println(result) // 1 (30 > 25)
|
||||
}
|
||||
|
||||
func ExampleMin() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
min := Min(intOrd)
|
||||
|
||||
result := min(5, 3)
|
||||
println(result) // 3
|
||||
}
|
||||
|
||||
func ExampleMax() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
max := Max(intOrd)
|
||||
|
||||
result := max(5, 3)
|
||||
println(result) // 5
|
||||
}
|
||||
|
||||
func ExampleClamp() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
clamp := Clamp(intOrd)(0, 100)
|
||||
|
||||
result1 := clamp(-10)
|
||||
result2 := clamp(50)
|
||||
result3 := clamp(150)
|
||||
|
||||
println(result1) // 0
|
||||
println(result2) // 50
|
||||
println(result3) // 100
|
||||
}
|
||||
|
||||
func ExampleLt() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
isLessThan5 := Lt(intOrd)(5)
|
||||
|
||||
result1 := isLessThan5(3)
|
||||
result2 := isLessThan5(5)
|
||||
result3 := isLessThan5(7)
|
||||
|
||||
println(result1) // true
|
||||
println(result2) // false
|
||||
println(result3) // false
|
||||
}
|
||||
|
||||
func ExampleLeq() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
isAtMost5 := Leq(intOrd)(5)
|
||||
|
||||
result1 := isAtMost5(3)
|
||||
result2 := isAtMost5(5)
|
||||
result3 := isAtMost5(7)
|
||||
|
||||
println(result1) // true
|
||||
println(result2) // true
|
||||
println(result3) // false
|
||||
}
|
||||
|
||||
func ExampleGt() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
isGreaterThan5 := Gt(intOrd)(5)
|
||||
|
||||
result1 := isGreaterThan5(3)
|
||||
result2 := isGreaterThan5(5)
|
||||
result3 := isGreaterThan5(7)
|
||||
|
||||
println(result1) // false
|
||||
println(result2) // false
|
||||
println(result3) // true
|
||||
}
|
||||
|
||||
func ExampleGeq() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
isAtLeast5 := Geq(intOrd)(5)
|
||||
|
||||
result1 := isAtLeast5(3)
|
||||
result2 := isAtLeast5(5)
|
||||
result3 := isAtLeast5(7)
|
||||
|
||||
println(result1) // false
|
||||
println(result2) // true
|
||||
println(result3) // true
|
||||
}
|
||||
|
||||
func ExampleBetween() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
isBetween3And7 := Between(intOrd)(3, 7)
|
||||
|
||||
result1 := isBetween3And7(2)
|
||||
result2 := isBetween3And7(3)
|
||||
result3 := isBetween3And7(5)
|
||||
result4 := isBetween3And7(7)
|
||||
result5 := isBetween3And7(8)
|
||||
|
||||
println(result1) // false
|
||||
println(result2) // true
|
||||
println(result3) // true
|
||||
println(result4) // false
|
||||
println(result5) // false
|
||||
}
|
||||
|
||||
func ExampleSemigroup() {
|
||||
type Person struct {
|
||||
LastName string
|
||||
FirstName string
|
||||
}
|
||||
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
|
||||
// Order by last name
|
||||
byLastName := Contramap(func(p Person) string {
|
||||
return p.LastName
|
||||
})(stringOrd)
|
||||
|
||||
// Order by first name
|
||||
byFirstName := Contramap(func(p Person) string {
|
||||
return p.FirstName
|
||||
})(stringOrd)
|
||||
|
||||
// Combine: order by last name, then first name
|
||||
sg := Semigroup[Person]()
|
||||
personOrd := sg.Concat(byLastName, byFirstName)
|
||||
|
||||
p1 := Person{LastName: "Smith", FirstName: "Alice"}
|
||||
p2 := Person{LastName: "Smith", FirstName: "Bob"}
|
||||
|
||||
result := personOrd.Compare(p1, p2)
|
||||
println(result) // -1 (Alice < Bob)
|
||||
}
|
||||
|
||||
func ExampleMonoid() {
|
||||
m := Monoid[int]()
|
||||
|
||||
// Empty ordering considers everything equal
|
||||
emptyOrd := m.Empty()
|
||||
result := emptyOrd.Compare(5, 3)
|
||||
println(result) // 0
|
||||
}
|
||||
|
||||
func ExampleMaxSemigroup() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
maxSg := MaxSemigroup(intOrd)
|
||||
|
||||
result := maxSg.Concat(5, 3)
|
||||
println(result) // 5
|
||||
}
|
||||
|
||||
func ExampleMinSemigroup() {
|
||||
intOrd := FromStrictCompare[int]()
|
||||
minSg := MinSemigroup(intOrd)
|
||||
|
||||
result := minSg.Concat(5, 3)
|
||||
println(result) // 3
|
||||
}
|
||||
|
||||
func ExampleOrdTime() {
|
||||
timeOrd := OrdTime()
|
||||
|
||||
t1 := time.Date(2023, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
t2 := time.Date(2024, 1, 1, 0, 0, 0, 0, time.UTC)
|
||||
|
||||
result := timeOrd.Compare(t1, t2)
|
||||
println(result) // -1 (t1 is before t2)
|
||||
}
|
||||
|
||||
59
v2/ord/types.go
Normal file
59
v2/ord/types.go
Normal file
@@ -0,0 +1,59 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package ord
|
||||
|
||||
type (
|
||||
// Kleisli represents a function that takes a value of type A and returns an Ord[B].
|
||||
// This is useful for creating orderings that depend on input values.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The input type
|
||||
// - B: The type for which ordering is produced
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Create a Kleisli that produces different orderings based on input
|
||||
// var orderingFactory Kleisli[string, int] = func(mode string) Ord[int] {
|
||||
// if mode == "ascending" {
|
||||
// return ord.FromStrictCompare[int]()
|
||||
// }
|
||||
// return ord.Reverse(ord.FromStrictCompare[int]())
|
||||
// }
|
||||
// ascOrd := orderingFactory("ascending")
|
||||
// descOrd := orderingFactory("descending")
|
||||
Kleisli[A, B any] = func(A) Ord[B]
|
||||
|
||||
// Operator represents a function that transforms an Ord[A] into a value of type B.
|
||||
// This is commonly used for operations that modify or combine orderings.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The type for which ordering is defined
|
||||
// - B: The result type of the operation
|
||||
//
|
||||
// This is equivalent to Kleisli[Ord[A], B] and is used for operations like
|
||||
// Contramap, which takes an Ord[A] and produces an Ord[B].
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// // Contramap is an Operator that transforms Ord[A] to Ord[B]
|
||||
// type Person struct { Age int }
|
||||
// var ageOperator Operator[int, Person] = ord.Contramap(func(p Person) int {
|
||||
// return p.Age
|
||||
// })
|
||||
// intOrd := ord.FromStrictCompare[int]()
|
||||
// personOrd := ageOperator(intOrd)
|
||||
Operator[A, B any] = Kleisli[Ord[A], B]
|
||||
)
|
||||
203
v2/ord/types_test.go
Normal file
203
v2/ord/types_test.go
Normal file
@@ -0,0 +1,203 @@
|
||||
// Copyright (c) 2023 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package ord
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// Test Kleisli type
|
||||
func TestKleisli(t *testing.T) {
|
||||
// Create a Kleisli that produces different orderings based on input
|
||||
var orderingFactory Kleisli[string, int] = func(mode string) Ord[int] {
|
||||
if mode == "ascending" {
|
||||
return FromStrictCompare[int]()
|
||||
}
|
||||
return Reverse(FromStrictCompare[int]())
|
||||
}
|
||||
|
||||
// Test ascending order
|
||||
ascOrd := orderingFactory("ascending")
|
||||
assert.Equal(t, -1, ascOrd.Compare(3, 5), "ascending: 3 < 5")
|
||||
assert.Equal(t, 1, ascOrd.Compare(5, 3), "ascending: 5 > 3")
|
||||
assert.Equal(t, 0, ascOrd.Compare(5, 5), "ascending: 5 == 5")
|
||||
|
||||
// Test descending order
|
||||
descOrd := orderingFactory("descending")
|
||||
assert.Equal(t, 1, descOrd.Compare(3, 5), "descending: 3 > 5")
|
||||
assert.Equal(t, -1, descOrd.Compare(5, 3), "descending: 5 < 3")
|
||||
assert.Equal(t, 0, descOrd.Compare(5, 5), "descending: 5 == 5")
|
||||
}
|
||||
|
||||
// Test Kleisli with complex types
|
||||
func TestKleisli_ComplexType(t *testing.T) {
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
|
||||
// Kleisli that creates orderings based on a field selector
|
||||
var personOrderingFactory Kleisli[string, Person] = func(field string) Ord[Person] {
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
intOrd := FromStrictCompare[int]()
|
||||
|
||||
switch field {
|
||||
case "name":
|
||||
return Contramap(func(p Person) string { return p.Name })(stringOrd)
|
||||
case "age":
|
||||
return Contramap(func(p Person) int { return p.Age })(intOrd)
|
||||
default:
|
||||
// Default to name ordering
|
||||
return Contramap(func(p Person) string { return p.Name })(stringOrd)
|
||||
}
|
||||
}
|
||||
|
||||
p1 := Person{Name: "Alice", Age: 30}
|
||||
p2 := Person{Name: "Bob", Age: 25}
|
||||
|
||||
// Order by name
|
||||
nameOrd := personOrderingFactory("name")
|
||||
assert.Equal(t, -1, nameOrd.Compare(p1, p2), "Alice < Bob by name")
|
||||
|
||||
// Order by age
|
||||
ageOrd := personOrderingFactory("age")
|
||||
assert.Equal(t, 1, ageOrd.Compare(p1, p2), "30 > 25 by age")
|
||||
}
|
||||
|
||||
// Test Operator type
|
||||
func TestOperator(t *testing.T) {
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
|
||||
// Operator that transforms Ord[int] to Ord[Person] by age
|
||||
var ageOperator Operator[int, Person] = Contramap(func(p Person) int {
|
||||
return p.Age
|
||||
})
|
||||
|
||||
intOrd := FromStrictCompare[int]()
|
||||
personOrd := ageOperator(intOrd)
|
||||
|
||||
p1 := Person{Name: "Alice", Age: 30}
|
||||
p2 := Person{Name: "Bob", Age: 25}
|
||||
p3 := Person{Name: "Charlie", Age: 30}
|
||||
|
||||
assert.Equal(t, 1, personOrd.Compare(p1, p2), "30 > 25")
|
||||
assert.Equal(t, -1, personOrd.Compare(p2, p1), "25 < 30")
|
||||
assert.Equal(t, 0, personOrd.Compare(p1, p3), "30 == 30")
|
||||
assert.True(t, personOrd.Equals(p1, p3), "same age")
|
||||
assert.False(t, personOrd.Equals(p1, p2), "different age")
|
||||
}
|
||||
|
||||
// Test Operator composition
|
||||
func TestOperator_Composition(t *testing.T) {
|
||||
type Address struct {
|
||||
Street string
|
||||
City string
|
||||
}
|
||||
|
||||
type Person struct {
|
||||
Name string
|
||||
Address Address
|
||||
}
|
||||
|
||||
// Create operators for different transformations
|
||||
stringOrd := FromStrictCompare[string]()
|
||||
|
||||
// Operator to order Person by city
|
||||
var cityOperator Operator[string, Person] = Contramap(func(p Person) string {
|
||||
return p.Address.City
|
||||
})
|
||||
|
||||
personOrd := cityOperator(stringOrd)
|
||||
|
||||
p1 := Person{Name: "Alice", Address: Address{Street: "Main St", City: "Boston"}}
|
||||
p2 := Person{Name: "Bob", Address: Address{Street: "Oak Ave", City: "Austin"}}
|
||||
|
||||
assert.Equal(t, 1, personOrd.Compare(p1, p2), "Boston > Austin")
|
||||
assert.Equal(t, -1, personOrd.Compare(p2, p1), "Austin < Boston")
|
||||
}
|
||||
|
||||
// Test Operator with multiple transformations
|
||||
func TestOperator_MultipleTransformations(t *testing.T) {
|
||||
type Product struct {
|
||||
Name string
|
||||
Price float64
|
||||
}
|
||||
|
||||
floatOrd := FromStrictCompare[float64]()
|
||||
|
||||
// Operator to order by price
|
||||
var priceOperator Operator[float64, Product] = Contramap(func(p Product) float64 {
|
||||
return p.Price
|
||||
})
|
||||
|
||||
// Operator to reverse the ordering
|
||||
var reverseOperator Operator[float64, Product] = func(o Ord[float64]) Ord[Product] {
|
||||
return priceOperator(Reverse(o))
|
||||
}
|
||||
|
||||
// Order by price descending
|
||||
productOrd := reverseOperator(floatOrd)
|
||||
|
||||
prod1 := Product{Name: "Widget", Price: 19.99}
|
||||
prod2 := Product{Name: "Gadget", Price: 29.99}
|
||||
|
||||
assert.Equal(t, 1, productOrd.Compare(prod1, prod2), "19.99 > 29.99 (reversed)")
|
||||
assert.Equal(t, -1, productOrd.Compare(prod2, prod1), "29.99 < 19.99 (reversed)")
|
||||
}
|
||||
|
||||
// Example test for Kleisli
|
||||
func ExampleKleisli() {
|
||||
// Create a Kleisli that produces different orderings based on input
|
||||
var orderingFactory Kleisli[string, int] = func(mode string) Ord[int] {
|
||||
if mode == "ascending" {
|
||||
return FromStrictCompare[int]()
|
||||
}
|
||||
return Reverse(FromStrictCompare[int]())
|
||||
}
|
||||
|
||||
ascOrd := orderingFactory("ascending")
|
||||
descOrd := orderingFactory("descending")
|
||||
|
||||
println(ascOrd.Compare(5, 3)) // 1
|
||||
println(descOrd.Compare(5, 3)) // -1
|
||||
}
|
||||
|
||||
// Example test for Operator
|
||||
func ExampleOperator() {
|
||||
type Person struct {
|
||||
Name string
|
||||
Age int
|
||||
}
|
||||
|
||||
// Operator that transforms Ord[int] to Ord[Person] by age
|
||||
var ageOperator Operator[int, Person] = Contramap(func(p Person) int {
|
||||
return p.Age
|
||||
})
|
||||
|
||||
intOrd := FromStrictCompare[int]()
|
||||
personOrd := ageOperator(intOrd)
|
||||
|
||||
p1 := Person{Name: "Alice", Age: 30}
|
||||
p2 := Person{Name: "Bob", Age: 25}
|
||||
|
||||
result := personOrd.Compare(p1, p2)
|
||||
println(result) // 1 (30 > 25)
|
||||
}
|
||||
@@ -73,7 +73,7 @@ Map operations transform one or both values:
|
||||
// Map both values
|
||||
p4 := pair.MonadBiMap(p,
|
||||
func(n int) string { return fmt.Sprintf("%d", n) },
|
||||
func(s string) int { return len(s) },
|
||||
S.Size,
|
||||
) // Pair[string, int]{"5", 5}
|
||||
|
||||
Curried versions for composition:
|
||||
@@ -91,7 +91,7 @@ Curried versions for composition:
|
||||
// Compose multiple transformations
|
||||
transform := F.Flow2(
|
||||
pair.MapHead[string](N.Mul(2)),
|
||||
pair.MapTail[int](func(s string) int { return len(s) }),
|
||||
pair.MapTail[int](S.Size),
|
||||
)
|
||||
result := transform(p) // Pair[int, int]{10, 5}
|
||||
|
||||
@@ -147,7 +147,7 @@ Apply functions wrapped in pairs to values in pairs:
|
||||
intSum := N.SemigroupSum[int]()
|
||||
|
||||
// Function in a pair
|
||||
pf := pair.MakePair(10, func(s string) int { return len(s) })
|
||||
pf := pair.MakePair(10, S.Size)
|
||||
|
||||
// Value in a pair
|
||||
pv := pair.MakePair(5, "hello")
|
||||
@@ -244,7 +244,7 @@ Functor - Map over values:
|
||||
|
||||
// Functor for tail
|
||||
functor := pair.FunctorTail[int, string, int]()
|
||||
mapper := functor.Map(func(s string) int { return len(s) })
|
||||
mapper := functor.Map(S.Size)
|
||||
|
||||
p := pair.MakePair(5, "hello")
|
||||
result := mapper(p) // Pair[int, int]{5, 5}
|
||||
@@ -267,7 +267,7 @@ Applicative - Apply wrapped functions:
|
||||
applicative := pair.ApplicativeTail[string, int, int](intSum)
|
||||
|
||||
// Create a pair with a function
|
||||
pf := applicative.Of(func(s string) int { return len(s) })
|
||||
pf := applicative.Of(S.Size)
|
||||
|
||||
// Apply to a value
|
||||
pv := pair.MakePair(5, "hello")
|
||||
|
||||
@@ -233,7 +233,7 @@ func PointedTail[B, A any](m monoid.Monoid[A]) pointed.Pointed[B, Pair[A, B]] {
|
||||
// Example:
|
||||
//
|
||||
// functor := pair.FunctorTail[string, int, int]()
|
||||
// mapper := functor.Map(func(s string) int { return len(s) })
|
||||
// mapper := functor.Map(S.Size)
|
||||
// p := pair.MakePair(5, "hello")
|
||||
// p2 := mapper(p) // Pair[int, int]{5, 5}
|
||||
func FunctorTail[B, A, B1 any]() functor.Functor[B, B1, Pair[A, B], Pair[A, B1]] {
|
||||
@@ -250,7 +250,7 @@ func FunctorTail[B, A, B1 any]() functor.Functor[B, B1, Pair[A, B], Pair[A, B1]]
|
||||
//
|
||||
// intSum := M.MonoidSum[int]()
|
||||
// applicative := pair.ApplicativeTail[string, int, int](intSum)
|
||||
// pf := applicative.Of(func(s string) int { return len(s) })
|
||||
// pf := applicative.Of(S.Size)
|
||||
// pv := pair.MakePair(5, "hello")
|
||||
// result := applicative.Ap(pv)(pf) // Pair[int, int]{5, 5}
|
||||
func ApplicativeTail[B, A, B1 any](m monoid.Monoid[A]) applicative.Applicative[B, B1, Pair[A, B], Pair[A, B1], Pair[A, func(B) B1]] {
|
||||
@@ -291,7 +291,7 @@ func Pointed[B, A any](m monoid.Monoid[A]) pointed.Pointed[B, Pair[A, B]] {
|
||||
// Example:
|
||||
//
|
||||
// functor := pair.Functor[string, int, int]()
|
||||
// mapper := functor.Map(func(s string) int { return len(s) })
|
||||
// mapper := functor.Map(S.Size)
|
||||
// p := pair.MakePair(5, "hello")
|
||||
// p2 := mapper(p) // Pair[int, int]{5, 5}
|
||||
func Functor[B, A, B1 any]() functor.Functor[B, B1, Pair[A, B], Pair[A, B1]] {
|
||||
@@ -307,7 +307,7 @@ func Functor[B, A, B1 any]() functor.Functor[B, B1, Pair[A, B], Pair[A, B1]] {
|
||||
//
|
||||
// intSum := M.MonoidSum[int]()
|
||||
// applicative := pair.Applicative[string, int, int](intSum)
|
||||
// pf := applicative.Of(func(s string) int { return len(s) })
|
||||
// pf := applicative.Of(S.Size)
|
||||
// pv := pair.MakePair(5, "hello")
|
||||
// result := applicative.Ap(pv)(pf) // Pair[int, int]{5, 5}
|
||||
func Applicative[B, A, B1 any](m monoid.Monoid[A]) applicative.Applicative[B, B1, Pair[A, B], Pair[A, B1], Pair[A, func(B) B1]] {
|
||||
|
||||
315
v2/pair/monoid.go
Normal file
315
v2/pair/monoid.go
Normal file
@@ -0,0 +1,315 @@
|
||||
// Copyright (c) 2024 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package pair
|
||||
|
||||
import (
|
||||
F "github.com/IBM/fp-go/v2/function"
|
||||
M "github.com/IBM/fp-go/v2/monoid"
|
||||
)
|
||||
|
||||
// Monoid creates a simple component-wise monoid for [Pair].
|
||||
//
|
||||
// This function creates a monoid that combines pairs by independently combining their
|
||||
// head and tail components using the provided monoids. Both components are combined
|
||||
// in NORMAL left-to-right order.
|
||||
//
|
||||
// IMPORTANT: This is DIFFERENT from [ApplicativeMonoidTail] and [ApplicativeMonoidHead],
|
||||
// which use applicative functor operations and reverse the order of the non-focused component.
|
||||
//
|
||||
// Use this function when you want:
|
||||
// - Simple, predictable left-to-right combination for both components
|
||||
// - Behavior that matches intuition for non-commutative operations
|
||||
// - Direct component-wise combination without applicative functor semantics
|
||||
//
|
||||
// Use [ApplicativeMonoidTail] or [ApplicativeMonoidHead] when you need applicative
|
||||
// functor semantics for lifting monoid operations into the Pair context.
|
||||
//
|
||||
// Parameters:
|
||||
// - l: A monoid for the head (left) values of type L
|
||||
// - r: A monoid for the tail (right) values of type R
|
||||
//
|
||||
// Returns:
|
||||
// - A Monoid[Pair[L, R]] that combines both components left-to-right
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import (
|
||||
// N "github.com/IBM/fp-go/v2/number"
|
||||
// S "github.com/IBM/fp-go/v2/string"
|
||||
// )
|
||||
//
|
||||
// intAdd := N.MonoidSum[int]()
|
||||
// strConcat := S.Monoid
|
||||
//
|
||||
// pairMonoid := pair.Monoid(intAdd, strConcat)
|
||||
//
|
||||
// p1 := pair.MakePair(5, "hello")
|
||||
// p2 := pair.MakePair(10, " world")
|
||||
//
|
||||
// result := pairMonoid.Concat(p1, p2)
|
||||
// // result is Pair[int, string]{15, "hello world"}
|
||||
// // Both components combine left-to-right: (5+10, "hello"+" world")
|
||||
//
|
||||
// empty := pairMonoid.Empty()
|
||||
// // empty is Pair[int, string]{0, ""}
|
||||
//
|
||||
// Comparison with ApplicativeMonoidTail:
|
||||
//
|
||||
// strConcat := S.Monoid
|
||||
//
|
||||
// // Simple component-wise monoid
|
||||
// simpleMonoid := pair.Monoid(strConcat, strConcat)
|
||||
// p1 := pair.MakePair("A", "1")
|
||||
// p2 := pair.MakePair("B", "2")
|
||||
// result1 := simpleMonoid.Concat(p1, p2)
|
||||
// // result1 is Pair[string, string]{"AB", "12"}
|
||||
// // Both components: left-to-right
|
||||
//
|
||||
// // Applicative monoid
|
||||
// appMonoid := pair.ApplicativeMonoidTail(strConcat, strConcat)
|
||||
// result2 := appMonoid.Concat(p1, p2)
|
||||
// // result2 is Pair[string, string]{"BA", "12"}
|
||||
// // Head: reversed, Tail: normal
|
||||
//
|
||||
//go:inline
|
||||
func Monoid[L, R any](l M.Monoid[L], r M.Monoid[R]) M.Monoid[Pair[L, R]] {
|
||||
return M.MakeMonoid(
|
||||
func(pl, pr Pair[L, R]) Pair[L, R] {
|
||||
return MakePair(l.Concat(Head(pl), Head(pr)), r.Concat(Tail(pl), Tail(pr)))
|
||||
},
|
||||
MakePair(l.Empty(), r.Empty()),
|
||||
)
|
||||
}
|
||||
|
||||
// ApplicativeMonoid creates a monoid for [Pair] using applicative functor operations on the tail.
|
||||
//
|
||||
// This is an alias for [ApplicativeMonoidTail], which lifts the right (tail) monoid into the
|
||||
// Pair applicative functor. The left monoid provides the semigroup for combining head values
|
||||
// during applicative operations.
|
||||
//
|
||||
// IMPORTANT BEHAVIORAL NOTE: The applicative implementation causes the HEAD component to be
|
||||
// combined in REVERSE order (right-to-left) while the TAIL combines normally (left-to-right).
|
||||
// This differs from Haskell's standard Applicative instance for pairs, which combines the
|
||||
// first component left-to-right. This matters for non-commutative operations like string
|
||||
// concatenation.
|
||||
//
|
||||
// Parameters:
|
||||
// - l: A monoid for the head (left) values of type L
|
||||
// - r: A monoid for the tail (right) values of type R
|
||||
//
|
||||
// Returns:
|
||||
// - A Monoid[Pair[L, R]] that combines pairs using applicative operations on the tail
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import (
|
||||
// N "github.com/IBM/fp-go/v2/number"
|
||||
// S "github.com/IBM/fp-go/v2/string"
|
||||
// )
|
||||
//
|
||||
// intAdd := N.MonoidSum[int]()
|
||||
// strConcat := S.Monoid
|
||||
//
|
||||
// pairMonoid := pair.ApplicativeMonoid(intAdd, strConcat)
|
||||
//
|
||||
// p1 := pair.MakePair(10, "foo")
|
||||
// p2 := pair.MakePair(20, "bar")
|
||||
//
|
||||
// result := pairMonoid.Concat(p1, p2)
|
||||
// // result is Pair[int, string]{30, "foobar"}
|
||||
// // Note: head combines normally (10+20), tail combines normally ("foo"+"bar")
|
||||
//
|
||||
// empty := pairMonoid.Empty()
|
||||
// // empty is Pair[int, string]{0, ""}
|
||||
//
|
||||
//go:inline
|
||||
func ApplicativeMonoid[L, R any](l M.Monoid[L], r M.Monoid[R]) M.Monoid[Pair[L, R]] {
|
||||
return ApplicativeMonoidTail(l, r)
|
||||
}
|
||||
|
||||
// ApplicativeMonoidTail creates a monoid for [Pair] by lifting the tail monoid into the applicative functor.
|
||||
//
|
||||
// This function constructs a monoid using the applicative structure of Pair, focusing on
|
||||
// the tail (right) value. The head values are combined using the left monoid's semigroup
|
||||
// operation during applicative application.
|
||||
//
|
||||
// CRITICAL BEHAVIORAL NOTE: The HEAD values are combined in REVERSE order (right-to-left),
|
||||
// while TAIL values combine in normal order (left-to-right). This is due to how the
|
||||
// applicative `ap` operation is implemented for Pair.
|
||||
//
|
||||
// NOTE: This differs from Haskell's standard Applicative instance for (,) which combines
|
||||
// the first component left-to-right. The reversal occurs because MonadApTail implements:
|
||||
//
|
||||
// MakePair(sg.Concat(second.head, first.head), ...)
|
||||
//
|
||||
// Example showing the reversal with non-commutative operations:
|
||||
//
|
||||
// strConcat := S.Monoid
|
||||
// pairMonoid := pair.ApplicativeMonoidTail(strConcat, strConcat)
|
||||
// p1 := pair.MakePair("hello", "foo")
|
||||
// p2 := pair.MakePair(" world", "bar")
|
||||
// result := pairMonoid.Concat(p1, p2)
|
||||
// // result is Pair[string, string]{" worldhello", "foobar"}
|
||||
// // ^^^^^^^^^^^^^^ ^^^^^^
|
||||
// // REVERSED! normal order
|
||||
//
|
||||
// In Haskell's Applicative for (,), this would give ("hellohello world", "foobar")
|
||||
//
|
||||
// The resulting monoid satisfies the standard monoid laws:
|
||||
// - Associativity: Concat(Concat(p1, p2), p3) = Concat(p1, Concat(p2, p3))
|
||||
// - Left identity: Concat(Empty(), p) = p
|
||||
// - Right identity: Concat(p, Empty()) = p
|
||||
//
|
||||
// Parameters:
|
||||
// - l: A monoid for the head (left) values of type L
|
||||
// - r: A monoid for the tail (right) values of type R
|
||||
//
|
||||
// Returns:
|
||||
// - A Monoid[Pair[L, R]] that combines pairs component-wise
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import (
|
||||
// N "github.com/IBM/fp-go/v2/number"
|
||||
// M "github.com/IBM/fp-go/v2/monoid"
|
||||
// )
|
||||
//
|
||||
// intAdd := N.MonoidSum[int]()
|
||||
// intMul := N.MonoidProduct[int]()
|
||||
//
|
||||
// pairMonoid := pair.ApplicativeMonoidTail(intAdd, intMul)
|
||||
//
|
||||
// p1 := pair.MakePair(5, 3)
|
||||
// p2 := pair.MakePair(10, 4)
|
||||
//
|
||||
// result := pairMonoid.Concat(p1, p2)
|
||||
// // result is Pair[int, int]{15, 12} (5+10, 3*4)
|
||||
// // Note: Addition is commutative, so order doesn't matter for head
|
||||
//
|
||||
// empty := pairMonoid.Empty()
|
||||
// // empty is Pair[int, int]{0, 1}
|
||||
//
|
||||
// Example with different types:
|
||||
//
|
||||
// import S "github.com/IBM/fp-go/v2/string"
|
||||
//
|
||||
// boolAnd := M.MakeMonoid(func(a, b bool) bool { return a && b }, true)
|
||||
// strConcat := S.Monoid
|
||||
//
|
||||
// pairMonoid := pair.ApplicativeMonoidTail(boolAnd, strConcat)
|
||||
//
|
||||
// p1 := pair.MakePair(true, "hello")
|
||||
// p2 := pair.MakePair(true, " world")
|
||||
//
|
||||
// result := pairMonoid.Concat(p1, p2)
|
||||
// // result is Pair[bool, string]{true, "hello world"}
|
||||
// // Note: Boolean AND is commutative, so order doesn't matter for head
|
||||
//
|
||||
//go:inline
|
||||
func ApplicativeMonoidTail[L, R any](l M.Monoid[L], r M.Monoid[R]) M.Monoid[Pair[L, R]] {
|
||||
return M.ApplicativeMonoid(
|
||||
FromHead[R](l.Empty()),
|
||||
MonadMapTail[L, R, func(R) R],
|
||||
F.Bind1of3(MonadApTail[L, R, R])(l),
|
||||
r)
|
||||
}
|
||||
|
||||
// ApplicativeMonoidHead creates a monoid for [Pair] by lifting the head monoid into the applicative functor.
|
||||
//
|
||||
// This function constructs a monoid using the applicative structure of Pair, focusing on
|
||||
// the head (left) value. The tail values are combined using the right monoid's semigroup
|
||||
// operation during applicative application.
|
||||
//
|
||||
// This is the dual of [ApplicativeMonoidTail], operating on the head instead of the tail.
|
||||
//
|
||||
// CRITICAL BEHAVIORAL NOTE: The TAIL values are combined in REVERSE order (right-to-left),
|
||||
// while HEAD values combine in normal order (left-to-right). This is the opposite behavior
|
||||
// of ApplicativeMonoidTail. The reversal occurs because MonadApHead implements:
|
||||
//
|
||||
// MakePair(..., sg.Concat(second.tail, first.tail))
|
||||
//
|
||||
// Example showing the reversal with non-commutative operations:
|
||||
//
|
||||
// strConcat := S.Monoid
|
||||
// pairMonoid := pair.ApplicativeMonoidHead(strConcat, strConcat)
|
||||
// p1 := pair.MakePair("hello", "foo")
|
||||
// p2 := pair.MakePair(" world", "bar")
|
||||
// result := pairMonoid.Concat(p1, p2)
|
||||
// // result is Pair[string, string]{"hello world", "barfoo"}
|
||||
// // ^^^^^^^^^^^^ ^^^^^^^^
|
||||
// // normal order REVERSED!
|
||||
//
|
||||
// The resulting monoid satisfies the standard monoid laws:
|
||||
// - Associativity: Concat(Concat(p1, p2), p3) = Concat(p1, Concat(p2, p3))
|
||||
// - Left identity: Concat(Empty(), p) = p
|
||||
// - Right identity: Concat(p, Empty()) = p
|
||||
//
|
||||
// Parameters:
|
||||
// - l: A monoid for the head (left) values of type L
|
||||
// - r: A monoid for the tail (right) values of type R
|
||||
//
|
||||
// Returns:
|
||||
// - A Monoid[Pair[L, R]] that combines pairs component-wise
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// import (
|
||||
// N "github.com/IBM/fp-go/v2/number"
|
||||
// M "github.com/IBM/fp-go/v2/monoid"
|
||||
// )
|
||||
//
|
||||
// intMul := N.MonoidProduct[int]()
|
||||
// intAdd := N.MonoidSum[int]()
|
||||
//
|
||||
// pairMonoid := pair.ApplicativeMonoidHead(intMul, intAdd)
|
||||
//
|
||||
// p1 := pair.MakePair(3, 5)
|
||||
// p2 := pair.MakePair(4, 10)
|
||||
//
|
||||
// result := pairMonoid.Concat(p1, p2)
|
||||
// // result is Pair[int, int]{12, 15} (3*4, 5+10)
|
||||
// // Note: Both operations are commutative, so order doesn't matter
|
||||
//
|
||||
// empty := pairMonoid.Empty()
|
||||
// // empty is Pair[int, int]{1, 0}
|
||||
//
|
||||
// Example comparing Head vs Tail with non-commutative operations:
|
||||
//
|
||||
// import S "github.com/IBM/fp-go/v2/string"
|
||||
//
|
||||
// strConcat := S.Monoid
|
||||
//
|
||||
// // Using ApplicativeMonoidHead - tail values REVERSED
|
||||
// headMonoid := pair.ApplicativeMonoidHead(strConcat, strConcat)
|
||||
// p1 := pair.MakePair("hello", "foo")
|
||||
// p2 := pair.MakePair(" world", "bar")
|
||||
// result := headMonoid.Concat(p1, p2)
|
||||
// // result is Pair[string, string]{"hello world", "barfoo"}
|
||||
//
|
||||
// // Using ApplicativeMonoidTail - head values REVERSED
|
||||
// tailMonoid := pair.ApplicativeMonoidTail(strConcat, strConcat)
|
||||
// result2 := tailMonoid.Concat(p1, p2)
|
||||
// // result2 is Pair[string, string]{" worldhello", "foobar"}
|
||||
// // DIFFERENT result! Head and tail are swapped in their reversal behavior
|
||||
//
|
||||
//go:inline
|
||||
func ApplicativeMonoidHead[L, R any](l M.Monoid[L], r M.Monoid[R]) M.Monoid[Pair[L, R]] {
|
||||
return M.ApplicativeMonoid(
|
||||
FromTail[L](r.Empty()),
|
||||
MonadMapHead[R, L, func(L) L],
|
||||
F.Bind1of3(MonadApHead[R, L, L])(r),
|
||||
l)
|
||||
}
|
||||
756
v2/pair/monoid_test.go
Normal file
756
v2/pair/monoid_test.go
Normal file
@@ -0,0 +1,756 @@
|
||||
// Copyright (c) 2024 - 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package pair
|
||||
|
||||
import (
|
||||
"testing"
|
||||
|
||||
M "github.com/IBM/fp-go/v2/monoid"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
S "github.com/IBM/fp-go/v2/string"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// TestApplicativeMonoidTail tests the ApplicativeMonoidTail implementation
|
||||
func TestApplicativeMonoidTail(t *testing.T) {
|
||||
t.Run("integer addition and string concatenation", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
p1 := MakePair(5, "hello")
|
||||
p2 := MakePair(3, " world")
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, 8, Head(result))
|
||||
assert.Equal(t, "hello world", Tail(result))
|
||||
})
|
||||
|
||||
t.Run("integer multiplication and addition", func(t *testing.T) {
|
||||
intMul := N.MonoidProduct[int]()
|
||||
intAdd := N.MonoidSum[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intMul, intAdd)
|
||||
|
||||
p1 := MakePair(3, 5)
|
||||
p2 := MakePair(4, 10)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, 12, Head(result)) // 3 * 4
|
||||
assert.Equal(t, 15, Tail(result)) // 5 + 10
|
||||
})
|
||||
|
||||
t.Run("boolean AND and OR", func(t *testing.T) {
|
||||
boolAnd := M.MakeMonoid(func(a, b bool) bool { return a && b }, true)
|
||||
boolOr := M.MakeMonoid(func(a, b bool) bool { return a || b }, false)
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(boolAnd, boolOr)
|
||||
|
||||
p1 := MakePair(true, false)
|
||||
p2 := MakePair(true, true)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, true, Head(result)) // true && true
|
||||
assert.Equal(t, true, Tail(result)) // false || true
|
||||
})
|
||||
|
||||
t.Run("empty value", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
empty := pairMonoid.Empty()
|
||||
assert.Equal(t, 0, Head(empty))
|
||||
assert.Equal(t, "", Tail(empty))
|
||||
})
|
||||
|
||||
t.Run("left identity law", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
p := MakePair(5, "test")
|
||||
result := pairMonoid.Concat(pairMonoid.Empty(), p)
|
||||
|
||||
assert.Equal(t, p, result)
|
||||
})
|
||||
|
||||
t.Run("right identity law", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
p := MakePair(5, "test")
|
||||
result := pairMonoid.Concat(p, pairMonoid.Empty())
|
||||
|
||||
assert.Equal(t, p, result)
|
||||
})
|
||||
|
||||
t.Run("associativity law", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
p1 := MakePair(1, "a")
|
||||
p2 := MakePair(2, "b")
|
||||
p3 := MakePair(3, "c")
|
||||
|
||||
left := pairMonoid.Concat(pairMonoid.Concat(p1, p2), p3)
|
||||
right := pairMonoid.Concat(p1, pairMonoid.Concat(p2, p3))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, 6, Head(left))
|
||||
assert.Equal(t, "abc", Tail(left))
|
||||
})
|
||||
|
||||
t.Run("multiple concatenations", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, intMul)
|
||||
|
||||
pairs := []Pair[int, int]{
|
||||
MakePair(1, 2),
|
||||
MakePair(3, 4),
|
||||
MakePair(5, 6),
|
||||
}
|
||||
|
||||
result := pairMonoid.Empty()
|
||||
for _, p := range pairs {
|
||||
result = pairMonoid.Concat(result, p)
|
||||
}
|
||||
|
||||
assert.Equal(t, 9, Head(result)) // 0 + 1 + 3 + 5
|
||||
assert.Equal(t, 48, Tail(result)) // 1 * 2 * 4 * 6
|
||||
})
|
||||
}
|
||||
|
||||
// TestApplicativeMonoidHead tests the ApplicativeMonoidHead implementation
|
||||
func TestApplicativeMonoidHead(t *testing.T) {
|
||||
t.Run("integer multiplication and addition", func(t *testing.T) {
|
||||
intMul := N.MonoidProduct[int]()
|
||||
intAdd := N.MonoidSum[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(intMul, intAdd)
|
||||
|
||||
p1 := MakePair(3, 5)
|
||||
p2 := MakePair(4, 10)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, 12, Head(result)) // 3 * 4
|
||||
assert.Equal(t, 15, Tail(result)) // 5 + 10
|
||||
})
|
||||
|
||||
t.Run("string concatenation and boolean OR", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
boolOr := M.MakeMonoid(func(a, b bool) bool { return a || b }, false)
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(strConcat, boolOr)
|
||||
|
||||
p1 := MakePair("hello", false)
|
||||
p2 := MakePair(" world", true)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, "hello world", Head(result))
|
||||
assert.Equal(t, true, Tail(result))
|
||||
})
|
||||
|
||||
t.Run("empty value", func(t *testing.T) {
|
||||
intMul := N.MonoidProduct[int]()
|
||||
intAdd := N.MonoidSum[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(intMul, intAdd)
|
||||
|
||||
empty := pairMonoid.Empty()
|
||||
assert.Equal(t, 1, Head(empty))
|
||||
assert.Equal(t, 0, Tail(empty))
|
||||
})
|
||||
|
||||
t.Run("left identity law", func(t *testing.T) {
|
||||
intMul := N.MonoidProduct[int]()
|
||||
intAdd := N.MonoidSum[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(intMul, intAdd)
|
||||
|
||||
p := MakePair(5, 10)
|
||||
result := pairMonoid.Concat(pairMonoid.Empty(), p)
|
||||
|
||||
assert.Equal(t, p, result)
|
||||
})
|
||||
|
||||
t.Run("right identity law", func(t *testing.T) {
|
||||
intMul := N.MonoidProduct[int]()
|
||||
intAdd := N.MonoidSum[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(intMul, intAdd)
|
||||
|
||||
p := MakePair(5, 10)
|
||||
result := pairMonoid.Concat(p, pairMonoid.Empty())
|
||||
|
||||
assert.Equal(t, p, result)
|
||||
})
|
||||
|
||||
t.Run("associativity law", func(t *testing.T) {
|
||||
intMul := N.MonoidProduct[int]()
|
||||
intAdd := N.MonoidSum[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(intMul, intAdd)
|
||||
|
||||
p1 := MakePair(2, 1)
|
||||
p2 := MakePair(3, 2)
|
||||
p3 := MakePair(4, 3)
|
||||
|
||||
left := pairMonoid.Concat(pairMonoid.Concat(p1, p2), p3)
|
||||
right := pairMonoid.Concat(p1, pairMonoid.Concat(p2, p3))
|
||||
|
||||
assert.Equal(t, left, right)
|
||||
assert.Equal(t, 24, Head(left)) // 2 * 3 * 4
|
||||
assert.Equal(t, 6, Tail(left)) // 1 + 2 + 3
|
||||
})
|
||||
|
||||
t.Run("multiple concatenations", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(intAdd, intMul)
|
||||
|
||||
pairs := []Pair[int, int]{
|
||||
MakePair(1, 2),
|
||||
MakePair(3, 4),
|
||||
MakePair(5, 6),
|
||||
}
|
||||
|
||||
result := pairMonoid.Empty()
|
||||
for _, p := range pairs {
|
||||
result = pairMonoid.Concat(result, p)
|
||||
}
|
||||
|
||||
assert.Equal(t, 9, Head(result)) // 0 + 1 + 3 + 5
|
||||
assert.Equal(t, 48, Tail(result)) // 1 * 2 * 4 * 6
|
||||
})
|
||||
}
|
||||
|
||||
// TestApplicativeMonoid tests the ApplicativeMonoid alias
|
||||
func TestApplicativeMonoid(t *testing.T) {
|
||||
t.Run("is alias for ApplicativeMonoidTail", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
monoid1 := ApplicativeMonoid(intAdd, strConcat)
|
||||
monoid2 := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
p1 := MakePair(5, "hello")
|
||||
p2 := MakePair(3, " world")
|
||||
|
||||
result1 := monoid1.Concat(p1, p2)
|
||||
result2 := monoid2.Concat(p1, p2)
|
||||
|
||||
assert.Equal(t, result1, result2)
|
||||
assert.Equal(t, 8, Head(result1))
|
||||
assert.Equal(t, "hello world", Tail(result1))
|
||||
})
|
||||
|
||||
t.Run("empty values are identical", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
monoid1 := ApplicativeMonoid(intAdd, strConcat)
|
||||
monoid2 := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
assert.Equal(t, monoid1.Empty(), monoid2.Empty())
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidHeadVsTail compares ApplicativeMonoidHead and ApplicativeMonoidTail
|
||||
func TestMonoidHeadVsTail(t *testing.T) {
|
||||
t.Run("same result with commutative operations", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
headMonoid := ApplicativeMonoidHead(intMul, intAdd)
|
||||
tailMonoid := ApplicativeMonoidTail(intMul, intAdd)
|
||||
|
||||
p1 := MakePair(2, 3)
|
||||
p2 := MakePair(4, 5)
|
||||
|
||||
resultHead := headMonoid.Concat(p1, p2)
|
||||
resultTail := tailMonoid.Concat(p1, p2)
|
||||
|
||||
// Both should give same result since operations are commutative
|
||||
assert.Equal(t, 8, Head(resultHead)) // 2 * 4
|
||||
assert.Equal(t, 8, Tail(resultHead)) // 3 + 5
|
||||
assert.Equal(t, 8, Head(resultTail)) // 2 * 4
|
||||
assert.Equal(t, 8, Tail(resultTail)) // 3 + 5
|
||||
})
|
||||
|
||||
t.Run("different empty values", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
headMonoid := ApplicativeMonoidHead(intMul, intAdd)
|
||||
tailMonoid := ApplicativeMonoidTail(intAdd, intMul)
|
||||
|
||||
emptyHead := headMonoid.Empty()
|
||||
emptyTail := tailMonoid.Empty()
|
||||
|
||||
assert.Equal(t, 1, Head(emptyHead)) // intMul empty
|
||||
assert.Equal(t, 0, Tail(emptyHead)) // intAdd empty
|
||||
assert.Equal(t, 0, Head(emptyTail)) // intAdd empty
|
||||
assert.Equal(t, 1, Tail(emptyTail)) // intMul empty
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidLaws verifies monoid laws for all implementations
|
||||
func TestMonoidLaws(t *testing.T) {
|
||||
testCases := []struct {
|
||||
name string
|
||||
monoid M.Monoid[Pair[int, int]]
|
||||
p1, p2, p3 Pair[int, int]
|
||||
}{
|
||||
{
|
||||
name: "ApplicativeMonoidTail",
|
||||
monoid: ApplicativeMonoidTail(N.MonoidSum[int](), N.MonoidProduct[int]()),
|
||||
p1: MakePair(1, 2),
|
||||
p2: MakePair(3, 4),
|
||||
p3: MakePair(5, 6),
|
||||
},
|
||||
{
|
||||
name: "ApplicativeMonoidHead",
|
||||
monoid: ApplicativeMonoidHead(N.MonoidProduct[int](), N.MonoidSum[int]()),
|
||||
p1: MakePair(2, 1),
|
||||
p2: MakePair(3, 2),
|
||||
p3: MakePair(4, 3),
|
||||
},
|
||||
{
|
||||
name: "ApplicativeMonoid",
|
||||
monoid: ApplicativeMonoid(N.MonoidSum[int](), N.MonoidSum[int]()),
|
||||
p1: MakePair(1, 2),
|
||||
p2: MakePair(3, 4),
|
||||
p3: MakePair(5, 6),
|
||||
},
|
||||
}
|
||||
|
||||
for _, tc := range testCases {
|
||||
t.Run(tc.name, func(t *testing.T) {
|
||||
t.Run("associativity", func(t *testing.T) {
|
||||
left := tc.monoid.Concat(tc.monoid.Concat(tc.p1, tc.p2), tc.p3)
|
||||
right := tc.monoid.Concat(tc.p1, tc.monoid.Concat(tc.p2, tc.p3))
|
||||
assert.Equal(t, left, right)
|
||||
})
|
||||
|
||||
t.Run("left identity", func(t *testing.T) {
|
||||
result := tc.monoid.Concat(tc.monoid.Empty(), tc.p1)
|
||||
assert.Equal(t, tc.p1, result)
|
||||
})
|
||||
|
||||
t.Run("right identity", func(t *testing.T) {
|
||||
result := tc.monoid.Concat(tc.p1, tc.monoid.Empty())
|
||||
assert.Equal(t, tc.p1, result)
|
||||
})
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
// TestMonoidEdgeCases tests edge cases for monoid operations
|
||||
func TestMonoidEdgeCases(t *testing.T) {
|
||||
t.Run("concatenating empty with empty", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, strConcat)
|
||||
|
||||
result := pairMonoid.Concat(pairMonoid.Empty(), pairMonoid.Empty())
|
||||
assert.Equal(t, pairMonoid.Empty(), result)
|
||||
})
|
||||
|
||||
t.Run("chain of operations", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, intMul)
|
||||
|
||||
result := pairMonoid.Concat(
|
||||
pairMonoid.Concat(
|
||||
pairMonoid.Concat(MakePair(1, 2), MakePair(2, 3)),
|
||||
MakePair(3, 4),
|
||||
),
|
||||
MakePair(4, 5),
|
||||
)
|
||||
|
||||
assert.Equal(t, 10, Head(result)) // 1 + 2 + 3 + 4
|
||||
assert.Equal(t, 120, Tail(result)) // 2 * 3 * 4 * 5
|
||||
})
|
||||
|
||||
t.Run("zero values", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, intMul)
|
||||
|
||||
p1 := MakePair(0, 0)
|
||||
p2 := MakePair(5, 10)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, 5, Head(result))
|
||||
assert.Equal(t, 0, Tail(result)) // 0 * 10 = 0
|
||||
})
|
||||
|
||||
t.Run("negative values", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, intMul)
|
||||
|
||||
p1 := MakePair(-5, -2)
|
||||
p2 := MakePair(3, 4)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, -2, Head(result)) // -5 + 3
|
||||
assert.Equal(t, -8, Tail(result)) // -2 * 4
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidWithDifferentTypes tests monoids with various type combinations
|
||||
func TestMonoidWithDifferentTypes(t *testing.T) {
|
||||
t.Run("string and boolean", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
boolAnd := M.MakeMonoid(func(a, b bool) bool { return a && b }, true)
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(strConcat, boolAnd)
|
||||
|
||||
p1 := MakePair("hello", true)
|
||||
p2 := MakePair(" world", true)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
// Note: The order depends on the applicative implementation
|
||||
assert.Equal(t, " worldhello", Head(result))
|
||||
assert.Equal(t, true, Tail(result))
|
||||
})
|
||||
|
||||
t.Run("boolean and string", func(t *testing.T) {
|
||||
boolOr := M.MakeMonoid(func(a, b bool) bool { return a || b }, false)
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(boolOr, strConcat)
|
||||
|
||||
p1 := MakePair(false, "foo")
|
||||
p2 := MakePair(true, "bar")
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, true, Head(result))
|
||||
assert.Equal(t, "foobar", Tail(result))
|
||||
})
|
||||
|
||||
t.Run("float64 addition and multiplication", func(t *testing.T) {
|
||||
floatAdd := N.MonoidSum[float64]()
|
||||
floatMul := N.MonoidProduct[float64]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(floatAdd, floatMul)
|
||||
|
||||
p1 := MakePair(1.5, 2.0)
|
||||
p2 := MakePair(2.5, 3.0)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, 4.0, Head(result))
|
||||
assert.Equal(t, 6.0, Tail(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidCommutativity tests behavior with non-commutative operations
|
||||
func TestMonoidCommutativity(t *testing.T) {
|
||||
t.Run("string concatenation is not commutative", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("hello", "foo")
|
||||
p2 := MakePair(" world", "bar")
|
||||
|
||||
result1 := pairMonoid.Concat(p1, p2)
|
||||
result2 := pairMonoid.Concat(p2, p1)
|
||||
|
||||
// The applicative implementation reverses the order for head values
|
||||
assert.Equal(t, " worldhello", Head(result1))
|
||||
assert.Equal(t, "foobar", Tail(result1))
|
||||
assert.Equal(t, "hello world", Head(result2))
|
||||
assert.Equal(t, "barfoo", Tail(result2))
|
||||
assert.NotEqual(t, result1, result2)
|
||||
})
|
||||
}
|
||||
|
||||
// TestSimpleMonoid tests the basic Monoid function (non-applicative)
|
||||
func TestSimpleMonoid(t *testing.T) {
|
||||
t.Run("combines both components left-to-right", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := Monoid(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("hello", "foo")
|
||||
p2 := MakePair(" world", "bar")
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
|
||||
// Both components combine in normal left-to-right order
|
||||
assert.Equal(t, "hello world", Head(result))
|
||||
assert.Equal(t, "foobar", Tail(result))
|
||||
})
|
||||
|
||||
t.Run("empty value", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := Monoid(intAdd, strConcat)
|
||||
|
||||
empty := pairMonoid.Empty()
|
||||
assert.Equal(t, 0, Head(empty))
|
||||
assert.Equal(t, "", Tail(empty))
|
||||
})
|
||||
|
||||
t.Run("monoid laws", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
pairMonoid := Monoid(intAdd, intMul)
|
||||
|
||||
p1 := MakePair(1, 2)
|
||||
p2 := MakePair(3, 4)
|
||||
p3 := MakePair(5, 6)
|
||||
|
||||
// Associativity
|
||||
left := pairMonoid.Concat(pairMonoid.Concat(p1, p2), p3)
|
||||
right := pairMonoid.Concat(p1, pairMonoid.Concat(p2, p3))
|
||||
assert.Equal(t, left, right)
|
||||
|
||||
// Left identity
|
||||
assert.Equal(t, p1, pairMonoid.Concat(pairMonoid.Empty(), p1))
|
||||
|
||||
// Right identity
|
||||
assert.Equal(t, p1, pairMonoid.Concat(p1, pairMonoid.Empty()))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidComparison compares the simple Monoid with applicative versions
|
||||
func TestMonoidComparison(t *testing.T) {
|
||||
t.Run("Monoid vs ApplicativeMonoidTail with strings", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
|
||||
simpleMonoid := Monoid(strConcat, strConcat)
|
||||
appMonoid := ApplicativeMonoidTail(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("A", "1")
|
||||
p2 := MakePair("B", "2")
|
||||
|
||||
simpleResult := simpleMonoid.Concat(p1, p2)
|
||||
appResult := appMonoid.Concat(p1, p2)
|
||||
|
||||
// Simple monoid: both components left-to-right
|
||||
assert.Equal(t, "AB", Head(simpleResult))
|
||||
assert.Equal(t, "12", Tail(simpleResult))
|
||||
|
||||
// Applicative monoid: head reversed, tail normal
|
||||
assert.Equal(t, "BA", Head(appResult))
|
||||
assert.Equal(t, "12", Tail(appResult))
|
||||
|
||||
// They produce different results!
|
||||
assert.NotEqual(t, simpleResult, appResult)
|
||||
})
|
||||
|
||||
t.Run("Monoid vs ApplicativeMonoidHead with strings", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
|
||||
simpleMonoid := Monoid(strConcat, strConcat)
|
||||
appMonoid := ApplicativeMonoidHead(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("A", "1")
|
||||
p2 := MakePair("B", "2")
|
||||
|
||||
simpleResult := simpleMonoid.Concat(p1, p2)
|
||||
appResult := appMonoid.Concat(p1, p2)
|
||||
|
||||
// Simple monoid: both components left-to-right
|
||||
assert.Equal(t, "AB", Head(simpleResult))
|
||||
assert.Equal(t, "12", Tail(simpleResult))
|
||||
|
||||
// Applicative monoid: head normal, tail reversed
|
||||
assert.Equal(t, "AB", Head(appResult))
|
||||
assert.Equal(t, "21", Tail(appResult))
|
||||
|
||||
// They produce different results!
|
||||
assert.NotEqual(t, simpleResult, appResult)
|
||||
})
|
||||
|
||||
t.Run("all three produce same result with commutative operations", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
simpleMonoid := Monoid(intAdd, intMul)
|
||||
appTailMonoid := ApplicativeMonoidTail(intAdd, intMul)
|
||||
appHeadMonoid := ApplicativeMonoidHead(intAdd, intMul)
|
||||
|
||||
p1 := MakePair(2, 3)
|
||||
p2 := MakePair(4, 5)
|
||||
|
||||
simpleResult := simpleMonoid.Concat(p1, p2)
|
||||
appTailResult := appTailMonoid.Concat(p1, p2)
|
||||
appHeadResult := appHeadMonoid.Concat(p1, p2)
|
||||
|
||||
// All produce the same result with commutative operations
|
||||
// Simple: (2+4, 3*5) = (6, 15)
|
||||
// AppTail: (4+2, 3*5) = (6, 15) - addition is commutative
|
||||
// AppHead: (2+4, 5*3) = (6, 15) - multiplication is commutative
|
||||
assert.Equal(t, 6, Head(simpleResult))
|
||||
assert.Equal(t, 15, Tail(simpleResult))
|
||||
assert.Equal(t, simpleResult, appTailResult)
|
||||
assert.Equal(t, simpleResult, appHeadResult)
|
||||
})
|
||||
|
||||
t.Run("Monoid matches Haskell behavior", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := Monoid(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("hello", "foo")
|
||||
p2 := MakePair(" world", "bar")
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
|
||||
// This matches what you'd expect from simple tuple combination
|
||||
// and is closer to intuitive behavior
|
||||
assert.Equal(t, "hello world", Head(result))
|
||||
assert.Equal(t, "foobar", Tail(result))
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidHaskellComparison documents how this implementation differs from Haskell's
|
||||
// standard Applicative instance for pairs (tuples).
|
||||
func TestMonoidHaskellComparison(t *testing.T) {
|
||||
t.Run("ApplicativeMonoidTail reverses head order unlike Haskell", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("hello", "foo")
|
||||
p2 := MakePair(" world", "bar")
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
|
||||
// Go implementation: head is reversed, tail is normal
|
||||
assert.Equal(t, " worldhello", Head(result))
|
||||
assert.Equal(t, "foobar", Tail(result))
|
||||
|
||||
// In Haskell's Applicative for (,):
|
||||
// (u, f) <*> (v, x) = (u <> v, f x)
|
||||
// pure (<>) <*> ("hello", "foo") <*> (" world", "bar")
|
||||
// would give: ("hello world", "foobar")
|
||||
// Note: Haskell combines first component left-to-right, not reversed
|
||||
})
|
||||
|
||||
t.Run("ApplicativeMonoidHead reverses tail order", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
|
||||
pairMonoid := ApplicativeMonoidHead(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("hello", "foo")
|
||||
p2 := MakePair(" world", "bar")
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
|
||||
// Go implementation: head is normal, tail is reversed
|
||||
assert.Equal(t, "hello world", Head(result))
|
||||
assert.Equal(t, "barfoo", Tail(result))
|
||||
|
||||
// This is the dual operation, focusing on head instead of tail
|
||||
})
|
||||
|
||||
t.Run("behavior with commutative operations matches Haskell", func(t *testing.T) {
|
||||
intAdd := N.MonoidSum[int]()
|
||||
intMul := N.MonoidProduct[int]()
|
||||
|
||||
pairMonoid := ApplicativeMonoidTail(intAdd, intMul)
|
||||
|
||||
p1 := MakePair(5, 3)
|
||||
p2 := MakePair(10, 4)
|
||||
|
||||
result := pairMonoid.Concat(p1, p2)
|
||||
|
||||
// With commutative operations, order doesn't matter
|
||||
// Both Go and Haskell give the same result
|
||||
assert.Equal(t, 15, Head(result)) // 5 + 10 = 10 + 5
|
||||
assert.Equal(t, 12, Tail(result)) // 3 * 4 = 4 * 3
|
||||
})
|
||||
}
|
||||
|
||||
// TestMonoidOrderingDocumentation provides clear examples of the ordering behavior
|
||||
// for documentation purposes.
|
||||
func TestMonoidOrderingDocumentation(t *testing.T) {
|
||||
t.Run("ApplicativeMonoidTail ordering", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
pairMonoid := ApplicativeMonoidTail(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("A", "1")
|
||||
p2 := MakePair("B", "2")
|
||||
p3 := MakePair("C", "3")
|
||||
|
||||
// Concat p1 and p2
|
||||
r12 := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, "BA", Head(r12)) // Head: reversed (p2 + p1)
|
||||
assert.Equal(t, "12", Tail(r12)) // Tail: normal (p1 + p2)
|
||||
|
||||
// Concat all three
|
||||
r123 := pairMonoid.Concat(r12, p3)
|
||||
assert.Equal(t, "CBA", Head(r123)) // Head: reversed (p3 + p2 + p1)
|
||||
assert.Equal(t, "123", Tail(r123)) // Tail: normal (p1 + p2 + p3)
|
||||
})
|
||||
|
||||
t.Run("ApplicativeMonoidHead ordering", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
pairMonoid := ApplicativeMonoidHead(strConcat, strConcat)
|
||||
|
||||
p1 := MakePair("A", "1")
|
||||
p2 := MakePair("B", "2")
|
||||
p3 := MakePair("C", "3")
|
||||
|
||||
// Concat p1 and p2
|
||||
r12 := pairMonoid.Concat(p1, p2)
|
||||
assert.Equal(t, "AB", Head(r12)) // Head: normal (p1 + p2)
|
||||
assert.Equal(t, "21", Tail(r12)) // Tail: reversed (p2 + p1)
|
||||
|
||||
// Concat all three
|
||||
r123 := pairMonoid.Concat(r12, p3)
|
||||
assert.Equal(t, "ABC", Head(r123)) // Head: normal (p1 + p2 + p3)
|
||||
assert.Equal(t, "321", Tail(r123)) // Tail: reversed (p3 + p2 + p1)
|
||||
})
|
||||
|
||||
t.Run("empty values respect ordering", func(t *testing.T) {
|
||||
strConcat := S.Monoid
|
||||
pairMonoid := ApplicativeMonoidTail(strConcat, strConcat)
|
||||
|
||||
empty := pairMonoid.Empty()
|
||||
p := MakePair("X", "Y")
|
||||
|
||||
// Empty is identity regardless of order
|
||||
r1 := pairMonoid.Concat(empty, p)
|
||||
r2 := pairMonoid.Concat(p, empty)
|
||||
|
||||
assert.Equal(t, p, r1)
|
||||
assert.Equal(t, p, r2)
|
||||
})
|
||||
}
|
||||
@@ -189,7 +189,7 @@ func MonadMapTail[A, B, B1 any](fa Pair[A, B], f func(B) B1) Pair[A, B1] {
|
||||
// p := pair.MakePair(5, "hello")
|
||||
// p2 := pair.MonadBiMap(p,
|
||||
// func(n int) string { return fmt.Sprintf("%d", n) },
|
||||
// func(s string) int { return len(s) },
|
||||
// S.Size,
|
||||
// ) // Pair[string, int]{"5", 5}
|
||||
//
|
||||
//go:inline
|
||||
@@ -202,7 +202,7 @@ func MonadBiMap[A, B, A1, B1 any](fa Pair[A, B], f func(A) A1, g func(B) B1) Pai
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// mapper := pair.Map[int](func(s string) int { return len(s) })
|
||||
// mapper := pair.Map[int](S.Size)
|
||||
// p := pair.MakePair(5, "hello")
|
||||
// p2 := mapper(p) // Pair[int, int]{5, 5}
|
||||
//
|
||||
@@ -232,7 +232,7 @@ func MapHead[B, A, A1 any](f func(A) A1) func(Pair[A, B]) Pair[A1, B] {
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// mapper := pair.MapTail[int](func(s string) int { return len(s) })
|
||||
// mapper := pair.MapTail[int](S.Size)
|
||||
// p := pair.MakePair(5, "hello")
|
||||
// p2 := mapper(p) // Pair[int, int]{5, 5}
|
||||
//
|
||||
@@ -248,7 +248,7 @@ func MapTail[A, B, B1 any](f func(B) B1) Operator[A, B, B1] {
|
||||
//
|
||||
// mapper := pair.BiMap(
|
||||
// func(n int) string { return fmt.Sprintf("%d", n) },
|
||||
// func(s string) int { return len(s) },
|
||||
// S.Size,
|
||||
// )
|
||||
// p := pair.MakePair(5, "hello")
|
||||
// p2 := mapper(p) // Pair[string, int]{"5", 5}
|
||||
@@ -400,7 +400,7 @@ func MonadApHead[B, A, A1 any](sg Semigroup[B], faa Pair[func(A) A1, B], fa Pair
|
||||
// import N "github.com/IBM/fp-go/v2/number"
|
||||
//
|
||||
// intSum := N.SemigroupSum[int]()
|
||||
// pf := pair.MakePair(10, func(s string) int { return len(s) })
|
||||
// pf := pair.MakePair(10, S.Size)
|
||||
// pv := pair.MakePair(5, "hello")
|
||||
// result := pair.MonadApTail(intSum, pf, pv) // Pair[int, int]{15, 5}
|
||||
//
|
||||
@@ -417,7 +417,7 @@ func MonadApTail[A, B, B1 any](sg Semigroup[A], fbb Pair[A, func(B) B1], fb Pair
|
||||
// import N "github.com/IBM/fp-go/v2/number"
|
||||
//
|
||||
// intSum := N.SemigroupSum[int]()
|
||||
// pf := pair.MakePair(10, func(s string) int { return len(s) })
|
||||
// pf := pair.MakePair(10, S.Size)
|
||||
// pv := pair.MakePair(5, "hello")
|
||||
// result := pair.MonadAp(intSum, pf, pv) // Pair[int, int]{15, 5}
|
||||
//
|
||||
@@ -454,7 +454,7 @@ func ApHead[B, A, A1 any](sg Semigroup[B], fa Pair[A, B]) func(Pair[func(A) A1,
|
||||
// intSum := N.SemigroupSum[int]()
|
||||
// pv := pair.MakePair(5, "hello")
|
||||
// ap := pair.ApTail(intSum, pv)
|
||||
// pf := pair.MakePair(10, func(s string) int { return len(s) })
|
||||
// pf := pair.MakePair(10, S.Size)
|
||||
// result := ap(pf) // Pair[int, int]{15, 5}
|
||||
func ApTail[A, B, B1 any](sg Semigroup[A], fb Pair[A, B]) Operator[A, func(B) B1, B1] {
|
||||
return func(fbb Pair[A, func(B) B1]) Pair[A, B1] {
|
||||
@@ -472,7 +472,7 @@ func ApTail[A, B, B1 any](sg Semigroup[A], fb Pair[A, B]) Operator[A, func(B) B1
|
||||
// intSum := N.SemigroupSum[int]()
|
||||
// pv := pair.MakePair(5, "hello")
|
||||
// ap := pair.Ap(intSum, pv)
|
||||
// pf := pair.MakePair(10, func(s string) int { return len(s) })
|
||||
// pf := pair.MakePair(10, S.Size)
|
||||
// result := ap(pf) // Pair[int, int]{15, 5}
|
||||
//
|
||||
//go:inline
|
||||
|
||||
@@ -60,6 +60,8 @@ import (
|
||||
// - You need to partially apply environments in a different order
|
||||
// - You're composing functions that expect parameters in reverse order
|
||||
// - You want to curry multi-parameter functions differently
|
||||
//
|
||||
//go:inline
|
||||
func Sequence[R1, R2, A any](ma Reader[R2, Reader[R1, A]]) Kleisli[R2, R1, A] {
|
||||
return function.Flip(ma)
|
||||
}
|
||||
|
||||
78
v2/reader/profunctor.go
Normal file
78
v2/reader/profunctor.go
Normal file
@@ -0,0 +1,78 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package reader
|
||||
|
||||
import "github.com/IBM/fp-go/v2/function"
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a Reader.
|
||||
// It applies f to the input (contravariantly) and g to the output (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type Config struct { Port int }
|
||||
// type Env struct { Config Config }
|
||||
// getPort := func(c Config) int { return c.Port }
|
||||
// extractConfig := func(e Env) Config { return e.Config }
|
||||
// toString := strconv.Itoa
|
||||
// r := reader.Promap(extractConfig, toString)(getPort)
|
||||
// result := r(Env{Config: Config{Port: 8080}}) // "8080"
|
||||
func Promap[E, A, D, B any](f func(D) E, g func(A) B) Kleisli[D, Reader[E, A], B] {
|
||||
return function.Bind13of3(function.Flow3[func(D) E, func(E) A, func(A) B])(f, g)
|
||||
}
|
||||
|
||||
// Local changes the value of the local context during the execution of the action `ma`.
|
||||
// This is similar to Contravariant's contramap and allows you to modify the environment
|
||||
// before passing it to a Reader.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type DetailedConfig struct { Host string; Port int }
|
||||
// type SimpleConfig struct { Host string }
|
||||
// getHost := func(c SimpleConfig) string { return c.Host }
|
||||
// simplify := func(d DetailedConfig) SimpleConfig { return SimpleConfig{Host: d.Host} }
|
||||
// r := reader.Local(simplify)(getHost)
|
||||
// result := r(DetailedConfig{Host: "localhost", Port: 8080}) // "localhost"
|
||||
//
|
||||
//go:inline
|
||||
func Local[A, R1, R2 any](f func(R2) R1) Kleisli[R2, Reader[R1, A], A] {
|
||||
return Compose[A](f)
|
||||
}
|
||||
|
||||
// Contramap is an alias for Local.
|
||||
// It changes the value of the local context during the execution of a Reader.
|
||||
// This is the contravariant functor operation that transforms the input environment.
|
||||
//
|
||||
// Contramap is semantically identical to Local - both modify the environment before
|
||||
// passing it to a Reader. The name "Contramap" emphasizes the contravariant nature
|
||||
// of the transformation (transforming the input rather than the output).
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type DetailedConfig struct { Host string; Port int }
|
||||
// type SimpleConfig struct { Host string }
|
||||
// getHost := func(c SimpleConfig) string { return c.Host }
|
||||
// simplify := func(d DetailedConfig) SimpleConfig { return SimpleConfig{Host: d.Host} }
|
||||
// r := reader.Contramap(simplify)(getHost)
|
||||
// result := r(DetailedConfig{Host: "localhost", Port: 8080}) // "localhost"
|
||||
//
|
||||
// See also: Local
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A, R1, R2 any](f func(R2) R1) Kleisli[R2, Reader[R1, A], A] {
|
||||
return Compose[A](f)
|
||||
}
|
||||
@@ -249,6 +249,34 @@ func MonadChain[R, A, B any](ma Reader[R, A], f Kleisli[R, A, B]) Reader[R, B] {
|
||||
// Chain sequences two Reader computations where the second depends on the result of the first.
|
||||
// This is the Monad operation that enables dependent computations.
|
||||
//
|
||||
// Relationship with Compose:
|
||||
//
|
||||
// Chain and Compose serve different purposes in Reader composition:
|
||||
//
|
||||
// - Chain: Monadic composition - sequences Readers that share the SAME environment type.
|
||||
// The second Reader depends on the VALUE produced by the first Reader, but both
|
||||
// Readers receive the same environment R. This is the monadic bind (>>=) operation.
|
||||
// Signature: Chain[R, A, B](f: A -> Reader[R, B]) -> Reader[R, A] -> Reader[R, B]
|
||||
//
|
||||
// - Compose: Function composition - chains Readers where the OUTPUT of the first
|
||||
// becomes the INPUT environment of the second. The environment types can differ.
|
||||
// This is standard function composition (.) for Readers as functions.
|
||||
// Signature: Compose[C, R, B](ab: Reader[R, B]) -> Reader[B, C] -> Reader[R, C]
|
||||
//
|
||||
// Key Differences:
|
||||
//
|
||||
// 1. Environment handling:
|
||||
// - Chain: Both Readers use the same environment R
|
||||
// - Compose: First Reader's output B becomes second Reader's input environment
|
||||
//
|
||||
// 2. Data flow:
|
||||
// - Chain: R -> A, then A -> Reader[R, B], both using same R
|
||||
// - Compose: R -> B, then B -> C (B is both output and environment)
|
||||
//
|
||||
// 3. Use cases:
|
||||
// - Chain: Dependent computations in the same context (e.g., fetch user, then fetch user's posts)
|
||||
// - Compose: Transforming nested environments (e.g., extract config from app state, then read from config)
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type Config struct { UserId int }
|
||||
@@ -360,6 +388,53 @@ func Flatten[R, A any](mma Reader[R, Reader[R, A]]) Reader[R, A] {
|
||||
// Compose composes two Readers sequentially, where the output environment of the first
|
||||
// becomes the input environment of the second.
|
||||
//
|
||||
// Relationship with Chain:
|
||||
//
|
||||
// Compose and Chain serve different purposes in Reader composition:
|
||||
//
|
||||
// - Compose: Function composition - chains Readers where the OUTPUT of the first
|
||||
// becomes the INPUT environment of the second. The environment types can differ.
|
||||
// This is standard function composition (.) for Readers as functions.
|
||||
// Signature: Compose[C, R, B](ab: Reader[R, B]) -> Reader[B, C] -> Reader[R, C]
|
||||
//
|
||||
// - Chain: Monadic composition - sequences Readers that share the SAME environment type.
|
||||
// The second Reader depends on the VALUE produced by the first Reader, but both
|
||||
// Readers receive the same environment R. This is the monadic bind (>>=) operation.
|
||||
// Signature: Chain[R, A, B](f: A -> Reader[R, B]) -> Reader[R, A] -> Reader[R, B]
|
||||
//
|
||||
// Key Differences:
|
||||
//
|
||||
// 1. Environment handling:
|
||||
// - Compose: First Reader's output B becomes second Reader's input environment
|
||||
// - Chain: Both Readers use the same environment R
|
||||
//
|
||||
// 2. Data flow:
|
||||
// - Compose: R -> B, then B -> C (B is both output and environment)
|
||||
// - Chain: R -> A, then A -> Reader[R, B], both using same R
|
||||
//
|
||||
// 3. Use cases:
|
||||
// - Compose: Transforming nested environments (e.g., extract config from app state, then read from config)
|
||||
// - Chain: Dependent computations in the same context (e.g., fetch user, then fetch user's posts)
|
||||
//
|
||||
// Visual Comparison:
|
||||
//
|
||||
// // Compose: Environment transformation
|
||||
// type AppState struct { Config Config }
|
||||
// type Config struct { Port int }
|
||||
// getConfig := func(s AppState) Config { return s.Config }
|
||||
// getPort := func(c Config) int { return c.Port }
|
||||
// getPortFromState := reader.Compose(getConfig)(getPort)
|
||||
// // Flow: AppState -> Config -> int (Config is both output and next input)
|
||||
//
|
||||
// // Chain: Same environment, dependent values
|
||||
// type Env struct { UserId int; Users map[int]string }
|
||||
// getUserId := func(e Env) int { return e.UserId }
|
||||
// getUser := func(id int) reader.Reader[Env, string] {
|
||||
// return func(e Env) string { return e.Users[id] }
|
||||
// }
|
||||
// getUserName := reader.Chain(getUser)(getUserId)
|
||||
// // Flow: Env -> int, then int -> Reader[Env, string] (Env used twice)
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type Config struct { Port int }
|
||||
@@ -367,10 +442,10 @@ func Flatten[R, A any](mma Reader[R, Reader[R, A]]) Reader[R, A] {
|
||||
// getConfig := func(e Env) Config { return e.Config }
|
||||
// getPort := func(c Config) int { return c.Port }
|
||||
// getPortFromEnv := reader.Compose(getConfig)(getPort)
|
||||
//
|
||||
//go:inline
|
||||
func Compose[C, R, B any](ab Reader[R, B]) Kleisli[R, Reader[B, C], C] {
|
||||
return func(bc Reader[B, C]) Reader[R, C] {
|
||||
return function.Flow2(ab, bc)
|
||||
}
|
||||
return function.Bind1st(function.Flow2[Reader[R, B], Reader[B, C]], ab)
|
||||
}
|
||||
|
||||
// First applies a Reader to the first element of a tuple, leaving the second element unchanged.
|
||||
@@ -401,42 +476,6 @@ func Second[A, B, C any](pbc Reader[B, C]) Reader[T.Tuple2[A, B], T.Tuple2[A, C]
|
||||
}
|
||||
}
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a Reader.
|
||||
// It applies f to the input (contravariantly) and g to the output (covariantly).
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type Config struct { Port int }
|
||||
// type Env struct { Config Config }
|
||||
// getPort := func(c Config) int { return c.Port }
|
||||
// extractConfig := func(e Env) Config { return e.Config }
|
||||
// toString := strconv.Itoa
|
||||
// r := reader.Promap(extractConfig, toString)(getPort)
|
||||
// result := r(Env{Config: Config{Port: 8080}}) // "8080"
|
||||
func Promap[E, A, D, B any](f func(D) E, g func(A) B) Kleisli[D, Reader[E, A], B] {
|
||||
return func(fea Reader[E, A]) Reader[D, B] {
|
||||
return function.Flow3(f, fea, g)
|
||||
}
|
||||
}
|
||||
|
||||
// Local changes the value of the local context during the execution of the action `ma`.
|
||||
// This is similar to Contravariant's contramap and allows you to modify the environment
|
||||
// before passing it to a Reader.
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type DetailedConfig struct { Host string; Port int }
|
||||
// type SimpleConfig struct { Host string }
|
||||
// getHost := func(c SimpleConfig) string { return c.Host }
|
||||
// simplify := func(d DetailedConfig) SimpleConfig { return SimpleConfig{Host: d.Host} }
|
||||
// r := reader.Local(simplify)(getHost)
|
||||
// result := r(DetailedConfig{Host: "localhost", Port: 8080}) // "localhost"
|
||||
//
|
||||
//go:inline
|
||||
func Local[A, R2, R1 any](f func(R2) R1) Kleisli[R2, Reader[R1, A], A] {
|
||||
return Compose[A](f)
|
||||
}
|
||||
|
||||
// Read applies a context to a Reader to obtain its value.
|
||||
// This is the "run" operation that executes a Reader with a specific environment.
|
||||
//
|
||||
@@ -446,8 +485,10 @@ func Local[A, R2, R1 any](f func(R2) R1) Kleisli[R2, Reader[R1, A], A] {
|
||||
// getPort := reader.Asks(func(c Config) int { return c.Port })
|
||||
// run := reader.Read(Config{Port: 8080})
|
||||
// port := run(getPort) // 8080
|
||||
//
|
||||
//go:inline
|
||||
func Read[A, E any](e E) func(Reader[E, A]) A {
|
||||
return I.Ap[A](e)
|
||||
return I.Flap[A](e)
|
||||
}
|
||||
|
||||
// MonadFlap is the monadic version of Flap.
|
||||
@@ -461,6 +502,8 @@ func Read[A, E any](e E) func(Reader[E, A]) A {
|
||||
// }
|
||||
// r := reader.MonadFlap(getMultiplier, 5)
|
||||
// result := r(Config{Multiplier: 3}) // 15
|
||||
//
|
||||
//go:inline
|
||||
func MonadFlap[R, B, A any](fab Reader[R, func(A) B], a A) Reader[R, B] {
|
||||
return functor.MonadFlap(MonadMap[R, func(A) B, B], fab, a)
|
||||
}
|
||||
@@ -477,6 +520,8 @@ func MonadFlap[R, B, A any](fab Reader[R, func(A) B], a A) Reader[R, B] {
|
||||
// applyTo5 := reader.Flap[Config](5)
|
||||
// r := applyTo5(getMultiplier)
|
||||
// result := r(Config{Multiplier: 3}) // 15
|
||||
//
|
||||
//go:inline
|
||||
func Flap[R, B, A any](a A) Operator[R, func(A) B, B] {
|
||||
return functor.Flap(Map[R, func(A) B, B], a)
|
||||
}
|
||||
|
||||
@@ -370,5 +370,3 @@ func TestTailRec_ComplexState(t *testing.T) {
|
||||
assert.Equal(t, 60, result)
|
||||
})
|
||||
}
|
||||
|
||||
// Made with Bob
|
||||
|
||||
76
v2/readereither/profunctor.go
Normal file
76
v2/readereither/profunctor.go
Normal file
@@ -0,0 +1,76 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readereither
|
||||
|
||||
import (
|
||||
"github.com/IBM/fp-go/v2/either"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
)
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a ReaderEither.
|
||||
// It applies f to the input environment (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Adapt the environment type before passing it to the ReaderEither (via f)
|
||||
// - Transform the success value after the computation completes (via g)
|
||||
//
|
||||
// The error type E remains unchanged through the transformation.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - R: The original environment type expected by the ReaderEither
|
||||
// - E: The error type (unchanged)
|
||||
// - A: The original success type produced by the ReaderEither
|
||||
// - D: The new input environment type
|
||||
// - B: The new output success type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input environment from D to R (contravariant)
|
||||
// - g: Function to transform the output success value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderEither[R, E, A] and returns a ReaderEither[D, E, B]
|
||||
//
|
||||
//go:inline
|
||||
func Promap[R, E, A, D, B any](f func(D) R, g func(A) B) Kleisli[D, E, ReaderEither[R, E, A], B] {
|
||||
return reader.Promap(f, either.Map[E](g))
|
||||
}
|
||||
|
||||
// Contramap changes the value of the local environment during the execution of a ReaderEither.
|
||||
// This is the contravariant functor operation that transforms the input environment.
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// Contramap is useful for adapting a ReaderEither to work with a different environment type
|
||||
// by providing a function that converts the new environment to the expected one.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - E: The error type (unchanged)
|
||||
// - A: The success type (unchanged)
|
||||
// - R2: The new input environment type
|
||||
// - R1: The original environment type expected by the ReaderEither
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the environment from R2 to R1
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderEither[R1, E, A] and returns a ReaderEither[R2, E, A]
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[E, A, R1, R2 any](f func(R2) R1) Kleisli[R2, E, ReaderEither[R1, E, A], A] {
|
||||
return reader.Contramap[Either[E, A]](f)
|
||||
}
|
||||
135
v2/readereither/profunctor_test.go
Normal file
135
v2/readereither/profunctor_test.go
Normal file
@@ -0,0 +1,135 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readereither
|
||||
|
||||
import (
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
E "github.com/IBM/fp-go/v2/either"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
type SimpleConfig struct {
|
||||
Port int
|
||||
}
|
||||
|
||||
type DetailedConfig struct {
|
||||
Host string
|
||||
Port int
|
||||
}
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both input and output", func(t *testing.T) {
|
||||
// ReaderEither that reads port from SimpleConfig
|
||||
getPort := func(c SimpleConfig) Either[string, int] {
|
||||
return E.Of[string](c.Port)
|
||||
}
|
||||
|
||||
// Transform DetailedConfig to SimpleConfig and int to string
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap[SimpleConfig, string](simplify, toString)(getPort)
|
||||
result := adapted(DetailedConfig{Host: "localhost", Port: 8080})
|
||||
|
||||
assert.Equal(t, E.Of[string]("8080"), result)
|
||||
})
|
||||
|
||||
t.Run("handles error case", func(t *testing.T) {
|
||||
// ReaderEither that returns an error
|
||||
getError := func(c SimpleConfig) Either[string, int] {
|
||||
return E.Left[int]("error occurred")
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap[SimpleConfig, string](simplify, toString)(getError)
|
||||
result := adapted(DetailedConfig{Host: "localhost", Port: 8080})
|
||||
|
||||
assert.Equal(t, E.Left[string]("error occurred"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("environment adaptation", func(t *testing.T) {
|
||||
// ReaderEither that reads from SimpleConfig
|
||||
getPort := func(c SimpleConfig) Either[string, int] {
|
||||
return E.Of[string](c.Port)
|
||||
}
|
||||
|
||||
// Adapt to work with DetailedConfig
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[string, int](simplify)(getPort)
|
||||
result := adapted(DetailedConfig{Host: "localhost", Port: 9000})
|
||||
|
||||
assert.Equal(t, E.Of[string](9000), result)
|
||||
})
|
||||
|
||||
t.Run("preserves error", func(t *testing.T) {
|
||||
getError := func(c SimpleConfig) Either[string, int] {
|
||||
return E.Left[int]("config error")
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Port: d.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[string, int](simplify)(getError)
|
||||
result := adapted(DetailedConfig{Host: "localhost", Port: 9000})
|
||||
|
||||
assert.Equal(t, E.Left[int]("config error"), result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapComposition tests that Promap can be composed
|
||||
func TestPromapComposition(t *testing.T) {
|
||||
t.Run("compose two Promap transformations", func(t *testing.T) {
|
||||
type Config1 struct{ Value int }
|
||||
type Config2 struct{ Value int }
|
||||
type Config3 struct{ Value int }
|
||||
|
||||
reader := func(c Config1) Either[string, int] {
|
||||
return E.Of[string](c.Value)
|
||||
}
|
||||
|
||||
f1 := func(c2 Config2) Config1 { return Config1{Value: c2.Value} }
|
||||
g1 := N.Mul(2)
|
||||
|
||||
f2 := func(c3 Config3) Config2 { return Config2{Value: c3.Value} }
|
||||
g2 := N.Add(10)
|
||||
|
||||
// Apply two Promap transformations
|
||||
step1 := Promap[Config1, string](f1, g1)(reader)
|
||||
step2 := Promap[Config2, string](f2, g2)(step1)
|
||||
|
||||
result := step2(Config3{Value: 5})
|
||||
|
||||
// (5 * 2) + 10 = 20
|
||||
assert.Equal(t, E.Of[string](20), result)
|
||||
})
|
||||
}
|
||||
@@ -151,7 +151,7 @@ func BiMap[E, E1, E2, A, B any](f func(E1) E2, g func(A) B) func(ReaderEither[E,
|
||||
|
||||
// Local changes the value of the local context during the execution of the action `ma` (similar to `Contravariant`'s
|
||||
// `contramap`).
|
||||
func Local[E, A, R2, R1 any](f func(R2) R1) func(ReaderEither[R1, E, A]) ReaderEither[R2, E, A] {
|
||||
func Local[E, A, R1, R2 any](f func(R2) R1) func(ReaderEither[R1, E, A]) ReaderEither[R2, E, A] {
|
||||
return reader.Local[Either[E, A]](f)
|
||||
}
|
||||
|
||||
|
||||
@@ -4,10 +4,10 @@ import "github.com/IBM/fp-go/v2/io"
|
||||
|
||||
//go:inline
|
||||
func ChainConsumer[R, A any](c Consumer[A]) Operator[R, A, struct{}] {
|
||||
return ChainIOK[R](io.FromConsumerK(c))
|
||||
return ChainIOK[R](io.FromConsumer(c))
|
||||
}
|
||||
|
||||
//go:inline
|
||||
func ChainFirstConsumer[R, A any](c Consumer[A]) Operator[R, A, A] {
|
||||
return ChainFirstIOK[R](io.FromConsumerK(c))
|
||||
return ChainFirstIOK[R](io.FromConsumer(c))
|
||||
}
|
||||
|
||||
236
v2/readerio/profunctor.go
Normal file
236
v2/readerio/profunctor.go
Normal file
@@ -0,0 +1,236 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerio
|
||||
|
||||
import (
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
)
|
||||
|
||||
// Promap is the profunctor map operation that transforms both the input and output of a ReaderIO.
|
||||
// It applies f to the input environment (contravariantly) and g to the output value (covariantly).
|
||||
//
|
||||
// See: https://github.com/fantasyland/fantasy-land?tab=readme-ov-file#profunctor
|
||||
//
|
||||
// This operation allows you to:
|
||||
// - Adapt the environment type before passing it to the ReaderIO (via f)
|
||||
// - Transform the result value after the IO effect completes (via g)
|
||||
//
|
||||
// The transformation happens in two stages:
|
||||
// 1. The input environment D is transformed to E using f (contravariant)
|
||||
// 2. The ReaderIO[E, A] is executed with the transformed environment
|
||||
// 3. The result value A is transformed to B using g (covariant) within the IO context
|
||||
//
|
||||
// Type Parameters:
|
||||
// - E: The original environment type expected by the ReaderIO
|
||||
// - A: The original result type produced by the ReaderIO
|
||||
// - D: The new input environment type
|
||||
// - B: The new output result type
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the input environment from D to E (contravariant)
|
||||
// - g: Function to transform the output value from A to B (covariant)
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderIO[E, A] and returns a ReaderIO[D, B]
|
||||
//
|
||||
// Example - Adapting environment and transforming result:
|
||||
//
|
||||
// type DetailedConfig struct {
|
||||
// Host string
|
||||
// Port int
|
||||
// Debug bool
|
||||
// }
|
||||
//
|
||||
// type SimpleConfig struct {
|
||||
// Host string
|
||||
// Port int
|
||||
// }
|
||||
//
|
||||
// // ReaderIO that reads port from SimpleConfig
|
||||
// getPort := readerio.Asks(func(c SimpleConfig) io.IO[int] {
|
||||
// return io.Of(c.Port)
|
||||
// })
|
||||
//
|
||||
// // Adapt DetailedConfig to SimpleConfig and convert int to string
|
||||
// simplify := func(d DetailedConfig) SimpleConfig {
|
||||
// return SimpleConfig{Host: d.Host, Port: d.Port}
|
||||
// }
|
||||
// toString := strconv.Itoa
|
||||
//
|
||||
// adapted := readerio.Promap(simplify, toString)(getPort)
|
||||
// result := adapted(DetailedConfig{Host: "localhost", Port: 8080, Debug: true})()
|
||||
// // result = "8080"
|
||||
//
|
||||
// Example - Logging with environment transformation:
|
||||
//
|
||||
// type AppEnv struct {
|
||||
// Logger *log.Logger
|
||||
// Config Config
|
||||
// }
|
||||
//
|
||||
// type LoggerEnv struct {
|
||||
// Logger *log.Logger
|
||||
// }
|
||||
//
|
||||
// logMessage := func(msg string) readerio.ReaderIO[LoggerEnv, func()] {
|
||||
// return readerio.Asks(func(env LoggerEnv) io.IO[func()] {
|
||||
// return io.Of(func() { env.Logger.Println(msg) })
|
||||
// })
|
||||
// }
|
||||
//
|
||||
// extractLogger := func(app AppEnv) LoggerEnv {
|
||||
// return LoggerEnv{Logger: app.Logger}
|
||||
// }
|
||||
// ignore := func(func()) string { return "logged" }
|
||||
//
|
||||
// logAndReturn := readerio.Promap(extractLogger, ignore)(logMessage("Hello"))
|
||||
// // Now works with AppEnv and returns string instead of func()
|
||||
//
|
||||
//go:inline
|
||||
func Promap[E, A, D, B any](f func(D) E, g func(A) B) Kleisli[D, ReaderIO[E, A], B] {
|
||||
return reader.Promap(f, io.Map(g))
|
||||
}
|
||||
|
||||
// Local changes the value of the local environment during the execution of a ReaderIO.
|
||||
// This allows you to modify or adapt the environment before passing it to a ReaderIO computation.
|
||||
//
|
||||
// Local is particularly useful for:
|
||||
// - Extracting a subset of a larger environment
|
||||
// - Transforming environment types
|
||||
// - Providing different views of the same environment to different computations
|
||||
//
|
||||
// The transformation is contravariant - it transforms the input environment before
|
||||
// the ReaderIO computation sees it, but doesn't affect the output value.
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The result type produced by the ReaderIO
|
||||
// - R2: The new input environment type
|
||||
// - R1: The original environment type expected by the ReaderIO
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the environment from R2 to R1
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderIO[R1, A] and returns a ReaderIO[R2, A]
|
||||
//
|
||||
// Example - Extracting a subset of environment:
|
||||
//
|
||||
// type AppConfig struct {
|
||||
// Database DatabaseConfig
|
||||
// Server ServerConfig
|
||||
// Logger *log.Logger
|
||||
// }
|
||||
//
|
||||
// type DatabaseConfig struct {
|
||||
// Host string
|
||||
// Port int
|
||||
// }
|
||||
//
|
||||
// // ReaderIO that only needs DatabaseConfig
|
||||
// connectDB := readerio.Asks(func(cfg DatabaseConfig) io.IO[string] {
|
||||
// return io.Of(fmt.Sprintf("Connected to %s:%d", cfg.Host, cfg.Port))
|
||||
// })
|
||||
//
|
||||
// // Extract database config from full app config
|
||||
// extractDB := func(app AppConfig) DatabaseConfig {
|
||||
// return app.Database
|
||||
// }
|
||||
//
|
||||
// // Adapt to work with full AppConfig
|
||||
// connectWithAppConfig := readerio.Local(extractDB)(connectDB)
|
||||
// result := connectWithAppConfig(AppConfig{
|
||||
// Database: DatabaseConfig{Host: "localhost", Port: 5432},
|
||||
// })()
|
||||
// // result = "Connected to localhost:5432"
|
||||
//
|
||||
// Example - Providing different views:
|
||||
//
|
||||
// type FullEnv struct {
|
||||
// UserID int
|
||||
// Role string
|
||||
// }
|
||||
//
|
||||
// type UserEnv struct {
|
||||
// UserID int
|
||||
// }
|
||||
//
|
||||
// getUserData := readerio.Asks(func(env UserEnv) io.IO[string] {
|
||||
// return io.Of(fmt.Sprintf("User: %d", env.UserID))
|
||||
// })
|
||||
//
|
||||
// toUserEnv := func(full FullEnv) UserEnv {
|
||||
// return UserEnv{UserID: full.UserID}
|
||||
// }
|
||||
//
|
||||
// adapted := readerio.Local(toUserEnv)(getUserData)
|
||||
// result := adapted(FullEnv{UserID: 42, Role: "admin"})()
|
||||
// // result = "User: 42"
|
||||
//
|
||||
//go:inline
|
||||
func Local[A, R1, R2 any](f func(R2) R1) Kleisli[R2, ReaderIO[R1, A], A] {
|
||||
return reader.Local[IO[A]](f)
|
||||
}
|
||||
|
||||
// Contramap is an alias for Local.
|
||||
// It changes the value of the local environment during the execution of a ReaderIO.
|
||||
// This is the contravariant functor operation that transforms the input environment.
|
||||
//
|
||||
// Contramap is semantically identical to Local - both modify the environment before
|
||||
// passing it to a ReaderIO. The name "Contramap" emphasizes the contravariant nature
|
||||
// of the transformation (transforming the input rather than the output).
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The result type produced by the ReaderIO
|
||||
// - R2: The new input environment type
|
||||
// - R1: The original environment type expected by the ReaderIO
|
||||
//
|
||||
// Parameters:
|
||||
// - f: Function to transform the environment from R2 to R1
|
||||
//
|
||||
// Returns:
|
||||
// - A Kleisli arrow that takes a ReaderIO[R1, A] and returns a ReaderIO[R2, A]
|
||||
//
|
||||
// Example - Environment adaptation:
|
||||
//
|
||||
// type DetailedEnv struct {
|
||||
// Config Config
|
||||
// Logger *log.Logger
|
||||
// Metrics Metrics
|
||||
// }
|
||||
//
|
||||
// type SimpleEnv struct {
|
||||
// Config Config
|
||||
// }
|
||||
//
|
||||
// readConfig := readerio.Asks(func(env SimpleEnv) io.IO[string] {
|
||||
// return io.Of(env.Config.Value)
|
||||
// })
|
||||
//
|
||||
// simplify := func(detailed DetailedEnv) SimpleEnv {
|
||||
// return SimpleEnv{Config: detailed.Config}
|
||||
// }
|
||||
//
|
||||
// adapted := readerio.Contramap(simplify)(readConfig)
|
||||
// result := adapted(DetailedEnv{Config: Config{Value: "test"}})()
|
||||
// // result = "test"
|
||||
//
|
||||
// See also: Local
|
||||
//
|
||||
//go:inline
|
||||
func Contramap[A, R1, R2 any](f func(R2) R1) Kleisli[R2, ReaderIO[R1, A], A] {
|
||||
return reader.Contramap[IO[A]](f)
|
||||
}
|
||||
614
v2/readerio/profunctor_test.go
Normal file
614
v2/readerio/profunctor_test.go
Normal file
@@ -0,0 +1,614 @@
|
||||
// Copyright (c) 2025 IBM Corp.
|
||||
// All rights reserved.
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
package readerio
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
"strconv"
|
||||
"testing"
|
||||
|
||||
"github.com/IBM/fp-go/v2/io"
|
||||
N "github.com/IBM/fp-go/v2/number"
|
||||
"github.com/IBM/fp-go/v2/reader"
|
||||
S "github.com/IBM/fp-go/v2/string"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
// Test environment types
|
||||
type DetailedConfig struct {
|
||||
Host string
|
||||
Port int
|
||||
Debug bool
|
||||
}
|
||||
|
||||
type SimpleConfig struct {
|
||||
Host string
|
||||
Port int
|
||||
}
|
||||
|
||||
type AppConfig struct {
|
||||
Database DatabaseConfig
|
||||
Server ServerConfig
|
||||
LogLevel string
|
||||
}
|
||||
|
||||
type DatabaseConfig struct {
|
||||
Host string
|
||||
Port int
|
||||
}
|
||||
|
||||
type ServerConfig struct {
|
||||
Port int
|
||||
Timeout int
|
||||
}
|
||||
|
||||
type UserEnv struct {
|
||||
UserID int
|
||||
}
|
||||
|
||||
type FullEnv struct {
|
||||
UserID int
|
||||
Role string
|
||||
}
|
||||
|
||||
// TestPromapBasic tests basic Promap functionality
|
||||
func TestPromapBasic(t *testing.T) {
|
||||
t.Run("transform both input and output", func(t *testing.T) {
|
||||
// ReaderIO that reads port from SimpleConfig
|
||||
getPort := func(c SimpleConfig) IO[int] {
|
||||
return io.Of(c.Port)
|
||||
}
|
||||
|
||||
// Adapt DetailedConfig to SimpleConfig and convert int to string
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Host: d.Host, Port: d.Port}
|
||||
}
|
||||
toString := strconv.Itoa
|
||||
|
||||
adapted := Promap(simplify, toString)(getPort)
|
||||
result := adapted(DetailedConfig{Host: "localhost", Port: 8080, Debug: true})()
|
||||
|
||||
assert.Equal(t, "8080", result)
|
||||
})
|
||||
|
||||
t.Run("identity transformations", func(t *testing.T) {
|
||||
getValue := func(n int) IO[int] {
|
||||
return io.Of(n * 2)
|
||||
}
|
||||
|
||||
// Identity functions should not change behavior
|
||||
identity := reader.Ask[int]()
|
||||
adapted := Promap(identity, identity)(getValue)
|
||||
result := adapted(5)()
|
||||
|
||||
assert.Equal(t, 10, result)
|
||||
})
|
||||
|
||||
t.Run("compose multiple transformations", func(t *testing.T) {
|
||||
getPort := func(c SimpleConfig) IO[int] {
|
||||
return io.Of(c.Port)
|
||||
}
|
||||
|
||||
// First transformation
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Host: d.Host, Port: d.Port}
|
||||
}
|
||||
double := N.Mul(2)
|
||||
|
||||
step1 := Promap(simplify, double)(getPort)
|
||||
|
||||
// Second transformation
|
||||
addDebug := func(d DetailedConfig) DetailedConfig {
|
||||
d.Debug = true
|
||||
return d
|
||||
}
|
||||
toString := S.Format[int]("Port: %d")
|
||||
|
||||
step2 := Promap(addDebug, toString)(step1)
|
||||
result := step2(DetailedConfig{Host: "localhost", Port: 8080})()
|
||||
|
||||
assert.Equal(t, "Port: 16160", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapWithIO tests Promap with actual IO effects
|
||||
func TestPromapWithIO(t *testing.T) {
|
||||
t.Run("transform IO result", func(t *testing.T) {
|
||||
counter := 0
|
||||
getAndIncrement := func(n int) IO[int] {
|
||||
return func() int {
|
||||
counter++
|
||||
return n + counter
|
||||
}
|
||||
}
|
||||
|
||||
double := reader.Ask[int]()
|
||||
toString := S.Format[int]("Result: %d")
|
||||
|
||||
adapted := Promap(double, toString)(getAndIncrement)
|
||||
result := adapted(10)()
|
||||
|
||||
assert.Equal(t, "Result: 11", result)
|
||||
assert.Equal(t, 1, counter)
|
||||
})
|
||||
|
||||
t.Run("environment transformation with side effects", func(t *testing.T) {
|
||||
var log []string
|
||||
|
||||
logAndReturn := func(msg string) IO[string] {
|
||||
return func() string {
|
||||
log = append(log, msg)
|
||||
return msg
|
||||
}
|
||||
}
|
||||
|
||||
addPrefix := S.Prepend("Input: ")
|
||||
addSuffix := S.Append(" [processed]")
|
||||
|
||||
adapted := Promap(addPrefix, addSuffix)(logAndReturn)
|
||||
result := adapted("test")()
|
||||
|
||||
assert.Equal(t, "Input: test [processed]", result)
|
||||
assert.Equal(t, []string{"Input: test"}, log)
|
||||
})
|
||||
}
|
||||
|
||||
// TestPromapEnvironmentExtraction tests extracting subsets of environments
|
||||
func TestPromapEnvironmentExtraction(t *testing.T) {
|
||||
t.Run("extract database config", func(t *testing.T) {
|
||||
connectDB := func(cfg DatabaseConfig) IO[string] {
|
||||
return io.Of(fmt.Sprintf("Connected to %s:%d", cfg.Host, cfg.Port))
|
||||
}
|
||||
|
||||
extractDB := func(app AppConfig) DatabaseConfig {
|
||||
return app.Database
|
||||
}
|
||||
identity := reader.Ask[string]()
|
||||
|
||||
adapted := Promap(extractDB, identity)(connectDB)
|
||||
result := adapted(AppConfig{
|
||||
Database: DatabaseConfig{Host: "localhost", Port: 5432},
|
||||
Server: ServerConfig{Port: 8080, Timeout: 30},
|
||||
})()
|
||||
|
||||
assert.Equal(t, "Connected to localhost:5432", result)
|
||||
})
|
||||
|
||||
t.Run("extract and transform", func(t *testing.T) {
|
||||
getServerPort := func(cfg ServerConfig) IO[int] {
|
||||
return io.Of(cfg.Port)
|
||||
}
|
||||
|
||||
extractServer := func(app AppConfig) ServerConfig {
|
||||
return app.Server
|
||||
}
|
||||
formatPort := func(port int) string {
|
||||
return fmt.Sprintf("Server listening on port %d", port)
|
||||
}
|
||||
|
||||
adapted := Promap(extractServer, formatPort)(getServerPort)
|
||||
result := adapted(AppConfig{
|
||||
Server: ServerConfig{Port: 8080, Timeout: 30},
|
||||
})()
|
||||
|
||||
assert.Equal(t, "Server listening on port 8080", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLocalBasic tests basic Local functionality
|
||||
func TestLocalBasic(t *testing.T) {
|
||||
t.Run("extract subset of environment", func(t *testing.T) {
|
||||
connectDB := func(cfg DatabaseConfig) IO[string] {
|
||||
return io.Of(fmt.Sprintf("Connected to %s:%d", cfg.Host, cfg.Port))
|
||||
}
|
||||
|
||||
extractDB := func(app AppConfig) DatabaseConfig {
|
||||
return app.Database
|
||||
}
|
||||
|
||||
adapted := Local[string](extractDB)(connectDB)
|
||||
result := adapted(AppConfig{
|
||||
Database: DatabaseConfig{Host: "localhost", Port: 5432},
|
||||
})()
|
||||
|
||||
assert.Equal(t, "Connected to localhost:5432", result)
|
||||
})
|
||||
|
||||
t.Run("transform environment type", func(t *testing.T) {
|
||||
getUserData := func(env UserEnv) IO[string] {
|
||||
return io.Of(fmt.Sprintf("User: %d", env.UserID))
|
||||
}
|
||||
|
||||
toUserEnv := func(full FullEnv) UserEnv {
|
||||
return UserEnv{UserID: full.UserID}
|
||||
}
|
||||
|
||||
adapted := Local[string](toUserEnv)(getUserData)
|
||||
result := adapted(FullEnv{UserID: 42, Role: "admin"})()
|
||||
|
||||
assert.Equal(t, "User: 42", result)
|
||||
})
|
||||
|
||||
t.Run("identity transformation", func(t *testing.T) {
|
||||
getValue := func(n int) IO[int] {
|
||||
return io.Of(n * 2)
|
||||
}
|
||||
|
||||
identity := reader.Ask[int]()
|
||||
adapted := Local[int](identity)(getValue)
|
||||
result := adapted(5)()
|
||||
|
||||
assert.Equal(t, 10, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLocalComposition tests composing Local transformations
|
||||
func TestLocalComposition(t *testing.T) {
|
||||
t.Run("compose two Local transformations", func(t *testing.T) {
|
||||
getPort := func(cfg DatabaseConfig) IO[int] {
|
||||
return io.Of(cfg.Port)
|
||||
}
|
||||
|
||||
extractDB := func(app AppConfig) DatabaseConfig {
|
||||
return app.Database
|
||||
}
|
||||
|
||||
// First Local
|
||||
step1 := Local[int](extractDB)(getPort)
|
||||
|
||||
// Second Local - add default values
|
||||
addDefaults := func(app AppConfig) AppConfig {
|
||||
if app.Database.Host == "" {
|
||||
app.Database.Host = "localhost"
|
||||
}
|
||||
return app
|
||||
}
|
||||
|
||||
step2 := Local[int](addDefaults)(step1)
|
||||
result := step2(AppConfig{
|
||||
Database: DatabaseConfig{Host: "", Port: 5432},
|
||||
})()
|
||||
|
||||
assert.Equal(t, 5432, result)
|
||||
})
|
||||
|
||||
t.Run("chain multiple environment transformations", func(t *testing.T) {
|
||||
getHost := func(cfg SimpleConfig) IO[string] {
|
||||
return io.Of(cfg.Host)
|
||||
}
|
||||
|
||||
// Transform DetailedConfig -> SimpleConfig
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Host: d.Host, Port: d.Port}
|
||||
}
|
||||
|
||||
adapted := Local[string](simplify)(getHost)
|
||||
result := adapted(DetailedConfig{Host: "example.com", Port: 8080, Debug: true})()
|
||||
|
||||
assert.Equal(t, "example.com", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestLocalWithIO tests Local with IO effects
|
||||
func TestLocalWithIO(t *testing.T) {
|
||||
t.Run("environment transformation with side effects", func(t *testing.T) {
|
||||
var accessLog []int
|
||||
|
||||
logAccess := func(id int) IO[string] {
|
||||
return func() string {
|
||||
accessLog = append(accessLog, id)
|
||||
return fmt.Sprintf("Accessed: %d", id)
|
||||
}
|
||||
}
|
||||
|
||||
extractUserID := func(env FullEnv) int {
|
||||
return env.UserID
|
||||
}
|
||||
|
||||
adapted := Local[string](extractUserID)(logAccess)
|
||||
result := adapted(FullEnv{UserID: 123, Role: "user"})()
|
||||
|
||||
assert.Equal(t, "Accessed: 123", result)
|
||||
assert.Equal(t, []int{123}, accessLog)
|
||||
})
|
||||
|
||||
t.Run("multiple executions with different environments", func(t *testing.T) {
|
||||
counter := 0
|
||||
increment := func(n int) IO[int] {
|
||||
return func() int {
|
||||
counter++
|
||||
return n + counter
|
||||
}
|
||||
}
|
||||
|
||||
double := N.Mul(2)
|
||||
adapted := Local[int](double)(increment)
|
||||
|
||||
result1 := adapted(5)() // 10 + 1 = 11
|
||||
result2 := adapted(10)() // 20 + 2 = 22
|
||||
|
||||
assert.Equal(t, 11, result1)
|
||||
assert.Equal(t, 22, result2)
|
||||
assert.Equal(t, 2, counter)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapBasic tests basic Contramap functionality
|
||||
func TestContramapBasic(t *testing.T) {
|
||||
t.Run("environment adaptation", func(t *testing.T) {
|
||||
readConfig := func(env SimpleConfig) IO[string] {
|
||||
return io.Of(fmt.Sprintf("%s:%d", env.Host, env.Port))
|
||||
}
|
||||
|
||||
simplify := func(detailed DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Host: detailed.Host, Port: detailed.Port}
|
||||
}
|
||||
|
||||
adapted := Contramap[string](simplify)(readConfig)
|
||||
result := adapted(DetailedConfig{Host: "localhost", Port: 8080, Debug: true})()
|
||||
|
||||
assert.Equal(t, "localhost:8080", result)
|
||||
})
|
||||
|
||||
t.Run("extract field from larger structure", func(t *testing.T) {
|
||||
getPort := func(port int) IO[string] {
|
||||
return io.Of(fmt.Sprintf("Port: %d", port))
|
||||
}
|
||||
|
||||
extractPort := func(cfg SimpleConfig) int {
|
||||
return cfg.Port
|
||||
}
|
||||
|
||||
adapted := Contramap[string](extractPort)(getPort)
|
||||
result := adapted(SimpleConfig{Host: "localhost", Port: 9000})()
|
||||
|
||||
assert.Equal(t, "Port: 9000", result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestContramapVsLocal verifies Contramap and Local are equivalent
|
||||
func TestContramapVsLocal(t *testing.T) {
|
||||
t.Run("same behavior as Local", func(t *testing.T) {
|
||||
getValue := func(n int) IO[int] {
|
||||
return io.Of(n * 3)
|
||||
}
|
||||
|
||||
double := N.Mul(2)
|
||||
|
||||
localResult := Local[int](double)(getValue)(5)()
|
||||
contramapResult := Contramap[int](double)(getValue)(5)()
|
||||
|
||||
assert.Equal(t, localResult, contramapResult)
|
||||
assert.Equal(t, 30, localResult) // (5 * 2) * 3 = 30
|
||||
})
|
||||
|
||||
t.Run("environment extraction equivalence", func(t *testing.T) {
|
||||
getHost := func(cfg SimpleConfig) IO[string] {
|
||||
return io.Of(cfg.Host)
|
||||
}
|
||||
|
||||
simplify := func(d DetailedConfig) SimpleConfig {
|
||||
return SimpleConfig{Host: d.Host, Port: d.Port}
|
||||
}
|
||||
|
||||
env := DetailedConfig{Host: "example.com", Port: 8080, Debug: false}
|
||||
|
||||
localResult := Local[string](simplify)(getHost)(env)()
|
||||
contramapResult := Contramap[string](simplify)(getHost)(env)()
|
||||
|
||||
assert.Equal(t, localResult, contramapResult)
|
||||
assert.Equal(t, "example.com", localResult)
|
||||
})
|
||||
}
|
||||
|
||||
// TestProfunctorLaws tests profunctor laws
|
||||
func TestProfunctorLaws(t *testing.T) {
|
||||
t.Run("identity law", func(t *testing.T) {
|
||||
getValue := func(n int) IO[int] {
|
||||
return io.Of(n + 10)
|
||||
}
|
||||
|
||||
identity := reader.Ask[int]()
|
||||
|
||||
// Promap(id, id) should be equivalent to id
|
||||
adapted := Promap(identity, identity)(getValue)
|
||||
original := getValue(5)()
|
||||
transformed := adapted(5)()
|
||||
|
||||
assert.Equal(t, original, transformed)
|
||||
assert.Equal(t, 15, transformed)
|
||||
})
|
||||
|
||||
t.Run("composition law", func(t *testing.T) {
|
||||
getValue := func(n int) IO[int] {
|
||||
return io.Of(n * 2)
|
||||
}
|
||||
|
||||
f1 := N.Add(1)
|
||||
f2 := N.Mul(3)
|
||||
g1 := N.Sub(5)
|
||||
g2 := N.Mul(2)
|
||||
|
||||
// Promap(f1, g2) . Promap(f2, g1) should equal Promap(f2 . f1, g2 . g1)
|
||||
// Note: composition order is reversed for contravariant part
|
||||
step1 := Promap(f2, g1)(getValue)
|
||||
composed1 := Promap(f1, g2)(step1)
|
||||
|
||||
composed2 := Promap(
|
||||
func(x int) int { return f2(f1(x)) },
|
||||
func(x int) int { return g2(g1(x)) },
|
||||
)(getValue)
|
||||
|
||||
result1 := composed1(10)()
|
||||
result2 := composed2(10)()
|
||||
|
||||
assert.Equal(t, result1, result2)
|
||||
})
|
||||
}
|
||||
|
||||
// TestEdgeCases tests edge cases and special scenarios
|
||||
func TestEdgeCases(t *testing.T) {
|
||||
t.Run("empty struct environment", func(t *testing.T) {
|
||||
type Empty struct{}
|
||||
|
||||
getValue := func(e Empty) IO[int] {
|
||||
return io.Of(42)
|
||||
}
|
||||
|
||||
identity := reader.Ask[Empty]()
|
||||
adapted := Local[int](identity)(getValue)
|
||||
result := adapted(Empty{})()
|
||||
|
||||
assert.Equal(t, 42, result)
|
||||
})
|
||||
|
||||
t.Run("function type handling", func(t *testing.T) {
|
||||
getFunc := func(n int) IO[func(int) int] {
|
||||
return io.Of(N.Mul(2))
|
||||
}
|
||||
|
||||
double := N.Mul(2)
|
||||
applyFunc := reader.Read[int](5)
|
||||
|
||||
adapted := Promap(double, applyFunc)(getFunc)
|
||||
result := adapted(3)() // (3 * 2) = 6, then func(5) = 10
|
||||
|
||||
assert.Equal(t, 10, result)
|
||||
})
|
||||
|
||||
t.Run("complex nested transformations", func(t *testing.T) {
|
||||
type Level3 struct{ Value int }
|
||||
type Level2 struct{ L3 Level3 }
|
||||
type Level1 struct{ L2 Level2 }
|
||||
|
||||
getValue := func(l3 Level3) IO[int] {
|
||||
return io.Of(l3.Value)
|
||||
}
|
||||
|
||||
extract := func(l1 Level1) Level3 {
|
||||
return l1.L2.L3
|
||||
}
|
||||
multiply := N.Mul(10)
|
||||
|
||||
adapted := Promap(extract, multiply)(getValue)
|
||||
result := adapted(Level1{L2: Level2{L3: Level3{Value: 7}}})()
|
||||
|
||||
assert.Equal(t, 70, result)
|
||||
})
|
||||
}
|
||||
|
||||
// TestRealWorldScenarios tests practical use cases
|
||||
func TestRealWorldScenarios(t *testing.T) {
|
||||
t.Run("database connection with config extraction", func(t *testing.T) {
|
||||
type DBConfig struct {
|
||||
ConnectionString string
|
||||
}
|
||||
|
||||
type AppSettings struct {
|
||||
DB DBConfig
|
||||
APIKey string
|
||||
Timeout int
|
||||
}
|
||||
|
||||
connect := func(cfg DBConfig) IO[string] {
|
||||
return io.Of("Connected: " + cfg.ConnectionString)
|
||||
}
|
||||
|
||||
extractDB := func(settings AppSettings) DBConfig {
|
||||
return settings.DB
|
||||
}
|
||||
|
||||
adapted := Local[string](extractDB)(connect)
|
||||
result := adapted(AppSettings{
|
||||
DB: DBConfig{ConnectionString: "postgres://localhost"},
|
||||
APIKey: "secret",
|
||||
Timeout: 30,
|
||||
})()
|
||||
|
||||
assert.Equal(t, "Connected: postgres://localhost", result)
|
||||
})
|
||||
|
||||
t.Run("logging with environment transformation", func(t *testing.T) {
|
||||
type LogContext struct {
|
||||
RequestID string
|
||||
UserID int
|
||||
}
|
||||
|
||||
type RequestContext struct {
|
||||
RequestID string
|
||||
UserID int
|
||||
Path string
|
||||
Method string
|
||||
}
|
||||
|
||||
var logs []string
|
||||
logMessage := func(ctx LogContext) IO[func()] {
|
||||
return func() func() {
|
||||
return func() {
|
||||
logs = append(logs, fmt.Sprintf("[%s] User %d", ctx.RequestID, ctx.UserID))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
extractLogContext := func(req RequestContext) LogContext {
|
||||
return LogContext{RequestID: req.RequestID, UserID: req.UserID}
|
||||
}
|
||||
|
||||
adapted := Local[func()](extractLogContext)(logMessage)
|
||||
result := adapted(RequestContext{
|
||||
RequestID: "req-123",
|
||||
UserID: 42,
|
||||
Path: "/api/users",
|
||||
Method: "GET",
|
||||
})()
|
||||
|
||||
result()
|
||||
assert.Equal(t, []string{"[req-123] User 42"}, logs)
|
||||
})
|
||||
|
||||
t.Run("API response transformation", func(t *testing.T) {
|
||||
type APIResponse struct {
|
||||
StatusCode int
|
||||
Body string
|
||||
}
|
||||
|
||||
type EnrichedResponse struct {
|
||||
Response APIResponse
|
||||
Timestamp int64
|
||||
RequestID string
|
||||
}
|
||||
|
||||
formatResponse := func(resp APIResponse) IO[string] {
|
||||
return io.Of(fmt.Sprintf("Status: %d, Body: %s", resp.StatusCode, resp.Body))
|
||||
}
|
||||
|
||||
extractResponse := func(enriched EnrichedResponse) APIResponse {
|
||||
return enriched.Response
|
||||
}
|
||||
addMetadata := func(s string) string {
|
||||
return "[API] " + s
|
||||
}
|
||||
|
||||
adapted := Promap(extractResponse, addMetadata)(formatResponse)
|
||||
result := adapted(EnrichedResponse{
|
||||
Response: APIResponse{StatusCode: 200, Body: "OK"},
|
||||
Timestamp: 1234567890,
|
||||
RequestID: "req-456",
|
||||
})()
|
||||
|
||||
assert.Equal(t, "[API] Status: 200, Body: OK", result)
|
||||
})
|
||||
}
|
||||
@@ -1112,6 +1112,63 @@ func Read[A, R any](r R) func(ReaderIO[R, A]) IO[A] {
|
||||
return reader.Read[IO[A]](r)
|
||||
}
|
||||
|
||||
// ReadIO executes a ReaderIO computation by providing an environment wrapped in an IO effect.
|
||||
// This is useful when the environment itself needs to be computed or retrieved through side effects.
|
||||
//
|
||||
// The function takes an IO[R] (an effectful computation that produces an environment) and returns
|
||||
// a function that can execute a ReaderIO[R, A] to produce an IO[A].
|
||||
//
|
||||
// This is particularly useful in scenarios where:
|
||||
// - The environment needs to be loaded from a file, database, or network
|
||||
// - The environment requires initialization with side effects
|
||||
// - You want to compose environment retrieval with the computation that uses it
|
||||
//
|
||||
// The execution flow is:
|
||||
// 1. Execute the IO[R] to get the environment R
|
||||
// 2. Pass the environment to the ReaderIO[R, A] to get an IO[A]
|
||||
// 3. Execute the resulting IO[A] to get the final result A
|
||||
//
|
||||
// Type Parameters:
|
||||
// - A: The result type of the ReaderIO computation
|
||||
// - R: The environment type required by the ReaderIO
|
||||
//
|
||||
// Parameters:
|
||||
// - r: An IO effect that produces the environment of type R
|
||||
//
|
||||
// Returns:
|
||||
// - A function that takes a ReaderIO[R, A] and returns an IO[A]
|
||||
//
|
||||
// Example:
|
||||
//
|
||||
// type Config struct {
|
||||
// DatabaseURL string
|
||||
// Port int
|
||||
// }
|
||||
//
|
||||
// // Load config from file (side effect)
|
||||
// loadConfig := io.Of(Config{DatabaseURL: "localhost:5432", Port: 8080})
|
||||
//
|
||||
// // A computation that uses the config
|
||||
// getConnectionString := readerio.Asks(func(c Config) io.IO[string] {
|
||||
// return io.Of(c.DatabaseURL)
|
||||
// })
|
||||
//
|
||||
// // Compose them together
|
||||
// result := readerio.ReadIO[string](loadConfig)(getConnectionString)
|
||||
// connectionString := result() // Executes both effects and returns "localhost:5432"
|
||||
//
|
||||
// Comparison with Read:
|
||||
// - [Read]: Takes a pure value R and executes the ReaderIO immediately
|
||||
// - [ReadIO]: Takes an IO[R] and chains the effects together
|
||||
//
|
||||
//go:inline
|
||||
func ReadIO[A, R any](r IO[R]) func(ReaderIO[R, A]) IO[A] {
|
||||
return function.Flow2(
|
||||
io.Chain[R, A],
|
||||
Read[A](r),
|
||||
)
|
||||
}
|
||||
|
||||
// Delay creates an operation that passes in the value after some delay
|
||||
//
|
||||
//go:inline
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user